diff options
1158 files changed, 13911 insertions, 12722 deletions
diff --git a/compiler/rustc_ast/src/tokenstream.rs b/compiler/rustc_ast/src/tokenstream.rs index 4c0c496584e..053468ff936 100644 --- a/compiler/rustc_ast/src/tokenstream.rs +++ b/compiler/rustc_ast/src/tokenstream.rs @@ -26,7 +26,7 @@ use rustc_span::{sym, Span, Symbol, DUMMY_SP}; use smallvec::{smallvec, SmallVec}; use std::borrow::Cow; -use std::{cmp, fmt, iter, mem}; +use std::{cmp, fmt, iter}; /// When the main Rust parser encounters a syntax-extension invocation, it /// parses the arguments to the invocation as a token tree. This is a very @@ -81,14 +81,6 @@ impl TokenTree { } } - /// Modify the `TokenTree`'s span in-place. - pub fn set_span(&mut self, span: Span) { - match self { - TokenTree::Token(token, _) => token.span = span, - TokenTree::Delimited(dspan, ..) => *dspan = DelimSpan::from_single(span), - } - } - /// Create a `TokenTree::Token` with alone spacing. pub fn token_alone(kind: TokenKind, span: Span) -> TokenTree { TokenTree::Token(Token::new(kind, span), Spacing::Alone) @@ -461,19 +453,6 @@ impl TokenStream { t1.next().is_none() && t2.next().is_none() } - /// Applies the supplied function to each `TokenTree` and its index in `self`, returning a new `TokenStream` - /// - /// It is equivalent to `TokenStream::new(self.trees().cloned().enumerate().map(|(i, tt)| f(i, tt)).collect())`. - pub fn map_enumerated_owned( - mut self, - mut f: impl FnMut(usize, TokenTree) -> TokenTree, - ) -> TokenStream { - let owned = Lrc::make_mut(&mut self.0); // clone if necessary - // rely on vec's in-place optimizations to avoid another allocation - *owned = mem::take(owned).into_iter().enumerate().map(|(i, tree)| f(i, tree)).collect(); - self - } - /// Create a token stream containing a single token with alone spacing. The /// spacing used for the final token in a constructed stream doesn't matter /// because it's never used. In practice we arbitrarily use diff --git a/compiler/rustc_ast_lowering/src/expr.rs b/compiler/rustc_ast_lowering/src/expr.rs index ba858d49acf..69704de105c 100644 --- a/compiler/rustc_ast_lowering/src/expr.rs +++ b/compiler/rustc_ast_lowering/src/expr.rs @@ -546,20 +546,7 @@ impl<'hir> LoweringContext<'_, 'hir> { fn lower_arm(&mut self, arm: &Arm) -> hir::Arm<'hir> { let pat = self.lower_pat(&arm.pat); - let guard = arm.guard.as_ref().map(|cond| { - if let ExprKind::Let(pat, scrutinee, span, is_recovered) = &cond.kind { - hir::Guard::IfLet(self.arena.alloc(hir::Let { - hir_id: self.next_id(), - span: self.lower_span(*span), - pat: self.lower_pat(pat), - ty: None, - init: self.lower_expr(scrutinee), - is_recovered: *is_recovered, - })) - } else { - hir::Guard::If(self.lower_expr(cond)) - } - }); + let guard = arm.guard.as_ref().map(|cond| self.lower_expr(cond)); let hir_id = self.next_id(); let span = self.lower_span(arm.span); self.lower_attrs(hir_id, &arm.attrs); diff --git a/compiler/rustc_ast_lowering/src/lib.rs b/compiler/rustc_ast_lowering/src/lib.rs index c7c77bf56b7..fb59770d48a 100644 --- a/compiler/rustc_ast_lowering/src/lib.rs +++ b/compiler/rustc_ast_lowering/src/lib.rs @@ -1434,19 +1434,21 @@ impl<'a, 'hir> LoweringContext<'a, 'hir> { let (bounds, lifetime_bound) = self.with_dyn_type_scope(true, |this| { let bounds = this.arena.alloc_from_iter(bounds.iter().filter_map(|bound| match bound { - GenericBound::Trait( - ty, - TraitBoundModifiers { - polarity: BoundPolarity::Positive | BoundPolarity::Negative(_), - constness, - }, - ) => Some(this.lower_poly_trait_ref(ty, itctx, *constness)), - // We can safely ignore constness here, since AST validation - // will take care of invalid modifier combinations. - GenericBound::Trait( - _, - TraitBoundModifiers { polarity: BoundPolarity::Maybe(_), .. }, - ) => None, + // We can safely ignore constness here since AST validation + // takes care of rejecting invalid modifier combinations and + // const trait bounds in trait object types. + GenericBound::Trait(ty, modifiers) => match modifiers.polarity { + BoundPolarity::Positive | BoundPolarity::Negative(_) => { + Some(this.lower_poly_trait_ref( + ty, + itctx, + // Still, don't pass along the constness here; we don't want to + // synthesize any host effect args, it'd only cause problems. + ast::BoundConstness::Never, + )) + } + BoundPolarity::Maybe(_) => None, + }, GenericBound::Outlives(lifetime) => { if lifetime_bound.is_none() { lifetime_bound = Some(this.lower_lifetime(lifetime)); diff --git a/compiler/rustc_ast_passes/messages.ftl b/compiler/rustc_ast_passes/messages.ftl index feea02c679c..a10797626f1 100644 --- a/compiler/rustc_ast_passes/messages.ftl +++ b/compiler/rustc_ast_passes/messages.ftl @@ -188,6 +188,9 @@ ast_passes_module_nonascii = trying to load file for module `{$name}` with non-a ast_passes_negative_bound_not_supported = negative bounds are not supported +ast_passes_negative_bound_with_parenthetical_notation = + parenthetical notation may not be used for negative bounds + ast_passes_nested_impl_trait = nested `impl Trait` is not allowed .outer = outer `impl Trait` .inner = nested `impl Trait` here diff --git a/compiler/rustc_ast_passes/src/ast_validation.rs b/compiler/rustc_ast_passes/src/ast_validation.rs index b69d4cccaf0..7f78f687055 100644 --- a/compiler/rustc_ast_passes/src/ast_validation.rs +++ b/compiler/rustc_ast_passes/src/ast_validation.rs @@ -1312,13 +1312,24 @@ impl<'a> Visitor<'a> for AstValidator<'a> { if let GenericBound::Trait(trait_ref, modifiers) = bound && let BoundPolarity::Negative(_) = modifiers.polarity && let Some(segment) = trait_ref.trait_ref.path.segments.last() - && let Some(ast::GenericArgs::AngleBracketed(args)) = segment.args.as_deref() { - for arg in &args.args { - if let ast::AngleBracketedArg::Constraint(constraint) = arg { - self.dcx() - .emit_err(errors::ConstraintOnNegativeBound { span: constraint.span }); + match segment.args.as_deref() { + Some(ast::GenericArgs::AngleBracketed(args)) => { + for arg in &args.args { + if let ast::AngleBracketedArg::Constraint(constraint) = arg { + self.dcx().emit_err(errors::ConstraintOnNegativeBound { + span: constraint.span, + }); + } + } + } + // The lowered form of parenthesized generic args contains a type binding. + Some(ast::GenericArgs::Parenthesized(args)) => { + self.dcx().emit_err(errors::NegativeBoundWithParentheticalNotation { + span: args.span, + }); } + None => {} } } diff --git a/compiler/rustc_ast_passes/src/errors.rs b/compiler/rustc_ast_passes/src/errors.rs index 42ada39f515..fcf19ce52ec 100644 --- a/compiler/rustc_ast_passes/src/errors.rs +++ b/compiler/rustc_ast_passes/src/errors.rs @@ -725,8 +725,8 @@ impl AddToDiagnostic for StableFeature { rustc_errors::SubdiagnosticMessage, ) -> rustc_errors::SubdiagnosticMessage, { - diag.set_arg("name", self.name); - diag.set_arg("since", self.since); + diag.arg("name", self.name); + diag.arg("since", self.since); diag.help(fluent::ast_passes_stable_since); } } @@ -764,6 +764,13 @@ pub struct ConstraintOnNegativeBound { } #[derive(Diagnostic)] +#[diag(ast_passes_negative_bound_with_parenthetical_notation)] +pub struct NegativeBoundWithParentheticalNotation { + #[primary_span] + pub span: Span, +} + +#[derive(Diagnostic)] #[diag(ast_passes_invalid_unnamed_field_ty)] pub struct InvalidUnnamedFieldTy { #[primary_span] diff --git a/compiler/rustc_attr/src/session_diagnostics.rs b/compiler/rustc_attr/src/session_diagnostics.rs index fd2b0866867..fdb5d66bf62 100644 --- a/compiler/rustc_attr/src/session_diagnostics.rs +++ b/compiler/rustc_attr/src/session_diagnostics.rs @@ -55,10 +55,10 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for UnknownMetaItem<'_> { fn into_diagnostic(self, dcx: &'a DiagCtxt, level: Level) -> DiagnosticBuilder<'a, G> { let expected = self.expected.iter().map(|name| format!("`{name}`")).collect::<Vec<_>>(); let mut diag = DiagnosticBuilder::new(dcx, level, fluent::attr_unknown_meta_item); - diag.set_span(self.span); + diag.span(self.span); diag.code(error_code!(E0541)); - diag.set_arg("item", self.item); - diag.set_arg("expected", expected.join(", ")); + diag.arg("item", self.item); + diag.arg("expected", expected.join(", ")); diag.span_label(self.span, fluent::attr_label); diag } @@ -215,7 +215,7 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for UnsupportedLiteral { } }, ); - diag.set_span(self.span); + diag.span(self.span); diag.code(error_code!(E0565)); if self.is_bytestr { diag.span_suggestion( diff --git a/compiler/rustc_borrowck/src/diagnostics/conflict_errors.rs b/compiler/rustc_borrowck/src/diagnostics/conflict_errors.rs index d824260f47c..9ce753134fb 100644 --- a/compiler/rustc_borrowck/src/diagnostics/conflict_errors.rs +++ b/compiler/rustc_borrowck/src/diagnostics/conflict_errors.rs @@ -3590,7 +3590,7 @@ impl<'b, 'v> Visitor<'v> for ConditionVisitor<'b> { )); } else if let Some(guard) = &arm.guard { self.errors.push(( - arm.pat.span.to(guard.body().span), + arm.pat.span.to(guard.span), format!( "if this pattern and condition are matched, {} is not \ initialized", diff --git a/compiler/rustc_builtin_macros/src/errors.rs b/compiler/rustc_builtin_macros/src/errors.rs index e07eb2e490b..f9ddffcc155 100644 --- a/compiler/rustc_builtin_macros/src/errors.rs +++ b/compiler/rustc_builtin_macros/src/errors.rs @@ -454,7 +454,7 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for EnvNotDefinedWithUserMe reason = "cannot translate user-provided messages" )] let mut diag = DiagnosticBuilder::new(dcx, level, self.msg_from_user.to_string()); - diag.set_span(self.span); + diag.span(self.span); diag } } @@ -618,7 +618,7 @@ impl AddToDiagnostic for FormatUnusedArg { rustc_errors::SubdiagnosticMessage, ) -> rustc_errors::SubdiagnosticMessage, { - diag.set_arg("named", self.named); + diag.arg("named", self.named); let msg = f(diag, crate::fluent_generated::builtin_macros_format_unused_arg.into()); diag.span_label(self.span, msg); } @@ -808,7 +808,7 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for AsmClobberNoReg { level, crate::fluent_generated::builtin_macros_asm_clobber_no_reg, ); - diag.set_span(self.spans.clone()); + diag.span(self.spans.clone()); // eager translation as `span_labels` takes `AsRef<str>` let lbl1 = dcx.eagerly_translate_to_string( crate::fluent_generated::builtin_macros_asm_clobber_abi, diff --git a/compiler/rustc_builtin_macros/src/test.rs b/compiler/rustc_builtin_macros/src/test.rs index 2af46f175d7..568f8247b28 100644 --- a/compiler/rustc_builtin_macros/src/test.rs +++ b/compiler/rustc_builtin_macros/src/test.rs @@ -395,10 +395,10 @@ fn not_testable_error(cx: &ExtCtxt<'_>, attr_sp: Span, item: Option<&ast::Item>) // These were a warning before #92959 and need to continue being that to avoid breaking // stable user code (#94508). Some(ast::ItemKind::MacCall(_)) => Level::Warning(None), - _ => Level::Error { lint: false }, + _ => Level::Error, }; let mut err = DiagnosticBuilder::<()>::new(dcx, level, msg); - err.set_span(attr_sp); + err.span(attr_sp); if let Some(item) = item { err.span_label( item.span, diff --git a/compiler/rustc_codegen_gcc/src/asm.rs b/compiler/rustc_codegen_gcc/src/asm.rs index ddd67a994c9..78e8e32b972 100644 --- a/compiler/rustc_codegen_gcc/src/asm.rs +++ b/compiler/rustc_codegen_gcc/src/asm.rs @@ -634,6 +634,7 @@ fn reg_to_gcc(reg: InlineAsmRegOrRegClass) -> ConstraintOrRegister { } InlineAsmRegClass::Wasm(WasmInlineAsmRegClass::local) => "r", InlineAsmRegClass::S390x(S390xInlineAsmRegClass::reg) => "r", + InlineAsmRegClass::S390x(S390xInlineAsmRegClass::reg_addr) => "a", InlineAsmRegClass::S390x(S390xInlineAsmRegClass::freg) => "f", InlineAsmRegClass::Err => unreachable!(), } @@ -704,7 +705,9 @@ fn dummy_output_type<'gcc, 'tcx>(cx: &CodegenCx<'gcc, 'tcx>, reg: InlineAsmRegCl InlineAsmRegClass::SpirV(SpirVInlineAsmRegClass::reg) => { bug!("LLVM backend does not support SPIR-V") }, - InlineAsmRegClass::S390x(S390xInlineAsmRegClass::reg) => cx.type_i32(), + InlineAsmRegClass::S390x( + S390xInlineAsmRegClass::reg | S390xInlineAsmRegClass::reg_addr + ) => cx.type_i32(), InlineAsmRegClass::S390x(S390xInlineAsmRegClass::freg) => cx.type_f64(), InlineAsmRegClass::Err => unreachable!(), } diff --git a/compiler/rustc_codegen_gcc/src/errors.rs b/compiler/rustc_codegen_gcc/src/errors.rs index 1b1ed0b411c..e9283b19894 100644 --- a/compiler/rustc_codegen_gcc/src/errors.rs +++ b/compiler/rustc_codegen_gcc/src/errors.rs @@ -119,12 +119,12 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for TargetFeatureDisableOrEnabl fluent::codegen_gcc_target_feature_disable_or_enable ); if let Some(span) = self.span { - diag.set_span(span); + diag.span(span); }; if let Some(missing_features) = self.missing_features { diag.subdiagnostic(missing_features); } - diag.set_arg("features", self.features.join(", ")); + diag.arg("features", self.features.join(", ")); diag } } diff --git a/compiler/rustc_codegen_llvm/src/abi.rs b/compiler/rustc_codegen_llvm/src/abi.rs index 97dc401251c..0718bebb31b 100644 --- a/compiler/rustc_codegen_llvm/src/abi.rs +++ b/compiler/rustc_codegen_llvm/src/abi.rs @@ -6,7 +6,7 @@ use crate::type_::Type; use crate::type_of::LayoutLlvmExt; use crate::value::Value; -use rustc_codegen_ssa::mir::operand::OperandValue; +use rustc_codegen_ssa::mir::operand::{OperandRef, OperandValue}; use rustc_codegen_ssa::mir::place::PlaceRef; use rustc_codegen_ssa::traits::*; use rustc_codegen_ssa::MemFlags; @@ -253,7 +253,7 @@ impl<'ll, 'tcx> ArgAbiExt<'ll, 'tcx> for ArgAbi<'tcx, Ty<'tcx>> { bx.lifetime_end(llscratch, scratch_size); } } else { - OperandValue::Immediate(val).store(bx, dst); + OperandRef::from_immediate_or_packed_pair(bx, val, self.layout).val.store(bx, dst); } } diff --git a/compiler/rustc_codegen_llvm/src/asm.rs b/compiler/rustc_codegen_llvm/src/asm.rs index 1323261ae92..a413466093b 100644 --- a/compiler/rustc_codegen_llvm/src/asm.rs +++ b/compiler/rustc_codegen_llvm/src/asm.rs @@ -690,6 +690,7 @@ fn reg_to_llvm(reg: InlineAsmRegOrRegClass, layout: Option<&TyAndLayout<'_>>) -> InlineAsmRegClass::Avr(AvrInlineAsmRegClass::reg_iw) => "w", InlineAsmRegClass::Avr(AvrInlineAsmRegClass::reg_ptr) => "e", InlineAsmRegClass::S390x(S390xInlineAsmRegClass::reg) => "r", + InlineAsmRegClass::S390x(S390xInlineAsmRegClass::reg_addr) => "a", InlineAsmRegClass::S390x(S390xInlineAsmRegClass::freg) => "f", InlineAsmRegClass::Msp430(Msp430InlineAsmRegClass::reg) => "r", InlineAsmRegClass::M68k(M68kInlineAsmRegClass::reg) => "r", @@ -867,7 +868,9 @@ fn dummy_output_type<'ll>(cx: &CodegenCx<'ll, '_>, reg: InlineAsmRegClass) -> &' InlineAsmRegClass::Avr(AvrInlineAsmRegClass::reg_pair) => cx.type_i16(), InlineAsmRegClass::Avr(AvrInlineAsmRegClass::reg_iw) => cx.type_i16(), InlineAsmRegClass::Avr(AvrInlineAsmRegClass::reg_ptr) => cx.type_i16(), - InlineAsmRegClass::S390x(S390xInlineAsmRegClass::reg) => cx.type_i32(), + InlineAsmRegClass::S390x( + S390xInlineAsmRegClass::reg | S390xInlineAsmRegClass::reg_addr, + ) => cx.type_i32(), InlineAsmRegClass::S390x(S390xInlineAsmRegClass::freg) => cx.type_f64(), InlineAsmRegClass::Msp430(Msp430InlineAsmRegClass::reg) => cx.type_i16(), InlineAsmRegClass::M68k(M68kInlineAsmRegClass::reg) => cx.type_i32(), diff --git a/compiler/rustc_codegen_llvm/src/back/write.rs b/compiler/rustc_codegen_llvm/src/back/write.rs index c607533a08e..45be85934b4 100644 --- a/compiler/rustc_codegen_llvm/src/back/write.rs +++ b/compiler/rustc_codegen_llvm/src/back/write.rs @@ -416,7 +416,7 @@ fn report_inline_asm( cookie = 0; } let level = match level { - llvm::DiagnosticLevel::Error => Level::Error { lint: false }, + llvm::DiagnosticLevel::Error => Level::Error, llvm::DiagnosticLevel::Warning => Level::Warning(None), llvm::DiagnosticLevel::Note | llvm::DiagnosticLevel::Remark => Level::Note, }; diff --git a/compiler/rustc_codegen_llvm/src/builder.rs b/compiler/rustc_codegen_llvm/src/builder.rs index 4e5fe290bb1..7ed27b33dce 100644 --- a/compiler/rustc_codegen_llvm/src/builder.rs +++ b/compiler/rustc_codegen_llvm/src/builder.rs @@ -558,10 +558,17 @@ impl<'a, 'll, 'tcx> BuilderMethods<'a, 'tcx> for Builder<'a, 'll, 'tcx> { OperandValue::Immediate(self.to_immediate(llval, place.layout)) } else if let abi::Abi::ScalarPair(a, b) = place.layout.abi { let b_offset = a.size(self).align_to(b.align(self).abi); - let pair_ty = place.layout.llvm_type(self); let mut load = |i, scalar: abi::Scalar, layout, align, offset| { - let llptr = self.struct_gep(pair_ty, place.llval, i as u64); + let llptr = if i == 0 { + place.llval + } else { + self.inbounds_gep( + self.type_i8(), + place.llval, + &[self.const_usize(b_offset.bytes())], + ) + }; let llty = place.layout.scalar_pair_element_llvm_type(self, i, false); let load = self.load(llty, llptr, align); scalar_load_metadata(self, load, scalar, layout, offset); diff --git a/compiler/rustc_codegen_llvm/src/errors.rs b/compiler/rustc_codegen_llvm/src/errors.rs index 8db97d577ca..422e8edff5f 100644 --- a/compiler/rustc_codegen_llvm/src/errors.rs +++ b/compiler/rustc_codegen_llvm/src/errors.rs @@ -107,7 +107,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ParseTargetMachineConfig<'_ let mut diag = DiagnosticBuilder::new(dcx, level, fluent::codegen_llvm_parse_target_machine_config); - diag.set_arg("error", message); + diag.arg("error", message); diag } } @@ -130,12 +130,12 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for TargetFeatureDisableOrEnabl fluent::codegen_llvm_target_feature_disable_or_enable, ); if let Some(span) = self.span { - diag.set_span(span); + diag.span(span); }; if let Some(missing_features) = self.missing_features { diag.subdiagnostic(missing_features); } - diag.set_arg("features", self.features.join(", ")); + diag.arg("features", self.features.join(", ")); diag } } @@ -205,8 +205,8 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for WithLlvmError<'_> { ParseBitcode => fluent::codegen_llvm_parse_bitcode_with_llvm_err, }; let mut diag = self.0.into_diagnostic(dcx, level); - diag.set_primary_message(msg_with_llvm_err); - diag.set_arg("llvm_err", self.1); + diag.primary_message(msg_with_llvm_err); + diag.arg("llvm_err", self.1); diag } } diff --git a/compiler/rustc_codegen_llvm/src/intrinsic.rs b/compiler/rustc_codegen_llvm/src/intrinsic.rs index 6043a8ebded..a0f9d5cf7cd 100644 --- a/compiler/rustc_codegen_llvm/src/intrinsic.rs +++ b/compiler/rustc_codegen_llvm/src/intrinsic.rs @@ -179,7 +179,10 @@ impl<'ll, 'tcx> IntrinsicCallMethods<'tcx> for Builder<'_, 'll, 'tcx> { unsafe { llvm::LLVMSetAlignment(load, align); } - self.to_immediate(load, self.layout_of(tp_ty)) + if !result.layout.is_zst() { + self.store(load, result.llval, result.align); + } + return; } sym::volatile_store => { let dst = args[0].deref(self.cx()); diff --git a/compiler/rustc_codegen_llvm/src/type_of.rs b/compiler/rustc_codegen_llvm/src/type_of.rs index 57b46382c96..e88f4217c9d 100644 --- a/compiler/rustc_codegen_llvm/src/type_of.rs +++ b/compiler/rustc_codegen_llvm/src/type_of.rs @@ -26,16 +26,7 @@ fn uncached_llvm_type<'a, 'tcx>( let element = layout.scalar_llvm_type_at(cx, element); return cx.type_vector(element, count); } - Abi::ScalarPair(..) => { - return cx.type_struct( - &[ - layout.scalar_pair_element_llvm_type(cx, 0, false), - layout.scalar_pair_element_llvm_type(cx, 1, false), - ], - false, - ); - } - Abi::Uninhabited | Abi::Aggregate { .. } => {} + Abi::Uninhabited | Abi::Aggregate { .. } | Abi::ScalarPair(..) => {} } let name = match layout.ty.kind() { @@ -275,11 +266,25 @@ impl<'tcx> LayoutLlvmExt<'tcx> for TyAndLayout<'tcx> { } fn immediate_llvm_type<'a>(&self, cx: &CodegenCx<'a, 'tcx>) -> &'a Type { - if let Abi::Scalar(scalar) = self.abi { - if scalar.is_bool() { - return cx.type_i1(); + match self.abi { + Abi::Scalar(scalar) => { + if scalar.is_bool() { + return cx.type_i1(); + } } - } + Abi::ScalarPair(..) => { + // An immediate pair always contains just the two elements, without any padding + // filler, as it should never be stored to memory. + return cx.type_struct( + &[ + self.scalar_pair_element_llvm_type(cx, 0, true), + self.scalar_pair_element_llvm_type(cx, 1, true), + ], + false, + ); + } + _ => {} + }; self.llvm_type(cx) } diff --git a/compiler/rustc_codegen_ssa/src/back/link.rs b/compiler/rustc_codegen_ssa/src/back/link.rs index 4ff497f2fdd..215649f33ff 100644 --- a/compiler/rustc_codegen_ssa/src/back/link.rs +++ b/compiler/rustc_codegen_ssa/src/back/link.rs @@ -1186,15 +1186,22 @@ mod win { } } -fn add_sanitizer_libraries(sess: &Session, crate_type: CrateType, linker: &mut dyn Linker) { - // On macOS the runtimes are distributed as dylibs which should be linked to - // both executables and dynamic shared objects. Everywhere else the runtimes - // are currently distributed as static libraries which should be linked to - // executables only. +fn add_sanitizer_libraries( + sess: &Session, + flavor: LinkerFlavor, + crate_type: CrateType, + linker: &mut dyn Linker, +) { + // On macOS and Windows using MSVC the runtimes are distributed as dylibs + // which should be linked to both executables and dynamic libraries. + // Everywhere else the runtimes are currently distributed as static + // libraries which should be linked to executables only. let needs_runtime = !sess.target.is_like_android && match crate_type { CrateType::Executable => true, - CrateType::Dylib | CrateType::Cdylib | CrateType::ProcMacro => sess.target.is_like_osx, + CrateType::Dylib | CrateType::Cdylib | CrateType::ProcMacro => { + sess.target.is_like_osx || sess.target.is_like_msvc + } CrateType::Rlib | CrateType::Staticlib => false, }; @@ -1204,26 +1211,31 @@ fn add_sanitizer_libraries(sess: &Session, crate_type: CrateType, linker: &mut d let sanitizer = sess.opts.unstable_opts.sanitizer; if sanitizer.contains(SanitizerSet::ADDRESS) { - link_sanitizer_runtime(sess, linker, "asan"); + link_sanitizer_runtime(sess, flavor, linker, "asan"); } if sanitizer.contains(SanitizerSet::LEAK) { - link_sanitizer_runtime(sess, linker, "lsan"); + link_sanitizer_runtime(sess, flavor, linker, "lsan"); } if sanitizer.contains(SanitizerSet::MEMORY) { - link_sanitizer_runtime(sess, linker, "msan"); + link_sanitizer_runtime(sess, flavor, linker, "msan"); } if sanitizer.contains(SanitizerSet::THREAD) { - link_sanitizer_runtime(sess, linker, "tsan"); + link_sanitizer_runtime(sess, flavor, linker, "tsan"); } if sanitizer.contains(SanitizerSet::HWADDRESS) { - link_sanitizer_runtime(sess, linker, "hwasan"); + link_sanitizer_runtime(sess, flavor, linker, "hwasan"); } if sanitizer.contains(SanitizerSet::SAFESTACK) { - link_sanitizer_runtime(sess, linker, "safestack"); + link_sanitizer_runtime(sess, flavor, linker, "safestack"); } } -fn link_sanitizer_runtime(sess: &Session, linker: &mut dyn Linker, name: &str) { +fn link_sanitizer_runtime( + sess: &Session, + flavor: LinkerFlavor, + linker: &mut dyn Linker, + name: &str, +) { fn find_sanitizer_runtime(sess: &Session, filename: &str) -> PathBuf { let session_tlib = filesearch::make_target_lib_path(&sess.sysroot, sess.opts.target_triple.triple()); @@ -1254,6 +1266,10 @@ fn link_sanitizer_runtime(sess: &Session, linker: &mut dyn Linker, name: &str) { let rpath = path.to_str().expect("non-utf8 component in path"); linker.args(&["-Wl,-rpath", "-Xlinker", rpath]); linker.link_dylib(&filename, false, true); + } else if sess.target.is_like_msvc && flavor == LinkerFlavor::Msvc(Lld::No) && name == "asan" { + // MSVC provides the `/INFERASANLIBS` argument to automatically find the + // compatible ASAN library. + linker.arg("/INFERASANLIBS"); } else { let filename = format!("librustc{channel}_rt.{name}.a"); let path = find_sanitizer_runtime(sess, &filename).join(&filename); @@ -2076,7 +2092,7 @@ fn linker_with_args<'a>( ); // Sanitizer libraries. - add_sanitizer_libraries(sess, crate_type, cmd); + add_sanitizer_libraries(sess, flavor, crate_type, cmd); // Object code from the current crate. // Take careful note of the ordering of the arguments we pass to the linker diff --git a/compiler/rustc_codegen_ssa/src/back/write.rs b/compiler/rustc_codegen_ssa/src/back/write.rs index 5a8db7bbf2d..d2c6b6e0c7b 100644 --- a/compiler/rustc_codegen_ssa/src/back/write.rs +++ b/compiler/rustc_codegen_ssa/src/back/write.rs @@ -1848,9 +1848,9 @@ impl SharedEmitterMain { } Ok(SharedEmitterMessage::InlineAsmError(cookie, msg, level, source)) => { let err_level = match level { - Level::Error { lint: false } => rustc_errors::Level::Error { lint: false }, - Level::Warning(_) => rustc_errors::Level::Warning(None), - Level::Note => rustc_errors::Level::Note, + Level::Error => Level::Error, + Level::Warning(_) => Level::Warning(None), + Level::Note => Level::Note, _ => bug!("Invalid inline asm diagnostic level"), }; let msg = msg.strip_prefix("error: ").unwrap_or(&msg).to_string(); @@ -1860,7 +1860,7 @@ impl SharedEmitterMain { if cookie != 0 { let pos = BytePos::from_u32(cookie); let span = Span::with_root_ctxt(pos, pos); - err.set_span(span); + err.span(span); }; // Point to the generated assembly if it is available. diff --git a/compiler/rustc_codegen_ssa/src/errors.rs b/compiler/rustc_codegen_ssa/src/errors.rs index 2b628d2aa69..c1086bebb8d 100644 --- a/compiler/rustc_codegen_ssa/src/errors.rs +++ b/compiler/rustc_codegen_ssa/src/errors.rs @@ -244,30 +244,30 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ThorinErrorWrapper { } thorin::Error::NamelessSection(_, offset) => { diag = build(fluent::codegen_ssa_thorin_section_without_name); - diag.set_arg("offset", format!("0x{offset:08x}")); + diag.arg("offset", format!("0x{offset:08x}")); diag } thorin::Error::RelocationWithInvalidSymbol(section, offset) => { diag = build(fluent::codegen_ssa_thorin_relocation_with_invalid_symbol); - diag.set_arg("section", section); - diag.set_arg("offset", format!("0x{offset:08x}")); + diag.arg("section", section); + diag.arg("offset", format!("0x{offset:08x}")); diag } thorin::Error::MultipleRelocations(section, offset) => { diag = build(fluent::codegen_ssa_thorin_multiple_relocations); - diag.set_arg("section", section); - diag.set_arg("offset", format!("0x{offset:08x}")); + diag.arg("section", section); + diag.arg("offset", format!("0x{offset:08x}")); diag } thorin::Error::UnsupportedRelocation(section, offset) => { diag = build(fluent::codegen_ssa_thorin_unsupported_relocation); - diag.set_arg("section", section); - diag.set_arg("offset", format!("0x{offset:08x}")); + diag.arg("section", section); + diag.arg("offset", format!("0x{offset:08x}")); diag } thorin::Error::MissingDwoName(id) => { diag = build(fluent::codegen_ssa_thorin_missing_dwo_name); - diag.set_arg("id", format!("0x{id:08x}")); + diag.arg("id", format!("0x{id:08x}")); diag } thorin::Error::NoCompilationUnits => { @@ -284,7 +284,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ThorinErrorWrapper { } thorin::Error::MissingRequiredSection(section) => { diag = build(fluent::codegen_ssa_thorin_missing_required_section); - diag.set_arg("section", section); + diag.arg("section", section); diag } thorin::Error::ParseUnitAbbreviations(_) => { @@ -305,34 +305,34 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ThorinErrorWrapper { } thorin::Error::IncompatibleIndexVersion(section, format, actual) => { diag = build(fluent::codegen_ssa_thorin_incompatible_index_version); - diag.set_arg("section", section); - diag.set_arg("actual", actual); - diag.set_arg("format", format); + diag.arg("section", section); + diag.arg("actual", actual); + diag.arg("format", format); diag } thorin::Error::OffsetAtIndex(_, index) => { diag = build(fluent::codegen_ssa_thorin_offset_at_index); - diag.set_arg("index", index); + diag.arg("index", index); diag } thorin::Error::StrAtOffset(_, offset) => { diag = build(fluent::codegen_ssa_thorin_str_at_offset); - diag.set_arg("offset", format!("0x{offset:08x}")); + diag.arg("offset", format!("0x{offset:08x}")); diag } thorin::Error::ParseIndex(_, section) => { diag = build(fluent::codegen_ssa_thorin_parse_index); - diag.set_arg("section", section); + diag.arg("section", section); diag } thorin::Error::UnitNotInIndex(unit) => { diag = build(fluent::codegen_ssa_thorin_unit_not_in_index); - diag.set_arg("unit", format!("0x{unit:08x}")); + diag.arg("unit", format!("0x{unit:08x}")); diag } thorin::Error::RowNotInIndex(_, row) => { diag = build(fluent::codegen_ssa_thorin_row_not_in_index); - diag.set_arg("row", row); + diag.arg("row", row); diag } thorin::Error::SectionNotInRow => { @@ -341,7 +341,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ThorinErrorWrapper { } thorin::Error::EmptyUnit(unit) => { diag = build(fluent::codegen_ssa_thorin_empty_unit); - diag.set_arg("unit", format!("0x{unit:08x}")); + diag.arg("unit", format!("0x{unit:08x}")); diag } thorin::Error::MultipleDebugInfoSection => { @@ -358,12 +358,12 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ThorinErrorWrapper { } thorin::Error::DuplicateUnit(unit) => { diag = build(fluent::codegen_ssa_thorin_duplicate_unit); - diag.set_arg("unit", format!("0x{unit:08x}")); + diag.arg("unit", format!("0x{unit:08x}")); diag } thorin::Error::MissingReferencedUnit(unit) => { diag = build(fluent::codegen_ssa_thorin_missing_referenced_unit); - diag.set_arg("unit", format!("0x{unit:08x}")); + diag.arg("unit", format!("0x{unit:08x}")); diag } thorin::Error::NoOutputObjectCreated => { @@ -376,27 +376,27 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for ThorinErrorWrapper { } thorin::Error::Io(e) => { diag = build(fluent::codegen_ssa_thorin_io); - diag.set_arg("error", format!("{e}")); + diag.arg("error", format!("{e}")); diag } thorin::Error::ObjectRead(e) => { diag = build(fluent::codegen_ssa_thorin_object_read); - diag.set_arg("error", format!("{e}")); + diag.arg("error", format!("{e}")); diag } thorin::Error::ObjectWrite(e) => { diag = build(fluent::codegen_ssa_thorin_object_write); - diag.set_arg("error", format!("{e}")); + diag.arg("error", format!("{e}")); diag } thorin::Error::GimliRead(e) => { diag = build(fluent::codegen_ssa_thorin_gimli_read); - diag.set_arg("error", format!("{e}")); + diag.arg("error", format!("{e}")); diag } thorin::Error::GimliWrite(e) => { diag = build(fluent::codegen_ssa_thorin_gimli_write); - diag.set_arg("error", format!("{e}")); + diag.arg("error", format!("{e}")); diag } _ => unimplemented!("Untranslated thorin error"), @@ -414,8 +414,8 @@ pub struct LinkingFailed<'a> { impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for LinkingFailed<'_> { fn into_diagnostic(self, dcx: &DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::codegen_ssa_linking_failed); - diag.set_arg("linker_path", format!("{}", self.linker_path.display())); - diag.set_arg("exit_status", format!("{}", self.exit_status)); + diag.arg("linker_path", format!("{}", self.linker_path.display())); + diag.arg("exit_status", format!("{}", self.exit_status)); let contains_undefined_ref = self.escaped_output.contains("undefined reference to"); diff --git a/compiler/rustc_codegen_ssa/src/mir/operand.rs b/compiler/rustc_codegen_ssa/src/mir/operand.rs index 794cbd315b7..6f6f010422f 100644 --- a/compiler/rustc_codegen_ssa/src/mir/operand.rs +++ b/compiler/rustc_codegen_ssa/src/mir/operand.rs @@ -231,14 +231,12 @@ impl<'a, 'tcx, V: CodegenObject> OperandRef<'tcx, V> { bx: &mut Bx, ) -> V { if let OperandValue::Pair(a, b) = self.val { - let llty = bx.cx().backend_type(self.layout); + let llty = bx.cx().immediate_backend_type(self.layout); debug!("Operand::immediate_or_packed_pair: packing {:?} into {:?}", self, llty); // Reconstruct the immediate aggregate. let mut llpair = bx.cx().const_poison(llty); - let imm_a = bx.from_immediate(a); - let imm_b = bx.from_immediate(b); - llpair = bx.insert_value(llpair, imm_a, 0); - llpair = bx.insert_value(llpair, imm_b, 1); + llpair = bx.insert_value(llpair, a, 0); + llpair = bx.insert_value(llpair, b, 1); llpair } else { self.immediate() @@ -251,14 +249,12 @@ impl<'a, 'tcx, V: CodegenObject> OperandRef<'tcx, V> { llval: V, layout: TyAndLayout<'tcx>, ) -> Self { - let val = if let Abi::ScalarPair(a, b) = layout.abi { + let val = if let Abi::ScalarPair(..) = layout.abi { debug!("Operand::from_immediate_or_packed_pair: unpacking {:?} @ {:?}", llval, layout); // Deconstruct the immediate aggregate. let a_llval = bx.extract_value(llval, 0); - let a_llval = bx.to_immediate_scalar(a_llval, a); let b_llval = bx.extract_value(llval, 1); - let b_llval = bx.to_immediate_scalar(b_llval, b); OperandValue::Pair(a_llval, b_llval) } else { OperandValue::Immediate(llval) @@ -435,15 +431,14 @@ impl<'a, 'tcx, V: CodegenObject> OperandValue<V> { let Abi::ScalarPair(a_scalar, b_scalar) = dest.layout.abi else { bug!("store_with_flags: invalid ScalarPair layout: {:#?}", dest.layout); }; - let ty = bx.backend_type(dest.layout); let b_offset = a_scalar.size(bx).align_to(b_scalar.align(bx).abi); - let llptr = bx.struct_gep(ty, dest.llval, 0); let val = bx.from_immediate(a); let align = dest.align; - bx.store_with_flags(val, llptr, align, flags); + bx.store_with_flags(val, dest.llval, align, flags); - let llptr = bx.struct_gep(ty, dest.llval, 1); + let llptr = + bx.inbounds_gep(bx.type_i8(), dest.llval, &[bx.const_usize(b_offset.bytes())]); let val = bx.from_immediate(b); let align = dest.align.restrict_for_offset(b_offset); bx.store_with_flags(val, llptr, align, flags); diff --git a/compiler/rustc_codegen_ssa/src/mir/place.rs b/compiler/rustc_codegen_ssa/src/mir/place.rs index c0bb3ac5661..73c08e2ca61 100644 --- a/compiler/rustc_codegen_ssa/src/mir/place.rs +++ b/compiler/rustc_codegen_ssa/src/mir/place.rs @@ -108,20 +108,17 @@ impl<'a, 'tcx, V: CodegenObject> PlaceRef<'tcx, V> { // Also handles the first field of Scalar, ScalarPair, and Vector layouts. self.llval } - Abi::ScalarPair(a, b) - if offset == a.size(bx.cx()).align_to(b.align(bx.cx()).abi) => - { - // Offset matches second field. - let ty = bx.backend_type(self.layout); - bx.struct_gep(ty, self.llval, 1) + Abi::ScalarPair(..) => { + // FIXME(nikic): Generate this for all ABIs. + bx.inbounds_gep(bx.type_i8(), self.llval, &[bx.const_usize(offset.bytes())]) } - Abi::Scalar(_) | Abi::ScalarPair(..) | Abi::Vector { .. } if field.is_zst() => { + Abi::Scalar(_) | Abi::Vector { .. } if field.is_zst() => { // ZST fields (even some that require alignment) are not included in Scalar, // ScalarPair, and Vector layouts, so manually offset the pointer. bx.gep(bx.cx().type_i8(), self.llval, &[bx.const_usize(offset.bytes())]) } - Abi::Scalar(_) | Abi::ScalarPair(..) => { - // All fields of Scalar and ScalarPair layouts must have been handled by this point. + Abi::Scalar(_) => { + // All fields of Scalar layouts must have been handled by this point. // Vector layouts have additional fields for each element of the vector, so don't panic in that case. bug!( "offset of non-ZST field `{:?}` does not match layout `{:#?}`", diff --git a/compiler/rustc_const_eval/src/errors.rs b/compiler/rustc_const_eval/src/errors.rs index 110ff87e27e..171cc89d6ad 100644 --- a/compiler/rustc_const_eval/src/errors.rs +++ b/compiler/rustc_const_eval/src/errors.rs @@ -518,7 +518,7 @@ impl<'a> ReportErrorExt for UndefinedBehaviorInfo<'a> { Ub(_) => {} Custom(custom) => { (custom.add_args)(&mut |name, value| { - builder.set_arg(name, value); + builder.arg(name, value); }); } ValidationError(e) => e.add_args(dcx, builder), @@ -536,65 +536,65 @@ impl<'a> ReportErrorExt for UndefinedBehaviorInfo<'a> { | UninhabitedEnumVariantWritten(_) | UninhabitedEnumVariantRead(_) => {} BoundsCheckFailed { len, index } => { - builder.set_arg("len", len); - builder.set_arg("index", index); + builder.arg("len", len); + builder.arg("index", index); } UnterminatedCString(ptr) | InvalidFunctionPointer(ptr) | InvalidVTablePointer(ptr) => { - builder.set_arg("pointer", ptr); + builder.arg("pointer", ptr); } PointerUseAfterFree(alloc_id, msg) => { builder - .set_arg("alloc_id", alloc_id) - .set_arg("bad_pointer_message", bad_pointer_message(msg, dcx)); + .arg("alloc_id", alloc_id) + .arg("bad_pointer_message", bad_pointer_message(msg, dcx)); } PointerOutOfBounds { alloc_id, alloc_size, ptr_offset, ptr_size, msg } => { builder - .set_arg("alloc_id", alloc_id) - .set_arg("alloc_size", alloc_size.bytes()) - .set_arg("ptr_offset", ptr_offset) - .set_arg("ptr_size", ptr_size.bytes()) - .set_arg("bad_pointer_message", bad_pointer_message(msg, dcx)); + .arg("alloc_id", alloc_id) + .arg("alloc_size", alloc_size.bytes()) + .arg("ptr_offset", ptr_offset) + .arg("ptr_size", ptr_size.bytes()) + .arg("bad_pointer_message", bad_pointer_message(msg, dcx)); } DanglingIntPointer(ptr, msg) => { if ptr != 0 { - builder.set_arg("pointer", format!("{ptr:#x}[noalloc]")); + builder.arg("pointer", format!("{ptr:#x}[noalloc]")); } - builder.set_arg("bad_pointer_message", bad_pointer_message(msg, dcx)); + builder.arg("bad_pointer_message", bad_pointer_message(msg, dcx)); } AlignmentCheckFailed(Misalignment { required, has }, msg) => { - builder.set_arg("required", required.bytes()); - builder.set_arg("has", has.bytes()); - builder.set_arg("msg", format!("{msg:?}")); + builder.arg("required", required.bytes()); + builder.arg("has", has.bytes()); + builder.arg("msg", format!("{msg:?}")); } WriteToReadOnly(alloc) | DerefFunctionPointer(alloc) | DerefVTablePointer(alloc) => { - builder.set_arg("allocation", alloc); + builder.arg("allocation", alloc); } InvalidBool(b) => { - builder.set_arg("value", format!("{b:02x}")); + builder.arg("value", format!("{b:02x}")); } InvalidChar(c) => { - builder.set_arg("value", format!("{c:08x}")); + builder.arg("value", format!("{c:08x}")); } InvalidTag(tag) => { - builder.set_arg("tag", format!("{tag:x}")); + builder.arg("tag", format!("{tag:x}")); } InvalidStr(err) => { - builder.set_arg("err", format!("{err}")); + builder.arg("err", format!("{err}")); } InvalidUninitBytes(Some((alloc, info))) => { - builder.set_arg("alloc", alloc); - builder.set_arg("access", info.access); - builder.set_arg("uninit", info.bad); + builder.arg("alloc", alloc); + builder.arg("access", info.access); + builder.arg("uninit", info.bad); } ScalarSizeMismatch(info) => { - builder.set_arg("target_size", info.target_size); - builder.set_arg("data_size", info.data_size); + builder.arg("target_size", info.target_size); + builder.arg("data_size", info.data_size); } AbiMismatchArgument { caller_ty, callee_ty } | AbiMismatchReturn { caller_ty, callee_ty } => { - builder.set_arg("caller_ty", caller_ty.to_string()); - builder.set_arg("callee_ty", callee_ty.to_string()); + builder.arg("caller_ty", caller_ty.to_string()); + builder.arg("callee_ty", callee_ty.to_string()); } } } @@ -695,7 +695,7 @@ impl<'tcx> ReportErrorExt for ValidationErrorInfo<'tcx> { ) }; - err.set_arg("front_matter", message); + err.arg("front_matter", message); fn add_range_arg<G: EmissionGuarantee>( r: WrappingRange, @@ -725,12 +725,12 @@ impl<'tcx> ReportErrorExt for ValidationErrorInfo<'tcx> { ]; let args = args.iter().map(|(a, b)| (a, b)); let message = dcx.eagerly_translate_to_string(msg, args); - err.set_arg("in_range", message); + err.arg("in_range", message); } match self.kind { PtrToUninhabited { ty, .. } | UninhabitedVal { ty } => { - err.set_arg("ty", ty); + err.arg("ty", ty); } PointerAsInt { expected } | Uninit { expected } => { let msg = match expected { @@ -747,28 +747,28 @@ impl<'tcx> ReportErrorExt for ValidationErrorInfo<'tcx> { ExpectedKind::Str => fluent::const_eval_validation_expected_str, }; let msg = dcx.eagerly_translate_to_string(msg, [].into_iter()); - err.set_arg("expected", msg); + err.arg("expected", msg); } InvalidEnumTag { value } | InvalidVTablePtr { value } | InvalidBool { value } | InvalidChar { value } | InvalidFnPtr { value } => { - err.set_arg("value", value); + err.arg("value", value); } NullablePtrOutOfRange { range, max_value } | PtrOutOfRange { range, max_value } => { add_range_arg(range, max_value, dcx, err) } OutOfRange { range, max_value, value } => { - err.set_arg("value", value); + err.arg("value", value); add_range_arg(range, max_value, dcx, err); } UnalignedPtr { required_bytes, found_bytes, .. } => { - err.set_arg("required_bytes", required_bytes); - err.set_arg("found_bytes", found_bytes); + err.arg("required_bytes", required_bytes); + err.arg("found_bytes", found_bytes); } DanglingPtrNoProvenance { pointer, .. } => { - err.set_arg("pointer", pointer); + err.arg("pointer", pointer); } NullPtr { .. } | PtrToStatic { .. } @@ -814,10 +814,10 @@ impl ReportErrorExt for UnsupportedOpInfo { // print. So it's not worth the effort of having diagnostics that can print the `info`. UnsizedLocal | Unsupported(_) | ReadPointerAsInt(_) => {} OverwritePartialPointer(ptr) | ReadPartialPointer(ptr) => { - builder.set_arg("ptr", ptr); + builder.arg("ptr", ptr); } ThreadLocalStatic(did) | ReadExternStatic(did) => { - builder.set_arg("did", format!("{did:?}")); + builder.arg("did", format!("{did:?}")); } } } @@ -844,7 +844,7 @@ impl<'tcx> ReportErrorExt for InterpError<'tcx> { InterpError::InvalidProgram(e) => e.add_args(dcx, builder), InterpError::ResourceExhaustion(e) => e.add_args(dcx, builder), InterpError::MachineStop(e) => e.add_args(&mut |name, value| { - builder.set_arg(name, value); + builder.arg(name, value); }), } } @@ -880,15 +880,15 @@ impl<'tcx> ReportErrorExt for InvalidProgramInfo<'tcx> { let diag: DiagnosticBuilder<'_, ()> = e.into_diagnostic().into_diagnostic(dcx, dummy_level); for (name, val) in diag.args() { - builder.set_arg(name.clone(), val.clone()); + builder.arg(name.clone(), val.clone()); } diag.cancel(); } InvalidProgramInfo::FnAbiAdjustForForeignAbi( AdjustForForeignAbiError::Unsupported { arch, abi }, ) => { - builder.set_arg("arch", arch); - builder.set_arg("abi", abi.name()); + builder.arg("arch", arch); + builder.arg("abi", abi.name()); } } } diff --git a/compiler/rustc_const_eval/src/transform/validate.rs b/compiler/rustc_const_eval/src/transform/validate.rs index b249ffb84b3..0b73691204d 100644 --- a/compiler/rustc_const_eval/src/transform/validate.rs +++ b/compiler/rustc_const_eval/src/transform/validate.rs @@ -74,7 +74,6 @@ impl<'tcx> MirPass<'tcx> for Validator { mir_phase, unwind_edge_count: 0, reachable_blocks: traversal::reachable_as_bitset(body), - place_cache: FxHashSet::default(), value_cache: FxHashSet::default(), can_unwind, }; @@ -106,7 +105,6 @@ struct CfgChecker<'a, 'tcx> { mir_phase: MirPhase, unwind_edge_count: usize, reachable_blocks: BitSet<BasicBlock>, - place_cache: FxHashSet<PlaceRef<'tcx>>, value_cache: FxHashSet<u128>, // If `false`, then the MIR must not contain `UnwindAction::Continue` or // `TerminatorKind::Resume`. @@ -294,19 +292,6 @@ impl<'a, 'tcx> Visitor<'tcx> for CfgChecker<'a, 'tcx> { fn visit_statement(&mut self, statement: &Statement<'tcx>, location: Location) { match &statement.kind { - StatementKind::Assign(box (dest, rvalue)) => { - // FIXME(JakobDegen): Check this for all rvalues, not just this one. - if let Rvalue::Use(Operand::Copy(src) | Operand::Move(src)) = rvalue { - // The sides of an assignment must not alias. Currently this just checks whether - // the places are identical. - if dest == src { - self.fail( - location, - "encountered `Assign` statement with overlapping memory", - ); - } - } - } StatementKind::AscribeUserType(..) => { if self.mir_phase >= MirPhase::Runtime(RuntimePhase::Initial) { self.fail( @@ -341,7 +326,8 @@ impl<'a, 'tcx> Visitor<'tcx> for CfgChecker<'a, 'tcx> { self.fail(location, format!("explicit `{kind:?}` is forbidden")); } } - StatementKind::StorageLive(_) + StatementKind::Assign(..) + | StatementKind::StorageLive(_) | StatementKind::StorageDead(_) | StatementKind::Intrinsic(_) | StatementKind::Coverage(_) @@ -404,10 +390,7 @@ impl<'a, 'tcx> Visitor<'tcx> for CfgChecker<'a, 'tcx> { } // The call destination place and Operand::Move place used as an argument might be - // passed by a reference to the callee. Consequently they must be non-overlapping - // and cannot be packed. Currently this simply checks for duplicate places. - self.place_cache.clear(); - self.place_cache.insert(destination.as_ref()); + // passed by a reference to the callee. Consequently they cannot be packed. if is_within_packed(self.tcx, &self.body.local_decls, *destination).is_some() { // This is bad! The callee will expect the memory to be aligned. self.fail( @@ -418,10 +401,8 @@ impl<'a, 'tcx> Visitor<'tcx> for CfgChecker<'a, 'tcx> { ), ); } - let mut has_duplicates = false; for arg in args { if let Operand::Move(place) = arg { - has_duplicates |= !self.place_cache.insert(place.as_ref()); if is_within_packed(self.tcx, &self.body.local_decls, *place).is_some() { // This is bad! The callee will expect the memory to be aligned. self.fail( @@ -434,16 +415,6 @@ impl<'a, 'tcx> Visitor<'tcx> for CfgChecker<'a, 'tcx> { } } } - - if has_duplicates { - self.fail( - location, - format!( - "encountered overlapping memory in `Move` arguments to `Call` terminator: {:?}", - terminator.kind, - ), - ); - } } TerminatorKind::Assert { target, unwind, .. } => { self.check_edge(location, *target, EdgeKind::Normal); @@ -1112,17 +1083,6 @@ impl<'a, 'tcx> Visitor<'tcx> for TypeChecker<'a, 'tcx> { ) } } - // FIXME(JakobDegen): Check this for all rvalues, not just this one. - if let Rvalue::Use(Operand::Copy(src) | Operand::Move(src)) = rvalue { - // The sides of an assignment must not alias. Currently this just checks whether - // the places are identical. - if dest == src { - self.fail( - location, - "encountered `Assign` statement with overlapping memory", - ); - } - } } StatementKind::AscribeUserType(..) => { if self.mir_phase >= MirPhase::Runtime(RuntimePhase::Initial) { diff --git a/compiler/rustc_driver_impl/src/lib.rs b/compiler/rustc_driver_impl/src/lib.rs index ca6b0afc76a..fd925b62702 100644 --- a/compiler/rustc_driver_impl/src/lib.rs +++ b/compiler/rustc_driver_impl/src/lib.rs @@ -12,6 +12,7 @@ #![feature(lazy_cell)] #![feature(let_chains)] #![feature(panic_update_hook)] +#![feature(result_flattening)] #![recursion_limit = "256"] #![deny(rustc::untranslatable_diagnostic)] #![deny(rustc::diagnostic_outside_of_impl)] @@ -1249,8 +1250,7 @@ pub fn catch_fatal_errors<F: FnOnce() -> R, R>(f: F) -> Result<R, ErrorGuarantee /// Variant of `catch_fatal_errors` for the `interface::Result` return type /// that also computes the exit code. pub fn catch_with_exit_code(f: impl FnOnce() -> interface::Result<()>) -> i32 { - let result = catch_fatal_errors(f).and_then(|result| result); - match result { + match catch_fatal_errors(f).flatten() { Ok(()) => EXIT_SUCCESS, Err(_) => EXIT_FAILURE, } @@ -1393,7 +1393,7 @@ fn report_ice( ) { let fallback_bundle = rustc_errors::fallback_fluent_bundle(crate::DEFAULT_LOCALE_RESOURCES.to_vec(), false); - let emitter = Box::new(rustc_errors::emitter::EmitterWriter::stderr( + let emitter = Box::new(rustc_errors::emitter::HumanEmitter::stderr( rustc_errors::ColorConfig::Auto, fallback_bundle, )); diff --git a/compiler/rustc_errors/src/annotate_snippet_emitter_writer.rs b/compiler/rustc_errors/src/annotate_snippet_emitter_writer.rs index 48e48f59a99..5c0e210f147 100644 --- a/compiler/rustc_errors/src/annotate_snippet_emitter_writer.rs +++ b/compiler/rustc_errors/src/annotate_snippet_emitter_writer.rs @@ -20,7 +20,7 @@ use rustc_span::source_map::SourceMap; use rustc_span::SourceFile; /// Generates diagnostics using annotate-snippet -pub struct AnnotateSnippetEmitterWriter { +pub struct AnnotateSnippetEmitter { source_map: Option<Lrc<SourceMap>>, fluent_bundle: Option<Lrc<FluentBundle>>, fallback_bundle: LazyFallbackBundle, @@ -33,7 +33,7 @@ pub struct AnnotateSnippetEmitterWriter { macro_backtrace: bool, } -impl Translate for AnnotateSnippetEmitterWriter { +impl Translate for AnnotateSnippetEmitter { fn fluent_bundle(&self) -> Option<&Lrc<FluentBundle>> { self.fluent_bundle.as_ref() } @@ -43,7 +43,7 @@ impl Translate for AnnotateSnippetEmitterWriter { } } -impl Emitter for AnnotateSnippetEmitterWriter { +impl Emitter for AnnotateSnippetEmitter { /// The entry point for the diagnostics generation fn emit_diagnostic(&mut self, diag: &Diagnostic) { let fluent_args = to_fluent_args(diag.args()); @@ -86,9 +86,7 @@ fn source_string(file: Lrc<SourceFile>, line: &Line) -> String { /// Maps `Diagnostic::Level` to `snippet::AnnotationType` fn annotation_type_for_level(level: Level) -> AnnotationType { match level { - Level::Bug | Level::DelayedBug | Level::Fatal | Level::Error { .. } => { - AnnotationType::Error - } + Level::Bug | Level::DelayedBug | Level::Fatal | Level::Error => AnnotationType::Error, Level::Warning(_) => AnnotationType::Warning, Level::Note | Level::OnceNote => AnnotationType::Note, Level::Help | Level::OnceHelp => AnnotationType::Help, @@ -99,7 +97,7 @@ fn annotation_type_for_level(level: Level) -> AnnotationType { } } -impl AnnotateSnippetEmitterWriter { +impl AnnotateSnippetEmitter { pub fn new( source_map: Option<Lrc<SourceMap>>, fluent_bundle: Option<Lrc<FluentBundle>>, diff --git a/compiler/rustc_errors/src/diagnostic.rs b/compiler/rustc_errors/src/diagnostic.rs index 49431fb7b3f..701c1c02ab0 100644 --- a/compiler/rustc_errors/src/diagnostic.rs +++ b/compiler/rustc_errors/src/diagnostic.rs @@ -212,6 +212,9 @@ impl StringPart { } } +// Note: most of these methods are setters that return `&mut Self`. The small +// number of simple getter functions all have `get_` prefixes to distinguish +// them from the setters. impl Diagnostic { #[track_caller] pub fn new<M: Into<DiagnosticMessage>>(level: Level, message: M) -> Self { @@ -241,11 +244,9 @@ impl Diagnostic { pub fn is_error(&self) -> bool { match self.level { - Level::Bug - | Level::DelayedBug - | Level::Fatal - | Level::Error { .. } - | Level::FailureNote => true, + Level::Bug | Level::DelayedBug | Level::Fatal | Level::Error | Level::FailureNote => { + true + } Level::Warning(_) | Level::Note @@ -308,25 +309,27 @@ impl Diagnostic { /// In the meantime, though, callsites are required to deal with the "bug" /// locally in whichever way makes the most sense. #[track_caller] - pub fn downgrade_to_delayed_bug(&mut self) -> &mut Self { + pub fn downgrade_to_delayed_bug(&mut self) { assert!( self.is_error(), "downgrade_to_delayed_bug: cannot downgrade {:?} to DelayedBug: not an error", self.level ); self.level = Level::DelayedBug; - - self } - /// Adds a span/label to be included in the resulting snippet. + /// Appends a labeled span to the diagnostic. /// - /// This is pushed onto the [`MultiSpan`] that was created when the diagnostic - /// was first built. That means it will be shown together with the original - /// span/label, *not* a span added by one of the `span_{note,warn,help,suggestions}` methods. + /// Labels are used to convey additional context for the diagnostic's primary span. They will + /// be shown together with the original diagnostic's span, *not* with spans added by + /// `span_note`, `span_help`, etc. Therefore, if the primary span is not displayable (because + /// the span is `DUMMY_SP` or the source code isn't found), labels will not be displayed + /// either. /// - /// This span is *not* considered a ["primary span"][`MultiSpan`]; only - /// the `Span` supplied when creating the diagnostic is primary. + /// Implementation-wise, the label span is pushed onto the [`MultiSpan`] that was created when + /// the diagnostic was constructed. However, the label span is *not* considered a + /// ["primary span"][`MultiSpan`]; only the `Span` supplied when creating the diagnostic is + /// primary. #[rustc_lint_diagnostics] pub fn span_label(&mut self, span: Span, label: impl Into<SubdiagnosticMessage>) -> &mut Self { self.span.push_span_label(span, self.subdiagnostic_message_to_diagnostic_message(label)); @@ -344,7 +347,7 @@ impl Diagnostic { pub fn replace_span_with(&mut self, after: Span, keep_label: bool) -> &mut Self { let before = self.span.clone(); - self.set_span(after); + self.span(after); for span_label in before.span_labels() { if let Some(label) = span_label.label { if span_label.is_primary && keep_label { @@ -876,7 +879,7 @@ impl Diagnostic { self } - pub fn set_span<S: Into<MultiSpan>>(&mut self, sp: S) -> &mut Self { + pub fn span<S: Into<MultiSpan>>(&mut self, sp: S) -> &mut Self { self.span = sp.into(); if let Some(span) = self.span.primary_span() { self.sort_span = span; @@ -884,7 +887,7 @@ impl Diagnostic { self } - pub fn set_is_lint(&mut self) -> &mut Self { + pub fn is_lint(&mut self) -> &mut Self { self.is_lint = true; self } @@ -903,7 +906,7 @@ impl Diagnostic { self.code.clone() } - pub fn set_primary_message(&mut self, msg: impl Into<DiagnosticMessage>) -> &mut Self { + pub fn primary_message(&mut self, msg: impl Into<DiagnosticMessage>) -> &mut Self { self.messages[0] = (msg.into(), Style::NoStyle); self } @@ -915,7 +918,7 @@ impl Diagnostic { self.args.iter() } - pub fn set_arg( + pub fn arg( &mut self, name: impl Into<Cow<'static, str>>, arg: impl IntoDiagnosticArg, diff --git a/compiler/rustc_errors/src/diagnostic_builder.rs b/compiler/rustc_errors/src/diagnostic_builder.rs index ae54d343dad..e018c14a4a5 100644 --- a/compiler/rustc_errors/src/diagnostic_builder.rs +++ b/compiler/rustc_errors/src/diagnostic_builder.rs @@ -31,7 +31,7 @@ where { fn into_diagnostic(self, dcx: &'a DiagCtxt, level: Level) -> DiagnosticBuilder<'a, G> { let mut diag = self.node.into_diagnostic(dcx, level); - diag.set_span(self.span); + diag.span(self.span); diag } } @@ -207,11 +207,11 @@ macro_rules! forward { // Forward pattern for &mut self -> &mut Self ( $(#[$attrs:meta])* - pub fn $n:ident(&mut self, $($name:ident: $ty:ty),* $(,)?) -> &mut Self + pub fn $n:ident(&mut self $(, $name:ident: $ty:ty)* $(,)?) -> &mut Self ) => { $(#[$attrs])* #[doc = concat!("See [`Diagnostic::", stringify!($n), "()`].")] - pub fn $n(&mut self, $($name: $ty),*) -> &mut Self { + pub fn $n(&mut self $(, $name: $ty)*) -> &mut Self { self.diagnostic.$n($($name),*); self } @@ -356,35 +356,16 @@ impl<'a, G: EmissionGuarantee> DiagnosticBuilder<'a, G> { self.emit() } - forward!( - #[track_caller] - pub fn downgrade_to_delayed_bug(&mut self,) -> &mut Self - ); - - forward!( - /// Appends a labeled span to the diagnostic. - /// - /// Labels are used to convey additional context for the diagnostic's primary span. They will - /// be shown together with the original diagnostic's span, *not* with spans added by - /// `span_note`, `span_help`, etc. Therefore, if the primary span is not displayable (because - /// the span is `DUMMY_SP` or the source code isn't found), labels will not be displayed - /// either. - /// - /// Implementation-wise, the label span is pushed onto the [`MultiSpan`] that was created when - /// the diagnostic was constructed. However, the label span is *not* considered a - /// ["primary span"][`MultiSpan`]; only the `Span` supplied when creating the diagnostic is - /// primary. - pub fn span_label(&mut self, span: Span, label: impl Into<SubdiagnosticMessage>) -> &mut Self); - - forward!( - /// Labels all the given spans with the provided label. - /// See [`Diagnostic::span_label()`] for more information. - pub fn span_labels( + forward!(pub fn span_label( + &mut self, + span: Span, + label: impl Into<SubdiagnosticMessage> + ) -> &mut Self); + forward!(pub fn span_labels( &mut self, spans: impl IntoIterator<Item = Span>, label: &str, ) -> &mut Self); - forward!(pub fn note_expected_found( &mut self, expected_label: &dyn fmt::Display, @@ -392,7 +373,6 @@ impl<'a, G: EmissionGuarantee> DiagnosticBuilder<'a, G> { found_label: &dyn fmt::Display, found: DiagnosticStyledString, ) -> &mut Self); - forward!(pub fn note_expected_found_extra( &mut self, expected_label: &dyn fmt::Display, @@ -402,7 +382,6 @@ impl<'a, G: EmissionGuarantee> DiagnosticBuilder<'a, G> { expected_extra: &dyn fmt::Display, found_extra: &dyn fmt::Display, ) -> &mut Self); - forward!(pub fn note(&mut self, msg: impl Into<SubdiagnosticMessage>) -> &mut Self); forward!(pub fn note_once(&mut self, msg: impl Into<SubdiagnosticMessage>) -> &mut Self); forward!(pub fn span_note( @@ -428,10 +407,8 @@ impl<'a, G: EmissionGuarantee> DiagnosticBuilder<'a, G> { sp: impl Into<MultiSpan>, msg: impl Into<SubdiagnosticMessage>, ) -> &mut Self); - forward!(pub fn set_is_lint(&mut self,) -> &mut Self); - - forward!(pub fn disable_suggestions(&mut self,) -> &mut Self); - + forward!(pub fn is_lint(&mut self) -> &mut Self); + forward!(pub fn disable_suggestions(&mut self) -> &mut Self); forward!(pub fn multipart_suggestion( &mut self, msg: impl Into<SubdiagnosticMessage>, @@ -498,16 +475,14 @@ impl<'a, G: EmissionGuarantee> DiagnosticBuilder<'a, G> { suggestion: impl ToString, applicability: Applicability, ) -> &mut Self); - - forward!(pub fn set_primary_message(&mut self, msg: impl Into<DiagnosticMessage>) -> &mut Self); - forward!(pub fn set_span(&mut self, sp: impl Into<MultiSpan>) -> &mut Self); + forward!(pub fn primary_message(&mut self, msg: impl Into<DiagnosticMessage>) -> &mut Self); + forward!(pub fn span(&mut self, sp: impl Into<MultiSpan>) -> &mut Self); forward!(pub fn code(&mut self, s: DiagnosticId) -> &mut Self); - forward!(pub fn set_arg( + forward!(pub fn arg( &mut self, name: impl Into<Cow<'static, str>>, arg: impl IntoDiagnosticArg, ) -> &mut Self); - forward!(pub fn subdiagnostic( &mut self, subdiagnostic: impl crate::AddToDiagnostic diff --git a/compiler/rustc_errors/src/diagnostic_impls.rs b/compiler/rustc_errors/src/diagnostic_impls.rs index 29cb304e8b5..de27c6e910b 100644 --- a/compiler/rustc_errors/src/diagnostic_impls.rs +++ b/compiler/rustc_errors/src/diagnostic_impls.rs @@ -254,29 +254,29 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for TargetDataLayoutErrors<'_> TargetDataLayoutErrors::InvalidAddressSpace { addr_space, err, cause } => { diag = DiagnosticBuilder::new(dcx, level, fluent::errors_target_invalid_address_space); - diag.set_arg("addr_space", addr_space); - diag.set_arg("cause", cause); - diag.set_arg("err", err); + diag.arg("addr_space", addr_space); + diag.arg("cause", cause); + diag.arg("err", err); diag } TargetDataLayoutErrors::InvalidBits { kind, bit, cause, err } => { diag = DiagnosticBuilder::new(dcx, level, fluent::errors_target_invalid_bits); - diag.set_arg("kind", kind); - diag.set_arg("bit", bit); - diag.set_arg("cause", cause); - diag.set_arg("err", err); + diag.arg("kind", kind); + diag.arg("bit", bit); + diag.arg("cause", cause); + diag.arg("err", err); diag } TargetDataLayoutErrors::MissingAlignment { cause } => { diag = DiagnosticBuilder::new(dcx, level, fluent::errors_target_missing_alignment); - diag.set_arg("cause", cause); + diag.arg("cause", cause); diag } TargetDataLayoutErrors::InvalidAlignment { cause, err } => { diag = DiagnosticBuilder::new(dcx, level, fluent::errors_target_invalid_alignment); - diag.set_arg("cause", cause); - diag.set_arg("err_kind", err.diag_ident()); - diag.set_arg("align", err.align()); + diag.arg("cause", cause); + diag.arg("err_kind", err.diag_ident()); + diag.arg("align", err.align()); diag } TargetDataLayoutErrors::InconsistentTargetArchitecture { dl, target } => { @@ -285,8 +285,8 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for TargetDataLayoutErrors<'_> level, fluent::errors_target_inconsistent_architecture, ); - diag.set_arg("dl", dl); - diag.set_arg("target", target); + diag.arg("dl", dl); + diag.arg("target", target); diag } TargetDataLayoutErrors::InconsistentTargetPointerWidth { pointer_size, target } => { @@ -295,13 +295,13 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for TargetDataLayoutErrors<'_> level, fluent::errors_target_inconsistent_pointer_width, ); - diag.set_arg("pointer_size", pointer_size); - diag.set_arg("target", target); + diag.arg("pointer_size", pointer_size); + diag.arg("target", target); diag } TargetDataLayoutErrors::InvalidBitsSize { err } => { diag = DiagnosticBuilder::new(dcx, level, fluent::errors_target_invalid_bits_size); - diag.set_arg("err", err); + diag.arg("err", err); diag } } diff --git a/compiler/rustc_errors/src/emitter.rs b/compiler/rustc_errors/src/emitter.rs index 546159c9d13..987832e6937 100644 --- a/compiler/rustc_errors/src/emitter.rs +++ b/compiler/rustc_errors/src/emitter.rs @@ -61,13 +61,13 @@ impl HumanReadableErrorType { self, mut dst: Box<dyn WriteColor + Send>, fallback_bundle: LazyFallbackBundle, - ) -> EmitterWriter { + ) -> HumanEmitter { let (short, color_config) = self.unzip(); let color = color_config.suggests_using_colors(); if !dst.supports_color() && color { dst = Box::new(Ansi::new(dst)); } - EmitterWriter::new(dst, fallback_bundle).short_message(short) + HumanEmitter::new(dst, fallback_bundle).short_message(short) } } @@ -196,13 +196,15 @@ pub trait Emitter: Translate { fn emit_diagnostic(&mut self, diag: &Diagnostic); /// Emit a notification that an artifact has been output. - /// This is currently only supported for the JSON format, - /// other formats can, and will, simply ignore it. + /// Currently only supported for the JSON format. fn emit_artifact_notification(&mut self, _path: &Path, _artifact_type: &str) {} + /// Emit a report about future breakage. + /// Currently only supported for the JSON format. fn emit_future_breakage_report(&mut self, _diags: Vec<Diagnostic>) {} - /// Emit list of unused externs + /// Emit list of unused externs. + /// Currently only supported for the JSON format. fn emit_unused_externs( &mut self, _lint_level: rustc_lint_defs::Level, @@ -501,7 +503,7 @@ pub trait Emitter: Translate { } } -impl Translate for EmitterWriter { +impl Translate for HumanEmitter { fn fluent_bundle(&self) -> Option<&Lrc<FluentBundle>> { self.fluent_bundle.as_ref() } @@ -511,7 +513,7 @@ impl Translate for EmitterWriter { } } -impl Emitter for EmitterWriter { +impl Emitter for HumanEmitter { fn source_map(&self) -> Option<&Lrc<SourceMap>> { self.sm.as_ref() } @@ -622,7 +624,7 @@ impl ColorConfig { /// Handles the writing of `HumanReadableErrorType::Default` and `HumanReadableErrorType::Short` #[derive(Setters)] -pub struct EmitterWriter { +pub struct HumanEmitter { #[setters(skip)] dst: IntoDynSyncSend<Destination>, sm: Option<Lrc<SourceMap>>, @@ -647,14 +649,14 @@ pub struct FileWithAnnotatedLines { multiline_depth: usize, } -impl EmitterWriter { - pub fn stderr(color_config: ColorConfig, fallback_bundle: LazyFallbackBundle) -> EmitterWriter { +impl HumanEmitter { + pub fn stderr(color_config: ColorConfig, fallback_bundle: LazyFallbackBundle) -> HumanEmitter { let dst = from_stderr(color_config); Self::create(dst, fallback_bundle) } - fn create(dst: Destination, fallback_bundle: LazyFallbackBundle) -> EmitterWriter { - EmitterWriter { + fn create(dst: Destination, fallback_bundle: LazyFallbackBundle) -> HumanEmitter { + HumanEmitter { dst: IntoDynSyncSend(dst), sm: None, fluent_bundle: None, @@ -673,7 +675,7 @@ impl EmitterWriter { pub fn new( dst: Box<dyn WriteColor + Send>, fallback_bundle: LazyFallbackBundle, - ) -> EmitterWriter { + ) -> HumanEmitter { Self::create(dst, fallback_bundle) } diff --git a/compiler/rustc_errors/src/lib.rs b/compiler/rustc_errors/src/lib.rs index e9507dcfed7..25bec9f766b 100644 --- a/compiler/rustc_errors/src/lib.rs +++ b/compiler/rustc_errors/src/lib.rs @@ -53,7 +53,7 @@ pub use snippet::Style; pub use termcolor::{Color, ColorSpec, WriteColor}; use crate::diagnostic_impls::{DelayedAtWithNewline, DelayedAtWithoutNewline}; -use emitter::{is_case_difference, DynEmitter, Emitter, EmitterWriter}; +use emitter::{is_case_difference, DynEmitter, Emitter, HumanEmitter}; use registry::Registry; use rustc_data_structures::fx::{FxHashSet, FxIndexMap, FxIndexSet}; use rustc_data_structures::stable_hasher::{Hash128, StableHasher}; @@ -525,9 +525,6 @@ pub struct DiagCtxtFlags { /// If true, immediately emit diagnostics that would otherwise be buffered. /// (rustc: see `-Z dont-buffer-diagnostics` and `-Z treat-err-as-bug`) pub dont_buffer_diagnostics: bool, - /// If true, immediately print bugs registered with `span_delayed_bug`. - /// (rustc: see `-Z report-delayed-bugs`) - pub report_delayed_bugs: bool, /// Show macro backtraces. /// (rustc: see `-Z macro-backtrace`) pub macro_backtrace: bool, @@ -574,7 +571,7 @@ impl DiagCtxt { sm: Option<Lrc<SourceMap>>, fallback_bundle: LazyFallbackBundle, ) -> Self { - let emitter = Box::new(EmitterWriter::stderr(ColorConfig::Auto, fallback_bundle).sm(sm)); + let emitter = Box::new(HumanEmitter::stderr(ColorConfig::Auto, fallback_bundle).sm(sm)); Self::with_emitter(emitter) } pub fn disable_warnings(mut self) -> Self { @@ -673,7 +670,7 @@ impl DiagCtxt { let key = (span.with_parent(None), key); if diag.is_error() { - if matches!(diag.level, Error { lint: true }) { + if diag.level == Error && diag.is_lint { inner.lint_err_count += 1; } else { inner.err_count += 1; @@ -697,7 +694,7 @@ impl DiagCtxt { let key = (span.with_parent(None), key); let diag = inner.stashed_diagnostics.remove(&key)?; if diag.is_error() { - if matches!(diag.level, Error { lint: true }) { + if diag.level == Error && diag.is_lint { inner.lint_err_count -= 1; } else { inner.err_count -= 1; @@ -732,7 +729,7 @@ impl DiagCtxt { msg: impl Into<DiagnosticMessage>, ) -> DiagnosticBuilder<'_, ()> { let mut result = self.struct_warn(msg); - result.set_span(span); + result.span(span); result } @@ -789,7 +786,7 @@ impl DiagCtxt { msg: impl Into<DiagnosticMessage>, ) -> DiagnosticBuilder<'_> { let mut result = self.struct_err(msg); - result.set_span(span); + result.span(span); result } @@ -812,7 +809,7 @@ impl DiagCtxt { #[rustc_lint_diagnostics] #[track_caller] pub fn struct_err(&self, msg: impl Into<DiagnosticMessage>) -> DiagnosticBuilder<'_> { - DiagnosticBuilder::new(self, Error { lint: false }, msg) + DiagnosticBuilder::new(self, Error, msg) } /// Construct a builder at the `Error` level with the `msg` and the `code`. @@ -850,7 +847,7 @@ impl DiagCtxt { msg: impl Into<DiagnosticMessage>, ) -> DiagnosticBuilder<'_, FatalAbort> { let mut result = self.struct_fatal(msg); - result.set_span(span); + result.span(span); result } @@ -878,16 +875,6 @@ impl DiagCtxt { DiagnosticBuilder::new(self, Fatal, msg) } - /// Construct a builder at the `Fatal` level with the `msg`, that doesn't abort. - #[rustc_lint_diagnostics] - #[track_caller] - pub fn struct_almost_fatal( - &self, - msg: impl Into<DiagnosticMessage>, - ) -> DiagnosticBuilder<'_, FatalError> { - DiagnosticBuilder::new(self, Fatal, msg) - } - /// Construct a builder at the `Help` level with the `msg`. #[rustc_lint_diagnostics] pub fn struct_help(&self, msg: impl Into<DiagnosticMessage>) -> DiagnosticBuilder<'_, ()> { @@ -917,7 +904,7 @@ impl DiagCtxt { msg: impl Into<DiagnosticMessage>, ) -> DiagnosticBuilder<'_, BugAbort> { let mut result = self.struct_bug(msg); - result.set_span(span); + result.span(span); result } @@ -1004,11 +991,10 @@ impl DiagCtxt { ) -> ErrorGuaranteed { let treat_next_err_as_bug = self.inner.borrow().treat_next_err_as_bug(); if treat_next_err_as_bug { - // FIXME: don't abort here if report_delayed_bugs is off self.span_bug(sp, msg); } let mut diagnostic = Diagnostic::new(DelayedBug, msg); - diagnostic.set_span(sp); + diagnostic.span(sp); self.emit_diagnostic(diagnostic).unwrap() } @@ -1016,11 +1002,7 @@ impl DiagCtxt { // where the explanation of what "good path" is (also, it should be renamed). pub fn good_path_delayed_bug(&self, msg: impl Into<DiagnosticMessage>) { let mut inner = self.inner.borrow_mut(); - - let mut diagnostic = Diagnostic::new(DelayedBug, msg); - if inner.flags.report_delayed_bugs { - inner.emit_diagnostic_without_consuming(&mut diagnostic); - } + let diagnostic = Diagnostic::new(DelayedBug, msg); let backtrace = std::backtrace::Backtrace::capture(); inner.good_path_delayed_bugs.push(DelayedDiagnostic::with_backtrace(diagnostic, backtrace)); } @@ -1039,7 +1021,7 @@ impl DiagCtxt { msg: impl Into<DiagnosticMessage>, ) -> DiagnosticBuilder<'_, ()> { let mut db = DiagnosticBuilder::new(self, Note, msg); - db.set_span(span); + db.span(span); db } @@ -1222,7 +1204,7 @@ impl DiagCtxt { #[track_caller] pub fn create_err<'a>(&'a self, err: impl IntoDiagnostic<'a>) -> DiagnosticBuilder<'a> { - err.into_diagnostic(self, Error { lint: false }) + err.into_diagnostic(self, Error) } #[track_caller] @@ -1377,7 +1359,7 @@ impl DiagCtxtInner { for diag in diags { // Decrement the count tracking the stash; emitting will increment it. if diag.is_error() { - if matches!(diag.level, Error { lint: true }) { + if diag.level == Error && diag.is_lint { self.lint_err_count -= 1; } else { self.err_count -= 1; @@ -1408,7 +1390,7 @@ impl DiagCtxtInner { &mut self, diagnostic: &mut Diagnostic, ) -> Option<ErrorGuaranteed> { - if matches!(diagnostic.level, Error { .. } | Fatal) && self.treat_err_as_bug() { + if matches!(diagnostic.level, Error | Fatal) && self.treat_err_as_bug() { diagnostic.level = Bug; } @@ -1430,10 +1412,8 @@ impl DiagCtxtInner { self.span_delayed_bugs .push(DelayedDiagnostic::with_backtrace(diagnostic.clone(), backtrace)); - if !self.flags.report_delayed_bugs { - #[allow(deprecated)] - return Some(ErrorGuaranteed::unchecked_claim_error_was_emitted()); - } + #[allow(deprecated)] + return Some(ErrorGuaranteed::unchecked_claim_error_was_emitted()); } if diagnostic.has_future_breakage() { @@ -1509,7 +1489,7 @@ impl DiagCtxtInner { } } if diagnostic.is_error() { - if matches!(diagnostic.level, Error { lint: true }) { + if diagnostic.level == Error && diagnostic.is_lint { self.bump_lint_err_count(); } else { self.bump_err_count(); @@ -1698,18 +1678,14 @@ pub enum Level { /// internal overflows, some file operation errors. /// /// Its `EmissionGuarantee` is `FatalAbort`, except in the non-aborting "almost fatal" case - /// that is occasionaly used, where it is `FatalError`. + /// that is occasionally used, where it is `FatalError`. Fatal, /// An error in the code being compiled, which prevents compilation from finishing. This is the /// most common case. /// /// Its `EmissionGuarantee` is `ErrorGuaranteed`. - Error { - /// If this error comes from a lint, don't abort compilation even when abort_if_errors() is - /// called. - lint: bool, - }, + Error, /// A warning about the code being compiled. Does not prevent compilation from finishing. /// @@ -1768,7 +1744,7 @@ impl Level { fn color(self) -> ColorSpec { let mut spec = ColorSpec::new(); match self { - Bug | DelayedBug | Fatal | Error { .. } => { + Bug | DelayedBug | Fatal | Error => { spec.set_fg(Some(Color::Red)).set_intense(true); } Warning(_) => { @@ -1789,7 +1765,7 @@ impl Level { pub fn to_str(self) -> &'static str { match self { Bug | DelayedBug => "error: internal compiler error", - Fatal | Error { .. } => "error", + Fatal | Error => "error", Warning(_) => "warning", Note | OnceNote => "note", Help | OnceHelp => "help", diff --git a/compiler/rustc_expand/src/expand.rs b/compiler/rustc_expand/src/expand.rs index 676f9f17976..5a616e0ffbf 100644 --- a/compiler/rustc_expand/src/expand.rs +++ b/compiler/rustc_expand/src/expand.rs @@ -855,7 +855,7 @@ impl<'a, 'b> MacroExpander<'a, 'b> { } Err(mut err) => { if err.span.is_dummy() { - err.set_span(span); + err.span(span); } annotate_err_with_kind(&mut err, kind, span); err.emit(); diff --git a/compiler/rustc_expand/src/mbe/macro_rules.rs b/compiler/rustc_expand/src/mbe/macro_rules.rs index e9736d6f2c8..e9797abcbdf 100644 --- a/compiler/rustc_expand/src/mbe/macro_rules.rs +++ b/compiler/rustc_expand/src/mbe/macro_rules.rs @@ -10,7 +10,7 @@ use crate::mbe::transcribe::transcribe; use rustc_ast as ast; use rustc_ast::token::{self, Delimiter, NonterminalKind, Token, TokenKind, TokenKind::*}; -use rustc_ast::tokenstream::{DelimSpan, TokenStream, TokenTree}; +use rustc_ast::tokenstream::{DelimSpan, TokenStream}; use rustc_ast::{NodeId, DUMMY_NODE_ID}; use rustc_ast_pretty::pprust; use rustc_attr::{self as attr, TransparencyError}; @@ -213,7 +213,7 @@ fn expand_macro<'cx>( let arm_span = rhses[i].span(); // rhs has holes ( `$id` and `$(...)` that need filled) - let mut tts = match transcribe(cx, &named_matches, rhs, rhs_span, transparency) { + let tts = match transcribe(cx, &named_matches, rhs, rhs_span, transparency) { Ok(tts) => tts, Err(mut err) => { err.emit(); @@ -221,37 +221,6 @@ fn expand_macro<'cx>( } }; - // Replace all the tokens for the corresponding positions in the macro, to maintain - // proper positions in error reporting, while maintaining the macro_backtrace. - if tts.len() == rhs.tts.len() { - tts = tts.map_enumerated_owned(|i, mut tt| { - let rhs_tt = &rhs.tts[i]; - let ctxt = tt.span().ctxt(); - match (&mut tt, rhs_tt) { - // preserve the delim spans if able - ( - TokenTree::Delimited(target_sp, ..), - mbe::TokenTree::Delimited(source_sp, ..), - ) => { - target_sp.open = source_sp.open.with_ctxt(ctxt); - target_sp.close = source_sp.close.with_ctxt(ctxt); - } - ( - TokenTree::Delimited(target_sp, ..), - mbe::TokenTree::MetaVar(source_sp, ..), - ) => { - target_sp.open = source_sp.with_ctxt(ctxt); - target_sp.close = source_sp.with_ctxt(ctxt).shrink_to_hi(); - } - _ => { - let sp = rhs_tt.span().with_ctxt(ctxt); - tt.set_span(sp); - } - } - tt - }); - } - if cx.trace_macros() { let msg = format!("to `{}`", pprust::tts_to_string(&tts)); trace_macros_note(&mut cx.expansions, sp, msg); diff --git a/compiler/rustc_expand/src/mbe/transcribe.rs b/compiler/rustc_expand/src/mbe/transcribe.rs index f2a9875ffd2..c969ca7ef89 100644 --- a/compiler/rustc_expand/src/mbe/transcribe.rs +++ b/compiler/rustc_expand/src/mbe/transcribe.rs @@ -4,7 +4,7 @@ use crate::errors::{ NoSyntaxVarsExprRepeat, VarStillRepeating, }; use crate::mbe::macro_parser::{MatchedNonterminal, MatchedSeq, MatchedTokenTree, NamedMatch}; -use crate::mbe::{self, MetaVarExpr}; +use crate::mbe::{self, KleeneOp, MetaVarExpr}; use rustc_ast::mut_visit::{self, MutVisitor}; use rustc_ast::token::{self, Delimiter, Token, TokenKind}; use rustc_ast::tokenstream::{DelimSpacing, DelimSpan, Spacing, TokenStream, TokenTree}; @@ -42,6 +42,7 @@ enum Frame<'a> { tts: &'a [mbe::TokenTree], idx: usize, sep: Option<Token>, + kleene_op: KleeneOp, }, } @@ -207,7 +208,7 @@ pub(super) fn transcribe<'a>( // Is the repetition empty? if len == 0 { - if seq.kleene.op == mbe::KleeneOp::OneOrMore { + if seq.kleene.op == KleeneOp::OneOrMore { // FIXME: this really ought to be caught at macro definition // time... It happens when the Kleene operator in the matcher and // the body for the same meta-variable do not match. @@ -227,6 +228,7 @@ pub(super) fn transcribe<'a>( idx: 0, sep: seq.separator.clone(), tts: &delimited.tts, + kleene_op: seq.kleene.op, }); } } @@ -243,7 +245,7 @@ pub(super) fn transcribe<'a>( MatchedTokenTree(tt) => { // `tt`s are emitted into the output stream directly as "raw tokens", // without wrapping them into groups. - result.push(tt.clone()); + result.push(maybe_use_metavar_location(cx, &stack, sp, tt)); } MatchedNonterminal(nt) => { // Other variables are emitted into the output stream as groups with @@ -308,6 +310,62 @@ pub(super) fn transcribe<'a>( } } +/// Usually metavariables `$var` produce interpolated tokens, which have an additional place for +/// keeping both the original span and the metavariable span. For `tt` metavariables that's not the +/// case however, and there's no place for keeping a second span. So we try to give the single +/// produced span a location that would be most useful in practice (the hygiene part of the span +/// must not be changed). +/// +/// Different locations are useful for different purposes: +/// - The original location is useful when we need to report a diagnostic for the original token in +/// isolation, without combining it with any surrounding tokens. This case occurs, but it is not +/// very common in practice. +/// - The metavariable location is useful when we need to somehow combine the token span with spans +/// of its surrounding tokens. This is the most common way to use token spans. +/// +/// So this function replaces the original location with the metavariable location in all cases +/// except these two: +/// - The metavariable is an element of undelimited sequence `$($tt)*`. +/// These are typically used for passing larger amounts of code, and tokens in that code usually +/// combine with each other and not with tokens outside of the sequence. +/// - The metavariable span comes from a different crate, then we prefer the more local span. +/// +/// FIXME: Find a way to keep both original and metavariable spans for all tokens without +/// regressing compilation time too much. Several experiments for adding such spans were made in +/// the past (PR #95580, #118517, #118671) and all showed some regressions. +fn maybe_use_metavar_location( + cx: &ExtCtxt<'_>, + stack: &[Frame<'_>], + metavar_span: Span, + orig_tt: &TokenTree, +) -> TokenTree { + let undelimited_seq = matches!( + stack.last(), + Some(Frame::Sequence { + tts: [_], + sep: None, + kleene_op: KleeneOp::ZeroOrMore | KleeneOp::OneOrMore, + .. + }) + ); + if undelimited_seq || cx.source_map().is_imported(metavar_span) { + return orig_tt.clone(); + } + + match orig_tt { + TokenTree::Token(Token { kind, span }, spacing) => { + let span = metavar_span.with_ctxt(span.ctxt()); + TokenTree::Token(Token { kind: kind.clone(), span }, *spacing) + } + TokenTree::Delimited(dspan, dspacing, delimiter, tts) => { + let open = metavar_span.shrink_to_lo().with_ctxt(dspan.open.ctxt()); + let close = metavar_span.shrink_to_hi().with_ctxt(dspan.close.ctxt()); + let dspan = DelimSpan::from_pair(open, close); + TokenTree::Delimited(dspan, *dspacing, *delimiter, tts.clone()) + } + } +} + /// Lookup the meta-var named `ident` and return the matched token tree from the invocation using /// the set of matches `interpolations`. /// diff --git a/compiler/rustc_expand/src/proc_macro_server.rs b/compiler/rustc_expand/src/proc_macro_server.rs index 5eb6aed7253..66695e020f1 100644 --- a/compiler/rustc_expand/src/proc_macro_server.rs +++ b/compiler/rustc_expand/src/proc_macro_server.rs @@ -379,7 +379,7 @@ impl ToInternal<SmallVec<[tokenstream::TokenTree; 2]>> impl ToInternal<rustc_errors::Level> for Level { fn to_internal(self) -> rustc_errors::Level { match self { - Level::Error => rustc_errors::Level::Error { lint: false }, + Level::Error => rustc_errors::Level::Error, Level::Warning => rustc_errors::Level::Warning(None), Level::Note => rustc_errors::Level::Note, Level::Help => rustc_errors::Level::Help, @@ -497,7 +497,7 @@ impl server::FreeFunctions for Rustc<'_, '_> { fn emit_diagnostic(&mut self, diagnostic: Diagnostic<Self::Span>) { let mut diag = rustc_errors::Diagnostic::new(diagnostic.level.to_internal(), diagnostic.message); - diag.set_span(MultiSpan::from_spans(diagnostic.spans)); + diag.span(MultiSpan::from_spans(diagnostic.spans)); for child in diagnostic.children { diag.sub(child.level.to_internal(), child.message, MultiSpan::from_spans(child.spans)); } diff --git a/compiler/rustc_expand/src/tests.rs b/compiler/rustc_expand/src/tests.rs index 0b859841828..3c14ad5e7b8 100644 --- a/compiler/rustc_expand/src/tests.rs +++ b/compiler/rustc_expand/src/tests.rs @@ -7,7 +7,7 @@ use rustc_span::source_map::{FilePathMapping, SourceMap}; use rustc_span::{BytePos, Span}; use rustc_data_structures::sync::Lrc; -use rustc_errors::emitter::EmitterWriter; +use rustc_errors::emitter::HumanEmitter; use rustc_errors::{DiagCtxt, MultiSpan, PResult}; use termcolor::WriteColor; @@ -30,7 +30,7 @@ fn create_test_handler() -> (DiagCtxt, Lrc<SourceMap>, Arc<Mutex<Vec<u8>>>) { vec![crate::DEFAULT_LOCALE_RESOURCE, rustc_parse::DEFAULT_LOCALE_RESOURCE], false, ); - let emitter = EmitterWriter::new(Box::new(Shared { data: output.clone() }), fallback_bundle) + let emitter = HumanEmitter::new(Box::new(Shared { data: output.clone() }), fallback_bundle) .sm(Some(source_map.clone())) .diagnostic_width(Some(140)); let dcx = DiagCtxt::with_emitter(Box::new(emitter)); diff --git a/compiler/rustc_feature/src/unstable.rs b/compiler/rustc_feature/src/unstable.rs index e6faad74384..59ea828440f 100644 --- a/compiler/rustc_feature/src/unstable.rs +++ b/compiler/rustc_feature/src/unstable.rs @@ -210,7 +210,7 @@ declare_features! ( /// Allows the `multiple_supertrait_upcastable` lint. (unstable, multiple_supertrait_upcastable, "1.69.0", None), /// Allow negative trait bounds. This is an internal-only feature for testing the trait solver! - (incomplete, negative_bounds, "1.71.0", None), + (internal, negative_bounds, "1.71.0", None), /// Allows using `#[omit_gdb_pretty_printer_section]`. (internal, omit_gdb_pretty_printer_section, "1.5.0", None), /// Allows using `#[prelude_import]` on glob `use` items. diff --git a/compiler/rustc_hir/src/hir.rs b/compiler/rustc_hir/src/hir.rs index 2c34fc13919..e88b876534e 100644 --- a/compiler/rustc_hir/src/hir.rs +++ b/compiler/rustc_hir/src/hir.rs @@ -1258,7 +1258,7 @@ pub struct Arm<'hir> { /// If this pattern and the optional guard matches, then `body` is evaluated. pub pat: &'hir Pat<'hir>, /// Optional guard clause. - pub guard: Option<Guard<'hir>>, + pub guard: Option<&'hir Expr<'hir>>, /// The expression the arm evaluates to if this arm matches. pub body: &'hir Expr<'hir>, } @@ -1281,26 +1281,6 @@ pub struct Let<'hir> { } #[derive(Debug, Clone, Copy, HashStable_Generic)] -pub enum Guard<'hir> { - If(&'hir Expr<'hir>), - IfLet(&'hir Let<'hir>), -} - -impl<'hir> Guard<'hir> { - /// Returns the body of the guard - /// - /// In other words, returns the e in either of the following: - /// - /// - `if e` - /// - `if let x = e` - pub fn body(&self) -> &'hir Expr<'hir> { - match self { - Guard::If(e) | Guard::IfLet(Let { init: e, .. }) => e, - } - } -} - -#[derive(Debug, Clone, Copy, HashStable_Generic)] pub struct ExprField<'hir> { #[stable_hasher(ignore)] pub hir_id: HirId, diff --git a/compiler/rustc_hir/src/intravisit.rs b/compiler/rustc_hir/src/intravisit.rs index e58e4c8fe0e..dd3633b6b4f 100644 --- a/compiler/rustc_hir/src/intravisit.rs +++ b/compiler/rustc_hir/src/intravisit.rs @@ -619,13 +619,8 @@ pub fn walk_stmt<'v, V: Visitor<'v>>(visitor: &mut V, statement: &'v Stmt<'v>) { pub fn walk_arm<'v, V: Visitor<'v>>(visitor: &mut V, arm: &'v Arm<'v>) { visitor.visit_id(arm.hir_id); visitor.visit_pat(arm.pat); - if let Some(ref g) = arm.guard { - match g { - Guard::If(ref e) => visitor.visit_expr(e), - Guard::IfLet(ref l) => { - visitor.visit_let_expr(l); - } - } + if let Some(ref e) = arm.guard { + visitor.visit_expr(e); } visitor.visit_expr(arm.body); } diff --git a/compiler/rustc_hir_analysis/src/astconv/bounds.rs b/compiler/rustc_hir_analysis/src/astconv/bounds.rs index 91b3807d744..d403f1a850d 100644 --- a/compiler/rustc_hir_analysis/src/astconv/bounds.rs +++ b/compiler/rustc_hir_analysis/src/astconv/bounds.rs @@ -26,23 +26,36 @@ impl<'tcx> dyn AstConv<'tcx> + '_ { span: Span, ) { let tcx = self.tcx(); + let sized_def_id = tcx.lang_items().sized_trait(); + let mut seen_negative_sized_bound = false; // Try to find an unbound in bounds. let mut unbounds: SmallVec<[_; 1]> = SmallVec::new(); let mut search_bounds = |ast_bounds: &'tcx [hir::GenericBound<'tcx>]| { for ab in ast_bounds { - if let hir::GenericBound::Trait(ptr, hir::TraitBoundModifier::Maybe) = ab { - unbounds.push(ptr) + let hir::GenericBound::Trait(ptr, modifier) = ab else { + continue; + }; + match modifier { + hir::TraitBoundModifier::Maybe => unbounds.push(ptr), + hir::TraitBoundModifier::Negative => { + if let Some(sized_def_id) = sized_def_id + && ptr.trait_ref.path.res == Res::Def(DefKind::Trait, sized_def_id) + { + seen_negative_sized_bound = true; + } + } + _ => {} } } }; search_bounds(ast_bounds); if let Some((self_ty, where_clause)) = self_ty_where_predicates { for clause in where_clause { - if let hir::WherePredicate::BoundPredicate(pred) = clause { - if pred.is_param_bound(self_ty.to_def_id()) { - search_bounds(pred.bounds); - } + if let hir::WherePredicate::BoundPredicate(pred) = clause + && pred.is_param_bound(self_ty.to_def_id()) + { + search_bounds(pred.bounds); } } } @@ -53,15 +66,13 @@ impl<'tcx> dyn AstConv<'tcx> + '_ { }); } - let sized_def_id = tcx.lang_items().sized_trait(); - let mut seen_sized_unbound = false; for unbound in unbounds { - if let Some(sized_def_id) = sized_def_id { - if unbound.trait_ref.path.res == Res::Def(DefKind::Trait, sized_def_id) { - seen_sized_unbound = true; - continue; - } + if let Some(sized_def_id) = sized_def_id + && unbound.trait_ref.path.res == Res::Def(DefKind::Trait, sized_def_id) + { + seen_sized_unbound = true; + continue; } // There was a `?Trait` bound, but it was not `?Sized`; warn. tcx.dcx().span_warn( @@ -71,15 +82,12 @@ impl<'tcx> dyn AstConv<'tcx> + '_ { ); } - // If the above loop finished there was no `?Sized` bound; add implicitly sized if `Sized` is available. - if sized_def_id.is_none() { - // No lang item for `Sized`, so we can't add it as a bound. - return; - } - if seen_sized_unbound { - // There was in fact a `?Sized` bound, return without doing anything - } else { - // There was no `?Sized` bound; add implicitly sized if `Sized` is available. + if seen_sized_unbound || seen_negative_sized_bound { + // There was in fact a `?Sized` or `!Sized` bound; + // we don't need to do anything. + } else if sized_def_id.is_some() { + // There was no `?Sized` or `!Sized` bound; + // add `Sized` if it's available. bounds.push_sized(tcx, self_ty, span); } } diff --git a/compiler/rustc_hir_analysis/src/astconv/errors.rs b/compiler/rustc_hir_analysis/src/astconv/errors.rs index f17f19bb77c..d22c4fe201d 100644 --- a/compiler/rustc_hir_analysis/src/astconv/errors.rs +++ b/compiler/rustc_hir_analysis/src/astconv/errors.rs @@ -605,7 +605,7 @@ impl<'o, 'tcx> dyn AstConv<'tcx> + 'o { let violations = object_safety_violations_for_assoc_item(tcx, trait_def_id, *assoc_item); if !violations.is_empty() { - report_object_safety_error(tcx, *span, trait_def_id, &violations).emit(); + report_object_safety_error(tcx, *span, None, trait_def_id, &violations).emit(); object_safety_violations = true; } } diff --git a/compiler/rustc_hir_analysis/src/astconv/generics.rs b/compiler/rustc_hir_analysis/src/astconv/generics.rs index 7d840ba7e81..3f0ad6584b6 100644 --- a/compiler/rustc_hir_analysis/src/astconv/generics.rs +++ b/compiler/rustc_hir_analysis/src/astconv/generics.rs @@ -70,7 +70,7 @@ fn generic_arg_mismatch_err( Res::Err => { add_braces_suggestion(arg, &mut err); return err - .set_primary_message("unresolved item provided when a constant was expected") + .primary_message("unresolved item provided when a constant was expected") .emit(); } Res::Def(DefKind::TyParam, src_def_id) => { diff --git a/compiler/rustc_hir_analysis/src/astconv/lint.rs b/compiler/rustc_hir_analysis/src/astconv/lint.rs index f3b93c91ae9..6675f517cfa 100644 --- a/compiler/rustc_hir_analysis/src/astconv/lint.rs +++ b/compiler/rustc_hir_analysis/src/astconv/lint.rs @@ -1,7 +1,9 @@ use rustc_ast::TraitObjectSyntax; use rustc_errors::{Diagnostic, StashKey}; use rustc_hir as hir; +use rustc_hir::def::{DefKind, Res}; use rustc_lint_defs::{builtin::BARE_TRAIT_OBJECTS, Applicability}; +use rustc_span::Span; use rustc_trait_selection::traits::error_reporting::suggestions::NextTypeParamName; use super::AstConv; @@ -32,32 +34,146 @@ impl<'o, 'tcx> dyn AstConv<'tcx> + 'o { } let of_trait_span = of_trait_ref.path.span; // make sure that we are not calling unwrap to abort during the compilation - let Ok(impl_trait_name) = tcx.sess.source_map().span_to_snippet(self_ty.span) else { - return; - }; let Ok(of_trait_name) = tcx.sess.source_map().span_to_snippet(of_trait_span) else { return; }; - // check if the trait has generics, to make a correct suggestion - let param_name = generics.params.next_type_param_name(None); - let add_generic_sugg = if let Some(span) = generics.span_for_param_suggestion() { - (span, format!(", {param_name}: {impl_trait_name}")) - } else { - (generics.span, format!("<{param_name}: {impl_trait_name}>")) + let Ok(impl_trait_name) = self.tcx().sess.source_map().span_to_snippet(self_ty.span) + else { + return; + }; + let sugg = self.add_generic_param_suggestion(generics, self_ty.span, &impl_trait_name); + if sugg.is_empty() { + return; }; diag.multipart_suggestion( format!( - "alternatively use a blanket \ - implementation to implement `{of_trait_name}` for \ + "alternatively use a blanket implementation to implement `{of_trait_name}` for \ all types that also implement `{impl_trait_name}`" ), - vec![(self_ty.span, param_name), add_generic_sugg], + sugg, Applicability::MaybeIncorrect, ); } } + fn add_generic_param_suggestion( + &self, + generics: &hir::Generics<'_>, + self_ty_span: Span, + impl_trait_name: &str, + ) -> Vec<(Span, String)> { + // check if the trait has generics, to make a correct suggestion + let param_name = generics.params.next_type_param_name(None); + + let add_generic_sugg = if let Some(span) = generics.span_for_param_suggestion() { + (span, format!(", {param_name}: {impl_trait_name}")) + } else { + (generics.span, format!("<{param_name}: {impl_trait_name}>")) + }; + vec![(self_ty_span, param_name), add_generic_sugg] + } + + /// Make sure that we are in the condition to suggest `impl Trait`. + fn maybe_lint_impl_trait(&self, self_ty: &hir::Ty<'_>, diag: &mut Diagnostic) -> bool { + let tcx = self.tcx(); + let parent_id = tcx.hir().get_parent_item(self_ty.hir_id).def_id; + let (hir::Node::Item(hir::Item { kind: hir::ItemKind::Fn(sig, generics, _), .. }) + | hir::Node::TraitItem(hir::TraitItem { + kind: hir::TraitItemKind::Fn(sig, _), + generics, + .. + })) = tcx.hir_node_by_def_id(parent_id) + else { + return false; + }; + let Ok(trait_name) = tcx.sess.source_map().span_to_snippet(self_ty.span) else { + return false; + }; + let impl_sugg = vec![(self_ty.span.shrink_to_lo(), "impl ".to_string())]; + let is_object_safe = match self_ty.kind { + hir::TyKind::TraitObject(objects, ..) => { + objects.iter().all(|o| match o.trait_ref.path.res { + Res::Def(DefKind::Trait, id) => tcx.check_is_object_safe(id), + _ => false, + }) + } + _ => false, + }; + if let hir::FnRetTy::Return(ty) = sig.decl.output + && ty.hir_id == self_ty.hir_id + { + let pre = if !is_object_safe { + format!("`{trait_name}` is not object safe, ") + } else { + String::new() + }; + let msg = format!( + "{pre}use `impl {trait_name}` to return an opaque type, as long as you return a \ + single underlying type", + ); + diag.multipart_suggestion_verbose(msg, impl_sugg, Applicability::MachineApplicable); + if is_object_safe { + diag.multipart_suggestion_verbose( + "alternatively, you can return an owned trait object", + vec![ + (ty.span.shrink_to_lo(), "Box<dyn ".to_string()), + (ty.span.shrink_to_hi(), ">".to_string()), + ], + Applicability::MachineApplicable, + ); + } else { + // We'll emit the object safety error already, with a structured suggestion. + diag.downgrade_to_delayed_bug(); + } + return true; + } + for ty in sig.decl.inputs { + if ty.hir_id != self_ty.hir_id { + continue; + } + let sugg = self.add_generic_param_suggestion(generics, self_ty.span, &trait_name); + if !sugg.is_empty() { + diag.multipart_suggestion_verbose( + format!("use a new generic type parameter, constrained by `{trait_name}`"), + sugg, + Applicability::MachineApplicable, + ); + diag.multipart_suggestion_verbose( + "you can also use an opaque type, but users won't be able to specify the type \ + parameter when calling the `fn`, having to rely exclusively on type inference", + impl_sugg, + Applicability::MachineApplicable, + ); + } + if !is_object_safe { + diag.note(format!("`{trait_name}` it is not object safe, so it can't be `dyn`")); + // We'll emit the object safety error already, with a structured suggestion. + diag.downgrade_to_delayed_bug(); + } else { + let sugg = if let hir::TyKind::TraitObject([_, _, ..], _, _) = self_ty.kind { + // There are more than one trait bound, we need surrounding parentheses. + vec![ + (self_ty.span.shrink_to_lo(), "&(dyn ".to_string()), + (self_ty.span.shrink_to_hi(), ")".to_string()), + ] + } else { + vec![(self_ty.span.shrink_to_lo(), "&dyn ".to_string())] + }; + diag.multipart_suggestion_verbose( + format!( + "alternatively, use a trait object to accept any type that implements \ + `{trait_name}`, accessing its methods at runtime using dynamic dispatch", + ), + sugg, + Applicability::MachineApplicable, + ); + } + return true; + } + false + } + pub(super) fn maybe_lint_bare_trait(&self, self_ty: &hir::Ty<'_>, in_path: bool) { let tcx = self.tcx(); if let hir::TyKind::TraitObject([poly_trait_ref, ..], _, TraitObjectSyntax::None) = @@ -98,7 +214,9 @@ impl<'o, 'tcx> dyn AstConv<'tcx> + 'o { let label = "add `dyn` keyword before this trait"; let mut diag = rustc_errors::struct_span_err!(tcx.dcx(), self_ty.span, E0782, "{}", msg); - if self_ty.span.can_be_used_for_suggestions() { + if self_ty.span.can_be_used_for_suggestions() + && !self.maybe_lint_impl_trait(self_ty, &mut diag) + { diag.multipart_suggestion_verbose( label, sugg, @@ -116,11 +234,15 @@ impl<'o, 'tcx> dyn AstConv<'tcx> + 'o { self_ty.span, msg, |lint| { - lint.multipart_suggestion_verbose( - "use `dyn`", - sugg, - Applicability::MachineApplicable, - ); + if self_ty.span.can_be_used_for_suggestions() + && !self.maybe_lint_impl_trait(self_ty, lint) + { + lint.multipart_suggestion_verbose( + "use `dyn`", + sugg, + Applicability::MachineApplicable, + ); + } self.maybe_lint_blanket_trait_impl(self_ty, lint); }, ); diff --git a/compiler/rustc_hir_analysis/src/astconv/object_safety.rs b/compiler/rustc_hir_analysis/src/astconv/object_safety.rs index a614d4abf25..8a3df79cb25 100644 --- a/compiler/rustc_hir_analysis/src/astconv/object_safety.rs +++ b/compiler/rustc_hir_analysis/src/astconv/object_safety.rs @@ -140,6 +140,7 @@ impl<'o, 'tcx> dyn AstConv<'tcx> + 'o { let reported = report_object_safety_error( tcx, span, + Some(hir_id), item.trait_ref().def_id(), &object_safety_violations, ) diff --git a/compiler/rustc_hir_analysis/src/check/check.rs b/compiler/rustc_hir_analysis/src/check/check.rs index d2e96ac74df..5ccb7ac3896 100644 --- a/compiler/rustc_hir_analysis/src/check/check.rs +++ b/compiler/rustc_hir_analysis/src/check/check.rs @@ -8,7 +8,7 @@ use rustc_attr as attr; use rustc_errors::{ErrorGuaranteed, MultiSpan}; use rustc_hir as hir; use rustc_hir::def::{CtorKind, DefKind}; -use rustc_hir::def_id::LocalModDefId; +use rustc_hir::def_id::{DefId, LocalDefId}; use rustc_hir::Node; use rustc_infer::infer::{RegionVariableOrigin, TyCtxtInferExt}; use rustc_infer::traits::{Obligation, TraitEngineExt as _}; @@ -198,8 +198,8 @@ fn check_static_inhabited(tcx: TyCtxt<'_>, def_id: LocalDefId) { /// Checks that an opaque type does not contain cycles and does not use `Self` or `T::Foo` /// projections that would result in "inheriting lifetimes". -fn check_opaque(tcx: TyCtxt<'_>, id: hir::ItemId) { - let item = tcx.hir().item(id); +fn check_opaque(tcx: TyCtxt<'_>, def_id: LocalDefId) { + let item = tcx.hir().expect_item(def_id); let hir::ItemKind::OpaqueTy(hir::OpaqueTy { origin, .. }) = item.kind else { tcx.dcx().span_delayed_bug(item.span, "expected opaque item"); return; @@ -440,40 +440,31 @@ fn check_static_linkage(tcx: TyCtxt<'_>, def_id: LocalDefId) { } } -fn check_item_type(tcx: TyCtxt<'_>, id: hir::ItemId) { - debug!( - "check_item_type(it.def_id={:?}, it.name={})", - id.owner_id, - tcx.def_path_str(id.owner_id) - ); +pub(crate) fn check_item_type(tcx: TyCtxt<'_>, def_id: LocalDefId) { let _indenter = indenter(); - match tcx.def_kind(id.owner_id) { + match tcx.def_kind(def_id) { DefKind::Static(..) => { - tcx.ensure().typeck(id.owner_id.def_id); - maybe_check_static_with_link_section(tcx, id.owner_id.def_id); - check_static_inhabited(tcx, id.owner_id.def_id); - check_static_linkage(tcx, id.owner_id.def_id); + tcx.ensure().typeck(def_id); + maybe_check_static_with_link_section(tcx, def_id); + check_static_inhabited(tcx, def_id); + check_static_linkage(tcx, def_id); } DefKind::Const => { - tcx.ensure().typeck(id.owner_id.def_id); + tcx.ensure().typeck(def_id); } DefKind::Enum => { - check_enum(tcx, id.owner_id.def_id); + check_enum(tcx, def_id); } DefKind::Fn => {} // entirely within check_item_body DefKind::Impl { of_trait } => { - if of_trait && let Some(impl_trait_ref) = tcx.impl_trait_ref(id.owner_id) { - check_impl_items_against_trait( - tcx, - id.owner_id.def_id, - impl_trait_ref.instantiate_identity(), - ); - check_on_unimplemented(tcx, id); + if of_trait && let Some(impl_trait_ref) = tcx.impl_trait_ref(def_id) { + check_impl_items_against_trait(tcx, def_id, impl_trait_ref.instantiate_identity()); + check_on_unimplemented(tcx, def_id); } } DefKind::Trait => { - let assoc_items = tcx.associated_items(id.owner_id); - check_on_unimplemented(tcx, id); + let assoc_items = tcx.associated_items(def_id); + check_on_unimplemented(tcx, def_id); for &assoc_item in assoc_items.in_definition_order() { match assoc_item.kind { @@ -482,12 +473,12 @@ fn check_item_type(tcx: TyCtxt<'_>, id: hir::ItemId) { forbid_intrinsic_abi(tcx, assoc_item.ident(tcx).span, abi); } ty::AssocKind::Type if assoc_item.defaultness(tcx).has_value() => { - let trait_args = GenericArgs::identity_for_item(tcx, id.owner_id); + let trait_args = GenericArgs::identity_for_item(tcx, def_id); let _: Result<_, rustc_errors::ErrorGuaranteed> = check_type_bounds( tcx, assoc_item, assoc_item, - ty::TraitRef::new(tcx, id.owner_id.to_def_id(), trait_args), + ty::TraitRef::new(tcx, def_id.to_def_id(), trait_args), ); } _ => {} @@ -495,13 +486,13 @@ fn check_item_type(tcx: TyCtxt<'_>, id: hir::ItemId) { } } DefKind::Struct => { - check_struct(tcx, id.owner_id.def_id); + check_struct(tcx, def_id); } DefKind::Union => { - check_union(tcx, id.owner_id.def_id); + check_union(tcx, def_id); } DefKind::OpaqueTy => { - let origin = tcx.opaque_type_origin(id.owner_id.def_id); + let origin = tcx.opaque_type_origin(def_id); if let hir::OpaqueTyOrigin::FnReturn(fn_def_id) | hir::OpaqueTyOrigin::AsyncFn(fn_def_id) = origin && let hir::Node::TraitItem(trait_item) = tcx.hir_node_by_def_id(fn_def_id) @@ -509,16 +500,16 @@ fn check_item_type(tcx: TyCtxt<'_>, id: hir::ItemId) { { // Skip opaques from RPIT in traits with no default body. } else { - check_opaque(tcx, id); + check_opaque(tcx, def_id); } } DefKind::TyAlias => { - let pty_ty = tcx.type_of(id.owner_id).instantiate_identity(); - let generics = tcx.generics_of(id.owner_id); + let pty_ty = tcx.type_of(def_id).instantiate_identity(); + let generics = tcx.generics_of(def_id); check_type_params_are_used(tcx, generics, pty_ty); } DefKind::ForeignMod => { - let it = tcx.hir().item(id); + let it = tcx.hir().expect_item(def_id); let hir::ItemKind::ForeignMod { abi, items } = it.kind else { return; }; @@ -589,19 +580,19 @@ fn check_item_type(tcx: TyCtxt<'_>, id: hir::ItemId) { } } DefKind::GlobalAsm => { - let it = tcx.hir().item(id); + let it = tcx.hir().expect_item(def_id); let hir::ItemKind::GlobalAsm(asm) = it.kind else { span_bug!(it.span, "DefKind::GlobalAsm but got {:#?}", it) }; - InlineAsmCtxt::new_global_asm(tcx).check_asm(asm, id.owner_id.def_id); + InlineAsmCtxt::new_global_asm(tcx).check_asm(asm, def_id); } _ => {} } } -pub(super) fn check_on_unimplemented(tcx: TyCtxt<'_>, item: hir::ItemId) { +pub(super) fn check_on_unimplemented(tcx: TyCtxt<'_>, def_id: LocalDefId) { // an error would be reported if this fails. - let _ = OnUnimplementedDirective::of_item(tcx, item.owner_id.to_def_id()); + let _ = OnUnimplementedDirective::of_item(tcx, def_id.to_def_id()); } pub(super) fn check_specialization_validity<'tcx>( @@ -1309,16 +1300,6 @@ pub(super) fn check_type_params_are_used<'tcx>( } } -pub(super) fn check_mod_item_types(tcx: TyCtxt<'_>, module_def_id: LocalModDefId) { - let module = tcx.hir_module_items(module_def_id); - for id in module.items() { - check_item_type(tcx, id); - } - if module_def_id == LocalModDefId::CRATE_DEF_ID { - super::entry::check_for_entry_fn(tcx); - } -} - fn async_opaque_type_cycle_error(tcx: TyCtxt<'_>, span: Span) -> ErrorGuaranteed { struct_span_err!(tcx.dcx(), span, E0733, "recursion in an `async fn` requires boxing") .span_label(span, "recursive `async fn`") diff --git a/compiler/rustc_hir_analysis/src/check/mod.rs b/compiler/rustc_hir_analysis/src/check/mod.rs index faec72cfeb6..f60d6950670 100644 --- a/compiler/rustc_hir_analysis/src/check/mod.rs +++ b/compiler/rustc_hir_analysis/src/check/mod.rs @@ -75,7 +75,6 @@ pub use check::check_abi; use std::num::NonZeroU32; -use check::check_mod_item_types; use rustc_data_structures::fx::{FxHashMap, FxHashSet}; use rustc_errors::ErrorGuaranteed; use rustc_errors::{pluralize, struct_span_err, Diagnostic, DiagnosticBuilder}; @@ -110,7 +109,6 @@ pub fn provide(providers: &mut Providers) { wfcheck::provide(providers); *providers = Providers { adt_destructor, - check_mod_item_types, region_scope_tree, collect_return_position_impl_trait_in_trait_tys, compare_impl_const: compare_impl_item::compare_impl_const_raw, diff --git a/compiler/rustc_hir_analysis/src/check/region.rs b/compiler/rustc_hir_analysis/src/check/region.rs index eab83c7a254..542e69a6c34 100644 --- a/compiler/rustc_hir_analysis/src/check/region.rs +++ b/compiler/rustc_hir_analysis/src/check/region.rs @@ -177,6 +177,14 @@ fn resolve_block<'tcx>(visitor: &mut RegionResolutionVisitor<'tcx>, blk: &'tcx h } fn resolve_arm<'tcx>(visitor: &mut RegionResolutionVisitor<'tcx>, arm: &'tcx hir::Arm<'tcx>) { + fn has_let_expr(expr: &Expr<'_>) -> bool { + match &expr.kind { + hir::ExprKind::Binary(_, lhs, rhs) => has_let_expr(lhs) || has_let_expr(rhs), + hir::ExprKind::Let(..) => true, + _ => false, + } + } + let prev_cx = visitor.cx; visitor.terminating_scopes.insert(arm.hir_id.local_id); @@ -184,7 +192,9 @@ fn resolve_arm<'tcx>(visitor: &mut RegionResolutionVisitor<'tcx>, arm: &'tcx hir visitor.enter_node_scope_with_dtor(arm.hir_id.local_id); visitor.cx.var_parent = visitor.cx.parent; - if let Some(hir::Guard::If(expr)) = arm.guard { + if let Some(expr) = arm.guard + && !has_let_expr(expr) + { visitor.terminating_scopes.insert(expr.hir_id.local_id); } diff --git a/compiler/rustc_hir_analysis/src/check/wfcheck.rs b/compiler/rustc_hir_analysis/src/check/wfcheck.rs index 580d4bd5b02..5f26da9c87f 100644 --- a/compiler/rustc_hir_analysis/src/check/wfcheck.rs +++ b/compiler/rustc_hir_analysis/src/check/wfcheck.rs @@ -172,7 +172,7 @@ fn check_item<'tcx>(tcx: TyCtxt<'tcx>, item: &'tcx hir::Item<'tcx>) -> Result<() item.name = ? tcx.def_path_str(def_id) ); - match item.kind { + let res = match item.kind { // Right now we check that every default trait implementation // has an implementation of itself. Basically, a case like: // @@ -271,7 +271,11 @@ fn check_item<'tcx>(tcx: TyCtxt<'tcx>, item: &'tcx hir::Item<'tcx>) -> Result<() } } _ => Ok(()), - } + }; + + crate::check::check::check_item_type(tcx, def_id); + + res } fn check_foreign_item(tcx: TyCtxt<'_>, item: &hir::ForeignItem<'_>) -> Result<(), ErrorGuaranteed> { @@ -1909,7 +1913,11 @@ fn check_mod_type_wf(tcx: TyCtxt<'_>, module: LocalModDefId) -> Result<(), Error let mut res = items.par_items(|item| tcx.ensure().check_well_formed(item.owner_id)); res = res.and(items.par_impl_items(|item| tcx.ensure().check_well_formed(item.owner_id))); res = res.and(items.par_trait_items(|item| tcx.ensure().check_well_formed(item.owner_id))); - res.and(items.par_foreign_items(|item| tcx.ensure().check_well_formed(item.owner_id))) + res = res.and(items.par_foreign_items(|item| tcx.ensure().check_well_formed(item.owner_id))); + if module == LocalModDefId::CRATE_DEF_ID { + super::entry::check_for_entry_fn(tcx); + } + res } fn error_392(tcx: TyCtxt<'_>, span: Span, param_name: Symbol) -> DiagnosticBuilder<'_> { diff --git a/compiler/rustc_hir_analysis/src/errors.rs b/compiler/rustc_hir_analysis/src/errors.rs index 75e7a5524a7..9124d502110 100644 --- a/compiler/rustc_hir_analysis/src/errors.rs +++ b/compiler/rustc_hir_analysis/src/errors.rs @@ -319,10 +319,10 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for MissingTypeParams { #[track_caller] fn into_diagnostic(self, dcx: &'a DiagCtxt, level: Level) -> DiagnosticBuilder<'a, G> { let mut err = DiagnosticBuilder::new(dcx, level, fluent::hir_analysis_missing_type_params); - err.set_span(self.span); + err.span(self.span); err.code(error_code!(E0393)); - err.set_arg("parameterCount", self.missing_type_params.len()); - err.set_arg( + err.arg("parameterCount", self.missing_type_params.len()); + err.arg( "parameters", self.missing_type_params .iter() diff --git a/compiler/rustc_hir_analysis/src/lib.rs b/compiler/rustc_hir_analysis/src/lib.rs index 81d8982eb15..b9e7500c894 100644 --- a/compiler/rustc_hir_analysis/src/lib.rs +++ b/compiler/rustc_hir_analysis/src/lib.rs @@ -200,18 +200,9 @@ pub fn check_crate(tcx: TyCtxt<'_>) -> Result<(), ErrorGuaranteed> { })?; } - let errs = tcx.sess.time("wf_checking", || { + tcx.sess.time("wf_checking", || { tcx.hir().try_par_for_each_module(|module| tcx.ensure().check_mod_type_wf(module)) - }); - - // NOTE: This is copy/pasted in librustdoc/core.rs and should be kept in sync. - tcx.sess.time("item_types_checking", || { - tcx.hir().for_each_module(|module| tcx.ensure().check_mod_item_types(module)) - }); - - // HACK: `check_mod_type_wf` may spuriously emit errors due to `span_delayed_bug`, even if - // those errors only actually get emitted in `check_mod_item_types`. - errs?; + })?; if tcx.features().rustc_attrs { tcx.sess.track_errors(|| collect::test_opaque_hidden_types(tcx))?; diff --git a/compiler/rustc_hir_analysis/src/outlives/implicit_infer.rs b/compiler/rustc_hir_analysis/src/outlives/implicit_infer.rs index c17925471d9..0cb38094cec 100644 --- a/compiler/rustc_hir_analysis/src/outlives/implicit_infer.rs +++ b/compiler/rustc_hir_analysis/src/outlives/implicit_infer.rs @@ -59,6 +59,17 @@ pub(super) fn infer_predicates( } } + DefKind::TyAlias if tcx.type_alias_is_lazy(item_did) => { + insert_required_predicates_to_be_wf( + tcx, + tcx.type_of(item_did).instantiate_identity(), + tcx.def_span(item_did), + &global_inferred_outlives, + &mut item_required_predicates, + &mut explicit_map, + ); + } + _ => {} }; @@ -88,14 +99,14 @@ pub(super) fn infer_predicates( fn insert_required_predicates_to_be_wf<'tcx>( tcx: TyCtxt<'tcx>, - field_ty: Ty<'tcx>, - field_span: Span, + ty: Ty<'tcx>, + span: Span, global_inferred_outlives: &FxHashMap<DefId, ty::EarlyBinder<RequiredPredicates<'tcx>>>, required_predicates: &mut RequiredPredicates<'tcx>, explicit_map: &mut ExplicitPredicatesMap<'tcx>, ) { - for arg in field_ty.walk() { - let ty = match arg.unpack() { + for arg in ty.walk() { + let leaf_ty = match arg.unpack() { GenericArgKind::Type(ty) => ty, // No predicates from lifetimes or constants, except potentially @@ -103,63 +114,26 @@ fn insert_required_predicates_to_be_wf<'tcx>( GenericArgKind::Lifetime(_) | GenericArgKind::Const(_) => continue, }; - match *ty.kind() { - // The field is of type &'a T which means that we will have - // a predicate requirement of T: 'a (T outlives 'a). - // - // We also want to calculate potential predicates for the T + match *leaf_ty.kind() { ty::Ref(region, rty, _) => { + // The type is `&'a T` which means that we will have + // a predicate requirement of `T: 'a` (`T` outlives `'a`). + // + // We also want to calculate potential predicates for the `T`. debug!("Ref"); - insert_outlives_predicate(tcx, rty.into(), region, field_span, required_predicates); + insert_outlives_predicate(tcx, rty.into(), region, span, required_predicates); } - // For each Adt (struct/enum/union) type `Foo<'a, T>`, we - // can load the current set of inferred and explicit - // predicates from `global_inferred_outlives` and filter the - // ones that are TypeOutlives. ty::Adt(def, args) => { - // First check the inferred predicates - // - // Example 1: - // - // struct Foo<'a, T> { - // field1: Bar<'a, T> - // } - // - // struct Bar<'b, U> { - // field2: &'b U - // } - // - // Here, when processing the type of `field1`, we would - // request the set of implicit predicates computed for `Bar` - // thus far. This will initially come back empty, but in next - // round we will get `U: 'b`. We then apply the substitution - // `['b => 'a, U => T]` and thus get the requirement that `T: - // 'a` holds for `Foo`. + // For ADTs (structs/enums/unions), we check inferred and explicit predicates. debug!("Adt"); - if let Some(unsubstituted_predicates) = global_inferred_outlives.get(&def.did()) { - for (unsubstituted_predicate, &span) in - unsubstituted_predicates.as_ref().skip_binder() - { - // `unsubstituted_predicate` is `U: 'b` in the - // example above. So apply the substitution to - // get `T: 'a` (or `predicate`): - let predicate = unsubstituted_predicates - .rebind(*unsubstituted_predicate) - .instantiate(tcx, args); - insert_outlives_predicate( - tcx, - predicate.0, - predicate.1, - span, - required_predicates, - ); - } - } - - // Check if the type has any explicit predicates that need - // to be added to `required_predicates` - // let _: () = args.region_at(0); + check_inferred_predicates( + tcx, + def.did(), + args, + global_inferred_outlives, + required_predicates, + ); check_explicit_predicates( tcx, def.did(), @@ -170,13 +144,31 @@ fn insert_required_predicates_to_be_wf<'tcx>( ); } + ty::Alias(ty::Weak, alias) => { + // This corresponds to a type like `Type<'a, T>`. + // We check inferred and explicit predicates. + debug!("Weak"); + check_inferred_predicates( + tcx, + alias.def_id, + alias.args, + global_inferred_outlives, + required_predicates, + ); + check_explicit_predicates( + tcx, + alias.def_id, + alias.args, + required_predicates, + explicit_map, + None, + ); + } + ty::Dynamic(obj, ..) => { // This corresponds to `dyn Trait<..>`. In this case, we should // use the explicit predicates as well. - debug!("Dynamic"); - debug!("field_ty = {}", &field_ty); - debug!("ty in field = {}", &ty); if let Some(ex_trait_ref) = obj.principal() { // Here, we are passing the type `usize` as a // placeholder value with the function @@ -198,21 +190,22 @@ fn insert_required_predicates_to_be_wf<'tcx>( } } - ty::Alias(ty::Projection, obj) => { - // This corresponds to `<T as Foo<'a>>::Bar`. In this case, we should use the - // explicit predicates as well. + ty::Alias(ty::Projection, alias) => { + // This corresponds to a type like `<() as Trait<'a, T>>::Type`. + // We only use the explicit predicates of the trait but + // not the ones of the associated type itself. debug!("Projection"); check_explicit_predicates( tcx, - tcx.parent(obj.def_id), - obj.args, + tcx.parent(alias.def_id), + alias.args, required_predicates, explicit_map, None, ); } - // FIXME(inherent_associated_types): Handle this case properly. + // FIXME(inherent_associated_types): Use the explicit predicates from the parent impl. ty::Alias(ty::Inherent, _) => {} _ => {} @@ -220,19 +213,21 @@ fn insert_required_predicates_to_be_wf<'tcx>( } } -/// We also have to check the explicit predicates -/// declared on the type. +/// Check the explicit predicates declared on the type. +/// +/// ### Example +/// /// ```ignore (illustrative) -/// struct Foo<'a, T> { -/// field1: Bar<T> +/// struct Outer<'a, T> { +/// field: Inner<T>, /// } /// -/// struct Bar<U> where U: 'static, U: Foo { -/// ... +/// struct Inner<U> where U: 'static, U: Outer { +/// // ... /// } /// ``` /// Here, we should fetch the explicit predicates, which -/// will give us `U: 'static` and `U: Foo`. The latter we +/// will give us `U: 'static` and `U: Outer`. The latter we /// can ignore, but we will want to process `U: 'static`, /// applying the substitution as above. fn check_explicit_predicates<'tcx>( @@ -303,3 +298,45 @@ fn check_explicit_predicates<'tcx>( insert_outlives_predicate(tcx, predicate.0, predicate.1, span, required_predicates); } } + +/// Check the inferred predicates declared on the type. +/// +/// ### Example +/// +/// ```ignore (illustrative) +/// struct Outer<'a, T> { +/// outer: Inner<'a, T>, +/// } +/// +/// struct Inner<'b, U> { +/// inner: &'b U, +/// } +/// ``` +/// +/// Here, when processing the type of field `outer`, we would request the +/// set of implicit predicates computed for `Inner` thus far. This will +/// initially come back empty, but in next round we will get `U: 'b`. +/// We then apply the substitution `['b => 'a, U => T]` and thus get the +/// requirement that `T: 'a` holds for `Outer`. +fn check_inferred_predicates<'tcx>( + tcx: TyCtxt<'tcx>, + def_id: DefId, + args: ty::GenericArgsRef<'tcx>, + global_inferred_outlives: &FxHashMap<DefId, ty::EarlyBinder<RequiredPredicates<'tcx>>>, + required_predicates: &mut RequiredPredicates<'tcx>, +) { + // Load the current set of inferred and explicit predicates from `global_inferred_outlives` + // and filter the ones that are `TypeOutlives`. + + let Some(predicates) = global_inferred_outlives.get(&def_id) else { + return; + }; + + for (&predicate, &span) in predicates.as_ref().skip_binder() { + // `predicate` is `U: 'b` in the example above. + // So apply the substitution to get `T: 'a`. + let ty::OutlivesPredicate(arg, region) = + predicates.rebind(predicate).instantiate(tcx, args); + insert_outlives_predicate(tcx, arg, region, span, required_predicates); + } +} diff --git a/compiler/rustc_hir_analysis/src/outlives/mod.rs b/compiler/rustc_hir_analysis/src/outlives/mod.rs index 72511bfa01f..a87112dcc12 100644 --- a/compiler/rustc_hir_analysis/src/outlives/mod.rs +++ b/compiler/rustc_hir_analysis/src/outlives/mod.rs @@ -21,6 +21,10 @@ fn inferred_outlives_of(tcx: TyCtxt<'_>, item_def_id: LocalDefId) -> &[(ty::Clau let crate_map = tcx.inferred_outlives_crate(()); crate_map.predicates.get(&item_def_id.to_def_id()).copied().unwrap_or(&[]) } + DefKind::TyAlias if tcx.type_alias_is_lazy(item_def_id) => { + let crate_map = tcx.inferred_outlives_crate(()); + crate_map.predicates.get(&item_def_id.to_def_id()).copied().unwrap_or(&[]) + } DefKind::AnonConst if tcx.features().generic_const_exprs => { let id = tcx.local_def_id_to_hir_id(item_def_id); if tcx.hir().opt_const_param_default_param_def_id(id).is_some() { @@ -47,8 +51,8 @@ fn inferred_outlives_of(tcx: TyCtxt<'_>, item_def_id: LocalDefId) -> &[(ty::Clau } fn inferred_outlives_crate(tcx: TyCtxt<'_>, (): ()) -> CratePredicatesMap<'_> { - // Compute a map from each struct/enum/union S to the **explicit** - // outlives predicates (`T: 'a`, `'a: 'b`) that the user wrote. + // Compute a map from each ADT (struct/enum/union) and lazy type alias to + // the **explicit** outlives predicates (`T: 'a`, `'a: 'b`) that the user wrote. // Typically there won't be many of these, except in older code where // they were mandatory. Nonetheless, we have to ensure that every such // predicate is satisfied, so they form a kind of base set of requirements diff --git a/compiler/rustc_hir_pretty/src/lib.rs b/compiler/rustc_hir_pretty/src/lib.rs index d6eea07cfbc..1eaec997053 100644 --- a/compiler/rustc_hir_pretty/src/lib.rs +++ b/compiler/rustc_hir_pretty/src/lib.rs @@ -1874,17 +1874,9 @@ impl<'a> State<'a> { self.print_pat(arm.pat); self.space(); if let Some(ref g) = arm.guard { - match *g { - hir::Guard::If(e) => { - self.word_space("if"); - self.print_expr(e); - self.space(); - } - hir::Guard::IfLet(&hir::Let { pat, ty, init, .. }) => { - self.word_nbsp("if"); - self.print_let(pat, ty, init); - } - } + self.word_space("if"); + self.print_expr(g); + self.space(); } self.word_space("=>"); diff --git a/compiler/rustc_hir_typeck/src/_match.rs b/compiler/rustc_hir_typeck/src/_match.rs index 181de372840..cf1f232229d 100644 --- a/compiler/rustc_hir_typeck/src/_match.rs +++ b/compiler/rustc_hir_typeck/src/_match.rs @@ -78,16 +78,9 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { let mut other_arms = vec![]; // Used only for diagnostics. let mut prior_arm = None; for arm in arms { - if let Some(g) = &arm.guard { + if let Some(e) = &arm.guard { self.diverges.set(Diverges::Maybe); - match g { - hir::Guard::If(e) => { - self.check_expr_has_type_or_error(e, tcx.types.bool, |_| {}); - } - hir::Guard::IfLet(l) => { - self.check_expr_let(l); - } - }; + self.check_expr_has_type_or_error(e, tcx.types.bool, |_| {}); } self.diverges.set(Diverges::Maybe); diff --git a/compiler/rustc_hir_typeck/src/check.rs b/compiler/rustc_hir_typeck/src/check.rs index 2a408ac255c..c887368b2a2 100644 --- a/compiler/rustc_hir_typeck/src/check.rs +++ b/compiler/rustc_hir_typeck/src/check.rs @@ -28,10 +28,10 @@ use rustc_trait_selection::traits::{ObligationCause, ObligationCauseCode}; pub(super) fn check_fn<'a, 'tcx>( fcx: &mut FnCtxt<'a, 'tcx>, fn_sig: ty::FnSig<'tcx>, + coroutine_types: Option<CoroutineTypes<'tcx>>, decl: &'tcx hir::FnDecl<'tcx>, fn_def_id: LocalDefId, body: &'tcx hir::Body<'tcx>, - closure_kind: Option<hir::ClosureKind>, params_can_be_unsized: bool, ) -> Option<CoroutineTypes<'tcx>> { let fn_id = fcx.tcx.local_def_id_to_hir_id(fn_def_id); @@ -49,54 +49,13 @@ pub(super) fn check_fn<'a, 'tcx>( fcx.param_env, )); + fcx.coroutine_types = coroutine_types; fcx.ret_coercion = Some(RefCell::new(CoerceMany::new(ret_ty))); let span = body.value.span; forbid_intrinsic_abi(tcx, span, fn_sig.abi); - if let Some(hir::ClosureKind::Coroutine(kind)) = closure_kind { - let yield_ty = match kind { - hir::CoroutineKind::Desugared(hir::CoroutineDesugaring::Gen, _) - | hir::CoroutineKind::Coroutine(_) => { - let yield_ty = fcx.next_ty_var(TypeVariableOrigin { - kind: TypeVariableOriginKind::TypeInference, - span, - }); - fcx.require_type_is_sized(yield_ty, span, traits::SizedYieldType); - yield_ty - } - // HACK(-Ztrait-solver=next): In the *old* trait solver, we must eagerly - // guide inference on the yield type so that we can handle `AsyncIterator` - // in this block in projection correctly. In the new trait solver, it is - // not a problem. - hir::CoroutineKind::Desugared(hir::CoroutineDesugaring::AsyncGen, _) => { - let yield_ty = fcx.next_ty_var(TypeVariableOrigin { - kind: TypeVariableOriginKind::TypeInference, - span, - }); - fcx.require_type_is_sized(yield_ty, span, traits::SizedYieldType); - - Ty::new_adt( - tcx, - tcx.adt_def(tcx.require_lang_item(hir::LangItem::Poll, Some(span))), - tcx.mk_args(&[Ty::new_adt( - tcx, - tcx.adt_def(tcx.require_lang_item(hir::LangItem::Option, Some(span))), - tcx.mk_args(&[yield_ty.into()]), - ) - .into()]), - ) - } - hir::CoroutineKind::Desugared(hir::CoroutineDesugaring::Async, _) => Ty::new_unit(tcx), - }; - - // Resume type defaults to `()` if the coroutine has no argument. - let resume_ty = fn_sig.inputs().get(0).copied().unwrap_or_else(|| Ty::new_unit(tcx)); - - fcx.resume_yield_tys = Some((resume_ty, yield_ty)); - } - GatherLocalsVisitor::new(fcx).visit_body(body); // C-variadic fns also have a `VaList` input that's not listed in `fn_sig` @@ -114,7 +73,8 @@ pub(super) fn check_fn<'a, 'tcx>( let inputs_fn = fn_sig.inputs().iter().copied(); for (idx, (param_ty, param)) in inputs_fn.chain(maybe_va_list).zip(body.params).enumerate() { // Check the pattern. - let ty_span = try { inputs_hir?.get(idx)?.span }; + let ty: Option<&hir::Ty<'_>> = try { inputs_hir?.get(idx)? }; + let ty_span = ty.map(|ty| ty.span); fcx.check_pat_top(param.pat, param_ty, ty_span, None, None); // Check that argument is Sized. @@ -122,14 +82,14 @@ pub(super) fn check_fn<'a, 'tcx>( fcx.require_type_is_sized( param_ty, param.pat.span, - // ty_span == binding_span iff this is a closure parameter with no type ascription, + // ty.span == binding_span iff this is a closure parameter with no type ascription, // or if it's an implicit `self` parameter traits::SizedArgumentType( if ty_span == Some(param.span) && tcx.is_closure_or_coroutine(fn_def_id.into()) { None } else { - ty_span + ty.map(|ty| ty.hir_id) }, ), ); @@ -147,25 +107,6 @@ pub(super) fn check_fn<'a, 'tcx>( fcx.require_type_is_sized(declared_ret_ty, return_or_body_span, traits::SizedReturnType); fcx.check_return_expr(body.value, false); - // We insert the deferred_coroutine_interiors entry after visiting the body. - // This ensures that all nested coroutines appear before the entry of this coroutine. - // resolve_coroutine_interiors relies on this property. - let coroutine_ty = if let Some(hir::ClosureKind::Coroutine(coroutine_kind)) = closure_kind { - let interior = fcx - .next_ty_var(TypeVariableOrigin { kind: TypeVariableOriginKind::MiscVariable, span }); - fcx.deferred_coroutine_interiors.borrow_mut().push(( - fn_def_id, - body.id(), - interior, - coroutine_kind, - )); - - let (resume_ty, yield_ty) = fcx.resume_yield_tys.unwrap(); - Some(CoroutineTypes { resume_ty, yield_ty, interior }) - } else { - None - }; - // Finalize the return check by taking the LUB of the return types // we saw and assigning it to the expected return type. This isn't // really expected to fail, since the coercions would have failed @@ -201,7 +142,7 @@ pub(super) fn check_fn<'a, 'tcx>( check_lang_start_fn(tcx, fn_sig, fn_def_id); } - coroutine_ty + fcx.coroutine_types } fn check_panic_info_fn(tcx: TyCtxt<'_>, fn_id: LocalDefId, fn_sig: ty::FnSig<'_>) { diff --git a/compiler/rustc_hir_typeck/src/closure.rs b/compiler/rustc_hir_typeck/src/closure.rs index bf6fda20df8..7edb5912dd5 100644 --- a/compiler/rustc_hir_typeck/src/closure.rs +++ b/compiler/rustc_hir_typeck/src/closure.rs @@ -72,7 +72,8 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { opt_kind: Option<ty::ClosureKind>, expected_sig: Option<ExpectedSig<'tcx>>, ) -> Ty<'tcx> { - let body = self.tcx.hir().body(closure.body); + let tcx = self.tcx; + let body = tcx.hir().body(closure.body); trace!("decl = {:#?}", closure.fn_decl); let expr_def_id = closure.def_id; @@ -83,81 +84,151 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { debug!(?bound_sig, ?liberated_sig); + // FIXME: We could probably actually just unify this further -- + // instead of having a `FnSig` and a `Option<CoroutineTypes>`, + // we can have a `ClosureSignature { Coroutine { .. }, Closure { .. } }`, + // similar to how `ty::GenSig` is a distinct data structure. + let coroutine_types = match closure.kind { + hir::ClosureKind::Closure => None, + hir::ClosureKind::Coroutine(kind) => { + let yield_ty = match kind { + hir::CoroutineKind::Desugared(hir::CoroutineDesugaring::Gen, _) + | hir::CoroutineKind::Coroutine(_) => { + let yield_ty = self.next_ty_var(TypeVariableOrigin { + kind: TypeVariableOriginKind::TypeInference, + span: expr_span, + }); + self.require_type_is_sized(yield_ty, expr_span, traits::SizedYieldType); + yield_ty + } + // HACK(-Ztrait-solver=next): In the *old* trait solver, we must eagerly + // guide inference on the yield type so that we can handle `AsyncIterator` + // in this block in projection correctly. In the new trait solver, it is + // not a problem. + hir::CoroutineKind::Desugared(hir::CoroutineDesugaring::AsyncGen, _) => { + let yield_ty = self.next_ty_var(TypeVariableOrigin { + kind: TypeVariableOriginKind::TypeInference, + span: expr_span, + }); + self.require_type_is_sized(yield_ty, expr_span, traits::SizedYieldType); + + Ty::new_adt( + tcx, + tcx.adt_def( + tcx.require_lang_item(hir::LangItem::Poll, Some(expr_span)), + ), + tcx.mk_args(&[Ty::new_adt( + tcx, + tcx.adt_def( + tcx.require_lang_item(hir::LangItem::Option, Some(expr_span)), + ), + tcx.mk_args(&[yield_ty.into()]), + ) + .into()]), + ) + } + hir::CoroutineKind::Desugared(hir::CoroutineDesugaring::Async, _) => { + tcx.types.unit + } + }; + + // Resume type defaults to `()` if the coroutine has no argument. + let resume_ty = liberated_sig.inputs().get(0).copied().unwrap_or(tcx.types.unit); + + Some(CoroutineTypes { resume_ty, yield_ty }) + } + }; + let mut fcx = FnCtxt::new(self, self.param_env, closure.def_id); - let coroutine_types = check_fn( + check_fn( &mut fcx, liberated_sig, + coroutine_types, closure.fn_decl, expr_def_id, body, - Some(closure.kind), // Closure "rust-call" ABI doesn't support unsized params false, ); - let parent_args = GenericArgs::identity_for_item( - self.tcx, - self.tcx.typeck_root_def_id(expr_def_id.to_def_id()), - ); + let parent_args = + GenericArgs::identity_for_item(tcx, tcx.typeck_root_def_id(expr_def_id.to_def_id())); let tupled_upvars_ty = self.next_root_ty_var(TypeVariableOrigin { kind: TypeVariableOriginKind::ClosureSynthetic, - span: self.tcx.def_span(expr_def_id), - }); - - if let Some(CoroutineTypes { resume_ty, yield_ty, interior }) = coroutine_types { - let coroutine_args = ty::CoroutineArgs::new( - self.tcx, - ty::CoroutineArgsParts { - parent_args, - resume_ty, - yield_ty, - return_ty: liberated_sig.output(), - witness: interior, - tupled_upvars_ty, - }, - ); - - return Ty::new_coroutine(self.tcx, expr_def_id.to_def_id(), coroutine_args.args); - } - - // Tuple up the arguments and insert the resulting function type into - // the `closures` table. - let sig = bound_sig.map_bound(|sig| { - self.tcx.mk_fn_sig( - [Ty::new_tup(self.tcx, sig.inputs())], - sig.output(), - sig.c_variadic, - sig.unsafety, - sig.abi, - ) + span: expr_span, }); - debug!(?sig, ?opt_kind); - - let closure_kind_ty = match opt_kind { - Some(kind) => Ty::from_closure_kind(self.tcx, kind), + match closure.kind { + hir::ClosureKind::Closure => { + assert_eq!(coroutine_types, None); + // Tuple up the arguments and insert the resulting function type into + // the `closures` table. + let sig = bound_sig.map_bound(|sig| { + tcx.mk_fn_sig( + [Ty::new_tup(tcx, sig.inputs())], + sig.output(), + sig.c_variadic, + sig.unsafety, + sig.abi, + ) + }); - // Create a type variable (for now) to represent the closure kind. - // It will be unified during the upvar inference phase (`upvar.rs`) - None => self.next_root_ty_var(TypeVariableOrigin { - // FIXME(eddyb) distinguish closure kind inference variables from the rest. - kind: TypeVariableOriginKind::ClosureSynthetic, - span: expr_span, - }), - }; + debug!(?sig, ?opt_kind); + + let closure_kind_ty = match opt_kind { + Some(kind) => Ty::from_closure_kind(tcx, kind), + + // Create a type variable (for now) to represent the closure kind. + // It will be unified during the upvar inference phase (`upvar.rs`) + None => self.next_root_ty_var(TypeVariableOrigin { + // FIXME(eddyb) distinguish closure kind inference variables from the rest. + kind: TypeVariableOriginKind::ClosureSynthetic, + span: expr_span, + }), + }; + + let closure_args = ty::ClosureArgs::new( + tcx, + ty::ClosureArgsParts { + parent_args, + closure_kind_ty, + closure_sig_as_fn_ptr_ty: Ty::new_fn_ptr(tcx, sig), + tupled_upvars_ty, + }, + ); - let closure_args = ty::ClosureArgs::new( - self.tcx, - ty::ClosureArgsParts { - parent_args, - closure_kind_ty, - closure_sig_as_fn_ptr_ty: Ty::new_fn_ptr(self.tcx, sig), - tupled_upvars_ty, - }, - ); + Ty::new_closure(tcx, expr_def_id.to_def_id(), closure_args.args) + } + hir::ClosureKind::Coroutine(_) => { + let Some(CoroutineTypes { resume_ty, yield_ty }) = coroutine_types else { + bug!("expected coroutine to have yield/resume types"); + }; + let interior = fcx.next_ty_var(TypeVariableOrigin { + kind: TypeVariableOriginKind::MiscVariable, + span: body.value.span, + }); + fcx.deferred_coroutine_interiors.borrow_mut().push(( + expr_def_id, + body.id(), + interior, + )); + + let coroutine_args = ty::CoroutineArgs::new( + tcx, + ty::CoroutineArgsParts { + parent_args, + resume_ty, + yield_ty, + return_ty: liberated_sig.output(), + witness: interior, + tupled_upvars_ty, + }, + ); - Ty::new_closure(self.tcx, expr_def_id.to_def_id(), closure_args.args) + Ty::new_coroutine(tcx, expr_def_id.to_def_id(), coroutine_args.args) + } + } } /// Given the expected type, figures out what it can about this closure we diff --git a/compiler/rustc_hir_typeck/src/errors.rs b/compiler/rustc_hir_typeck/src/errors.rs index ff03cf16a27..4f929068887 100644 --- a/compiler/rustc_hir_typeck/src/errors.rs +++ b/compiler/rustc_hir_typeck/src/errors.rs @@ -215,7 +215,7 @@ impl AddToDiagnostic for TypeMismatchFruTypo { where F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { - diag.set_arg("expr", self.expr.as_deref().unwrap_or("NONE")); + diag.arg("expr", self.expr.as_deref().unwrap_or("NONE")); // Only explain that `a ..b` is a range if it's split up if self.expr_span.between(self.fru_span).is_empty() { diff --git a/compiler/rustc_hir_typeck/src/expr.rs b/compiler/rustc_hir_typeck/src/expr.rs index 7425d6f8901..44d9f1ed818 100644 --- a/compiler/rustc_hir_typeck/src/expr.rs +++ b/compiler/rustc_hir_typeck/src/expr.rs @@ -15,6 +15,7 @@ use crate::errors::{ use crate::fatally_break_rust; use crate::method::SelfSource; use crate::type_error_struct; +use crate::CoroutineTypes; use crate::Expectation::{self, ExpectCastableToType, ExpectHasType, NoExpectation}; use crate::{ report_unexpected_variant_res, BreakableCtxt, Diverges, FnCtxt, Needs, @@ -3163,8 +3164,8 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { value: &'tcx hir::Expr<'tcx>, expr: &'tcx hir::Expr<'tcx>, ) -> Ty<'tcx> { - match self.resume_yield_tys { - Some((resume_ty, yield_ty)) => { + match self.coroutine_types { + Some(CoroutineTypes { resume_ty, yield_ty }) => { self.check_expr_coercible_to_type(value, yield_ty, None); resume_ty diff --git a/compiler/rustc_hir_typeck/src/expr_use_visitor.rs b/compiler/rustc_hir_typeck/src/expr_use_visitor.rs index e952a7ff9e8..ed3dd1e39df 100644 --- a/compiler/rustc_hir_typeck/src/expr_use_visitor.rs +++ b/compiler/rustc_hir_typeck/src/expr_use_visitor.rs @@ -669,12 +669,8 @@ impl<'a, 'tcx> ExprUseVisitor<'a, 'tcx> { ); self.walk_pat(discr_place, arm.pat, arm.guard.is_some()); - match arm.guard { - Some(hir::Guard::If(e)) => self.consume_expr(e), - Some(hir::Guard::IfLet(l)) => { - self.walk_local(l.init, l.pat, None, |t| t.borrow_expr(l.init, ty::ImmBorrow)) - } - None => {} + if let Some(ref e) = arm.guard { + self.consume_expr(e) } self.consume_expr(arm.body); diff --git a/compiler/rustc_hir_typeck/src/fallback.rs b/compiler/rustc_hir_typeck/src/fallback.rs index 023bd70be17..aa8bbad1d12 100644 --- a/compiler/rustc_hir_typeck/src/fallback.rs +++ b/compiler/rustc_hir_typeck/src/fallback.rs @@ -85,7 +85,7 @@ impl<'tcx> FnCtxt<'_, 'tcx> { return false; } - // not setting the `fallback_has_occured` field here because + // not setting the `fallback_has_occurred` field here because // that field is only used for type fallback diagnostics. for effect in unsolved_effects { let expected = self.tcx.consts.true_; diff --git a/compiler/rustc_hir_typeck/src/fn_ctxt/_impl.rs b/compiler/rustc_hir_typeck/src/fn_ctxt/_impl.rs index 994f11b57d1..cb109a2e024 100644 --- a/compiler/rustc_hir_typeck/src/fn_ctxt/_impl.rs +++ b/compiler/rustc_hir_typeck/src/fn_ctxt/_impl.rs @@ -534,7 +534,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { let coroutines = std::mem::take(&mut *self.deferred_coroutine_interiors.borrow_mut()); debug!(?coroutines); - for &(expr_def_id, body_id, interior, _) in coroutines.iter() { + for &(expr_def_id, body_id, interior) in coroutines.iter() { debug!(?expr_def_id); // Create the `CoroutineWitness` type that we will unify with `interior`. diff --git a/compiler/rustc_hir_typeck/src/fn_ctxt/mod.rs b/compiler/rustc_hir_typeck/src/fn_ctxt/mod.rs index 635284c5f73..fde3d41faec 100644 --- a/compiler/rustc_hir_typeck/src/fn_ctxt/mod.rs +++ b/compiler/rustc_hir_typeck/src/fn_ctxt/mod.rs @@ -5,7 +5,7 @@ mod checks; mod suggestions; use crate::coercion::DynamicCoerceMany; -use crate::{Diverges, EnclosingBreakables, Inherited}; +use crate::{CoroutineTypes, Diverges, EnclosingBreakables, Inherited}; use rustc_errors::{DiagCtxt, ErrorGuaranteed}; use rustc_hir as hir; use rustc_hir::def_id::{DefId, LocalDefId}; @@ -68,7 +68,7 @@ pub struct FnCtxt<'a, 'tcx> { /// First span of a return site that we find. Used in error messages. pub(super) ret_coercion_span: Cell<Option<Span>>, - pub(super) resume_yield_tys: Option<(Ty<'tcx>, Ty<'tcx>)>, + pub(super) coroutine_types: Option<CoroutineTypes<'tcx>>, /// Whether the last checked node generates a divergence (e.g., /// `return` will set this to `Always`). In general, when entering @@ -122,7 +122,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { err_count_on_creation: inh.tcx.dcx().err_count(), ret_coercion: None, ret_coercion_span: Cell::new(None), - resume_yield_tys: None, + coroutine_types: None, diverges: Cell::new(Diverges::Maybe), enclosing_breakables: RefCell::new(EnclosingBreakables { stack: Vec::new(), diff --git a/compiler/rustc_hir_typeck/src/gather_locals.rs b/compiler/rustc_hir_typeck/src/gather_locals.rs index e169b45d725..52dc1e85916 100644 --- a/compiler/rustc_hir_typeck/src/gather_locals.rs +++ b/compiler/rustc_hir_typeck/src/gather_locals.rs @@ -60,7 +60,7 @@ pub(super) struct GatherLocalsVisitor<'a, 'tcx> { // parameters are special cases of patterns, but we want to handle them as // *distinct* cases. so track when we are hitting a pattern *within* an fn // parameter. - outermost_fn_param_pat: Option<Span>, + outermost_fn_param_pat: Option<(Span, hir::HirId)>, } impl<'a, 'tcx> GatherLocalsVisitor<'a, 'tcx> { @@ -131,7 +131,8 @@ impl<'a, 'tcx> Visitor<'tcx> for GatherLocalsVisitor<'a, 'tcx> { } fn visit_param(&mut self, param: &'tcx hir::Param<'tcx>) { - let old_outermost_fn_param_pat = self.outermost_fn_param_pat.replace(param.ty_span); + let old_outermost_fn_param_pat = + self.outermost_fn_param_pat.replace((param.ty_span, param.hir_id)); intravisit::walk_param(self, param); self.outermost_fn_param_pat = old_outermost_fn_param_pat; } @@ -141,7 +142,7 @@ impl<'a, 'tcx> Visitor<'tcx> for GatherLocalsVisitor<'a, 'tcx> { if let PatKind::Binding(_, _, ident, _) = p.kind { let var_ty = self.assign(p.span, p.hir_id, None); - if let Some(ty_span) = self.outermost_fn_param_pat { + if let Some((ty_span, hir_id)) = self.outermost_fn_param_pat { if !self.fcx.tcx.features().unsized_fn_params { self.fcx.require_type_is_sized( var_ty, @@ -154,7 +155,7 @@ impl<'a, 'tcx> Visitor<'tcx> for GatherLocalsVisitor<'a, 'tcx> { { None } else { - Some(ty_span) + Some(hir_id) }, ), ); diff --git a/compiler/rustc_hir_typeck/src/inherited.rs b/compiler/rustc_hir_typeck/src/inherited.rs index 7a6a2b2a010..4ad46845f0b 100644 --- a/compiler/rustc_hir_typeck/src/inherited.rs +++ b/compiler/rustc_hir_typeck/src/inherited.rs @@ -55,8 +55,7 @@ pub struct Inherited<'tcx> { pub(super) deferred_asm_checks: RefCell<Vec<(&'tcx hir::InlineAsm<'tcx>, hir::HirId)>>, - pub(super) deferred_coroutine_interiors: - RefCell<Vec<(LocalDefId, hir::BodyId, Ty<'tcx>, hir::CoroutineKind)>>, + pub(super) deferred_coroutine_interiors: RefCell<Vec<(LocalDefId, hir::BodyId, Ty<'tcx>)>>, /// Whenever we introduce an adjustment from `!` into a type variable, /// we record that type variable here. This is later used to inform diff --git a/compiler/rustc_hir_typeck/src/lib.rs b/compiler/rustc_hir_typeck/src/lib.rs index da9a2bde783..6044b1fdd40 100644 --- a/compiler/rustc_hir_typeck/src/lib.rs +++ b/compiler/rustc_hir_typeck/src/lib.rs @@ -193,7 +193,7 @@ fn typeck_with_fallback<'tcx>( let fn_sig = tcx.liberate_late_bound_regions(def_id.to_def_id(), fn_sig); let fn_sig = fcx.normalize(body.value.span, fn_sig); - check_fn(&mut fcx, fn_sig, decl, def_id, body, None, tcx.features().unsized_fn_params); + check_fn(&mut fcx, fn_sig, None, decl, def_id, body, tcx.features().unsized_fn_params); } else { let expected_type = if let Some(&hir::Ty { kind: hir::TyKind::Infer, span, .. }) = body_ty { Some(fcx.next_ty_var(TypeVariableOrigin { @@ -295,15 +295,13 @@ fn typeck_with_fallback<'tcx>( /// When `check_fn` is invoked on a coroutine (i.e., a body that /// includes yield), it returns back some information about the yield /// points. +#[derive(Debug, PartialEq, Copy, Clone)] struct CoroutineTypes<'tcx> { /// Type of coroutine argument / values returned by `yield`. resume_ty: Ty<'tcx>, /// Type of value that is yielded. yield_ty: Ty<'tcx>, - - /// Types that are captured (see `CoroutineInterior` for more). - interior: Ty<'tcx>, } #[derive(Copy, Clone, Debug, PartialEq, Eq)] diff --git a/compiler/rustc_hir_typeck/src/method/suggest.rs b/compiler/rustc_hir_typeck/src/method/suggest.rs index 47fdd64796e..560537b468b 100644 --- a/compiler/rustc_hir_typeck/src/method/suggest.rs +++ b/compiler/rustc_hir_typeck/src/method/suggest.rs @@ -961,7 +961,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { but its trait bounds were not satisfied" ) }); - err.set_primary_message(primary_message); + err.primary_message(primary_message); if let Some(label) = label { custom_span_label = true; err.span_label(span, label); @@ -2252,6 +2252,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { &self, err: &mut Diagnostic, errors: Vec<FulfillmentError<'tcx>>, + suggest_derive: bool, ) { let all_local_types_needing_impls = errors.iter().all(|e| match e.obligation.predicate.kind().skip_binder() { @@ -2322,10 +2323,15 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { .iter() .map(|e| (e.obligation.predicate, None, Some(e.obligation.cause.clone()))) .collect(); - self.suggest_derive(err, &preds); + if suggest_derive { + self.suggest_derive(err, &preds); + } else { + // The predicate comes from a binop where the lhs and rhs have different types. + let _ = self.note_predicate_source_and_get_derives(err, &preds); + } } - pub fn suggest_derive( + fn note_predicate_source_and_get_derives( &self, err: &mut Diagnostic, unsatisfied_predicates: &[( @@ -2333,7 +2339,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { Option<ty::Predicate<'tcx>>, Option<ObligationCause<'tcx>>, )], - ) { + ) -> Vec<(String, Span, Symbol)> { let mut derives = Vec::<(String, Span, Symbol)>::new(); let mut traits = Vec::new(); for (pred, _, _) in unsatisfied_predicates { @@ -2382,21 +2388,6 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { traits.sort(); traits.dedup(); - derives.sort(); - derives.dedup(); - - let mut derives_grouped = Vec::<(String, Span, String)>::new(); - for (self_name, self_span, trait_name) in derives.into_iter() { - if let Some((last_self_name, _, ref mut last_trait_names)) = derives_grouped.last_mut() - { - if last_self_name == &self_name { - last_trait_names.push_str(format!(", {trait_name}").as_str()); - continue; - } - } - derives_grouped.push((self_name, self_span, trait_name.to_string())); - } - let len = traits.len(); if len > 0 { let span = @@ -2419,6 +2410,34 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { ); } + derives + } + + pub(crate) fn suggest_derive( + &self, + err: &mut Diagnostic, + unsatisfied_predicates: &[( + ty::Predicate<'tcx>, + Option<ty::Predicate<'tcx>>, + Option<ObligationCause<'tcx>>, + )], + ) { + let mut derives = self.note_predicate_source_and_get_derives(err, unsatisfied_predicates); + derives.sort(); + derives.dedup(); + + let mut derives_grouped = Vec::<(String, Span, String)>::new(); + for (self_name, self_span, trait_name) in derives.into_iter() { + if let Some((last_self_name, _, ref mut last_trait_names)) = derives_grouped.last_mut() + { + if last_self_name == &self_name { + last_trait_names.push_str(format!(", {trait_name}").as_str()); + continue; + } + } + derives_grouped.push((self_name, self_span, trait_name.to_string())); + } + for (self_name, self_span, traits) in &derives_grouped { err.span_suggestion_verbose( self_span.shrink_to_lo(), diff --git a/compiler/rustc_hir_typeck/src/op.rs b/compiler/rustc_hir_typeck/src/op.rs index de3d5f498d5..7b49a7cc009 100644 --- a/compiler/rustc_hir_typeck/src/op.rs +++ b/compiler/rustc_hir_typeck/src/op.rs @@ -318,7 +318,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { lhs_expr.span, format!("cannot use `{}=` on type `{}`", op.node.as_str(), lhs_ty), ); - self.note_unmet_impls_on_type(&mut err, errors); + self.note_unmet_impls_on_type(&mut err, errors, false); (err, None) } IsAssign::No => { @@ -375,7 +375,8 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { err.span_label(lhs_expr.span, lhs_ty.to_string()); err.span_label(rhs_expr.span, rhs_ty.to_string()); } - self.note_unmet_impls_on_type(&mut err, errors); + let suggest_derive = self.can_eq(self.param_env, lhs_ty, rhs_ty); + self.note_unmet_impls_on_type(&mut err, errors, suggest_derive); (err, output_def_id) } }; @@ -852,7 +853,7 @@ impl<'a, 'tcx> FnCtxt<'a, 'tcx> { Str | Never | Char | Tuple(_) | Array(_, _) => {} Ref(_, lty, _) if *lty.kind() == Str => {} _ => { - self.note_unmet_impls_on_type(&mut err, errors); + self.note_unmet_impls_on_type(&mut err, errors, true); } } } diff --git a/compiler/rustc_infer/src/errors/mod.rs b/compiler/rustc_infer/src/errors/mod.rs index a0768fc7115..aee99063e03 100644 --- a/compiler/rustc_infer/src/errors/mod.rs +++ b/compiler/rustc_infer/src/errors/mod.rs @@ -247,8 +247,8 @@ impl AddToDiagnostic for RegionOriginNote<'_> { } RegionOriginNote::WithName { span, msg, name, continues } => { label_or_note(span, msg); - diag.set_arg("name", name); - diag.set_arg("continues", continues); + diag.arg("name", name); + diag.arg("continues", continues); } RegionOriginNote::WithRequirement { span, @@ -256,7 +256,7 @@ impl AddToDiagnostic for RegionOriginNote<'_> { expected_found: Some((expected, found)), } => { label_or_note(span, fluent::infer_subtype); - diag.set_arg("requirement", requirement); + diag.arg("requirement", requirement); diag.note_expected_found(&"", expected, &"", found); } @@ -265,7 +265,7 @@ impl AddToDiagnostic for RegionOriginNote<'_> { // handling of region checking when type errors are present is // *terrible*. label_or_note(span, fluent::infer_subtype_2); - diag.set_arg("requirement", requirement); + diag.arg("requirement", requirement); } }; } @@ -298,8 +298,8 @@ impl AddToDiagnostic for LifetimeMismatchLabels { diag.span_label(param_span, fluent::infer_declared_different); diag.span_label(ret_span, fluent::infer_nothing); diag.span_label(span, fluent::infer_data_returned); - diag.set_arg("label_var1_exists", label_var1.is_some()); - diag.set_arg("label_var1", label_var1.map(|x| x.to_string()).unwrap_or_default()); + diag.arg("label_var1_exists", label_var1.is_some()); + diag.arg("label_var1", label_var1.map(|x| x.to_string()).unwrap_or_default()); } LifetimeMismatchLabels::Normal { hir_equal, @@ -317,16 +317,10 @@ impl AddToDiagnostic for LifetimeMismatchLabels { diag.span_label(ty_sup, fluent::infer_types_declared_different); diag.span_label(ty_sub, fluent::infer_nothing); diag.span_label(span, fluent::infer_data_flows); - diag.set_arg("label_var1_exists", label_var1.is_some()); - diag.set_arg( - "label_var1", - label_var1.map(|x| x.to_string()).unwrap_or_default(), - ); - diag.set_arg("label_var2_exists", label_var2.is_some()); - diag.set_arg( - "label_var2", - label_var2.map(|x| x.to_string()).unwrap_or_default(), - ); + diag.arg("label_var1_exists", label_var1.is_some()); + diag.arg("label_var1", label_var1.map(|x| x.to_string()).unwrap_or_default()); + diag.arg("label_var2_exists", label_var2.is_some()); + diag.arg("label_var2", label_var2.map(|x| x.to_string()).unwrap_or_default()); } } } @@ -417,7 +411,7 @@ impl AddToDiagnostic for AddLifetimeParamsSuggestion<'_> { suggestions, Applicability::MaybeIncorrect, ); - diag.set_arg("is_impl", is_impl); + diag.arg("is_impl", is_impl); true }; if mk_suggestion() && self.add_note { @@ -878,8 +872,8 @@ impl AddToDiagnostic for MoreTargeted { F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { diag.code(rustc_errors::error_code!(E0772)); - diag.set_primary_message(fluent::infer_more_targeted); - diag.set_arg("ident", self.ident); + diag.primary_message(fluent::infer_more_targeted); + diag.arg("ident", self.ident); } } @@ -1299,7 +1293,7 @@ impl AddToDiagnostic for SuggestTuplePatternMany { where F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { - diag.set_arg("path", self.path); + diag.arg("path", self.path); let message = f(diag, crate::fluent_generated::infer_stp_wrap_many.into()); diag.multipart_suggestions( message, diff --git a/compiler/rustc_infer/src/errors/note_and_explain.rs b/compiler/rustc_infer/src/errors/note_and_explain.rs index 68bf36a1615..8e45cc6d80e 100644 --- a/compiler/rustc_infer/src/errors/note_and_explain.rs +++ b/compiler/rustc_infer/src/errors/note_and_explain.rs @@ -164,10 +164,10 @@ impl AddToDiagnostic for RegionExplanation<'_> { where F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { - diag.set_arg("pref_kind", self.prefix); - diag.set_arg("suff_kind", self.suffix); - diag.set_arg("desc_kind", self.desc.kind); - diag.set_arg("desc_arg", self.desc.arg); + diag.arg("pref_kind", self.prefix); + diag.arg("suff_kind", self.suffix); + diag.arg("desc_kind", self.desc.kind); + diag.arg("desc_arg", self.desc.arg); let msg = f(diag, fluent::infer_region_explanation.into()); if let Some(span) = self.desc.span { diff --git a/compiler/rustc_infer/src/traits/error_reporting/mod.rs b/compiler/rustc_infer/src/traits/error_reporting/mod.rs index d89c205da3f..e91411ffc7a 100644 --- a/compiler/rustc_infer/src/traits/error_reporting/mod.rs +++ b/compiler/rustc_infer/src/traits/error_reporting/mod.rs @@ -2,9 +2,10 @@ use super::ObjectSafetyViolation; use crate::infer::InferCtxt; use rustc_data_structures::fx::FxIndexSet; -use rustc_errors::{struct_span_err, DiagnosticBuilder, MultiSpan}; +use rustc_errors::{struct_span_err, Applicability, DiagnosticBuilder, MultiSpan}; use rustc_hir as hir; use rustc_hir::def_id::{DefId, LocalDefId}; +use rustc_hir::intravisit::Map; use rustc_middle::ty::print::with_no_trimmed_paths; use rustc_middle::ty::{self, TyCtxt}; use rustc_span::Span; @@ -42,6 +43,7 @@ impl<'tcx> InferCtxt<'tcx> { pub fn report_object_safety_error<'tcx>( tcx: TyCtxt<'tcx>, span: Span, + hir_id: Option<hir::HirId>, trait_def_id: DefId, violations: &[ObjectSafetyViolation], ) -> DiagnosticBuilder<'tcx> { @@ -59,6 +61,24 @@ pub fn report_object_safety_error<'tcx>( ); err.span_label(span, format!("`{trait_str}` cannot be made into an object")); + if let Some(hir_id) = hir_id + && let Some(hir::Node::Ty(ty)) = tcx.hir().find(hir_id) + && let hir::TyKind::TraitObject([trait_ref, ..], ..) = ty.kind + { + let mut hir_id = hir_id; + while let hir::Node::Ty(ty) = tcx.hir().get_parent(hir_id) { + hir_id = ty.hir_id; + } + if tcx.hir().get_parent(hir_id).fn_sig().is_some() { + // Do not suggest `impl Trait` when dealing with things like super-traits. + err.span_suggestion_verbose( + ty.span.until(trait_ref.span), + "consider using an opaque type instead", + "impl ", + Applicability::MaybeIncorrect, + ); + } + } let mut reported_violations = FxIndexSet::default(); let mut multi_span = vec![]; let mut messages = vec![]; @@ -132,7 +152,10 @@ pub fn report_object_safety_error<'tcx>( }; let externally_visible = if !impls.is_empty() && let Some(def_id) = trait_def_id.as_local() - && tcx.effective_visibilities(()).is_exported(def_id) + // We may be executing this during typeck, which would result in cycle + // if we used effective_visibilities query, which looks into opaque types + // (and therefore calls typeck). + && tcx.resolutions(()).effective_visibilities.is_exported(def_id) { true } else { diff --git a/compiler/rustc_interface/src/passes.rs b/compiler/rustc_interface/src/passes.rs index 559874641c3..ce76c2cba93 100644 --- a/compiler/rustc_interface/src/passes.rs +++ b/compiler/rustc_interface/src/passes.rs @@ -735,9 +735,9 @@ fn analysis(tcx: TyCtxt<'_>, (): ()) -> Result<()> { sess.time("MIR_borrow_checking", || { tcx.hir().par_body_owners(|def_id| { - // Run THIR unsafety check because it's responsible for stealing - // and deallocating THIR when enabled. - tcx.ensure().thir_check_unsafety(def_id); + // Run unsafety check because it's responsible for stealing and + // deallocating THIR. + tcx.ensure().check_unsafety(def_id); tcx.ensure().mir_borrowck(def_id) }); }); diff --git a/compiler/rustc_interface/src/tests.rs b/compiler/rustc_interface/src/tests.rs index c4a1f3a0e51..f3f59b05682 100644 --- a/compiler/rustc_interface/src/tests.rs +++ b/compiler/rustc_interface/src/tests.rs @@ -6,8 +6,8 @@ use rustc_session::config::{ build_configuration, build_session_options, rustc_optgroups, BranchProtection, CFGuard, Cfg, DebugInfo, DumpMonoStatsFormat, ErrorOutputType, ExternEntry, ExternLocation, Externs, FunctionReturn, InliningThreshold, Input, InstrumentCoverage, InstrumentXRay, - LinkSelfContained, LinkerPluginLto, LocationDetail, LtoCli, MirSpanview, NextSolverConfig, - OomStrategy, Options, OutFileName, OutputType, OutputTypes, PAuthKey, PacRet, Passes, Polonius, + LinkSelfContained, LinkerPluginLto, LocationDetail, LtoCli, NextSolverConfig, OomStrategy, + Options, OutFileName, OutputType, OutputTypes, PAuthKey, PacRet, Passes, Polonius, ProcMacroExecutionStrategy, Strip, SwitchWithOptPath, SymbolManglingVersion, WasiExecModel, }; use rustc_session::lint::Level; @@ -666,7 +666,6 @@ fn test_unstable_options_tracking_hash() { untracked!(dump_mir_dir, String::from("abc")); untracked!(dump_mir_exclude_pass_number, true); untracked!(dump_mir_graphviz, true); - untracked!(dump_mir_spanview, Some(MirSpanview::Statement)); untracked!(dump_mono_stats, SwitchWithOptPath::Enabled(Some("mono-items-dir/".into()))); untracked!(dump_mono_stats_format, DumpMonoStatsFormat::Json); untracked!(dylib_lto, true); @@ -806,7 +805,6 @@ fn test_unstable_options_tracking_hash() { tracked!(relax_elf_relocations, Some(true)); tracked!(relro_level, Some(RelroLevel::Full)); tracked!(remap_cwd_prefix, Some(PathBuf::from("abc"))); - tracked!(report_delayed_bugs, true); tracked!(sanitizer, SanitizerSet::ADDRESS); tracked!(sanitizer_cfi_canonical_jump_tables, None); tracked!(sanitizer_cfi_generalize_pointers, Some(true)); @@ -822,7 +820,7 @@ fn test_unstable_options_tracking_hash() { tracked!(stack_protector, StackProtector::All); tracked!(teach, true); tracked!(thinlto, Some(true)); - tracked!(thir_unsafeck, true); + tracked!(thir_unsafeck, false); tracked!(tiny_const_eval_limit, true); tracked!(tls_model, Some(TlsModel::GeneralDynamic)); tracked!(translate_remapped_path_to_local_path, false); diff --git a/compiler/rustc_lint/src/builtin.rs b/compiler/rustc_lint/src/builtin.rs index 8afb5f2d32e..8d2f2aaca55 100644 --- a/compiler/rustc_lint/src/builtin.rs +++ b/compiler/rustc_lint/src/builtin.rs @@ -2734,10 +2734,13 @@ impl<'tcx> LateLintPass<'tcx> for NamedAsmLabels { #[allow(rustc::diagnostic_outside_of_impl)] fn check_expr(&mut self, cx: &LateContext<'tcx>, expr: &'tcx hir::Expr<'tcx>) { if let hir::Expr { - kind: hir::ExprKind::InlineAsm(hir::InlineAsm { template_strs, .. }), + kind: hir::ExprKind::InlineAsm(hir::InlineAsm { template_strs, options, .. }), .. } = expr { + // asm with `options(raw)` does not do replacement with `{` and `}`. + let raw = options.contains(InlineAsmOptions::RAW); + for (template_sym, template_snippet, template_span) in template_strs.iter() { let template_str = template_sym.as_str(); let find_label_span = |needle: &str| -> Option<Span> { @@ -2763,24 +2766,57 @@ impl<'tcx> LateLintPass<'tcx> for NamedAsmLabels { for statement in statements { // If there's a comment, trim it from the statement let statement = statement.find("//").map_or(statement, |idx| &statement[..idx]); + + // In this loop, if there is ever a non-label, no labels can come after it. let mut start_idx = 0; - for (idx, _) in statement.match_indices(':') { + 'label_loop: for (idx, _) in statement.match_indices(':') { let possible_label = statement[start_idx..idx].trim(); let mut chars = possible_label.chars(); - let Some(c) = chars.next() else { - // Empty string means a leading ':' in this section, which is not a label - break; + + let Some(start) = chars.next() else { + // Empty string means a leading ':' in this section, which is not a label. + break 'label_loop; }; - // A label starts with an alphabetic character or . or _ and continues with alphanumeric characters, _, or $ - if (c.is_alphabetic() || matches!(c, '.' | '_')) - && chars.all(|c| c.is_alphanumeric() || matches!(c, '_' | '$')) - { - found_labels.push(possible_label); - } else { - // If we encounter a non-label, there cannot be any further labels, so stop checking - break; + + // Whether a { bracket has been seen and its } hasn't been found yet. + let mut in_bracket = false; + + // A label starts with an ASCII alphabetic character or . or _ + // A label can also start with a format arg, if it's not a raw asm block. + if !raw && start == '{' { + in_bracket = true; + } else if !(start.is_ascii_alphabetic() || matches!(start, '.' | '_')) { + break 'label_loop; + } + + // Labels continue with ASCII alphanumeric characters, _, or $ + for c in chars { + // Inside a template format arg, any character is permitted for the puproses of label detection + // because we assume that it can be replaced with some other valid label string later. + // `options(raw)` asm blocks cannot have format args, so they are excluded from this special case. + if !raw && in_bracket { + if c == '{' { + // Nested brackets are not allowed in format args, this cannot be a label. + break 'label_loop; + } + + if c == '}' { + // The end of the format arg. + in_bracket = false; + } + } else if !raw && c == '{' { + // Start of a format arg. + in_bracket = true; + } else { + if !(c.is_ascii_alphanumeric() || matches!(c, '_' | '$')) { + // The potential label had an invalid character inside it, it cannot be a label. + break 'label_loop; + } + } } + // If all characters passed the label checks, this is likely a label. + found_labels.push(possible_label); start_idx = idx + 1; } } diff --git a/compiler/rustc_lint/src/errors.rs b/compiler/rustc_lint/src/errors.rs index eccea35c702..841d282a099 100644 --- a/compiler/rustc_lint/src/errors.rs +++ b/compiler/rustc_lint/src/errors.rs @@ -31,7 +31,7 @@ impl AddToDiagnostic for OverruledAttributeSub { match self { OverruledAttributeSub::DefaultSource { id } => { diag.note(fluent::lint_default_source); - diag.set_arg("id", id); + diag.arg("id", id); } OverruledAttributeSub::NodeSource { span, reason } => { diag.span_label(span, fluent::lint_node_source); diff --git a/compiler/rustc_lint/src/levels.rs b/compiler/rustc_lint/src/levels.rs index 5950bc76ade..49821437b76 100644 --- a/compiler/rustc_lint/src/levels.rs +++ b/compiler/rustc_lint/src/levels.rs @@ -1069,7 +1069,7 @@ impl<'s, P: LintLevelsProvider> LintLevelsBuilder<'s, P> { Some(span.into()), fluent::lint_unknown_gated_lint, |lint| { - lint.set_arg("name", lint_id.lint.name_lower()); + lint.arg("name", lint_id.lint.name_lower()); lint.note(fluent::lint_note); rustc_session::parse::add_feature_diagnostics_for_issue( lint, diff --git a/compiler/rustc_lint/src/lib.rs b/compiler/rustc_lint/src/lib.rs index 93904fb5c56..76c630fc456 100644 --- a/compiler/rustc_lint/src/lib.rs +++ b/compiler/rustc_lint/src/lib.rs @@ -328,6 +328,7 @@ fn register_builtins(store: &mut LintStore) { store.register_renamed("disjoint_capture_migration", "rust_2021_incompatible_closure_captures"); store.register_renamed("or_patterns_back_compat", "rust_2021_incompatible_or_patterns"); store.register_renamed("non_fmt_panic", "non_fmt_panics"); + store.register_renamed("unused_tuple_struct_fields", "dead_code"); // These were moved to tool lints, but rustc still sees them when compiling normally, before // tool lints are registered, so `check_tool_name_for_backwards_compat` doesn't work. Use diff --git a/compiler/rustc_lint/src/lints.rs b/compiler/rustc_lint/src/lints.rs index ca6408bdf3d..614c3ecbcae 100644 --- a/compiler/rustc_lint/src/lints.rs +++ b/compiler/rustc_lint/src/lints.rs @@ -5,8 +5,8 @@ use std::num::NonZeroU32; use crate::errors::RequestedLevel; use crate::fluent_generated as fluent; use rustc_errors::{ - AddToDiagnostic, Applicability, DecorateLint, DiagnosticMessage, DiagnosticStyledString, - SuggestionStyle, + AddToDiagnostic, Applicability, DecorateLint, Diagnostic, DiagnosticBuilder, DiagnosticMessage, + DiagnosticStyledString, SubdiagnosticMessage, SuggestionStyle, }; use rustc_hir::def_id::DefId; use rustc_macros::{LintDiagnostic, Subdiagnostic}; @@ -135,7 +135,7 @@ pub struct BuiltinMissingDebugImpl<'a> { // Needed for def_path_str impl<'a> DecorateLint<'a, ()> for BuiltinMissingDebugImpl<'_> { fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("debug", self.tcx.def_path_str(self.def_id)); + diag.arg("debug", self.tcx.def_path_str(self.def_id)); } fn msg(&self) -> DiagnosticMessage { @@ -239,7 +239,7 @@ pub struct BuiltinUngatedAsyncFnTrackCaller<'a> { } impl<'a> DecorateLint<'a, ()> for BuiltinUngatedAsyncFnTrackCaller<'_> { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { diag.span_label(self.label, fluent::lint_label); rustc_session::parse::add_feature_diagnostics( diag, @@ -268,12 +268,9 @@ pub struct SuggestChangingAssocTypes<'a, 'b> { } impl AddToDiagnostic for SuggestChangingAssocTypes<'_, '_> { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { // Access to associates types should use `<T as Bound>::Assoc`, which does not need a // bound. Let's see if this type does that. @@ -281,7 +278,7 @@ impl AddToDiagnostic for SuggestChangingAssocTypes<'_, '_> { // We use a HIR visitor to walk the type. use rustc_hir::intravisit::{self, Visitor}; struct WalkAssocTypes<'a> { - err: &'a mut rustc_errors::Diagnostic, + err: &'a mut Diagnostic, } impl Visitor<'_> for WalkAssocTypes<'_> { fn visit_qpath( @@ -326,12 +323,9 @@ pub struct BuiltinTypeAliasGenericBoundsSuggestion { } impl AddToDiagnostic for BuiltinTypeAliasGenericBoundsSuggestion { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { diag.multipart_suggestion( fluent::lint_suggestion, @@ -425,8 +419,8 @@ pub struct BuiltinUnpermittedTypeInit<'a> { } impl<'a> DecorateLint<'a, ()> for BuiltinUnpermittedTypeInit<'_> { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("ty", self.ty); + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { + diag.arg("ty", self.ty); diag.span_label(self.label, fluent::lint_builtin_unpermitted_type_init_label); if let InhabitedPredicate::True = self.ty.inhabited_predicate(self.tcx) { // Only suggest late `MaybeUninit::assume_init` initialization if the type is inhabited. @@ -438,7 +432,7 @@ impl<'a> DecorateLint<'a, ()> for BuiltinUnpermittedTypeInit<'_> { self.sub.add_to_diagnostic(diag); } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { self.msg.clone() } } @@ -449,12 +443,9 @@ pub struct BuiltinUnpermittedTypeInitSub { } impl AddToDiagnostic for BuiltinUnpermittedTypeInitSub { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { let mut err = self.err; loop { @@ -506,12 +497,9 @@ pub struct BuiltinClashingExternSub<'a> { } impl AddToDiagnostic for BuiltinClashingExternSub<'_> { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { let mut expected_str = DiagnosticStyledString::new(); expected_str.push(self.expected.fn_sig(self.tcx).to_string(), false); @@ -779,12 +767,9 @@ pub struct HiddenUnicodeCodepointsDiagLabels { } impl AddToDiagnostic for HiddenUnicodeCodepointsDiagLabels { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { for (c, span) in self.spans { diag.span_label(span, format!("{c:?}")); @@ -799,12 +784,9 @@ pub enum HiddenUnicodeCodepointsDiagSub { // Used because of multiple multipart_suggestion and note impl AddToDiagnostic for HiddenUnicodeCodepointsDiagSub { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { match self { HiddenUnicodeCodepointsDiagSub::Escape { spans } => { @@ -830,7 +812,7 @@ impl AddToDiagnostic for HiddenUnicodeCodepointsDiagSub { // FIXME: in other suggestions we've reversed the inner spans of doc comments. We // should do the same here to provide the same good suggestions as we do for // literals above. - diag.set_arg( + diag.arg( "escaped", spans .into_iter() @@ -953,12 +935,9 @@ pub struct NonBindingLetSub { } impl AddToDiagnostic for NonBindingLetSub { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { diag.span_suggestion_verbose( self.suggestion, @@ -1147,8 +1126,8 @@ pub struct NonFmtPanicUnused { // Used because of two suggestions based on one Option<Span> impl<'a> DecorateLint<'a, ()> for NonFmtPanicUnused { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("count", self.count); + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { + diag.arg("count", self.count); diag.note(fluent::lint_note); if let Some(span) = self.suggestion { diag.span_suggestion( @@ -1166,7 +1145,7 @@ impl<'a> DecorateLint<'a, ()> for NonFmtPanicUnused { } } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { fluent::lint_non_fmt_panic_unused } } @@ -1224,12 +1203,9 @@ pub enum NonSnakeCaseDiagSub { } impl AddToDiagnostic for NonSnakeCaseDiagSub { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { match self { NonSnakeCaseDiagSub::Label { span } => { @@ -1342,12 +1318,12 @@ pub struct DropTraitConstraintsDiag<'a> { // Needed for def_path_str impl<'a> DecorateLint<'a, ()> for DropTraitConstraintsDiag<'_> { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("predicate", self.predicate); - diag.set_arg("needs_drop", self.tcx.def_path_str(self.def_id)); + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { + diag.arg("predicate", self.predicate); + diag.arg("needs_drop", self.tcx.def_path_str(self.def_id)); } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { fluent::lint_drop_trait_constraints } } @@ -1359,11 +1335,11 @@ pub struct DropGlue<'a> { // Needed for def_path_str impl<'a> DecorateLint<'a, ()> for DropGlue<'_> { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("needs_drop", self.tcx.def_path_str(self.def_id)); + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { + diag.arg("needs_drop", self.tcx.def_path_str(self.def_id)); } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { fluent::lint_drop_glue } } @@ -1423,12 +1399,9 @@ pub enum OverflowingBinHexSign { } impl AddToDiagnostic for OverflowingBinHexSign { - fn add_to_diagnostic_with<F>(self, diag: &mut rustc_errors::Diagnostic, _: F) + fn add_to_diagnostic_with<F>(self, diag: &mut Diagnostic, _: F) where - F: Fn( - &mut rustc_errors::Diagnostic, - rustc_errors::SubdiagnosticMessage, - ) -> rustc_errors::SubdiagnosticMessage, + F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { match self { OverflowingBinHexSign::Positive => { @@ -1633,9 +1606,9 @@ pub struct ImproperCTypes<'a> { // Used because of the complexity of Option<DiagnosticMessage>, DiagnosticMessage, and Option<Span> impl<'a> DecorateLint<'a, ()> for ImproperCTypes<'_> { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("ty", self.ty); - diag.set_arg("desc", self.desc); + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { + diag.arg("ty", self.ty); + diag.arg("desc", self.desc); diag.span_label(self.label, fluent::lint_label); if let Some(help) = self.help { diag.help(help); @@ -1646,7 +1619,7 @@ impl<'a> DecorateLint<'a, ()> for ImproperCTypes<'_> { } } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { fluent::lint_improper_ctypes } } @@ -1776,10 +1749,10 @@ pub enum UnusedDefSuggestion { // Needed because of def_path_str impl<'a> DecorateLint<'a, ()> for UnusedDef<'_, '_> { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { - diag.set_arg("pre", self.pre); - diag.set_arg("post", self.post); - diag.set_arg("def", self.cx.tcx.def_path_str(self.def_id)); + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { + diag.arg("pre", self.pre); + diag.arg("post", self.post); + diag.arg("def", self.cx.tcx.def_path_str(self.def_id)); // check for #[must_use = "..."] if let Some(note) = self.note { diag.note(note.to_string()); @@ -1789,7 +1762,7 @@ impl<'a> DecorateLint<'a, ()> for UnusedDef<'_, '_> { } } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { fluent::lint_unused_def } } @@ -1859,14 +1832,14 @@ pub struct AsyncFnInTraitDiag { } impl<'a> DecorateLint<'a, ()> for AsyncFnInTraitDiag { - fn decorate_lint<'b>(self, diag: &'b mut rustc_errors::DiagnosticBuilder<'a, ()>) { + fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { diag.note(fluent::lint_note); if let Some(sugg) = self.sugg { diag.multipart_suggestion(fluent::lint_suggestion, sugg, Applicability::MaybeIncorrect); } } - fn msg(&self) -> rustc_errors::DiagnosticMessage { + fn msg(&self) -> DiagnosticMessage { fluent::lint_async_fn_in_trait } } diff --git a/compiler/rustc_lint/src/non_fmt_panic.rs b/compiler/rustc_lint/src/non_fmt_panic.rs index 9fcd70ba0b5..f0bbc03d747 100644 --- a/compiler/rustc_lint/src/non_fmt_panic.rs +++ b/compiler/rustc_lint/src/non_fmt_panic.rs @@ -121,7 +121,7 @@ fn check_panic<'tcx>(cx: &LateContext<'tcx>, f: &'tcx hir::Expr<'tcx>, arg: &'tc #[allow(rustc::diagnostic_outside_of_impl)] cx.struct_span_lint(NON_FMT_PANICS, arg_span, fluent::lint_non_fmt_panic, |lint| { - lint.set_arg("name", symbol); + lint.arg("name", symbol); lint.note(fluent::lint_note); lint.note(fluent::lint_more_info_note); if !is_arg_inside_call(arg_span, span) { @@ -180,7 +180,7 @@ fn check_panic<'tcx>(cx: &LateContext<'tcx>, f: &'tcx hir::Expr<'tcx>, arg: &'tc fmt_applicability, ); } else if suggest_debug { - lint.set_arg("ty", ty); + lint.arg("ty", ty); lint.span_suggestion_verbose( arg_span.shrink_to_lo(), fluent::lint_debug_suggestion, @@ -191,7 +191,7 @@ fn check_panic<'tcx>(cx: &LateContext<'tcx>, f: &'tcx hir::Expr<'tcx>, arg: &'tc if suggest_panic_any { if let Some((open, close, del)) = find_delimiters(cx, span) { - lint.set_arg("already_suggested", suggest_display || suggest_debug); + lint.arg("already_suggested", suggest_display || suggest_debug); lint.multipart_suggestion( fluent::lint_panic_suggestion, if del == '(' { diff --git a/compiler/rustc_lint_defs/src/builtin.rs b/compiler/rustc_lint_defs/src/builtin.rs index e35d1ee0461..19da51b7dcf 100644 --- a/compiler/rustc_lint_defs/src/builtin.rs +++ b/compiler/rustc_lint_defs/src/builtin.rs @@ -125,7 +125,6 @@ declare_lint_pass! { UNUSED_MACROS, UNUSED_MUT, UNUSED_QUALIFICATIONS, - UNUSED_TUPLE_STRUCT_FIELDS, UNUSED_UNSAFE, UNUSED_VARIABLES, USELESS_DEPRECATED, @@ -697,8 +696,13 @@ declare_lint! { /// Dead code may signal a mistake or unfinished code. To silence the /// warning for individual items, prefix the name with an underscore such /// as `_foo`. If it was intended to expose the item outside of the crate, - /// consider adding a visibility modifier like `pub`. Otherwise consider - /// removing the unused code. + /// consider adding a visibility modifier like `pub`. + /// + /// To preserve the numbering of tuple structs with unused fields, + /// change the unused fields to have unit type or use + /// `PhantomData`. + /// + /// Otherwise consider removing the unused code. pub DEAD_CODE, Warn, "detect unused, unexported items" @@ -733,32 +737,6 @@ declare_lint! { } declare_lint! { - /// The `unused_tuple_struct_fields` lint detects fields of tuple structs - /// that are never read. - /// - /// ### Example - /// - /// ```rust - /// #[warn(unused_tuple_struct_fields)] - /// struct S(i32, i32, i32); - /// let s = S(1, 2, 3); - /// let _ = (s.0, s.2); - /// ``` - /// - /// {{produces}} - /// - /// ### Explanation - /// - /// Tuple struct fields that are never read anywhere may indicate a - /// mistake or unfinished code. To silence this warning, consider - /// removing the unused field(s) or, to preserve the numbering of the - /// remaining fields, change the unused field(s) to have unit type. - pub UNUSED_TUPLE_STRUCT_FIELDS, - Allow, - "detects tuple struct fields that are never read" -} - -declare_lint! { /// The `unreachable_code` lint detects unreachable code paths. /// /// ### Example diff --git a/compiler/rustc_macros/src/diagnostics/diagnostic_builder.rs b/compiler/rustc_macros/src/diagnostics/diagnostic_builder.rs index f3e98d68b60..fb908fe2db1 100644 --- a/compiler/rustc_macros/src/diagnostics/diagnostic_builder.rs +++ b/compiler/rustc_macros/src/diagnostics/diagnostic_builder.rs @@ -5,8 +5,8 @@ use crate::diagnostics::error::{ }; use crate::diagnostics::utils::{ build_field_mapping, is_doc_comment, report_error_if_not_applied_to_span, report_type_error, - should_generate_set_arg, type_is_bool, type_is_unit, type_matches_path, FieldInfo, - FieldInnerTy, FieldMap, HasFieldMap, SetOnce, SpannedOption, SubdiagnosticKind, + should_generate_arg, type_is_bool, type_is_unit, type_matches_path, FieldInfo, FieldInnerTy, + FieldMap, HasFieldMap, SetOnce, SpannedOption, SubdiagnosticKind, }; use proc_macro2::{Ident, Span, TokenStream}; use quote::{format_ident, quote, quote_spanned}; @@ -125,15 +125,15 @@ impl DiagnosticDeriveVariantBuilder { } /// Generates calls to `span_label` and similar functions based on the attributes on fields or - /// calls to `set_arg` when no attributes are present. + /// calls to `arg` when no attributes are present. pub(crate) fn body(&mut self, variant: &VariantInfo<'_>) -> TokenStream { let mut body = quote! {}; - // Generate `set_arg` calls first.. - for binding in variant.bindings().iter().filter(|bi| should_generate_set_arg(bi.ast())) { + // Generate `arg` calls first.. + for binding in variant.bindings().iter().filter(|bi| should_generate_arg(bi.ast())) { body.extend(self.generate_field_code(binding)); } // ..and then subdiagnostic additions. - for binding in variant.bindings().iter().filter(|bi| !should_generate_set_arg(bi.ast())) { + for binding in variant.bindings().iter().filter(|bi| !should_generate_arg(bi.ast())) { body.extend(self.generate_field_attrs_code(binding)); } body @@ -253,7 +253,7 @@ impl DiagnosticDeriveVariantBuilder { let ident = format_ident!("{}", ident); // strip `r#` prefix, if present quote! { - diag.set_arg( + diag.arg( stringify!(#ident), #field_binding ); @@ -312,7 +312,7 @@ impl DiagnosticDeriveVariantBuilder { let name = ident.to_string(); match (&attr.meta, name.as_str()) { // Don't need to do anything - by virtue of the attribute existing, the - // `set_arg` call will not be generated. + // `arg` call will not be generated. (Meta::Path(_), "skip_arg") => return Ok(quote! {}), (Meta::Path(_), "primary_span") => { match self.kind { @@ -320,7 +320,7 @@ impl DiagnosticDeriveVariantBuilder { report_error_if_not_applied_to_span(attr, &info)?; return Ok(quote! { - diag.set_span(#binding); + diag.span(#binding); }); } DiagnosticDeriveKind::LintDiagnostic => { diff --git a/compiler/rustc_macros/src/diagnostics/subdiagnostic.rs b/compiler/rustc_macros/src/diagnostics/subdiagnostic.rs index 663abecb67c..c029b931e7d 100644 --- a/compiler/rustc_macros/src/diagnostics/subdiagnostic.rs +++ b/compiler/rustc_macros/src/diagnostics/subdiagnostic.rs @@ -6,8 +6,8 @@ use crate::diagnostics::error::{ use crate::diagnostics::utils::{ build_field_mapping, build_suggestion_code, is_doc_comment, new_code_ident, report_error_if_not_applied_to_applicability, report_error_if_not_applied_to_span, - should_generate_set_arg, AllowMultipleAlternatives, FieldInfo, FieldInnerTy, FieldMap, - HasFieldMap, SetOnce, SpannedOption, SubdiagnosticKind, + should_generate_arg, AllowMultipleAlternatives, FieldInfo, FieldInnerTy, FieldMap, HasFieldMap, + SetOnce, SpannedOption, SubdiagnosticKind, }; use proc_macro2::TokenStream; use quote::{format_ident, quote}; @@ -214,7 +214,7 @@ impl<'parent, 'a> SubdiagnosticDeriveVariantBuilder<'parent, 'a> { } /// Generates the code for a field with no attributes. - fn generate_field_set_arg(&mut self, binding_info: &BindingInfo<'_>) -> TokenStream { + fn generate_field_arg(&mut self, binding_info: &BindingInfo<'_>) -> TokenStream { let diag = &self.parent.diag; let field = binding_info.ast(); @@ -225,7 +225,7 @@ impl<'parent, 'a> SubdiagnosticDeriveVariantBuilder<'parent, 'a> { let ident = format_ident!("{}", ident); // strip `r#` prefix, if present quote! { - #diag.set_arg( + #diag.arg( stringify!(#ident), #field_binding ); @@ -505,7 +505,7 @@ impl<'parent, 'a> SubdiagnosticDeriveVariantBuilder<'parent, 'a> { .variant .bindings() .iter() - .filter(|binding| !should_generate_set_arg(binding.ast())) + .filter(|binding| !should_generate_arg(binding.ast())) .map(|binding| self.generate_field_attr_code(binding, kind_stats)) .collect(); @@ -593,8 +593,8 @@ impl<'parent, 'a> SubdiagnosticDeriveVariantBuilder<'parent, 'a> { .variant .bindings() .iter() - .filter(|binding| should_generate_set_arg(binding.ast())) - .map(|binding| self.generate_field_set_arg(binding)) + .filter(|binding| should_generate_arg(binding.ast())) + .map(|binding| self.generate_field_arg(binding)) .collect(); let formatting_init = &self.formatting_init; diff --git a/compiler/rustc_macros/src/diagnostics/utils.rs b/compiler/rustc_macros/src/diagnostics/utils.rs index 2700f02e33a..4684306e235 100644 --- a/compiler/rustc_macros/src/diagnostics/utils.rs +++ b/compiler/rustc_macros/src/diagnostics/utils.rs @@ -584,7 +584,7 @@ pub(super) enum SubdiagnosticKind { suggestion_kind: SuggestionKind, applicability: SpannedOption<Applicability>, /// Identifier for variable used for formatted code, e.g. `___code_0`. Enables separation - /// of formatting and diagnostic emission so that `set_arg` calls can happen in-between.. + /// of formatting and diagnostic emission so that `arg` calls can happen in-between.. code_field: syn::Ident, /// Initialization logic for `code_field`'s variable, e.g. /// `let __formatted_code = /* whatever */;` @@ -863,9 +863,9 @@ impl quote::IdentFragment for SubdiagnosticKind { } } -/// Returns `true` if `field` should generate a `set_arg` call rather than any other diagnostic +/// Returns `true` if `field` should generate a `arg` call rather than any other diagnostic /// call (like `span_label`). -pub(super) fn should_generate_set_arg(field: &Field) -> bool { +pub(super) fn should_generate_arg(field: &Field) -> bool { // Perhaps this should be an exhaustive list... field.attrs.iter().all(|attr| is_doc_comment(attr)) } diff --git a/compiler/rustc_metadata/src/errors.rs b/compiler/rustc_metadata/src/errors.rs index e13068cb6f9..27c26d31781 100644 --- a/compiler/rustc_metadata/src/errors.rs +++ b/compiler/rustc_metadata/src/errors.rs @@ -500,10 +500,10 @@ pub(crate) struct MultipleCandidates { impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for MultipleCandidates { fn into_diagnostic(self, dcx: &'_ DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::metadata_multiple_candidates); - diag.set_arg("crate_name", self.crate_name); - diag.set_arg("flavor", self.flavor); + diag.arg("crate_name", self.crate_name); + diag.arg("flavor", self.flavor); diag.code(error_code!(E0464)); - diag.set_span(self.span); + diag.span(self.span); for (i, candidate) in self.candidates.iter().enumerate() { diag.note(format!("candidate #{}: {}", i + 1, candidate.display())); } @@ -596,10 +596,10 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for InvalidMetadataFiles { #[track_caller] fn into_diagnostic(self, dcx: &'_ DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::metadata_invalid_meta_files); - diag.set_arg("crate_name", self.crate_name); - diag.set_arg("add_info", self.add_info); + diag.arg("crate_name", self.crate_name); + diag.arg("add_info", self.add_info); diag.code(error_code!(E0786)); - diag.set_span(self.span); + diag.span(self.span); for crate_rejection in self.crate_rejections { diag.note(crate_rejection); } @@ -623,12 +623,12 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for CannotFindCrate { #[track_caller] fn into_diagnostic(self, dcx: &'_ DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::metadata_cannot_find_crate); - diag.set_arg("crate_name", self.crate_name); - diag.set_arg("current_crate", self.current_crate); - diag.set_arg("add_info", self.add_info); - diag.set_arg("locator_triple", self.locator_triple.triple()); + diag.arg("crate_name", self.crate_name); + diag.arg("current_crate", self.current_crate); + diag.arg("add_info", self.add_info); + diag.arg("locator_triple", self.locator_triple.triple()); diag.code(error_code!(E0463)); - diag.set_span(self.span); + diag.span(self.span); if (self.crate_name == sym::std || self.crate_name == sym::core) && self.locator_triple != TargetTriple::from_triple(config::host_triple()) { diff --git a/compiler/rustc_middle/src/lint.rs b/compiler/rustc_middle/src/lint.rs index ae432a04065..d45ec8e4646 100644 --- a/compiler/rustc_middle/src/lint.rs +++ b/compiler/rustc_middle/src/lint.rs @@ -314,14 +314,14 @@ pub fn struct_lint_level( } Level::ForceWarn(Some(expect_id)) => rustc_errors::Level::Warning(Some(expect_id)), Level::Warn | Level::ForceWarn(None) => rustc_errors::Level::Warning(None), - Level::Deny | Level::Forbid => rustc_errors::Level::Error { lint: true }, + Level::Deny | Level::Forbid => rustc_errors::Level::Error, }; let mut err = DiagnosticBuilder::new(sess.dcx(), err_level, ""); if let Some(span) = span { - err.set_span(span); + err.span(span); } - err.set_is_lint(); + err.is_lint(); // If this code originates in a foreign macro, aka something that this crate // did not itself author, then it's likely that there's nothing this crate @@ -348,7 +348,7 @@ pub fn struct_lint_level( // Delay evaluating and setting the primary message until after we've // suppressed the lint due to macros. - err.set_primary_message(msg); + err.primary_message(msg); // Lint diagnostics that are covered by the expect level will not be emitted outside // the compiler. It is therefore not necessary to add any information for the user. diff --git a/compiler/rustc_middle/src/mir/interpret/error.rs b/compiler/rustc_middle/src/mir/interpret/error.rs index e6536074f35..1b4e9c28635 100644 --- a/compiler/rustc_middle/src/mir/interpret/error.rs +++ b/compiler/rustc_middle/src/mir/interpret/error.rs @@ -2,14 +2,10 @@ use super::{AllocId, AllocRange, Pointer, Scalar}; use crate::error; use crate::mir::{ConstAlloc, ConstValue}; -use crate::query::TyCtxtAt; use crate::ty::{layout, tls, Ty, TyCtxt, ValTree}; use rustc_data_structures::sync::Lock; -use rustc_errors::{ - struct_span_err, DiagnosticArgValue, DiagnosticBuilder, DiagnosticMessage, ErrorGuaranteed, - IntoDiagnosticArg, -}; +use rustc_errors::{DiagnosticArgValue, DiagnosticMessage, ErrorGuaranteed, IntoDiagnosticArg}; use rustc_macros::HashStable; use rustc_session::CtfeBacktrace; use rustc_span::{def_id::DefId, Span, DUMMY_SP}; @@ -90,10 +86,6 @@ pub type EvalToConstValueResult<'tcx> = Result<ConstValue<'tcx>, ErrorHandled>; /// This is needed in `thir::pattern::lower_inline_const`. pub type EvalToValTreeResult<'tcx> = Result<Option<ValTree<'tcx>>, ErrorHandled>; -pub fn struct_error<'tcx>(tcx: TyCtxtAt<'tcx>, msg: &str) -> DiagnosticBuilder<'tcx> { - struct_span_err!(tcx.dcx(), tcx.span, E0080, "{}", msg) -} - #[cfg(all(target_arch = "x86_64", target_pointer_width = "64"))] static_assert_size!(InterpErrorInfo<'_>, 8); diff --git a/compiler/rustc_middle/src/mir/interpret/mod.rs b/compiler/rustc_middle/src/mir/interpret/mod.rs index 2db56008553..0da3524e055 100644 --- a/compiler/rustc_middle/src/mir/interpret/mod.rs +++ b/compiler/rustc_middle/src/mir/interpret/mod.rs @@ -142,12 +142,11 @@ use crate::ty::GenericArgKind; use crate::ty::{self, Instance, Ty, TyCtxt}; pub use self::error::{ - struct_error, BadBytesAccess, CheckAlignMsg, CheckInAllocMsg, ErrorHandled, - EvalToAllocationRawResult, EvalToConstValueResult, EvalToValTreeResult, ExpectedKind, - InterpError, InterpErrorInfo, InterpResult, InvalidMetaKind, InvalidProgramInfo, - MachineStopType, Misalignment, PointerKind, ReportedErrorInfo, ResourceExhaustionInfo, - ScalarSizeMismatch, UndefinedBehaviorInfo, UnsupportedOpInfo, ValidationErrorInfo, - ValidationErrorKind, + BadBytesAccess, CheckAlignMsg, CheckInAllocMsg, ErrorHandled, EvalToAllocationRawResult, + EvalToConstValueResult, EvalToValTreeResult, ExpectedKind, InterpError, InterpErrorInfo, + InterpResult, InvalidMetaKind, InvalidProgramInfo, MachineStopType, Misalignment, PointerKind, + ReportedErrorInfo, ResourceExhaustionInfo, ScalarSizeMismatch, UndefinedBehaviorInfo, + UnsupportedOpInfo, ValidationErrorInfo, ValidationErrorKind, }; pub use self::value::Scalar; diff --git a/compiler/rustc_middle/src/mir/mod.rs b/compiler/rustc_middle/src/mir/mod.rs index 01ad3aefffa..f0885f79657 100644 --- a/compiler/rustc_middle/src/mir/mod.rs +++ b/compiler/rustc_middle/src/mir/mod.rs @@ -55,7 +55,6 @@ pub mod mono; pub mod patch; pub mod pretty; mod query; -pub mod spanview; mod statement; mod syntax; pub mod tcx; @@ -729,7 +728,7 @@ pub struct SourceInfo { pub span: Span, /// The source scope, keeping track of which bindings can be - /// seen by debuginfo, active lint levels, `unsafe {...}`, etc. + /// seen by debuginfo, active lint levels, etc. pub scope: SourceScope, } @@ -951,7 +950,7 @@ pub struct LocalDecl<'tcx> { /// Extra information about a some locals that's used for diagnostics and for /// classifying variables into local variables, statics, etc, which is needed e.g. -/// for unsafety checking. +/// for borrow checking. /// /// Not used for non-StaticRef temporaries, the return place, or anonymous /// function parameters. diff --git a/compiler/rustc_middle/src/mir/pretty.rs b/compiler/rustc_middle/src/mir/pretty.rs index 0b487eae36d..a1e5d73a0fd 100644 --- a/compiler/rustc_middle/src/mir/pretty.rs +++ b/compiler/rustc_middle/src/mir/pretty.rs @@ -5,7 +5,6 @@ use std::io::{self, Write as _}; use std::path::{Path, PathBuf}; use super::graphviz::write_mir_fn_graphviz; -use super::spanview::write_mir_fn_spanview; use rustc_ast::InlineAsmTemplatePiece; use rustc_middle::mir::interpret::{ alloc_range, read_target_uint, AllocBytes, AllocId, Allocation, GlobalAlloc, Pointer, @@ -141,16 +140,6 @@ fn dump_matched_mir_node<'tcx, F>( write_mir_fn_graphviz(tcx, body, false, &mut file)?; }; } - - if let Some(spanview) = tcx.sess.opts.unstable_opts.dump_mir_spanview { - let _: io::Result<()> = try { - let file_basename = dump_file_basename(tcx, pass_num, pass_name, disambiguator, body); - let mut file = create_dump_file_with_basename(tcx, &file_basename, "html")?; - if body.source.def_id().is_local() { - write_mir_fn_spanview(tcx, body, spanview, &file_basename, &mut file)?; - } - }; - } } /// Returns the file basename portion (without extension) of a filename path diff --git a/compiler/rustc_middle/src/mir/spanview.rs b/compiler/rustc_middle/src/mir/spanview.rs deleted file mode 100644 index cb9fc0d37f2..00000000000 --- a/compiler/rustc_middle/src/mir/spanview.rs +++ /dev/null @@ -1,642 +0,0 @@ -use rustc_middle::hir; -use rustc_middle::mir::*; -use rustc_session::config::MirSpanview; -use rustc_span::{BytePos, Pos}; - -use std::cmp; -use std::io::{self, Write}; - -pub const TOOLTIP_INDENT: &str = " "; - -const CARET: char = '\u{2038}'; // Unicode `CARET` -const ANNOTATION_LEFT_BRACKET: char = '\u{298a}'; // Unicode `Z NOTATION RIGHT BINDING BRACKET` -const ANNOTATION_RIGHT_BRACKET: char = '\u{2989}'; // Unicode `Z NOTATION LEFT BINDING BRACKET` -const NEW_LINE_SPAN: &str = "</span>\n<span class=\"line\">"; -const HEADER: &str = r#"<!DOCTYPE html> -<html lang="en"> -<head> -<meta charset="utf-8">"#; -const START_BODY: &str = r#"</head> -<body>"#; -const FOOTER: &str = r#"</body> -</html>"#; - -const STYLE_SECTION: &str = r#"<style> - .line { - counter-increment: line; - } - .line:before { - content: counter(line) ": "; - font-family: Menlo, Monaco, monospace; - font-style: italic; - width: 3.8em; - display: inline-block; - text-align: right; - filter: opacity(50%); - -webkit-user-select: none; - } - .code { - color: #dddddd; - background-color: #222222; - font-family: Menlo, Monaco, monospace; - line-height: 1.4em; - border-bottom: 2px solid #222222; - white-space: pre; - display: inline-block; - } - .odd { - background-color: #55bbff; - color: #223311; - } - .even { - background-color: #ee7756; - color: #551133; - } - .code { - --index: calc(var(--layer) - 1); - padding-top: calc(var(--index) * 0.15em); - filter: - hue-rotate(calc(var(--index) * 25deg)) - saturate(calc(100% - (var(--index) * 2%))) - brightness(calc(100% - (var(--index) * 1.5%))); - } - .annotation { - color: #4444ff; - font-family: monospace; - font-style: italic; - display: none; - -webkit-user-select: none; - } - body:active .annotation { - /* requires holding mouse down anywhere on the page */ - display: inline-block; - } - span:hover .annotation { - /* requires hover over a span ONLY on its first line */ - display: inline-block; - } -</style>"#; - -/// Metadata to highlight the span of a MIR BasicBlock, Statement, or Terminator. -#[derive(Clone, Debug)] -pub struct SpanViewable { - pub bb: BasicBlock, - pub span: Span, - pub id: String, - pub tooltip: String, -} - -/// Write a spanview HTML+CSS file to analyze MIR element spans. -pub fn write_mir_fn_spanview<'tcx, W>( - tcx: TyCtxt<'tcx>, - body: &Body<'tcx>, - spanview: MirSpanview, - title: &str, - w: &mut W, -) -> io::Result<()> -where - W: Write, -{ - let def_id = body.source.def_id(); - let hir_body = hir_body(tcx, def_id); - if hir_body.is_none() { - return Ok(()); - } - let body_span = hir_body.unwrap().value.span; - let mut span_viewables = Vec::new(); - for (bb, data) in body.basic_blocks.iter_enumerated() { - match spanview { - MirSpanview::Statement => { - for (i, statement) in data.statements.iter().enumerate() { - if let Some(span_viewable) = - statement_span_viewable(tcx, body_span, bb, i, statement) - { - span_viewables.push(span_viewable); - } - } - if let Some(span_viewable) = terminator_span_viewable(tcx, body_span, bb, data) { - span_viewables.push(span_viewable); - } - } - MirSpanview::Terminator => { - if let Some(span_viewable) = terminator_span_viewable(tcx, body_span, bb, data) { - span_viewables.push(span_viewable); - } - } - MirSpanview::Block => { - if let Some(span_viewable) = block_span_viewable(tcx, body_span, bb, data) { - span_viewables.push(span_viewable); - } - } - } - } - write_document(tcx, fn_span(tcx, def_id), span_viewables, title, w)?; - Ok(()) -} - -/// Generate a spanview HTML+CSS document for the given local function `def_id`, and a pre-generated -/// list `SpanViewable`s. -pub fn write_document<'tcx, W>( - tcx: TyCtxt<'tcx>, - spanview_span: Span, - mut span_viewables: Vec<SpanViewable>, - title: &str, - w: &mut W, -) -> io::Result<()> -where - W: Write, -{ - let mut from_pos = spanview_span.lo(); - let end_pos = spanview_span.hi(); - let source_map = tcx.sess.source_map(); - let start = source_map.lookup_char_pos(from_pos); - let indent_to_initial_start_col = " ".repeat(start.col.to_usize()); - debug!( - "spanview_span={:?}; source is:\n{}{}", - spanview_span, - indent_to_initial_start_col, - source_map.span_to_snippet(spanview_span).expect("function should have printable source") - ); - writeln!(w, "{HEADER}")?; - writeln!(w, "<title>{title}</title>")?; - writeln!(w, "{STYLE_SECTION}")?; - writeln!(w, "{START_BODY}")?; - write!( - w, - r#"<div class="code" style="counter-reset: line {}"><span class="line">{}"#, - start.line - 1, - indent_to_initial_start_col, - )?; - span_viewables.sort_unstable_by(|a, b| { - let a = a.span; - let b = b.span; - if a.lo() == b.lo() { - // Sort hi() in reverse order so shorter spans are attempted after longer spans. - // This should give shorter spans a higher "layer", so they are not covered by - // the longer spans. - b.hi().partial_cmp(&a.hi()) - } else { - a.lo().partial_cmp(&b.lo()) - } - .unwrap() - }); - let mut ordered_viewables = &span_viewables[..]; - const LOWEST_VIEWABLE_LAYER: usize = 1; - let mut alt = false; - while ordered_viewables.len() > 0 { - debug!( - "calling write_next_viewable with from_pos={}, end_pos={}, and viewables len={}", - from_pos.to_usize(), - end_pos.to_usize(), - ordered_viewables.len() - ); - let curr_id = &ordered_viewables[0].id; - let (next_from_pos, next_ordered_viewables) = write_next_viewable_with_overlaps( - tcx, - from_pos, - end_pos, - ordered_viewables, - alt, - LOWEST_VIEWABLE_LAYER, - w, - )?; - debug!( - "DONE calling write_next_viewable, with new from_pos={}, \ - and remaining viewables len={}", - next_from_pos.to_usize(), - next_ordered_viewables.len() - ); - assert!( - from_pos != next_from_pos || ordered_viewables.len() != next_ordered_viewables.len(), - "write_next_viewable_with_overlaps() must make a state change" - ); - from_pos = next_from_pos; - if next_ordered_viewables.len() != ordered_viewables.len() { - ordered_viewables = next_ordered_viewables; - if let Some(next_ordered_viewable) = ordered_viewables.first() { - if &next_ordered_viewable.id != curr_id { - alt = !alt; - } - } - } - } - if from_pos < end_pos { - write_coverage_gap(tcx, from_pos, end_pos, w)?; - } - writeln!(w, r#"</span></div>"#)?; - writeln!(w, "{FOOTER}")?; - Ok(()) -} - -/// Format a string showing the start line and column, and end line and column within a file. -pub fn source_range_no_file(tcx: TyCtxt<'_>, span: Span) -> String { - let source_map = tcx.sess.source_map(); - let start = source_map.lookup_char_pos(span.lo()); - let end = source_map.lookup_char_pos(span.hi()); - format!("{}:{}-{}:{}", start.line, start.col.to_usize() + 1, end.line, end.col.to_usize() + 1) -} - -fn statement_span_viewable<'tcx>( - tcx: TyCtxt<'tcx>, - body_span: Span, - bb: BasicBlock, - i: usize, - statement: &Statement<'tcx>, -) -> Option<SpanViewable> { - let span = statement.source_info.span; - if !body_span.contains(span) { - return None; - } - let id = format!("{}[{}]", bb.index(), i); - let tooltip = tooltip(tcx, &id, span, vec![statement.clone()], &None); - Some(SpanViewable { bb, span, id, tooltip }) -} - -fn terminator_span_viewable<'tcx>( - tcx: TyCtxt<'tcx>, - body_span: Span, - bb: BasicBlock, - data: &BasicBlockData<'tcx>, -) -> Option<SpanViewable> { - let term = data.terminator(); - let span = term.source_info.span; - if !body_span.contains(span) { - return None; - } - let id = format!("{}:{}", bb.index(), term.kind.name()); - let tooltip = tooltip(tcx, &id, span, vec![], &data.terminator); - Some(SpanViewable { bb, span, id, tooltip }) -} - -fn block_span_viewable<'tcx>( - tcx: TyCtxt<'tcx>, - body_span: Span, - bb: BasicBlock, - data: &BasicBlockData<'tcx>, -) -> Option<SpanViewable> { - let span = compute_block_span(data, body_span); - if !body_span.contains(span) { - return None; - } - let id = format!("{}", bb.index()); - let tooltip = tooltip(tcx, &id, span, data.statements.clone(), &data.terminator); - Some(SpanViewable { bb, span, id, tooltip }) -} - -fn compute_block_span(data: &BasicBlockData<'_>, body_span: Span) -> Span { - let mut span = data.terminator().source_info.span; - for statement_span in data.statements.iter().map(|statement| statement.source_info.span) { - // Only combine Spans from the root context, and within the function's body_span. - if statement_span.ctxt().is_root() && body_span.contains(statement_span) { - span = span.to(statement_span); - } - } - span -} - -/// Recursively process each ordered span. Spans that overlap will have progressively varying -/// styles, such as increased padding for each overlap. Non-overlapping adjacent spans will -/// have alternating style choices, to help distinguish between them if, visually adjacent. -/// The `layer` is incremented for each overlap, and the `alt` bool alternates between true -/// and false, for each adjacent non-overlapping span. Source code between the spans (code -/// that is not in any coverage region) has neutral styling. -fn write_next_viewable_with_overlaps<'tcx, 'b, W>( - tcx: TyCtxt<'tcx>, - mut from_pos: BytePos, - mut to_pos: BytePos, - ordered_viewables: &'b [SpanViewable], - alt: bool, - layer: usize, - w: &mut W, -) -> io::Result<(BytePos, &'b [SpanViewable])> -where - W: Write, -{ - let debug_indent = " ".repeat(layer); - let (viewable, mut remaining_viewables) = - ordered_viewables.split_first().expect("ordered_viewables should have some"); - - if from_pos < viewable.span.lo() { - debug!( - "{}advance from_pos to next SpanViewable (from from_pos={} to viewable.span.lo()={} \ - of {:?}), with to_pos={}", - debug_indent, - from_pos.to_usize(), - viewable.span.lo().to_usize(), - viewable.span, - to_pos.to_usize() - ); - let hi = cmp::min(viewable.span.lo(), to_pos); - write_coverage_gap(tcx, from_pos, hi, w)?; - from_pos = hi; - if from_pos < viewable.span.lo() { - debug!( - "{}EARLY RETURN: stopped before getting to next SpanViewable, at {}", - debug_indent, - from_pos.to_usize() - ); - return Ok((from_pos, ordered_viewables)); - } - } - - if from_pos < viewable.span.hi() { - // Set to_pos to the end of this `viewable` to ensure the recursive calls stop writing - // with room to print the tail. - to_pos = cmp::min(viewable.span.hi(), to_pos); - debug!( - "{}update to_pos (if not closer) to viewable.span.hi()={}; to_pos is now {}", - debug_indent, - viewable.span.hi().to_usize(), - to_pos.to_usize() - ); - } - - let mut subalt = false; - while remaining_viewables.len() > 0 && remaining_viewables[0].span.overlaps(viewable.span) { - let overlapping_viewable = &remaining_viewables[0]; - debug!("{}overlapping_viewable.span={:?}", debug_indent, overlapping_viewable.span); - - let span = - trim_span(viewable.span, from_pos, cmp::min(overlapping_viewable.span.lo(), to_pos)); - let mut some_html_snippet = if from_pos <= viewable.span.hi() || viewable.span.is_empty() { - // `viewable` is not yet fully rendered, so start writing the span, up to either the - // `to_pos` or the next `overlapping_viewable`, whichever comes first. - debug!( - "{}make html_snippet (may not write it if early exit) for partial span {:?} \ - of viewable.span {:?}", - debug_indent, span, viewable.span - ); - from_pos = span.hi(); - make_html_snippet(tcx, span, Some(viewable)) - } else { - None - }; - - // Defer writing the HTML snippet (until after early return checks) ONLY for empty spans. - // An empty Span with Some(html_snippet) is probably a tail marker. If there is an early - // exit, there should be another opportunity to write the tail marker. - if !span.is_empty() { - if let Some(ref html_snippet) = some_html_snippet { - debug!( - "{}write html_snippet for that partial span of viewable.span {:?}", - debug_indent, viewable.span - ); - write_span(html_snippet, &viewable.tooltip, alt, layer, w)?; - } - some_html_snippet = None; - } - - if from_pos < overlapping_viewable.span.lo() { - debug!( - "{}EARLY RETURN: from_pos={} has not yet reached the \ - overlapping_viewable.span {:?}", - debug_indent, - from_pos.to_usize(), - overlapping_viewable.span - ); - // must have reached `to_pos` before reaching the start of the - // `overlapping_viewable.span` - return Ok((from_pos, ordered_viewables)); - } - - if from_pos == to_pos - && !(from_pos == overlapping_viewable.span.lo() && overlapping_viewable.span.is_empty()) - { - debug!( - "{}EARLY RETURN: from_pos=to_pos={} and overlapping_viewable.span {:?} is not \ - empty, or not from_pos", - debug_indent, - to_pos.to_usize(), - overlapping_viewable.span - ); - // `to_pos` must have occurred before the overlapping viewable. Return - // `ordered_viewables` so we can continue rendering the `viewable`, from after the - // `to_pos`. - return Ok((from_pos, ordered_viewables)); - } - - if let Some(ref html_snippet) = some_html_snippet { - debug!( - "{}write html_snippet for that partial span of viewable.span {:?}", - debug_indent, viewable.span - ); - write_span(html_snippet, &viewable.tooltip, alt, layer, w)?; - } - - debug!( - "{}recursively calling write_next_viewable with from_pos={}, to_pos={}, \ - and viewables len={}", - debug_indent, - from_pos.to_usize(), - to_pos.to_usize(), - remaining_viewables.len() - ); - // Write the overlaps (and the overlaps' overlaps, if any) up to `to_pos`. - let curr_id = &remaining_viewables[0].id; - let (next_from_pos, next_remaining_viewables) = write_next_viewable_with_overlaps( - tcx, - from_pos, - to_pos, - remaining_viewables, - subalt, - layer + 1, - w, - )?; - debug!( - "{}DONE recursively calling write_next_viewable, with new from_pos={}, and remaining \ - viewables len={}", - debug_indent, - next_from_pos.to_usize(), - next_remaining_viewables.len() - ); - assert!( - from_pos != next_from_pos - || remaining_viewables.len() != next_remaining_viewables.len(), - "write_next_viewable_with_overlaps() must make a state change" - ); - from_pos = next_from_pos; - if next_remaining_viewables.len() != remaining_viewables.len() { - remaining_viewables = next_remaining_viewables; - if let Some(next_ordered_viewable) = remaining_viewables.first() { - if &next_ordered_viewable.id != curr_id { - subalt = !subalt; - } - } - } - } - if from_pos <= viewable.span.hi() { - let span = trim_span(viewable.span, from_pos, to_pos); - debug!( - "{}After overlaps, writing (end span?) {:?} of viewable.span {:?}", - debug_indent, span, viewable.span - ); - if let Some(ref html_snippet) = make_html_snippet(tcx, span, Some(viewable)) { - from_pos = span.hi(); - write_span(html_snippet, &viewable.tooltip, alt, layer, w)?; - } - } - debug!("{}RETURN: No more overlap", debug_indent); - Ok(( - from_pos, - if from_pos < viewable.span.hi() { ordered_viewables } else { remaining_viewables }, - )) -} - -#[inline(always)] -fn write_coverage_gap<W>(tcx: TyCtxt<'_>, lo: BytePos, hi: BytePos, w: &mut W) -> io::Result<()> -where - W: Write, -{ - let span = Span::with_root_ctxt(lo, hi); - if let Some(ref html_snippet) = make_html_snippet(tcx, span, None) { - write_span(html_snippet, "", false, 0, w) - } else { - Ok(()) - } -} - -fn write_span<W>( - html_snippet: &str, - tooltip: &str, - alt: bool, - layer: usize, - w: &mut W, -) -> io::Result<()> -where - W: Write, -{ - let maybe_alt_class = if layer > 0 { if alt { " odd" } else { " even" } } else { "" }; - let maybe_title_attr = if !tooltip.is_empty() { - format!(" title=\"{}\"", escape_attr(tooltip)) - } else { - "".to_owned() - }; - if layer == 1 { - write!(w, "<span>")?; - } - for (i, line) in html_snippet.lines().enumerate() { - if i > 0 { - write!(w, "{NEW_LINE_SPAN}")?; - } - write!( - w, - r#"<span class="code{maybe_alt_class}" style="--layer: {layer}"{maybe_title_attr}>{line}</span>"# - )?; - } - // Check for and translate trailing newlines, because `str::lines()` ignores them - if html_snippet.ends_with('\n') { - write!(w, "{NEW_LINE_SPAN}")?; - } - if layer == 1 { - write!(w, "</span>")?; - } - Ok(()) -} - -fn make_html_snippet( - tcx: TyCtxt<'_>, - span: Span, - some_viewable: Option<&SpanViewable>, -) -> Option<String> { - let source_map = tcx.sess.source_map(); - let snippet = source_map - .span_to_snippet(span) - .unwrap_or_else(|err| bug!("span_to_snippet error for span {:?}: {:?}", span, err)); - let html_snippet = if let Some(viewable) = some_viewable { - let is_head = span.lo() == viewable.span.lo(); - let is_tail = span.hi() == viewable.span.hi(); - let mut labeled_snippet = if is_head { - format!(r#"<span class="annotation">{}{}</span>"#, viewable.id, ANNOTATION_LEFT_BRACKET) - } else { - "".to_owned() - }; - if span.is_empty() { - if is_head && is_tail { - labeled_snippet.push(CARET); - } - } else { - labeled_snippet.push_str(&escape_html(&snippet)); - }; - if is_tail { - labeled_snippet.push_str(&format!( - r#"<span class="annotation">{}{}</span>"#, - ANNOTATION_RIGHT_BRACKET, viewable.id - )); - } - labeled_snippet - } else { - escape_html(&snippet) - }; - if html_snippet.is_empty() { None } else { Some(html_snippet) } -} - -fn tooltip<'tcx>( - tcx: TyCtxt<'tcx>, - spanview_id: &str, - span: Span, - statements: Vec<Statement<'tcx>>, - terminator: &Option<Terminator<'tcx>>, -) -> String { - let source_map = tcx.sess.source_map(); - let mut text = Vec::new(); - text.push(format!("{}: {}:", spanview_id, &source_map.span_to_embeddable_string(span))); - for statement in statements { - let source_range = source_range_no_file(tcx, statement.source_info.span); - text.push(format!( - "\n{}{}: {}: {:?}", - TOOLTIP_INDENT, - source_range, - statement.kind.name(), - statement - )); - } - if let Some(term) = terminator { - let source_range = source_range_no_file(tcx, term.source_info.span); - text.push(format!( - "\n{}{}: {}: {:?}", - TOOLTIP_INDENT, - source_range, - term.kind.name(), - term.kind - )); - } - text.join("") -} - -fn trim_span(span: Span, from_pos: BytePos, to_pos: BytePos) -> Span { - trim_span_hi(trim_span_lo(span, from_pos), to_pos) -} - -fn trim_span_lo(span: Span, from_pos: BytePos) -> Span { - if from_pos <= span.lo() { span } else { span.with_lo(cmp::min(span.hi(), from_pos)) } -} - -fn trim_span_hi(span: Span, to_pos: BytePos) -> Span { - if to_pos >= span.hi() { span } else { span.with_hi(cmp::max(span.lo(), to_pos)) } -} - -fn fn_span(tcx: TyCtxt<'_>, def_id: DefId) -> Span { - let fn_decl_span = tcx.def_span(def_id); - if let Some(body_span) = hir_body(tcx, def_id).map(|hir_body| hir_body.value.span) { - if fn_decl_span.eq_ctxt(body_span) { fn_decl_span.to(body_span) } else { body_span } - } else { - fn_decl_span - } -} - -fn hir_body(tcx: TyCtxt<'_>, def_id: DefId) -> Option<&rustc_hir::Body<'_>> { - let hir_node = tcx.hir().get_if_local(def_id).expect("expected DefId is local"); - hir::map::associated_body(hir_node).map(|(_, fn_body_id)| tcx.hir().body(fn_body_id)) -} - -fn escape_html(s: &str) -> String { - s.replace('&', "&").replace('<', "<").replace('>', ">") -} - -fn escape_attr(s: &str) -> String { - s.replace('&', "&") - .replace('\"', """) - .replace('\'', "'") - .replace('<', "<") - .replace('>', ">") -} diff --git a/compiler/rustc_middle/src/query/mod.rs b/compiler/rustc_middle/src/query/mod.rs index 3a54f5f6b3d..bf5e59ba78d 100644 --- a/compiler/rustc_middle/src/query/mod.rs +++ b/compiler/rustc_middle/src/query/mod.rs @@ -869,15 +869,14 @@ rustc_queries! { desc { |tcx| "collecting all inherent impls for `{:?}`", key } } - /// The result of unsafety-checking this `LocalDefId`. - query unsafety_check_result(key: LocalDefId) -> &'tcx mir::UnsafetyCheckResult { + /// The result of unsafety-checking this `LocalDefId` with the old checker. + query mir_unsafety_check_result(key: LocalDefId) -> &'tcx mir::UnsafetyCheckResult { desc { |tcx| "unsafety-checking `{}`", tcx.def_path_str(key) } cache_on_disk_if { true } } - /// Unsafety-check this `LocalDefId` with THIR unsafeck. This should be - /// used with `-Zthir-unsafeck`. - query thir_check_unsafety(key: LocalDefId) { + /// Unsafety-check this `LocalDefId`. + query check_unsafety(key: LocalDefId) { desc { |tcx| "unsafety-checking `{}`", tcx.def_path_str(key) } cache_on_disk_if { true } } @@ -938,10 +937,6 @@ rustc_queries! { desc { |tcx| "checking naked functions in {}", describe_as_module(key, tcx) } } - query check_mod_item_types(key: LocalModDefId) -> () { - desc { |tcx| "checking item types in {}", describe_as_module(key, tcx) } - } - query check_mod_privacy(key: LocalModDefId) -> () { desc { |tcx| "checking privacy in {}", describe_as_module(key.to_local_def_id(), tcx) } } diff --git a/compiler/rustc_middle/src/thir.rs b/compiler/rustc_middle/src/thir.rs index b6759d35210..2b5983314ee 100644 --- a/compiler/rustc_middle/src/thir.rs +++ b/compiler/rustc_middle/src/thir.rs @@ -519,20 +519,13 @@ pub struct FruInfo<'tcx> { #[derive(Clone, Debug, HashStable)] pub struct Arm<'tcx> { pub pattern: Box<Pat<'tcx>>, - pub guard: Option<Guard<'tcx>>, + pub guard: Option<ExprId>, pub body: ExprId, pub lint_level: LintLevel, pub scope: region::Scope, pub span: Span, } -/// A `match` guard. -#[derive(Clone, Debug, HashStable)] -pub enum Guard<'tcx> { - If(ExprId), - IfLet(Box<Pat<'tcx>>, ExprId), -} - #[derive(Copy, Clone, Debug, HashStable)] pub enum LogicalOp { /// The `&&` operator. diff --git a/compiler/rustc_middle/src/thir/visit.rs b/compiler/rustc_middle/src/thir/visit.rs index ade3ea289cc..4847a7bea91 100644 --- a/compiler/rustc_middle/src/thir/visit.rs +++ b/compiler/rustc_middle/src/thir/visit.rs @@ -1,5 +1,5 @@ use super::{ - AdtExpr, Arm, Block, ClosureExpr, Expr, ExprKind, Guard, InlineAsmExpr, InlineAsmOperand, Pat, + AdtExpr, Arm, Block, ClosureExpr, Expr, ExprKind, InlineAsmExpr, InlineAsmOperand, Pat, PatKind, Stmt, StmtKind, Thir, }; @@ -213,13 +213,8 @@ pub fn walk_arm<'thir, 'tcx: 'thir, V: Visitor<'thir, 'tcx>>( visitor: &mut V, arm: &'thir Arm<'tcx>, ) { - match arm.guard { - Some(Guard::If(expr)) => visitor.visit_expr(&visitor.thir()[expr]), - Some(Guard::IfLet(ref pat, expr)) => { - visitor.visit_pat(pat); - visitor.visit_expr(&visitor.thir()[expr]); - } - None => {} + if let Some(expr) = arm.guard { + visitor.visit_expr(&visitor.thir()[expr]) } visitor.visit_pat(&arm.pattern); visitor.visit_expr(&visitor.thir()[arm.body]); diff --git a/compiler/rustc_middle/src/traits/mod.rs b/compiler/rustc_middle/src/traits/mod.rs index 09b0a0dfbf3..af601a0d702 100644 --- a/compiler/rustc_middle/src/traits/mod.rs +++ b/compiler/rustc_middle/src/traits/mod.rs @@ -289,7 +289,7 @@ pub enum ObligationCauseCode<'tcx> { /// Type of each variable must be `Sized`. VariableType(hir::HirId), /// Argument type must be `Sized`. - SizedArgumentType(Option<Span>), + SizedArgumentType(Option<hir::HirId>), /// Return type must be `Sized`. SizedReturnType, /// Yield type must be `Sized`. diff --git a/compiler/rustc_middle/src/ty/print/pretty.rs b/compiler/rustc_middle/src/ty/print/pretty.rs index ebbd02e01bf..dadd4de2bf9 100644 --- a/compiler/rustc_middle/src/ty/print/pretty.rs +++ b/compiler/rustc_middle/src/ty/print/pretty.rs @@ -912,7 +912,8 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { let mut traits = FxIndexMap::default(); let mut fn_traits = FxIndexMap::default(); - let mut is_sized = false; + let mut has_sized_bound = false; + let mut has_negative_sized_bound = false; let mut lifetimes = SmallVec::<[ty::Region<'tcx>; 1]>::new(); for (predicate, _) in bounds.iter_instantiated_copied(tcx, args) { @@ -922,13 +923,24 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { ty::ClauseKind::Trait(pred) => { let trait_ref = bound_predicate.rebind(pred.trait_ref); - // Don't print + Sized, but rather + ?Sized if absent. + // Don't print `+ Sized`, but rather `+ ?Sized` if absent. if Some(trait_ref.def_id()) == tcx.lang_items().sized_trait() { - is_sized = true; - continue; + match pred.polarity { + ty::ImplPolarity::Positive | ty::ImplPolarity::Reservation => { + has_sized_bound = true; + continue; + } + ty::ImplPolarity::Negative => has_negative_sized_bound = true, + } } - self.insert_trait_and_projection(trait_ref, None, &mut traits, &mut fn_traits); + self.insert_trait_and_projection( + trait_ref, + pred.polarity, + None, + &mut traits, + &mut fn_traits, + ); } ty::ClauseKind::Projection(pred) => { let proj_ref = bound_predicate.rebind(pred); @@ -939,6 +951,7 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { self.insert_trait_and_projection( trait_ref, + ty::ImplPolarity::Positive, Some(proj_ty), &mut traits, &mut fn_traits, @@ -955,7 +968,7 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { let mut first = true; // Insert parenthesis around (Fn(A, B) -> C) if the opaque ty has more than one other trait - let paren_needed = fn_traits.len() > 1 || traits.len() > 0 || !is_sized; + let paren_needed = fn_traits.len() > 1 || traits.len() > 0 || !has_sized_bound; for (fn_once_trait_ref, entry) in fn_traits { write!(self, "{}", if first { "" } else { " + " })?; @@ -1002,18 +1015,21 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { // trait_refs we collected in the OpaqueFnEntry as normal trait refs. _ => { if entry.has_fn_once { - traits.entry(fn_once_trait_ref).or_default().extend( - // Group the return ty with its def id, if we had one. - entry - .return_ty - .map(|ty| (tcx.require_lang_item(LangItem::FnOnce, None), ty)), - ); + traits + .entry((fn_once_trait_ref, ty::ImplPolarity::Positive)) + .or_default() + .extend( + // Group the return ty with its def id, if we had one. + entry.return_ty.map(|ty| { + (tcx.require_lang_item(LangItem::FnOnce, None), ty) + }), + ); } if let Some(trait_ref) = entry.fn_mut_trait_ref { - traits.entry(trait_ref).or_default(); + traits.entry((trait_ref, ty::ImplPolarity::Positive)).or_default(); } if let Some(trait_ref) = entry.fn_trait_ref { - traits.entry(trait_ref).or_default(); + traits.entry((trait_ref, ty::ImplPolarity::Positive)).or_default(); } } } @@ -1023,11 +1039,15 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { } // Print the rest of the trait types (that aren't Fn* family of traits) - for (trait_ref, assoc_items) in traits { + for ((trait_ref, polarity), assoc_items) in traits { write!(self, "{}", if first { "" } else { " + " })?; self.wrap_binder(&trait_ref, |trait_ref, cx| { define_scoped_cx!(cx); + + if polarity == ty::ImplPolarity::Negative { + p!("!"); + } p!(print(trait_ref.print_only_trait_name())); let generics = tcx.generics_of(trait_ref.def_id); @@ -1094,9 +1114,15 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { })?; } - if !is_sized { - write!(self, "{}?Sized", if first { "" } else { " + " })?; - } else if first { + let add_sized = has_sized_bound && (first || has_negative_sized_bound); + let add_maybe_sized = !has_sized_bound && !has_negative_sized_bound; + if add_sized || add_maybe_sized { + if !first { + write!(self, " + ")?; + } + if add_maybe_sized { + write!(self, "?")?; + } write!(self, "Sized")?; } @@ -1128,9 +1154,10 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { fn insert_trait_and_projection( &mut self, trait_ref: ty::PolyTraitRef<'tcx>, + polarity: ty::ImplPolarity, proj_ty: Option<(DefId, ty::Binder<'tcx, Term<'tcx>>)>, traits: &mut FxIndexMap< - ty::PolyTraitRef<'tcx>, + (ty::PolyTraitRef<'tcx>, ty::ImplPolarity), FxIndexMap<DefId, ty::Binder<'tcx, Term<'tcx>>>, >, fn_traits: &mut FxIndexMap<ty::PolyTraitRef<'tcx>, OpaqueFnEntry<'tcx>>, @@ -1139,7 +1166,10 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { // If our trait_ref is FnOnce or any of its children, project it onto the parent FnOnce // super-trait ref and record it there. - if let Some(fn_once_trait) = self.tcx().lang_items().fn_once_trait() { + // We skip negative Fn* bounds since they can't use parenthetical notation anyway. + if polarity == ty::ImplPolarity::Positive + && let Some(fn_once_trait) = self.tcx().lang_items().fn_once_trait() + { // If we have a FnOnce, then insert it into if trait_def_id == fn_once_trait { let entry = fn_traits.entry(trait_ref).or_default(); @@ -1167,7 +1197,7 @@ pub trait PrettyPrinter<'tcx>: Printer<'tcx> + fmt::Write { } // Otherwise, just group our traits and projection types. - traits.entry(trait_ref).or_default().extend(proj_ty); + traits.entry((trait_ref, polarity)).or_default().extend(proj_ty); } fn pretty_print_inherent_projection( diff --git a/compiler/rustc_middle/src/ty/util.rs b/compiler/rustc_middle/src/ty/util.rs index ad2442a7963..3a6fbaec9fd 100644 --- a/compiler/rustc_middle/src/ty/util.rs +++ b/compiler/rustc_middle/src/ty/util.rs @@ -1483,7 +1483,7 @@ pub fn reveal_opaque_types_in_bounds<'tcx>( val.fold_with(&mut visitor) } -/// Determines whether an item is annotated with `doc(hidden)`. +/// Determines whether an item is directly annotated with `doc(hidden)`. fn is_doc_hidden(tcx: TyCtxt<'_>, def_id: LocalDefId) -> bool { tcx.get_attrs(def_id, sym::doc) .filter_map(|attr| attr.meta_item_list()) diff --git a/compiler/rustc_mir_build/src/build/custom/parse/instruction.rs b/compiler/rustc_mir_build/src/build/custom/parse/instruction.rs index 4ce7f831c87..e3dea2212df 100644 --- a/compiler/rustc_mir_build/src/build/custom/parse/instruction.rs +++ b/compiler/rustc_mir_build/src/build/custom/parse/instruction.rs @@ -61,7 +61,7 @@ impl<'tcx, 'body> ParseCtxt<'tcx, 'body> { @call(mir_drop, args) => { Ok(TerminatorKind::Drop { place: self.parse_place(args[0])?, - target: self.parse_block(args[1])?, + target: self.parse_return_to(args[1])?, unwind: self.parse_unwind_action(args[2])?, replace: false, }) @@ -104,6 +104,14 @@ impl<'tcx, 'body> ParseCtxt<'tcx, 'body> { ) } + fn parse_return_to(&self, expr_id: ExprId) -> PResult<BasicBlock> { + parse_by_kind!(self, expr_id, _, "return block", + @call(mir_return_to, args) => { + self.parse_block(args[0]) + }, + ) + } + fn parse_match(&self, arms: &[ArmId], span: Span) -> PResult<SwitchTargets> { let Some((otherwise, rest)) = arms.split_last() else { return Err(ParseError { @@ -146,7 +154,7 @@ impl<'tcx, 'body> ParseCtxt<'tcx, 'body> { ExprKind::Assign { lhs, rhs } => (*lhs, *rhs), ); let destination = self.parse_place(destination)?; - let target = self.parse_block(args[1])?; + let target = self.parse_return_to(args[1])?; let unwind = self.parse_unwind_action(args[2])?; parse_by_kind!(self, call, _, "function call", diff --git a/compiler/rustc_mir_build/src/build/expr/into.rs b/compiler/rustc_mir_build/src/build/expr/into.rs index f50945a4de0..060a3b521a4 100644 --- a/compiler/rustc_mir_build/src/build/expr/into.rs +++ b/compiler/rustc_mir_build/src/build/expr/into.rs @@ -82,7 +82,8 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { cond, Some(condition_scope), condition_scope, - source_info + source_info, + true, )); this.expr_into_dest(destination, then_blk, then) @@ -173,6 +174,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { Some(condition_scope), condition_scope, source_info, + true, ) }); let (short_circuit, continuation, constant) = match op { diff --git a/compiler/rustc_mir_build/src/build/matches/mod.rs b/compiler/rustc_mir_build/src/build/matches/mod.rs index 7f29e3308f4..906b3205ca7 100644 --- a/compiler/rustc_mir_build/src/build/matches/mod.rs +++ b/compiler/rustc_mir_build/src/build/matches/mod.rs @@ -33,6 +33,12 @@ use std::borrow::Borrow; use std::mem; impl<'a, 'tcx> Builder<'a, 'tcx> { + /// Lowers a condition in a way that ensures that variables bound in any let + /// expressions are definitely initialized in the if body. + /// + /// If `declare_bindings` is false then variables created in `let` + /// expressions will not be declared. This is for if let guards on arms with + /// an or pattern, where the guard is lowered multiple times. pub(crate) fn then_else_break( &mut self, mut block: BasicBlock, @@ -40,6 +46,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override: Option<region::Scope>, break_scope: region::Scope, variable_source_info: SourceInfo, + declare_bindings: bool, ) -> BlockAnd<()> { let this = self; let expr = &this.thir[expr_id]; @@ -53,6 +60,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, break_scope, variable_source_info, + declare_bindings, )); let rhs_then_block = unpack!(this.then_else_break( @@ -61,6 +69,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, break_scope, variable_source_info, + declare_bindings, )); rhs_then_block.unit() @@ -75,6 +84,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, local_scope, variable_source_info, + true, ) }); let rhs_success_block = unpack!(this.then_else_break( @@ -83,6 +93,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, break_scope, variable_source_info, + true, )); this.cfg.goto(lhs_success_block, variable_source_info, rhs_success_block); rhs_success_block.unit() @@ -102,6 +113,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, local_scope, variable_source_info, + true, ) }); this.break_for_else(success_block, break_scope, variable_source_info); @@ -116,6 +128,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, break_scope, variable_source_info, + declare_bindings, ) }) } @@ -125,6 +138,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { temp_scope_override, break_scope, variable_source_info, + declare_bindings, ), ExprKind::Let { expr, ref pat } => this.lower_let_expr( block, @@ -133,7 +147,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { break_scope, Some(variable_source_info.scope), variable_source_info.span, - true, + declare_bindings, ), _ => { let temp_scope = temp_scope_override.unwrap_or_else(|| this.local_scope()); @@ -417,7 +431,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { None, arm.span, &arm.pattern, - arm.guard.as_ref(), + arm.guard, opt_scrutinee_place, ); @@ -709,7 +723,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { mut visibility_scope: Option<SourceScope>, scope_span: Span, pattern: &Pat<'tcx>, - guard: Option<&Guard<'tcx>>, + guard: Option<ExprId>, opt_match_place: Option<(Option<&Place<'tcx>>, Span)>, ) -> Option<SourceScope> { self.visit_primary_bindings( @@ -737,13 +751,40 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { ); }, ); - if let Some(Guard::IfLet(guard_pat, _)) = guard { - // FIXME: pass a proper `opt_match_place` - self.declare_bindings(visibility_scope, scope_span, guard_pat, None, None); + if let Some(guard_expr) = guard { + self.declare_guard_bindings(guard_expr, scope_span, visibility_scope); } visibility_scope } + /// Declare bindings in a guard. This has to be done when declaring bindings + /// for an arm to ensure that or patterns only have one version of each + /// variable. + pub(crate) fn declare_guard_bindings( + &mut self, + guard_expr: ExprId, + scope_span: Span, + visibility_scope: Option<SourceScope>, + ) { + match self.thir.exprs[guard_expr].kind { + ExprKind::Let { expr: _, pat: ref guard_pat } => { + // FIXME: pass a proper `opt_match_place` + self.declare_bindings(visibility_scope, scope_span, guard_pat, None, None); + } + ExprKind::Scope { value, .. } => { + self.declare_guard_bindings(value, scope_span, visibility_scope); + } + ExprKind::Use { source } => { + self.declare_guard_bindings(source, scope_span, visibility_scope); + } + ExprKind::LogicalOp { op: LogicalOp::And, lhs, rhs } => { + self.declare_guard_bindings(lhs, scope_span, visibility_scope); + self.declare_guard_bindings(rhs, scope_span, visibility_scope); + } + _ => {} + } + } + pub(crate) fn storage_live_binding( &mut self, block: BasicBlock, @@ -2009,7 +2050,7 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { // * So we eagerly create the reference for the arm and then take a // reference to that. if let Some((arm, match_scope)) = arm_match_scope - && let Some(guard) = &arm.guard + && let Some(guard) = arm.guard { let tcx = self.tcx; let bindings = parent_bindings @@ -2034,21 +2075,16 @@ impl<'a, 'tcx> Builder<'a, 'tcx> { let mut guard_span = rustc_span::DUMMY_SP; let (post_guard_block, otherwise_post_guard_block) = - self.in_if_then_scope(match_scope, guard_span, |this| match *guard { - Guard::If(e) => { - guard_span = this.thir[e].span; - this.then_else_break( - block, - e, - None, - match_scope, - this.source_info(arm.span), - ) - } - Guard::IfLet(ref pat, s) => { - guard_span = this.thir[s].span; - this.lower_let_expr(block, s, pat, match_scope, None, arm.span, false) - } + self.in_if_then_scope(match_scope, guard_span, |this| { + guard_span = this.thir[guard].span; + this.then_else_break( + block, + guard, + None, + match_scope, + this.source_info(arm.span), + false, + ) }); let source_info = self.source_info(guard_span); diff --git a/compiler/rustc_mir_build/src/check_unsafety.rs b/compiler/rustc_mir_build/src/check_unsafety.rs index 2e8b6c19ec7..b4a02fae454 100644 --- a/compiler/rustc_mir_build/src/check_unsafety.rs +++ b/compiler/rustc_mir_build/src/check_unsafety.rs @@ -14,7 +14,7 @@ use rustc_session::lint::builtin::{UNSAFE_OP_IN_UNSAFE_FN, UNUSED_UNSAFE}; use rustc_session::lint::Level; use rustc_span::def_id::{DefId, LocalDefId}; use rustc_span::symbol::Symbol; -use rustc_span::Span; +use rustc_span::{sym, Span}; use std::mem; use std::ops::Bound; @@ -144,11 +144,17 @@ impl<'tcx> UnsafetyVisitor<'_, 'tcx> { let hir_context = self.tcx.local_def_id_to_hir_id(def); let safety_context = mem::replace(&mut self.safety_context, SafetyContext::Safe); let mut inner_visitor = UnsafetyVisitor { + tcx: self.tcx, thir: inner_thir, hir_context, safety_context, + body_target_features: self.body_target_features, + assignment_info: self.assignment_info, + in_union_destructure: false, + param_env: self.param_env, + inside_adt: false, warnings: self.warnings, - ..*self + suggest_unsafe_block: self.suggest_unsafe_block, }; inner_visitor.visit_expr(&inner_thir[expr]); // Unsafe blocks can be used in the inner body, make sure to take it into account @@ -886,14 +892,15 @@ impl UnsafeOpKind { } } -pub fn thir_check_unsafety(tcx: TyCtxt<'_>, def: LocalDefId) { - // THIR unsafeck is gated under `-Z thir-unsafeck` +pub fn check_unsafety(tcx: TyCtxt<'_>, def: LocalDefId) { + // THIR unsafeck can be disabled with `-Z thir-unsafeck=off` if !tcx.sess.opts.unstable_opts.thir_unsafeck { return; } // Closures and inline consts are handled by their owner, if it has a body - if tcx.is_typeck_child(def.to_def_id()) { + // Also, don't safety check custom MIR + if tcx.is_typeck_child(def.to_def_id()) || tcx.has_attr(def, sym::custom_mir) { return; } diff --git a/compiler/rustc_mir_build/src/errors.rs b/compiler/rustc_mir_build/src/errors.rs index 8677cba6a7c..61ad99acf38 100644 --- a/compiler/rustc_mir_build/src/errors.rs +++ b/compiler/rustc_mir_build/src/errors.rs @@ -467,11 +467,11 @@ impl<'a> IntoDiagnostic<'a> for NonExhaustivePatternsTypeNotEmpty<'_, '_, '_> { level, fluent::mir_build_non_exhaustive_patterns_type_not_empty, ); - diag.set_span(self.span); + diag.span(self.span); diag.code(error_code!(E0004)); let peeled_ty = self.ty.peel_refs(); - diag.set_arg("ty", self.ty); - diag.set_arg("peeled_ty", peeled_ty); + diag.arg("ty", self.ty); + diag.arg("peeled_ty", peeled_ty); if let ty::Adt(def, _) = peeled_ty.kind() { let def_span = self @@ -855,7 +855,7 @@ impl<'tcx> AddToDiagnostic for AdtDefinedHere<'tcx> { where F: Fn(&mut Diagnostic, SubdiagnosticMessage) -> SubdiagnosticMessage, { - diag.set_arg("ty", self.ty); + diag.arg("ty", self.ty); let mut spans = MultiSpan::from(self.adt_def_span); for Variant { span } in self.variants { diff --git a/compiler/rustc_mir_build/src/lib.rs b/compiler/rustc_mir_build/src/lib.rs index a776e917de5..430c4ee3da7 100644 --- a/compiler/rustc_mir_build/src/lib.rs +++ b/compiler/rustc_mir_build/src/lib.rs @@ -31,7 +31,7 @@ pub fn provide(providers: &mut Providers) { providers.mir_built = build::mir_built; providers.closure_saved_names_of_captured_variables = build::closure_saved_names_of_captured_variables; - providers.thir_check_unsafety = check_unsafety::thir_check_unsafety; + providers.check_unsafety = check_unsafety::check_unsafety; providers.thir_body = thir::cx::thir_body; providers.thir_tree = thir::print::thir_tree; providers.thir_flat = thir::print::thir_flat; diff --git a/compiler/rustc_mir_build/src/thir/cx/expr.rs b/compiler/rustc_mir_build/src/thir/cx/expr.rs index 8ec70c58c46..78d72b30284 100644 --- a/compiler/rustc_mir_build/src/thir/cx/expr.rs +++ b/compiler/rustc_mir_build/src/thir/cx/expr.rs @@ -855,13 +855,8 @@ impl<'tcx> Cx<'tcx> { fn convert_arm(&mut self, arm: &'tcx hir::Arm<'tcx>) -> ArmId { let arm = Arm { - pattern: self.pattern_from_hir(arm.pat), - guard: arm.guard.as_ref().map(|g| match g { - hir::Guard::If(e) => Guard::If(self.mirror_expr(e)), - hir::Guard::IfLet(l) => { - Guard::IfLet(self.pattern_from_hir(l.pat), self.mirror_expr(l.init)) - } - }), + pattern: self.pattern_from_hir(&arm.pat), + guard: arm.guard.as_ref().map(|g| self.mirror_expr(g)), body: self.mirror_expr(arm.body), lint_level: LintLevel::Explicit(arm.hir_id), scope: region::Scope { id: arm.hir_id.local_id, data: region::ScopeData::Node }, diff --git a/compiler/rustc_mir_build/src/thir/pattern/check_match.rs b/compiler/rustc_mir_build/src/thir/pattern/check_match.rs index 0bcc2a315ff..f0c767e6ca1 100644 --- a/compiler/rustc_mir_build/src/thir/pattern/check_match.rs +++ b/compiler/rustc_mir_build/src/thir/pattern/check_match.rs @@ -100,20 +100,10 @@ impl<'p, 'tcx> Visitor<'p, 'tcx> for MatchVisitor<'p, 'tcx> { #[instrument(level = "trace", skip(self))] fn visit_arm(&mut self, arm: &'p Arm<'tcx>) { self.with_lint_level(arm.lint_level, |this| { - match arm.guard { - Some(Guard::If(expr)) => { - this.with_let_source(LetSource::IfLetGuard, |this| { - this.visit_expr(&this.thir[expr]) - }); - } - Some(Guard::IfLet(ref pat, expr)) => { - this.with_let_source(LetSource::IfLetGuard, |this| { - this.check_let(pat, Some(expr), pat.span); - this.visit_pat(pat); - this.visit_expr(&this.thir[expr]); - }); - } - None => {} + if let Some(expr) = arm.guard { + this.with_let_source(LetSource::IfLetGuard, |this| { + this.visit_expr(&this.thir[expr]) + }); } this.visit_pat(&arm.pattern); this.visit_expr(&self.thir[arm.body]); diff --git a/compiler/rustc_mir_build/src/thir/print.rs b/compiler/rustc_mir_build/src/thir/print.rs index 28be3139905..267ea3aa3e1 100644 --- a/compiler/rustc_mir_build/src/thir/print.rs +++ b/compiler/rustc_mir_build/src/thir/print.rs @@ -593,9 +593,9 @@ impl<'a, 'tcx> ThirPrinter<'a, 'tcx> { print_indented!(self, "pattern: ", depth_lvl + 1); self.print_pat(pattern, depth_lvl + 2); - if let Some(guard) = guard { + if let Some(guard) = *guard { print_indented!(self, "guard: ", depth_lvl + 1); - self.print_guard(guard, depth_lvl + 2); + self.print_expr(guard, depth_lvl + 2); } else { print_indented!(self, "guard: None", depth_lvl + 1); } @@ -764,27 +764,6 @@ impl<'a, 'tcx> ThirPrinter<'a, 'tcx> { print_indented!(self, "}", depth_lvl); } - fn print_guard(&mut self, guard: &Guard<'tcx>, depth_lvl: usize) { - print_indented!(self, "Guard {", depth_lvl); - - match guard { - Guard::If(expr_id) => { - print_indented!(self, "If (", depth_lvl + 1); - self.print_expr(*expr_id, depth_lvl + 2); - print_indented!(self, ")", depth_lvl + 1); - } - Guard::IfLet(pat, expr_id) => { - print_indented!(self, "IfLet (", depth_lvl + 1); - self.print_pat(pat, depth_lvl + 2); - print_indented!(self, ",", depth_lvl + 1); - self.print_expr(*expr_id, depth_lvl + 2); - print_indented!(self, ")", depth_lvl + 1); - } - } - - print_indented!(self, "}", depth_lvl); - } - fn print_closure_expr(&mut self, expr: &ClosureExpr<'tcx>, depth_lvl: usize) { let ClosureExpr { closure_id, args, upvars, movability, fake_reads } = expr; diff --git a/compiler/rustc_mir_transform/src/check_unsafety.rs b/compiler/rustc_mir_transform/src/check_unsafety.rs index d94d96c1115..582c2c0c6b6 100644 --- a/compiler/rustc_mir_transform/src/check_unsafety.rs +++ b/compiler/rustc_mir_transform/src/check_unsafety.rs @@ -131,7 +131,7 @@ impl<'tcx> Visitor<'tcx> for UnsafetyChecker<'_, 'tcx> { &AggregateKind::Closure(def_id, _) | &AggregateKind::Coroutine(def_id, _) => { let def_id = def_id.expect_local(); let UnsafetyCheckResult { violations, used_unsafe_blocks, .. } = - self.tcx.unsafety_check_result(def_id); + self.tcx.mir_unsafety_check_result(def_id); self.register_violations(violations, used_unsafe_blocks.items().copied()); } }, @@ -153,7 +153,7 @@ impl<'tcx> Visitor<'tcx> for UnsafetyChecker<'_, 'tcx> { if self.tcx.def_kind(def_id) == DefKind::InlineConst { let local_def_id = def_id.expect_local(); let UnsafetyCheckResult { violations, used_unsafe_blocks, .. } = - self.tcx.unsafety_check_result(local_def_id); + self.tcx.mir_unsafety_check_result(local_def_id); self.register_violations(violations, used_unsafe_blocks.items().copied()); } } @@ -390,7 +390,7 @@ impl<'tcx> UnsafetyChecker<'_, 'tcx> { } pub(crate) fn provide(providers: &mut Providers) { - *providers = Providers { unsafety_check_result, ..*providers }; + *providers = Providers { mir_unsafety_check_result, ..*providers }; } /// Context information for [`UnusedUnsafeVisitor`] traversal, @@ -490,7 +490,7 @@ fn check_unused_unsafe( unused_unsafes } -fn unsafety_check_result(tcx: TyCtxt<'_>, def: LocalDefId) -> &UnsafetyCheckResult { +fn mir_unsafety_check_result(tcx: TyCtxt<'_>, def: LocalDefId) -> &UnsafetyCheckResult { debug!("unsafety_violations({:?})", def); // N.B., this borrow is valid because all the consumers of @@ -538,7 +538,8 @@ pub fn check_unsafety(tcx: TyCtxt<'_>, def_id: LocalDefId) { return; } - let UnsafetyCheckResult { violations, unused_unsafes, .. } = tcx.unsafety_check_result(def_id); + let UnsafetyCheckResult { violations, unused_unsafes, .. } = + tcx.mir_unsafety_check_result(def_id); // Only suggest wrapping the entire function body in an unsafe block once let mut suggest_unsafe_block = true; diff --git a/compiler/rustc_mir_transform/src/dest_prop.rs b/compiler/rustc_mir_transform/src/dest_prop.rs index 15502adfb5a..cd80f423466 100644 --- a/compiler/rustc_mir_transform/src/dest_prop.rs +++ b/compiler/rustc_mir_transform/src/dest_prop.rs @@ -133,7 +133,6 @@ use std::collections::hash_map::{Entry, OccupiedEntry}; -use crate::simplify::remove_dead_blocks; use crate::MirPass; use rustc_data_structures::fx::FxHashMap; use rustc_index::bit_set::BitSet; @@ -241,12 +240,6 @@ impl<'tcx> MirPass<'tcx> for DestinationPropagation { apply_merges(body, tcx, &merges, &merged_locals); } - if round_count != 0 { - // Merging can introduce overlap between moved arguments and/or call destination in an - // unreachable code, which validator considers to be ill-formed. - remove_dead_blocks(body); - } - trace!(round_count); } } diff --git a/compiler/rustc_mir_transform/src/errors.rs b/compiler/rustc_mir_transform/src/errors.rs index 17916e16daf..bde442049b1 100644 --- a/compiler/rustc_mir_transform/src/errors.rs +++ b/compiler/rustc_mir_transform/src/errors.rs @@ -67,11 +67,11 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for RequiresUnsafe { fn into_diagnostic(self, dcx: &'a DiagCtxt, level: Level) -> DiagnosticBuilder<'a, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::mir_transform_requires_unsafe); diag.code(rustc_errors::DiagnosticId::Error("E0133".to_string())); - diag.set_span(self.span); + diag.span(self.span); diag.span_label(self.span, self.details.label()); let desc = dcx.eagerly_translate_to_string(self.details.label(), [].into_iter()); - diag.set_arg("details", desc); - diag.set_arg("op_in_unsafe_fn_allowed", self.op_in_unsafe_fn_allowed); + diag.arg("details", desc); + diag.arg("op_in_unsafe_fn_allowed", self.op_in_unsafe_fn_allowed); self.details.add_subdiagnostics(&mut diag); if let Some(sp) = self.enclosing { diag.span_label(sp, fluent::mir_transform_not_inherited); @@ -122,16 +122,16 @@ impl RequiresUnsafeDetail { } CallToFunctionWith { ref missing, ref build_enabled } => { diag.help(fluent::mir_transform_target_feature_call_help); - diag.set_arg( + diag.arg( "missing_target_features", DiagnosticArgValue::StrListSepByAnd( missing.iter().map(|feature| Cow::from(feature.as_str())).collect(), ), ); - diag.set_arg("missing_target_features_count", missing.len()); + diag.arg("missing_target_features_count", missing.len()); if !build_enabled.is_empty() { diag.note(fluent::mir_transform_target_feature_call_note); - diag.set_arg( + diag.arg( "build_target_features", DiagnosticArgValue::StrListSepByAnd( build_enabled @@ -140,7 +140,7 @@ impl RequiresUnsafeDetail { .collect(), ), ); - diag.set_arg("build_target_features_count", build_enabled.len()); + diag.arg("build_target_features_count", build_enabled.len()); } } } @@ -183,7 +183,7 @@ impl<'a> DecorateLint<'a, ()> for UnsafeOpInUnsafeFn { fn decorate_lint<'b>(self, diag: &'b mut DiagnosticBuilder<'a, ()>) { let dcx = diag.dcx().expect("lint should not yet be emitted"); let desc = dcx.eagerly_translate_to_string(self.details.label(), [].into_iter()); - diag.set_arg("details", desc); + diag.arg("details", desc); diag.span_label(self.details.span, self.details.label()); self.details.add_subdiagnostics(diag); @@ -213,7 +213,7 @@ impl<'a, P: std::fmt::Debug> DecorateLint<'a, ()> for AssertLint<P> { let assert_kind = self.panic(); let message = assert_kind.diagnostic_message(); assert_kind.add_args(&mut |name, value| { - diag.set_arg(name, value); + diag.arg(name, value); }); diag.span_label(span, message); } @@ -280,9 +280,9 @@ impl<'a> DecorateLint<'a, ()> for MustNotSupend<'_, '_> { diag.subdiagnostic(reason); } diag.span_help(self.src_sp, fluent::_subdiag::help); - diag.set_arg("pre", self.pre); - diag.set_arg("def_path", self.tcx.def_path_str(self.def_id)); - diag.set_arg("post", self.post); + diag.arg("pre", self.pre); + diag.arg("def_path", self.tcx.def_path_str(self.def_id)); + diag.arg("post", self.post); } fn msg(&self) -> rustc_errors::DiagnosticMessage { diff --git a/compiler/rustc_mir_transform/src/lib.rs b/compiler/rustc_mir_transform/src/lib.rs index 5562ae7f3bd..164b6b9c4f5 100644 --- a/compiler/rustc_mir_transform/src/lib.rs +++ b/compiler/rustc_mir_transform/src/lib.rs @@ -285,9 +285,9 @@ fn mir_const_qualif(tcx: TyCtxt<'_>, def: LocalDefId) -> ConstQualifs { /// FIXME(oli-obk): it's unclear whether we still need this phase (and its corresponding query). /// We used to have this for pre-miri MIR based const eval. fn mir_const(tcx: TyCtxt<'_>, def: LocalDefId) -> &Steal<Body<'_>> { - // Unsafety check uses the raw mir, so make sure it is run. + // MIR unsafety check uses the raw mir, so make sure it is run. if !tcx.sess.opts.unstable_opts.thir_unsafeck { - tcx.ensure_with_value().unsafety_check_result(def); + tcx.ensure_with_value().mir_unsafety_check_result(def); } // has_ffi_unwind_calls query uses the raw mir, so make sure it is run. diff --git a/compiler/rustc_mir_transform/src/lint.rs b/compiler/rustc_mir_transform/src/lint.rs index 3940d0ddbf3..c0c0a3f5ee6 100644 --- a/compiler/rustc_mir_transform/src/lint.rs +++ b/compiler/rustc_mir_transform/src/lint.rs @@ -1,6 +1,7 @@ //! This pass statically detects code which has undefined behaviour or is likely to be erroneous. //! It can be used to locate problems in MIR building or optimizations. It assumes that all code //! can be executed, so it has false positives. +use rustc_data_structures::fx::FxHashSet; use rustc_index::bit_set::BitSet; use rustc_middle::mir::visit::{PlaceContext, Visitor}; use rustc_middle::mir::*; @@ -11,7 +12,6 @@ use rustc_mir_dataflow::{Analysis, ResultsCursor}; use std::borrow::Cow; pub fn lint_body<'tcx>(tcx: TyCtxt<'tcx>, body: &Body<'tcx>, when: String) { - let reachable_blocks = traversal::reachable_as_bitset(body); let always_live_locals = &always_storage_live_locals(body); let maybe_storage_live = MaybeStorageLive::new(Cow::Borrowed(always_live_locals)) @@ -24,17 +24,19 @@ pub fn lint_body<'tcx>(tcx: TyCtxt<'tcx>, body: &Body<'tcx>, when: String) { .iterate_to_fixpoint() .into_results_cursor(body); - Lint { + let mut lint = Lint { tcx, when, body, is_fn_like: tcx.def_kind(body.source.def_id()).is_fn_like(), always_live_locals, - reachable_blocks, maybe_storage_live, maybe_storage_dead, + places: Default::default(), + }; + for (bb, data) in traversal::reachable(body) { + lint.visit_basic_block_data(bb, data); } - .visit_body(body); } struct Lint<'a, 'tcx> { @@ -43,9 +45,9 @@ struct Lint<'a, 'tcx> { body: &'a Body<'tcx>, is_fn_like: bool, always_live_locals: &'a BitSet<Local>, - reachable_blocks: BitSet<BasicBlock>, maybe_storage_live: ResultsCursor<'a, 'tcx, MaybeStorageLive<'a>>, maybe_storage_dead: ResultsCursor<'a, 'tcx, MaybeStorageDead<'a>>, + places: FxHashSet<PlaceRef<'tcx>>, } impl<'a, 'tcx> Lint<'a, 'tcx> { @@ -67,7 +69,7 @@ impl<'a, 'tcx> Lint<'a, 'tcx> { impl<'a, 'tcx> Visitor<'tcx> for Lint<'a, 'tcx> { fn visit_local(&mut self, local: Local, context: PlaceContext, location: Location) { - if self.reachable_blocks.contains(location.block) && context.is_use() { + if context.is_use() { self.maybe_storage_dead.seek_after_primary_effect(location); if self.maybe_storage_dead.get().contains(local) { self.fail(location, format!("use of local {local:?}, which has no storage here")); @@ -76,18 +78,28 @@ impl<'a, 'tcx> Visitor<'tcx> for Lint<'a, 'tcx> { } fn visit_statement(&mut self, statement: &Statement<'tcx>, location: Location) { - match statement.kind { - StatementKind::StorageLive(local) => { - if self.reachable_blocks.contains(location.block) { - self.maybe_storage_live.seek_before_primary_effect(location); - if self.maybe_storage_live.get().contains(local) { + match &statement.kind { + StatementKind::Assign(box (dest, rvalue)) => { + if let Rvalue::Use(Operand::Copy(src) | Operand::Move(src)) = rvalue { + // The sides of an assignment must not alias. Currently this just checks whether + // the places are identical. + if dest == src { self.fail( location, - format!("StorageLive({local:?}) which already has storage here"), + "encountered `Assign` statement with overlapping memory", ); } } } + StatementKind::StorageLive(local) => { + self.maybe_storage_live.seek_before_primary_effect(location); + if self.maybe_storage_live.get().contains(*local) { + self.fail( + location, + format!("StorageLive({local:?}) which already has storage here"), + ); + } + } _ => {} } @@ -95,9 +107,9 @@ impl<'a, 'tcx> Visitor<'tcx> for Lint<'a, 'tcx> { } fn visit_terminator(&mut self, terminator: &Terminator<'tcx>, location: Location) { - match terminator.kind { + match &terminator.kind { TerminatorKind::Return => { - if self.is_fn_like && self.reachable_blocks.contains(location.block) { + if self.is_fn_like { self.maybe_storage_live.seek_after_primary_effect(location); for local in self.maybe_storage_live.get().iter() { if !self.always_live_locals.contains(local) { @@ -111,6 +123,28 @@ impl<'a, 'tcx> Visitor<'tcx> for Lint<'a, 'tcx> { } } } + TerminatorKind::Call { args, destination, .. } => { + // The call destination place and Operand::Move place used as an argument might be + // passed by a reference to the callee. Consequently they must be non-overlapping. + // Currently this simply checks for duplicate places. + self.places.clear(); + self.places.insert(destination.as_ref()); + let mut has_duplicates = false; + for arg in args { + if let Operand::Move(place) = arg { + has_duplicates |= !self.places.insert(place.as_ref()); + } + } + if has_duplicates { + self.fail( + location, + format!( + "encountered overlapping memory in `Move` arguments to `Call` terminator: {:?}", + terminator.kind, + ), + ); + } + } _ => {} } diff --git a/compiler/rustc_mir_transform/src/pass_manager.rs b/compiler/rustc_mir_transform/src/pass_manager.rs index 82074f1960d..f4c572aec12 100644 --- a/compiler/rustc_mir_transform/src/pass_manager.rs +++ b/compiler/rustc_mir_transform/src/pass_manager.rs @@ -109,14 +109,15 @@ fn run_passes_inner<'tcx>( phase_change: Option<MirPhase>, validate_each: bool, ) { - let lint = tcx.sess.opts.unstable_opts.lint_mir & !body.should_skip(); - let validate = validate_each & tcx.sess.opts.unstable_opts.validate_mir & !body.should_skip(); let overridden_passes = &tcx.sess.opts.unstable_opts.mir_enable_passes; trace!(?overridden_passes); let prof_arg = tcx.sess.prof.enabled().then(|| format!("{:?}", body.source.def_id())); if !body.should_skip() { + let validate = validate_each & tcx.sess.opts.unstable_opts.validate_mir; + let lint = tcx.sess.opts.unstable_opts.lint_mir; + for pass in passes { let name = pass.name(); @@ -162,7 +163,12 @@ fn run_passes_inner<'tcx>( body.pass_count = 0; dump_mir_for_phase_change(tcx, body); - if validate || new_phase == MirPhase::Runtime(RuntimePhase::Optimized) { + + let validate = + (validate_each & tcx.sess.opts.unstable_opts.validate_mir & !body.should_skip()) + || new_phase == MirPhase::Runtime(RuntimePhase::Optimized); + let lint = tcx.sess.opts.unstable_opts.lint_mir & !body.should_skip(); + if validate { validate_body(tcx, body, format!("after phase change to {}", new_phase.name())); } if lint { diff --git a/compiler/rustc_monomorphize/src/errors.rs b/compiler/rustc_monomorphize/src/errors.rs index 592e71251b8..2ca14673a58 100644 --- a/compiler/rustc_monomorphize/src/errors.rs +++ b/compiler/rustc_monomorphize/src/errors.rs @@ -51,7 +51,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for UnusedGenericParamsHint { fn into_diagnostic(self, dcx: &'_ DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::monomorphize_unused_generic_params); - diag.set_span(self.span); + diag.span(self.span); for (span, name) in self.param_spans.into_iter().zip(self.param_names) { // FIXME: I can figure out how to do a label with a fluent string with a fixed message, // or a label with a dynamic value in a hard-coded string, but I haven't figured out diff --git a/compiler/rustc_parse/messages.ftl b/compiler/rustc_parse/messages.ftl index c6bddbfacd6..c11a6fab7e5 100644 --- a/compiler/rustc_parse/messages.ftl +++ b/compiler/rustc_parse/messages.ftl @@ -10,6 +10,8 @@ parse_ambiguous_range_pattern = the range pattern here has ambiguous interpretat parse_array_brackets_instead_of_braces = this is a block expression, not an array .suggestion = to make an array, use square brackets instead of curly braces +parse_array_index_offset_of = array indexing not supported in offset_of + parse_assignment_else_not_allowed = <assignment> ... else {"{"} ... {"}"} is not allowed parse_assoc_lifetime = associated lifetimes are not supported @@ -405,6 +407,8 @@ parse_invalid_logical_operator = `{$incorrect}` is not a logical operator parse_invalid_meta_item = expected unsuffixed literal or identifier, found `{$token}` +parse_invalid_offset_of = offset_of expects dot-separated field and variant names + parse_invalid_unicode_escape = invalid unicode character escape .label = invalid escape .help = unicode escape must {$surrogate -> @@ -767,6 +771,9 @@ parse_unexpected_if_with_if = unexpected `if` in the condition expression parse_unexpected_lifetime_in_pattern = unexpected lifetime `{$symbol}` in pattern .suggestion = remove the lifetime +parse_unexpected_paren_in_range_pat = range pattern bounds cannot have parentheses +parse_unexpected_paren_in_range_pat_sugg = remove these parentheses + parse_unexpected_parentheses_in_for_head = unexpected parentheses surrounding `for` loop head .suggestion = remove parentheses in `for` loop diff --git a/compiler/rustc_parse/src/errors.rs b/compiler/rustc_parse/src/errors.rs index e276b34ca37..0de252707bd 100644 --- a/compiler/rustc_parse/src/errors.rs +++ b/compiler/rustc_parse/src/errors.rs @@ -1065,8 +1065,8 @@ impl<'a> IntoDiagnostic<'a> for ExpectedIdentifier { None => fluent::parse_expected_identifier_found_str, }, ); - diag.set_span(self.span); - diag.set_arg("token", self.token); + diag.span(self.span); + diag.arg("token", self.token); if let Some(sugg) = self.suggest_raw { sugg.add_to_diagnostic(&mut diag); @@ -1123,8 +1123,8 @@ impl<'a> IntoDiagnostic<'a> for ExpectedSemi { None => fluent::parse_expected_semi_found_str, }, ); - diag.set_span(self.span); - diag.set_arg("token", self.token); + diag.span(self.span); + diag.arg("token", self.token); if let Some(unexpected_token_label) = self.unexpected_token_label { diag.span_label(unexpected_token_label, fluent::parse_label_unexpected_token); @@ -2379,6 +2379,27 @@ pub(crate) struct ExpectedCommaAfterPatternField { } #[derive(Diagnostic)] +#[diag(parse_unexpected_paren_in_range_pat)] +pub(crate) struct UnexpectedParenInRangePat { + #[primary_span] + pub span: Vec<Span>, + #[subdiagnostic] + pub sugg: UnexpectedParenInRangePatSugg, +} + +#[derive(Subdiagnostic)] +#[multipart_suggestion( + parse_unexpected_paren_in_range_pat_sugg, + applicability = "machine-applicable" +)] +pub(crate) struct UnexpectedParenInRangePatSugg { + #[suggestion_part(code = "")] + pub start_span: Span, + #[suggestion_part(code = "")] + pub end_span: Span, +} + +#[derive(Diagnostic)] #[diag(parse_return_types_use_thin_arrow)] pub(crate) struct ReturnTypesUseThinArrow { #[primary_span] @@ -2887,3 +2908,11 @@ pub(crate) struct TransposeDynOrImplSugg<'a> { pub insertion_span: Span, pub kw: &'a str, } + +#[derive(Diagnostic)] +#[diag(parse_array_index_offset_of)] +pub(crate) struct ArrayIndexInOffsetOf(#[primary_span] pub Span); + +#[derive(Diagnostic)] +#[diag(parse_invalid_offset_of)] +pub(crate) struct InvalidOffsetOf(#[primary_span] pub Span); diff --git a/compiler/rustc_parse/src/lexer/mod.rs b/compiler/rustc_parse/src/lexer/mod.rs index 083d1984e00..4819ed6021d 100644 --- a/compiler/rustc_parse/src/lexer/mod.rs +++ b/compiler/rustc_parse/src/lexer/mod.rs @@ -7,9 +7,7 @@ use rustc_ast::ast::{self, AttrStyle}; use rustc_ast::token::{self, CommentKind, Delimiter, Token, TokenKind}; use rustc_ast::tokenstream::TokenStream; use rustc_ast::util::unicode::contains_text_flow_control_chars; -use rustc_errors::{ - error_code, Applicability, DiagCtxt, Diagnostic, DiagnosticBuilder, FatalAbort, StashKey, -}; +use rustc_errors::{error_code, Applicability, DiagCtxt, Diagnostic, StashKey}; use rustc_lexer::unescape::{self, EscapeError, Mode}; use rustc_lexer::{Base, DocStyle, RawStrError}; use rustc_lexer::{Cursor, LiteralKind}; @@ -252,7 +250,7 @@ impl<'a> StringReader<'a> { if starts_with_number { let span = self.mk_sp(start, self.pos); let mut diag = self.dcx().struct_err("lifetimes cannot start with a number"); - diag.set_span(span); + diag.span(span); diag.stash(span, StashKey::LifetimeIsChar); } let ident = Symbol::intern(lifetime_name); @@ -344,18 +342,6 @@ impl<'a> StringReader<'a> { token::Ident(sym, false) } - fn struct_fatal_span_char( - &self, - from_pos: BytePos, - to_pos: BytePos, - m: &str, - c: char, - ) -> DiagnosticBuilder<'a, FatalAbort> { - self.sess - .dcx - .struct_span_fatal(self.mk_sp(from_pos, to_pos), format!("{}: {}", m, escaped_char(c))) - } - /// Detect usages of Unicode codepoints changing the direction of the text on screen and loudly /// complain about it. fn lint_unicode_text_flow(&self, start: BytePos) { @@ -568,13 +554,16 @@ impl<'a> StringReader<'a> { } fn report_non_started_raw_string(&self, start: BytePos, bad_char: char) -> ! { - self.struct_fatal_span_char( - start, - self.pos, - "found invalid character; only `#` is allowed in raw string delimitation", - bad_char, - ) - .emit() + self.sess + .dcx + .struct_span_fatal( + self.mk_sp(start, self.pos), + format!( + "found invalid character; only `#` is allowed in raw string delimitation: {}", + escaped_char(bad_char) + ), + ) + .emit() } fn report_unterminated_raw_string( diff --git a/compiler/rustc_parse/src/lib.rs b/compiler/rustc_parse/src/lib.rs index f06aeed8628..579c3cffcfb 100644 --- a/compiler/rustc_parse/src/lib.rs +++ b/compiler/rustc_parse/src/lib.rs @@ -154,7 +154,7 @@ fn try_file_to_source_file( let msg = format!("couldn't read {}: {}", path.display(), e); let mut diag = Diagnostic::new(Level::Fatal, msg); if let Some(sp) = spanopt { - diag.set_span(sp); + diag.span(sp); } diag }) diff --git a/compiler/rustc_parse/src/parser/attr.rs b/compiler/rustc_parse/src/parser/attr.rs index fb8ad05f25d..c8629069968 100644 --- a/compiler/rustc_parse/src/parser/attr.rs +++ b/compiler/rustc_parse/src/parser/attr.rs @@ -174,7 +174,7 @@ impl<'a> Parser<'a> { ) { Ok(Some(item)) => { // FIXME(#100717) - err.set_arg("item", item.kind.descr()); + err.arg("item", item.kind.descr()); err.span_label(item.span, fluent::parse_label_does_not_annotate_this); err.span_suggestion_verbose( replacement_span, diff --git a/compiler/rustc_parse/src/parser/diagnostics.rs b/compiler/rustc_parse/src/parser/diagnostics.rs index 77bca2f138a..aed5e11133b 100644 --- a/compiler/rustc_parse/src/parser/diagnostics.rs +++ b/compiler/rustc_parse/src/parser/diagnostics.rs @@ -846,7 +846,7 @@ impl<'a> Parser<'a> { ) => { let n_hashes: u8 = *n_hashes; - err.set_primary_message("too many `#` when terminating raw string"); + err.primary_message("too many `#` when terminating raw string"); let str_span = self.prev_token.span; let mut span = self.token.span; let mut count = 0; @@ -857,7 +857,7 @@ impl<'a> Parser<'a> { self.bump(); count += 1; } - err.set_span(span); + err.span(span); err.span_suggestion( span, format!("remove the extra `#`{}", pluralize!(count)), diff --git a/compiler/rustc_parse/src/parser/expr.rs b/compiler/rustc_parse/src/parser/expr.rs index bf6151b64d3..0b24e784126 100644 --- a/compiler/rustc_parse/src/parser/expr.rs +++ b/compiler/rustc_parse/src/parser/expr.rs @@ -1023,7 +1023,7 @@ impl<'a> Parser<'a> { // we should break everything including floats into more basic proc-macro style // tokens in the lexer (probably preferable). // See also `TokenKind::break_two_token_op` which does similar splitting of `>>` into `>`. - fn break_up_float(&mut self, float: Symbol) -> DestructuredFloat { + fn break_up_float(&self, float: Symbol, span: Span) -> DestructuredFloat { #[derive(Debug)] enum FloatComponent { IdentLike(String), @@ -1053,7 +1053,6 @@ impl<'a> Parser<'a> { // With proc macros the span can refer to anything, the source may be too short, // or too long, or non-ASCII. It only makes sense to break our span into components // if its underlying text is identical to our float literal. - let span = self.token.span; let can_take_span_apart = || self.span_to_snippet(span).as_deref() == Ok(float_str).as_deref(); @@ -1115,7 +1114,7 @@ impl<'a> Parser<'a> { float: Symbol, suffix: Option<Symbol>, ) -> P<Expr> { - match self.break_up_float(float) { + match self.break_up_float(float, self.token.span) { // 1e2 DestructuredFloat::Single(sym, _sp) => { self.parse_expr_tuple_field_access(lo, base, sym, suffix, None) @@ -1143,40 +1142,105 @@ impl<'a> Parser<'a> { } } - fn parse_field_name_maybe_tuple(&mut self) -> PResult<'a, ThinVec<Ident>> { - let token::Literal(token::Lit { kind: token::Float, symbol, suffix }) = self.token.kind - else { - return Ok(thin_vec![self.parse_field_name()?]); - }; - Ok(match self.break_up_float(symbol) { - // 1e2 - DestructuredFloat::Single(sym, sp) => { - self.bump(); - thin_vec![Ident::new(sym, sp)] - } - // 1. - DestructuredFloat::TrailingDot(sym, sym_span, dot_span) => { - assert!(suffix.is_none()); - // Analogous to `Self::break_and_eat` - self.break_last_token = true; - // This might work, in cases like `1. 2`, and might not, - // in cases like `offset_of!(Ty, 1.)`. It depends on what comes - // after the float-like token, and therefore we have to make - // the other parts of the parser think that there is a dot literal. - self.token = Token::new(token::Ident(sym, false), sym_span); - self.bump_with((Token::new(token::Dot, dot_span), self.token_spacing)); - thin_vec![Ident::new(sym, sym_span)] - } - // 1.2 | 1.2e3 - DestructuredFloat::MiddleDot(symbol1, ident1_span, _dot_span, symbol2, ident2_span) => { - self.bump(); - thin_vec![Ident::new(symbol1, ident1_span), Ident::new(symbol2, ident2_span)] + /// Parse the field access used in offset_of, matched by `$(e:expr)+`. + /// Currently returns a list of idents. However, it should be possible in + /// future to also do array indices, which might be arbitrary expressions. + fn parse_floating_field_access(&mut self) -> PResult<'a, P<[Ident]>> { + let mut fields = Vec::new(); + let mut trailing_dot = None; + + loop { + // This is expected to use a metavariable $(args:expr)+, but the builtin syntax + // could be called directly. Calling `parse_expr` allows this function to only + // consider `Expr`s. + let expr = self.parse_expr()?; + let mut current = &expr; + let start_idx = fields.len(); + loop { + match current.kind { + ExprKind::Field(ref left, right) => { + // Field access is read right-to-left. + fields.insert(start_idx, right); + trailing_dot = None; + current = left; + } + // Parse this both to give helpful error messages and to + // verify it can be done with this parser setup. + ExprKind::Index(ref left, ref _right, span) => { + self.dcx().emit_err(errors::ArrayIndexInOffsetOf(span)); + current = left; + } + ExprKind::Lit(token::Lit { + kind: token::Float | token::Integer, + symbol, + suffix, + }) => { + if let Some(suffix) = suffix { + self.expect_no_tuple_index_suffix(current.span, suffix); + } + match self.break_up_float(symbol, current.span) { + // 1e2 + DestructuredFloat::Single(sym, sp) => { + trailing_dot = None; + fields.insert(start_idx, Ident::new(sym, sp)); + } + // 1. + DestructuredFloat::TrailingDot(sym, sym_span, dot_span) => { + assert!(suffix.is_none()); + trailing_dot = Some(dot_span); + fields.insert(start_idx, Ident::new(sym, sym_span)); + } + // 1.2 | 1.2e3 + DestructuredFloat::MiddleDot( + symbol1, + span1, + _dot_span, + symbol2, + span2, + ) => { + trailing_dot = None; + fields.insert(start_idx, Ident::new(symbol2, span2)); + fields.insert(start_idx, Ident::new(symbol1, span1)); + } + DestructuredFloat::Error => { + trailing_dot = None; + fields.insert(start_idx, Ident::new(symbol, self.prev_token.span)); + } + } + break; + } + ExprKind::Path(None, Path { ref segments, .. }) => { + match &segments[..] { + [PathSegment { ident, args: None, .. }] => { + trailing_dot = None; + fields.insert(start_idx, *ident) + } + _ => { + self.dcx().emit_err(errors::InvalidOffsetOf(current.span)); + break; + } + } + break; + } + _ => { + self.dcx().emit_err(errors::InvalidOffsetOf(current.span)); + break; + } + } } - DestructuredFloat::Error => { - self.bump(); - thin_vec![Ident::new(symbol, self.prev_token.span)] + + if matches!(self.token.kind, token::CloseDelim(..) | token::Comma) { + break; + } else if trailing_dot.is_none() { + // This loop should only repeat if there is a trailing dot. + self.dcx().emit_err(errors::InvalidOffsetOf(self.token.span)); + break; } - }) + } + if let Some(dot) = trailing_dot { + self.dcx().emit_err(errors::InvalidOffsetOf(dot)); + } + Ok(fields.into_iter().collect()) } fn parse_expr_tuple_field_access( @@ -1907,15 +1971,29 @@ impl<'a> Parser<'a> { let container = self.parse_ty()?; self.expect(&TokenKind::Comma)?; - let seq_sep = SeqSep { sep: Some(token::Dot), trailing_sep_allowed: false }; - let (fields, _trailing, _recovered) = self.parse_seq_to_before_end( - &TokenKind::CloseDelim(Delimiter::Parenthesis), - seq_sep, - Parser::parse_field_name_maybe_tuple, - )?; - let fields = fields.into_iter().flatten().collect::<Vec<_>>(); + let fields = self.parse_floating_field_access()?; + let trailing_comma = self.eat_noexpect(&TokenKind::Comma); + + if let Err(mut e) = + self.expect_one_of(&[], &[TokenKind::CloseDelim(Delimiter::Parenthesis)]) + { + if trailing_comma { + e.note("unexpected third argument to offset_of"); + } else { + e.note("offset_of expects dot-separated field and variant names"); + } + e.emit(); + } + + // Eat tokens until the macro call ends. + if self.may_recover() { + while !matches!(self.token.kind, token::CloseDelim(..) | token::Eof) { + self.bump(); + } + } + let span = lo.to(self.token.span); - Ok(self.mk_expr(span, ExprKind::OffsetOf(container, fields.into()))) + Ok(self.mk_expr(span, ExprKind::OffsetOf(container, fields))) } /// Returns a string literal if the next token is a string literal. diff --git a/compiler/rustc_parse/src/parser/mod.rs b/compiler/rustc_parse/src/parser/mod.rs index 3932d32a6e1..b201d36455e 100644 --- a/compiler/rustc_parse/src/parser/mod.rs +++ b/compiler/rustc_parse/src/parser/mod.rs @@ -925,9 +925,8 @@ impl<'a> Parser<'a> { }); } - expect_err.set_primary_message( - "closure bodies that contain statements must be surrounded by braces", - ); + expect_err + .primary_message("closure bodies that contain statements must be surrounded by braces"); let preceding_pipe_span = closure_spans.closing_pipe; let following_token_span = self.token.span; @@ -951,7 +950,7 @@ impl<'a> Parser<'a> { ); expect_err.span_note(second_note, "the closure body may be incorrectly delimited"); - expect_err.set_span(vec![preceding_pipe_span, following_token_span]); + expect_err.span(vec![preceding_pipe_span, following_token_span]); let opening_suggestion_str = " {".to_string(); let closing_suggestion_str = "}".to_string(); diff --git a/compiler/rustc_parse/src/parser/pat.rs b/compiler/rustc_parse/src/parser/pat.rs index afbc2537578..7d17b1d4c4d 100644 --- a/compiler/rustc_parse/src/parser/pat.rs +++ b/compiler/rustc_parse/src/parser/pat.rs @@ -6,7 +6,8 @@ use crate::errors::{ InclusiveRangeExtraEquals, InclusiveRangeMatchArrow, InclusiveRangeNoEnd, InvalidMutInPattern, PatternOnWrongSideOfAt, RefMutOrderIncorrect, RemoveLet, RepeatedMutInPattern, SwitchRefBoxOrder, TopLevelOrPatternNotAllowed, TopLevelOrPatternNotAllowedSugg, - TrailingVertNotAllowed, UnexpectedLifetimeInPattern, UnexpectedVertVertBeforeFunctionParam, + TrailingVertNotAllowed, UnexpectedLifetimeInPattern, UnexpectedParenInRangePat, + UnexpectedParenInRangePatSugg, UnexpectedVertVertBeforeFunctionParam, UnexpectedVertVertInPattern, }; use crate::{maybe_recover_from_interpolated_ty_qpath, maybe_whole}; @@ -579,6 +580,8 @@ impl<'a> Parser<'a> { /// Parse a tuple or parenthesis pattern. fn parse_pat_tuple_or_parens(&mut self) -> PResult<'a, PatKind> { + let open_paren = self.token.span; + let (fields, trailing_comma) = self.parse_paren_comma_seq(|p| { p.parse_pat_allow_top_alt( None, @@ -591,7 +594,29 @@ impl<'a> Parser<'a> { // Here, `(pat,)` is a tuple pattern. // For backward compatibility, `(..)` is a tuple pattern as well. Ok(if fields.len() == 1 && !(trailing_comma || fields[0].is_rest()) { - PatKind::Paren(fields.into_iter().next().unwrap()) + let pat = fields.into_iter().next().unwrap(); + let close_paren = self.prev_token.span; + + match &pat.kind { + // recover ranges with parentheses around the `(start)..` + PatKind::Lit(begin) + if self.may_recover() + && let Some(form) = self.parse_range_end() => + { + self.dcx().emit_err(UnexpectedParenInRangePat { + span: vec![open_paren, close_paren], + sugg: UnexpectedParenInRangePatSugg { + start_span: open_paren, + end_span: close_paren, + }, + }); + + self.parse_pat_range_begin_with(begin.clone(), form)? + } + + // (pat) with optional parentheses + _ => PatKind::Paren(pat), + } } else { PatKind::Tuple(fields) }) @@ -794,11 +819,21 @@ impl<'a> Parser<'a> { || t.can_begin_literal_maybe_minus() // e.g. `42`. || t.is_whole_expr() || t.is_lifetime() // recover `'a` instead of `'a'` + || (self.may_recover() // recover leading `(` + && t.kind == token::OpenDelim(Delimiter::Parenthesis) + && self.look_ahead(dist + 1, |t| t.kind != token::OpenDelim(Delimiter::Parenthesis)) + && self.is_pat_range_end_start(dist + 1)) }) } + /// Parse a range pattern end bound fn parse_pat_range_end(&mut self) -> PResult<'a, P<Expr>> { - if self.check_inline_const(0) { + // recover leading `(` + let open_paren = (self.may_recover() + && self.eat_noexpect(&token::OpenDelim(Delimiter::Parenthesis))) + .then_some(self.prev_token.span); + + let bound = if self.check_inline_const(0) { self.parse_const_block(self.token.span, true) } else if self.check_path() { let lo = self.token.span; @@ -814,7 +849,22 @@ impl<'a> Parser<'a> { Ok(self.mk_expr(lo.to(hi), ExprKind::Path(qself, path))) } else { self.parse_literal_maybe_minus() + }?; + + // recover trailing `)` + if let Some(open_paren) = open_paren { + self.expect(&token::CloseDelim(Delimiter::Parenthesis))?; + + self.dcx().emit_err(UnexpectedParenInRangePat { + span: vec![open_paren, self.prev_token.span], + sugg: UnexpectedParenInRangePatSugg { + start_span: open_paren, + end_span: self.prev_token.span, + }, + }); } + + Ok(bound) } /// Is this the start of a pattern beginning with a path? diff --git a/compiler/rustc_passes/src/check_attr.rs b/compiler/rustc_passes/src/check_attr.rs index edce99db705..e4bbc9eeaf7 100644 --- a/compiler/rustc_passes/src/check_attr.rs +++ b/compiler/rustc_passes/src/check_attr.rs @@ -2341,17 +2341,17 @@ impl<'tcx> CheckAttrVisitor<'tcx> { match terr { TypeError::ArgumentMutability(idx) | TypeError::ArgumentSorts(_, idx) => { if let Some(ty) = hir_sig.decl.inputs.get(idx) { - diag.set_span(ty.span); + diag.span(ty.span); cause.span = ty.span; } else if idx == hir_sig.decl.inputs.len() { let span = hir_sig.decl.output.span(); - diag.set_span(span); + diag.span(span); cause.span = span; } } TypeError::ArgCount => { if let Some(ty) = hir_sig.decl.inputs.get(expected_sig.inputs().len()) { - diag.set_span(ty.span); + diag.span(ty.span); cause.span = ty.span; } } diff --git a/compiler/rustc_passes/src/dead.rs b/compiler/rustc_passes/src/dead.rs index 22aac1e775e..ac2ca23ad41 100644 --- a/compiler/rustc_passes/src/dead.rs +++ b/compiler/rustc_passes/src/dead.rs @@ -15,8 +15,8 @@ use rustc_middle::middle::codegen_fn_attrs::CodegenFnAttrFlags; use rustc_middle::middle::privacy::Level; use rustc_middle::query::Providers; use rustc_middle::ty::{self, TyCtxt}; -use rustc_session::lint::builtin::{DEAD_CODE, UNUSED_TUPLE_STRUCT_FIELDS}; -use rustc_session::lint::{self, Lint, LintId}; +use rustc_session::lint; +use rustc_session::lint::builtin::DEAD_CODE; use rustc_span::symbol::{sym, Symbol}; use rustc_target::abi::FieldIdx; use std::mem; @@ -766,6 +766,12 @@ enum ShouldWarnAboutField { No, } +#[derive(Debug, Copy, Clone, PartialEq, Eq)] +enum ReportOn { + TupleField, + NamedField, +} + impl<'tcx> DeadVisitor<'tcx> { fn should_warn_about_field(&mut self, field: &ty::FieldDef) -> ShouldWarnAboutField { if self.live_symbols.contains(&field.did.expect_local()) { @@ -787,9 +793,9 @@ impl<'tcx> DeadVisitor<'tcx> { ShouldWarnAboutField::Yes } - fn def_lint_level(&self, lint: &'static Lint, id: LocalDefId) -> lint::Level { + fn def_lint_level(&self, id: LocalDefId) -> lint::Level { let hir_id = self.tcx.local_def_id_to_hir_id(id); - self.tcx.lint_level_at_node(lint, hir_id).0 + self.tcx.lint_level_at_node(DEAD_CODE, hir_id).0 } // # Panics @@ -803,7 +809,7 @@ impl<'tcx> DeadVisitor<'tcx> { dead_codes: &[&DeadItem], participle: &str, parent_item: Option<LocalDefId>, - lint: &'static Lint, + report_on: ReportOn, ) { let Some(&first_item) = dead_codes.first() else { return; @@ -864,8 +870,8 @@ impl<'tcx> DeadVisitor<'tcx> { None }; - let diag = if LintId::of(lint) == LintId::of(UNUSED_TUPLE_STRUCT_FIELDS) { - MultipleDeadCodes::UnusedTupleStructFields { + let diag = match report_on { + ReportOn::TupleField => MultipleDeadCodes::UnusedTupleStructFields { multiple, num, descr, @@ -874,9 +880,9 @@ impl<'tcx> DeadVisitor<'tcx> { change_fields_suggestion: ChangeFieldsToBeOfUnitType { num, spans: spans.clone() }, parent_info, ignored_derived_impls, - } - } else { - MultipleDeadCodes::DeadCodes { + }, + + ReportOn::NamedField => MultipleDeadCodes::DeadCodes { multiple, num, descr, @@ -884,11 +890,11 @@ impl<'tcx> DeadVisitor<'tcx> { name_list, parent_info, ignored_derived_impls, - } + }, }; let hir_id = tcx.local_def_id_to_hir_id(first_item.def_id); - self.tcx.emit_spanned_lint(lint, hir_id, MultiSpan::from_spans(spans), diag); + self.tcx.emit_spanned_lint(DEAD_CODE, hir_id, MultiSpan::from_spans(spans), diag); } fn warn_multiple( @@ -896,7 +902,7 @@ impl<'tcx> DeadVisitor<'tcx> { def_id: LocalDefId, participle: &str, dead_codes: Vec<DeadItem>, - lint: &'static Lint, + report_on: ReportOn, ) { let mut dead_codes = dead_codes .iter() @@ -907,7 +913,7 @@ impl<'tcx> DeadVisitor<'tcx> { } dead_codes.sort_by_key(|v| v.level); for group in dead_codes[..].group_by(|a, b| a.level == b.level) { - self.lint_at_single_level(&group, participle, Some(def_id), lint); + self.lint_at_single_level(&group, participle, Some(def_id), report_on); } } @@ -915,9 +921,9 @@ impl<'tcx> DeadVisitor<'tcx> { let item = DeadItem { def_id: id, name: self.tcx.item_name(id.to_def_id()), - level: self.def_lint_level(DEAD_CODE, id), + level: self.def_lint_level(id), }; - self.lint_at_single_level(&[&item], participle, None, DEAD_CODE); + self.lint_at_single_level(&[&item], participle, None, ReportOn::NamedField); } fn check_definition(&mut self, def_id: LocalDefId) { @@ -964,12 +970,12 @@ fn check_mod_deathness(tcx: TyCtxt<'_>, module: LocalModDefId) { let def_id = item.id.owner_id.def_id; if !visitor.is_live_code(def_id) { let name = tcx.item_name(def_id.to_def_id()); - let level = visitor.def_lint_level(DEAD_CODE, def_id); + let level = visitor.def_lint_level(def_id); dead_items.push(DeadItem { def_id, name, level }) } } - visitor.warn_multiple(item.owner_id.def_id, "used", dead_items, DEAD_CODE); + visitor.warn_multiple(item.owner_id.def_id, "used", dead_items, ReportOn::NamedField); } if !live_symbols.contains(&item.owner_id.def_id) { @@ -991,7 +997,7 @@ fn check_mod_deathness(tcx: TyCtxt<'_>, module: LocalModDefId) { let def_id = variant.def_id.expect_local(); if !live_symbols.contains(&def_id) { // Record to group diagnostics. - let level = visitor.def_lint_level(DEAD_CODE, def_id); + let level = visitor.def_lint_level(def_id); dead_variants.push(DeadItem { def_id, name: variant.name, level }); continue; } @@ -999,24 +1005,30 @@ fn check_mod_deathness(tcx: TyCtxt<'_>, module: LocalModDefId) { let is_positional = variant.fields.raw.first().map_or(false, |field| { field.name.as_str().starts_with(|c: char| c.is_ascii_digit()) }); - let lint = if is_positional { UNUSED_TUPLE_STRUCT_FIELDS } else { DEAD_CODE }; + let report_on = + if is_positional { ReportOn::TupleField } else { ReportOn::NamedField }; let dead_fields = variant .fields .iter() .filter_map(|field| { let def_id = field.did.expect_local(); if let ShouldWarnAboutField::Yes = visitor.should_warn_about_field(field) { - let level = visitor.def_lint_level(lint, def_id); + let level = visitor.def_lint_level(def_id); Some(DeadItem { def_id, name: field.name, level }) } else { None } }) .collect(); - visitor.warn_multiple(def_id, "read", dead_fields, lint); + visitor.warn_multiple(def_id, "read", dead_fields, report_on); } - visitor.warn_multiple(item.owner_id.def_id, "constructed", dead_variants, DEAD_CODE); + visitor.warn_multiple( + item.owner_id.def_id, + "constructed", + dead_variants, + ReportOn::NamedField, + ); } } diff --git a/compiler/rustc_passes/src/errors.rs b/compiler/rustc_passes/src/errors.rs index 856256a0641..9bd9dd41cf6 100644 --- a/compiler/rustc_passes/src/errors.rs +++ b/compiler/rustc_passes/src/errors.rs @@ -868,8 +868,8 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for InvalidAttrAtCrateLevel { fn into_diagnostic(self, dcx: &'_ DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::passes_invalid_attr_at_crate_level); - diag.set_span(self.span); - diag.set_arg("name", self.name); + diag.span(self.span); + diag.arg("name", self.name); // Only emit an error with a suggestion if we can create a string out // of the attribute span if let Some(span) = self.sugg_span { @@ -881,7 +881,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for InvalidAttrAtCrateLevel { ); } if let Some(item) = self.item { - diag.set_arg("kind", item.kind); + diag.arg("kind", item.kind); diag.span_label(item.span, fluent::passes_invalid_attr_at_crate_level_item); } diag @@ -1018,9 +1018,9 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'_, G> for BreakNonLoop<'a> { #[track_caller] fn into_diagnostic(self, dcx: &DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::passes_break_non_loop); - diag.set_span(self.span); + diag.span(self.span); diag.code(error_code!(E0571)); - diag.set_arg("kind", self.kind); + diag.arg("kind", self.kind); diag.span_label(self.span, fluent::passes_label); if let Some(head) = self.head { diag.span_label(head, fluent::passes_label2); @@ -1162,7 +1162,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for NakedFunctionsAsmBlock { #[track_caller] fn into_diagnostic(self, dcx: &DiagCtxt, level: Level) -> DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::passes_naked_functions_asm_block); - diag.set_span(self.span); + diag.span(self.span); diag.code(error_code!(E0787)); for span in self.multiple_asms.iter() { diag.span_label(*span, fluent::passes_label_multiple_asm); @@ -1273,11 +1273,11 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for NoMainErr { #[track_caller] fn into_diagnostic(self, dcx: &'a DiagCtxt, level: Level) -> DiagnosticBuilder<'a, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::passes_no_main_function); - diag.set_span(DUMMY_SP); + diag.span(DUMMY_SP); diag.code(error_code!(E0601)); - diag.set_arg("crate_name", self.crate_name); - diag.set_arg("filename", self.filename); - diag.set_arg("has_filename", self.has_filename); + diag.arg("crate_name", self.crate_name); + diag.arg("filename", self.filename); + diag.arg("has_filename", self.has_filename); let note = if !self.non_main_fns.is_empty() { for &span in &self.non_main_fns { diag.span_note(span, fluent::passes_here_is_main); @@ -1294,7 +1294,7 @@ impl<'a, G: EmissionGuarantee> IntoDiagnostic<'a, G> for NoMainErr { if self.file_empty { diag.note(note); } else { - diag.set_span(self.sp.shrink_to_hi()); + diag.span(self.sp.shrink_to_hi()); diag.span_label(self.sp.shrink_to_hi(), note); } @@ -1340,15 +1340,15 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for DuplicateLangItem { }, ); diag.code(error_code!(E0152)); - diag.set_arg("lang_item_name", self.lang_item_name); - diag.set_arg("crate_name", self.crate_name); - diag.set_arg("dependency_of", self.dependency_of); - diag.set_arg("path", self.path); - diag.set_arg("orig_crate_name", self.orig_crate_name); - diag.set_arg("orig_dependency_of", self.orig_dependency_of); - diag.set_arg("orig_path", self.orig_path); + diag.arg("lang_item_name", self.lang_item_name); + diag.arg("crate_name", self.crate_name); + diag.arg("dependency_of", self.dependency_of); + diag.arg("path", self.path); + diag.arg("orig_crate_name", self.orig_crate_name); + diag.arg("orig_dependency_of", self.orig_dependency_of); + diag.arg("orig_path", self.orig_path); if let Some(span) = self.local_span { - diag.set_span(span); + diag.span(span); } if let Some(span) = self.first_defined_span { diag.span_note(span, fluent::passes_first_defined_span); diff --git a/compiler/rustc_passes/src/liveness.rs b/compiler/rustc_passes/src/liveness.rs index cfe829f170f..8fa4fa1e384 100644 --- a/compiler/rustc_passes/src/liveness.rs +++ b/compiler/rustc_passes/src/liveness.rs @@ -351,10 +351,7 @@ impl<'tcx> Visitor<'tcx> for IrMaps<'tcx> { } fn visit_arm(&mut self, arm: &'tcx hir::Arm<'tcx>) { - self.add_from_pat(arm.pat); - if let Some(hir::Guard::IfLet(let_expr)) = arm.guard { - self.add_from_pat(let_expr.pat); - } + self.add_from_pat(&arm.pat); intravisit::walk_arm(self, arm); } @@ -921,14 +918,11 @@ impl<'a, 'tcx> Liveness<'a, 'tcx> { for arm in arms { let body_succ = self.propagate_through_expr(arm.body, succ); - let guard_succ = arm.guard.as_ref().map_or(body_succ, |g| match g { - hir::Guard::If(e) => self.propagate_through_expr(e, body_succ), - hir::Guard::IfLet(let_expr) => { - let let_bind = self.define_bindings_in_pat(let_expr.pat, body_succ); - self.propagate_through_expr(let_expr.init, let_bind) - } - }); - let arm_succ = self.define_bindings_in_pat(arm.pat, guard_succ); + let guard_succ = arm + .guard + .as_ref() + .map_or(body_succ, |g| self.propagate_through_expr(g, body_succ)); + let arm_succ = self.define_bindings_in_pat(&arm.pat, guard_succ); self.merge_from_succ(ln, arm_succ); } self.propagate_through_expr(e, ln) @@ -1328,9 +1322,6 @@ impl<'a, 'tcx> Visitor<'tcx> for Liveness<'a, 'tcx> { fn visit_arm(&mut self, arm: &'tcx hir::Arm<'tcx>) { self.check_unused_vars_in_pat(arm.pat, None, None, |_, _, _, _| {}); - if let Some(hir::Guard::IfLet(let_expr)) = arm.guard { - self.check_unused_vars_in_pat(let_expr.pat, None, None, |_, _, _, _| {}); - } intravisit::walk_arm(self, arm); } } diff --git a/compiler/rustc_pattern_analysis/src/lints.rs b/compiler/rustc_pattern_analysis/src/lints.rs index cb712fe640c..1a4f3edd810 100644 --- a/compiler/rustc_pattern_analysis/src/lints.rs +++ b/compiler/rustc_pattern_analysis/src/lints.rs @@ -204,7 +204,7 @@ pub(crate) fn lint_nonexhaustive_missing_variants<'a, 'p, 'tcx>( use rustc_errors::DecorateLint; let mut err = rcx.tcx.dcx().struct_span_warn(arm.pat.data().unwrap().span, ""); - err.set_primary_message(decorator.msg()); + err.primary_message(decorator.msg()); decorator.decorate_lint(&mut err); err.emit(); } diff --git a/compiler/rustc_resolve/src/diagnostics.rs b/compiler/rustc_resolve/src/diagnostics.rs index 8743b734926..c1cb20f6bb0 100644 --- a/compiler/rustc_resolve/src/diagnostics.rs +++ b/compiler/rustc_resolve/src/diagnostics.rs @@ -100,6 +100,8 @@ pub(crate) struct ImportSuggestion { pub descr: &'static str, pub path: Path, pub accessible: bool, + // false if the path traverses a foreign `#[doc(hidden)]` item. + pub doc_visible: bool, pub via_import: bool, /// An extra note that should be issued if this item is suggested pub note: Option<String>, @@ -1146,10 +1148,16 @@ impl<'a, 'tcx> Resolver<'a, 'tcx> { { let mut candidates = Vec::new(); let mut seen_modules = FxHashSet::default(); - let mut worklist = vec![(start_module, ThinVec::<ast::PathSegment>::new(), true)]; + let start_did = start_module.def_id(); + let mut worklist = vec![( + start_module, + ThinVec::<ast::PathSegment>::new(), + true, + start_did.is_local() || !self.tcx.is_doc_hidden(start_did), + )]; let mut worklist_via_import = vec![]; - while let Some((in_module, path_segments, accessible)) = match worklist.pop() { + while let Some((in_module, path_segments, accessible, doc_visible)) = match worklist.pop() { None => worklist_via_import.pop(), Some(x) => Some(x), } { @@ -1192,6 +1200,14 @@ impl<'a, 'tcx> Resolver<'a, 'tcx> { } } + let res = name_binding.res(); + let did = match res { + Res::Def(DefKind::Ctor(..), did) => this.tcx.opt_parent(did), + _ => res.opt_def_id(), + }; + let child_doc_visible = doc_visible + && (did.map_or(true, |did| did.is_local() || !this.tcx.is_doc_hidden(did))); + // collect results based on the filter function // avoid suggesting anything from the same module in which we are resolving // avoid suggesting anything with a hygienic name @@ -1200,7 +1216,6 @@ impl<'a, 'tcx> Resolver<'a, 'tcx> { && in_module != parent_scope.module && !ident.span.normalize_to_macros_2_0().from_expansion() { - let res = name_binding.res(); if filter_fn(res) { // create the path let mut segms = if lookup_ident.span.at_least_rust_2018() { @@ -1214,10 +1229,6 @@ impl<'a, 'tcx> Resolver<'a, 'tcx> { segms.push(ast::PathSegment::from_ident(ident)); let path = Path { span: name_binding.span, segments: segms, tokens: None }; - let did = match res { - Res::Def(DefKind::Ctor(..), did) => this.tcx.opt_parent(did), - _ => res.opt_def_id(), - }; if child_accessible { // Remove invisible match if exists @@ -1257,6 +1268,7 @@ impl<'a, 'tcx> Resolver<'a, 'tcx> { descr: res.descr(), path, accessible: child_accessible, + doc_visible: child_doc_visible, note, via_import, }); @@ -1277,7 +1289,7 @@ impl<'a, 'tcx> Resolver<'a, 'tcx> { // add the module to the lookup if seen_modules.insert(module.def_id()) { if via_import { &mut worklist_via_import } else { &mut worklist } - .push((module, path_segments, child_accessible)); + .push((module, path_segments, child_accessible, child_doc_visible)); } } } @@ -2687,8 +2699,26 @@ fn show_candidates( Vec::new(); candidates.iter().for_each(|c| { - (if c.accessible { &mut accessible_path_strings } else { &mut inaccessible_path_strings }) - .push((pprust::path_to_string(&c.path), c.descr, c.did, &c.note, c.via_import)) + if c.accessible { + // Don't suggest `#[doc(hidden)]` items from other crates + if c.doc_visible { + accessible_path_strings.push(( + pprust::path_to_string(&c.path), + c.descr, + c.did, + &c.note, + c.via_import, + )) + } + } else { + inaccessible_path_strings.push(( + pprust::path_to_string(&c.path), + c.descr, + c.did, + &c.note, + c.via_import, + )) + } }); // we want consistent results across executions, but candidates are produced @@ -2787,9 +2817,7 @@ fn show_candidates( err.help(msg); } true - } else if !matches!(mode, DiagnosticMode::Import) { - assert!(!inaccessible_path_strings.is_empty()); - + } else if !(inaccessible_path_strings.is_empty() || matches!(mode, DiagnosticMode::Import)) { let prefix = if let DiagnosticMode::Pattern = mode { "you might have meant to match on " } else { diff --git a/compiler/rustc_resolve/src/late.rs b/compiler/rustc_resolve/src/late.rs index c3026e52430..a82f7bdfbf3 100644 --- a/compiler/rustc_resolve/src/late.rs +++ b/compiler/rustc_resolve/src/late.rs @@ -3076,7 +3076,16 @@ impl<'a: 'ast, 'b, 'ast, 'tcx> LateResolutionVisitor<'a, 'b, 'ast, 'tcx> { } let feed_visibility = |this: &mut Self, def_id| { - let vis = this.r.tcx.visibility(def_id).expect_local(); + let vis = this.r.tcx.visibility(def_id); + let vis = if vis.is_visible_locally() { + vis.expect_local() + } else { + this.r.dcx().span_delayed_bug( + span, + "error should be emitted when an unexpected trait item is used", + ); + rustc_middle::ty::Visibility::Public + }; this.r.feed_visibility(this.r.local_def_id(id), vis); }; diff --git a/compiler/rustc_resolve/src/late/diagnostics.rs b/compiler/rustc_resolve/src/late/diagnostics.rs index 9bd58dfe82b..0fe606cacf5 100644 --- a/compiler/rustc_resolve/src/late/diagnostics.rs +++ b/compiler/rustc_resolve/src/late/diagnostics.rs @@ -1383,7 +1383,7 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { | PathSource::TupleStruct(span, _) => { // We want the main underline to cover the suggested code as well for // cleaner output. - err.set_span(*span); + err.span(*span); *span } _ => span, @@ -1615,7 +1615,7 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { let field_spans = match source { // e.g. `if let Enum::TupleVariant(field1, field2) = _` PathSource::TupleStruct(_, pattern_spans) => { - err.set_primary_message( + err.primary_message( "cannot match against a tuple struct which contains private fields", ); @@ -1628,7 +1628,7 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { span: call_span, .. })) => { - err.set_primary_message( + err.primary_message( "cannot initialize a tuple struct which contains private fields", ); self.suggest_alternative_construction_methods( @@ -2191,15 +2191,20 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { fn find_module(&mut self, def_id: DefId) -> Option<(Module<'a>, ImportSuggestion)> { let mut result = None; let mut seen_modules = FxHashSet::default(); - let mut worklist = vec![(self.r.graph_root, ThinVec::new())]; - - while let Some((in_module, path_segments)) = worklist.pop() { + let root_did = self.r.graph_root.def_id(); + let mut worklist = vec![( + self.r.graph_root, + ThinVec::new(), + root_did.is_local() || !self.r.tcx.is_doc_hidden(root_did), + )]; + + while let Some((in_module, path_segments, doc_visible)) = worklist.pop() { // abort if the module is already found if result.is_some() { break; } - in_module.for_each_child(self.r, |_, ident, _, name_binding| { + in_module.for_each_child(self.r, |r, ident, _, name_binding| { // abort if the module is already found or if name_binding is private external if result.is_some() || !name_binding.vis.is_visible_locally() { return; @@ -2209,6 +2214,8 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { let mut path_segments = path_segments.clone(); path_segments.push(ast::PathSegment::from_ident(ident)); let module_def_id = module.def_id(); + let doc_visible = doc_visible + && (module_def_id.is_local() || !r.tcx.is_doc_hidden(module_def_id)); if module_def_id == def_id { let path = Path { span: name_binding.span, segments: path_segments, tokens: None }; @@ -2219,6 +2226,7 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { descr: "module", path, accessible: true, + doc_visible, note: None, via_import: false, }, @@ -2226,7 +2234,7 @@ impl<'a: 'ast, 'ast, 'tcx> LateResolutionVisitor<'a, '_, 'ast, 'tcx> { } else { // add the module to the lookup if seen_modules.insert(module_def_id) { - worklist.push((module, path_segments)); + worklist.push((module, path_segments, doc_visible)); } } } diff --git a/compiler/rustc_session/src/config.rs b/compiler/rustc_session/src/config.rs index 89508c77639..12d8293ecd2 100644 --- a/compiler/rustc_session/src/config.rs +++ b/compiler/rustc_session/src/config.rs @@ -125,21 +125,6 @@ pub enum LtoCli { Unspecified, } -/// The different settings that the `-Z dump_mir_spanview` flag can have. `Statement` generates a -/// document highlighting each span of every statement (including terminators). `Terminator` and -/// `Block` highlight a single span per `BasicBlock`: the span of the block's `Terminator`, or a -/// computed span for the block, representing the entire range, covering the block's terminator and -/// all of its statements. -#[derive(Clone, Copy, PartialEq, Hash, Debug)] -pub enum MirSpanview { - /// Default `-Z dump_mir_spanview` or `-Z dump_mir_spanview=statement` - Statement, - /// `-Z dump_mir_spanview=terminator` - Terminator, - /// `-Z dump_mir_spanview=block` - Block, -} - /// The different settings that the `-C instrument-coverage` flag can have. /// /// Coverage instrumentation now supports combining `-C instrument-coverage` @@ -1162,7 +1147,6 @@ impl UnstableOptions { can_emit_warnings, treat_err_as_bug: self.treat_err_as_bug, dont_buffer_diagnostics: self.dont_buffer_diagnostics, - report_delayed_bugs: self.report_delayed_bugs, macro_backtrace: self.macro_backtrace, deduplicate_diagnostics: self.deduplicate_diagnostics, track_diagnostics: self.track_diagnostics, @@ -2051,23 +2035,14 @@ fn check_error_format_stability( early_dcx: &mut EarlyDiagCtxt, unstable_opts: &UnstableOptions, error_format: ErrorOutputType, - json_rendered: HumanReadableErrorType, ) { if !unstable_opts.unstable_options { - if let ErrorOutputType::Json { pretty: true, json_rendered } = error_format { - early_dcx.abort_if_error_and_set_error_format(ErrorOutputType::Json { - pretty: false, - json_rendered, - }); + if let ErrorOutputType::Json { pretty: true, .. } = error_format { early_dcx.early_fatal("`--error-format=pretty-json` is unstable"); } if let ErrorOutputType::HumanReadable(HumanReadableErrorType::AnnotateSnippet(_)) = error_format { - early_dcx.abort_if_error_and_set_error_format(ErrorOutputType::Json { - pretty: false, - json_rendered, - }); early_dcx.early_fatal("`--error-format=human-annotate-rs` is unstable"); } } @@ -2665,7 +2640,7 @@ pub fn build_session_options(early_dcx: &mut EarlyDiagCtxt, matches: &getopts::M let mut unstable_opts = UnstableOptions::build(early_dcx, matches); let (lint_opts, describe_lints, lint_cap) = get_cmd_lint_options(early_dcx, matches); - check_error_format_stability(early_dcx, &unstable_opts, error_format, json_rendered); + check_error_format_stability(early_dcx, &unstable_opts, error_format); if !unstable_opts.unstable_options && json_unused_externs.is_enabled() { early_dcx.early_fatal( diff --git a/compiler/rustc_session/src/errors.rs b/compiler/rustc_session/src/errors.rs index 0f86773b73f..758c3122404 100644 --- a/compiler/rustc_session/src/errors.rs +++ b/compiler/rustc_session/src/errors.rs @@ -19,7 +19,7 @@ impl<'a> IntoDiagnostic<'a> for FeatureGateError { #[track_caller] fn into_diagnostic(self, dcx: &'a DiagCtxt, level: Level) -> DiagnosticBuilder<'a> { let mut diag = DiagnosticBuilder::new(dcx, level, self.explain); - diag.set_span(self.span); + diag.span(self.span); diag.code(error_code!(E0658)); diag } diff --git a/compiler/rustc_session/src/options.rs b/compiler/rustc_session/src/options.rs index 8274fd05bc0..842bf1d60f6 100644 --- a/compiler/rustc_session/src/options.rs +++ b/compiler/rustc_session/src/options.rs @@ -391,7 +391,6 @@ mod desc { pub const parse_strip: &str = "either `none`, `debuginfo`, or `symbols`"; pub const parse_linker_flavor: &str = ::rustc_target::spec::LinkerFlavorCli::one_of(); pub const parse_optimization_fuel: &str = "crate=integer"; - pub const parse_mir_spanview: &str = "`statement` (default), `terminator`, or `block`"; pub const parse_dump_mono_stats: &str = "`markdown` (default) or `json`"; pub const parse_instrument_coverage: &str = "`all` (default), `branch`, `except-unused-generics`, `except-unused-functions`, or `off`"; @@ -866,29 +865,6 @@ mod parse { } } - pub(crate) fn parse_mir_spanview(slot: &mut Option<MirSpanview>, v: Option<&str>) -> bool { - if v.is_some() { - let mut bool_arg = None; - if parse_opt_bool(&mut bool_arg, v) { - *slot = bool_arg.unwrap().then_some(MirSpanview::Statement); - return true; - } - } - - let Some(v) = v else { - *slot = Some(MirSpanview::Statement); - return true; - }; - - *slot = Some(match v.trim_end_matches('s') { - "statement" | "stmt" => MirSpanview::Statement, - "terminator" | "term" => MirSpanview::Terminator, - "block" | "basicblock" => MirSpanview::Block, - _ => return false, - }); - true - } - pub(crate) fn parse_time_passes_format(slot: &mut TimePassesFormat, v: Option<&str>) -> bool { match v { None => true, @@ -1601,11 +1577,6 @@ options! { "exclude the pass number when dumping MIR (used in tests) (default: no)"), dump_mir_graphviz: bool = (false, parse_bool, [UNTRACKED], "in addition to `.mir` files, create graphviz `.dot` files (default: no)"), - dump_mir_spanview: Option<MirSpanview> = (None, parse_mir_spanview, [UNTRACKED], - "in addition to `.mir` files, create `.html` files to view spans for \ - all `statement`s (including terminators), only `terminator` spans, or \ - computed `block` spans (one span encompassing a block's terminator and \ - all statements)."), dump_mono_stats: SwitchWithOptPath = (SwitchWithOptPath::Disabled, parse_switch_with_opt_path, [UNTRACKED], "output statistics about monomorphization collection"), @@ -1841,8 +1812,6 @@ options! { remark_dir: Option<PathBuf> = (None, parse_opt_pathbuf, [UNTRACKED], "directory into which to write optimization remarks (if not specified, they will be \ written to standard error output)"), - report_delayed_bugs: bool = (false, parse_bool, [TRACKED], - "immediately print bugs registered with `span_delayed_bug` (default: no)"), sanitizer: SanitizerSet = (SanitizerSet::empty(), parse_sanitizers, [TRACKED], "use a sanitizer"), sanitizer_cfi_canonical_jump_tables: Option<bool> = (Some(true), parse_opt_bool, [TRACKED], @@ -1919,8 +1888,8 @@ written to standard error output)"), #[rustc_lint_opt_deny_field_access("use `Session::lto` instead of this field")] thinlto: Option<bool> = (None, parse_opt_bool, [TRACKED], "enable ThinLTO when possible"), - thir_unsafeck: bool = (false, parse_bool, [TRACKED], - "use the THIR unsafety checker (default: no)"), + thir_unsafeck: bool = (true, parse_bool, [TRACKED], + "use the THIR unsafety checker (default: yes)"), /// We default to 1 here since we want to behave like /// a sequential compiler for now. This'll likely be adjusted /// in the future. Note that -Zthreads=0 is the way to get diff --git a/compiler/rustc_session/src/session.rs b/compiler/rustc_session/src/session.rs index 9ee7625e5bf..ce166ae352f 100644 --- a/compiler/rustc_session/src/session.rs +++ b/compiler/rustc_session/src/session.rs @@ -17,8 +17,8 @@ use rustc_data_structures::profiling::{SelfProfiler, SelfProfilerRef}; use rustc_data_structures::sync::{ AtomicU64, DynSend, DynSync, Lock, Lrc, OneThread, Ordering::SeqCst, }; -use rustc_errors::annotate_snippet_emitter_writer::AnnotateSnippetEmitterWriter; -use rustc_errors::emitter::{DynEmitter, EmitterWriter, HumanReadableErrorType}; +use rustc_errors::annotate_snippet_emitter_writer::AnnotateSnippetEmitter; +use rustc_errors::emitter::{DynEmitter, HumanEmitter, HumanReadableErrorType}; use rustc_errors::json::JsonEmitter; use rustc_errors::registry::Registry; use rustc_errors::{ @@ -1000,7 +1000,7 @@ fn default_emitter( let (short, color_config) = kind.unzip(); if let HumanReadableErrorType::AnnotateSnippet(_) = kind { - let emitter = AnnotateSnippetEmitterWriter::new( + let emitter = AnnotateSnippetEmitter::new( Some(source_map), bundle, fallback_bundle, @@ -1009,7 +1009,7 @@ fn default_emitter( ); Box::new(emitter.ui_testing(sopts.unstable_opts.ui_testing)) } else { - let emitter = EmitterWriter::stderr(color_config, fallback_bundle) + let emitter = HumanEmitter::stderr(color_config, fallback_bundle) .fluent_bundle(bundle) .sm(Some(source_map)) .short_message(short) @@ -1274,7 +1274,10 @@ fn validate_commandline_args_with_session_available(sess: &Session) { } // Cannot enable crt-static with sanitizers on Linux - if sess.crt_static(None) && !sess.opts.unstable_opts.sanitizer.is_empty() { + if sess.crt_static(None) + && !sess.opts.unstable_opts.sanitizer.is_empty() + && !sess.target.is_like_msvc + { sess.dcx().emit_err(errors::CannotEnableCrtStaticLinux); } @@ -1501,7 +1504,7 @@ fn mk_emitter(output: ErrorOutputType) -> Box<DynEmitter> { let emitter: Box<DynEmitter> = match output { config::ErrorOutputType::HumanReadable(kind) => { let (short, color_config) = kind.unzip(); - Box::new(EmitterWriter::stderr(color_config, fallback_bundle).short_message(short)) + Box::new(HumanEmitter::stderr(color_config, fallback_bundle).short_message(short)) } config::ErrorOutputType::Json { pretty, json_rendered } => Box::new(JsonEmitter::basic( pretty, diff --git a/compiler/rustc_span/src/symbol.rs b/compiler/rustc_span/src/symbol.rs index 0b44071496e..9af81e06303 100644 --- a/compiler/rustc_span/src/symbol.rs +++ b/compiler/rustc_span/src/symbol.rs @@ -1041,6 +1041,7 @@ symbols! { mir_offset, mir_retag, mir_return, + mir_return_to, mir_set_discriminant, mir_static, mir_static_mut, diff --git a/compiler/rustc_symbol_mangling/src/errors.rs b/compiler/rustc_symbol_mangling/src/errors.rs index 06a2b3ca9c4..0fa59d2ddfb 100644 --- a/compiler/rustc_symbol_mangling/src/errors.rs +++ b/compiler/rustc_symbol_mangling/src/errors.rs @@ -19,7 +19,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for TestOutput { #[allow(rustc::untranslatable_diagnostic)] let mut diag = DiagnosticBuilder::new(dcx, level, format!("{kind}({content})")); - diag.set_span(span); + diag.span(span); diag } } diff --git a/compiler/rustc_target/src/asm/s390x.rs b/compiler/rustc_target/src/asm/s390x.rs index 0a50064f587..b8afeb824d8 100644 --- a/compiler/rustc_target/src/asm/s390x.rs +++ b/compiler/rustc_target/src/asm/s390x.rs @@ -6,6 +6,7 @@ use std::fmt; def_reg_class! { S390x S390xInlineAsmRegClass { reg, + reg_addr, freg, } } @@ -36,7 +37,7 @@ impl S390xInlineAsmRegClass { arch: InlineAsmArch, ) -> &'static [(InlineAsmType, Option<Symbol>)] { match (self, arch) { - (Self::reg, _) => types! { _: I8, I16, I32, I64; }, + (Self::reg | Self::reg_addr, _) => types! { _: I8, I16, I32, I64; }, (Self::freg, _) => types! { _: F32, F64; }, } } @@ -45,19 +46,19 @@ impl S390xInlineAsmRegClass { def_regs! { S390x S390xInlineAsmReg S390xInlineAsmRegClass { r0: reg = ["r0"], - r1: reg = ["r1"], - r2: reg = ["r2"], - r3: reg = ["r3"], - r4: reg = ["r4"], - r5: reg = ["r5"], - r6: reg = ["r6"], - r7: reg = ["r7"], - r8: reg = ["r8"], - r9: reg = ["r9"], - r10: reg = ["r10"], - r12: reg = ["r12"], - r13: reg = ["r13"], - r14: reg = ["r14"], + r1: reg, reg_addr = ["r1"], + r2: reg, reg_addr = ["r2"], + r3: reg, reg_addr = ["r3"], + r4: reg, reg_addr = ["r4"], + r5: reg, reg_addr = ["r5"], + r6: reg, reg_addr = ["r6"], + r7: reg, reg_addr = ["r7"], + r8: reg, reg_addr = ["r8"], + r9: reg, reg_addr = ["r9"], + r10: reg, reg_addr = ["r10"], + r12: reg, reg_addr = ["r12"], + r13: reg, reg_addr = ["r13"], + r14: reg, reg_addr = ["r14"], f0: freg = ["f0"], f1: freg = ["f1"], f2: freg = ["f2"], diff --git a/compiler/rustc_target/src/spec/targets/i686_pc_windows_msvc.rs b/compiler/rustc_target/src/spec/targets/i686_pc_windows_msvc.rs index ba80c23196e..5abc3017bf8 100644 --- a/compiler/rustc_target/src/spec/targets/i686_pc_windows_msvc.rs +++ b/compiler/rustc_target/src/spec/targets/i686_pc_windows_msvc.rs @@ -1,9 +1,10 @@ -use crate::spec::{base, LinkerFlavor, Lld, Target}; +use crate::spec::{base, LinkerFlavor, Lld, SanitizerSet, Target}; pub fn target() -> Target { let mut base = base::windows_msvc::opts(); base.cpu = "pentium4".into(); base.max_atomic_width = Some(64); + base.supported_sanitizers = SanitizerSet::ADDRESS; base.add_pre_link_args( LinkerFlavor::Msvc(Lld::No), diff --git a/compiler/rustc_target/src/spec/targets/x86_64_pc_windows_msvc.rs b/compiler/rustc_target/src/spec/targets/x86_64_pc_windows_msvc.rs index 7d6276a0c2d..3a4da91c244 100644 --- a/compiler/rustc_target/src/spec/targets/x86_64_pc_windows_msvc.rs +++ b/compiler/rustc_target/src/spec/targets/x86_64_pc_windows_msvc.rs @@ -1,10 +1,11 @@ -use crate::spec::{base, Target}; +use crate::spec::{base, SanitizerSet, Target}; pub fn target() -> Target { let mut base = base::windows_msvc::opts(); base.cpu = "x86-64".into(); base.plt_by_default = false; base.max_atomic_width = Some(64); + base.supported_sanitizers = SanitizerSet::ADDRESS; Target { llvm_target: "x86_64-pc-windows-msvc".into(), diff --git a/compiler/rustc_trait_selection/src/errors.rs b/compiler/rustc_trait_selection/src/errors.rs index bea6fbd6ac5..5eff52afbca 100644 --- a/compiler/rustc_trait_selection/src/errors.rs +++ b/compiler/rustc_trait_selection/src/errors.rs @@ -66,12 +66,9 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for NegativePositiveConflict<'_ ) -> rustc_errors::DiagnosticBuilder<'_, G> { let mut diag = DiagnosticBuilder::new(dcx, level, fluent::trait_selection_negative_positive_conflict); - diag.set_arg("trait_desc", self.trait_desc.print_only_trait_path().to_string()); - diag.set_arg( - "self_desc", - self.self_ty.map_or_else(|| "none".to_string(), |ty| ty.to_string()), - ); - diag.set_span(self.impl_span); + diag.arg("trait_desc", self.trait_desc.print_only_trait_path().to_string()); + diag.arg("self_desc", self.self_ty.map_or_else(|| "none".to_string(), |ty| ty.to_string())); + diag.span(self.impl_span); diag.code(rustc_errors::error_code!(E0751)); match self.negative_impl_span { Ok(span) => { @@ -79,7 +76,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for NegativePositiveConflict<'_ } Err(cname) => { diag.note(fluent::trait_selection_negative_implementation_in_crate); - diag.set_arg("negative_impl_cname", cname.to_string()); + diag.arg("negative_impl_cname", cname.to_string()); } } match self.positive_impl_span { @@ -88,7 +85,7 @@ impl<G: EmissionGuarantee> IntoDiagnostic<'_, G> for NegativePositiveConflict<'_ } Err(cname) => { diag.note(fluent::trait_selection_positive_implementation_in_crate); - diag.set_arg("positive_impl_cname", cname.to_string()); + diag.arg("positive_impl_cname", cname.to_string()); } } diag @@ -115,7 +112,7 @@ impl AddToDiagnostic for AdjustSignatureBorrow { { match self { AdjustSignatureBorrow::Borrow { to_borrow } => { - diag.set_arg("len", to_borrow.len()); + diag.arg("len", to_borrow.len()); diag.multipart_suggestion_verbose( fluent::trait_selection_adjust_signature_borrow, to_borrow, @@ -123,7 +120,7 @@ impl AddToDiagnostic for AdjustSignatureBorrow { ); } AdjustSignatureBorrow::RemoveBorrow { remove_borrow } => { - diag.set_arg("len", remove_borrow.len()); + diag.arg("len", remove_borrow.len()); diag.multipart_suggestion_verbose( fluent::trait_selection_adjust_signature_remove_borrow, remove_borrow, diff --git a/compiler/rustc_trait_selection/src/traits/error_reporting/suggestions.rs b/compiler/rustc_trait_selection/src/traits/error_reporting/suggestions.rs index f63314081d6..58700850a60 100644 --- a/compiler/rustc_trait_selection/src/traits/error_reporting/suggestions.rs +++ b/compiler/rustc_trait_selection/src/traits/error_reporting/suggestions.rs @@ -19,11 +19,10 @@ use rustc_errors::{ use rustc_hir as hir; use rustc_hir::def::{DefKind, Res}; use rustc_hir::def_id::DefId; -use rustc_hir::intravisit::Visitor; +use rustc_hir::intravisit::{Map, Visitor}; use rustc_hir::is_range_literal; use rustc_hir::lang_items::LangItem; -use rustc_hir::{CoroutineDesugaring, CoroutineKind, CoroutineSource, Node}; -use rustc_hir::{Expr, HirId}; +use rustc_hir::{CoroutineDesugaring, CoroutineKind, CoroutineSource, Expr, HirId, Node}; use rustc_infer::infer::error_reporting::TypeErrCtxt; use rustc_infer::infer::type_variable::{TypeVariableOrigin, TypeVariableOriginKind}; use rustc_infer::infer::{BoundRegionConversionTime, DefineOpaqueTypes, InferOk}; @@ -2008,7 +2007,7 @@ impl<'tcx> TypeErrCtxtExt<'tcx> for TypeErrCtxt<'_, 'tcx> { }; err.code(error_code!(E0746)); - err.set_primary_message("return type cannot have an unboxed trait object"); + err.primary_message("return type cannot have an unboxed trait object"); err.children.clear(); let span = obligation.cause.span; @@ -2713,7 +2712,7 @@ impl<'tcx> TypeErrCtxtExt<'tcx> for TypeErrCtxt<'_, 'tcx> { if name == sym::Send { ("`Send`", "sent") } else { ("`Sync`", "shared") }; err.clear_code(); - err.set_primary_message(format!( + err.primary_message(format!( "{future_or_coroutine} cannot be {trait_verb} between threads safely" )); @@ -2801,7 +2800,7 @@ impl<'tcx> TypeErrCtxtExt<'tcx> for TypeErrCtxt<'_, 'tcx> { .unwrap_or_else(|| format!("{future_or_coroutine} is not {trait_name}")); span.push_span_label(original_span, message); - err.set_span(span); + err.span(span); format!("is not {trait_name}") } else { @@ -3200,35 +3199,80 @@ impl<'tcx> TypeErrCtxtExt<'tcx> for TypeErrCtxt<'_, 'tcx> { err.help("unsized locals are gated as an unstable feature"); } } - ObligationCauseCode::SizedArgumentType(ty_span) => { - if let Some(span) = ty_span { - if let ty::PredicateKind::Clause(clause) = predicate.kind().skip_binder() - && let ty::ClauseKind::Trait(trait_pred) = clause - && let ty::Dynamic(..) = trait_pred.self_ty().kind() - { - let span = if let Ok(snippet) = - self.tcx.sess.source_map().span_to_snippet(span) - && snippet.starts_with("dyn ") - { - let pos = snippet.len() - snippet[3..].trim_start().len(); - span.with_hi(span.lo() + BytePos(pos as u32)) - } else { - span.shrink_to_lo() - }; - err.span_suggestion_verbose( - span, - "you can use `impl Trait` as the argument type", - "impl ".to_string(), - Applicability::MaybeIncorrect, - ); + ObligationCauseCode::SizedArgumentType(hir_id) => { + let mut ty = None; + let borrowed_msg = "function arguments must have a statically known size, borrowed \ + types always have a known size"; + if let Some(hir_id) = hir_id + && let Some(hir::Node::Param(param)) = self.tcx.hir().find(hir_id) + && let Some(item) = self.tcx.hir().find_parent(hir_id) + && let Some(decl) = item.fn_decl() + && let Some(t) = decl.inputs.iter().find(|t| param.ty_span.contains(t.span)) + { + // We use `contains` because the type might be surrounded by parentheses, + // which makes `ty_span` and `t.span` disagree with each other, but one + // fully contains the other: `foo: (dyn Foo + Bar)` + // ^-------------^ + // || + // |t.span + // param._ty_span + ty = Some(t); + } else if let Some(hir_id) = hir_id + && let Some(hir::Node::Ty(t)) = self.tcx.hir().find(hir_id) + { + ty = Some(t); + } + if let Some(ty) = ty { + match ty.kind { + hir::TyKind::TraitObject(traits, _, _) => { + let (span, kw) = match traits { + [first, ..] if first.span.lo() == ty.span.lo() => { + // Missing `dyn` in front of trait object. + (ty.span.shrink_to_lo(), "dyn ") + } + [first, ..] => (ty.span.until(first.span), ""), + [] => span_bug!(ty.span, "trait object with no traits: {ty:?}"), + }; + let needs_parens = traits.len() != 1; + err.span_suggestion_verbose( + span, + "you can use `impl Trait` as the argument type", + "impl ".to_string(), + Applicability::MaybeIncorrect, + ); + let sugg = if !needs_parens { + vec![(span.shrink_to_lo(), format!("&{kw}"))] + } else { + vec![ + (span.shrink_to_lo(), format!("&({kw}")), + (ty.span.shrink_to_hi(), ")".to_string()), + ] + }; + err.multipart_suggestion_verbose( + borrowed_msg, + sugg, + Applicability::MachineApplicable, + ); + } + hir::TyKind::Slice(_ty) => { + err.span_suggestion_verbose( + ty.span.shrink_to_lo(), + "function arguments must have a statically known size, borrowed \ + slices always have a known size", + "&", + Applicability::MachineApplicable, + ); + } + hir::TyKind::Path(_) => { + err.span_suggestion_verbose( + ty.span.shrink_to_lo(), + borrowed_msg, + "&", + Applicability::MachineApplicable, + ); + } + _ => {} } - err.span_suggestion_verbose( - span.shrink_to_lo(), - "function arguments must have a statically known size, borrowed types \ - always have a known size", - "&", - Applicability::MachineApplicable, - ); } else { err.note("all function arguments must have a statically known size"); } diff --git a/compiler/rustc_trait_selection/src/traits/error_reporting/type_err_ctxt_ext.rs b/compiler/rustc_trait_selection/src/traits/error_reporting/type_err_ctxt_ext.rs index d2598b0defe..efc75ee538e 100644 --- a/compiler/rustc_trait_selection/src/traits/error_reporting/type_err_ctxt_ext.rs +++ b/compiler/rustc_trait_selection/src/traits/error_reporting/type_err_ctxt_ext.rs @@ -816,7 +816,7 @@ impl<'tcx> TypeErrCtxtExt<'tcx> for TypeErrCtxt<'_, 'tcx> { ty::PredicateKind::ObjectSafe(trait_def_id) => { let violations = self.tcx.object_safety_violations(trait_def_id); - report_object_safety_error(self.tcx, span, trait_def_id, violations) + report_object_safety_error(self.tcx, span, None, trait_def_id, violations) } ty::PredicateKind::Clause(ty::ClauseKind::WellFormed(ty)) => { @@ -924,7 +924,7 @@ impl<'tcx> TypeErrCtxtExt<'tcx> for TypeErrCtxt<'_, 'tcx> { TraitNotObjectSafe(did) => { let violations = self.tcx.object_safety_violations(did); - report_object_safety_error(self.tcx, span, did, violations) + report_object_safety_error(self.tcx, span, None, did, violations) } SelectionError::NotConstEvaluatable(NotConstEvaluatable::MentionsInfer) => { @@ -3163,14 +3163,14 @@ impl<'tcx> InferCtxtPrivExt<'tcx> for TypeErrCtxt<'_, 'tcx> { ) { match obligation_cause_code { ObligationCauseCode::RustCall => { - err.set_primary_message("functions with the \"rust-call\" ABI must take a single non-self tuple argument"); + err.primary_message("functions with the \"rust-call\" ABI must take a single non-self tuple argument"); } ObligationCauseCode::BindingObligation(def_id, _) | ObligationCauseCode::ItemObligation(def_id) if self.tcx.is_fn_trait(*def_id) => { err.code(rustc_errors::error_code!(E0059)); - err.set_primary_message(format!( + err.primary_message(format!( "type parameter to bare `{}` trait must be a tuple", self.tcx.def_path_str(*def_id) )); diff --git a/library/alloc/src/boxed.rs b/library/alloc/src/boxed.rs index fdf5e134f4d..6977681e5a3 100644 --- a/library/alloc/src/boxed.rs +++ b/library/alloc/src/boxed.rs @@ -24,6 +24,7 @@ //! Creating a recursive data structure: //! //! ``` +//! ##[allow(dead_code)] //! #[derive(Debug)] //! enum List<T> { //! Cons(T, Box<List<T>>), diff --git a/library/alloc/src/boxed/thin.rs b/library/alloc/src/boxed/thin.rs index a8005b7067d..9463b73b574 100644 --- a/library/alloc/src/boxed/thin.rs +++ b/library/alloc/src/boxed/thin.rs @@ -171,7 +171,7 @@ struct WithHeader<H>(NonNull<u8>, PhantomData<H>); /// An opaque representation of `WithHeader<H>` to avoid the /// projection invariance of `<T as Pointee>::Metadata`. #[repr(transparent)] -#[allow(unused_tuple_struct_fields)] // Field only used through `WithHeader` type above. +#[allow(dead_code)] // Field only used through `WithHeader` type above. struct WithOpaqueHeader(NonNull<u8>); impl WithOpaqueHeader { diff --git a/library/alloc/src/collections/btree/set/tests.rs b/library/alloc/src/collections/btree/set/tests.rs index 8726c5bfead..688ce57e9da 100644 --- a/library/alloc/src/collections/btree/set/tests.rs +++ b/library/alloc/src/collections/btree/set/tests.rs @@ -524,7 +524,7 @@ fn test_extend_ref() { #[test] fn test_recovery() { #[derive(Debug)] - struct Foo(&'static str, i32); + struct Foo(&'static str, #[allow(dead_code)] i32); impl PartialEq for Foo { fn eq(&self, other: &Self) -> bool { diff --git a/library/alloc/src/collections/vec_deque/tests.rs b/library/alloc/src/collections/vec_deque/tests.rs index b7fdebfa60b..f8ce4ca9788 100644 --- a/library/alloc/src/collections/vec_deque/tests.rs +++ b/library/alloc/src/collections/vec_deque/tests.rs @@ -1085,7 +1085,7 @@ fn test_clone_from() { fn test_vec_deque_truncate_drop() { static mut DROPS: u32 = 0; #[derive(Clone)] - struct Elem(i32); + struct Elem(#[allow(dead_code)] i32); impl Drop for Elem { fn drop(&mut self) { unsafe { diff --git a/library/alloc/tests/autotraits.rs b/library/alloc/tests/autotraits.rs index b41e457614e..ba5e28f7293 100644 --- a/library/alloc/tests/autotraits.rs +++ b/library/alloc/tests/autotraits.rs @@ -1,7 +1,7 @@ fn require_sync<T: Sync>(_: T) {} fn require_send_sync<T: Send + Sync>(_: T) {} -struct NotSend(*const ()); +struct NotSend(#[allow(dead_code)] *const ()); unsafe impl Sync for NotSend {} #[test] diff --git a/library/alloc/tests/vec.rs b/library/alloc/tests/vec.rs index 364dc920187..9ec6f6ae1ac 100644 --- a/library/alloc/tests/vec.rs +++ b/library/alloc/tests/vec.rs @@ -547,7 +547,7 @@ fn test_cmp() { #[test] fn test_vec_truncate_drop() { static mut DROPS: u32 = 0; - struct Elem(i32); + struct Elem(#[allow(dead_code)] i32); impl Drop for Elem { fn drop(&mut self) { unsafe { @@ -1089,7 +1089,7 @@ fn test_into_iter_advance_by() { #[test] fn test_into_iter_drop_allocator() { - struct ReferenceCountedAllocator<'a>(DropCounter<'a>); + struct ReferenceCountedAllocator<'a>(#[allow(dead_code)] DropCounter<'a>); unsafe impl Allocator for ReferenceCountedAllocator<'_> { fn allocate(&self, layout: Layout) -> Result<NonNull<[u8]>, core::alloc::AllocError> { @@ -2407,7 +2407,7 @@ fn test_vec_dedup_multiple_ident() { #[test] fn test_vec_dedup_partialeq() { #[derive(Debug)] - struct Foo(i32, i32); + struct Foo(i32, #[allow(dead_code)] i32); impl PartialEq for Foo { fn eq(&self, other: &Foo) -> bool { diff --git a/library/core/benches/slice.rs b/library/core/benches/slice.rs index 3bfb35e684e..8f87a211449 100644 --- a/library/core/benches/slice.rs +++ b/library/core/benches/slice.rs @@ -91,7 +91,7 @@ fn binary_search_l3_worst_case(b: &mut Bencher) { } #[derive(Clone)] -struct Rgb(u8, u8, u8); +struct Rgb(#[allow(dead_code)] u8, #[allow(dead_code)] u8, #[allow(dead_code)] u8); impl Rgb { fn gen(i: usize) -> Self { @@ -154,7 +154,7 @@ swap_with_slice!(swap_with_slice_5x_usize_3000, 3000, |i| [i; 5]); #[bench] fn fill_byte_sized(b: &mut Bencher) { #[derive(Copy, Clone)] - struct NewType(u8); + struct NewType(#[allow(dead_code)] u8); let mut ary = [NewType(0); 1024]; diff --git a/library/core/src/intrinsics.rs b/library/core/src/intrinsics.rs index 031c8d9984c..696bf6f3a94 100644 --- a/library/core/src/intrinsics.rs +++ b/library/core/src/intrinsics.rs @@ -947,7 +947,7 @@ extern "rust-intrinsic" { /// own, or if it does not enable any significant optimizations. /// /// This intrinsic does not have a stable counterpart. - #[rustc_const_unstable(feature = "const_assume", issue = "76972")] + #[rustc_const_stable(feature = "const_assume", since = "CURRENT_RUSTC_VERSION")] #[rustc_nounwind] pub fn assume(b: bool); diff --git a/library/core/src/intrinsics/mir.rs b/library/core/src/intrinsics/mir.rs index 34a61e76fcf..c6401ec1e33 100644 --- a/library/core/src/intrinsics/mir.rs +++ b/library/core/src/intrinsics/mir.rs @@ -104,21 +104,22 @@ //! } //! //! #[custom_mir(dialect = "runtime", phase = "optimized")] +#![cfg_attr(bootstrap, doc = "#[cfg(any())]")] // disable the following function in doctests when `bootstrap` is set //! fn push_and_pop<T>(v: &mut Vec<T>, value: T) { //! mir!( //! let _unused; //! let popped; //! //! { -//! Call(_unused = Vec::push(v, value), pop, UnwindContinue()) +//! Call(_unused = Vec::push(v, value), ReturnTo(pop), UnwindContinue()) //! } //! //! pop = { -//! Call(popped = Vec::pop(v), drop, UnwindContinue()) +//! Call(popped = Vec::pop(v), ReturnTo(drop), UnwindContinue()) //! } //! //! drop = { -//! Drop(popped, ret, UnwindContinue()) +//! Drop(popped, ReturnTo(ret), UnwindContinue()) //! } //! //! ret = { @@ -242,9 +243,8 @@ //! - `match some_int_operand` becomes a `SwitchInt`. Each arm should be `literal => basic_block` //! - The exception is the last arm, which must be `_ => basic_block` and corresponds to the //! otherwise branch. -//! - [`Call`] has an associated function as well. The third argument of this function is a normal -//! function call expression, for example `my_other_function(a, 5)`. -//! +//! - [`Call`] has an associated function as well, with special syntax: +//! `Call(ret_val = function(arg1, arg2, ...), ReturnTo(next_block), UnwindContinue())`. #![unstable( feature = "custom_mir", @@ -287,35 +287,68 @@ macro_rules! define { } // Unwind actions +pub struct UnwindActionArg; define!( "mir_unwind_continue", /// An unwind action that continues unwinding. - fn UnwindContinue() + fn UnwindContinue() -> UnwindActionArg ); define!( "mir_unwind_unreachable", /// An unwind action that triggers undefined behaviour. - fn UnwindUnreachable() -> BasicBlock + fn UnwindUnreachable() -> UnwindActionArg ); define!( "mir_unwind_terminate", /// An unwind action that terminates the execution. /// /// `UnwindTerminate` can also be used as a terminator. - fn UnwindTerminate(reason: UnwindTerminateReason) + fn UnwindTerminate(reason: UnwindTerminateReason) -> UnwindActionArg ); define!( "mir_unwind_cleanup", /// An unwind action that continues execution in a given basic blok. - fn UnwindCleanup(goto: BasicBlock) + fn UnwindCleanup(goto: BasicBlock) -> UnwindActionArg ); +// Return destination for `Call` +pub struct ReturnToArg; +define!("mir_return_to", fn ReturnTo(goto: BasicBlock) -> ReturnToArg); + // Terminators define!("mir_return", fn Return() -> BasicBlock); define!("mir_goto", fn Goto(destination: BasicBlock) -> BasicBlock); define!("mir_unreachable", fn Unreachable() -> BasicBlock); -define!("mir_drop", fn Drop<T, U>(place: T, goto: BasicBlock, unwind_action: U)); -define!("mir_call", fn Call<U>(call: (), goto: BasicBlock, unwind_action: U)); +define!("mir_drop", + /// Drop the contents of a place. + /// + /// The first argument must be a place. + /// + /// The second argument must be of the form `ReturnTo(bb)`, where `bb` is the basic block that + /// will be jumped to after the destructor returns. + /// + /// The third argument describes what happens on unwind. It can be one of: + /// - [`UnwindContinue`] + /// - [`UnwindUnreachable`] + /// - [`UnwindTerminate`] + /// - [`UnwindCleanup`] + fn Drop<T>(place: T, goto: ReturnToArg, unwind_action: UnwindActionArg) +); +define!("mir_call", + /// Call a function. + /// + /// The first argument must be of the form `ret_val = fun(arg1, arg2, ...)`. + /// + /// The second argument must be of the form `ReturnTo(bb)`, where `bb` is the basic block that + /// will be jumped to after the function returns. + /// + /// The third argument describes what happens on unwind. It can be one of: + /// - [`UnwindContinue`] + /// - [`UnwindUnreachable`] + /// - [`UnwindTerminate`] + /// - [`UnwindCleanup`] + fn Call(call: (), goto: ReturnToArg, unwind_action: UnwindActionArg) +); define!("mir_unwind_resume", /// A terminator that resumes the unwinding. fn UnwindResume() diff --git a/library/core/src/lib.rs b/library/core/src/lib.rs index 07720f23598..9316ec93f24 100644 --- a/library/core/src/lib.rs +++ b/library/core/src/lib.rs @@ -119,7 +119,6 @@ #![feature(const_arguments_as_str)] #![feature(const_array_from_ref)] #![feature(const_array_into_iter_constructors)] -#![feature(const_assume)] #![feature(const_bigint_helper_methods)] #![feature(const_black_box)] #![feature(const_caller_location)] diff --git a/library/core/src/mem/mod.rs b/library/core/src/mem/mod.rs index c1687abb7cb..407954001e4 100644 --- a/library/core/src/mem/mod.rs +++ b/library/core/src/mem/mod.rs @@ -1395,8 +1395,18 @@ impl<T> SizedTypeProperties for T {} /// /// assert_eq!(mem::offset_of!(Option<&u8>, Some.0), 0); /// ``` +#[cfg(not(bootstrap))] #[unstable(feature = "offset_of", issue = "106655")] #[allow_internal_unstable(builtin_syntax, hint_must_use)] +pub macro offset_of($Container:ty, $($fields:expr)+ $(,)?) { + // The `{}` is for better error messages + crate::hint::must_use({builtin # offset_of($Container, $($fields)+)}) +} + +#[cfg(bootstrap)] +#[unstable(feature = "offset_of", issue = "106655")] +#[allow_internal_unstable(builtin_syntax, hint_must_use)] +#[allow(missing_docs)] pub macro offset_of($Container:ty, $($fields:tt).+ $(,)?) { // The `{}` is for better error messages crate::hint::must_use({builtin # offset_of($Container, $($fields).+)}) diff --git a/library/core/tests/any.rs b/library/core/tests/any.rs index 8d2d31b6431..25002617d0b 100644 --- a/library/core/tests/any.rs +++ b/library/core/tests/any.rs @@ -122,7 +122,7 @@ fn any_unsized() { fn distinct_type_names() { // https://github.com/rust-lang/rust/issues/84666 - struct Velocity(f32, f32); + struct Velocity(#[allow(dead_code)] f32, #[allow(dead_code)] f32); fn type_name_of_val<T>(_: T) -> &'static str { type_name::<T>() diff --git a/library/core/tests/array.rs b/library/core/tests/array.rs index 3656eecca50..b1c1456ade1 100644 --- a/library/core/tests/array.rs +++ b/library/core/tests/array.rs @@ -262,7 +262,7 @@ fn array_default_impl_avoids_leaks_on_panic() { use core::sync::atomic::{AtomicUsize, Ordering::Relaxed}; static COUNTER: AtomicUsize = AtomicUsize::new(0); #[derive(Debug)] - struct Bomb(usize); + struct Bomb(#[allow(dead_code)] usize); impl Default for Bomb { fn default() -> Bomb { diff --git a/library/core/tests/atomic.rs b/library/core/tests/atomic.rs index a67a842d340..0d1c72a6892 100644 --- a/library/core/tests/atomic.rs +++ b/library/core/tests/atomic.rs @@ -188,7 +188,7 @@ fn ptr_bitops() { #[cfg(any(not(target_arch = "arm"), target_os = "linux"))] // Missing intrinsic in compiler-builtins fn ptr_bitops_tagging() { #[repr(align(16))] - struct Tagme(u128); + struct Tagme(#[allow(dead_code)] u128); let tagme = Tagme(1000); let ptr = &tagme as *const Tagme as *mut Tagme; diff --git a/library/core/tests/intrinsics.rs b/library/core/tests/intrinsics.rs index 06870c6d06c..740565d0df6 100644 --- a/library/core/tests/intrinsics.rs +++ b/library/core/tests/intrinsics.rs @@ -4,7 +4,7 @@ use core::intrinsics::assume; #[test] fn test_typeid_sized_types() { struct X; - struct Y(u32); + struct Y(#[allow(dead_code)] u32); assert_eq!(TypeId::of::<X>(), TypeId::of::<X>()); assert_eq!(TypeId::of::<Y>(), TypeId::of::<Y>()); @@ -14,8 +14,8 @@ fn test_typeid_sized_types() { #[test] fn test_typeid_unsized_types() { trait Z {} - struct X(str); - struct Y(dyn Z + 'static); + struct X(#[allow(dead_code)] str); + struct Y(#[allow(dead_code)] dyn Z + 'static); assert_eq!(TypeId::of::<X>(), TypeId::of::<X>()); assert_eq!(TypeId::of::<Y>(), TypeId::of::<Y>()); diff --git a/library/core/tests/lib.rs b/library/core/tests/lib.rs index 5946862d3e4..8604d41eb68 100644 --- a/library/core/tests/lib.rs +++ b/library/core/tests/lib.rs @@ -9,7 +9,6 @@ #![feature(bigint_helper_methods)] #![feature(cell_update)] #![feature(const_align_offset)] -#![feature(const_assume)] #![feature(const_align_of_val_raw)] #![feature(const_black_box)] #![feature(const_caller_location)] diff --git a/library/core/tests/ptr.rs b/library/core/tests/ptr.rs index ee885adfeee..238f29c5980 100644 --- a/library/core/tests/ptr.rs +++ b/library/core/tests/ptr.rs @@ -451,34 +451,34 @@ fn align_offset_various_strides() { for ptr in 1usize..4 * align { unsafe { #[repr(packed)] - struct A3(u16, u8); + struct A3(#[allow(dead_code)] u16, #[allow(dead_code)] u8); x |= test_stride::<A3>(ptr::invalid::<A3>(ptr), align); - struct A4(u32); + struct A4(#[allow(dead_code)] u32); x |= test_stride::<A4>(ptr::invalid::<A4>(ptr), align); #[repr(packed)] - struct A5(u32, u8); + struct A5(#[allow(dead_code)] u32, #[allow(dead_code)] u8); x |= test_stride::<A5>(ptr::invalid::<A5>(ptr), align); #[repr(packed)] - struct A6(u32, u16); + struct A6(#[allow(dead_code)] u32, #[allow(dead_code)] u16); x |= test_stride::<A6>(ptr::invalid::<A6>(ptr), align); #[repr(packed)] - struct A7(u32, u16, u8); + struct A7(#[allow(dead_code)] u32, #[allow(dead_code)] u16, #[allow(dead_code)] u8); x |= test_stride::<A7>(ptr::invalid::<A7>(ptr), align); #[repr(packed)] - struct A8(u32, u32); + struct A8(#[allow(dead_code)] u32, #[allow(dead_code)] u32); x |= test_stride::<A8>(ptr::invalid::<A8>(ptr), align); #[repr(packed)] - struct A9(u32, u32, u8); + struct A9(#[allow(dead_code)] u32, #[allow(dead_code)] u32, #[allow(dead_code)] u8); x |= test_stride::<A9>(ptr::invalid::<A9>(ptr), align); #[repr(packed)] - struct A10(u32, u32, u16); + struct A10(#[allow(dead_code)] u32, #[allow(dead_code)] u32, #[allow(dead_code)] u16); x |= test_stride::<A10>(ptr::invalid::<A10>(ptr), align); x |= test_stride::<u32>(ptr::invalid::<u32>(ptr), align); @@ -517,34 +517,34 @@ fn align_offset_various_strides_const() { while ptr < 4 * align { unsafe { #[repr(packed)] - struct A3(u16, u8); + struct A3(#[allow(dead_code)] u16, #[allow(dead_code)] u8); test_stride::<A3>(ptr::invalid::<A3>(ptr), ptr, align); - struct A4(u32); + struct A4(#[allow(dead_code)] u32); test_stride::<A4>(ptr::invalid::<A4>(ptr), ptr, align); #[repr(packed)] - struct A5(u32, u8); + struct A5(#[allow(dead_code)] u32, #[allow(dead_code)] u8); test_stride::<A5>(ptr::invalid::<A5>(ptr), ptr, align); #[repr(packed)] - struct A6(u32, u16); + struct A6(#[allow(dead_code)] u32, #[allow(dead_code)] u16); test_stride::<A6>(ptr::invalid::<A6>(ptr), ptr, align); #[repr(packed)] - struct A7(u32, u16, u8); + struct A7(#[allow(dead_code)] u32, #[allow(dead_code)] u16, #[allow(dead_code)] u8); test_stride::<A7>(ptr::invalid::<A7>(ptr), ptr, align); #[repr(packed)] - struct A8(u32, u32); + struct A8(#[allow(dead_code)] u32, #[allow(dead_code)] u32); test_stride::<A8>(ptr::invalid::<A8>(ptr), ptr, align); #[repr(packed)] - struct A9(u32, u32, u8); + struct A9(#[allow(dead_code)] u32, #[allow(dead_code)] u32, #[allow(dead_code)] u8); test_stride::<A9>(ptr::invalid::<A9>(ptr), ptr, align); #[repr(packed)] - struct A10(u32, u32, u16); + struct A10(#[allow(dead_code)] u32, #[allow(dead_code)] u32, #[allow(dead_code)] u16); test_stride::<A10>(ptr::invalid::<A10>(ptr), ptr, align); test_stride::<u32>(ptr::invalid::<u32>(ptr), ptr, align); @@ -672,7 +672,7 @@ fn align_offset_issue_103361() { const SIZE: usize = 1 << 30; #[cfg(target_pointer_width = "16")] const SIZE: usize = 1 << 13; - struct HugeSize([u8; SIZE - 1]); + struct HugeSize(#[allow(dead_code)] [u8; SIZE - 1]); let _ = ptr::invalid::<HugeSize>(SIZE).align_offset(SIZE); } @@ -684,7 +684,7 @@ fn align_offset_issue_103361_const() { const SIZE: usize = 1 << 30; #[cfg(target_pointer_width = "16")] const SIZE: usize = 1 << 13; - struct HugeSize([u8; SIZE - 1]); + struct HugeSize(#[allow(dead_code)] [u8; SIZE - 1]); const { assert!(ptr::invalid::<HugeSize>(SIZE - 1).align_offset(SIZE) == SIZE - 1); @@ -834,7 +834,7 @@ fn ptr_metadata_bounds() { fn dyn_metadata() { #[derive(Debug)] #[repr(align(32))] - struct Something([u8; 47]); + struct Something(#[allow(dead_code)] [u8; 47]); let value = Something([0; 47]); let trait_object: &dyn Debug = &value; diff --git a/library/core/tests/slice.rs b/library/core/tests/slice.rs index 33a30339856..cc1fc7e4d7e 100644 --- a/library/core/tests/slice.rs +++ b/library/core/tests/slice.rs @@ -2109,9 +2109,9 @@ fn test_align_to_zst() { #[test] fn test_align_to_non_trivial() { #[repr(align(8))] - struct U64(u64, u64); + struct U64(#[allow(dead_code)] u64, #[allow(dead_code)] u64); #[repr(align(8))] - struct U64U64U32(u64, u64, u32); + struct U64U64U32(#[allow(dead_code)] u64, #[allow(dead_code)] u64, #[allow(dead_code)] u32); let data = [ U64(1, 2), U64(3, 4), @@ -2196,7 +2196,7 @@ fn test_slice_partition_dedup_multiple_ident() { #[test] fn test_slice_partition_dedup_partialeq() { #[derive(Debug)] - struct Foo(i32, i32); + struct Foo(i32, #[allow(dead_code)] i32); impl PartialEq for Foo { fn eq(&self, other: &Foo) -> bool { diff --git a/library/std/src/collections/hash/set/tests.rs b/library/std/src/collections/hash/set/tests.rs index 208f61e755c..a1884090043 100644 --- a/library/std/src/collections/hash/set/tests.rs +++ b/library/std/src/collections/hash/set/tests.rs @@ -352,7 +352,7 @@ fn test_replace() { use crate::hash; #[derive(Debug)] - struct Foo(&'static str, i32); + struct Foo(&'static str, #[allow(dead_code)] i32); impl PartialEq for Foo { fn eq(&self, other: &Self) -> bool { diff --git a/library/std/src/os/unix/net/listener.rs b/library/std/src/os/unix/net/listener.rs index 5be8aebc70f..1b70b669c77 100644 --- a/library/std/src/os/unix/net/listener.rs +++ b/library/std/src/os/unix/net/listener.rs @@ -73,8 +73,18 @@ impl UnixListener { unsafe { let inner = Socket::new_raw(libc::AF_UNIX, libc::SOCK_STREAM)?; let (addr, len) = sockaddr_un(path.as_ref())?; - const backlog: libc::c_int = - if cfg!(any(target_os = "linux", target_os = "freebsd")) { -1 } else { 128 }; + #[cfg(any(target_os = "windows", target_os = "redox"))] + const backlog: libc::c_int = 128; + #[cfg(any(target_os = "linux", target_os = "freebsd", target_os = "openbsd"))] + const backlog: libc::c_int = -1; + #[cfg(not(any( + target_os = "windows", + target_os = "redox", + target_os = "linux", + target_os = "freebsd", + target_os = "openbsd" + )))] + const backlog: libc::c_int = libc::SOMAXCONN; cvt(libc::bind(inner.as_inner().as_raw_fd(), &addr as *const _ as *const _, len as _))?; cvt(libc::listen(inner.as_inner().as_raw_fd(), backlog))?; diff --git a/library/test/Cargo.toml b/library/test/Cargo.toml index 91a1abde059..92c535501bf 100644 --- a/library/test/Cargo.toml +++ b/library/test/Cargo.toml @@ -3,9 +3,6 @@ name = "test" version = "0.0.0" edition = "2021" -[lib] -crate-type = ["dylib", "rlib"] - [dependencies] getopts = { version = "0.2.21", features = ['rustc-dep-of-std'] } std = { path = "../std" } diff --git a/src/bootstrap/src/core/build_steps/check.rs b/src/bootstrap/src/core/build_steps/check.rs index ecaaf91aec1..f1f2f28909d 100644 --- a/src/bootstrap/src/core/build_steps/check.rs +++ b/src/bootstrap/src/core/build_steps/check.rs @@ -386,7 +386,7 @@ impl Step for RustAnalyzer { cargo_subcommand(builder.kind), "src/tools/rust-analyzer", SourceType::InTree, - &["rust-analyzer/in-rust-tree".to_owned()], + &["in-rust-tree".to_owned()], ); cargo.allow_features(crate::core::build_steps::tool::RustAnalyzer::ALLOW_FEATURES); diff --git a/src/bootstrap/src/core/build_steps/compile.rs b/src/bootstrap/src/core/build_steps/compile.rs index dbb64583d56..d699c4fe536 100644 --- a/src/bootstrap/src/core/build_steps/compile.rs +++ b/src/bootstrap/src/core/build_steps/compile.rs @@ -274,7 +274,7 @@ fn copy_third_party_objects( ) -> Vec<(PathBuf, DependencyType)> { let mut target_deps = vec![]; - if builder.config.sanitizers_enabled(target) && compiler.stage != 0 { + if builder.config.needs_sanitizer_runtime_built(target) && compiler.stage != 0 { // The sanitizers are only copied in stage1 or above, // to avoid creating dependency on LLVM. target_deps.extend( diff --git a/src/bootstrap/src/core/build_steps/test.rs b/src/bootstrap/src/core/build_steps/test.rs index 92140b00da8..7f46726b956 100644 --- a/src/bootstrap/src/core/build_steps/test.rs +++ b/src/bootstrap/src/core/build_steps/test.rs @@ -385,7 +385,7 @@ impl Step for RustAnalyzer { "test", crate_path, SourceType::InTree, - &["sysroot-abi".to_owned()], + &["in-rust-tree".to_owned()], ); cargo.allow_features(tool::RustAnalyzer::ALLOW_FEATURES); @@ -1937,6 +1937,29 @@ NOTE: if you're sure you want to do this, please open an issue as to why. In the } } + // Special setup to enable running with sanitizers on MSVC. + if !builder.config.dry_run() + && target.contains("msvc") + && builder.config.sanitizers_enabled(target) + { + // Ignore interception failures: not all dlls in the process will have been built with + // address sanitizer enabled (e.g., ntdll.dll). + cmd.env("ASAN_WIN_CONTINUE_ON_INTERCEPTION_FAILURE", "1"); + // Add the address sanitizer runtime to the PATH - it is located next to cl.exe. + let asan_runtime_path = + builder.cc.borrow()[&target].path().parent().unwrap().to_path_buf(); + let old_path = cmd + .get_envs() + .find_map(|(k, v)| (k == "PATH").then_some(v)) + .flatten() + .map_or_else(|| env::var_os("PATH").unwrap_or_default(), |v| v.to_owned()); + let new_path = env::join_paths( + env::split_paths(&old_path).chain(std::iter::once(asan_runtime_path)), + ) + .expect("Could not add ASAN runtime path to PATH"); + cmd.env("PATH", new_path); + } + // Some UI tests trigger behavior in rustc where it reads $CARGO and changes behavior if it exists. // To make the tests work that rely on it not being set, make sure it is not set. cmd.env_remove("CARGO"); @@ -1953,7 +1976,7 @@ NOTE: if you're sure you want to do this, please open an issue as to why. In the } if builder.config.profiler_enabled(target) { - cmd.env("RUSTC_PROFILER_SUPPORT", "1"); + cmd.arg("--profiler-support"); } cmd.env("RUST_TEST_TMPDIR", builder.tempdir()); diff --git a/src/bootstrap/src/core/build_steps/tool.rs b/src/bootstrap/src/core/build_steps/tool.rs index 2cd42dd8081..5d8d10a7deb 100644 --- a/src/bootstrap/src/core/build_steps/tool.rs +++ b/src/bootstrap/src/core/build_steps/tool.rs @@ -594,7 +594,7 @@ pub struct RustAnalyzer { } impl RustAnalyzer { - pub const ALLOW_FEATURES: &'static str = "rustc_private,proc_macro_internals,proc_macro_diagnostic,proc_macro_span,proc_macro_span_shrink"; + pub const ALLOW_FEATURES: &'static str = "rustc_private,proc_macro_internals,proc_macro_diagnostic,proc_macro_span,proc_macro_span_shrink,proc_macro_def_site"; } impl Step for RustAnalyzer { @@ -628,7 +628,7 @@ impl Step for RustAnalyzer { tool: "rust-analyzer", mode: Mode::ToolRustc, path: "src/tools/rust-analyzer", - extra_features: vec!["rust-analyzer/in-rust-tree".to_owned()], + extra_features: vec!["in-rust-tree".to_owned()], source_type: SourceType::InTree, allow_features: RustAnalyzer::ALLOW_FEATURES, }) @@ -673,9 +673,9 @@ impl Step for RustAnalyzerProcMacroSrv { compiler: self.compiler, target: self.target, tool: "rust-analyzer-proc-macro-srv", - mode: Mode::ToolStd, + mode: Mode::ToolRustc, path: "src/tools/rust-analyzer/crates/proc-macro-srv-cli", - extra_features: vec!["sysroot-abi".to_owned()], + extra_features: vec!["in-rust-tree".to_owned()], source_type: SourceType::InTree, allow_features: RustAnalyzer::ALLOW_FEATURES, }); diff --git a/src/bootstrap/src/core/config/config.rs b/src/bootstrap/src/core/config/config.rs index c6bf71c8837..3ac3e545631 100644 --- a/src/bootstrap/src/core/config/config.rs +++ b/src/bootstrap/src/core/config/config.rs @@ -2180,8 +2180,15 @@ impl Config { self.target_config.get(&target).map(|t| t.sanitizers).flatten().unwrap_or(self.sanitizers) } - pub fn any_sanitizers_enabled(&self) -> bool { - self.target_config.values().any(|t| t.sanitizers == Some(true)) || self.sanitizers + pub fn needs_sanitizer_runtime_built(&self, target: TargetSelection) -> bool { + // MSVC uses the Microsoft-provided sanitizer runtime, but all other runtimes we build. + !target.is_msvc() && self.sanitizers_enabled(target) + } + + pub fn any_sanitizers_to_build(&self) -> bool { + self.target_config + .iter() + .any(|(ts, t)| !ts.is_msvc() && t.sanitizers.unwrap_or(self.sanitizers)) } pub fn profiler_path(&self, target: TargetSelection) -> Option<&str> { diff --git a/src/bootstrap/src/core/sanity.rs b/src/bootstrap/src/core/sanity.rs index 9101d94ea88..82755f41800 100644 --- a/src/bootstrap/src/core/sanity.rs +++ b/src/bootstrap/src/core/sanity.rs @@ -96,7 +96,7 @@ pub fn check(build: &mut Build) { }) .any(|build_llvm_ourselves| build_llvm_ourselves); - let need_cmake = building_llvm || build.config.any_sanitizers_enabled(); + let need_cmake = building_llvm || build.config.any_sanitizers_to_build(); if need_cmake && cmd_finder.maybe_have("cmake").is_none() { eprintln!( " diff --git a/src/doc/rustc/src/platform-support.md b/src/doc/rustc/src/platform-support.md index 09070168b67..33a678a31d6 100644 --- a/src/doc/rustc/src/platform-support.md +++ b/src/doc/rustc/src/platform-support.md @@ -151,7 +151,6 @@ target | std | notes `i586-pc-windows-msvc` | * | 32-bit Windows w/o SSE [^x86_32-floats-x87] `i586-unknown-linux-gnu` | ✓ | 32-bit Linux w/o SSE (kernel 3.2, glibc 2.17) [^x86_32-floats-x87] `i586-unknown-linux-musl` | ✓ | 32-bit Linux w/o SSE, MUSL [^x86_32-floats-x87] -[`i586-unknown-netbsd`](platform-support/netbsd.md) | ✓ | 32-bit x86, restricted to Pentium [`i686-linux-android`](platform-support/android.md) | ✓ | 32-bit x86 Android [^x86_32-floats-return-ABI] `i686-unknown-freebsd` | ✓ | 32-bit FreeBSD [^x86_32-floats-return-ABI] `i686-unknown-linux-musl` | ✓ | 32-bit Linux with MUSL [^x86_32-floats-return-ABI] @@ -161,7 +160,9 @@ target | std | notes [`nvptx64-nvidia-cuda`](platform-support/nvptx64-nvidia-cuda.md) | * | --emit=asm generates PTX code that [runs on NVIDIA GPUs] [`riscv32imac-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | Bare RISC-V (RV32IMAC ISA) [`riscv32i-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | Bare RISC-V (RV32I ISA) +[`riscv32im-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | | Bare RISC-V (RV32IM ISA) [`riscv32imc-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | Bare RISC-V (RV32IMC ISA) +[`riscv32imafc-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | Bare RISC-V (RV32IMAFC ISA) `riscv64gc-unknown-none-elf` | * | Bare RISC-V (RV64IMAFDC ISA) `riscv64imac-unknown-none-elf` | * | Bare RISC-V (RV64IMAC ISA) `sparc64-unknown-linux-gnu` | ✓ | SPARC Linux (kernel 4.4, glibc 2.23) @@ -270,6 +271,7 @@ target | std | host | notes `hexagon-unknown-linux-musl` | ? | | `i386-apple-ios` | ✓ | | 32-bit x86 iOS [^x86_32-floats-return-ABI] [`i586-pc-nto-qnx700`](platform-support/nto-qnx.md) | * | | 32-bit x86 QNX Neutrino 7.0 RTOS [^x86_32-floats-return-ABI] +[`i586-unknown-netbsd`](platform-support/netbsd.md) | ✓ | | 32-bit x86, restricted to Pentium `i686-apple-darwin` | ✓ | ✓ | 32-bit macOS (10.12+, Sierra+) [^x86_32-floats-return-ABI] `i686-pc-windows-msvc` | * | | 32-bit Windows XP support [^x86_32-floats-return-ABI] [`i686-pc-windows-gnullvm`](platform-support/pc-windows-gnullvm.md) | ✓ | ✓ | [^x86_32-floats-return-ABI] @@ -318,8 +320,6 @@ target | std | host | notes [`powerpc64-ibm-aix`](platform-support/aix.md) | ? | | 64-bit AIX (7.2 and newer) `riscv32gc-unknown-linux-gnu` | | | RISC-V Linux (kernel 5.4, glibc 2.33) `riscv32gc-unknown-linux-musl` | | | RISC-V Linux (kernel 5.4, musl + RISCV32 support patches) -[`riscv32imafc-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | Bare RISC-V (RV32IMAFC ISA) -[`riscv32im-unknown-none-elf`](platform-support/riscv32imac-unknown-none-elf.md) | * | | Bare RISC-V (RV32IM ISA) [`riscv32imac-unknown-xous-elf`](platform-support/riscv32imac-unknown-xous-elf.md) | ? | | RISC-V Xous (RV32IMAC ISA) [`riscv32imc-esp-espidf`](platform-support/esp-idf.md) | ✓ | | RISC-V ESP-IDF [`riscv32imac-esp-espidf`](platform-support/esp-idf.md) | ✓ | | RISC-V ESP-IDF diff --git a/src/doc/rustc/src/platform-support/riscv32imac-unknown-none-elf.md b/src/doc/rustc/src/platform-support/riscv32imac-unknown-none-elf.md index a069f3d3aa9..739b12bad8b 100644 --- a/src/doc/rustc/src/platform-support/riscv32imac-unknown-none-elf.md +++ b/src/doc/rustc/src/platform-support/riscv32imac-unknown-none-elf.md @@ -1,6 +1,6 @@ # `riscv32{i,im,imc,imac,imafc}-unknown-none-elf` -**Tier: 2/3** +**Tier: 2** Bare-metal target for RISC-V CPUs with the RV32I, RV32IM, RV32IMC, RV32IMAFC and RV32IMAC ISAs. @@ -24,11 +24,11 @@ This target is included in Rust and can be installed via `rustup`. ## Testing -This is a cross-compiled no-std target, which must be run either in a simulator +This is a cross-compiled `no-std` target, which must be run either in a simulator or by programming them onto suitable hardware. It is not possible to run the -Rust testsuite on this target. +Rust test-suite on this target. ## Cross-compilation toolchains and C code This target supports C code. If interlinking with C or C++, you may need to use -riscv64-unknown-elf-gcc as a linker instead of rust-lld. +`riscv64-unknown-elf-gcc` as a linker instead of `rust-lld`. diff --git a/src/doc/unstable-book/src/language-features/asm-experimental-arch.md b/src/doc/unstable-book/src/language-features/asm-experimental-arch.md index 968c9bb4ebb..59acbc73db4 100644 --- a/src/doc/unstable-book/src/language-features/asm-experimental-arch.md +++ b/src/doc/unstable-book/src/language-features/asm-experimental-arch.md @@ -84,7 +84,7 @@ This feature tracks `asm!` and `global_asm!` support for the following architect | M68k | `reg_data` | None | `i8`, `i16`, `i32` | | CSKY | `reg` | None | `i8`, `i16`, `i32` | | CSKY | `freg` | None | `f32`, | -| s390x | `reg` | None | `i8`, `i16`, `i32`, `i64` | +| s390x | `reg`, `reg_addr` | None | `i8`, `i16`, `i32`, `i64` | | s390x | `freg` | None | `f32`, `f64` | ## Register aliases @@ -158,9 +158,10 @@ This feature tracks `asm!` and `global_asm!` support for the following architect | NVPTX | `reg64` | None | `rd0` | None | | Hexagon | `reg` | None | `r0` | None | | PowerPC | `reg` | None | `0` | None | -| PowerPC | `reg_nonzero` | None | `3` | `b` | +| PowerPC | `reg_nonzero` | None | `3` | None | | PowerPC | `freg` | None | `0` | None | | s390x | `reg` | None | `%r0` | None | +| s390x | `reg_addr` | None | `%r1` | None | | s390x | `freg` | None | `%f0` | None | | CSKY | `reg` | None | `r0` | None | | CSKY | `freg` | None | `f0` | None | diff --git a/src/librustdoc/core.rs b/src/librustdoc/core.rs index 102a9f40e9b..359d5ec485e 100644 --- a/src/librustdoc/core.rs +++ b/src/librustdoc/core.rs @@ -1,7 +1,7 @@ use rustc_data_structures::fx::{FxHashMap, FxHashSet}; use rustc_data_structures::sync::Lrc; use rustc_data_structures::unord::UnordSet; -use rustc_errors::emitter::{DynEmitter, EmitterWriter}; +use rustc_errors::emitter::{DynEmitter, HumanEmitter}; use rustc_errors::json::JsonEmitter; use rustc_errors::TerminalUrl; use rustc_feature::UnstableFeatures; @@ -138,7 +138,7 @@ pub(crate) fn new_dcx( ErrorOutputType::HumanReadable(kind) => { let (short, color_config) = kind.unzip(); Box::new( - EmitterWriter::stderr(color_config, fallback_bundle) + HumanEmitter::stderr(color_config, fallback_bundle) .sm(source_map.map(|sm| sm as _)) .short_message(short) .teach(unstable_opts.teach) @@ -323,7 +323,9 @@ pub(crate) fn run_global_ctxt( tcx.hir().try_par_for_each_module(|module| tcx.ensure().check_mod_type_wf(module)) }); tcx.sess.time("item_types_checking", || { - tcx.hir().for_each_module(|module| tcx.ensure().check_mod_item_types(module)) + tcx.hir().for_each_module(|module| { + let _ = tcx.ensure().check_mod_type_wf(module); + }); }); tcx.dcx().abort_if_errors(); diff --git a/src/librustdoc/doctest.rs b/src/librustdoc/doctest.rs index c74f2ecb018..9a900625268 100644 --- a/src/librustdoc/doctest.rs +++ b/src/librustdoc/doctest.rs @@ -557,7 +557,7 @@ pub(crate) fn make_test( // crate already is included. let result = rustc_driver::catch_fatal_errors(|| { rustc_span::create_session_if_not_set_then(edition, |_| { - use rustc_errors::emitter::{Emitter, EmitterWriter}; + use rustc_errors::emitter::{Emitter, HumanEmitter}; use rustc_errors::DiagCtxt; use rustc_parse::parser::ForceCollect; use rustc_span::source_map::FilePathMapping; @@ -572,11 +572,11 @@ pub(crate) fn make_test( rustc_driver::DEFAULT_LOCALE_RESOURCES.to_vec(), false, ); - supports_color = EmitterWriter::stderr(ColorConfig::Auto, fallback_bundle.clone()) + supports_color = HumanEmitter::stderr(ColorConfig::Auto, fallback_bundle.clone()) .diagnostic_width(Some(80)) .supports_color(); - let emitter = EmitterWriter::new(Box::new(io::sink()), fallback_bundle); + let emitter = HumanEmitter::new(Box::new(io::sink()), fallback_bundle); // FIXME(misdreavus): pass `-Z treat-err-as-bug` to the doctest parser let dcx = DiagCtxt::with_emitter(Box::new(emitter)).disable_warnings(); @@ -739,7 +739,7 @@ fn check_if_attr_is_complete(source: &str, edition: Edition) -> bool { } rustc_driver::catch_fatal_errors(|| { rustc_span::create_session_if_not_set_then(edition, |_| { - use rustc_errors::emitter::EmitterWriter; + use rustc_errors::emitter::HumanEmitter; use rustc_errors::DiagCtxt; use rustc_span::source_map::FilePathMapping; @@ -752,7 +752,7 @@ fn check_if_attr_is_complete(source: &str, edition: Edition) -> bool { false, ); - let emitter = EmitterWriter::new(Box::new(io::sink()), fallback_bundle); + let emitter = HumanEmitter::new(Box::new(io::sink()), fallback_bundle); let dcx = DiagCtxt::with_emitter(Box::new(emitter)).disable_warnings(); let sess = ParseSess::with_dcx(dcx, sm); diff --git a/src/librustdoc/html/render/span_map.rs b/src/librustdoc/html/render/span_map.rs index d1ece73374d..b055e355b78 100644 --- a/src/librustdoc/html/render/span_map.rs +++ b/src/librustdoc/html/render/span_map.rs @@ -154,6 +154,28 @@ impl<'tcx> SpanMapVisitor<'tcx> { self.matches.insert(new_span, link_from_src); true } + + fn handle_call(&mut self, hir_id: HirId, expr_hir_id: Option<HirId>, span: Span) { + let hir = self.tcx.hir(); + let body_id = hir.enclosing_body_owner(hir_id); + // FIXME: this is showing error messages for parts of the code that are not + // compiled (because of cfg)! + // + // See discussion in https://github.com/rust-lang/rust/issues/69426#issuecomment-1019412352 + let typeck_results = self + .tcx + .typeck_body(hir.maybe_body_owned_by(body_id).expect("a body which isn't a body")); + // Interestingly enough, for method calls, we need the whole expression whereas for static + // method/function calls, we need the call expression specifically. + if let Some(def_id) = typeck_results.type_dependent_def_id(expr_hir_id.unwrap_or(hir_id)) { + let link = if def_id.as_local().is_some() { + LinkFromSrc::Local(rustc_span(def_id, self.tcx)) + } else { + LinkFromSrc::External(def_id) + }; + self.matches.insert(span, link); + } + } } impl<'tcx> Visitor<'tcx> for SpanMapVisitor<'tcx> { @@ -191,27 +213,17 @@ impl<'tcx> Visitor<'tcx> for SpanMapVisitor<'tcx> { } fn visit_expr(&mut self, expr: &'tcx rustc_hir::Expr<'tcx>) { - if let ExprKind::MethodCall(segment, ..) = expr.kind { - let hir = self.tcx.hir(); - let body_id = hir.enclosing_body_owner(segment.hir_id); - // FIXME: this is showing error messages for parts of the code that are not - // compiled (because of cfg)! - // - // See discussion in https://github.com/rust-lang/rust/issues/69426#issuecomment-1019412352 - let typeck_results = self - .tcx - .typeck_body(hir.maybe_body_owned_by(body_id).expect("a body which isn't a body")); - if let Some(def_id) = typeck_results.type_dependent_def_id(expr.hir_id) { - let link = if def_id.as_local().is_some() { - LinkFromSrc::Local(rustc_span(def_id, self.tcx)) - } else { - LinkFromSrc::External(def_id) - }; - self.matches.insert(segment.ident.span, link); + match expr.kind { + ExprKind::MethodCall(segment, ..) => { + self.handle_call(segment.hir_id, Some(expr.hir_id), segment.ident.span) + } + ExprKind::Call(call, ..) => self.handle_call(call.hir_id, None, call.span), + _ => { + if self.handle_macro(expr.span) { + // We don't want to go deeper into the macro. + return; + } } - } else if self.handle_macro(expr.span) { - // We don't want to go deeper into the macro. - return; } intravisit::walk_expr(self, expr); } diff --git a/src/librustdoc/passes/collect_intra_doc_links.rs b/src/librustdoc/passes/collect_intra_doc_links.rs index ee185ab9892..506eb56fdc8 100644 --- a/src/librustdoc/passes/collect_intra_doc_links.rs +++ b/src/librustdoc/passes/collect_intra_doc_links.rs @@ -1733,7 +1733,7 @@ fn report_diagnostic( }; if let Some(sp) = span { - lint.set_span(sp); + lint.span(sp); } else { // blah blah blah\nblah\nblah [blah] blah blah\nblah blah // ^ ~~~~ diff --git a/src/librustdoc/passes/lint/redundant_explicit_links.rs b/src/librustdoc/passes/lint/redundant_explicit_links.rs index 4491d20b478..73f6a426360 100644 --- a/src/librustdoc/passes/lint/redundant_explicit_links.rs +++ b/src/librustdoc/passes/lint/redundant_explicit_links.rs @@ -244,7 +244,7 @@ fn find_resolution(resolutions: &DocLinkResMap, path: &str) -> Option<Res<NodeId .find_map(|ns| resolutions.get(&(Symbol::intern(path), ns)).copied().flatten()) } -/// Collects all neccessary data of link. +/// Collects all necessary data of link. fn collect_link_data(offset_iter: &mut OffsetIter<'_, '_>) -> LinkData { let mut resolvable_link = None; let mut resolvable_link_range = None; diff --git a/src/tools/clippy/clippy_lints/src/doc/needless_doctest_main.rs b/src/tools/clippy/clippy_lints/src/doc/needless_doctest_main.rs index c639813a3f9..a744b69ecb4 100644 --- a/src/tools/clippy/clippy_lints/src/doc/needless_doctest_main.rs +++ b/src/tools/clippy/clippy_lints/src/doc/needless_doctest_main.rs @@ -5,7 +5,7 @@ use crate::doc::{NEEDLESS_DOCTEST_MAIN, TEST_ATTR_IN_DOCTEST}; use clippy_utils::diagnostics::span_lint; use rustc_ast::{CoroutineKind, Fn, FnRetTy, Item, ItemKind}; use rustc_data_structures::sync::Lrc; -use rustc_errors::emitter::EmitterWriter; +use rustc_errors::emitter::HumanEmitter; use rustc_errors::DiagCtxt; use rustc_lint::LateContext; use rustc_parse::maybe_new_parser_from_source_str; @@ -44,7 +44,7 @@ pub fn check( let fallback_bundle = rustc_errors::fallback_fluent_bundle(rustc_driver::DEFAULT_LOCALE_RESOURCES.to_vec(), false); - let emitter = EmitterWriter::new(Box::new(io::sink()), fallback_bundle); + let emitter = HumanEmitter::new(Box::new(io::sink()), fallback_bundle); let dcx = DiagCtxt::with_emitter(Box::new(emitter)).disable_warnings(); #[expect(clippy::arc_with_non_send_sync)] // `Lrc` is expected by with_dcx let sm = Lrc::new(SourceMap::new(FilePathMapping::empty())); diff --git a/src/tools/clippy/clippy_lints/src/entry.rs b/src/tools/clippy/clippy_lints/src/entry.rs index ce0a1dfdc61..0b4bc375df0 100644 --- a/src/tools/clippy/clippy_lints/src/entry.rs +++ b/src/tools/clippy/clippy_lints/src/entry.rs @@ -8,7 +8,7 @@ use core::fmt::{self, Write}; use rustc_errors::Applicability; use rustc_hir::hir_id::HirIdSet; use rustc_hir::intravisit::{walk_expr, Visitor}; -use rustc_hir::{Block, Expr, ExprKind, Guard, HirId, Let, Pat, Stmt, StmtKind, UnOp}; +use rustc_hir::{Block, Expr, ExprKind, HirId, Pat, Stmt, StmtKind, UnOp}; use rustc_lint::{LateContext, LateLintPass}; use rustc_session::declare_lint_pass; use rustc_span::{Span, SyntaxContext, DUMMY_SP}; @@ -465,7 +465,7 @@ impl<'tcx> Visitor<'tcx> for InsertSearcher<'_, 'tcx> { let mut is_map_used = self.is_map_used; for arm in arms { self.visit_pat(arm.pat); - if let Some(Guard::If(guard) | Guard::IfLet(&Let { init: guard, .. })) = arm.guard { + if let Some(guard) = arm.guard { self.visit_non_tail_expr(guard); } is_map_used |= self.visit_cond_arm(arm.body); diff --git a/src/tools/clippy/clippy_lints/src/manual_clamp.rs b/src/tools/clippy/clippy_lints/src/manual_clamp.rs index 385fe387a31..0da309f9531 100644 --- a/src/tools/clippy/clippy_lints/src/manual_clamp.rs +++ b/src/tools/clippy/clippy_lints/src/manual_clamp.rs @@ -11,7 +11,7 @@ use clippy_utils::{ use itertools::Itertools; use rustc_errors::{Applicability, Diagnostic}; use rustc_hir::def::Res; -use rustc_hir::{Arm, BinOpKind, Block, Expr, ExprKind, Guard, HirId, PatKind, PathSegment, PrimTy, QPath, StmtKind}; +use rustc_hir::{Arm, BinOpKind, Block, Expr, ExprKind, HirId, PatKind, PathSegment, PrimTy, QPath, StmtKind}; use rustc_lint::{LateContext, LateLintPass}; use rustc_middle::ty::Ty; use rustc_session::impl_lint_pass; @@ -394,7 +394,7 @@ fn is_match_pattern<'tcx>(cx: &LateContext<'tcx>, expr: &'tcx Expr<'tcx>) -> Opt // Find possible min/max branches let minmax_values = |a: &'tcx Arm<'tcx>| { if let PatKind::Binding(_, var_hir_id, _, None) = &a.pat.kind - && let Some(Guard::If(e)) = a.guard + && let Some(e) = a.guard { Some((e, var_hir_id, a.body)) } else { diff --git a/src/tools/clippy/clippy_lints/src/matches/collapsible_match.rs b/src/tools/clippy/clippy_lints/src/matches/collapsible_match.rs index 91e6ca7fa8b..5fef5930fab 100644 --- a/src/tools/clippy/clippy_lints/src/matches/collapsible_match.rs +++ b/src/tools/clippy/clippy_lints/src/matches/collapsible_match.rs @@ -7,7 +7,7 @@ use clippy_utils::{ }; use rustc_errors::MultiSpan; use rustc_hir::LangItem::OptionNone; -use rustc_hir::{Arm, Expr, Guard, HirId, Let, Pat, PatKind}; +use rustc_hir::{Arm, Expr, HirId, Pat, PatKind}; use rustc_lint::LateContext; use rustc_span::Span; @@ -16,7 +16,7 @@ use super::COLLAPSIBLE_MATCH; pub(super) fn check_match<'tcx>(cx: &LateContext<'tcx>, arms: &'tcx [Arm<'_>]) { if let Some(els_arm) = arms.iter().rfind(|arm| arm_is_wild_like(cx, arm)) { for arm in arms { - check_arm(cx, true, arm.pat, arm.body, arm.guard.as_ref(), Some(els_arm.body)); + check_arm(cx, true, arm.pat, arm.body, arm.guard, Some(els_arm.body)); } } } @@ -35,7 +35,7 @@ fn check_arm<'tcx>( outer_is_match: bool, outer_pat: &'tcx Pat<'tcx>, outer_then_body: &'tcx Expr<'tcx>, - outer_guard: Option<&'tcx Guard<'tcx>>, + outer_guard: Option<&'tcx Expr<'tcx>>, outer_else_body: Option<&'tcx Expr<'tcx>>, ) { let inner_expr = peel_blocks_with_stmt(outer_then_body); @@ -71,7 +71,7 @@ fn check_arm<'tcx>( // the binding must not be used in the if guard && outer_guard.map_or( true, - |(Guard::If(e) | Guard::IfLet(Let { init: e, .. }))| !is_local_used(cx, *e, binding_id) + |e| !is_local_used(cx, e, binding_id) ) // ...or anywhere in the inner expression && match inner { diff --git a/src/tools/clippy/clippy_lints/src/matches/match_like_matches.rs b/src/tools/clippy/clippy_lints/src/matches/match_like_matches.rs index 56123326fe4..b062e81cefd 100644 --- a/src/tools/clippy/clippy_lints/src/matches/match_like_matches.rs +++ b/src/tools/clippy/clippy_lints/src/matches/match_like_matches.rs @@ -4,7 +4,7 @@ use clippy_utils::source::snippet_with_applicability; use clippy_utils::{is_lint_allowed, is_wild, span_contains_comment}; use rustc_ast::{Attribute, LitKind}; use rustc_errors::Applicability; -use rustc_hir::{Arm, BorrowKind, Expr, ExprKind, Guard, Pat, PatKind, QPath}; +use rustc_hir::{Arm, BorrowKind, Expr, ExprKind, Pat, PatKind, QPath}; use rustc_lint::{LateContext, LintContext}; use rustc_middle::ty; use rustc_span::source_map::Spanned; @@ -41,14 +41,8 @@ pub(super) fn check_match<'tcx>( find_matches_sugg( cx, scrutinee, - arms.iter().map(|arm| { - ( - cx.tcx.hir().attrs(arm.hir_id), - Some(arm.pat), - arm.body, - arm.guard.as_ref(), - ) - }), + arms.iter() + .map(|arm| (cx.tcx.hir().attrs(arm.hir_id), Some(arm.pat), arm.body, arm.guard)), e, false, ) @@ -67,14 +61,7 @@ where I: Clone + DoubleEndedIterator + ExactSizeIterator - + Iterator< - Item = ( - &'a [Attribute], - Option<&'a Pat<'b>>, - &'a Expr<'b>, - Option<&'a Guard<'b>>, - ), - >, + + Iterator<Item = (&'a [Attribute], Option<&'a Pat<'b>>, &'a Expr<'b>, Option<&'a Expr<'b>>)>, { if !span_contains_comment(cx.sess().source_map(), expr.span) && iter.len() >= 2 @@ -115,7 +102,7 @@ where }) .join(" | ") }; - let pat_and_guard = if let Some(Guard::If(g)) = first_guard { + let pat_and_guard = if let Some(g) = first_guard { format!( "{pat} if {}", snippet_with_applicability(cx, g.span, "..", &mut applicability) diff --git a/src/tools/clippy/clippy_lints/src/matches/needless_match.rs b/src/tools/clippy/clippy_lints/src/matches/needless_match.rs index 44dc29c36a6..cc482f15a91 100644 --- a/src/tools/clippy/clippy_lints/src/matches/needless_match.rs +++ b/src/tools/clippy/clippy_lints/src/matches/needless_match.rs @@ -8,7 +8,7 @@ use clippy_utils::{ }; use rustc_errors::Applicability; use rustc_hir::LangItem::OptionNone; -use rustc_hir::{Arm, BindingAnnotation, ByRef, Expr, ExprKind, Guard, ItemKind, Node, Pat, PatKind, Path, QPath}; +use rustc_hir::{Arm, BindingAnnotation, ByRef, Expr, ExprKind, ItemKind, Node, Pat, PatKind, Path, QPath}; use rustc_lint::LateContext; use rustc_span::sym; @@ -66,18 +66,9 @@ fn check_all_arms(cx: &LateContext<'_>, match_expr: &Expr<'_>, arms: &[Arm<'_>]) let arm_expr = peel_blocks_with_stmt(arm.body); if let Some(guard_expr) = &arm.guard { - match guard_expr { - // gives up if `pat if expr` can have side effects - Guard::If(if_cond) => { - if if_cond.can_have_side_effects() { - return false; - } - }, - // gives up `pat if let ...` arm - Guard::IfLet(_) => { - return false; - }, - }; + if guard_expr.can_have_side_effects() { + return false; + } } if let PatKind::Wild = arm.pat.kind { diff --git a/src/tools/clippy/clippy_lints/src/matches/redundant_guards.rs b/src/tools/clippy/clippy_lints/src/matches/redundant_guards.rs index f57b22374c8..dfaaeb14ca3 100644 --- a/src/tools/clippy/clippy_lints/src/matches/redundant_guards.rs +++ b/src/tools/clippy/clippy_lints/src/matches/redundant_guards.rs @@ -5,7 +5,7 @@ use clippy_utils::visitors::{for_each_expr, is_local_used}; use rustc_ast::{BorrowKind, LitKind}; use rustc_errors::Applicability; use rustc_hir::def::{DefKind, Res}; -use rustc_hir::{Arm, BinOpKind, Expr, ExprKind, Guard, MatchSource, Node, Pat, PatKind}; +use rustc_hir::{Arm, BinOpKind, Expr, ExprKind, MatchSource, Node, Pat, PatKind}; use rustc_lint::LateContext; use rustc_span::symbol::Ident; use rustc_span::{Span, Symbol}; @@ -21,20 +21,19 @@ pub(super) fn check<'tcx>(cx: &LateContext<'tcx>, arms: &'tcx [Arm<'tcx>]) { }; // `Some(x) if matches!(x, y)` - if let Guard::If(if_expr) = guard - && let ExprKind::Match( - scrutinee, - [ - arm, - Arm { - pat: Pat { - kind: PatKind::Wild, .. - }, - .. + if let ExprKind::Match( + scrutinee, + [ + arm, + Arm { + pat: Pat { + kind: PatKind::Wild, .. }, - ], - MatchSource::Normal, - ) = if_expr.kind + .. + }, + ], + MatchSource::Normal, + ) = guard.kind && let Some(binding) = get_pat_binding(cx, scrutinee, outer_arm) { let pat_span = match (arm.pat.kind, binding.byref_ident) { @@ -45,14 +44,14 @@ pub(super) fn check<'tcx>(cx: &LateContext<'tcx>, arms: &'tcx [Arm<'tcx>]) { emit_redundant_guards( cx, outer_arm, - if_expr.span, + guard.span, snippet(cx, pat_span, "<binding>"), &binding, arm.guard, ); } // `Some(x) if let Some(2) = x` - else if let Guard::IfLet(let_expr) = guard + else if let ExprKind::Let(let_expr) = guard.kind && let Some(binding) = get_pat_binding(cx, let_expr.init, outer_arm) { let pat_span = match (let_expr.pat.kind, binding.byref_ident) { @@ -71,8 +70,7 @@ pub(super) fn check<'tcx>(cx: &LateContext<'tcx>, arms: &'tcx [Arm<'tcx>]) { } // `Some(x) if x == Some(2)` // `Some(x) if Some(2) == x` - else if let Guard::If(if_expr) = guard - && let ExprKind::Binary(bin_op, local, pat) = if_expr.kind + else if let ExprKind::Binary(bin_op, local, pat) = guard.kind && matches!(bin_op.node, BinOpKind::Eq) // Ensure they have the same type. If they don't, we'd need deref coercion which isn't // possible (currently) in a pattern. In some cases, you can use something like @@ -96,16 +94,15 @@ pub(super) fn check<'tcx>(cx: &LateContext<'tcx>, arms: &'tcx [Arm<'tcx>]) { emit_redundant_guards( cx, outer_arm, - if_expr.span, + guard.span, snippet(cx, pat_span, "<binding>"), &binding, None, ); - } else if let Guard::If(if_expr) = guard - && let ExprKind::MethodCall(path, recv, args, ..) = if_expr.kind + } else if let ExprKind::MethodCall(path, recv, args, ..) = guard.kind && let Some(binding) = get_pat_binding(cx, recv, outer_arm) { - check_method_calls(cx, outer_arm, path.ident.name, recv, args, if_expr, &binding); + check_method_calls(cx, outer_arm, path.ident.name, recv, args, guard, &binding); } } } @@ -216,7 +213,7 @@ fn emit_redundant_guards<'tcx>( guard_span: Span, binding_replacement: Cow<'static, str>, pat_binding: &PatBindingInfo, - inner_guard: Option<Guard<'_>>, + inner_guard: Option<&Expr<'_>>, ) { span_lint_and_then( cx, @@ -242,12 +239,7 @@ fn emit_redundant_guards<'tcx>( ( guard_span.source_callsite().with_lo(outer_arm.pat.span.hi()), inner_guard.map_or_else(String::new, |guard| { - let (prefix, span) = match guard { - Guard::If(e) => ("if", e.span), - Guard::IfLet(l) => ("if let", l.span), - }; - - format!(" {prefix} {}", snippet(cx, span, "<guard>")) + format!(" if {}", snippet(cx, guard.span, "<guard>")) }), ), ], diff --git a/src/tools/clippy/clippy_lints/src/matches/redundant_pattern_match.rs b/src/tools/clippy/clippy_lints/src/matches/redundant_pattern_match.rs index a4acdfb1db4..b5870d94d99 100644 --- a/src/tools/clippy/clippy_lints/src/matches/redundant_pattern_match.rs +++ b/src/tools/clippy/clippy_lints/src/matches/redundant_pattern_match.rs @@ -9,7 +9,7 @@ use rustc_ast::ast::LitKind; use rustc_errors::Applicability; use rustc_hir::def::{DefKind, Res}; use rustc_hir::LangItem::{self, OptionNone, OptionSome, PollPending, PollReady, ResultErr, ResultOk}; -use rustc_hir::{Arm, Expr, ExprKind, Guard, Node, Pat, PatKind, QPath, UnOp}; +use rustc_hir::{Arm, Expr, ExprKind, Node, Pat, PatKind, QPath, UnOp}; use rustc_lint::LateContext; use rustc_middle::ty::{self, GenericArgKind, Ty}; use rustc_span::{sym, Span, Symbol}; @@ -277,8 +277,6 @@ pub(super) fn check_match<'tcx>(cx: &LateContext<'tcx>, expr: &'tcx Expr<'_>, op let mut sugg = format!("{}.{good_method}", snippet(cx, result_expr.span, "_")); if let Some(guard) = maybe_guard { - let Guard::If(guard) = *guard else { return }; // `...is_none() && let ...` is a syntax error - // wow, the HIR for match guards in `PAT if let PAT = expr && expr => ...` is annoying! // `guard` here is `Guard::If` with the let expression somewhere deep in the tree of exprs, // counter to the intuition that it should be `Guard::IfLet`, so we need another check @@ -319,7 +317,7 @@ fn found_good_method<'tcx>( cx: &LateContext<'_>, arms: &'tcx [Arm<'tcx>], node: (&PatKind<'_>, &PatKind<'_>), -) -> Option<(&'static str, Option<&'tcx Guard<'tcx>>)> { +) -> Option<(&'static str, Option<&'tcx Expr<'tcx>>)> { match node { ( PatKind::TupleStruct(ref path_left, patterns_left, _), @@ -409,7 +407,7 @@ fn get_good_method<'tcx>( cx: &LateContext<'_>, arms: &'tcx [Arm<'tcx>], path_left: &QPath<'_>, -) -> Option<(&'static str, Option<&'tcx Guard<'tcx>>)> { +) -> Option<(&'static str, Option<&'tcx Expr<'tcx>>)> { if let Some(name) = get_ident(path_left) { let (expected_item_left, should_be_left, should_be_right) = match name.as_str() { "Ok" => (Item::Lang(ResultOk), "is_ok()", "is_err()"), @@ -478,7 +476,7 @@ fn find_good_method_for_match<'a, 'tcx>( expected_item_right: Item, should_be_left: &'a str, should_be_right: &'a str, -) -> Option<(&'a str, Option<&'tcx Guard<'tcx>>)> { +) -> Option<(&'a str, Option<&'tcx Expr<'tcx>>)> { let first_pat = arms[0].pat; let second_pat = arms[1].pat; @@ -496,8 +494,8 @@ fn find_good_method_for_match<'a, 'tcx>( match body_node_pair { (ExprKind::Lit(lit_left), ExprKind::Lit(lit_right)) => match (&lit_left.node, &lit_right.node) { - (LitKind::Bool(true), LitKind::Bool(false)) => Some((should_be_left, arms[0].guard.as_ref())), - (LitKind::Bool(false), LitKind::Bool(true)) => Some((should_be_right, arms[1].guard.as_ref())), + (LitKind::Bool(true), LitKind::Bool(false)) => Some((should_be_left, arms[0].guard)), + (LitKind::Bool(false), LitKind::Bool(true)) => Some((should_be_right, arms[1].guard)), _ => None, }, _ => None, @@ -511,7 +509,7 @@ fn find_good_method_for_matches_macro<'a, 'tcx>( expected_item_left: Item, should_be_left: &'a str, should_be_right: &'a str, -) -> Option<(&'a str, Option<&'tcx Guard<'tcx>>)> { +) -> Option<(&'a str, Option<&'tcx Expr<'tcx>>)> { let first_pat = arms[0].pat; let body_node_pair = if is_pat_variant(cx, first_pat, path_left, expected_item_left) { @@ -522,8 +520,8 @@ fn find_good_method_for_matches_macro<'a, 'tcx>( match body_node_pair { (ExprKind::Lit(lit_left), ExprKind::Lit(lit_right)) => match (&lit_left.node, &lit_right.node) { - (LitKind::Bool(true), LitKind::Bool(false)) => Some((should_be_left, arms[0].guard.as_ref())), - (LitKind::Bool(false), LitKind::Bool(true)) => Some((should_be_right, arms[1].guard.as_ref())), + (LitKind::Bool(true), LitKind::Bool(false)) => Some((should_be_left, arms[0].guard)), + (LitKind::Bool(false), LitKind::Bool(true)) => Some((should_be_right, arms[1].guard)), _ => None, }, _ => None, diff --git a/src/tools/clippy/clippy_lints/src/methods/iter_overeager_cloned.rs b/src/tools/clippy/clippy_lints/src/methods/iter_overeager_cloned.rs index eac6df0545f..b2fe129cd95 100644 --- a/src/tools/clippy/clippy_lints/src/methods/iter_overeager_cloned.rs +++ b/src/tools/clippy/clippy_lints/src/methods/iter_overeager_cloned.rs @@ -22,7 +22,7 @@ pub(super) enum Op<'a> { // rm `.cloned()` // e.g. `map` `for_each` `all` `any` - NeedlessMove(&'a str, &'a Expr<'a>), + NeedlessMove(&'a Expr<'a>), // later `.cloned()` // and add `&` to the parameter of closure parameter @@ -59,7 +59,7 @@ pub(super) fn check<'tcx>( return; } - if let Op::NeedlessMove(_, expr) = op { + if let Op::NeedlessMove(expr) = op { let rustc_hir::ExprKind::Closure(closure) = expr.kind else { return; }; @@ -104,7 +104,7 @@ pub(super) fn check<'tcx>( } let (lint, msg, trailing_clone) = match op { - Op::RmCloned | Op::NeedlessMove(_, _) => (REDUNDANT_CLONE, "unneeded cloning of iterator items", ""), + Op::RmCloned | Op::NeedlessMove(_) => (REDUNDANT_CLONE, "unneeded cloning of iterator items", ""), Op::LaterCloned | Op::FixClosure(_, _) => ( ITER_OVEREAGER_CLONED, "unnecessarily eager cloning of iterator items", @@ -133,7 +133,7 @@ pub(super) fn check<'tcx>( diag.span_suggestion(replace_span, "try", snip, Applicability::MachineApplicable); } }, - Op::NeedlessMove(_, _) => { + Op::NeedlessMove(_) => { let method_span = expr.span.with_lo(cloned_call.span.hi()); if let Some(snip) = snippet_opt(cx, method_span) { let replace_span = expr.span.with_lo(cloned_recv.span.hi()); diff --git a/src/tools/clippy/clippy_lints/src/methods/mod.rs b/src/tools/clippy/clippy_lints/src/methods/mod.rs index 25b1ea526e2..c1e126137df 100644 --- a/src/tools/clippy/clippy_lints/src/methods/mod.rs +++ b/src/tools/clippy/clippy_lints/src/methods/mod.rs @@ -4186,7 +4186,7 @@ impl Methods { expr, recv, recv2, - iter_overeager_cloned::Op::NeedlessMove(name, arg), + iter_overeager_cloned::Op::NeedlessMove(arg), false, ); } @@ -4204,7 +4204,7 @@ impl Methods { expr, recv, recv2, - iter_overeager_cloned::Op::NeedlessMove(name, arg), + iter_overeager_cloned::Op::NeedlessMove(arg), false, ), Some(("chars", recv, _, _, _)) @@ -4379,7 +4379,7 @@ impl Methods { expr, recv, recv2, - iter_overeager_cloned::Op::NeedlessMove(name, arg), + iter_overeager_cloned::Op::NeedlessMove(arg), false, ), _ => {}, @@ -4433,7 +4433,7 @@ impl Methods { expr, recv, recv2, - iter_overeager_cloned::Op::NeedlessMove(name, m_arg), + iter_overeager_cloned::Op::NeedlessMove(m_arg), false, ), _ => {}, diff --git a/src/tools/clippy/clippy_lints/src/mixed_read_write_in_expression.rs b/src/tools/clippy/clippy_lints/src/mixed_read_write_in_expression.rs index 3ff40081c47..195ce17629a 100644 --- a/src/tools/clippy/clippy_lints/src/mixed_read_write_in_expression.rs +++ b/src/tools/clippy/clippy_lints/src/mixed_read_write_in_expression.rs @@ -1,7 +1,7 @@ use clippy_utils::diagnostics::{span_lint, span_lint_and_note}; use clippy_utils::{get_parent_expr, path_to_local, path_to_local_id}; use rustc_hir::intravisit::{walk_expr, Visitor}; -use rustc_hir::{BinOpKind, Block, Expr, ExprKind, Guard, HirId, Local, Node, Stmt, StmtKind}; +use rustc_hir::{BinOpKind, Block, Expr, ExprKind, HirId, Local, Node, Stmt, StmtKind}; use rustc_lint::{LateContext, LateLintPass}; use rustc_middle::ty; use rustc_session::declare_lint_pass; @@ -119,7 +119,7 @@ impl<'a, 'tcx> DivergenceVisitor<'a, 'tcx> { ExprKind::Match(e, arms, _) => { self.visit_expr(e); for arm in arms { - if let Some(Guard::If(if_expr)) = arm.guard { + if let Some(if_expr) = arm.guard { self.visit_expr(if_expr); } // make sure top level arm expressions aren't linted diff --git a/src/tools/clippy/clippy_lints/src/question_mark.rs b/src/tools/clippy/clippy_lints/src/question_mark.rs index 509d9483e1d..9469888a4d4 100644 --- a/src/tools/clippy/clippy_lints/src/question_mark.rs +++ b/src/tools/clippy/clippy_lints/src/question_mark.rs @@ -80,7 +80,6 @@ enum IfBlockType<'hir> { Ty<'hir>, Symbol, &'hir Expr<'hir>, - Option<&'hir Expr<'hir>>, ), /// An `if let Xxx(a) = b { c } else { d }` expression. /// @@ -143,7 +142,7 @@ fn check_let_some_else_return_none(cx: &LateContext<'_>, stmt: &Stmt<'_>) { fn is_early_return(smbl: Symbol, cx: &LateContext<'_>, if_block: &IfBlockType<'_>) -> bool { match *if_block { - IfBlockType::IfIs(caller, caller_ty, call_sym, if_then, _) => { + IfBlockType::IfIs(caller, caller_ty, call_sym, if_then) => { // If the block could be identified as `if x.is_none()/is_err()`, // we then only need to check the if_then return to see if it is none/err. is_type_diagnostic_item(cx, caller_ty, smbl) @@ -235,7 +234,7 @@ impl QuestionMark { && !is_else_clause(cx.tcx, expr) && let ExprKind::MethodCall(segment, caller, ..) = &cond.kind && let caller_ty = cx.typeck_results().expr_ty(caller) - && let if_block = IfBlockType::IfIs(caller, caller_ty, segment.ident.name, then, r#else) + && let if_block = IfBlockType::IfIs(caller, caller_ty, segment.ident.name, then) && (is_early_return(sym::Option, cx, &if_block) || is_early_return(sym::Result, cx, &if_block)) { let mut applicability = Applicability::MachineApplicable; diff --git a/src/tools/clippy/clippy_lints/src/transmute/transmute_undefined_repr.rs b/src/tools/clippy/clippy_lints/src/transmute/transmute_undefined_repr.rs index a65bc0ce458..db378cfd755 100644 --- a/src/tools/clippy/clippy_lints/src/transmute/transmute_undefined_repr.rs +++ b/src/tools/clippy/clippy_lints/src/transmute/transmute_undefined_repr.rs @@ -26,18 +26,18 @@ pub(super) fn check<'tcx>( // `Repr(C)` <-> unordered type. // If the first field of the `Repr(C)` type matches then the transmute is ok - (ReducedTy::OrderedFields(_, Some(from_sub_ty)), ReducedTy::UnorderedFields(to_sub_ty)) - | (ReducedTy::UnorderedFields(from_sub_ty), ReducedTy::OrderedFields(_, Some(to_sub_ty))) => { + (ReducedTy::OrderedFields(Some(from_sub_ty)), ReducedTy::UnorderedFields(to_sub_ty)) + | (ReducedTy::UnorderedFields(from_sub_ty), ReducedTy::OrderedFields(Some(to_sub_ty))) => { from_ty = from_sub_ty; to_ty = to_sub_ty; continue; }, - (ReducedTy::OrderedFields(_, Some(from_sub_ty)), ReducedTy::Other(to_sub_ty)) if reduced_tys.to_fat_ptr => { + (ReducedTy::OrderedFields(Some(from_sub_ty)), ReducedTy::Other(to_sub_ty)) if reduced_tys.to_fat_ptr => { from_ty = from_sub_ty; to_ty = to_sub_ty; continue; }, - (ReducedTy::Other(from_sub_ty), ReducedTy::OrderedFields(_, Some(to_sub_ty))) + (ReducedTy::Other(from_sub_ty), ReducedTy::OrderedFields(Some(to_sub_ty))) if reduced_tys.from_fat_ptr => { from_ty = from_sub_ty; @@ -235,8 +235,8 @@ enum ReducedTy<'tcx> { TypeErasure { raw_ptr_only: bool }, /// The type is a struct containing either zero non-zero sized fields, or multiple non-zero /// sized fields with a defined order. - /// The second value is the first non-zero sized type. - OrderedFields(Ty<'tcx>, Option<Ty<'tcx>>), + /// The value is the first non-zero sized type. + OrderedFields(Option<Ty<'tcx>>), /// The type is a struct containing multiple non-zero sized fields with no defined order. UnorderedFields(Ty<'tcx>), /// Any other type. @@ -259,7 +259,7 @@ fn reduce_ty<'tcx>(cx: &LateContext<'tcx>, mut ty: Ty<'tcx>) -> ReducedTy<'tcx> ty::Tuple(args) => { let mut iter = args.iter(); let Some(sized_ty) = iter.find(|&ty| !is_zero_sized_ty(cx, ty)) else { - return ReducedTy::OrderedFields(ty, None); + return ReducedTy::OrderedFields(None); }; if iter.all(|ty| is_zero_sized_ty(cx, ty)) { ty = sized_ty; @@ -281,7 +281,7 @@ fn reduce_ty<'tcx>(cx: &LateContext<'tcx>, mut ty: Ty<'tcx>) -> ReducedTy<'tcx> continue; } if def.repr().inhibit_struct_field_reordering_opt() { - ReducedTy::OrderedFields(ty, Some(sized_ty)) + ReducedTy::OrderedFields(Some(sized_ty)) } else { ReducedTy::UnorderedFields(ty) } diff --git a/src/tools/clippy/clippy_lints/src/utils/author.rs b/src/tools/clippy/clippy_lints/src/utils/author.rs index 8817e46b3c8..8d38b87e1d7 100644 --- a/src/tools/clippy/clippy_lints/src/utils/author.rs +++ b/src/tools/clippy/clippy_lints/src/utils/author.rs @@ -318,17 +318,11 @@ impl<'a, 'tcx> PrintVisitor<'a, 'tcx> { self.pat(field!(arm.pat)); match arm.value.guard { None => chain!(self, "{arm}.guard.is_none()"), - Some(hir::Guard::If(expr)) => { + Some(expr) => { bind!(self, expr); - chain!(self, "let Some(Guard::If({expr})) = {arm}.guard"); + chain!(self, "let Some({expr}) = {arm}.guard"); self.expr(expr); }, - Some(hir::Guard::IfLet(let_expr)) => { - bind!(self, let_expr); - chain!(self, "let Some(Guard::IfLet({let_expr}) = {arm}.guard"); - self.pat(field!(let_expr.pat)); - self.expr(field!(let_expr.init)); - }, } self.expr(field!(arm.body)); } diff --git a/src/tools/clippy/clippy_utils/src/hir_utils.rs b/src/tools/clippy/clippy_utils/src/hir_utils.rs index e610ed93050..a23105691bf 100644 --- a/src/tools/clippy/clippy_utils/src/hir_utils.rs +++ b/src/tools/clippy/clippy_utils/src/hir_utils.rs @@ -8,7 +8,7 @@ use rustc_hir::def::Res; use rustc_hir::MatchSource::TryDesugar; use rustc_hir::{ ArrayLen, BinOpKind, BindingAnnotation, Block, BodyId, Closure, Expr, ExprField, ExprKind, FnRetTy, GenericArg, - GenericArgs, Guard, HirId, HirIdMap, InlineAsmOperand, Let, Lifetime, LifetimeName, Pat, PatField, PatKind, Path, + GenericArgs, HirId, HirIdMap, InlineAsmOperand, Let, Lifetime, LifetimeName, Pat, PatField, PatKind, Path, PathSegment, PrimTy, QPath, Stmt, StmtKind, Ty, TyKind, TypeBinding, }; use rustc_lexer::{tokenize, TokenKind}; @@ -320,7 +320,7 @@ impl HirEqInterExpr<'_, '_, '_> { && self.eq_expr(le, re) && over(la, ra, |l, r| { self.eq_pat(l.pat, r.pat) - && both(&l.guard, &r.guard, |l, r| self.eq_guard(l, r)) + && both(&l.guard, &r.guard, |l, r| self.eq_expr(l, r)) && self.eq_expr(l.body, r.body) }) }, @@ -410,16 +410,6 @@ impl HirEqInterExpr<'_, '_, '_> { left.ident.name == right.ident.name && self.eq_expr(left.expr, right.expr) } - fn eq_guard(&mut self, left: &Guard<'_>, right: &Guard<'_>) -> bool { - match (left, right) { - (Guard::If(l), Guard::If(r)) => self.eq_expr(l, r), - (Guard::IfLet(l), Guard::IfLet(r)) => { - self.eq_pat(l.pat, r.pat) && both(&l.ty, &r.ty, |l, r| self.eq_ty(l, r)) && self.eq_expr(l.init, r.init) - }, - _ => false, - } - } - fn eq_generic_arg(&mut self, left: &GenericArg<'_>, right: &GenericArg<'_>) -> bool { match (left, right) { (GenericArg::Const(l), GenericArg::Const(r)) => self.eq_body(l.value.body, r.value.body), @@ -876,7 +866,7 @@ impl<'a, 'tcx> SpanlessHash<'a, 'tcx> { for arm in arms { self.hash_pat(arm.pat); if let Some(ref e) = arm.guard { - self.hash_guard(e); + self.hash_expr(e); } self.hash_expr(arm.body); } @@ -1056,14 +1046,6 @@ impl<'a, 'tcx> SpanlessHash<'a, 'tcx> { } } - pub fn hash_guard(&mut self, g: &Guard<'_>) { - match g { - Guard::If(expr) | Guard::IfLet(Let { init: expr, .. }) => { - self.hash_expr(expr); - }, - } - } - pub fn hash_lifetime(&mut self, lifetime: &Lifetime) { lifetime.ident.name.hash(&mut self.s); std::mem::discriminant(&lifetime.res).hash(&mut self.s); diff --git a/src/tools/clippy/clippy_utils/src/lib.rs b/src/tools/clippy/clippy_utils/src/lib.rs index 70a3c6f82c1..cdf8528f48a 100644 --- a/src/tools/clippy/clippy_utils/src/lib.rs +++ b/src/tools/clippy/clippy_utils/src/lib.rs @@ -3164,7 +3164,7 @@ pub fn is_never_expr<'tcx>(cx: &LateContext<'tcx>, e: &'tcx Expr<'_>) -> Option< self.is_never = false; if let Some(guard) = arm.guard { let in_final_expr = mem::replace(&mut self.in_final_expr, false); - self.visit_expr(guard.body()); + self.visit_expr(guard); self.in_final_expr = in_final_expr; // The compiler doesn't consider diverging guards as causing the arm to diverge. self.is_never = false; @@ -3223,7 +3223,7 @@ pub fn is_never_expr<'tcx>(cx: &LateContext<'tcx>, e: &'tcx Expr<'_>) -> Option< fn visit_arm(&mut self, arm: &Arm<'tcx>) { if let Some(guard) = arm.guard { let in_final_expr = mem::replace(&mut self.in_final_expr, false); - self.visit_expr(guard.body()); + self.visit_expr(guard); self.in_final_expr = in_final_expr; } self.visit_expr(arm.body); diff --git a/src/tools/clippy/tests/ui/borrow_interior_mutable_const/auxiliary/helper.rs b/src/tools/clippy/tests/ui/borrow_interior_mutable_const/auxiliary/helper.rs index b03c21262c3..96e037d4fcd 100644 --- a/src/tools/clippy/tests/ui/borrow_interior_mutable_const/auxiliary/helper.rs +++ b/src/tools/clippy/tests/ui/borrow_interior_mutable_const/auxiliary/helper.rs @@ -2,7 +2,6 @@ // As the most common case is the `http` crate, it replicates `http::HeaderName`'s structure. #![allow(clippy::declare_interior_mutable_const)] -#![allow(unused_tuple_struct_fields)] use std::sync::atomic::AtomicUsize; diff --git a/src/tools/clippy/tests/ui/crashes/ice-6251.stderr b/src/tools/clippy/tests/ui/crashes/ice-6251.stderr index 11081dc8087..0196c9923db 100644 --- a/src/tools/clippy/tests/ui/crashes/ice-6251.stderr +++ b/src/tools/clippy/tests/ui/crashes/ice-6251.stderr @@ -6,7 +6,7 @@ LL | fn bug<T>() -> impl Iterator<Item = [(); { |x: [u8]| x }]> { | = help: the trait `std::marker::Sized` is not implemented for `[u8]` = help: unsized fn params are gated as an unstable feature -help: function arguments must have a statically known size, borrowed types always have a known size +help: function arguments must have a statically known size, borrowed slices always have a known size | LL | fn bug<T>() -> impl Iterator<Item = [(); { |x: &[u8]| x }]> { | + diff --git a/src/tools/clippy/tests/ui/crashes/ice-6252.stderr b/src/tools/clippy/tests/ui/crashes/ice-6252.stderr index f929bec9583..f6d0976091c 100644 --- a/src/tools/clippy/tests/ui/crashes/ice-6252.stderr +++ b/src/tools/clippy/tests/ui/crashes/ice-6252.stderr @@ -8,8 +8,6 @@ help: consider importing one of these items | LL + use core::marker::PhantomData; | -LL + use serde::__private::PhantomData; - | LL + use std::marker::PhantomData; | diff --git a/src/tools/clippy/tests/ui/format.fixed b/src/tools/clippy/tests/ui/format.fixed index 36679a9c883..2b32fdeae2b 100644 --- a/src/tools/clippy/tests/ui/format.fixed +++ b/src/tools/clippy/tests/ui/format.fixed @@ -1,6 +1,5 @@ #![warn(clippy::useless_format)] #![allow( - unused_tuple_struct_fields, clippy::print_literal, clippy::redundant_clone, clippy::to_string_in_format_args, diff --git a/src/tools/clippy/tests/ui/format.rs b/src/tools/clippy/tests/ui/format.rs index b0920daf088..bad192067e9 100644 --- a/src/tools/clippy/tests/ui/format.rs +++ b/src/tools/clippy/tests/ui/format.rs @@ -1,6 +1,5 @@ #![warn(clippy::useless_format)] #![allow( - unused_tuple_struct_fields, clippy::print_literal, clippy::redundant_clone, clippy::to_string_in_format_args, diff --git a/src/tools/clippy/tests/ui/format.stderr b/src/tools/clippy/tests/ui/format.stderr index d4630a8f1da..e02fdb1e415 100644 --- a/src/tools/clippy/tests/ui/format.stderr +++ b/src/tools/clippy/tests/ui/format.stderr @@ -1,5 +1,5 @@ error: useless use of `format!` - --> $DIR/format.rs:20:5 + --> $DIR/format.rs:19:5 | LL | format!("foo"); | ^^^^^^^^^^^^^^ help: consider using `.to_string()`: `"foo".to_string()` @@ -8,19 +8,19 @@ LL | format!("foo"); = help: to override `-D warnings` add `#[allow(clippy::useless_format)]` error: useless use of `format!` - --> $DIR/format.rs:21:5 + --> $DIR/format.rs:20:5 | LL | format!("{{}}"); | ^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `"{}".to_string()` error: useless use of `format!` - --> $DIR/format.rs:22:5 + --> $DIR/format.rs:21:5 | LL | format!("{{}} abc {{}}"); | ^^^^^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `"{} abc {}".to_string()` error: useless use of `format!` - --> $DIR/format.rs:23:5 + --> $DIR/format.rs:22:5 | LL | / format!( LL | | r##"foo {{}} @@ -35,67 +35,67 @@ LL ~ " bar"##.to_string(); | error: useless use of `format!` - --> $DIR/format.rs:28:13 + --> $DIR/format.rs:27:13 | LL | let _ = format!(""); | ^^^^^^^^^^^ help: consider using `String::new()`: `String::new()` error: useless use of `format!` - --> $DIR/format.rs:30:5 + --> $DIR/format.rs:29:5 | LL | format!("{}", "foo"); | ^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `"foo".to_string()` error: useless use of `format!` - --> $DIR/format.rs:38:5 + --> $DIR/format.rs:37:5 | LL | format!("{}", arg); | ^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `arg.to_string()` error: useless use of `format!` - --> $DIR/format.rs:68:5 + --> $DIR/format.rs:67:5 | LL | format!("{}", 42.to_string()); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `42.to_string()` error: useless use of `format!` - --> $DIR/format.rs:70:5 + --> $DIR/format.rs:69:5 | LL | format!("{}", x.display().to_string()); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `x.display().to_string()` error: useless use of `format!` - --> $DIR/format.rs:74:18 + --> $DIR/format.rs:73:18 | LL | let _ = Some(format!("{}", a + "bar")); | ^^^^^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `a + "bar"` error: useless use of `format!` - --> $DIR/format.rs:78:22 + --> $DIR/format.rs:77:22 | LL | let _s: String = format!("{}", &*v.join("\n")); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `(&*v.join("\n")).to_string()` error: useless use of `format!` - --> $DIR/format.rs:84:13 + --> $DIR/format.rs:83:13 | LL | let _ = format!("{x}"); | ^^^^^^^^^^^^^^ help: consider using `.to_string()`: `x.to_string()` error: useless use of `format!` - --> $DIR/format.rs:86:13 + --> $DIR/format.rs:85:13 | LL | let _ = format!("{y}", y = x); | ^^^^^^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `x.to_string()` error: useless use of `format!` - --> $DIR/format.rs:90:13 + --> $DIR/format.rs:89:13 | LL | let _ = format!("{abc}"); | ^^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `abc.to_string()` error: useless use of `format!` - --> $DIR/format.rs:92:13 + --> $DIR/format.rs:91:13 | LL | let _ = format!("{xx}"); | ^^^^^^^^^^^^^^^ help: consider using `.to_string()`: `xx.to_string()` diff --git a/src/tools/clippy/tests/ui/from_iter_instead_of_collect.fixed b/src/tools/clippy/tests/ui/from_iter_instead_of_collect.fixed index 82c8e1d8abd..c250162dfb8 100644 --- a/src/tools/clippy/tests/ui/from_iter_instead_of_collect.fixed +++ b/src/tools/clippy/tests/ui/from_iter_instead_of_collect.fixed @@ -1,5 +1,5 @@ #![warn(clippy::from_iter_instead_of_collect)] -#![allow(unused_imports, unused_tuple_struct_fields)] +#![allow(unused_imports)] #![allow(clippy::useless_vec)] use std::collections::{BTreeMap, BTreeSet, HashMap, VecDeque}; diff --git a/src/tools/clippy/tests/ui/from_iter_instead_of_collect.rs b/src/tools/clippy/tests/ui/from_iter_instead_of_collect.rs index 2aed6b14be1..8adbb841c8b 100644 --- a/src/tools/clippy/tests/ui/from_iter_instead_of_collect.rs +++ b/src/tools/clippy/tests/ui/from_iter_instead_of_collect.rs @@ -1,5 +1,5 @@ #![warn(clippy::from_iter_instead_of_collect)] -#![allow(unused_imports, unused_tuple_struct_fields)] +#![allow(unused_imports)] #![allow(clippy::useless_vec)] use std::collections::{BTreeMap, BTreeSet, HashMap, VecDeque}; diff --git a/src/tools/clippy/tests/ui/must_use_candidates.fixed b/src/tools/clippy/tests/ui/must_use_candidates.fixed index 3ed705b2906..db20ba29f3d 100644 --- a/src/tools/clippy/tests/ui/must_use_candidates.fixed +++ b/src/tools/clippy/tests/ui/must_use_candidates.fixed @@ -1,7 +1,6 @@ #![feature(never_type)] #![allow( unused_mut, - unused_tuple_struct_fields, clippy::redundant_allocation, clippy::needless_pass_by_ref_mut )] diff --git a/src/tools/clippy/tests/ui/must_use_candidates.rs b/src/tools/clippy/tests/ui/must_use_candidates.rs index ab8efea0ac7..d7e56130245 100644 --- a/src/tools/clippy/tests/ui/must_use_candidates.rs +++ b/src/tools/clippy/tests/ui/must_use_candidates.rs @@ -1,7 +1,6 @@ #![feature(never_type)] #![allow( unused_mut, - unused_tuple_struct_fields, clippy::redundant_allocation, clippy::needless_pass_by_ref_mut )] diff --git a/src/tools/clippy/tests/ui/must_use_candidates.stderr b/src/tools/clippy/tests/ui/must_use_candidates.stderr index 581399f3e48..39446bf6cd9 100644 --- a/src/tools/clippy/tests/ui/must_use_candidates.stderr +++ b/src/tools/clippy/tests/ui/must_use_candidates.stderr @@ -1,5 +1,5 @@ error: this function could have a `#[must_use]` attribute - --> $DIR/must_use_candidates.rs:16:1 + --> $DIR/must_use_candidates.rs:15:1 | LL | pub fn pure(i: u8) -> u8 { | ^^^^^^^^^^^^^^^^^^^^^^^^ help: add the attribute: `#[must_use] pub fn pure(i: u8) -> u8` @@ -8,25 +8,25 @@ LL | pub fn pure(i: u8) -> u8 { = help: to override `-D warnings` add `#[allow(clippy::must_use_candidate)]` error: this method could have a `#[must_use]` attribute - --> $DIR/must_use_candidates.rs:21:5 + --> $DIR/must_use_candidates.rs:20:5 | LL | pub fn inherent_pure(&self) -> u8 { | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: add the attribute: `#[must_use] pub fn inherent_pure(&self) -> u8` error: this function could have a `#[must_use]` attribute - --> $DIR/must_use_candidates.rs:52:1 + --> $DIR/must_use_candidates.rs:51:1 | LL | pub fn with_marker(_d: std::marker::PhantomData<&mut u32>) -> bool { | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: add the attribute: `#[must_use] pub fn with_marker(_d: std::marker::PhantomData<&mut u32>) -> bool` error: this function could have a `#[must_use]` attribute - --> $DIR/must_use_candidates.rs:64:1 + --> $DIR/must_use_candidates.rs:63:1 | LL | pub fn rcd(_x: Rc<u32>) -> bool { | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: add the attribute: `#[must_use] pub fn rcd(_x: Rc<u32>) -> bool` error: this function could have a `#[must_use]` attribute - --> $DIR/must_use_candidates.rs:72:1 + --> $DIR/must_use_candidates.rs:71:1 | LL | pub fn arcd(_x: Arc<u32>) -> bool { | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: add the attribute: `#[must_use] pub fn arcd(_x: Arc<u32>) -> bool` diff --git a/src/tools/clippy/tests/ui/numbered_fields.fixed b/src/tools/clippy/tests/ui/numbered_fields.fixed index 7f0a6f8e544..dc88081ba0a 100644 --- a/src/tools/clippy/tests/ui/numbered_fields.fixed +++ b/src/tools/clippy/tests/ui/numbered_fields.fixed @@ -1,5 +1,4 @@ #![warn(clippy::init_numbered_fields)] -#![allow(unused_tuple_struct_fields)] #[derive(Default)] struct TupleStruct(u32, u32, u8); diff --git a/src/tools/clippy/tests/ui/numbered_fields.rs b/src/tools/clippy/tests/ui/numbered_fields.rs index 38f3b36ec4d..e8fa652e3c1 100644 --- a/src/tools/clippy/tests/ui/numbered_fields.rs +++ b/src/tools/clippy/tests/ui/numbered_fields.rs @@ -1,5 +1,4 @@ #![warn(clippy::init_numbered_fields)] -#![allow(unused_tuple_struct_fields)] #[derive(Default)] struct TupleStruct(u32, u32, u8); diff --git a/src/tools/clippy/tests/ui/numbered_fields.stderr b/src/tools/clippy/tests/ui/numbered_fields.stderr index d52a0cf15a8..76f5e082f32 100644 --- a/src/tools/clippy/tests/ui/numbered_fields.stderr +++ b/src/tools/clippy/tests/ui/numbered_fields.stderr @@ -1,5 +1,5 @@ error: used a field initializer for a tuple struct - --> $DIR/numbered_fields.rs:18:13 + --> $DIR/numbered_fields.rs:17:13 | LL | let _ = TupleStruct { | _____________^ @@ -13,7 +13,7 @@ LL | | }; = help: to override `-D warnings` add `#[allow(clippy::init_numbered_fields)]` error: used a field initializer for a tuple struct - --> $DIR/numbered_fields.rs:25:13 + --> $DIR/numbered_fields.rs:24:13 | LL | let _ = TupleStruct { | _____________^ diff --git a/src/tools/clippy/tests/ui/option_if_let_else.fixed b/src/tools/clippy/tests/ui/option_if_let_else.fixed index 363520112ef..d443334bb05 100644 --- a/src/tools/clippy/tests/ui/option_if_let_else.fixed +++ b/src/tools/clippy/tests/ui/option_if_let_else.fixed @@ -1,6 +1,5 @@ #![warn(clippy::option_if_let_else)] #![allow( - unused_tuple_struct_fields, clippy::ref_option_ref, clippy::equatable_if_let, clippy::let_unit_value, diff --git a/src/tools/clippy/tests/ui/option_if_let_else.rs b/src/tools/clippy/tests/ui/option_if_let_else.rs index aaa87a0db54..317c35bf842 100644 --- a/src/tools/clippy/tests/ui/option_if_let_else.rs +++ b/src/tools/clippy/tests/ui/option_if_let_else.rs @@ -1,6 +1,5 @@ #![warn(clippy::option_if_let_else)] #![allow( - unused_tuple_struct_fields, clippy::ref_option_ref, clippy::equatable_if_let, clippy::let_unit_value, diff --git a/src/tools/clippy/tests/ui/option_if_let_else.stderr b/src/tools/clippy/tests/ui/option_if_let_else.stderr index 55a8360ffd0..e053d356ff2 100644 --- a/src/tools/clippy/tests/ui/option_if_let_else.stderr +++ b/src/tools/clippy/tests/ui/option_if_let_else.stderr @@ -1,5 +1,5 @@ error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:11:5 + --> $DIR/option_if_let_else.rs:10:5 | LL | / if let Some(x) = string { LL | | (true, x) @@ -12,19 +12,19 @@ LL | | } = help: to override `-D warnings` add `#[allow(clippy::option_if_let_else)]` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:29:13 + --> $DIR/option_if_let_else.rs:28:13 | LL | let _ = if let Some(s) = *string { s.len() } else { 0 }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `string.map_or(0, |s| s.len())` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:30:13 + --> $DIR/option_if_let_else.rs:29:13 | LL | let _ = if let Some(s) = &num { s } else { &0 }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `num.as_ref().map_or(&0, |s| s)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:31:13 + --> $DIR/option_if_let_else.rs:30:13 | LL | let _ = if let Some(s) = &mut num { | _____________^ @@ -44,13 +44,13 @@ LL ~ }); | error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:37:13 + --> $DIR/option_if_let_else.rs:36:13 | LL | let _ = if let Some(ref s) = num { s } else { &0 }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `num.as_ref().map_or(&0, |s| s)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:38:13 + --> $DIR/option_if_let_else.rs:37:13 | LL | let _ = if let Some(mut s) = num { | _____________^ @@ -70,7 +70,7 @@ LL ~ }); | error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:44:13 + --> $DIR/option_if_let_else.rs:43:13 | LL | let _ = if let Some(ref mut s) = num { | _____________^ @@ -90,7 +90,7 @@ LL ~ }); | error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:53:5 + --> $DIR/option_if_let_else.rs:52:5 | LL | / if let Some(x) = arg { LL | | let y = x * x; @@ -109,7 +109,7 @@ LL + }) | error: use Option::map_or_else instead of an if let/else - --> $DIR/option_if_let_else.rs:66:13 + --> $DIR/option_if_let_else.rs:65:13 | LL | let _ = if let Some(x) = arg { | _____________^ @@ -121,7 +121,7 @@ LL | | }; | |_____^ help: try: `arg.map_or_else(side_effect, |x| x)` error: use Option::map_or_else instead of an if let/else - --> $DIR/option_if_let_else.rs:75:13 + --> $DIR/option_if_let_else.rs:74:13 | LL | let _ = if let Some(x) = arg { | _____________^ @@ -144,7 +144,7 @@ LL ~ }, |x| x * x * x * x); | error: use Option::map_or_else instead of an if let/else - --> $DIR/option_if_let_else.rs:108:13 + --> $DIR/option_if_let_else.rs:107:13 | LL | / if let Some(idx) = s.find('.') { LL | | vec![s[..idx].to_string(), s[idx..].to_string()] @@ -154,7 +154,7 @@ LL | | } | |_____________^ help: try: `s.find('.').map_or_else(|| vec![s.to_string()], |idx| vec![s[..idx].to_string(), s[idx..].to_string()])` error: use Option::map_or_else instead of an if let/else - --> $DIR/option_if_let_else.rs:119:5 + --> $DIR/option_if_let_else.rs:118:5 | LL | / if let Ok(binding) = variable { LL | | println!("Ok {binding}"); @@ -177,13 +177,13 @@ LL + }) | error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:143:13 + --> $DIR/option_if_let_else.rs:142:13 | LL | let _ = if let Some(x) = optional { x + 2 } else { 5 }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `optional.map_or(5, |x| x + 2)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:153:13 + --> $DIR/option_if_let_else.rs:152:13 | LL | let _ = if let Some(x) = Some(0) { | _____________^ @@ -205,13 +205,13 @@ LL ~ }); | error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:181:13 + --> $DIR/option_if_let_else.rs:180:13 | LL | let _ = if let Some(x) = Some(0) { s.len() + x } else { s.len() }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `Some(0).map_or(s.len(), |x| s.len() + x)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:185:13 + --> $DIR/option_if_let_else.rs:184:13 | LL | let _ = if let Some(x) = Some(0) { | _____________^ @@ -231,7 +231,7 @@ LL ~ }); | error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:224:13 + --> $DIR/option_if_let_else.rs:223:13 | LL | let _ = match s { | _____________^ @@ -241,7 +241,7 @@ LL | | }; | |_____^ help: try: `s.map_or(1, |string| string.len())` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:228:13 + --> $DIR/option_if_let_else.rs:227:13 | LL | let _ = match Some(10) { | _____________^ @@ -251,7 +251,7 @@ LL | | }; | |_____^ help: try: `Some(10).map_or(5, |a| a + 1)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:234:13 + --> $DIR/option_if_let_else.rs:233:13 | LL | let _ = match res { | _____________^ @@ -261,7 +261,7 @@ LL | | }; | |_____^ help: try: `res.map_or(1, |a| a + 1)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:238:13 + --> $DIR/option_if_let_else.rs:237:13 | LL | let _ = match res { | _____________^ @@ -271,13 +271,13 @@ LL | | }; | |_____^ help: try: `res.map_or(1, |a| a + 1)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:242:13 + --> $DIR/option_if_let_else.rs:241:13 | LL | let _ = if let Ok(a) = res { a + 1 } else { 5 }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `res.map_or(5, |a| a + 1)` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:259:17 + --> $DIR/option_if_let_else.rs:258:17 | LL | let _ = match initial { | _________________^ @@ -287,7 +287,7 @@ LL | | }; | |_________^ help: try: `initial.as_ref().map_or(42, |value| do_something(value))` error: use Option::map_or instead of an if let/else - --> $DIR/option_if_let_else.rs:266:17 + --> $DIR/option_if_let_else.rs:265:17 | LL | let _ = match initial { | _________________^ @@ -297,7 +297,7 @@ LL | | }; | |_________^ help: try: `initial.as_mut().map_or(42, |value| do_something2(value))` error: use Option::map_or_else instead of an if let/else - --> $DIR/option_if_let_else.rs:289:24 + --> $DIR/option_if_let_else.rs:288:24 | LL | let mut _hashmap = if let Some(hm) = &opt { | ________________________^ @@ -308,7 +308,7 @@ LL | | }; | |_____^ help: try: `opt.as_ref().map_or_else(HashMap::new, |hm| hm.clone())` error: use Option::map_or_else instead of an if let/else - --> $DIR/option_if_let_else.rs:295:19 + --> $DIR/option_if_let_else.rs:294:19 | LL | let mut _hm = if let Some(hm) = &opt { hm.clone() } else { new_map!() }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ help: try: `opt.as_ref().map_or_else(|| new_map!(), |hm| hm.clone())` diff --git a/src/tools/clippy/tests/ui/unreadable_literal.fixed b/src/tools/clippy/tests/ui/unreadable_literal.fixed index 6d8c719ee07..fb9c2672db8 100644 --- a/src/tools/clippy/tests/ui/unreadable_literal.fixed +++ b/src/tools/clippy/tests/ui/unreadable_literal.fixed @@ -1,5 +1,4 @@ #![warn(clippy::unreadable_literal)] -#![allow(unused_tuple_struct_fields)] struct Foo(u64); diff --git a/src/tools/clippy/tests/ui/unreadable_literal.rs b/src/tools/clippy/tests/ui/unreadable_literal.rs index 42ca773c351..0a24fa85254 100644 --- a/src/tools/clippy/tests/ui/unreadable_literal.rs +++ b/src/tools/clippy/tests/ui/unreadable_literal.rs @@ -1,5 +1,4 @@ #![warn(clippy::unreadable_literal)] -#![allow(unused_tuple_struct_fields)] struct Foo(u64); diff --git a/src/tools/clippy/tests/ui/unreadable_literal.stderr b/src/tools/clippy/tests/ui/unreadable_literal.stderr index d7a3377ec37..37f91acf82b 100644 --- a/src/tools/clippy/tests/ui/unreadable_literal.stderr +++ b/src/tools/clippy/tests/ui/unreadable_literal.stderr @@ -1,5 +1,5 @@ error: long literal lacking separators - --> $DIR/unreadable_literal.rs:32:17 + --> $DIR/unreadable_literal.rs:31:17 | LL | let _bad = (0b110110_i64, 0x12345678_usize, 123456_f32, 1.234567_f32); | ^^^^^^^^^^^^ help: consider: `0b11_0110_i64` @@ -8,55 +8,55 @@ LL | let _bad = (0b110110_i64, 0x12345678_usize, 123456_f32, 1.234567_f32); = help: to override `-D warnings` add `#[allow(clippy::unreadable_literal)]` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:32:31 + --> $DIR/unreadable_literal.rs:31:31 | LL | let _bad = (0b110110_i64, 0x12345678_usize, 123456_f32, 1.234567_f32); | ^^^^^^^^^^^^^^^^ help: consider: `0x1234_5678_usize` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:32:49 + --> $DIR/unreadable_literal.rs:31:49 | LL | let _bad = (0b110110_i64, 0x12345678_usize, 123456_f32, 1.234567_f32); | ^^^^^^^^^^ help: consider: `123_456_f32` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:32:61 + --> $DIR/unreadable_literal.rs:31:61 | LL | let _bad = (0b110110_i64, 0x12345678_usize, 123456_f32, 1.234567_f32); | ^^^^^^^^^^^^ help: consider: `1.234_567_f32` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:34:20 + --> $DIR/unreadable_literal.rs:33:20 | LL | let _bad_sci = 1.123456e1; | ^^^^^^^^^^ help: consider: `1.123_456e1` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:36:18 + --> $DIR/unreadable_literal.rs:35:18 | LL | let _fail1 = 0xabcdef; | ^^^^^^^^ help: consider: `0x00ab_cdef` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:37:23 + --> $DIR/unreadable_literal.rs:36:23 | LL | let _fail2: u32 = 0xBAFEBAFE; | ^^^^^^^^^^ help: consider: `0xBAFE_BAFE` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:38:18 + --> $DIR/unreadable_literal.rs:37:18 | LL | let _fail3 = 0xabcdeff; | ^^^^^^^^^ help: consider: `0x0abc_deff` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:39:24 + --> $DIR/unreadable_literal.rs:38:24 | LL | let _fail4: i128 = 0xabcabcabcabcabcabc; | ^^^^^^^^^^^^^^^^^^^^ help: consider: `0x00ab_cabc_abca_bcab_cabc` error: long literal lacking separators - --> $DIR/unreadable_literal.rs:40:18 + --> $DIR/unreadable_literal.rs:39:18 | LL | let _fail5 = 1.100300400; | ^^^^^^^^^^^ help: consider: `1.100_300_400` diff --git a/src/tools/compiletest/src/common.rs b/src/tools/compiletest/src/common.rs index e85f6319936..4cf5a710586 100644 --- a/src/tools/compiletest/src/common.rs +++ b/src/tools/compiletest/src/common.rs @@ -387,6 +387,10 @@ pub struct Config { // Needed both to construct build_helper::git::GitConfig pub git_repository: String, pub nightly_branch: String, + + /// True if the profiler runtime is enabled for this target. + /// Used by the "needs-profiler-support" header in test files. + pub profiler_support: bool, } impl Config { diff --git a/src/tools/compiletest/src/errors.rs b/src/tools/compiletest/src/errors.rs index c33e66e02ac..e0ec76aa027 100644 --- a/src/tools/compiletest/src/errors.rs +++ b/src/tools/compiletest/src/errors.rs @@ -11,7 +11,7 @@ use once_cell::sync::Lazy; use regex::Regex; use tracing::*; -#[derive(Clone, Debug, PartialEq)] +#[derive(Copy, Clone, Debug, PartialEq)] pub enum ErrorKind { Help, Error, diff --git a/src/tools/compiletest/src/header.rs b/src/tools/compiletest/src/header.rs index f85f9e674ab..e70e01e8757 100644 --- a/src/tools/compiletest/src/header.rs +++ b/src/tools/compiletest/src/header.rs @@ -178,6 +178,9 @@ pub struct TestProps { // Whether to tell `rustc` to remap the "src base" directory to a fake // directory. pub remap_src_base: bool, + /// Extra flags to pass to `llvm-cov` when producing coverage reports. + /// Only used by the "coverage-run" test mode. + pub llvm_cov_flags: Vec<String>, } mod directives { @@ -216,6 +219,7 @@ mod directives { pub const MIR_UNIT_TEST: &'static str = "unit-test"; pub const REMAP_SRC_BASE: &'static str = "remap-src-base"; pub const COMPARE_OUTPUT_LINES_BY_SUBSET: &'static str = "compare-output-lines-by-subset"; + pub const LLVM_COV_FLAGS: &'static str = "llvm-cov-flags"; // This isn't a real directive, just one that is probably mistyped often pub const INCORRECT_COMPILER_FLAGS: &'static str = "compiler-flags"; } @@ -265,6 +269,7 @@ impl TestProps { stderr_per_bitwidth: false, mir_unit_test: None, remap_src_base: false, + llvm_cov_flags: vec![], } } @@ -321,16 +326,23 @@ impl TestProps { |r| r, ); - if let Some(flags) = config.parse_name_value_directive(ln, COMPILE_FLAGS) { - self.compile_flags.extend( - flags - .split("'") - .enumerate() - .flat_map(|(i, f)| { + fn split_flags(flags: &str) -> Vec<String> { + // Individual flags can be single-quoted to preserve spaces; see + // <https://github.com/rust-lang/rust/pull/115948/commits/957c5db6>. + flags + .split("'") + .enumerate() + .flat_map( + |(i, f)| { if i % 2 == 1 { vec![f] } else { f.split_whitespace().collect() } - }) - .map(|s| s.to_owned()), - ); + }, + ) + .map(move |s| s.to_owned()) + .collect::<Vec<_>>() + } + + if let Some(flags) = config.parse_name_value_directive(ln, COMPILE_FLAGS) { + self.compile_flags.extend(split_flags(&flags)); } if config.parse_name_value_directive(ln, INCORRECT_COMPILER_FLAGS).is_some() { panic!("`compiler-flags` directive should be spelled `compile-flags`"); @@ -488,6 +500,10 @@ impl TestProps { COMPARE_OUTPUT_LINES_BY_SUBSET, &mut self.compare_output_lines_by_subset, ); + + if let Some(flags) = config.parse_name_value_directive(ln, LLVM_COV_FLAGS) { + self.llvm_cov_flags.extend(split_flags(&flags)); + } }); } diff --git a/src/tools/compiletest/src/header/cfg.rs b/src/tools/compiletest/src/header/cfg.rs index e2a04b7e558..df8c8047050 100644 --- a/src/tools/compiletest/src/header/cfg.rs +++ b/src/tools/compiletest/src/header/cfg.rs @@ -1,4 +1,4 @@ -use crate::common::{CompareMode, Config, Debugger}; +use crate::common::{CompareMode, Config, Debugger, Mode}; use crate::header::IgnoreDecision; use std::collections::HashSet; @@ -208,6 +208,17 @@ pub(super) fn parse_cfg_name_directive<'a>( }, message: "when comparing with {name}", } + // Coverage tests run the same test file in multiple modes. + // If a particular test should not be run in one of the modes, ignore it + // with "ignore-mode-coverage-map" or "ignore-mode-coverage-run". + condition! { + name: format!("mode-{}", config.mode.to_str()), + allowed_names: ContainsPrefixed { + prefix: "mode-", + inner: Mode::STR_VARIANTS, + }, + message: "when the test mode is {name}", + } if prefix == "ignore" && outcome == MatchOutcome::Invalid { // Don't error out for ignore-tidy-* diretives, as those are not handled by compiletest. diff --git a/src/tools/compiletest/src/header/needs.rs b/src/tools/compiletest/src/header/needs.rs index 4a40fb55f5c..9b22b2112a8 100644 --- a/src/tools/compiletest/src/header/needs.rs +++ b/src/tools/compiletest/src/header/needs.rs @@ -238,7 +238,7 @@ impl CachedNeedsConditions { sanitizer_memtag: sanitizers.contains(&Sanitizer::Memtag), sanitizer_shadow_call_stack: sanitizers.contains(&Sanitizer::ShadowCallStack), sanitizer_safestack: sanitizers.contains(&Sanitizer::Safestack), - profiler_support: std::env::var_os("RUSTC_PROFILER_SUPPORT").is_some(), + profiler_support: config.profiler_support, xray: config.target_cfg().xray, // For tests using the `needs-rust-lld` directive (e.g. for `-Clink-self-contained=+linker`), diff --git a/src/tools/compiletest/src/header/tests.rs b/src/tools/compiletest/src/header/tests.rs index 295134c78dc..8882f1582ac 100644 --- a/src/tools/compiletest/src/header/tests.rs +++ b/src/tools/compiletest/src/header/tests.rs @@ -1,7 +1,8 @@ use std::io::Read; use std::path::Path; +use std::str::FromStr; -use crate::common::{Config, Debugger}; +use crate::common::{Config, Debugger, Mode}; use crate::header::{parse_normalization_string, EarlyProps, HeadersCache}; fn make_test_description<R: Read>( @@ -55,6 +56,7 @@ fn test_parse_normalization_string() { #[derive(Default)] struct ConfigBuilder { + mode: Option<String>, channel: Option<String>, host: Option<String>, target: Option<String>, @@ -62,9 +64,15 @@ struct ConfigBuilder { llvm_version: Option<String>, git_hash: bool, system_llvm: bool, + profiler_support: bool, } impl ConfigBuilder { + fn mode(&mut self, s: &str) -> &mut Self { + self.mode = Some(s.to_owned()); + self + } + fn channel(&mut self, s: &str) -> &mut Self { self.channel = Some(s.to_owned()); self @@ -100,10 +108,16 @@ impl ConfigBuilder { self } + fn profiler_support(&mut self, s: bool) -> &mut Self { + self.profiler_support = s; + self + } + fn build(&mut self) -> Config { let args = &[ "compiletest", - "--mode=ui", + "--mode", + self.mode.as_deref().unwrap_or("ui"), "--suite=ui", "--compile-lib-path=", "--run-lib-path=", @@ -142,6 +156,9 @@ impl ConfigBuilder { if self.system_llvm { args.push("--system-llvm".to_owned()); } + if self.profiler_support { + args.push("--profiler-support".to_owned()); + } args.push("--rustc-path".to_string()); // This is a subtle/fragile thing. On rust-lang CI, there is no global @@ -341,6 +358,15 @@ fn sanitizers() { } #[test] +fn profiler_support() { + let config: Config = cfg().profiler_support(false).build(); + assert!(check_ignore(&config, "// needs-profiler-support")); + + let config: Config = cfg().profiler_support(true).build(); + assert!(!check_ignore(&config, "// needs-profiler-support")); +} + +#[test] fn asm_support() { let asms = [ ("avr-unknown-gnu-atmega328", false), @@ -530,3 +556,17 @@ fn families() { assert!(!check_ignore(&config, &format!("// ignore-{other}"))); } } + +#[test] +fn ignore_mode() { + for &mode in Mode::STR_VARIANTS { + // Indicate profiler support so that "coverage-run" tests aren't skipped. + let config: Config = cfg().mode(mode).profiler_support(true).build(); + let other = if mode == "coverage-run" { "coverage-map" } else { "coverage-run" }; + assert_ne!(mode, other); + assert_eq!(config.mode, Mode::from_str(mode).unwrap()); + assert_ne!(config.mode, Mode::from_str(other).unwrap()); + assert!(check_ignore(&config, &format!("// ignore-mode-{mode}"))); + assert!(!check_ignore(&config, &format!("// ignore-mode-{other}"))); + } +} diff --git a/src/tools/compiletest/src/lib.rs b/src/tools/compiletest/src/lib.rs index 5a80b9121f0..60dd15841b7 100644 --- a/src/tools/compiletest/src/lib.rs +++ b/src/tools/compiletest/src/lib.rs @@ -142,6 +142,7 @@ pub fn parse_config(args: Vec<String>) -> Config { .optflag("", "force-rerun", "rerun tests even if the inputs are unchanged") .optflag("", "only-modified", "only run tests that result been modified") .optflag("", "nocapture", "") + .optflag("", "profiler-support", "is the profiler runtime enabled for this target") .optflag("h", "help", "show this message") .reqopt("", "channel", "current Rust channel", "CHANNEL") .optflag("", "git-hash", "run tests which rely on commit version being compiled into the binaries") @@ -315,6 +316,8 @@ pub fn parse_config(args: Vec<String>) -> Config { git_repository: matches.opt_str("git-repository").unwrap(), nightly_branch: matches.opt_str("nightly-branch").unwrap(), + + profiler_support: matches.opt_present("profiler-support"), } } diff --git a/src/tools/compiletest/src/runtest.rs b/src/tools/compiletest/src/runtest.rs index ca80328f3ac..b258b748ca8 100644 --- a/src/tools/compiletest/src/runtest.rs +++ b/src/tools/compiletest/src/runtest.rs @@ -575,6 +575,8 @@ impl<'test> TestCx<'test> { cmd.arg("--object"); cmd.arg(bin); } + + cmd.args(&self.props.llvm_cov_flags); }); if !proc_res.status.success() { self.fatal_proc_rec("llvm-cov show failed!", &proc_res); @@ -3977,23 +3979,29 @@ impl<'test> TestCx<'test> { proc_res.status, self.props.error_patterns ); - if !explicit && self.config.compare_mode.is_none() { - let check_patterns = should_run == WillExecute::No - && (!self.props.error_patterns.is_empty() - || !self.props.regex_error_patterns.is_empty()); + let check_patterns = should_run == WillExecute::No + && (!self.props.error_patterns.is_empty() + || !self.props.regex_error_patterns.is_empty()); + if !explicit && self.config.compare_mode.is_none() { let check_annotations = !check_patterns || !expected_errors.is_empty(); - if check_patterns { - // "// error-pattern" comments - let output_to_check = self.get_output(&proc_res); - self.check_all_error_patterns(&output_to_check, &proc_res, pm); - } - if check_annotations { // "//~ERROR comments" self.check_expected_errors(expected_errors, &proc_res); } + } else if explicit && !expected_errors.is_empty() { + let msg = format!( + "line {}: cannot combine `--error-format` with {} annotations; use `error-pattern` instead", + expected_errors[0].line_num, + expected_errors[0].kind.unwrap_or(ErrorKind::Error), + ); + self.fatal(&msg); + } + if check_patterns { + // "// error-pattern" comments + let output_to_check = self.get_output(&proc_res); + self.check_all_error_patterns(&output_to_check, &proc_res, pm); } if self.props.run_rustfix && self.config.compare_mode.is_none() { diff --git a/src/tools/miri/src/diagnostics.rs b/src/tools/miri/src/diagnostics.rs index 4375fa67b80..d3d4490f302 100644 --- a/src/tools/miri/src/diagnostics.rs +++ b/src/tools/miri/src/diagnostics.rs @@ -454,12 +454,12 @@ pub fn report_msg<'tcx>( let span = stacktrace.first().map_or(DUMMY_SP, |fi| fi.span); let sess = machine.tcx.sess; let level = match diag_level { - DiagLevel::Error => Level::Error { lint: false }, + DiagLevel::Error => Level::Error, DiagLevel::Warning => Level::Warning(None), DiagLevel::Note => Level::Note, }; let mut err = DiagnosticBuilder::<()>::new(sess.dcx(), level, title); - err.set_span(span); + err.span(span); // Show main message. if span != DUMMY_SP { diff --git a/src/tools/miri/src/helpers.rs b/src/tools/miri/src/helpers.rs index d2fd51b099a..14ba69b898b 100644 --- a/src/tools/miri/src/helpers.rs +++ b/src/tools/miri/src/helpers.rs @@ -6,6 +6,7 @@ use std::time::Duration; use log::trace; use rustc_apfloat::ieee::{Double, Single}; +use rustc_apfloat::Float; use rustc_hir::def::{DefKind, Namespace}; use rustc_hir::def_id::{DefId, CRATE_DEF_INDEX}; use rustc_index::IndexVec; @@ -117,6 +118,50 @@ fn try_resolve_did(tcx: TyCtxt<'_>, path: &[&str], namespace: Option<Namespace>) } } +/// Convert a softfloat type to its corresponding hostfloat type. +pub trait ToHost { + type HostFloat; + fn to_host(self) -> Self::HostFloat; +} + +/// Convert a hostfloat type to its corresponding softfloat type. +pub trait ToSoft { + type SoftFloat; + fn to_soft(self) -> Self::SoftFloat; +} + +impl ToHost for rustc_apfloat::ieee::Double { + type HostFloat = f64; + + fn to_host(self) -> Self::HostFloat { + f64::from_bits(self.to_bits().try_into().unwrap()) + } +} + +impl ToSoft for f64 { + type SoftFloat = rustc_apfloat::ieee::Double; + + fn to_soft(self) -> Self::SoftFloat { + Float::from_bits(self.to_bits().into()) + } +} + +impl ToHost for rustc_apfloat::ieee::Single { + type HostFloat = f32; + + fn to_host(self) -> Self::HostFloat { + f32::from_bits(self.to_bits().try_into().unwrap()) + } +} + +impl ToSoft for f32 { + type SoftFloat = rustc_apfloat::ieee::Single; + + fn to_soft(self) -> Self::SoftFloat { + Float::from_bits(self.to_bits().into()) + } +} + impl<'mir, 'tcx: 'mir> EvalContextExt<'mir, 'tcx> for crate::MiriInterpCx<'mir, 'tcx> {} pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { /// Checks if the given crate/module exists. @@ -1188,11 +1233,3 @@ pub(crate) fn simd_element_to_bool(elem: ImmTy<'_, Provenance>) -> InterpResult< _ => throw_ub_format!("each element of a SIMD mask must be all-0-bits or all-1-bits"), }) } - -// This looks like something that would be nice to have in the standard library... -pub(crate) fn round_to_next_multiple_of(x: u64, divisor: u64) -> u64 { - assert_ne!(divisor, 0); - // divisor is nonzero; multiplication cannot overflow since we just divided - #[allow(clippy::arithmetic_side_effects)] - return (x.checked_add(divisor - 1).unwrap() / divisor) * divisor; -} diff --git a/src/tools/miri/src/lib.rs b/src/tools/miri/src/lib.rs index 4e9febf0205..cacd02bbfae 100644 --- a/src/tools/miri/src/lib.rs +++ b/src/tools/miri/src/lib.rs @@ -11,6 +11,7 @@ #![feature(round_ties_even)] #![feature(let_chains)] #![feature(lint_reasons)] +#![feature(int_roundings)] // Configure clippy and other lints #![allow( clippy::collapsible_else_if, diff --git a/src/tools/miri/src/operator.rs b/src/tools/miri/src/operator.rs index e5a437f95f0..14076444696 100644 --- a/src/tools/miri/src/operator.rs +++ b/src/tools/miri/src/operator.rs @@ -118,4 +118,8 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { nan } } + + fn adjust_nan<F1: Float + FloatConvert<F2>, F2: Float>(&self, f: F2, inputs: &[F1]) -> F2 { + if f.is_nan() { self.generate_nan(inputs) } else { f } + } } diff --git a/src/tools/miri/src/shims/foreign_items.rs b/src/tools/miri/src/shims/foreign_items.rs index 8ddfc05dd30..e7b2a6823ed 100644 --- a/src/tools/miri/src/shims/foreign_items.rs +++ b/src/tools/miri/src/shims/foreign_items.rs @@ -23,6 +23,7 @@ use rustc_target::{ use super::backtrace::EvalContextExt as _; use crate::*; +use helpers::{ToHost, ToSoft}; /// Type of dynamic symbols (for `dlsym` et al) #[derive(Debug, Copy, Clone)] @@ -886,23 +887,26 @@ trait EvalContextExtPriv<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { | "tgammaf" => { let [f] = this.check_shim(abi, Abi::C { unwind: false }, link_name, args)?; + let f = this.read_scalar(f)?.to_f32()?; // FIXME: Using host floats. - let f = f32::from_bits(this.read_scalar(f)?.to_u32()?); + let f_host = f.to_host(); let res = match link_name.as_str() { - "cbrtf" => f.cbrt(), - "coshf" => f.cosh(), - "sinhf" => f.sinh(), - "tanf" => f.tan(), - "tanhf" => f.tanh(), - "acosf" => f.acos(), - "asinf" => f.asin(), - "atanf" => f.atan(), - "log1pf" => f.ln_1p(), - "expm1f" => f.exp_m1(), - "tgammaf" => f.gamma(), + "cbrtf" => f_host.cbrt(), + "coshf" => f_host.cosh(), + "sinhf" => f_host.sinh(), + "tanf" => f_host.tan(), + "tanhf" => f_host.tanh(), + "acosf" => f_host.acos(), + "asinf" => f_host.asin(), + "atanf" => f_host.atan(), + "log1pf" => f_host.ln_1p(), + "expm1f" => f_host.exp_m1(), + "tgammaf" => f_host.gamma(), _ => bug!(), }; - this.write_scalar(Scalar::from_u32(res.to_bits()), dest)?; + let res = res.to_soft(); + let res = this.adjust_nan(res, &[f]); + this.write_scalar(res, dest)?; } #[rustfmt::skip] | "_hypotf" @@ -911,19 +915,20 @@ trait EvalContextExtPriv<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { | "fdimf" => { let [f1, f2] = this.check_shim(abi, Abi::C { unwind: false }, link_name, args)?; + let f1 = this.read_scalar(f1)?.to_f32()?; + let f2 = this.read_scalar(f2)?.to_f32()?; // underscore case for windows, here and below // (see https://docs.microsoft.com/en-us/cpp/c-runtime-library/reference/floating-point-primitives?view=vs-2019) // FIXME: Using host floats. - let f1 = f32::from_bits(this.read_scalar(f1)?.to_u32()?); - let f2 = f32::from_bits(this.read_scalar(f2)?.to_u32()?); let res = match link_name.as_str() { - "_hypotf" | "hypotf" => f1.hypot(f2), - "atan2f" => f1.atan2(f2), + "_hypotf" | "hypotf" => f1.to_host().hypot(f2.to_host()).to_soft(), + "atan2f" => f1.to_host().atan2(f2.to_host()).to_soft(), #[allow(deprecated)] - "fdimf" => f1.abs_sub(f2), + "fdimf" => f1.to_host().abs_sub(f2.to_host()).to_soft(), _ => bug!(), }; - this.write_scalar(Scalar::from_u32(res.to_bits()), dest)?; + let res = this.adjust_nan(res, &[f1, f2]); + this.write_scalar(res, dest)?; } #[rustfmt::skip] | "cbrt" @@ -939,23 +944,26 @@ trait EvalContextExtPriv<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { | "tgamma" => { let [f] = this.check_shim(abi, Abi::C { unwind: false }, link_name, args)?; + let f = this.read_scalar(f)?.to_f64()?; // FIXME: Using host floats. - let f = f64::from_bits(this.read_scalar(f)?.to_u64()?); + let f_host = f.to_host(); let res = match link_name.as_str() { - "cbrt" => f.cbrt(), - "cosh" => f.cosh(), - "sinh" => f.sinh(), - "tan" => f.tan(), - "tanh" => f.tanh(), - "acos" => f.acos(), - "asin" => f.asin(), - "atan" => f.atan(), - "log1p" => f.ln_1p(), - "expm1" => f.exp_m1(), - "tgamma" => f.gamma(), + "cbrt" => f_host.cbrt(), + "cosh" => f_host.cosh(), + "sinh" => f_host.sinh(), + "tan" => f_host.tan(), + "tanh" => f_host.tanh(), + "acos" => f_host.acos(), + "asin" => f_host.asin(), + "atan" => f_host.atan(), + "log1p" => f_host.ln_1p(), + "expm1" => f_host.exp_m1(), + "tgamma" => f_host.gamma(), _ => bug!(), }; - this.write_scalar(Scalar::from_u64(res.to_bits()), dest)?; + let res = res.to_soft(); + let res = this.adjust_nan(res, &[f]); + this.write_scalar(res, dest)?; } #[rustfmt::skip] | "_hypot" @@ -964,17 +972,20 @@ trait EvalContextExtPriv<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { | "fdim" => { let [f1, f2] = this.check_shim(abi, Abi::C { unwind: false }, link_name, args)?; + let f1 = this.read_scalar(f1)?.to_f64()?; + let f2 = this.read_scalar(f2)?.to_f64()?; + // underscore case for windows, here and below + // (see https://docs.microsoft.com/en-us/cpp/c-runtime-library/reference/floating-point-primitives?view=vs-2019) // FIXME: Using host floats. - let f1 = f64::from_bits(this.read_scalar(f1)?.to_u64()?); - let f2 = f64::from_bits(this.read_scalar(f2)?.to_u64()?); let res = match link_name.as_str() { - "_hypot" | "hypot" => f1.hypot(f2), - "atan2" => f1.atan2(f2), + "_hypot" | "hypot" => f1.to_host().hypot(f2.to_host()).to_soft(), + "atan2" => f1.to_host().atan2(f2.to_host()).to_soft(), #[allow(deprecated)] - "fdim" => f1.abs_sub(f2), + "fdim" => f1.to_host().abs_sub(f2.to_host()).to_soft(), _ => bug!(), }; - this.write_scalar(Scalar::from_u64(res.to_bits()), dest)?; + let res = this.adjust_nan(res, &[f1, f2]); + this.write_scalar(res, dest)?; } #[rustfmt::skip] | "_ldexp" @@ -987,27 +998,30 @@ trait EvalContextExtPriv<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let exp = this.read_scalar(exp)?.to_i32()?; let res = x.scalbn(exp); - this.write_scalar(Scalar::from_f64(res), dest)?; + let res = this.adjust_nan(res, &[x]); + this.write_scalar(res, dest)?; } "lgammaf_r" => { let [x, signp] = this.check_shim(abi, Abi::C { unwind: false }, link_name, args)?; - // FIXME: Using host floats. - let x = f32::from_bits(this.read_scalar(x)?.to_u32()?); + let x = this.read_scalar(x)?.to_f32()?; let signp = this.deref_pointer(signp)?; - let (res, sign) = x.ln_gamma(); + // FIXME: Using host floats. + let (res, sign) = x.to_host().ln_gamma(); this.write_int(sign, &signp)?; - this.write_scalar(Scalar::from_u32(res.to_bits()), dest)?; + let res = this.adjust_nan(res.to_soft(), &[x]); + this.write_scalar(res, dest)?; } "lgamma_r" => { let [x, signp] = this.check_shim(abi, Abi::C { unwind: false }, link_name, args)?; - // FIXME: Using host floats. - let x = f64::from_bits(this.read_scalar(x)?.to_u64()?); + let x = this.read_scalar(x)?.to_f64()?; let signp = this.deref_pointer(signp)?; - let (res, sign) = x.ln_gamma(); + // FIXME: Using host floats. + let (res, sign) = x.to_host().ln_gamma(); this.write_int(sign, &signp)?; - this.write_scalar(Scalar::from_u64(res.to_bits()), dest)?; + let res = this.adjust_nan(res.to_soft(), &[x]); + this.write_scalar(res, dest)?; } // LLVM intrinsics diff --git a/src/tools/miri/src/shims/intrinsics/mod.rs b/src/tools/miri/src/shims/intrinsics/mod.rs index 66918db995d..cc81ef6e6c9 100644 --- a/src/tools/miri/src/shims/intrinsics/mod.rs +++ b/src/tools/miri/src/shims/intrinsics/mod.rs @@ -15,7 +15,7 @@ use rustc_target::abi::Size; use crate::*; use atomic::EvalContextExt as _; -use helpers::check_arg_count; +use helpers::{check_arg_count, ToHost, ToSoft}; use simd::EvalContextExt as _; impl<'mir, 'tcx: 'mir> EvalContextExt<'mir, 'tcx> for crate::MiriInterpCx<'mir, 'tcx> {} @@ -146,12 +146,14 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let [f] = check_arg_count(args)?; let f = this.read_scalar(f)?.to_f32()?; // Can be implemented in soft-floats. + // This is a "bitwise" operation, so there's no NaN non-determinism. this.write_scalar(Scalar::from_f32(f.abs()), dest)?; } "fabsf64" => { let [f] = check_arg_count(args)?; let f = this.read_scalar(f)?.to_f64()?; // Can be implemented in soft-floats. + // This is a "bitwise" operation, so there's no NaN non-determinism. this.write_scalar(Scalar::from_f64(f.abs()), dest)?; } #[rustfmt::skip] @@ -170,25 +172,28 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { | "rintf32" => { let [f] = check_arg_count(args)?; + let f = this.read_scalar(f)?.to_f32()?; // FIXME: Using host floats. - let f = f32::from_bits(this.read_scalar(f)?.to_u32()?); - let f = match intrinsic_name { - "sinf32" => f.sin(), - "cosf32" => f.cos(), - "sqrtf32" => f.sqrt(), - "expf32" => f.exp(), - "exp2f32" => f.exp2(), - "logf32" => f.ln(), - "log10f32" => f.log10(), - "log2f32" => f.log2(), - "floorf32" => f.floor(), - "ceilf32" => f.ceil(), - "truncf32" => f.trunc(), - "roundf32" => f.round(), - "rintf32" => f.round_ties_even(), + let f_host = f.to_host(); + let res = match intrinsic_name { + "sinf32" => f_host.sin(), + "cosf32" => f_host.cos(), + "sqrtf32" => f_host.sqrt(), + "expf32" => f_host.exp(), + "exp2f32" => f_host.exp2(), + "logf32" => f_host.ln(), + "log10f32" => f_host.log10(), + "log2f32" => f_host.log2(), + "floorf32" => f_host.floor(), + "ceilf32" => f_host.ceil(), + "truncf32" => f_host.trunc(), + "roundf32" => f_host.round(), + "rintf32" => f_host.round_ties_even(), _ => bug!(), }; - this.write_scalar(Scalar::from_u32(f.to_bits()), dest)?; + let res = res.to_soft(); + let res = this.adjust_nan(res, &[f]); + this.write_scalar(res, dest)?; } #[rustfmt::skip] @@ -207,25 +212,28 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { | "rintf64" => { let [f] = check_arg_count(args)?; + let f = this.read_scalar(f)?.to_f64()?; // FIXME: Using host floats. - let f = f64::from_bits(this.read_scalar(f)?.to_u64()?); - let f = match intrinsic_name { - "sinf64" => f.sin(), - "cosf64" => f.cos(), - "sqrtf64" => f.sqrt(), - "expf64" => f.exp(), - "exp2f64" => f.exp2(), - "logf64" => f.ln(), - "log10f64" => f.log10(), - "log2f64" => f.log2(), - "floorf64" => f.floor(), - "ceilf64" => f.ceil(), - "truncf64" => f.trunc(), - "roundf64" => f.round(), - "rintf64" => f.round_ties_even(), + let f_host = f.to_host(); + let res = match intrinsic_name { + "sinf64" => f_host.sin(), + "cosf64" => f_host.cos(), + "sqrtf64" => f_host.sqrt(), + "expf64" => f_host.exp(), + "exp2f64" => f_host.exp2(), + "logf64" => f_host.ln(), + "log10f64" => f_host.log10(), + "log2f64" => f_host.log2(), + "floorf64" => f_host.floor(), + "ceilf64" => f_host.ceil(), + "truncf64" => f_host.trunc(), + "roundf64" => f_host.round(), + "rintf64" => f_host.round_ties_even(), _ => bug!(), }; - this.write_scalar(Scalar::from_u64(f.to_bits()), dest)?; + let res = res.to_soft(); + let res = this.adjust_nan(res, &[f]); + this.write_scalar(res, dest)?; } #[rustfmt::skip] @@ -268,7 +276,13 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { ), _ => {} } - this.binop_ignore_overflow(op, &a, &b, dest)?; + let res = this.wrapping_binary_op(op, &a, &b)?; + if !float_finite(&res)? { + throw_ub_format!("`{intrinsic_name}` intrinsic produced non-finite value as result"); + } + // This cannot be a NaN so we also don't have to apply any non-determinism. + // (Also, `wrapping_binary_op` already called `generate_nan` if needed.) + this.write_immediate(*res, dest)?; } #[rustfmt::skip] @@ -280,9 +294,9 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let a = this.read_scalar(a)?.to_f32()?; let b = this.read_scalar(b)?.to_f32()?; let res = match intrinsic_name { - "minnumf32" => a.min(b), - "maxnumf32" => a.max(b), - "copysignf32" => a.copy_sign(b), + "minnumf32" => this.adjust_nan(a.min(b), &[a, b]), + "maxnumf32" => this.adjust_nan(a.max(b), &[a, b]), + "copysignf32" => a.copy_sign(b), // bitwise, no NaN adjustments _ => bug!(), }; this.write_scalar(Scalar::from_f32(res), dest)?; @@ -297,68 +311,74 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let a = this.read_scalar(a)?.to_f64()?; let b = this.read_scalar(b)?.to_f64()?; let res = match intrinsic_name { - "minnumf64" => a.min(b), - "maxnumf64" => a.max(b), - "copysignf64" => a.copy_sign(b), + "minnumf64" => this.adjust_nan(a.min(b), &[a, b]), + "maxnumf64" => this.adjust_nan(a.max(b), &[a, b]), + "copysignf64" => a.copy_sign(b), // bitwise, no NaN adjustments _ => bug!(), }; this.write_scalar(Scalar::from_f64(res), dest)?; } - "powf32" => { - let [f, f2] = check_arg_count(args)?; - // FIXME: Using host floats. - let f = f32::from_bits(this.read_scalar(f)?.to_u32()?); - let f2 = f32::from_bits(this.read_scalar(f2)?.to_u32()?); - let res = f.powf(f2); - this.write_scalar(Scalar::from_u32(res.to_bits()), dest)?; - } - - "powf64" => { - let [f, f2] = check_arg_count(args)?; - // FIXME: Using host floats. - let f = f64::from_bits(this.read_scalar(f)?.to_u64()?); - let f2 = f64::from_bits(this.read_scalar(f2)?.to_u64()?); - let res = f.powf(f2); - this.write_scalar(Scalar::from_u64(res.to_bits()), dest)?; - } - "fmaf32" => { let [a, b, c] = check_arg_count(args)?; + let a = this.read_scalar(a)?.to_f32()?; + let b = this.read_scalar(b)?.to_f32()?; + let c = this.read_scalar(c)?.to_f32()?; // FIXME: Using host floats, to work around https://github.com/rust-lang/rustc_apfloat/issues/11 - let a = f32::from_bits(this.read_scalar(a)?.to_u32()?); - let b = f32::from_bits(this.read_scalar(b)?.to_u32()?); - let c = f32::from_bits(this.read_scalar(c)?.to_u32()?); - let res = a.mul_add(b, c); - this.write_scalar(Scalar::from_u32(res.to_bits()), dest)?; + let res = a.to_host().mul_add(b.to_host(), c.to_host()).to_soft(); + let res = this.adjust_nan(res, &[a, b, c]); + this.write_scalar(res, dest)?; } "fmaf64" => { let [a, b, c] = check_arg_count(args)?; + let a = this.read_scalar(a)?.to_f64()?; + let b = this.read_scalar(b)?.to_f64()?; + let c = this.read_scalar(c)?.to_f64()?; // FIXME: Using host floats, to work around https://github.com/rust-lang/rustc_apfloat/issues/11 - let a = f64::from_bits(this.read_scalar(a)?.to_u64()?); - let b = f64::from_bits(this.read_scalar(b)?.to_u64()?); - let c = f64::from_bits(this.read_scalar(c)?.to_u64()?); - let res = a.mul_add(b, c); - this.write_scalar(Scalar::from_u64(res.to_bits()), dest)?; + let res = a.to_host().mul_add(b.to_host(), c.to_host()).to_soft(); + let res = this.adjust_nan(res, &[a, b, c]); + this.write_scalar(res, dest)?; + } + + "powf32" => { + let [f1, f2] = check_arg_count(args)?; + let f1 = this.read_scalar(f1)?.to_f32()?; + let f2 = this.read_scalar(f2)?.to_f32()?; + // FIXME: Using host floats. + let res = f1.to_host().powf(f2.to_host()).to_soft(); + let res = this.adjust_nan(res, &[f1, f2]); + this.write_scalar(res, dest)?; + } + + "powf64" => { + let [f1, f2] = check_arg_count(args)?; + let f1 = this.read_scalar(f1)?.to_f64()?; + let f2 = this.read_scalar(f2)?.to_f64()?; + // FIXME: Using host floats. + let res = f1.to_host().powf(f2.to_host()).to_soft(); + let res = this.adjust_nan(res, &[f1, f2]); + this.write_scalar(res, dest)?; } "powif32" => { let [f, i] = check_arg_count(args)?; - // FIXME: Using host floats. - let f = f32::from_bits(this.read_scalar(f)?.to_u32()?); + let f = this.read_scalar(f)?.to_f32()?; let i = this.read_scalar(i)?.to_i32()?; - let res = f.powi(i); - this.write_scalar(Scalar::from_u32(res.to_bits()), dest)?; + // FIXME: Using host floats. + let res = f.to_host().powi(i).to_soft(); + let res = this.adjust_nan(res, &[f]); + this.write_scalar(res, dest)?; } "powif64" => { let [f, i] = check_arg_count(args)?; - // FIXME: Using host floats. - let f = f64::from_bits(this.read_scalar(f)?.to_u64()?); + let f = this.read_scalar(f)?.to_f64()?; let i = this.read_scalar(i)?.to_i32()?; - let res = f.powi(i); - this.write_scalar(Scalar::from_u64(res.to_bits()), dest)?; + // FIXME: Using host floats. + let res = f.to_host().powi(i).to_soft(); + let res = this.adjust_nan(res, &[f]); + this.write_scalar(res, dest)?; } "float_to_int_unchecked" => { diff --git a/src/tools/miri/src/shims/intrinsics/simd.rs b/src/tools/miri/src/shims/intrinsics/simd.rs index 2c8493d8aad..ea2d104694a 100644 --- a/src/tools/miri/src/shims/intrinsics/simd.rs +++ b/src/tools/miri/src/shims/intrinsics/simd.rs @@ -4,11 +4,15 @@ use rustc_middle::{mir, ty, ty::FloatTy}; use rustc_span::{sym, Symbol}; use rustc_target::abi::{Endian, HasDataLayout}; -use crate::helpers::{ - bool_to_simd_element, check_arg_count, round_to_next_multiple_of, simd_element_to_bool, -}; +use crate::helpers::{bool_to_simd_element, check_arg_count, simd_element_to_bool, ToHost, ToSoft}; use crate::*; +#[derive(Copy, Clone)] +pub(crate) enum MinMax { + Min, + Max, +} + impl<'mir, 'tcx: 'mir> EvalContextExt<'mir, 'tcx> for crate::MiriInterpCx<'mir, 'tcx> {} pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { /// Calls the simd intrinsic `intrinsic`; the `simd_` prefix has already been removed. @@ -67,13 +71,17 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let op = this.read_immediate(&this.project_index(&op, i)?)?; let dest = this.project_index(&dest, i)?; let val = match which { - Op::MirOp(mir_op) => this.wrapping_unary_op(mir_op, &op)?.to_scalar(), + Op::MirOp(mir_op) => { + // This already does NaN adjustments + this.wrapping_unary_op(mir_op, &op)?.to_scalar() + } Op::Abs => { // Works for f32 and f64. let ty::Float(float_ty) = op.layout.ty.kind() else { span_bug!(this.cur_span(), "{} operand is not a float", intrinsic_name) }; let op = op.to_scalar(); + // "Bitwise" operation, no NaN adjustments match float_ty { FloatTy::F32 => Scalar::from_f32(op.to_f32()?.abs()), FloatTy::F64 => Scalar::from_f64(op.to_f64()?.abs()), @@ -86,14 +94,16 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { // FIXME using host floats match float_ty { FloatTy::F32 => { - let f = f32::from_bits(op.to_scalar().to_u32()?); - let res = f.sqrt(); - Scalar::from_u32(res.to_bits()) + let f = op.to_scalar().to_f32()?; + let res = f.to_host().sqrt().to_soft(); + let res = this.adjust_nan(res, &[f]); + Scalar::from(res) } FloatTy::F64 => { - let f = f64::from_bits(op.to_scalar().to_u64()?); - let res = f.sqrt(); - Scalar::from_u64(res.to_bits()) + let f = op.to_scalar().to_f64()?; + let res = f.to_host().sqrt().to_soft(); + let res = this.adjust_nan(res, &[f]); + Scalar::from(res) } } } @@ -105,11 +115,13 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { FloatTy::F32 => { let f = op.to_scalar().to_f32()?; let res = f.round_to_integral(rounding).value; + let res = this.adjust_nan(res, &[f]); Scalar::from_f32(res) } FloatTy::F64 => { let f = op.to_scalar().to_f64()?; let res = f.round_to_integral(rounding).value; + let res = this.adjust_nan(res, &[f]); Scalar::from_f64(res) } } @@ -157,8 +169,7 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { enum Op { MirOp(BinOp), SaturatingOp(BinOp), - FMax, - FMin, + FMinMax(MinMax), WrappingOffset, } let which = match intrinsic_name { @@ -178,8 +189,8 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { "le" => Op::MirOp(BinOp::Le), "gt" => Op::MirOp(BinOp::Gt), "ge" => Op::MirOp(BinOp::Ge), - "fmax" => Op::FMax, - "fmin" => Op::FMin, + "fmax" => Op::FMinMax(MinMax::Max), + "fmin" => Op::FMinMax(MinMax::Min), "saturating_add" => Op::SaturatingOp(BinOp::Add), "saturating_sub" => Op::SaturatingOp(BinOp::Sub), "arith_offset" => Op::WrappingOffset, @@ -192,6 +203,7 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let dest = this.project_index(&dest, i)?; let val = match which { Op::MirOp(mir_op) => { + // This does NaN adjustments. let (val, overflowed) = this.overflowing_binary_op(mir_op, &left, &right)?; if matches!(mir_op, BinOp::Shl | BinOp::Shr) { // Shifts have extra UB as SIMD operations that the MIR binop does not have. @@ -225,11 +237,8 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let offset_ptr = ptr.wrapping_signed_offset(offset_bytes, this); Scalar::from_maybe_pointer(offset_ptr, this) } - Op::FMax => { - fmax_op(&left, &right)? - } - Op::FMin => { - fmin_op(&left, &right)? + Op::FMinMax(op) => { + this.fminmax_op(op, &left, &right)? } }; this.write_scalar(val, &dest)?; @@ -259,18 +268,20 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { }; let val = match float_ty { FloatTy::F32 => { - let a = f32::from_bits(a.to_u32()?); - let b = f32::from_bits(b.to_u32()?); - let c = f32::from_bits(c.to_u32()?); - let res = a.mul_add(b, c); - Scalar::from_u32(res.to_bits()) + let a = a.to_f32()?; + let b = b.to_f32()?; + let c = c.to_f32()?; + let res = a.to_host().mul_add(b.to_host(), c.to_host()).to_soft(); + let res = this.adjust_nan(res, &[a, b, c]); + Scalar::from(res) } FloatTy::F64 => { - let a = f64::from_bits(a.to_u64()?); - let b = f64::from_bits(b.to_u64()?); - let c = f64::from_bits(c.to_u64()?); - let res = a.mul_add(b, c); - Scalar::from_u64(res.to_bits()) + let a = a.to_f64()?; + let b = b.to_f64()?; + let c = c.to_f64()?; + let res = a.to_host().mul_add(b.to_host(), c.to_host()).to_soft(); + let res = this.adjust_nan(res, &[a, b, c]); + Scalar::from(res) } }; this.write_scalar(val, &dest)?; @@ -295,8 +306,7 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { enum Op { MirOp(BinOp), MirOpBool(BinOp), - Max, - Min, + MinMax(MinMax), } let which = match intrinsic_name { "reduce_and" => Op::MirOp(BinOp::BitAnd), @@ -304,8 +314,8 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { "reduce_xor" => Op::MirOp(BinOp::BitXor), "reduce_any" => Op::MirOpBool(BinOp::BitOr), "reduce_all" => Op::MirOpBool(BinOp::BitAnd), - "reduce_max" => Op::Max, - "reduce_min" => Op::Min, + "reduce_max" => Op::MinMax(MinMax::Max), + "reduce_min" => Op::MinMax(MinMax::Min), _ => unreachable!(), }; @@ -325,24 +335,16 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let op = imm_from_bool(simd_element_to_bool(op)?); this.wrapping_binary_op(mir_op, &res, &op)? } - Op::Max => { - if matches!(res.layout.ty.kind(), ty::Float(_)) { - ImmTy::from_scalar(fmax_op(&res, &op)?, res.layout) - } else { - // Just boring integers, so NaNs to worry about - if this.wrapping_binary_op(BinOp::Ge, &res, &op)?.to_scalar().to_bool()? { - res - } else { - op - } - } - } - Op::Min => { + Op::MinMax(mmop) => { if matches!(res.layout.ty.kind(), ty::Float(_)) { - ImmTy::from_scalar(fmin_op(&res, &op)?, res.layout) + ImmTy::from_scalar(this.fminmax_op(mmop, &res, &op)?, res.layout) } else { // Just boring integers, so NaNs to worry about - if this.wrapping_binary_op(BinOp::Le, &res, &op)?.to_scalar().to_bool()? { + let mirop = match mmop { + MinMax::Min => BinOp::Le, + MinMax::Max => BinOp::Ge, + }; + if this.wrapping_binary_op(mirop, &res, &op)?.to_scalar().to_bool()? { res } else { op @@ -402,7 +404,7 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { let (yes, yes_len) = this.operand_to_simd(yes)?; let (no, no_len) = this.operand_to_simd(no)?; let (dest, dest_len) = this.place_to_simd(dest)?; - let bitmask_len = round_to_next_multiple_of(dest_len, 8); + let bitmask_len = dest_len.next_multiple_of(8); // The mask must be an integer or an array. assert!( @@ -448,7 +450,7 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { "bitmask" => { let [op] = check_arg_count(args)?; let (op, op_len) = this.operand_to_simd(op)?; - let bitmask_len = round_to_next_multiple_of(op_len, 8); + let bitmask_len = op_len.next_multiple_of(8); // Returns either an unsigned integer or array of `u8`. assert!( @@ -709,6 +711,43 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { } Ok(()) } + + fn fminmax_op( + &self, + op: MinMax, + left: &ImmTy<'tcx, Provenance>, + right: &ImmTy<'tcx, Provenance>, + ) -> InterpResult<'tcx, Scalar<Provenance>> { + let this = self.eval_context_ref(); + assert_eq!(left.layout.ty, right.layout.ty); + let ty::Float(float_ty) = left.layout.ty.kind() else { + bug!("fmax operand is not a float") + }; + let left = left.to_scalar(); + let right = right.to_scalar(); + Ok(match float_ty { + FloatTy::F32 => { + let left = left.to_f32()?; + let right = right.to_f32()?; + let res = match op { + MinMax::Min => left.min(right), + MinMax::Max => left.max(right), + }; + let res = this.adjust_nan(res, &[left, right]); + Scalar::from_f32(res) + } + FloatTy::F64 => { + let left = left.to_f64()?; + let right = right.to_f64()?; + let res = match op { + MinMax::Min => left.min(right), + MinMax::Max => left.max(right), + }; + let res = this.adjust_nan(res, &[left, right]); + Scalar::from_f64(res) + } + }) + } } fn simd_bitmask_index(idx: u32, vec_len: u32, endianness: Endian) -> u32 { @@ -719,31 +758,3 @@ fn simd_bitmask_index(idx: u32, vec_len: u32, endianness: Endian) -> u32 { Endian::Big => vec_len - 1 - idx, // reverse order of bits } } - -fn fmax_op<'tcx>( - left: &ImmTy<'tcx, Provenance>, - right: &ImmTy<'tcx, Provenance>, -) -> InterpResult<'tcx, Scalar<Provenance>> { - assert_eq!(left.layout.ty, right.layout.ty); - let ty::Float(float_ty) = left.layout.ty.kind() else { bug!("fmax operand is not a float") }; - let left = left.to_scalar(); - let right = right.to_scalar(); - Ok(match float_ty { - FloatTy::F32 => Scalar::from_f32(left.to_f32()?.max(right.to_f32()?)), - FloatTy::F64 => Scalar::from_f64(left.to_f64()?.max(right.to_f64()?)), - }) -} - -fn fmin_op<'tcx>( - left: &ImmTy<'tcx, Provenance>, - right: &ImmTy<'tcx, Provenance>, -) -> InterpResult<'tcx, Scalar<Provenance>> { - assert_eq!(left.layout.ty, right.layout.ty); - let ty::Float(float_ty) = left.layout.ty.kind() else { bug!("fmin operand is not a float") }; - let left = left.to_scalar(); - let right = right.to_scalar(); - Ok(match float_ty { - FloatTy::F32 => Scalar::from_f32(left.to_f32()?.min(right.to_f32()?)), - FloatTy::F64 => Scalar::from_f64(left.to_f64()?.min(right.to_f64()?)), - }) -} diff --git a/src/tools/miri/src/shims/unix/fs.rs b/src/tools/miri/src/shims/unix/fs.rs index 1402f07dd38..99d8a3a2c91 100644 --- a/src/tools/miri/src/shims/unix/fs.rs +++ b/src/tools/miri/src/shims/unix/fs.rs @@ -559,8 +559,21 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { ); }; - if mode != 0o666 { - throw_unsup_format!("non-default mode 0o{:o} is not supported", mode); + #[cfg(unix)] + { + // Support all modes on UNIX host + use std::os::unix::fs::OpenOptionsExt; + options.mode(mode); + } + #[cfg(not(unix))] + { + // Only support default mode for non-UNIX (i.e. Windows) host + if mode != 0o666 { + throw_unsup_format!( + "non-default mode 0o{:o} is not supported on non-Unix hosts", + mode + ); + } } mirror |= o_creat; diff --git a/src/tools/miri/src/shims/unix/mem.rs b/src/tools/miri/src/shims/unix/mem.rs index 5aa514715bc..d7dc17fa89f 100644 --- a/src/tools/miri/src/shims/unix/mem.rs +++ b/src/tools/miri/src/shims/unix/mem.rs @@ -14,7 +14,7 @@ //! munmap shim which would partily unmap a region of address space previously mapped by mmap will //! report UB. -use crate::{helpers::round_to_next_multiple_of, *}; +use crate::*; use rustc_target::abi::Size; impl<'mir, 'tcx: 'mir> EvalContextExt<'mir, 'tcx> for crate::MiriInterpCx<'mir, 'tcx> {} @@ -96,7 +96,14 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { } let align = this.machine.page_align(); - let map_length = round_to_next_multiple_of(length, this.machine.page_size); + let Some(map_length) = length.checked_next_multiple_of(this.machine.page_size) else { + this.set_last_error(Scalar::from_i32(this.eval_libc_i32("EINVAL")))?; + return Ok(this.eval_libc("MAP_FAILED")); + }; + if map_length > this.target_usize_max() { + this.set_last_error(Scalar::from_i32(this.eval_libc_i32("EINVAL")))?; + return Ok(this.eval_libc("MAP_FAILED")); + } let ptr = this.allocate_ptr(Size::from_bytes(map_length), align, MiriMemoryKind::Mmap.into())?; @@ -129,7 +136,16 @@ pub trait EvalContextExt<'mir, 'tcx: 'mir>: crate::MiriInterpCxExt<'mir, 'tcx> { return Ok(Scalar::from_i32(-1)); } - let length = Size::from_bytes(round_to_next_multiple_of(length, this.machine.page_size)); + let Some(length) = length.checked_next_multiple_of(this.machine.page_size) else { + this.set_last_error(Scalar::from_i32(this.eval_libc_i32("EINVAL")))?; + return Ok(Scalar::from_i32(-1)); + }; + if length > this.target_usize_max() { + this.set_last_error(Scalar::from_i32(this.eval_libc_i32("EINVAL")))?; + return Ok(this.eval_libc("MAP_FAILED")); + } + + let length = Size::from_bytes(length); this.deallocate_ptr( addr, Some((length, this.machine.page_align())), diff --git a/src/tools/miri/test_dependencies/Cargo.lock b/src/tools/miri/test_dependencies/Cargo.lock index 8d18d8535d8..aa3b25e338a 100644 --- a/src/tools/miri/test_dependencies/Cargo.lock +++ b/src/tools/miri/test_dependencies/Cargo.lock @@ -45,6 +45,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "bef38d45163c2f1dde094a7dfd33ccf595c92905c8f8f4fdc18d06fb1037718a" [[package]] +name = "bitflags" +version = "2.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "327762f6e5a765692301e5bb513e0d9fef63be86bbc14528052b1cd3e6f03e07" + +[[package]] name = "bumpalo" version = "3.14.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -72,6 +78,22 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "baf1de4339761588bc0619e3cbc0120ee582ebb74b53b4efbf79117bd2da40fd" [[package]] +name = "errno" +version = "0.3.8" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a258e46cdc063eb8519c00b9fc845fc47bcfca4130e2f08e88665ceda8474245" +dependencies = [ + "libc", + "windows-sys 0.52.0", +] + +[[package]] +name = "fastrand" +version = "2.0.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "25cbce373ec4653f1a01a31e8a5e5ec0c622dc27ff9c4e6606eefef5cbbed4a5" + +[[package]] name = "getrandom" version = "0.1.16" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -123,6 +145,12 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9cdc71e17332e86d2e1d38c1f99edcb6288ee11b815fb1a4b049eaa2114d369b" [[package]] +name = "linux-raw-sys" +version = "0.4.12" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "c4cd1a83af159aa67994778be9070f0ae1bd732942279cabb14f86f986a21456" + +[[package]] name = "lock_api" version = "0.4.10" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -161,7 +189,7 @@ checksum = "927a765cd3fc26206e66b296465fa9d3e5ab003e651c1b3c060e7956d96b19d2" dependencies = [ "libc", "wasi 0.11.0+wasi-snapshot-preview1", - "windows-sys", + "windows-sys 0.48.0", ] [[package]] @@ -174,7 +202,9 @@ dependencies = [ "num_cpus", "page_size", "rand", + "tempfile", "tokio", + "windows-sys 0.52.0", ] [[package]] @@ -230,9 +260,9 @@ checksum = "93f00c865fe7cabf650081affecd3871070f26767e7b2070a3ffae14c654b447" dependencies = [ "cfg-if", "libc", - "redox_syscall", + "redox_syscall 0.3.5", "smallvec", - "windows-targets", + "windows-targets 0.48.5", ] [[package]] @@ -301,7 +331,16 @@ version = "0.3.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "567664f262709473930a4bf9e51bf2ebf3348f2e748ccc50dea20646858f8f29" dependencies = [ - "bitflags", + "bitflags 1.3.2", +] + +[[package]] +name = "redox_syscall" +version = "0.4.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "4722d768eff46b75989dd134e5c353f0d6296e5aaa3132e776cbdb56be7731aa" +dependencies = [ + "bitflags 1.3.2", ] [[package]] @@ -311,6 +350,19 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "d626bb9dae77e28219937af045c257c28bfd3f69333c512553507f5f9798cb76" [[package]] +name = "rustix" +version = "0.38.21" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "2b426b0506e5d50a7d8dafcf2e81471400deb602392c7dd110815afb4eaf02a3" +dependencies = [ + "bitflags 2.4.1", + "errno", + "libc", + "linux-raw-sys", + "windows-sys 0.48.0", +] + +[[package]] name = "scopeguard" version = "1.2.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -338,7 +390,7 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "4031e820eb552adee9295814c0ced9e5cf38ddf1e8b7d566d6de8e2538ea989e" dependencies = [ "libc", - "windows-sys", + "windows-sys 0.48.0", ] [[package]] @@ -353,6 +405,19 @@ dependencies = [ ] [[package]] +name = "tempfile" +version = "3.8.1" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "7ef1adac450ad7f4b3c28589471ade84f25f731a7a0fe30d71dfa9f60fd808e5" +dependencies = [ + "cfg-if", + "fastrand", + "redox_syscall 0.4.1", + "rustix", + "windows-sys 0.48.0", +] + +[[package]] name = "tokio" version = "1.32.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -368,7 +433,7 @@ dependencies = [ "signal-hook-registry", "socket2", "tokio-macros", - "windows-sys", + "windows-sys 0.48.0", ] [[package]] @@ -482,7 +547,16 @@ version = "0.48.0" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "677d2418bec65e3338edb076e806bc1ec15693c5d0104683f2efe857f61056a9" dependencies = [ - "windows-targets", + "windows-targets 0.48.5", +] + +[[package]] +name = "windows-sys" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "282be5f36a8ce781fad8c8ae18fa3f9beff57ec1b52cb3de0789201425d9a33d" +dependencies = [ + "windows-targets 0.52.0", ] [[package]] @@ -491,13 +565,28 @@ version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "9a2fa6e2155d7247be68c096456083145c183cbbbc2764150dda45a87197940c" dependencies = [ - "windows_aarch64_gnullvm", - "windows_aarch64_msvc", - "windows_i686_gnu", - "windows_i686_msvc", - "windows_x86_64_gnu", - "windows_x86_64_gnullvm", - "windows_x86_64_msvc", + "windows_aarch64_gnullvm 0.48.5", + "windows_aarch64_msvc 0.48.5", + "windows_i686_gnu 0.48.5", + "windows_i686_msvc 0.48.5", + "windows_x86_64_gnu 0.48.5", + "windows_x86_64_gnullvm 0.48.5", + "windows_x86_64_msvc 0.48.5", +] + +[[package]] +name = "windows-targets" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "8a18201040b24831fbb9e4eb208f8892e1f50a37feb53cc7ff887feb8f50e7cd" +dependencies = [ + "windows_aarch64_gnullvm 0.52.0", + "windows_aarch64_msvc 0.52.0", + "windows_i686_gnu 0.52.0", + "windows_i686_msvc 0.52.0", + "windows_x86_64_gnu 0.52.0", + "windows_x86_64_gnullvm 0.52.0", + "windows_x86_64_msvc 0.52.0", ] [[package]] @@ -507,37 +596,79 @@ source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "2b38e32f0abccf9987a4e3079dfb67dcd799fb61361e53e2882c3cbaf0d905d8" [[package]] +name = "windows_aarch64_gnullvm" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "cb7764e35d4db8a7921e09562a0304bf2f93e0a51bfccee0bd0bb0b666b015ea" + +[[package]] name = "windows_aarch64_msvc" version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "dc35310971f3b2dbbf3f0690a219f40e2d9afcf64f9ab7cc1be722937c26b4bc" [[package]] +name = "windows_aarch64_msvc" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "bbaa0368d4f1d2aaefc55b6fcfee13f41544ddf36801e793edbbfd7d7df075ef" + +[[package]] name = "windows_i686_gnu" version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "a75915e7def60c94dcef72200b9a8e58e5091744960da64ec734a6c6e9b3743e" [[package]] +name = "windows_i686_gnu" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "a28637cb1fa3560a16915793afb20081aba2c92ee8af57b4d5f28e4b3e7df313" + +[[package]] name = "windows_i686_msvc" version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "8f55c233f70c4b27f66c523580f78f1004e8b5a8b659e05a4eb49d4166cca406" [[package]] +name = "windows_i686_msvc" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "ffe5e8e31046ce6230cc7215707b816e339ff4d4d67c65dffa206fd0f7aa7b9a" + +[[package]] name = "windows_x86_64_gnu" version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "53d40abd2583d23e4718fddf1ebec84dbff8381c07cae67ff7768bbf19c6718e" [[package]] +name = "windows_x86_64_gnu" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "3d6fa32db2bc4a2f5abeacf2b69f7992cd09dca97498da74a151a3132c26befd" + +[[package]] name = "windows_x86_64_gnullvm" version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "0b7b52767868a23d5bab768e390dc5f5c55825b6d30b86c844ff2dc7414044cc" [[package]] +name = "windows_x86_64_gnullvm" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "1a657e1e9d3f514745a572a6846d3c7aa7dbe1658c056ed9c3344c4109a6949e" + +[[package]] name = "windows_x86_64_msvc" version = "0.48.5" source = "registry+https://github.com/rust-lang/crates.io-index" checksum = "ed94fce61571a4006852b7389a063ab983c02eb1bb37b47f8272ce92d06d9538" + +[[package]] +name = "windows_x86_64_msvc" +version = "0.52.0" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "dff9641d1cd4be8d1a070daf9e3773c5f67e78b4d9d42263020c057706765c04" diff --git a/src/tools/miri/test_dependencies/Cargo.toml b/src/tools/miri/test_dependencies/Cargo.toml index d54560608dc..9f28e4d169f 100644 --- a/src/tools/miri/test_dependencies/Cargo.toml +++ b/src/tools/miri/test_dependencies/Cargo.toml @@ -11,6 +11,7 @@ edition = "2021" # all dependencies (and their transitive ones) listed here can be used in `tests/`. libc = "0.2" num_cpus = "1.10.1" +tempfile = "3" getrandom_01 = { package = "getrandom", version = "0.1" } getrandom_02 = { package = "getrandom", version = "0.2", features = ["js"] } @@ -20,4 +21,7 @@ rand = { version = "0.8", features = ["small_rng"] } page_size = "0.6" tokio = { version = "1.24", features = ["full"] } +[target.'cfg(windows)'.dependencies] +windows-sys = { version = "0.52", features = [ "Win32_Foundation", "Win32_System_Threading" ] } + [workspace] diff --git a/src/tools/miri/tests/compiletest.rs b/src/tools/miri/tests/compiletest.rs index 3394c4a49f8..074808b1122 100644 --- a/src/tools/miri/tests/compiletest.rs +++ b/src/tools/miri/tests/compiletest.rs @@ -111,6 +111,8 @@ fn test_config(target: &str, path: &str, mode: Mode, with_dependencies: bool) -> "run".into(), // There is no `cargo miri build` so we just use `cargo miri run`. ]); config.dependency_builder.args = builder_args.into_iter().map(Into::into).collect(); + // Reset `RUSTFLAGS` to work around <https://github.com/rust-lang/rust/pull/119574#issuecomment-1876878344>. + config.dependency_builder.envs.push(("RUSTFLAGS".into(), None)); } config } diff --git a/src/tools/miri/tests/fail/concurrency/windows_join_detached.rs b/src/tools/miri/tests/fail-dep/concurrency/windows_join_detached.rs index b68a07797f8..0e9eb24459c 100644 --- a/src/tools/miri/tests/fail/concurrency/windows_join_detached.rs +++ b/src/tools/miri/tests/fail-dep/concurrency/windows_join_detached.rs @@ -3,18 +3,16 @@ // Joining a detached thread is undefined behavior. -use std::os::windows::io::{AsRawHandle, RawHandle}; +use std::os::windows::io::AsRawHandle; use std::thread; -extern "system" { - fn CloseHandle(handle: RawHandle) -> u32; -} +use windows_sys::Win32::Foundation::{CloseHandle, HANDLE}; fn main() { let thread = thread::spawn(|| ()); unsafe { - assert_ne!(CloseHandle(thread.as_raw_handle()), 0); + assert_ne!(CloseHandle(thread.as_raw_handle() as HANDLE), 0); } thread.join().unwrap(); diff --git a/src/tools/miri/tests/fail/concurrency/windows_join_detached.stderr b/src/tools/miri/tests/fail-dep/concurrency/windows_join_detached.stderr index 651c2eba0d9..651c2eba0d9 100644 --- a/src/tools/miri/tests/fail/concurrency/windows_join_detached.stderr +++ b/src/tools/miri/tests/fail-dep/concurrency/windows_join_detached.stderr diff --git a/src/tools/miri/tests/fail/concurrency/windows_join_main.rs b/src/tools/miri/tests/fail-dep/concurrency/windows_join_main.rs index cde6d19ef25..910e06222ee 100644 --- a/src/tools/miri/tests/fail/concurrency/windows_join_main.rs +++ b/src/tools/miri/tests/fail-dep/concurrency/windows_join_main.rs @@ -6,21 +6,18 @@ use std::thread; -extern "system" { - fn WaitForSingleObject(handle: isize, timeout: u32) -> u32; -} - -const INFINITE: u32 = u32::MAX; +use windows_sys::Win32::Foundation::{HANDLE, WAIT_OBJECT_0}; +use windows_sys::Win32::System::Threading::{WaitForSingleObject, INFINITE}; // XXX HACK: This is how miri represents the handle for thread 0. // This value can be "legitimately" obtained by using `GetCurrentThread` with `DuplicateHandle` // but miri does not implement `DuplicateHandle` yet. -const MAIN_THREAD: isize = (2i32 << 30) as isize; +const MAIN_THREAD: HANDLE = (2i32 << 30) as HANDLE; fn main() { thread::spawn(|| { unsafe { - assert_eq!(WaitForSingleObject(MAIN_THREAD, INFINITE), 0); //~ ERROR: deadlock: the evaluated program deadlocked + assert_eq!(WaitForSingleObject(MAIN_THREAD, INFINITE), WAIT_OBJECT_0); //~ ERROR: deadlock: the evaluated program deadlocked } }) .join() diff --git a/src/tools/miri/tests/fail/concurrency/windows_join_main.stderr b/src/tools/miri/tests/fail-dep/concurrency/windows_join_main.stderr index 94fe95a0bdf..cb51c7e0bd9 100644 --- a/src/tools/miri/tests/fail/concurrency/windows_join_main.stderr +++ b/src/tools/miri/tests/fail-dep/concurrency/windows_join_main.stderr @@ -1,8 +1,8 @@ error: deadlock: the evaluated program deadlocked --> $DIR/windows_join_main.rs:LL:CC | -LL | assert_eq!(WaitForSingleObject(MAIN_THREAD, INFINITE), 0); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ the evaluated program deadlocked +LL | assert_eq!(WaitForSingleObject(MAIN_THREAD, INFINITE), WAIT_OBJECT_0); + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ the evaluated program deadlocked | = note: inside closure at RUSTLIB/core/src/macros/mod.rs:LL:CC = note: this error originates in the macro `assert_eq` (in Nightly builds, run with -Z macro-backtrace for more info) diff --git a/src/tools/miri/tests/fail/concurrency/windows_join_self.rs b/src/tools/miri/tests/fail-dep/concurrency/windows_join_self.rs index d9bbf66a7dc..a7c8faf5a98 100644 --- a/src/tools/miri/tests/fail/concurrency/windows_join_self.rs +++ b/src/tools/miri/tests/fail-dep/concurrency/windows_join_self.rs @@ -6,18 +6,14 @@ use std::thread; -extern "system" { - fn GetCurrentThread() -> usize; - fn WaitForSingleObject(handle: usize, timeout: u32) -> u32; -} - -const INFINITE: u32 = u32::MAX; +use windows_sys::Win32::Foundation::WAIT_OBJECT_0; +use windows_sys::Win32::System::Threading::{GetCurrentThread, WaitForSingleObject, INFINITE}; fn main() { thread::spawn(|| { unsafe { let native = GetCurrentThread(); - assert_eq!(WaitForSingleObject(native, INFINITE), 0); //~ ERROR: deadlock: the evaluated program deadlocked + assert_eq!(WaitForSingleObject(native, INFINITE), WAIT_OBJECT_0); //~ ERROR: deadlock: the evaluated program deadlocked } }) .join() diff --git a/src/tools/miri/tests/fail/concurrency/windows_join_self.stderr b/src/tools/miri/tests/fail-dep/concurrency/windows_join_self.stderr index 0d2a22677c7..8b76e124215 100644 --- a/src/tools/miri/tests/fail/concurrency/windows_join_self.stderr +++ b/src/tools/miri/tests/fail-dep/concurrency/windows_join_self.stderr @@ -1,7 +1,7 @@ error: deadlock: the evaluated program deadlocked --> $DIR/windows_join_self.rs:LL:CC | -LL | assert_eq!(WaitForSingleObject(native, INFINITE), 0); +LL | assert_eq!(WaitForSingleObject(native, INFINITE), WAIT_OBJECT_0); | ^ the evaluated program deadlocked | = note: inside closure at $DIR/windows_join_self.rs:LL:CC diff --git a/src/tools/miri/tests/fail/both_borrows/newtype_pair_retagging.rs b/src/tools/miri/tests/fail/both_borrows/newtype_pair_retagging.rs index 98dbef6a996..57a7d2f9e7b 100644 --- a/src/tools/miri/tests/fail/both_borrows/newtype_pair_retagging.rs +++ b/src/tools/miri/tests/fail/both_borrows/newtype_pair_retagging.rs @@ -3,7 +3,7 @@ //@[stack]error-in-other-file: which is strongly protected //@[tree]error-in-other-file: /deallocation through .* is forbidden/ -struct Newtype<'a>(&'a mut i32, i32); +struct Newtype<'a>(#[allow(dead_code)] &'a mut i32, #[allow(dead_code)] i32); fn dealloc_while_running(_n: Newtype<'_>, dealloc: impl FnOnce()) { dealloc(); diff --git a/src/tools/miri/tests/fail/both_borrows/newtype_retagging.rs b/src/tools/miri/tests/fail/both_borrows/newtype_retagging.rs index e280050cdad..746d04d1af1 100644 --- a/src/tools/miri/tests/fail/both_borrows/newtype_retagging.rs +++ b/src/tools/miri/tests/fail/both_borrows/newtype_retagging.rs @@ -4,7 +4,7 @@ //@[stack]error-in-other-file: which is strongly protected //@[tree]error-in-other-file: /deallocation through .* is forbidden/ -struct Newtype<'a>(&'a mut i32); +struct Newtype<'a>(#[allow(dead_code)] &'a mut i32); fn dealloc_while_running(_n: Newtype<'_>, dealloc: impl FnOnce()) { dealloc(); diff --git a/src/tools/miri/tests/fail/concurrency/read_only_atomic_load_large.rs b/src/tools/miri/tests/fail/concurrency/read_only_atomic_load_large.rs index a9a8f0f5ddd..2d1cb04907c 100644 --- a/src/tools/miri/tests/fail/concurrency/read_only_atomic_load_large.rs +++ b/src/tools/miri/tests/fail/concurrency/read_only_atomic_load_large.rs @@ -6,7 +6,7 @@ use std::sync::atomic::{AtomicI64, Ordering}; #[repr(align(8))] -struct AlignedI64(i64); +struct AlignedI64(#[allow(dead_code)] i64); fn main() { static X: AlignedI64 = AlignedI64(0); diff --git a/src/tools/miri/tests/fail/dangling_pointers/dyn_size.rs b/src/tools/miri/tests/fail/dangling_pointers/dyn_size.rs index fa01bbc19c9..0ed7b91997c 100644 --- a/src/tools/miri/tests/fail/dangling_pointers/dyn_size.rs +++ b/src/tools/miri/tests/fail/dangling_pointers/dyn_size.rs @@ -1,7 +1,7 @@ // should find the bug even without retagging //@compile-flags: -Zmiri-disable-stacked-borrows -struct SliceWithHead(u8, [u8]); +struct SliceWithHead(#[allow(dead_code)] u8, #[allow(dead_code)] [u8]); fn main() { let buf = [0u32; 1]; diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.rs b/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.rs index e79bd70e915..8a5c10913b4 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.rs +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.rs @@ -14,7 +14,7 @@ fn main() { let ptr = std::ptr::addr_of_mut!(non_copy); // Inside `callee`, the first argument and `*ptr` are basically // aliasing places! - Call(_unit = callee(Move(*ptr), ptr), after_call, UnwindContinue()) + Call(_unit = callee(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) } after_call = { Return() diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.stack.stderr b/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.stack.stderr index 1756123c84e..422dc243436 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.stack.stderr +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.stack.stderr @@ -27,8 +27,8 @@ LL | unsafe { ptr.write(S(0)) }; note: inside `main` --> $DIR/arg_inplace_mutate.rs:LL:CC | -LL | Call(_unit = callee(Move(*ptr), ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_unit = callee(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.tree.stderr b/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.tree.stderr index 76f7ee189e3..4fe9b7b4728 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.tree.stderr +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_mutate.tree.stderr @@ -35,8 +35,8 @@ LL | unsafe { ptr.write(S(0)) }; note: inside `main` --> $DIR/arg_inplace_mutate.rs:LL:CC | -LL | Call(_unit = callee(Move(*ptr), ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_unit = callee(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_after.rs b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_after.rs index e4c00fdd845..18daf9497a1 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_after.rs +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_after.rs @@ -11,7 +11,7 @@ fn main() { { let non_copy = S(42); // This could change `non_copy` in-place - Call(_unit = change_arg(Move(non_copy)), after_call, UnwindContinue()) + Call(_unit = change_arg(Move(non_copy)), ReturnTo(after_call), UnwindContinue()) } after_call = { // So now we must not be allowed to observe non-copy again. diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.none.stderr b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.none.stderr index 723ca75daef..1c73577f5cd 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.none.stderr +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.none.stderr @@ -11,8 +11,8 @@ LL | unsafe { ptr.read() }; note: inside `main` --> $DIR/arg_inplace_observe_during.rs:LL:CC | -LL | Call(_unit = change_arg(Move(*ptr), ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_unit = change_arg(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.rs b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.rs index 517abd733a9..2201bf17bfc 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.rs +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.rs @@ -14,7 +14,7 @@ fn main() { let non_copy = S(42); let ptr = std::ptr::addr_of_mut!(non_copy); // This could change `non_copy` in-place - Call(_unit = change_arg(Move(*ptr), ptr), after_call, UnwindContinue()) + Call(_unit = change_arg(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) } after_call = { Return() diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.stack.stderr b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.stack.stderr index 401e8c6d5a8..09c9a777eca 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.stack.stderr +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.stack.stderr @@ -27,8 +27,8 @@ LL | x.0 = 0; note: inside `main` --> $DIR/arg_inplace_observe_during.rs:LL:CC | -LL | Call(_unit = change_arg(Move(*ptr), ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_unit = change_arg(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.tree.stderr b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.tree.stderr index 3529ddd3c53..67906f24bbd 100644 --- a/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.tree.stderr +++ b/src/tools/miri/tests/fail/function_calls/arg_inplace_observe_during.tree.stderr @@ -35,8 +35,8 @@ LL | x.0 = 0; note: inside `main` --> $DIR/arg_inplace_observe_during.rs:LL:CC | -LL | Call(_unit = change_arg(Move(*ptr), ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_unit = change_arg(Move(*ptr), ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.none.stderr b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.none.stderr index 48db898a250..eb215a2d2e8 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.none.stderr +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.none.stderr @@ -11,8 +11,8 @@ LL | unsafe { ptr.read() }; note: inside `main` --> $DIR/return_pointer_aliasing.rs:LL:CC | -LL | Call(*ptr = myfun(ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(*ptr = myfun(ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.rs b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.rs index 23b1e38b99f..c8e0782eff2 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.rs +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.rs @@ -15,7 +15,7 @@ pub fn main() { let ptr = &raw mut x; // We arrange for `myfun` to have a pointer that aliases // its return place. Even just reading from that pointer is UB. - Call(*ptr = myfun(ptr), after_call, UnwindContinue()) + Call(*ptr = myfun(ptr), ReturnTo(after_call), UnwindContinue()) } after_call = { diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.stack.stderr b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.stack.stderr index 85dcd29ba55..01357f430fc 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.stack.stderr +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.stack.stderr @@ -27,8 +27,8 @@ LL | unsafe { ptr.read() }; note: inside `main` --> $DIR/return_pointer_aliasing.rs:LL:CC | -LL | Call(*ptr = myfun(ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(*ptr = myfun(ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.tree.stderr b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.tree.stderr index ea1867b1a71..6b3f5fbedee 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.tree.stderr +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing.tree.stderr @@ -35,8 +35,8 @@ LL | unsafe { ptr.read() }; note: inside `main` --> $DIR/return_pointer_aliasing.rs:LL:CC | -LL | Call(*ptr = myfun(ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(*ptr = myfun(ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.rs b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.rs index 56706cdb63b..7db641538ce 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.rs +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.rs @@ -15,7 +15,7 @@ pub fn main() { let ptr = &raw mut _x; // We arrange for `myfun` to have a pointer that aliases // its return place. Even just reading from that pointer is UB. - Call(_x = myfun(ptr), after_call, UnwindContinue()) + Call(_x = myfun(ptr), ReturnTo(after_call), UnwindContinue()) } after_call = { diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.stack.stderr b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.stack.stderr index 12a99fbf293..04040827b0f 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.stack.stderr +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.stack.stderr @@ -30,8 +30,8 @@ LL | unsafe { ptr.write(0) }; note: inside `main` --> $DIR/return_pointer_aliasing2.rs:LL:CC | -LL | Call(_x = myfun(ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_x = myfun(ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.tree.stderr b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.tree.stderr index 926303bb489..37c98eabbec 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.tree.stderr +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_aliasing2.tree.stderr @@ -35,8 +35,8 @@ LL | unsafe { ptr.write(0) }; note: inside `main` --> $DIR/return_pointer_aliasing2.rs:LL:CC | -LL | Call(_x = myfun(ptr), after_call, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | Call(_x = myfun(ptr), ReturnTo(after_call), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `::core::intrinsics::mir::__internal_remove_let` which comes from the expansion of the macro `mir` (in Nightly builds, run with -Z macro-backtrace for more info) note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace diff --git a/src/tools/miri/tests/fail/function_calls/return_pointer_on_unwind.rs b/src/tools/miri/tests/fail/function_calls/return_pointer_on_unwind.rs index 923c59e7429..244acd8f2be 100644 --- a/src/tools/miri/tests/fail/function_calls/return_pointer_on_unwind.rs +++ b/src/tools/miri/tests/fail/function_calls/return_pointer_on_unwind.rs @@ -14,7 +14,7 @@ struct S(i32, [u8; 128]); fn docall(out: &mut S) { mir! { { - Call(*out = callee(), after_call, UnwindContinue()) + Call(*out = callee(), ReturnTo(after_call), UnwindContinue()) } after_call = { @@ -37,7 +37,7 @@ fn callee() -> S { // become visible to the outside. In codegen we can see them // but Miri should detect this as UB! RET.0 = 42; - Call(_unit = startpanic(), after_call, UnwindContinue()) + Call(_unit = startpanic(), ReturnTo(after_call), UnwindContinue()) } after_call = { diff --git a/src/tools/miri/tests/fail/function_pointers/abi_mismatch_array_vs_struct.rs b/src/tools/miri/tests/fail/function_pointers/abi_mismatch_array_vs_struct.rs index 415e91b250f..401927f5f6c 100644 --- a/src/tools/miri/tests/fail/function_pointers/abi_mismatch_array_vs_struct.rs +++ b/src/tools/miri/tests/fail/function_pointers/abi_mismatch_array_vs_struct.rs @@ -3,7 +3,7 @@ // Some targets treat arrays and structs very differently. We would probably catch that on those // targets since we check the `PassMode`; here we ensure that we catch it on *all* targets // (in particular, on x86-64 the pass mode is `Indirect` for both of these). -struct S(i32, i32, i32, i32); +struct S(#[allow(dead_code)] i32, #[allow(dead_code)] i32, #[allow(dead_code)] i32, #[allow(dead_code)] i32); type A = [i32; 4]; fn main() { diff --git a/src/tools/miri/tests/fail/fast_math_both.rs b/src/tools/miri/tests/fail/intrinsics/fast_math_both.rs index dd2787bf40f..dd2787bf40f 100644 --- a/src/tools/miri/tests/fail/fast_math_both.rs +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_both.rs diff --git a/src/tools/miri/tests/fail/fast_math_both.stderr b/src/tools/miri/tests/fail/intrinsics/fast_math_both.stderr index feba0c5991c..feba0c5991c 100644 --- a/src/tools/miri/tests/fail/fast_math_both.stderr +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_both.stderr diff --git a/src/tools/miri/tests/fail/fast_math_first.rs b/src/tools/miri/tests/fail/intrinsics/fast_math_first.rs index e495498ab28..e495498ab28 100644 --- a/src/tools/miri/tests/fail/fast_math_first.rs +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_first.rs diff --git a/src/tools/miri/tests/fail/fast_math_first.stderr b/src/tools/miri/tests/fail/intrinsics/fast_math_first.stderr index b26b5a37215..b26b5a37215 100644 --- a/src/tools/miri/tests/fail/fast_math_first.stderr +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_first.stderr diff --git a/src/tools/miri/tests/fail/intrinsics/fast_math_result.rs b/src/tools/miri/tests/fail/intrinsics/fast_math_result.rs new file mode 100644 index 00000000000..4a143da0575 --- /dev/null +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_result.rs @@ -0,0 +1,7 @@ +#![feature(core_intrinsics)] + +fn main() { + unsafe { + let _x: f32 = core::intrinsics::fdiv_fast(1.0, 0.0); //~ ERROR: `fdiv_fast` intrinsic produced non-finite value as result + } +} diff --git a/src/tools/miri/tests/fail/intrinsics/fast_math_result.stderr b/src/tools/miri/tests/fail/intrinsics/fast_math_result.stderr new file mode 100644 index 00000000000..5b24d225026 --- /dev/null +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_result.stderr @@ -0,0 +1,15 @@ +error: Undefined Behavior: `fdiv_fast` intrinsic produced non-finite value as result + --> $DIR/fast_math_result.rs:LL:CC + | +LL | let _x: f32 = core::intrinsics::fdiv_fast(1.0, 0.0); + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ `fdiv_fast` intrinsic produced non-finite value as result + | + = help: this indicates a bug in the program: it performed an invalid operation, and caused Undefined Behavior + = help: see https://doc.rust-lang.org/nightly/reference/behavior-considered-undefined.html for further information + = note: BACKTRACE: + = note: inside `main` at $DIR/fast_math_result.rs:LL:CC + +note: some details are omitted, run with `MIRIFLAGS=-Zmiri-backtrace=full` for a verbose backtrace + +error: aborting due to 1 previous error + diff --git a/src/tools/miri/tests/fail/fast_math_second.rs b/src/tools/miri/tests/fail/intrinsics/fast_math_second.rs index 408c461077f..408c461077f 100644 --- a/src/tools/miri/tests/fail/fast_math_second.rs +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_second.rs diff --git a/src/tools/miri/tests/fail/fast_math_second.stderr b/src/tools/miri/tests/fail/intrinsics/fast_math_second.stderr index cb46aa97a8d..cb46aa97a8d 100644 --- a/src/tools/miri/tests/fail/fast_math_second.stderr +++ b/src/tools/miri/tests/fail/intrinsics/fast_math_second.stderr diff --git a/src/tools/miri/tests/fail/issue-miri-1112.rs b/src/tools/miri/tests/fail/issue-miri-1112.rs index 387253a3f98..9542673b0d9 100644 --- a/src/tools/miri/tests/fail/issue-miri-1112.rs +++ b/src/tools/miri/tests/fail/issue-miri-1112.rs @@ -1,7 +1,7 @@ trait Empty {} #[repr(transparent)] -pub struct FunnyPointer(dyn Empty); +pub struct FunnyPointer(#[allow(dead_code)] dyn Empty); #[repr(C)] pub struct Meta { diff --git a/src/tools/miri/tests/fail/unaligned_pointers/drop_in_place.rs b/src/tools/miri/tests/fail/unaligned_pointers/drop_in_place.rs index d71d5954a40..2283231eb01 100644 --- a/src/tools/miri/tests/fail/unaligned_pointers/drop_in_place.rs +++ b/src/tools/miri/tests/fail/unaligned_pointers/drop_in_place.rs @@ -1,7 +1,7 @@ //@compile-flags: -Cdebug-assertions=no #[repr(transparent)] -struct HasDrop(u8); +struct HasDrop(#[allow(dead_code)] u8); impl Drop for HasDrop { fn drop(&mut self) {} diff --git a/src/tools/miri/tests/fail/unaligned_pointers/promise_alignment.rs b/src/tools/miri/tests/fail/unaligned_pointers/promise_alignment.rs index 82753fe803c..e075db66039 100644 --- a/src/tools/miri/tests/fail/unaligned_pointers/promise_alignment.rs +++ b/src/tools/miri/tests/fail/unaligned_pointers/promise_alignment.rs @@ -7,7 +7,7 @@ mod utils; #[repr(align(8))] #[derive(Copy, Clone)] -struct Align8(u64); +struct Align8(#[allow(dead_code)] u64); fn main() { let buffer = [0u32; 128]; // get some 4-aligned memory @@ -35,7 +35,7 @@ fn main() { if cfg!(read_unaligned_ptr) { #[repr(align(16))] #[derive(Copy, Clone)] - struct Align16(u128); + struct Align16(#[allow(dead_code)] u128); let align16 = if align8.addr() % 16 == 0 { align8 } else { align8.wrapping_add(2) }; assert!(align16.addr() % 16 == 0); diff --git a/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.rs b/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.rs index 9357b372505..3a87bb78677 100644 --- a/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.rs +++ b/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.rs @@ -20,7 +20,7 @@ fn call(f: fn(NonZeroU32)) { let tmp = ptr::addr_of!(c); let ptr = tmp as *const NonZeroU32; // The call site now is a NonZeroU32-to-u32 transmute. - Call(_res = f(*ptr), retblock, UnwindContinue()) //~ERROR: expected something greater or equal to 1 + Call(_res = f(*ptr), ReturnTo(retblock), UnwindContinue()) //~ERROR: expected something greater or equal to 1 } retblock = { Return() diff --git a/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.stderr b/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.stderr index 9e9ea710f0e..b1a2bd2c79a 100644 --- a/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.stderr +++ b/src/tools/miri/tests/fail/validity/cast_fn_ptr_invalid_caller_arg.stderr @@ -1,8 +1,8 @@ error: Undefined Behavior: constructing invalid value: encountered 0, but expected something greater or equal to 1 --> $DIR/cast_fn_ptr_invalid_caller_arg.rs:LL:CC | -LL | Call(_res = f(*ptr), retblock, UnwindContinue()) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ constructing invalid value: encountered 0, but expected something greater or equal to 1 +LL | Call(_res = f(*ptr), ReturnTo(retblock), UnwindContinue()) + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ constructing invalid value: encountered 0, but expected something greater or equal to 1 | = help: this indicates a bug in the program: it performed an invalid operation, and caused Undefined Behavior = help: see https://doc.rust-lang.org/nightly/reference/behavior-considered-undefined.html for further information diff --git a/src/tools/miri/tests/pass/concurrency/windows_condvar_shared.rs b/src/tools/miri/tests/pass-dep/concurrency/windows_condvar_shared.rs index 3b27af9094c..5bff9098a58 100644 --- a/src/tools/miri/tests/pass/concurrency/windows_condvar_shared.rs +++ b/src/tools/miri/tests/pass-dep/concurrency/windows_condvar_shared.rs @@ -2,39 +2,30 @@ // We are making scheduler assumptions here. //@compile-flags: -Zmiri-preemption-rate=0 -use std::ffi::c_void; use std::ptr::null_mut; use std::thread; +use windows_sys::Win32::System::Threading::{ + AcquireSRWLockExclusive, AcquireSRWLockShared, ReleaseSRWLockExclusive, ReleaseSRWLockShared, + SleepConditionVariableSRW, WakeAllConditionVariable, CONDITION_VARIABLE, + CONDITION_VARIABLE_LOCKMODE_SHARED, INFINITE, SRWLOCK, +}; + +// not in windows-sys +const SRWLOCK_INIT: SRWLOCK = SRWLOCK { Ptr: null_mut() }; +const CONDITION_VARIABLE_INIT: CONDITION_VARIABLE = CONDITION_VARIABLE { Ptr: null_mut() }; + #[derive(Copy, Clone)] struct SendPtr<T>(*mut T); unsafe impl<T> Send for SendPtr<T> {} -extern "system" { - fn SleepConditionVariableSRW( - condvar: *mut *mut c_void, - lock: *mut *mut c_void, - timeout: u32, - flags: u32, - ) -> i32; - fn WakeAllConditionVariable(condvar: *mut *mut c_void); - - fn AcquireSRWLockExclusive(lock: *mut *mut c_void); - fn AcquireSRWLockShared(lock: *mut *mut c_void); - fn ReleaseSRWLockExclusive(lock: *mut *mut c_void); - fn ReleaseSRWLockShared(lock: *mut *mut c_void); -} - -const CONDITION_VARIABLE_LOCKMODE_SHARED: u32 = 1; -const INFINITE: u32 = u32::MAX; - /// threads should be able to reacquire the lock while it is locked by multiple other threads in shared mode fn all_shared() { println!("all_shared"); - let mut lock = null_mut(); - let mut condvar = null_mut(); + let mut lock = SRWLOCK_INIT; + let mut condvar = CONDITION_VARIABLE_INIT; let lock_ptr = SendPtr(&mut lock); let condvar_ptr = SendPtr(&mut condvar); @@ -105,8 +96,8 @@ fn all_shared() { fn shared_sleep_and_exclusive_lock() { println!("shared_sleep_and_exclusive_lock"); - let mut lock = null_mut(); - let mut condvar = null_mut(); + let mut lock = SRWLOCK_INIT; + let mut condvar = CONDITION_VARIABLE_INIT; let lock_ptr = SendPtr(&mut lock); let condvar_ptr = SendPtr(&mut condvar); @@ -166,8 +157,8 @@ fn shared_sleep_and_exclusive_lock() { fn exclusive_sleep_and_shared_lock() { println!("exclusive_sleep_and_shared_lock"); - let mut lock = null_mut(); - let mut condvar = null_mut(); + let mut lock = SRWLOCK_INIT; + let mut condvar = CONDITION_VARIABLE_INIT; let lock_ptr = SendPtr(&mut lock); let condvar_ptr = SendPtr(&mut condvar); diff --git a/src/tools/miri/tests/pass/concurrency/windows_condvar_shared.stdout b/src/tools/miri/tests/pass-dep/concurrency/windows_condvar_shared.stdout index 918b54668f2..918b54668f2 100644 --- a/src/tools/miri/tests/pass/concurrency/windows_condvar_shared.stdout +++ b/src/tools/miri/tests/pass-dep/concurrency/windows_condvar_shared.stdout diff --git a/src/tools/miri/tests/pass/concurrency/windows_detach_terminated.rs b/src/tools/miri/tests/pass-dep/concurrency/windows_detach_terminated.rs index 91088ce6aef..3d4f8c5e1c0 100644 --- a/src/tools/miri/tests/pass/concurrency/windows_detach_terminated.rs +++ b/src/tools/miri/tests/pass-dep/concurrency/windows_detach_terminated.rs @@ -5,12 +5,10 @@ use std::os::windows::io::IntoRawHandle; use std::thread; -extern "system" { - fn CloseHandle(handle: usize) -> i32; -} +use windows_sys::Win32::Foundation::{CloseHandle, HANDLE}; fn main() { - let thread = thread::spawn(|| {}).into_raw_handle() as usize; + let thread = thread::spawn(|| {}).into_raw_handle() as HANDLE; // this yield ensures that `thread` is terminated by this point thread::yield_now(); diff --git a/src/tools/miri/tests/pass/concurrency/windows_init_once.rs b/src/tools/miri/tests/pass-dep/concurrency/windows_init_once.rs index b2412f7dbb0..5e33617f98a 100644 --- a/src/tools/miri/tests/pass/concurrency/windows_init_once.rs +++ b/src/tools/miri/tests/pass-dep/concurrency/windows_init_once.rs @@ -2,33 +2,24 @@ // We are making scheduler assumptions here. //@compile-flags: -Zmiri-preemption-rate=0 -use std::ffi::c_void; use std::ptr::null_mut; use std::thread; +use windows_sys::Win32::Foundation::{FALSE, TRUE}; +use windows_sys::Win32::System::Threading::{ + InitOnceBeginInitialize, InitOnceComplete, INIT_ONCE, INIT_ONCE_INIT_FAILED, +}; + +// not in windows-sys +const INIT_ONCE_STATIC_INIT: INIT_ONCE = INIT_ONCE { Ptr: null_mut() }; + #[derive(Copy, Clone)] struct SendPtr<T>(*mut T); unsafe impl<T> Send for SendPtr<T> {} -extern "system" { - fn InitOnceBeginInitialize( - init: *mut *mut c_void, - flags: u32, - pending: *mut i32, - context: *mut c_void, - ) -> i32; - - fn InitOnceComplete(init: *mut *mut c_void, flags: u32, context: *mut c_void) -> i32; -} - -const TRUE: i32 = 1; -const FALSE: i32 = 0; - -const INIT_ONCE_INIT_FAILED: u32 = 4; - fn single_thread() { - let mut init_once = null_mut(); + let mut init_once = INIT_ONCE_STATIC_INIT; let mut pending = 0; unsafe { @@ -41,7 +32,7 @@ fn single_thread() { assert_eq!(pending, FALSE); } - let mut init_once = null_mut(); + let mut init_once = INIT_ONCE_STATIC_INIT; unsafe { assert_eq!(InitOnceBeginInitialize(&mut init_once, 0, &mut pending, null_mut()), TRUE); @@ -55,7 +46,7 @@ fn single_thread() { } fn block_until_complete() { - let mut init_once = null_mut(); + let mut init_once = INIT_ONCE_STATIC_INIT; let mut pending = 0; unsafe { @@ -92,7 +83,7 @@ fn block_until_complete() { } fn retry_on_fail() { - let mut init_once = null_mut(); + let mut init_once = INIT_ONCE_STATIC_INIT; let mut pending = 0; unsafe { @@ -134,7 +125,7 @@ fn retry_on_fail() { } fn no_data_race_after_complete() { - let mut init_once = null_mut(); + let mut init_once = INIT_ONCE_STATIC_INIT; let mut pending = 0; unsafe { diff --git a/src/tools/miri/tests/pass/concurrency/windows_init_once.stdout b/src/tools/miri/tests/pass-dep/concurrency/windows_init_once.stdout index f3d5aad8edc..f3d5aad8edc 100644 --- a/src/tools/miri/tests/pass/concurrency/windows_init_once.stdout +++ b/src/tools/miri/tests/pass-dep/concurrency/windows_init_once.stdout diff --git a/src/tools/miri/tests/pass/concurrency/windows_join_multiple.rs b/src/tools/miri/tests/pass-dep/concurrency/windows_join_multiple.rs index 5da5497f982..bff59591a94 100644 --- a/src/tools/miri/tests/pass/concurrency/windows_join_multiple.rs +++ b/src/tools/miri/tests/pass-dep/concurrency/windows_join_multiple.rs @@ -6,11 +6,8 @@ use std::os::windows::io::IntoRawHandle; use std::sync::atomic::{AtomicBool, Ordering}; use std::thread; -extern "system" { - fn WaitForSingleObject(handle: usize, timeout: u32) -> u32; -} - -const INFINITE: u32 = u32::MAX; +use windows_sys::Win32::Foundation::{HANDLE, WAIT_OBJECT_0}; +use windows_sys::Win32::System::Threading::{WaitForSingleObject, INFINITE}; fn main() { static FLAG: AtomicBool = AtomicBool::new(false); @@ -20,10 +17,10 @@ fn main() { thread::yield_now(); } }) - .into_raw_handle() as usize; + .into_raw_handle() as HANDLE; let waiter = move || unsafe { - assert_eq!(WaitForSingleObject(blocker, INFINITE), 0); + assert_eq!(WaitForSingleObject(blocker, INFINITE), WAIT_OBJECT_0); }; let waiter1 = thread::spawn(waiter); diff --git a/src/tools/miri/tests/pass-dep/shims/mmap.rs b/src/tools/miri/tests/pass-dep/shims/mmap.rs index 518f2ea3e6f..e19f54d0687 100644 --- a/src/tools/miri/tests/pass-dep/shims/mmap.rs +++ b/src/tools/miri/tests/pass-dep/shims/mmap.rs @@ -90,9 +90,30 @@ fn test_mmap() { assert_eq!(Error::last_os_error().raw_os_error().unwrap(), libc::ENOTSUP); } + // We report an error for mappings whose length cannot be rounded up to a multiple of + // the page size. + let ptr = unsafe { + libc::mmap( + ptr::null_mut(), + usize::MAX - 1, + libc::PROT_READ | libc::PROT_WRITE, + libc::MAP_PRIVATE | libc::MAP_ANONYMOUS, + -1, + 0, + ) + }; + assert_eq!(ptr, libc::MAP_FAILED); + + // We report an error when trying to munmap an address which is not a multiple of the page size let res = unsafe { libc::munmap(ptr::invalid_mut(1), page_size) }; assert_eq!(res, -1); assert_eq!(Error::last_os_error().raw_os_error().unwrap(), libc::EINVAL); + + // We report an error when trying to munmap a length that cannot be rounded up to a multiple of + // the page size. + let res = unsafe { libc::munmap(ptr::invalid_mut(page_size), usize::MAX - 1) }; + assert_eq!(res, -1); + assert_eq!(Error::last_os_error().raw_os_error().unwrap(), libc::EINVAL); } #[cfg(target_os = "linux")] diff --git a/src/tools/miri/tests/pass-dep/tempfile.rs b/src/tools/miri/tests/pass-dep/tempfile.rs new file mode 100644 index 00000000000..c4583ca3f47 --- /dev/null +++ b/src/tools/miri/tests/pass-dep/tempfile.rs @@ -0,0 +1,21 @@ +//@ignore-target-windows: File handling is not implemented yet +//@ignore-host-windows: Only supported for UNIX hosts +//@compile-flags: -Zmiri-disable-isolation + +#[path = "../utils/mod.rs"] +mod utils; + +/// Test that the [`tempfile`] crate is compatible with miri for UNIX hosts and targets +fn main() { + test_tempfile(); + test_tempfile_in(); +} + +fn test_tempfile() { + tempfile::tempfile().unwrap(); +} + +fn test_tempfile_in() { + let dir_path = utils::tmp(); + tempfile::tempfile_in(dir_path).unwrap(); +} diff --git a/src/tools/miri/tests/pass/align_offset_symbolic.rs b/src/tools/miri/tests/pass/align_offset_symbolic.rs index 3e493952d28..4df364bac7a 100644 --- a/src/tools/miri/tests/pass/align_offset_symbolic.rs +++ b/src/tools/miri/tests/pass/align_offset_symbolic.rs @@ -46,7 +46,7 @@ fn test_align_to() { { #[repr(align(8))] #[derive(Copy, Clone)] - struct Align8(u64); + struct Align8(#[allow(dead_code)] u64); let (_l, m, _r) = unsafe { s.align_to::<Align8>() }; assert!(m.len() > 0); @@ -97,7 +97,7 @@ fn huge_align() { const SIZE: usize = 1 << 30; #[cfg(target_pointer_width = "16")] const SIZE: usize = 1 << 13; - struct HugeSize([u8; SIZE - 1]); + struct HugeSize(#[allow(dead_code)] [u8; SIZE - 1]); let _ = std::ptr::invalid::<HugeSize>(SIZE).align_offset(SIZE); } diff --git a/src/tools/miri/tests/pass/box-custom-alloc.rs b/src/tools/miri/tests/pass/box-custom-alloc.rs index 3d055961d15..75b512f6f72 100644 --- a/src/tools/miri/tests/pass/box-custom-alloc.rs +++ b/src/tools/miri/tests/pass/box-custom-alloc.rs @@ -57,7 +57,7 @@ fn test1() { } // Make the allocator itself so big that the Box is not even a ScalarPair any more. -struct OnceAllocRef<'s, 'a>(&'s OnceAlloc<'a>, u64); +struct OnceAllocRef<'s, 'a>(&'s OnceAlloc<'a>, #[allow(dead_code)] u64); unsafe impl<'shared, 'a: 'shared> Allocator for OnceAllocRef<'shared, 'a> { fn allocate(&self, layout: Layout) -> Result<NonNull<[u8]>, AllocError> { diff --git a/src/tools/miri/tests/pass/box.rs b/src/tools/miri/tests/pass/box.rs index 3bb481aab88..174bf8be30b 100644 --- a/src/tools/miri/tests/pass/box.rs +++ b/src/tools/miri/tests/pass/box.rs @@ -46,7 +46,7 @@ fn boxed_pair_to_vec() { } #[derive(Debug)] - struct Foo(u64); + struct Foo(#[allow(dead_code)] u64); fn reinterstruct(box_pair: Box<PairFoo>) -> Vec<Foo> { let ref_pair = Box::leak(box_pair) as *mut PairFoo; let ptr_foo = unsafe { std::ptr::addr_of_mut!((*ref_pair).fst) }; diff --git a/src/tools/miri/tests/pass/fat_ptr.rs b/src/tools/miri/tests/pass/fat_ptr.rs index 8317156a218..c5603d2cf80 100644 --- a/src/tools/miri/tests/pass/fat_ptr.rs +++ b/src/tools/miri/tests/pass/fat_ptr.rs @@ -1,6 +1,6 @@ // test that ordinary fat pointer operations work. -struct Wrapper<T: ?Sized>(u32, T); +struct Wrapper<T: ?Sized>(#[allow(dead_code)] u32, T); struct FatPtrContainer<'a> { ptr: &'a [u8], diff --git a/src/tools/miri/tests/pass/float_nan.rs b/src/tools/miri/tests/pass/float_nan.rs index 6ea034e2cda..207ce70fb20 100644 --- a/src/tools/miri/tests/pass/float_nan.rs +++ b/src/tools/miri/tests/pass/float_nan.rs @@ -1,8 +1,16 @@ +#![feature(float_gamma, portable_simd, core_intrinsics, platform_intrinsics)] use std::collections::HashSet; use std::fmt; use std::hash::Hash; use std::hint::black_box; +fn ldexp(a: f64, b: i32) -> f64 { + extern "C" { + fn ldexp(x: f64, n: i32) -> f64; + } + unsafe { ldexp(a, b) } +} + #[derive(Clone, Copy, Debug, PartialEq, Eq)] enum Sign { Neg = 1, @@ -249,6 +257,58 @@ fn test_f32() { check_all_outcomes(HashSet::from_iter([F32::nan(Neg, Signaling, all1_payload)]), || { F32::from(-all1_snan) }); + + // Intrinsics + let nan = F32::nan(Neg, Quiet, 0).as_f32(); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(f32::min(nan, nan)), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(nan.sin()), + ); + check_all_outcomes( + HashSet::from_iter([ + F32::nan(Pos, Quiet, 0), + F32::nan(Neg, Quiet, 0), + F32::nan(Pos, Quiet, 1), + F32::nan(Neg, Quiet, 1), + F32::nan(Pos, Quiet, 2), + F32::nan(Neg, Quiet, 2), + F32::nan(Pos, Quiet, all1_payload), + F32::nan(Neg, Quiet, all1_payload), + F32::nan(Pos, Signaling, all1_payload), + F32::nan(Neg, Signaling, all1_payload), + ]), + || F32::from(just1.mul_add(F32::nan(Neg, Quiet, 2).as_f32(), all1_snan)), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(nan.powf(nan)), + ); + check_all_outcomes( + HashSet::from_iter([1.0f32.into()]), + || F32::from(1.0f32.powf(nan)), // special `pow` rule + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(nan.powi(1)), + ); + + // libm functions + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(nan.sinh()), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(nan.atan2(nan)), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(nan.ln_gamma().0), + ); } fn test_f64() { @@ -309,6 +369,62 @@ fn test_f64() { ]), || F64::from(just1 % all1_snan), ); + + // Intrinsics + let nan = F64::nan(Neg, Quiet, 0).as_f64(); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(f64::min(nan, nan)), + ); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(nan.sin()), + ); + check_all_outcomes( + HashSet::from_iter([ + F64::nan(Pos, Quiet, 0), + F64::nan(Neg, Quiet, 0), + F64::nan(Pos, Quiet, 1), + F64::nan(Neg, Quiet, 1), + F64::nan(Pos, Quiet, 2), + F64::nan(Neg, Quiet, 2), + F64::nan(Pos, Quiet, all1_payload), + F64::nan(Neg, Quiet, all1_payload), + F64::nan(Pos, Signaling, all1_payload), + F64::nan(Neg, Signaling, all1_payload), + ]), + || F64::from(just1.mul_add(F64::nan(Neg, Quiet, 2).as_f64(), all1_snan)), + ); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(nan.powf(nan)), + ); + check_all_outcomes( + HashSet::from_iter([1.0f64.into()]), + || F64::from(1.0f64.powf(nan)), // special `pow` rule + ); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(nan.powi(1)), + ); + + // libm functions + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(nan.sinh()), + ); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(nan.atan2(nan)), + ); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(ldexp(nan, 1)), + ); + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(nan.ln_gamma().0), + ); } fn test_casts() { @@ -397,6 +513,61 @@ fn test_casts() { ); } +fn test_simd() { + use std::intrinsics::simd::*; + use std::simd::*; + + extern "platform-intrinsic" { + fn simd_fsqrt<T>(x: T) -> T; + fn simd_ceil<T>(x: T) -> T; + fn simd_fma<T>(x: T, y: T, z: T) -> T; + } + + let nan = F32::nan(Neg, Quiet, 0).as_f32(); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_div(f32x4::splat(0.0), f32x4::splat(0.0)) }[0]), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_fmin(f32x4::splat(nan), f32x4::splat(nan)) }[0]), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_fmax(f32x4::splat(nan), f32x4::splat(nan)) }[0]), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || { + F32::from( + unsafe { simd_fma(f32x4::splat(nan), f32x4::splat(nan), f32x4::splat(nan)) }[0], + ) + }, + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_reduce_add_ordered::<_, f32>(f32x4::splat(nan), nan) }), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_reduce_max::<_, f32>(f32x4::splat(nan)) }), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_fsqrt(f32x4::splat(nan)) }[0]), + ); + check_all_outcomes( + HashSet::from_iter([F32::nan(Pos, Quiet, 0), F32::nan(Neg, Quiet, 0)]), + || F32::from(unsafe { simd_ceil(f32x4::splat(nan)) }[0]), + ); + + // Casts + check_all_outcomes( + HashSet::from_iter([F64::nan(Pos, Quiet, 0), F64::nan(Neg, Quiet, 0)]), + || F64::from(unsafe { simd_cast::<f32x4, f64x4>(f32x4::splat(nan)) }[0]), + ); +} + fn main() { // Check our constants against std, just to be sure. // We add 1 since our numbers are the number of bits stored @@ -408,4 +579,5 @@ fn main() { test_f32(); test_f64(); test_casts(); + test_simd(); } diff --git a/src/tools/miri/tests/pass/function_calls/return_place_on_heap.rs b/src/tools/miri/tests/pass/function_calls/return_place_on_heap.rs index 89ee689fabe..a5cbe2a0d1d 100644 --- a/src/tools/miri/tests/pass/function_calls/return_place_on_heap.rs +++ b/src/tools/miri/tests/pass/function_calls/return_place_on_heap.rs @@ -11,7 +11,7 @@ pub fn main() { { let x = 0; let ptr = &raw mut x; - Call(*ptr = myfun(), after_call, UnwindContinue()) + Call(*ptr = myfun(), ReturnTo(after_call), UnwindContinue()) } after_call = { diff --git a/src/tools/miri/tests/pass/issues/issue-3200-packed2-field-offset.rs b/src/tools/miri/tests/pass/issues/issue-3200-packed2-field-offset.rs index a8a7387ecdc..bdcb87e1a2e 100644 --- a/src/tools/miri/tests/pass/issues/issue-3200-packed2-field-offset.rs +++ b/src/tools/miri/tests/pass/issues/issue-3200-packed2-field-offset.rs @@ -2,7 +2,7 @@ use std::mem; #[repr(packed(4))] -struct Slice([u32]); +struct Slice(#[allow(dead_code)] [u32]); #[repr(packed(2), C)] struct PackedSized { diff --git a/src/tools/miri/tests/pass/issues/issue-34571.rs b/src/tools/miri/tests/pass/issues/issue-34571.rs index e1ed8d19e4e..bdb0d39ceba 100644 --- a/src/tools/miri/tests/pass/issues/issue-34571.rs +++ b/src/tools/miri/tests/pass/issues/issue-34571.rs @@ -1,6 +1,6 @@ #[repr(u8)] enum Foo { - Foo(u8), + Foo(#[allow(dead_code)] u8), } fn main() { diff --git a/src/tools/miri/tests/pass/issues/issue-36278-prefix-nesting.rs b/src/tools/miri/tests/pass/issues/issue-36278-prefix-nesting.rs index 6bc8f02c3ba..faa37fb58ef 100644 --- a/src/tools/miri/tests/pass/issues/issue-36278-prefix-nesting.rs +++ b/src/tools/miri/tests/pass/issues/issue-36278-prefix-nesting.rs @@ -4,7 +4,7 @@ use std::mem; const SZ: usize = 100; -struct P<T: ?Sized>([u8; SZ], T); +struct P<T: ?Sized>(#[allow(dead_code)] [u8; SZ], T); type Ack<T> = P<P<T>>; diff --git a/src/tools/miri/tests/pass/packed_struct.rs b/src/tools/miri/tests/pass/packed_struct.rs index 0b06167aec2..b86235e0c67 100644 --- a/src/tools/miri/tests/pass/packed_struct.rs +++ b/src/tools/miri/tests/pass/packed_struct.rs @@ -102,7 +102,7 @@ fn test_inner_packed() { struct Inner(u32); #[derive(Clone, Copy)] - struct Outer(u8, Inner); + struct Outer(#[allow(dead_code)] u8, Inner); let o = Outer(0, Inner(42)); let _x = o.1; diff --git a/src/tools/miri/tests/pass/stacked-borrows/no_field_retagging.rs b/src/tools/miri/tests/pass/stacked-borrows/no_field_retagging.rs index 48fc8e8668c..507df068a7e 100644 --- a/src/tools/miri/tests/pass/stacked-borrows/no_field_retagging.rs +++ b/src/tools/miri/tests/pass/stacked-borrows/no_field_retagging.rs @@ -1,6 +1,6 @@ //@compile-flags: -Zmiri-retag-fields=none -struct Newtype<'a>(&'a mut i32); +struct Newtype<'a>(#[allow(dead_code)] &'a mut i32); fn dealloc_while_running(_n: Newtype<'_>, dealloc: impl FnOnce()) { dealloc(); diff --git a/src/tools/miri/tests/pass/stacked-borrows/non_scalar_field_retagging.rs b/src/tools/miri/tests/pass/stacked-borrows/non_scalar_field_retagging.rs index ddedc19c999..06c0b683810 100644 --- a/src/tools/miri/tests/pass/stacked-borrows/non_scalar_field_retagging.rs +++ b/src/tools/miri/tests/pass/stacked-borrows/non_scalar_field_retagging.rs @@ -1,6 +1,6 @@ //@compile-flags: -Zmiri-retag-fields=scalar -struct Newtype<'a>(&'a mut i32, i32, i32); +struct Newtype<'a>(#[allow(dead_code)] &'a mut i32, #[allow(dead_code)] i32, #[allow(dead_code)] i32); fn dealloc_while_running(_n: Newtype<'_>, dealloc: impl FnOnce()) { dealloc(); diff --git a/src/tools/miri/tests/pass/stacked-borrows/stacked-borrows.rs b/src/tools/miri/tests/pass/stacked-borrows/stacked-borrows.rs index dd3ee36f988..734411ccc72 100644 --- a/src/tools/miri/tests/pass/stacked-borrows/stacked-borrows.rs +++ b/src/tools/miri/tests/pass/stacked-borrows/stacked-borrows.rs @@ -226,7 +226,7 @@ fn not_unpin_not_protected() { // the self-referential-coroutine situation, it does not seem worth the potential trouble.) use std::marker::PhantomPinned; - pub struct NotUnpin(i32, PhantomPinned); + pub struct NotUnpin(#[allow(dead_code)] i32, PhantomPinned); fn inner(x: &mut NotUnpin, f: fn(&mut NotUnpin)) { // `f` may mutate, but it may not deallocate! diff --git a/src/tools/miri/tests/pass/tree_borrows/tree-borrows.rs b/src/tools/miri/tests/pass/tree_borrows/tree-borrows.rs index d45be91afcc..adad18c1af3 100644 --- a/src/tools/miri/tests/pass/tree_borrows/tree-borrows.rs +++ b/src/tools/miri/tests/pass/tree_borrows/tree-borrows.rs @@ -318,7 +318,7 @@ fn not_unpin_not_protected() { // the self-referential-coroutine situation, it does not seem worth the potential trouble.) use std::marker::PhantomPinned; - pub struct NotUnpin(i32, PhantomPinned); + pub struct NotUnpin(#[allow(dead_code)] i32, PhantomPinned); fn inner(x: &mut NotUnpin, f: fn(&mut NotUnpin)) { // `f` may mutate, but it may not deallocate! diff --git a/src/tools/miri/tests/pass/zst_variant_drop.rs b/src/tools/miri/tests/pass/zst_variant_drop.rs index a76f64ce29d..3da6959b221 100644 --- a/src/tools/miri/tests/pass/zst_variant_drop.rs +++ b/src/tools/miri/tests/pass/zst_variant_drop.rs @@ -10,7 +10,7 @@ impl Drop for Foo { static mut FOO: bool = false; enum Bar { - A(Box<i32>), + A(#[allow(dead_code)] Box<i32>), B(Foo), } diff --git a/src/tools/rust-analyzer/.cargo/config.toml b/src/tools/rust-analyzer/.cargo/config.toml index c9ad7803951..c3cfda85517 100644 --- a/src/tools/rust-analyzer/.cargo/config.toml +++ b/src/tools/rust-analyzer/.cargo/config.toml @@ -2,7 +2,7 @@ xtask = "run --package xtask --bin xtask --" tq = "test -- -q" qt = "tq" -lint = "clippy --all-targets -- -Aclippy::collapsible_if -Aclippy::needless_pass_by_value -Aclippy::nonminimal_bool -Aclippy::redundant_pattern_matching --cap-lints warn" +lint = "clippy --all-targets -- --cap-lints warn" [target.x86_64-pc-windows-msvc] linker = "rust-lld" diff --git a/src/tools/rust-analyzer/.github/workflows/ci.yaml b/src/tools/rust-analyzer/.github/workflows/ci.yaml index 1f2a7796d11..be830415f9c 100644 --- a/src/tools/rust-analyzer/.github/workflows/ci.yaml +++ b/src/tools/rust-analyzer/.github/workflows/ci.yaml @@ -38,7 +38,6 @@ jobs: - 'crates/proc-macro-api/**' - 'crates/proc-macro-srv/**' - 'crates/proc-macro-srv-cli/**' - - 'crates/proc-macro-test/**' rust: needs: changes diff --git a/src/tools/rust-analyzer/Cargo.lock b/src/tools/rust-analyzer/Cargo.lock index 227d1db0ec7..c7d110eafb6 100644 --- a/src/tools/rust-analyzer/Cargo.lock +++ b/src/tools/rust-analyzer/Cargo.lock @@ -74,11 +74,11 @@ dependencies = [ "profile", "rust-analyzer-salsa", "rustc-hash", + "semver", + "span", "stdx", "syntax", - "test-utils", "triomphe", - "tt", "vfs", ] @@ -516,8 +516,10 @@ dependencies = [ "rustc-dependencies", "rustc-hash", "smallvec", + "span", "stdx", "syntax", + "test-fixture", "test-utils", "tracing", "triomphe", @@ -542,6 +544,7 @@ dependencies = [ "profile", "rustc-hash", "smallvec", + "span", "stdx", "syntax", "tracing", @@ -581,6 +584,7 @@ dependencies = [ "smallvec", "stdx", "syntax", + "test-fixture", "test-utils", "tracing", "tracing-subscriber", @@ -624,6 +628,7 @@ dependencies = [ "smallvec", "stdx", "syntax", + "test-fixture", "test-utils", "text-edit", "toolchain", @@ -647,6 +652,7 @@ dependencies = [ "sourcegen", "stdx", "syntax", + "test-fixture", "test-utils", "text-edit", ] @@ -666,6 +672,7 @@ dependencies = [ "smallvec", "stdx", "syntax", + "test-fixture", "test-utils", "text-edit", ] @@ -694,8 +701,10 @@ dependencies = [ "rayon", "rustc-hash", "sourcegen", + "span", "stdx", "syntax", + "test-fixture", "test-utils", "text-edit", "tracing", @@ -720,6 +729,7 @@ dependencies = [ "sourcegen", "stdx", "syntax", + "test-fixture", "test-utils", "text-edit", ] @@ -737,6 +747,7 @@ dependencies = [ "parser", "stdx", "syntax", + "test-fixture", "test-utils", "text-edit", "triomphe", @@ -903,11 +914,13 @@ version = "0.0.0" dependencies = [ "anyhow", "crossbeam-channel", + "hir-expand", "ide", "ide-db", "itertools", "proc-macro-api", "project-model", + "span", "tracing", "tt", "vfs", @@ -932,33 +945,33 @@ checksum = "b06a4cde4c0f271a446782e3eff8de789548ce57dbc8eca9292c27f4a42004b4" [[package]] name = "lsp-server" -version = "0.7.4" -source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "b52dccdf3302eefab8c8a1273047f0a3c3dca4b527c8458d00c09484c8371928" +version = "0.7.6" dependencies = [ "crossbeam-channel", + "ctrlc", "log", + "lsp-types", "serde", "serde_json", ] [[package]] name = "lsp-server" -version = "0.7.5" +version = "0.7.6" +source = "registry+https://github.com/rust-lang/crates.io-index" +checksum = "248f65b78f6db5d8e1b1604b4098a28b43d21a8eb1deeca22b1c421b276c7095" dependencies = [ "crossbeam-channel", - "ctrlc", "log", - "lsp-types", "serde", "serde_json", ] [[package]] name = "lsp-types" -version = "0.94.0" +version = "0.95.0" source = "registry+https://github.com/rust-lang/crates.io-index" -checksum = "0b63735a13a1f9cd4f4835223d828ed9c2e35c8c5e61837774399f558b6a1237" +checksum = "158c1911354ef73e8fe42da6b10c0484cb65c7f1007f28022e847706c1ab6984" dependencies = [ "bitflags 1.3.2", "serde", @@ -975,6 +988,7 @@ dependencies = [ "parser", "rustc-hash", "smallvec", + "span", "stdx", "syntax", "test-utils", @@ -1251,6 +1265,7 @@ dependencies = [ "serde", "serde_json", "snap", + "span", "stdx", "text-size", "tracing", @@ -1262,6 +1277,7 @@ dependencies = [ name = "proc-macro-srv" version = "0.0.0" dependencies = [ + "base-db", "expect-test", "libloading", "mbe", @@ -1270,6 +1286,7 @@ dependencies = [ "paths", "proc-macro-api", "proc-macro-test", + "span", "stdx", "tt", ] @@ -1287,15 +1304,10 @@ name = "proc-macro-test" version = "0.0.0" dependencies = [ "cargo_metadata", - "proc-macro-test-impl", "toolchain", ] [[package]] -name = "proc-macro-test-impl" -version = "0.0.0" - -[[package]] name = "proc-macro2" version = "1.0.69" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1514,7 +1526,7 @@ dependencies = [ "ide-ssr", "itertools", "load-cargo", - "lsp-server 0.7.4", + "lsp-server 0.7.6 (registry+https://github.com/rust-lang/crates.io-index)", "lsp-types", "mbe", "mimalloc", @@ -1535,6 +1547,7 @@ dependencies = [ "sourcegen", "stdx", "syntax", + "test-fixture", "test-utils", "tikv-jemallocator", "toolchain", @@ -1727,6 +1740,17 @@ dependencies = [ ] [[package]] +name = "span" +version = "0.0.0" +dependencies = [ + "la-arena 0.3.1 (registry+https://github.com/rust-lang/crates.io-index)", + "rust-analyzer-salsa", + "stdx", + "syntax", + "vfs", +] + +[[package]] name = "static_assertions" version = "1.1.0" source = "registry+https://github.com/rust-lang/crates.io-index" @@ -1797,6 +1821,20 @@ dependencies = [ ] [[package]] +name = "test-fixture" +version = "0.0.0" +dependencies = [ + "base-db", + "cfg", + "hir-expand", + "rustc-hash", + "span", + "stdx", + "test-utils", + "tt", +] + +[[package]] name = "test-utils" version = "0.0.0" dependencies = [ @@ -1998,6 +2036,7 @@ name = "tt" version = "0.0.0" dependencies = [ "smol_str", + "span", "stdx", "text-size", ] diff --git a/src/tools/rust-analyzer/Cargo.toml b/src/tools/rust-analyzer/Cargo.toml index 1213979c390..7054020086e 100644 --- a/src/tools/rust-analyzer/Cargo.toml +++ b/src/tools/rust-analyzer/Cargo.toml @@ -1,10 +1,10 @@ [workspace] members = ["xtask/", "lib/*", "crates/*"] -exclude = ["crates/proc-macro-test/imp"] +exclude = ["crates/proc-macro-srv/proc-macro-test/"] resolver = "2" [workspace.package] -rust-version = "1.70" +rust-version = "1.74" edition = "2021" license = "MIT OR Apache-2.0" authors = ["rust-analyzer team"] @@ -70,10 +70,9 @@ proc-macro-srv = { path = "./crates/proc-macro-srv", version = "0.0.0" } proc-macro-srv-cli = { path = "./crates/proc-macro-srv-cli", version = "0.0.0" } profile = { path = "./crates/profile", version = "0.0.0" } project-model = { path = "./crates/project-model", version = "0.0.0" } -sourcegen = { path = "./crates/sourcegen", version = "0.0.0" } +span = { path = "./crates/span", version = "0.0.0" } stdx = { path = "./crates/stdx", version = "0.0.0" } syntax = { path = "./crates/syntax", version = "0.0.0" } -test-utils = { path = "./crates/test-utils", version = "0.0.0" } text-edit = { path = "./crates/text-edit", version = "0.0.0" } toolchain = { path = "./crates/toolchain", version = "0.0.0" } tt = { path = "./crates/tt", version = "0.0.0" } @@ -82,19 +81,25 @@ vfs = { path = "./crates/vfs", version = "0.0.0" } rustc-dependencies = { path = "./crates/rustc-dependencies", version = "0.0.0" } # local crates that aren't published to crates.io. These should not have versions. -proc-macro-test = { path = "./crates/proc-macro-test" } +sourcegen = { path = "./crates/sourcegen" } +test-fixture = { path = "./crates/test-fixture" } +test-utils = { path = "./crates/test-utils" } # In-tree crates that are published separately and follow semver. See lib/README.md line-index = { version = "0.1.1" } la-arena = { version = "0.3.1" } -lsp-server = { version = "0.7.4" } +lsp-server = { version = "0.7.6" } # non-local crates anyhow = "1.0.75" +arrayvec = "0.7.4" bitflags = "2.4.1" cargo_metadata = "0.18.1" +command-group = "2.0.1" +crossbeam-channel = "0.5.8" dissimilar = "1.0.7" either = "1.9.0" +expect-test = "1.4.0" hashbrown = { version = "0.14", features = [ "inline-more", ], default-features = false } @@ -105,6 +110,7 @@ nohash-hasher = "0.2.0" rayon = "1.8.0" rust-analyzer-salsa = "0.17.0-pre.4" rustc-hash = "1.1.0" +semver = "1.0.14" serde = { version = "1.0.192", features = ["derive"] } serde_json = "1.0.108" smallvec = { version = "1.10.0", features = [ @@ -124,5 +130,12 @@ tracing-subscriber = { version = "0.3.18", default-features = false, features = triomphe = { version = "0.1.10", default-features = false, features = ["std"] } xshell = "0.2.5" + # We need to freeze the version of the crate, as the raw-api feature is considered unstable dashmap = { version = "=5.5.3", features = ["raw-api"] } + +[workspace.lints.clippy] +collapsible_if = "allow" +needless_pass_by_value = "allow" +nonminimal_bool = "allow" +redundant_pattern_matching = "allow" \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/base-db/Cargo.toml b/src/tools/rust-analyzer/crates/base-db/Cargo.toml index 393ffe155ba..1aa43175f90 100644 --- a/src/tools/rust-analyzer/crates/base-db/Cargo.toml +++ b/src/tools/rust-analyzer/crates/base-db/Cargo.toml @@ -16,12 +16,15 @@ la-arena.workspace = true rust-analyzer-salsa.workspace = true rustc-hash.workspace = true triomphe.workspace = true +semver.workspace = true # local deps cfg.workspace = true profile.workspace = true stdx.workspace = true syntax.workspace = true -test-utils.workspace = true -tt.workspace = true vfs.workspace = true +span.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/base-db/src/change.rs b/src/tools/rust-analyzer/crates/base-db/src/change.rs index 6a3b36b2312..4332e572e20 100644 --- a/src/tools/rust-analyzer/crates/base-db/src/change.rs +++ b/src/tools/rust-analyzer/crates/base-db/src/change.rs @@ -7,18 +7,17 @@ use salsa::Durability; use triomphe::Arc; use vfs::FileId; -use crate::{CrateGraph, ProcMacros, SourceDatabaseExt, SourceRoot, SourceRootId}; +use crate::{CrateGraph, SourceDatabaseExt, SourceRoot, SourceRootId}; /// Encapsulate a bunch of raw `.set` calls on the database. #[derive(Default)] -pub struct Change { +pub struct FileChange { pub roots: Option<Vec<SourceRoot>>, pub files_changed: Vec<(FileId, Option<Arc<str>>)>, pub crate_graph: Option<CrateGraph>, - pub proc_macros: Option<ProcMacros>, } -impl fmt::Debug for Change { +impl fmt::Debug for FileChange { fn fmt(&self, fmt: &mut fmt::Formatter<'_>) -> fmt::Result { let mut d = fmt.debug_struct("Change"); if let Some(roots) = &self.roots { @@ -34,9 +33,9 @@ impl fmt::Debug for Change { } } -impl Change { +impl FileChange { pub fn new() -> Self { - Change::default() + FileChange::default() } pub fn set_roots(&mut self, roots: Vec<SourceRoot>) { @@ -51,10 +50,6 @@ impl Change { self.crate_graph = Some(graph); } - pub fn set_proc_macros(&mut self, proc_macros: ProcMacros) { - self.proc_macros = Some(proc_macros); - } - pub fn apply(self, db: &mut dyn SourceDatabaseExt) { let _p = profile::span("RootDatabase::apply_change"); if let Some(roots) = self.roots { @@ -79,9 +74,6 @@ impl Change { if let Some(crate_graph) = self.crate_graph { db.set_crate_graph_with_durability(Arc::new(crate_graph), Durability::HIGH); } - if let Some(proc_macros) = self.proc_macros { - db.set_proc_macros_with_durability(Arc::new(proc_macros), Durability::HIGH); - } } } diff --git a/src/tools/rust-analyzer/crates/base-db/src/input.rs b/src/tools/rust-analyzer/crates/base-db/src/input.rs index c2472363aac..e45a81238ac 100644 --- a/src/tools/rust-analyzer/crates/base-db/src/input.rs +++ b/src/tools/rust-analyzer/crates/base-db/src/input.rs @@ -6,22 +6,19 @@ //! actual IO. See `vfs` and `project_model` in the `rust-analyzer` crate for how //! actual IO is done and lowered to input. -use std::{fmt, mem, ops, panic::RefUnwindSafe, str::FromStr, sync}; +use std::{fmt, mem, ops, str::FromStr}; use cfg::CfgOptions; use la_arena::{Arena, Idx}; use rustc_hash::{FxHashMap, FxHashSet}; +use semver::Version; use syntax::SmolStr; use triomphe::Arc; use vfs::{file_set::FileSet, AbsPathBuf, AnchoredPath, FileId, VfsPath}; -use crate::span::SpanData; - // Map from crate id to the name of the crate and path of the proc-macro. If the value is `None`, // then the crate for the proc-macro hasn't been build yet as the build data is missing. pub type ProcMacroPaths = FxHashMap<CrateId, Result<(Option<String>, AbsPathBuf), String>>; -pub type ProcMacros = FxHashMap<CrateId, ProcMacroLoadResult>; - /// Files are grouped into source roots. A source root is a directory on the /// file systems which is watched for changes. Typically it corresponds to a /// Rust crate. Source roots *might* be nested: in this case, a file belongs to @@ -242,49 +239,8 @@ impl CrateDisplayName { CrateDisplayName { crate_name, canonical_name } } } - -// FIXME: These should not be defined in here? Why does base db know about proc-macros -// ProcMacroKind is used in [`fixture`], but that module probably shouldn't be in this crate either. - -#[derive(Debug, Copy, Clone, PartialEq, Eq, Hash)] -pub struct ProcMacroId(pub u32); - -#[derive(Copy, Clone, Eq, PartialEq, Debug, Hash)] -pub enum ProcMacroKind { - CustomDerive, - FuncLike, - Attr, -} - -pub trait ProcMacroExpander: fmt::Debug + Send + Sync + RefUnwindSafe { - fn expand( - &self, - subtree: &tt::Subtree<SpanData>, - attrs: Option<&tt::Subtree<SpanData>>, - env: &Env, - def_site: SpanData, - call_site: SpanData, - mixed_site: SpanData, - ) -> Result<tt::Subtree<SpanData>, ProcMacroExpansionError>; -} - -#[derive(Debug)] -pub enum ProcMacroExpansionError { - Panic(String), - /// Things like "proc macro server was killed by OOM". - System(String), -} - -pub type ProcMacroLoadResult = Result<Vec<ProcMacro>, String>; pub type TargetLayoutLoadResult = Result<Arc<str>, Arc<str>>; -#[derive(Debug, Clone)] -pub struct ProcMacro { - pub name: SmolStr, - pub kind: ProcMacroKind, - pub expander: sync::Arc<dyn ProcMacroExpander>, -} - #[derive(Debug, Copy, Clone, PartialEq, Eq, Hash, PartialOrd, Ord)] pub enum ReleaseChannel { Stable, @@ -303,7 +259,7 @@ impl ReleaseChannel { pub fn from_str(str: &str) -> Option<Self> { Some(match str { - "" => ReleaseChannel::Stable, + "" | "stable" => ReleaseChannel::Stable, "nightly" => ReleaseChannel::Nightly, _ if str.starts_with("beta") => ReleaseChannel::Beta, _ => return None, @@ -334,7 +290,7 @@ pub struct CrateData { // things. This info does need to be somewhat present though as to prevent deduplication from // happening across different workspaces with different layouts. pub target_layout: TargetLayoutLoadResult, - pub channel: Option<ReleaseChannel>, + pub toolchain: Option<Version>, } impl CrateData { @@ -391,6 +347,10 @@ impl CrateData { slf_deps.eq(other_deps) } + + pub fn channel(&self) -> Option<ReleaseChannel> { + self.toolchain.as_ref().and_then(|v| ReleaseChannel::from_str(&v.pre)) + } } #[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Hash)] @@ -398,10 +358,12 @@ pub enum Edition { Edition2015, Edition2018, Edition2021, + Edition2024, } impl Edition { pub const CURRENT: Edition = Edition::Edition2021; + pub const DEFAULT: Edition = Edition::Edition2015; } #[derive(Default, Debug, Clone, PartialEq, Eq)] @@ -472,7 +434,7 @@ impl CrateGraph { is_proc_macro: bool, origin: CrateOrigin, target_layout: Result<Arc<str>, Arc<str>>, - channel: Option<ReleaseChannel>, + toolchain: Option<Version>, ) -> CrateId { let data = CrateData { root_file_id, @@ -486,7 +448,7 @@ impl CrateGraph { origin, target_layout, is_proc_macro, - channel, + toolchain, }; self.arena.alloc(data) } @@ -784,6 +746,7 @@ impl FromStr for Edition { "2015" => Edition::Edition2015, "2018" => Edition::Edition2018, "2021" => Edition::Edition2021, + "2024" => Edition::Edition2024, _ => return Err(ParseEditionError { invalid_input: s.to_string() }), }; Ok(res) @@ -796,6 +759,7 @@ impl fmt::Display for Edition { Edition::Edition2015 => "2015", Edition::Edition2018 => "2018", Edition::Edition2021 => "2021", + Edition::Edition2024 => "2024", }) } } diff --git a/src/tools/rust-analyzer/crates/base-db/src/lib.rs b/src/tools/rust-analyzer/crates/base-db/src/lib.rs index 57e7934367b..a0a55df5f99 100644 --- a/src/tools/rust-analyzer/crates/base-db/src/lib.rs +++ b/src/tools/rust-analyzer/crates/base-db/src/lib.rs @@ -4,27 +4,27 @@ mod input; mod change; -pub mod fixture; -pub mod span; use std::panic; use rustc_hash::FxHashSet; -use syntax::{ast, Parse, SourceFile, TextRange, TextSize}; +use syntax::{ast, Parse, SourceFile}; use triomphe::Arc; pub use crate::{ - change::Change, + change::FileChange, input::{ CrateData, CrateDisplayName, CrateGraph, CrateId, CrateName, CrateOrigin, Dependency, - DependencyKind, Edition, Env, LangCrateOrigin, ProcMacro, ProcMacroExpander, - ProcMacroExpansionError, ProcMacroId, ProcMacroKind, ProcMacroLoadResult, ProcMacroPaths, - ProcMacros, ReleaseChannel, SourceRoot, SourceRootId, TargetLayoutLoadResult, + DependencyKind, Edition, Env, LangCrateOrigin, ProcMacroPaths, ReleaseChannel, SourceRoot, + SourceRootId, TargetLayoutLoadResult, }, }; pub use salsa::{self, Cancelled}; +pub use span::{FilePosition, FileRange}; pub use vfs::{file_set::FileSet, AnchoredPath, AnchoredPathBuf, FileId, VfsPath}; +pub use semver::{BuildMetadata, Prerelease, Version, VersionReq}; + #[macro_export] macro_rules! impl_intern_key { ($name:ident) => { @@ -43,18 +43,6 @@ pub trait Upcast<T: ?Sized> { fn upcast(&self) -> &T; } -#[derive(Clone, Copy, Debug)] -pub struct FilePosition { - pub file_id: FileId, - pub offset: TextSize, -} - -#[derive(Clone, Copy, Debug, Eq, PartialEq, Hash)] -pub struct FileRange { - pub file_id: FileId, - pub range: TextRange, -} - pub const DEFAULT_PARSE_LRU_CAP: usize = 128; pub trait FileLoader { @@ -74,10 +62,6 @@ pub trait SourceDatabase: FileLoader + std::fmt::Debug { /// The crate graph. #[salsa::input] fn crate_graph(&self) -> Arc<CrateGraph>; - - /// The proc macros. - #[salsa::input] - fn proc_macros(&self) -> Arc<ProcMacros>; } fn parse(db: &dyn SourceDatabase, file_id: FileId) -> Parse<ast::SourceFile> { diff --git a/src/tools/rust-analyzer/crates/cfg/Cargo.toml b/src/tools/rust-analyzer/crates/cfg/Cargo.toml index 4324584df39..fbda065b10f 100644 --- a/src/tools/rust-analyzer/crates/cfg/Cargo.toml +++ b/src/tools/rust-analyzer/crates/cfg/Cargo.toml @@ -12,7 +12,7 @@ rust-version.workspace = true doctest = false [dependencies] -rustc-hash = "1.1.0" +rustc-hash.workspace = true # locals deps tt.workspace = true @@ -29,3 +29,6 @@ derive_arbitrary = "1.3.2" # local deps mbe.workspace = true syntax.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/cfg/src/tests.rs b/src/tools/rust-analyzer/crates/cfg/src/tests.rs index c7ac1af934a..62fb429a63f 100644 --- a/src/tools/rust-analyzer/crates/cfg/src/tests.rs +++ b/src/tools/rust-analyzer/crates/cfg/src/tests.rs @@ -1,6 +1,6 @@ use arbitrary::{Arbitrary, Unstructured}; use expect_test::{expect, Expect}; -use mbe::{syntax_node_to_token_tree, DummyTestSpanMap}; +use mbe::{syntax_node_to_token_tree, DummyTestSpanMap, DUMMY}; use syntax::{ast, AstNode}; use crate::{CfgAtom, CfgExpr, CfgOptions, DnfExpr}; @@ -8,7 +8,7 @@ use crate::{CfgAtom, CfgExpr, CfgOptions, DnfExpr}; fn assert_parse_result(input: &str, expected: CfgExpr) { let source_file = ast::SourceFile::parse(input).ok().unwrap(); let tt = source_file.syntax().descendants().find_map(ast::TokenTree::cast).unwrap(); - let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap); + let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap, DUMMY); let cfg = CfgExpr::parse(&tt); assert_eq!(cfg, expected); } @@ -16,7 +16,7 @@ fn assert_parse_result(input: &str, expected: CfgExpr) { fn check_dnf(input: &str, expect: Expect) { let source_file = ast::SourceFile::parse(input).ok().unwrap(); let tt = source_file.syntax().descendants().find_map(ast::TokenTree::cast).unwrap(); - let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap); + let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap, DUMMY); let cfg = CfgExpr::parse(&tt); let actual = format!("#![cfg({})]", DnfExpr::new(cfg)); expect.assert_eq(&actual); @@ -25,7 +25,7 @@ fn check_dnf(input: &str, expect: Expect) { fn check_why_inactive(input: &str, opts: &CfgOptions, expect: Expect) { let source_file = ast::SourceFile::parse(input).ok().unwrap(); let tt = source_file.syntax().descendants().find_map(ast::TokenTree::cast).unwrap(); - let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap); + let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap, DUMMY); let cfg = CfgExpr::parse(&tt); let dnf = DnfExpr::new(cfg); let why_inactive = dnf.why_inactive(opts).unwrap().to_string(); @@ -36,7 +36,7 @@ fn check_why_inactive(input: &str, opts: &CfgOptions, expect: Expect) { fn check_enable_hints(input: &str, opts: &CfgOptions, expected_hints: &[&str]) { let source_file = ast::SourceFile::parse(input).ok().unwrap(); let tt = source_file.syntax().descendants().find_map(ast::TokenTree::cast).unwrap(); - let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap); + let tt = syntax_node_to_token_tree(tt.syntax(), DummyTestSpanMap, DUMMY); let cfg = CfgExpr::parse(&tt); let dnf = DnfExpr::new(cfg); let hints = dnf.compute_enable_hints(opts).map(|diff| diff.to_string()).collect::<Vec<_>>(); diff --git a/src/tools/rust-analyzer/crates/flycheck/Cargo.toml b/src/tools/rust-analyzer/crates/flycheck/Cargo.toml index 4322d2d966a..b8c10da1b6e 100644 --- a/src/tools/rust-analyzer/crates/flycheck/Cargo.toml +++ b/src/tools/rust-analyzer/crates/flycheck/Cargo.toml @@ -13,14 +13,17 @@ doctest = false [dependencies] cargo_metadata.workspace = true -crossbeam-channel = "0.5.8" +crossbeam-channel.workspace = true tracing.workspace = true -rustc-hash = "1.1.0" +rustc-hash.workspace = true serde_json.workspace = true serde.workspace = true -command-group = "2.0.1" +command-group.workspace = true # local deps paths.workspace = true stdx.workspace = true toolchain.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/hir-def/Cargo.toml b/src/tools/rust-analyzer/crates/hir-def/Cargo.toml index 2d174517605..5933d30040f 100644 --- a/src/tools/rust-analyzer/crates/hir-def/Cargo.toml +++ b/src/tools/rust-analyzer/crates/hir-def/Cargo.toml @@ -12,7 +12,7 @@ rust-version.workspace = true doctest = false [dependencies] -arrayvec = "0.7.2" +arrayvec.workspace = true bitflags.workspace = true cov-mark = "2.0.0-pre.1" dashmap.workspace = true @@ -23,7 +23,7 @@ indexmap.workspace = true itertools.workspace = true la-arena.workspace = true once_cell = "1.17.0" -rustc-hash = "1.1.0" +rustc-hash.workspace = true tracing.workspace = true smallvec.workspace = true hashbrown.workspace = true @@ -42,13 +42,18 @@ mbe.workspace = true cfg.workspace = true tt.workspace = true limit.workspace = true +span.workspace = true [dev-dependencies] -expect-test = "1.4.0" +expect-test.workspace = true # local deps test-utils.workspace = true +test-fixture.workspace = true [features] in-rust-tree = ["rustc-dependencies/in-rust-tree"] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/hir-def/src/attr.rs b/src/tools/rust-analyzer/crates/hir-def/src/attr.rs index 942b28fc145..26f76afb1f0 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/attr.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/attr.rs @@ -637,9 +637,12 @@ impl<'attr> AttrQuery<'attr> { } } -fn any_has_attrs( - db: &dyn DefDatabase, - id: impl Lookup<Data = impl HasSource<Value = impl ast::HasAttrs>>, +fn any_has_attrs<'db>( + db: &(dyn DefDatabase + 'db), + id: impl Lookup< + Database<'db> = dyn DefDatabase + 'db, + Data = impl HasSource<Value = impl ast::HasAttrs>, + >, ) -> InFile<ast::AnyHasAttrs> { id.lookup(db).source(db).map(ast::AnyHasAttrs::new) } @@ -650,17 +653,17 @@ fn attrs_from_item_tree<N: ItemTreeNode>(db: &dyn DefDatabase, id: ItemTreeId<N> tree.raw_attrs(mod_item.into()).clone() } -fn attrs_from_item_tree_loc<N: ItemTreeNode>( - db: &dyn DefDatabase, - lookup: impl Lookup<Data = ItemLoc<N>>, +fn attrs_from_item_tree_loc<'db, N: ItemTreeNode>( + db: &(dyn DefDatabase + 'db), + lookup: impl Lookup<Database<'db> = dyn DefDatabase + 'db, Data = ItemLoc<N>>, ) -> RawAttrs { let id = lookup.lookup(db).id; attrs_from_item_tree(db, id) } -fn attrs_from_item_tree_assoc<N: ItemTreeNode>( - db: &dyn DefDatabase, - lookup: impl Lookup<Data = AssocItemLoc<N>>, +fn attrs_from_item_tree_assoc<'db, N: ItemTreeNode>( + db: &(dyn DefDatabase + 'db), + lookup: impl Lookup<Database<'db> = dyn DefDatabase + 'db, Data = AssocItemLoc<N>>, ) -> RawAttrs { let id = lookup.lookup(db).id; attrs_from_item_tree(db, id) diff --git a/src/tools/rust-analyzer/crates/hir-def/src/attr/tests.rs b/src/tools/rust-analyzer/crates/hir-def/src/attr/tests.rs index 0f98a4ec93c..1a63e96bfa9 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/attr/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/attr/tests.rs @@ -1,19 +1,23 @@ //! This module contains tests for doc-expression parsing. //! Currently, it tests `#[doc(hidden)]` and `#[doc(alias)]`. +use triomphe::Arc; + use base_db::FileId; -use hir_expand::span::{RealSpanMap, SpanMapRef}; +use hir_expand::span_map::{RealSpanMap, SpanMap}; use mbe::syntax_node_to_token_tree; -use syntax::{ast, AstNode}; +use syntax::{ast, AstNode, TextRange}; use crate::attr::{DocAtom, DocExpr}; fn assert_parse_result(input: &str, expected: DocExpr) { let source_file = ast::SourceFile::parse(input).ok().unwrap(); let tt = source_file.syntax().descendants().find_map(ast::TokenTree::cast).unwrap(); + let map = SpanMap::RealSpanMap(Arc::new(RealSpanMap::absolute(FileId::from_raw(0)))); let tt = syntax_node_to_token_tree( tt.syntax(), - SpanMapRef::RealSpanMap(&RealSpanMap::absolute(FileId::from_raw(0))), + map.as_ref(), + map.span_for_range(TextRange::empty(0.into())), ); let cfg = DocExpr::parse(&tt); assert_eq!(cfg, expected); diff --git a/src/tools/rust-analyzer/crates/hir-def/src/body/lower.rs b/src/tools/rust-analyzer/crates/hir-def/src/body/lower.rs index c6a90932015..a45ec844aba 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/body/lower.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/body/lower.rs @@ -8,7 +8,7 @@ use either::Either; use hir_expand::{ ast_id_map::AstIdMap, name::{name, AsName, Name}, - AstId, ExpandError, InFile, + ExpandError, InFile, }; use intern::Interned; use profile::Count; @@ -66,7 +66,7 @@ pub(super) fn lower( krate, def_map: expander.module.def_map(db), source_map: BodySourceMap::default(), - ast_id_map: db.ast_id_map(expander.current_file_id), + ast_id_map: db.ast_id_map(expander.current_file_id()), body: Body { exprs: Default::default(), pats: Default::default(), @@ -408,7 +408,7 @@ impl ExprCollector<'_> { ast::Expr::ParenExpr(e) => { let inner = self.collect_expr_opt(e.expr()); // make the paren expr point to the inner expression as well - let src = self.expander.to_source(syntax_ptr); + let src = self.expander.in_file(syntax_ptr); self.source_map.expr_map.insert(src, inner); inner } @@ -441,7 +441,7 @@ impl ExprCollector<'_> { Some(e) => self.collect_expr(e), None => self.missing_expr(), }; - let src = self.expander.to_source(AstPtr::new(&field)); + let src = self.expander.in_file(AstPtr::new(&field)); self.source_map.field_map_back.insert(expr, src); Some(RecordLitField { name, expr }) }) @@ -644,7 +644,7 @@ impl ExprCollector<'_> { Some(id) => { // Make the macro-call point to its expanded expression so we can query // semantics on syntax pointers to the macro - let src = self.expander.to_source(syntax_ptr); + let src = self.expander.in_file(syntax_ptr); self.source_map.expr_map.insert(src, id); id } @@ -957,22 +957,31 @@ impl ExprCollector<'_> { T: ast::AstNode, { // File containing the macro call. Expansion errors will be attached here. - let outer_file = self.expander.current_file_id; + let outer_file = self.expander.current_file_id(); - let macro_call_ptr = self.expander.to_source(AstPtr::new(&mcall)); + let macro_call_ptr = self.expander.in_file(syntax_ptr); let module = self.expander.module.local_id; - let res = self.expander.enter_expand(self.db, mcall, |path| { - self.def_map - .resolve_path( - self.db, - module, - &path, - crate::item_scope::BuiltinShadowMode::Other, - Some(MacroSubNs::Bang), - ) - .0 - .take_macros() - }); + + let res = match self.def_map.modules[module] + .scope + .macro_invocations + .get(&InFile::new(outer_file, self.ast_id_map.ast_id_for_ptr(syntax_ptr))) + { + // fast path, macro call is in a block module + Some(&call) => Ok(self.expander.enter_expand_id(self.db, call)), + None => self.expander.enter_expand(self.db, mcall, |path| { + self.def_map + .resolve_path( + self.db, + module, + &path, + crate::item_scope::BuiltinShadowMode::Other, + Some(MacroSubNs::Bang), + ) + .0 + .take_macros() + }), + }; let res = match res { Ok(res) => res, @@ -986,7 +995,6 @@ impl ExprCollector<'_> { return collector(self, None); } }; - if record_diagnostics { match &res.err { Some(ExpandError::UnresolvedProcMacro(krate)) => { @@ -1013,10 +1021,10 @@ impl ExprCollector<'_> { Some((mark, expansion)) => { // Keep collecting even with expansion errors so we can provide completions and // other services in incomplete macro expressions. - self.source_map.expansions.insert(macro_call_ptr, self.expander.current_file_id); + self.source_map.expansions.insert(macro_call_ptr, self.expander.current_file_id()); let prev_ast_id_map = mem::replace( &mut self.ast_id_map, - self.db.ast_id_map(self.expander.current_file_id), + self.db.ast_id_map(self.expander.current_file_id()), ); if record_diagnostics { @@ -1066,7 +1074,7 @@ impl ExprCollector<'_> { Some(tail) => { // Make the macro-call point to its expanded expression so we can query // semantics on syntax pointers to the macro - let src = self.expander.to_source(syntax_ptr); + let src = self.expander.in_file(syntax_ptr); self.source_map.expr_map.insert(src, tail); Some(tail) } @@ -1140,7 +1148,7 @@ impl ExprCollector<'_> { let block_id = if block_has_items { let file_local_id = self.ast_id_map.ast_id(&block); - let ast_id = AstId::new(self.expander.current_file_id, file_local_id); + let ast_id = self.expander.in_file(file_local_id); Some(self.db.intern_block(BlockLoc { ast_id, module: self.expander.module })) } else { None @@ -1333,7 +1341,7 @@ impl ExprCollector<'_> { let ast_pat = f.pat()?; let pat = self.collect_pat(ast_pat, binding_list); let name = f.field_name()?.as_name(); - let src = self.expander.to_source(AstPtr::new(&f)); + let src = self.expander.in_file(AstPtr::new(&f)); self.source_map.pat_field_map_back.insert(pat, src); Some(RecordFieldPat { name, pat }) }) @@ -1391,7 +1399,7 @@ impl ExprCollector<'_> { ast::Pat::MacroPat(mac) => match mac.macro_call() { Some(call) => { let macro_ptr = AstPtr::new(&call); - let src = self.expander.to_source(AstPtr::new(&Either::Left(pat))); + let src = self.expander.in_file(AstPtr::new(&Either::Left(pat))); let pat = self.collect_macro_call(call, macro_ptr, true, |this, expanded_pat| { this.collect_pat_opt(expanded_pat, binding_list) @@ -1472,10 +1480,7 @@ impl ExprCollector<'_> { } self.source_map.diagnostics.push(BodyDiagnostic::InactiveCode { - node: InFile::new( - self.expander.current_file_id, - SyntaxNodePtr::new(owner.syntax()), - ), + node: self.expander.in_file(SyntaxNodePtr::new(owner.syntax())), cfg, opts: self.expander.cfg_options().clone(), }); @@ -1514,10 +1519,7 @@ impl ExprCollector<'_> { } else { Err(BodyDiagnostic::UnreachableLabel { name, - node: InFile::new( - self.expander.current_file_id, - AstPtr::new(&lifetime), - ), + node: self.expander.in_file(AstPtr::new(&lifetime)), }) }; } @@ -1526,7 +1528,7 @@ impl ExprCollector<'_> { Err(BodyDiagnostic::UndeclaredLabel { name, - node: InFile::new(self.expander.current_file_id, AstPtr::new(&lifetime)), + node: self.expander.in_file(AstPtr::new(&lifetime)), }) } @@ -1990,7 +1992,7 @@ fn pat_literal_to_hir(lit: &ast::LiteralPat) -> Option<(Literal, ast::Literal)> impl ExprCollector<'_> { fn alloc_expr(&mut self, expr: Expr, ptr: ExprPtr) -> ExprId { - let src = self.expander.to_source(ptr); + let src = self.expander.in_file(ptr); let id = self.body.exprs.alloc(expr); self.source_map.expr_map_back.insert(id, src.clone()); self.source_map.expr_map.insert(src, id); @@ -2018,7 +2020,7 @@ impl ExprCollector<'_> { } fn alloc_pat(&mut self, pat: Pat, ptr: PatPtr) -> PatId { - let src = self.expander.to_source(ptr); + let src = self.expander.in_file(ptr); let id = self.body.pats.alloc(pat); self.source_map.pat_map_back.insert(id, src.clone()); self.source_map.pat_map.insert(src, id); @@ -2033,7 +2035,7 @@ impl ExprCollector<'_> { } fn alloc_label(&mut self, label: Label, ptr: LabelPtr) -> LabelId { - let src = self.expander.to_source(ptr); + let src = self.expander.in_file(ptr); let id = self.body.labels.alloc(label); self.source_map.label_map_back.insert(id, src.clone()); self.source_map.label_map.insert(src, id); diff --git a/src/tools/rust-analyzer/crates/hir-def/src/body/scope.rs b/src/tools/rust-analyzer/crates/hir-def/src/body/scope.rs index baca293e290..ab623250d40 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/body/scope.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/body/scope.rs @@ -267,9 +267,10 @@ fn compute_expr_scopes(expr: ExprId, body: &Body, scopes: &mut ExprScopes, scope #[cfg(test)] mod tests { - use base_db::{fixture::WithFixture, FileId, SourceDatabase}; + use base_db::{FileId, SourceDatabase}; use hir_expand::{name::AsName, InFile}; use syntax::{algo::find_node_at_offset, ast, AstNode}; + use test_fixture::WithFixture; use test_utils::{assert_eq_text, extract_offset}; use crate::{db::DefDatabase, test_db::TestDB, FunctionId, ModuleDefId}; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/body/tests.rs b/src/tools/rust-analyzer/crates/hir-def/src/body/tests.rs index 2b432dfbb92..a76ddffb411 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/body/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/body/tests.rs @@ -1,7 +1,8 @@ mod block; -use base_db::{fixture::WithFixture, SourceDatabase}; +use base_db::SourceDatabase; use expect_test::{expect, Expect}; +use test_fixture::WithFixture; use crate::{test_db::TestDB, ModuleDefId}; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/data.rs b/src/tools/rust-analyzer/crates/hir-def/src/data.rs index 635d13f24ad..9c183c9332b 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/data.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/data.rs @@ -16,7 +16,7 @@ use crate::{ db::DefDatabase, expander::{Expander, Mark}, item_tree::{self, AssocItem, FnFlags, ItemTree, ItemTreeId, MacroCall, ModItem, TreeId}, - macro_call_as_call_id, macro_id_to_def_id, + macro_call_as_call_id, nameres::{ attr_resolution::ResolvedAttr, diagnostics::DefDiagnostic, @@ -720,7 +720,7 @@ impl<'a> AssocItemCollector<'a> { ) .0 .take_macros() - .map(|it| macro_id_to_def_id(self.db, it)) + .map(|it| self.db.macro_def(it)) }; match macro_call_as_call_id( self.db.upcast(), diff --git a/src/tools/rust-analyzer/crates/hir-def/src/db.rs b/src/tools/rust-analyzer/crates/hir-def/src/db.rs index 31c1a713031..d5831022f28 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/db.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/db.rs @@ -1,7 +1,7 @@ //! Defines database & queries for name resolution. use base_db::{salsa, CrateId, SourceDatabase, Upcast}; use either::Either; -use hir_expand::{db::ExpandDatabase, HirFileId}; +use hir_expand::{db::ExpandDatabase, HirFileId, MacroDefId}; use intern::Interned; use la_arena::ArenaMap; use syntax::{ast, AstPtr}; @@ -24,9 +24,10 @@ use crate::{ AttrDefId, BlockId, BlockLoc, ConstBlockId, ConstBlockLoc, ConstId, ConstLoc, DefWithBodyId, EnumId, EnumLoc, ExternBlockId, ExternBlockLoc, ExternCrateId, ExternCrateLoc, FunctionId, FunctionLoc, GenericDefId, ImplId, ImplLoc, InTypeConstId, InTypeConstLoc, LocalEnumVariantId, - LocalFieldId, Macro2Id, Macro2Loc, MacroRulesId, MacroRulesLoc, ProcMacroId, ProcMacroLoc, - StaticId, StaticLoc, StructId, StructLoc, TraitAliasId, TraitAliasLoc, TraitId, TraitLoc, - TypeAliasId, TypeAliasLoc, UnionId, UnionLoc, UseId, UseLoc, VariantId, + LocalFieldId, Macro2Id, Macro2Loc, MacroId, MacroRulesId, MacroRulesLoc, MacroRulesLocFlags, + ProcMacroId, ProcMacroLoc, StaticId, StaticLoc, StructId, StructLoc, TraitAliasId, + TraitAliasLoc, TraitId, TraitLoc, TypeAliasId, TypeAliasLoc, UnionId, UnionLoc, UseId, UseLoc, + VariantId, }; #[salsa::query_group(InternDatabaseStorage)] @@ -110,6 +111,8 @@ pub trait DefDatabase: InternDatabase + ExpandDatabase + Upcast<dyn ExpandDataba #[salsa::invoke(DefMap::block_def_map_query)] fn block_def_map(&self, block: BlockId) -> Arc<DefMap>; + fn macro_def(&self, m: MacroId) -> MacroDefId; + // region:data #[salsa::invoke(StructData::struct_data_query)] @@ -239,12 +242,6 @@ pub trait DefDatabase: InternDatabase + ExpandDatabase + Upcast<dyn ExpandDataba #[salsa::invoke(LangItems::crate_lang_items_query)] fn crate_lang_items(&self, krate: CrateId) -> Arc<LangItems>; - #[salsa::transparent] - fn crate_limits(&self, crate_id: CrateId) -> CrateLimits; - - #[salsa::transparent] - fn recursion_limit(&self, crate_id: CrateId) -> u32; - fn crate_supports_no_std(&self, crate_id: CrateId) -> bool; } @@ -253,24 +250,6 @@ fn crate_def_map_wait(db: &dyn DefDatabase, krate: CrateId) -> Arc<DefMap> { db.crate_def_map_query(krate) } -pub struct CrateLimits { - /// The maximum depth for potentially infinitely-recursive compile-time operations like macro expansion or auto-dereference. - pub recursion_limit: u32, -} - -fn crate_limits(db: &dyn DefDatabase, crate_id: CrateId) -> CrateLimits { - let def_map = db.crate_def_map(crate_id); - - CrateLimits { - // 128 is the default in rustc. - recursion_limit: def_map.recursion_limit().unwrap_or(128), - } -} - -fn recursion_limit(db: &dyn DefDatabase, crate_id: CrateId) -> u32 { - db.crate_limits(crate_id).recursion_limit -} - fn crate_supports_no_std(db: &dyn DefDatabase, crate_id: CrateId) -> bool { let file = db.crate_graph()[crate_id].root_file_id; let item_tree = db.file_item_tree(file.into()); @@ -305,3 +284,78 @@ fn crate_supports_no_std(db: &dyn DefDatabase, crate_id: CrateId) -> bool { false } + +fn macro_def(db: &dyn DefDatabase, id: MacroId) -> MacroDefId { + use hir_expand::InFile; + + use crate::{Lookup, MacroDefKind, MacroExpander}; + + let kind = |expander, file_id, m| { + let in_file = InFile::new(file_id, m); + match expander { + MacroExpander::Declarative => MacroDefKind::Declarative(in_file), + MacroExpander::BuiltIn(it) => MacroDefKind::BuiltIn(it, in_file), + MacroExpander::BuiltInAttr(it) => MacroDefKind::BuiltInAttr(it, in_file), + MacroExpander::BuiltInDerive(it) => MacroDefKind::BuiltInDerive(it, in_file), + MacroExpander::BuiltInEager(it) => MacroDefKind::BuiltInEager(it, in_file), + } + }; + + match id { + MacroId::Macro2Id(it) => { + let loc: Macro2Loc = it.lookup(db); + + let item_tree = loc.id.item_tree(db); + let makro = &item_tree[loc.id.value]; + MacroDefId { + krate: loc.container.krate, + kind: kind(loc.expander, loc.id.file_id(), makro.ast_id.upcast()), + local_inner: false, + allow_internal_unsafe: loc.allow_internal_unsafe, + span: db + .span_map(loc.id.file_id()) + .span_for_range(db.ast_id_map(loc.id.file_id()).get(makro.ast_id).text_range()), + edition: loc.edition, + } + } + + MacroId::MacroRulesId(it) => { + let loc: MacroRulesLoc = it.lookup(db); + + let item_tree = loc.id.item_tree(db); + let makro = &item_tree[loc.id.value]; + MacroDefId { + krate: loc.container.krate, + kind: kind(loc.expander, loc.id.file_id(), makro.ast_id.upcast()), + local_inner: loc.flags.contains(MacroRulesLocFlags::LOCAL_INNER), + allow_internal_unsafe: loc + .flags + .contains(MacroRulesLocFlags::ALLOW_INTERNAL_UNSAFE), + span: db + .span_map(loc.id.file_id()) + .span_for_range(db.ast_id_map(loc.id.file_id()).get(makro.ast_id).text_range()), + edition: loc.edition, + } + } + MacroId::ProcMacroId(it) => { + let loc = it.lookup(db); + + let item_tree = loc.id.item_tree(db); + let makro = &item_tree[loc.id.value]; + MacroDefId { + krate: loc.container.krate, + kind: MacroDefKind::ProcMacro( + loc.expander, + loc.kind, + InFile::new(loc.id.file_id(), makro.ast_id), + ), + local_inner: false, + allow_internal_unsafe: false, + span: db + .span_map(loc.id.file_id()) + .span_for_range(db.ast_id_map(loc.id.file_id()).get(makro.ast_id).text_range()), + edition: loc.edition, + } + } + } +} diff --git a/src/tools/rust-analyzer/crates/hir-def/src/expander.rs b/src/tools/rust-analyzer/crates/hir-def/src/expander.rs index 398f116d831..b83feeedc34 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/expander.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/expander.rs @@ -4,15 +4,15 @@ use base_db::CrateId; use cfg::CfgOptions; use drop_bomb::DropBomb; use hir_expand::{ - attrs::RawAttrs, mod_path::ModPath, span::SpanMap, ExpandError, ExpandResult, HirFileId, + attrs::RawAttrs, mod_path::ModPath, span_map::SpanMap, ExpandError, ExpandResult, HirFileId, InFile, MacroCallId, }; use limit::Limit; -use syntax::{ast, Parse, SyntaxNode}; +use syntax::{ast, Parse}; use crate::{ - attr::Attrs, db::DefDatabase, lower::LowerCtx, macro_id_to_def_id, path::Path, AsMacroCall, - MacroId, ModuleId, UnresolvedMacro, + attr::Attrs, db::DefDatabase, lower::LowerCtx, path::Path, AsMacroCall, MacroId, ModuleId, + UnresolvedMacro, }; #[derive(Debug)] @@ -20,7 +20,7 @@ pub struct Expander { cfg_options: CfgOptions, span_map: SpanMap, krate: CrateId, - pub(crate) current_file_id: HirFileId, + current_file_id: HirFileId, pub(crate) module: ModuleId, /// `recursion_depth == usize::MAX` indicates that the recursion limit has been reached. recursion_depth: u32, @@ -29,12 +29,13 @@ pub struct Expander { impl Expander { pub fn new(db: &dyn DefDatabase, current_file_id: HirFileId, module: ModuleId) -> Expander { - let recursion_limit = db.recursion_limit(module.krate); - #[cfg(not(test))] - let recursion_limit = Limit::new(recursion_limit as usize); - // Without this, `body::tests::your_stack_belongs_to_me` stack-overflows in debug - #[cfg(test)] - let recursion_limit = Limit::new(std::cmp::min(32, recursion_limit as usize)); + let recursion_limit = module.def_map(db).recursion_limit() as usize; + let recursion_limit = Limit::new(if cfg!(test) { + // Without this, `body::tests::your_stack_belongs_to_me` stack-overflows in debug + std::cmp::min(32, recursion_limit) + } else { + recursion_limit + }); Expander { current_file_id, module, @@ -56,9 +57,9 @@ impl Expander { let mut unresolved_macro_err = None; let result = self.within_limit(db, |this| { - let macro_call = InFile::new(this.current_file_id, ¯o_call); + let macro_call = this.in_file(¯o_call); match macro_call.as_call_id_with_errors(db.upcast(), this.module.krate(), |path| { - resolver(path).map(|it| macro_id_to_def_id(db, it)) + resolver(path).map(|it| db.macro_def(it)) }) { Ok(call_id) => call_id, Err(resolve_err) => { @@ -83,17 +84,6 @@ impl Expander { self.within_limit(db, |_this| ExpandResult::ok(Some(call_id))) } - fn enter_expand_inner( - db: &dyn DefDatabase, - call_id: MacroCallId, - error: Option<ExpandError>, - ) -> ExpandResult<Option<InFile<Parse<SyntaxNode>>>> { - let macro_file = call_id.as_macro_file(); - let ExpandResult { value, err } = db.parse_macro_expansion(macro_file); - - ExpandResult { value: Some(InFile::new(macro_file.into(), value.0)), err: error.or(err) } - } - pub fn exit(&mut self, mut mark: Mark) { self.span_map = mark.span_map; self.current_file_id = mark.file_id; @@ -113,7 +103,7 @@ impl Expander { LowerCtx::new(db, self.span_map.clone(), self.current_file_id) } - pub(crate) fn to_source<T>(&self, value: T) -> InFile<T> { + pub(crate) fn in_file<T>(&self, value: T) -> InFile<T> { InFile { file_id: self.current_file_id, value } } @@ -164,26 +154,34 @@ impl Expander { return ExpandResult { value: None, err }; }; - let res = Self::enter_expand_inner(db, call_id, err); - match res.err { - // If proc-macro is disabled or unresolved, we want to expand to a missing expression - // instead of an empty tree which might end up in an empty block. - Some(ExpandError::UnresolvedProcMacro(_)) => res.map(|_| None), - _ => res.map(|value| { - value.and_then(|InFile { file_id, value }| { - let parse = value.cast::<T>()?; + let macro_file = call_id.as_macro_file(); + let res = db.parse_macro_expansion(macro_file); + + let err = err.or(res.err); + ExpandResult { + value: match err { + // If proc-macro is disabled or unresolved, we want to expand to a missing expression + // instead of an empty tree which might end up in an empty block. + Some(ExpandError::UnresolvedProcMacro(_)) => None, + _ => (|| { + let parse = res.value.0.cast::<T>()?; self.recursion_depth += 1; - let old_span_map = std::mem::replace(&mut self.span_map, db.span_map(file_id)); - let old_file_id = std::mem::replace(&mut self.current_file_id, file_id); + let old_span_map = std::mem::replace( + &mut self.span_map, + SpanMap::ExpansionSpanMap(res.value.1), + ); + let old_file_id = + std::mem::replace(&mut self.current_file_id, macro_file.into()); let mark = Mark { file_id: old_file_id, span_map: old_span_map, bomb: DropBomb::new("expansion mark dropped"), }; Some((mark, parse)) - }) - }), + })(), + }, + err, } } } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/find_path.rs b/src/tools/rust-analyzer/crates/hir-def/src/find_path.rs index 13af0b0218e..4737b48703d 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/find_path.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/find_path.rs @@ -585,9 +585,9 @@ fn find_local_import_locations( #[cfg(test)] mod tests { - use base_db::fixture::WithFixture; use hir_expand::db::ExpandDatabase; use syntax::ast::AstNode; + use test_fixture::WithFixture; use crate::test_db::TestDB; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/import_map.rs b/src/tools/rust-analyzer/crates/hir-def/src/import_map.rs index 26d333f9a0b..aea7229bd64 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/import_map.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/import_map.rs @@ -469,8 +469,9 @@ pub fn search_dependencies( #[cfg(test)] mod tests { - use base_db::{fixture::WithFixture, SourceDatabase, Upcast}; + use base_db::{SourceDatabase, Upcast}; use expect_test::{expect, Expect}; + use test_fixture::WithFixture; use crate::{db::DefDatabase, test_db::TestDB, ItemContainerId, Lookup}; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/item_scope.rs b/src/tools/rust-analyzer/crates/hir-def/src/item_scope.rs index ce83cb435e2..4902f24e2e3 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/item_scope.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/item_scope.rs @@ -102,8 +102,10 @@ pub struct ItemScope { // FIXME: Macro shadowing in one module is not properly handled. Non-item place macros will // be all resolved to the last one defined if shadowing happens. legacy_macros: FxHashMap<Name, SmallVec<[MacroId; 1]>>, - /// The derive macro invocations in this scope. + /// The attribute macro invocations in this scope. attr_macros: FxHashMap<AstId<ast::Item>, MacroCallId>, + /// The macro invocations in this scope. + pub macro_invocations: FxHashMap<AstId<ast::MacroCall>, MacroCallId>, /// The derive macro invocations in this scope, keyed by the owner item over the actual derive attributes /// paired with the derive macro invocations for the specific attribute. derive_macros: FxHashMap<AstId<ast::Adt>, SmallVec<[DeriveMacroInvocation; 1]>>, @@ -345,6 +347,10 @@ impl ItemScope { self.attr_macros.insert(item, call); } + pub(crate) fn add_macro_invoc(&mut self, call: AstId<ast::MacroCall>, call_id: MacroCallId) { + self.macro_invocations.insert(call, call_id); + } + pub(crate) fn attr_macro_invocs( &self, ) -> impl Iterator<Item = (AstId<ast::Item>, MacroCallId)> + '_ { @@ -692,6 +698,7 @@ impl ItemScope { use_imports_values, use_imports_types, use_imports_macros, + macro_invocations, } = self; types.shrink_to_fit(); values.shrink_to_fit(); @@ -709,6 +716,7 @@ impl ItemScope { derive_macros.shrink_to_fit(); extern_crate_decls.shrink_to_fit(); use_decls.shrink_to_fit(); + macro_invocations.shrink_to_fit(); } } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/item_tree.rs b/src/tools/rust-analyzer/crates/hir-def/src/item_tree.rs index 3d2cddffa3b..20e4e44339e 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/item_tree.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/item_tree.rs @@ -29,6 +29,9 @@ //! //! In general, any item in the `ItemTree` stores its `AstId`, which allows mapping it back to its //! surface syntax. +//! +//! Note that we cannot store [`span::Span`]s inside of this, as typing in an item invalidates its +//! encompassing span! mod lower; mod pretty; @@ -42,7 +45,7 @@ use std::{ }; use ast::{AstNode, HasName, StructKind}; -use base_db::{span::SyntaxContextId, CrateId}; +use base_db::CrateId; use either::Either; use hir_expand::{ ast_id_map::{AstIdNode, FileAstId}, @@ -55,6 +58,7 @@ use la_arena::{Arena, Idx, IdxRange, RawIdx}; use profile::Count; use rustc_hash::FxHashMap; use smallvec::SmallVec; +use span::Span; use stdx::never; use syntax::{ast, match_ast, SyntaxKind}; use triomphe::Arc; @@ -280,7 +284,7 @@ struct ItemTreeData { mods: Arena<Mod>, macro_calls: Arena<MacroCall>, macro_rules: Arena<MacroRules>, - macro_defs: Arena<MacroDef>, + macro_defs: Arena<Macro2>, vis: ItemVisibilities, } @@ -513,7 +517,7 @@ mod_items! { Mod in mods -> ast::Module, MacroCall in macro_calls -> ast::MacroCall, MacroRules in macro_rules -> ast::MacroRules, - MacroDef in macro_defs -> ast::MacroDef, + Macro2 in macro_defs -> ast::MacroDef, } macro_rules! impl_index { @@ -746,7 +750,8 @@ pub struct MacroCall { pub path: Interned<ModPath>, pub ast_id: FileAstId<ast::MacroCall>, pub expand_to: ExpandTo, - pub call_site: SyntaxContextId, + // FIXME: We need to move this out. It invalidates the item tree when typing inside the macro call. + pub call_site: Span, } #[derive(Debug, Clone, Eq, PartialEq)] @@ -758,7 +763,7 @@ pub struct MacroRules { /// "Macros 2.0" macro definition. #[derive(Debug, Clone, Eq, PartialEq)] -pub struct MacroDef { +pub struct Macro2 { pub name: Name, pub visibility: RawVisibilityId, pub ast_id: FileAstId<ast::MacroDef>, @@ -917,7 +922,7 @@ impl ModItem { | ModItem::Impl(_) | ModItem::Mod(_) | ModItem::MacroRules(_) - | ModItem::MacroDef(_) => None, + | ModItem::Macro2(_) => None, ModItem::MacroCall(call) => Some(AssocItem::MacroCall(*call)), ModItem::Const(konst) => Some(AssocItem::Const(*konst)), ModItem::TypeAlias(alias) => Some(AssocItem::TypeAlias(*alias)), @@ -943,7 +948,7 @@ impl ModItem { ModItem::Mod(it) => tree[it.index()].ast_id().upcast(), ModItem::MacroCall(it) => tree[it.index()].ast_id().upcast(), ModItem::MacroRules(it) => tree[it.index()].ast_id().upcast(), - ModItem::MacroDef(it) => tree[it.index()].ast_id().upcast(), + ModItem::Macro2(it) => tree[it.index()].ast_id().upcast(), } } } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/item_tree/lower.rs b/src/tools/rust-analyzer/crates/hir-def/src/item_tree/lower.rs index 83a2790ce8f..8e2fafe81b5 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/item_tree/lower.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/item_tree/lower.rs @@ -2,7 +2,7 @@ use std::collections::hash_map::Entry; -use hir_expand::{ast_id_map::AstIdMap, span::SpanMapRef, HirFileId}; +use hir_expand::{ast_id_map::AstIdMap, span_map::SpanMapRef, HirFileId}; use syntax::ast::{self, HasModuleItem, HasTypeBounds}; use crate::{ @@ -549,7 +549,7 @@ impl<'a> Ctx<'a> { path, ast_id, expand_to, - call_site: span_map.span_for_range(m.syntax().text_range()).ctx, + call_site: span_map.span_for_range(m.syntax().text_range()), }; Some(id(self.data().macro_calls.alloc(res))) } @@ -562,13 +562,13 @@ impl<'a> Ctx<'a> { Some(id(self.data().macro_rules.alloc(res))) } - fn lower_macro_def(&mut self, m: &ast::MacroDef) -> Option<FileItemTreeId<MacroDef>> { + fn lower_macro_def(&mut self, m: &ast::MacroDef) -> Option<FileItemTreeId<Macro2>> { let name = m.name().map(|it| it.as_name())?; let ast_id = self.source_ast_id_map.ast_id(m); let visibility = self.lower_visibility(m); - let res = MacroDef { name, ast_id, visibility }; + let res = Macro2 { name, ast_id, visibility }; Some(id(self.data().macro_defs.alloc(res))) } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/item_tree/pretty.rs b/src/tools/rust-analyzer/crates/hir-def/src/item_tree/pretty.rs index 244111d202c..6d92fce0727 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/item_tree/pretty.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/item_tree/pretty.rs @@ -464,8 +464,8 @@ impl Printer<'_> { let MacroRules { name, ast_id: _ } = &self.tree[it]; wln!(self, "macro_rules! {} {{ ... }}", name.display(self.db.upcast())); } - ModItem::MacroDef(it) => { - let MacroDef { name, visibility, ast_id: _ } = &self.tree[it]; + ModItem::Macro2(it) => { + let Macro2 { name, visibility, ast_id: _ } = &self.tree[it]; self.print_visibility(*visibility); wln!(self, "macro {} {{ ... }}", name.display(self.db.upcast())); } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/item_tree/tests.rs b/src/tools/rust-analyzer/crates/hir-def/src/item_tree/tests.rs index 96c65b941c1..f97ae0d8e43 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/item_tree/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/item_tree/tests.rs @@ -1,5 +1,5 @@ -use base_db::fixture::WithFixture; use expect_test::{expect, Expect}; +use test_fixture::WithFixture; use crate::{db::DefDatabase, test_db::TestDB}; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/lib.rs b/src/tools/rust-analyzer/crates/hir-def/src/lib.rs index b5333861cc8..22ba3aab4e9 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/lib.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/lib.rs @@ -63,7 +63,7 @@ use std::{ panic::{RefUnwindSafe, UnwindSafe}, }; -use base_db::{impl_intern_key, salsa, span::SyntaxContextId, CrateId, ProcMacroKind}; +use base_db::{impl_intern_key, salsa, CrateId, Edition}; use hir_expand::{ ast_id_map::{AstIdNode, FileAstId}, attrs::{Attr, AttrId, AttrInput}, @@ -72,24 +72,27 @@ use hir_expand::{ builtin_fn_macro::{BuiltinFnLikeExpander, EagerExpander}, db::ExpandDatabase, eager::expand_eager_macro_input, + impl_intern_lookup, name::Name, - proc_macro::ProcMacroExpander, + proc_macro::{CustomProcMacroExpander, ProcMacroKind}, AstId, ExpandError, ExpandResult, ExpandTo, HirFileId, InFile, MacroCallId, MacroCallKind, MacroDefId, MacroDefKind, }; use item_tree::ExternBlock; use la_arena::Idx; use nameres::DefMap; +use span::Span; use stdx::impl_from; use syntax::{ast, AstNode}; -pub use hir_expand::tt; +pub use hir_expand::{tt, Intern, Lookup}; use crate::{ builtin_type::BuiltinType, data::adt::VariantData, + db::DefDatabase, item_tree::{ - Const, Enum, ExternCrate, Function, Impl, ItemTreeId, ItemTreeNode, MacroDef, MacroRules, + Const, Enum, ExternCrate, Function, Impl, ItemTreeId, ItemTreeNode, Macro2, MacroRules, Static, Struct, Trait, TraitAlias, TypeAlias, Union, Use, }, }; @@ -101,7 +104,7 @@ pub struct CrateRootModuleId { } impl CrateRootModuleId { - pub fn def_map(&self, db: &dyn db::DefDatabase) -> Arc<DefMap> { + pub fn def_map(&self, db: &dyn DefDatabase) -> Arc<DefMap> { db.crate_def_map(self.krate) } @@ -163,7 +166,7 @@ pub struct ModuleId { } impl ModuleId { - pub fn def_map(self, db: &dyn db::DefDatabase) -> Arc<DefMap> { + pub fn def_map(self, db: &dyn DefDatabase) -> Arc<DefMap> { match self.block { Some(block) => db.block_def_map(block), None => db.crate_def_map(self.krate), @@ -174,7 +177,7 @@ impl ModuleId { self.krate } - pub fn name(self, db: &dyn db::DefDatabase) -> Option<Name> { + pub fn name(self, db: &dyn DefDatabase) -> Option<Name> { let def_map = self.def_map(db); let parent = def_map[self.local_id].parent?; def_map[parent].children.iter().find_map(|(name, module_id)| { @@ -186,7 +189,7 @@ impl ModuleId { }) } - pub fn containing_module(self, db: &dyn db::DefDatabase) -> Option<ModuleId> { + pub fn containing_module(self, db: &dyn DefDatabase) -> Option<ModuleId> { self.def_map(db).containing_module(self.local_id) } @@ -263,20 +266,7 @@ impl<N: ItemTreeNode> Hash for AssocItemLoc<N> { macro_rules! impl_intern { ($id:ident, $loc:ident, $intern:ident, $lookup:ident) => { impl_intern_key!($id); - - impl Intern for $loc { - type ID = $id; - fn intern(self, db: &dyn db::DefDatabase) -> $id { - db.$intern(self) - } - } - - impl Lookup for $id { - type Data = $loc; - fn lookup(&self, db: &dyn db::DefDatabase) -> $loc { - db.$lookup(*self) - } - } + impl_intern_lookup!(DefDatabase, $id, $loc, $intern, $lookup); }; } @@ -376,9 +366,10 @@ pub struct Macro2Id(salsa::InternId); #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)] pub struct Macro2Loc { pub container: ModuleId, - pub id: ItemTreeId<MacroDef>, + pub id: ItemTreeId<Macro2>, pub expander: MacroExpander, pub allow_internal_unsafe: bool, + pub edition: Edition, } impl_intern!(Macro2Id, Macro2Loc, intern_macro2, lookup_intern_macro2); @@ -389,19 +380,28 @@ pub struct MacroRulesLoc { pub container: ModuleId, pub id: ItemTreeId<MacroRules>, pub expander: MacroExpander, - pub allow_internal_unsafe: bool, - pub local_inner: bool, + pub flags: MacroRulesLocFlags, + pub edition: Edition, } impl_intern!(MacroRulesId, MacroRulesLoc, intern_macro_rules, lookup_intern_macro_rules); +bitflags::bitflags! { + #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)] + pub struct MacroRulesLocFlags: u8 { + const ALLOW_INTERNAL_UNSAFE = 1 << 0; + const LOCAL_INNER = 1 << 1; + } +} + #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash, Ord, PartialOrd)] pub struct ProcMacroId(salsa::InternId); #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)] pub struct ProcMacroLoc { pub container: CrateRootModuleId, pub id: ItemTreeId<Function>, - pub expander: ProcMacroExpander, + pub expander: CustomProcMacroExpander, pub kind: ProcMacroKind, + pub edition: Edition, } impl_intern!(ProcMacroId, ProcMacroLoc, intern_proc_macro, lookup_intern_proc_macro); @@ -510,7 +510,7 @@ pub enum MacroId { impl_from!(Macro2Id, MacroRulesId, ProcMacroId for MacroId); impl MacroId { - pub fn is_attribute(self, db: &dyn db::DefDatabase) -> bool { + pub fn is_attribute(self, db: &dyn DefDatabase) -> bool { matches!(self, MacroId::ProcMacroId(it) if it.lookup(db).kind == ProcMacroKind::Attr) } } @@ -722,7 +722,7 @@ impl PartialEq for InTypeConstLoc { } impl InTypeConstId { - pub fn source(&self, db: &dyn db::DefDatabase) -> ast::ConstArg { + pub fn source(&self, db: &dyn DefDatabase) -> ast::ConstArg { let src = self.lookup(db).id; let file_id = src.file_id; let root = &db.parse_or_expand(file_id); @@ -742,7 +742,7 @@ pub enum GeneralConstId { impl_from!(ConstId, ConstBlockId, InTypeConstId for GeneralConstId); impl GeneralConstId { - pub fn generic_def(self, db: &dyn db::DefDatabase) -> Option<GenericDefId> { + pub fn generic_def(self, db: &dyn DefDatabase) -> Option<GenericDefId> { match self { GeneralConstId::ConstId(it) => Some(it.into()), GeneralConstId::ConstBlockId(it) => it.lookup(db).parent.as_generic_def_id(), @@ -750,7 +750,7 @@ impl GeneralConstId { } } - pub fn name(self, db: &dyn db::DefDatabase) -> String { + pub fn name(self, db: &dyn DefDatabase) -> String { match self { GeneralConstId::ConstId(const_id) => db .const_data(const_id) @@ -933,7 +933,7 @@ pub enum VariantId { impl_from!(EnumVariantId, StructId, UnionId for VariantId); impl VariantId { - pub fn variant_data(self, db: &dyn db::DefDatabase) -> Arc<VariantData> { + pub fn variant_data(self, db: &dyn DefDatabase) -> Arc<VariantData> { match self { VariantId::StructId(it) => db.struct_data(it).variant_data.clone(), VariantId::UnionId(it) => db.union_data(it).variant_data.clone(), @@ -943,7 +943,7 @@ impl VariantId { } } - pub fn file_id(self, db: &dyn db::DefDatabase) -> HirFileId { + pub fn file_id(self, db: &dyn DefDatabase) -> HirFileId { match self { VariantId::EnumVariantId(it) => it.parent.lookup(db).id.file_id(), VariantId::StructId(it) => it.lookup(db).id.file_id(), @@ -960,22 +960,12 @@ impl VariantId { } } -trait Intern { - type ID; - fn intern(self, db: &dyn db::DefDatabase) -> Self::ID; -} - -pub trait Lookup { - type Data; - fn lookup(&self, db: &dyn db::DefDatabase) -> Self::Data; -} - pub trait HasModule { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId; + fn module(&self, db: &dyn DefDatabase) -> ModuleId; } impl HasModule for ItemContainerId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match *self { ItemContainerId::ModuleId(it) => it, ItemContainerId::ImplId(it) => it.lookup(db).container, @@ -986,13 +976,13 @@ impl HasModule for ItemContainerId { } impl<N: ItemTreeNode> HasModule for AssocItemLoc<N> { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { self.container.module(db) } } impl HasModule for AdtId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match self { AdtId::StructId(it) => it.lookup(db).container, AdtId::UnionId(it) => it.lookup(db).container, @@ -1002,13 +992,13 @@ impl HasModule for AdtId { } impl HasModule for ExternCrateId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { self.lookup(db).container } } impl HasModule for VariantId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match self { VariantId::EnumVariantId(it) => it.parent.lookup(db).container, VariantId::StructId(it) => it.lookup(db).container, @@ -1018,7 +1008,7 @@ impl HasModule for VariantId { } impl HasModule for MacroId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match self { MacroId::MacroRulesId(it) => it.lookup(db).container, MacroId::Macro2Id(it) => it.lookup(db).container, @@ -1028,7 +1018,7 @@ impl HasModule for MacroId { } impl HasModule for TypeOwnerId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match self { TypeOwnerId::FunctionId(it) => it.lookup(db).module(db), TypeOwnerId::StaticId(it) => it.lookup(db).module(db), @@ -1045,7 +1035,7 @@ impl HasModule for TypeOwnerId { } impl HasModule for DefWithBodyId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match self { DefWithBodyId::FunctionId(it) => it.lookup(db).module(db), DefWithBodyId::StaticId(it) => it.lookup(db).module(db), @@ -1057,7 +1047,7 @@ impl HasModule for DefWithBodyId { } impl HasModule for GenericDefId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { match self { GenericDefId::FunctionId(it) => it.lookup(db).module(db), GenericDefId::AdtId(it) => it.module(db), @@ -1072,13 +1062,13 @@ impl HasModule for GenericDefId { } impl HasModule for TypeAliasId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { self.lookup(db).module(db) } } impl HasModule for TraitId { - fn module(&self, db: &dyn db::DefDatabase) -> ModuleId { + fn module(&self, db: &dyn DefDatabase) -> ModuleId { self.lookup(db).container } } @@ -1087,7 +1077,7 @@ impl ModuleDefId { /// Returns the module containing `self` (or `self`, if `self` is itself a module). /// /// Returns `None` if `self` refers to a primitive type. - pub fn module(&self, db: &dyn db::DefDatabase) -> Option<ModuleId> { + pub fn module(&self, db: &dyn DefDatabase) -> Option<ModuleId> { Some(match self { ModuleDefId::ModuleId(id) => *id, ModuleDefId::FunctionId(id) => id.lookup(db).module(db), @@ -1105,7 +1095,7 @@ impl ModuleDefId { } impl AttrDefId { - pub fn krate(&self, db: &dyn db::DefDatabase) -> CrateId { + pub fn krate(&self, db: &dyn DefDatabase) -> CrateId { match self { AttrDefId::ModuleId(it) => it.krate, AttrDefId::FieldId(it) => it.parent.module(db).krate, @@ -1171,7 +1161,7 @@ impl AsMacroCall for InFile<&ast::MacroCall> { return Ok(ExpandResult::only_err(ExpandError::other("malformed macro invocation"))); }; - let call_site = span_map.span_for_range(self.value.syntax().text_range()).ctx; + let call_site = span_map.span_for_range(self.value.syntax().text_range()); macro_call_as_call_id_with_eager( db, @@ -1201,7 +1191,7 @@ impl<T: AstIdNode> AstIdWithPath<T> { fn macro_call_as_call_id( db: &dyn ExpandDatabase, call: &AstIdWithPath<ast::MacroCall>, - call_site: SyntaxContextId, + call_site: Span, expand_to: ExpandTo, krate: CrateId, resolver: impl Fn(path::ModPath) -> Option<MacroDefId> + Copy, @@ -1213,7 +1203,7 @@ fn macro_call_as_call_id( fn macro_call_as_call_id_with_eager( db: &dyn ExpandDatabase, call: &AstIdWithPath<ast::MacroCall>, - call_site: SyntaxContextId, + call_site: Span, expand_to: ExpandTo, krate: CrateId, resolver: impl FnOnce(path::ModPath) -> Option<MacroDefId>, @@ -1243,83 +1233,12 @@ fn macro_call_as_call_id_with_eager( Ok(res) } -pub fn macro_id_to_def_id(db: &dyn db::DefDatabase, id: MacroId) -> MacroDefId { - match id { - MacroId::Macro2Id(it) => { - let loc = it.lookup(db); - - let item_tree = loc.id.item_tree(db); - let makro = &item_tree[loc.id.value]; - let in_file = |m: FileAstId<ast::MacroDef>| InFile::new(loc.id.file_id(), m.upcast()); - MacroDefId { - krate: loc.container.krate, - kind: match loc.expander { - MacroExpander::Declarative => MacroDefKind::Declarative(in_file(makro.ast_id)), - MacroExpander::BuiltIn(it) => MacroDefKind::BuiltIn(it, in_file(makro.ast_id)), - MacroExpander::BuiltInAttr(it) => { - MacroDefKind::BuiltInAttr(it, in_file(makro.ast_id)) - } - MacroExpander::BuiltInDerive(it) => { - MacroDefKind::BuiltInDerive(it, in_file(makro.ast_id)) - } - MacroExpander::BuiltInEager(it) => { - MacroDefKind::BuiltInEager(it, in_file(makro.ast_id)) - } - }, - local_inner: false, - allow_internal_unsafe: loc.allow_internal_unsafe, - } - } - MacroId::MacroRulesId(it) => { - let loc = it.lookup(db); - - let item_tree = loc.id.item_tree(db); - let makro = &item_tree[loc.id.value]; - let in_file = |m: FileAstId<ast::MacroRules>| InFile::new(loc.id.file_id(), m.upcast()); - MacroDefId { - krate: loc.container.krate, - kind: match loc.expander { - MacroExpander::Declarative => MacroDefKind::Declarative(in_file(makro.ast_id)), - MacroExpander::BuiltIn(it) => MacroDefKind::BuiltIn(it, in_file(makro.ast_id)), - MacroExpander::BuiltInAttr(it) => { - MacroDefKind::BuiltInAttr(it, in_file(makro.ast_id)) - } - MacroExpander::BuiltInDerive(it) => { - MacroDefKind::BuiltInDerive(it, in_file(makro.ast_id)) - } - MacroExpander::BuiltInEager(it) => { - MacroDefKind::BuiltInEager(it, in_file(makro.ast_id)) - } - }, - local_inner: loc.local_inner, - allow_internal_unsafe: loc.allow_internal_unsafe, - } - } - MacroId::ProcMacroId(it) => { - let loc = it.lookup(db); - - let item_tree = loc.id.item_tree(db); - let makro = &item_tree[loc.id.value]; - MacroDefId { - krate: loc.container.krate, - kind: MacroDefKind::ProcMacro( - loc.expander, - loc.kind, - InFile::new(loc.id.file_id(), makro.ast_id), - ), - local_inner: false, - allow_internal_unsafe: false, - } - } - } -} - fn derive_macro_as_call_id( - db: &dyn db::DefDatabase, + db: &dyn DefDatabase, item_attr: &AstIdWithPath<ast::Adt>, derive_attr_index: AttrId, derive_pos: u32, - call_site: SyntaxContextId, + call_site: Span, krate: CrateId, resolver: impl Fn(path::ModPath) -> Option<(MacroId, MacroDefId)>, ) -> Result<(MacroId, MacroDefId, MacroCallId), UnresolvedMacro> { @@ -1340,7 +1259,7 @@ fn derive_macro_as_call_id( } fn attr_macro_as_call_id( - db: &dyn db::DefDatabase, + db: &dyn DefDatabase, item_attr: &AstIdWithPath<ast::Item>, macro_attr: &Attr, krate: CrateId, @@ -1349,7 +1268,7 @@ fn attr_macro_as_call_id( let arg = match macro_attr.input.as_deref() { Some(AttrInput::TokenTree(tt)) => { let mut tt = tt.as_ref().clone(); - tt.delimiter = tt::Delimiter::DUMMY_INVISIBLE; + tt.delimiter = tt::Delimiter::invisible_spanned(macro_attr.span); Some(tt) } @@ -1364,7 +1283,7 @@ fn attr_macro_as_call_id( attr_args: arg.map(Arc::new), invoc_attr_index: macro_attr.id, }, - macro_attr.ctxt, + macro_attr.span, ) } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/lower.rs b/src/tools/rust-analyzer/crates/hir-def/src/lower.rs index a3505b65fe7..395b69d284f 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/lower.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/lower.rs @@ -3,7 +3,7 @@ use std::cell::OnceCell; use hir_expand::{ ast_id_map::{AstIdMap, AstIdNode}, - span::{SpanMap, SpanMapRef}, + span_map::{SpanMap, SpanMapRef}, AstId, HirFileId, InFile, }; use syntax::ast; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/builtin_fn_macro.rs b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/builtin_fn_macro.rs index 514219ee715..d4798f4507d 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/builtin_fn_macro.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/builtin_fn_macro.rs @@ -163,31 +163,43 @@ fn main() { ""; } fn test_assert_expand() { check( r#" -#[rustc_builtin_macro] -macro_rules! assert { - ($cond:expr) => ({ /* compiler built-in */ }); - ($cond:expr, $($args:tt)*) => ({ /* compiler built-in */ }) -} - +//- minicore: assert fn main() { assert!(true, "{} {:?}", arg1(a, b, c), arg2); } "#, - expect![[r##" -#[rustc_builtin_macro] -macro_rules! assert { - ($cond:expr) => ({ /* compiler built-in */ }); - ($cond:expr, $($args:tt)*) => ({ /* compiler built-in */ }) + expect![[r#" +fn main() { + { + if !(true ) { + $crate::panic::panic_2021!("{} {:?}", arg1(a, b, c), arg2); + } + }; +} +"#]], + ); } +// FIXME: This is the wrong expansion, see FIXME on `builtin_fn_macro::use_panic_2021` +#[test] +fn test_assert_expand_2015() { + check( + r#" +//- minicore: assert +//- /main.rs edition:2015 +fn main() { + assert!(true, "{} {:?}", arg1(a, b, c), arg2); +} +"#, + expect![[r#" fn main() { { if !(true ) { - $crate::panic!("{} {:?}", arg1(a, b, c), arg2); + $crate::panic::panic_2021!("{} {:?}", arg1(a, b, c), arg2); } }; } -"##]], +"#]], ); } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe.rs b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe.rs index 9bf2a50d57c..f2046bfbce4 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe.rs @@ -1218,8 +1218,10 @@ m! { macro_rules! m { ($(#[$m:meta])+) => ( $(#[$m])+ fn bar() {} ) } -#[doc = " Single Line Doc 1"] -#[doc = "\n MultiLines Doc\n "] fn bar() {} +#[doc = r" Single Line Doc 1"] +#[doc = r" + MultiLines Doc + "] fn bar() {} "##]], ); } @@ -1260,8 +1262,10 @@ m! { macro_rules! m { ($(#[$ m:meta])+) => ( $(#[$m])+ fn bar() {} ) } -#[doc = " 錦瑟無端五十弦，一弦一柱思華年。"] -#[doc = "\n 莊生曉夢迷蝴蝶，望帝春心託杜鵑。\n "] fn bar() {} +#[doc = r" 錦瑟無端五十弦，一弦一柱思華年。"] +#[doc = r" + 莊生曉夢迷蝴蝶，望帝春心託杜鵑。 + "] fn bar() {} "##]], ); } @@ -1281,7 +1285,7 @@ m! { macro_rules! m { ($(#[$m:meta])+) => ( $(#[$m])+ fn bar() {} ) } -#[doc = " \\ \" \'"] fn bar() {} +#[doc = r#" \ " '"#] fn bar() {} "##]], ); } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/meta_syntax.rs b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/meta_syntax.rs index 7e7b4004421..e875950e4e5 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/meta_syntax.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/meta_syntax.rs @@ -18,7 +18,7 @@ macro_rules! m { ($($false:ident)*) => ($false); (double_dollar) => ($$); ($) => (m!($);); - ($($t:tt)*) => ($( ${ignore(t)} ${index()} )-*); + ($($t:tt)*) => ($( ${ignore($t)} ${index()} )-*); } m!($); "#, @@ -33,7 +33,7 @@ macro_rules! m { ($($false:ident)*) => ($false); (double_dollar) => ($$); ($) => (m!($);); - ($($t:tt)*) => ($( ${ignore(t)} ${index()} )-*); + ($($t:tt)*) => ($( ${ignore($t)} ${index()} )-*); } m!($); "#]], diff --git a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/metavar_expr.rs b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/metavar_expr.rs index 967b5ad36ba..6560d0ec466 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/metavar_expr.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mbe/metavar_expr.rs @@ -77,13 +77,13 @@ fn test_metavar_exprs() { check( r#" macro_rules! m { - ( $( $t:tt )* ) => ( $( ${ignore(t)} -${index()} )-* ); + ( $( $t:tt )* ) => ( $( ${ignore($t)} -${index()} )-* ); } const _: i32 = m!(a b c); "#, expect![[r#" macro_rules! m { - ( $( $t:tt )* ) => ( $( ${ignore(t)} -${index()} )-* ); + ( $( $t:tt )* ) => ( $( ${ignore($t)} -${index()} )-* ); } const _: i32 = -0--1--2; "#]], @@ -96,7 +96,7 @@ fn count_basic() { r#" macro_rules! m { ($($t:ident),*) => { - ${count(t)} + ${count($t)} } } @@ -109,7 +109,7 @@ fn test() { expect![[r#" macro_rules! m { ($($t:ident),*) => { - ${count(t)} + ${count($t)} } } @@ -130,9 +130,9 @@ macro_rules! foo { ($( $( $($t:ident)* ),* );*) => { $( { - let depth_none = ${count(t)}; - let depth_zero = ${count(t, 0)}; - let depth_one = ${count(t, 1)}; + let depth_none = ${count($t)}; + let depth_zero = ${count($t, 0)}; + let depth_one = ${count($t, 1)}; } )* } @@ -150,9 +150,9 @@ macro_rules! foo { ($( $( $($t:ident)* ),* );*) => { $( { - let depth_none = ${count(t)}; - let depth_zero = ${count(t, 0)}; - let depth_one = ${count(t, 1)}; + let depth_none = ${count($t)}; + let depth_zero = ${count($t, 0)}; + let depth_one = ${count($t, 1)}; } )* } @@ -160,11 +160,11 @@ macro_rules! foo { fn bar() { { - let depth_none = 6; + let depth_none = 3; let depth_zero = 3; let depth_one = 6; } { - let depth_none = 3; + let depth_none = 1; let depth_zero = 1; let depth_one = 3; } @@ -178,12 +178,12 @@ fn count_depth_out_of_bounds() { check( r#" macro_rules! foo { - ($($t:ident)*) => { ${count(t, 1)} }; - ($( $( $l:literal )* );*) => { $(${count(l, 1)};)* } + ($($t:ident)*) => { ${count($t, 1)} }; + ($( $( $l:literal )* );*) => { $(${count($l, 1)};)* } } macro_rules! bar { - ($($t:ident)*) => { ${count(t, 1024)} }; - ($( $( $l:literal )* );*) => { $(${count(l, 8192)};)* } + ($($t:ident)*) => { ${count($t, 1024)} }; + ($( $( $l:literal )* );*) => { $(${count($l, 8192)};)* } } fn test() { @@ -195,19 +195,21 @@ fn test() { "#, expect![[r#" macro_rules! foo { - ($($t:ident)*) => { ${count(t, 1)} }; - ($( $( $l:literal )* );*) => { $(${count(l, 1)};)* } + ($($t:ident)*) => { ${count($t, 1)} }; + ($( $( $l:literal )* );*) => { $(${count($l, 1)};)* } } macro_rules! bar { - ($($t:ident)*) => { ${count(t, 1024)} }; - ($( $( $l:literal )* );*) => { $(${count(l, 8192)};)* } + ($($t:ident)*) => { ${count($t, 1024)} }; + ($( $( $l:literal )* );*) => { $(${count($l, 8192)};)* } } fn test() { - /* error: ${count} out of bounds */; - /* error: ${count} out of bounds */; - /* error: ${count} out of bounds */; - /* error: ${count} out of bounds */; + 2; + 2; + 1;; + 2; + 2; + 1;; } "#]], ); @@ -218,8 +220,8 @@ fn misplaced_count() { check( r#" macro_rules! foo { - ($($t:ident)*) => { $(${count(t)})* }; - ($l:literal) => { ${count(l)} } + ($($t:ident)*) => { $(${count($t)})* }; + ($l:literal) => { ${count($l)} } } fn test() { @@ -229,13 +231,13 @@ fn test() { "#, expect![[r#" macro_rules! foo { - ($($t:ident)*) => { $(${count(t)})* }; - ($l:literal) => { ${count(l)} } + ($($t:ident)*) => { $(${count($t)})* }; + ($l:literal) => { ${count($l)} } } fn test() { - /* error: ${count} misplaced */; - /* error: ${count} misplaced */; + 1 1 1; + 1; } "#]], ); @@ -246,13 +248,13 @@ fn malformed_count() { check( r#" macro_rules! too_many_args { - ($($t:ident)*) => { ${count(t, 1, leftover)} } + ($($t:ident)*) => { ${count($t, 1, leftover)} } } macro_rules! depth_suffixed { - ($($t:ident)*) => { ${count(t, 0usize)} } + ($($t:ident)*) => { ${count($t, 0usize)} } } macro_rules! depth_too_large { - ($($t:ident)*) => { ${count(t, 18446744073709551616)} } + ($($t:ident)*) => { ${count($t, 18446744073709551616)} } } fn test() { @@ -263,13 +265,13 @@ fn test() { "#, expect![[r#" macro_rules! too_many_args { - ($($t:ident)*) => { ${count(t, 1, leftover)} } + ($($t:ident)*) => { ${count($t, 1, leftover)} } } macro_rules! depth_suffixed { - ($($t:ident)*) => { ${count(t, 0usize)} } + ($($t:ident)*) => { ${count($t, 0usize)} } } macro_rules! depth_too_large { - ($($t:ident)*) => { ${count(t, 18446744073709551616)} } + ($($t:ident)*) => { ${count($t, 18446744073709551616)} } } fn test() { @@ -288,7 +290,7 @@ fn count_interaction_with_empty_binding() { r#" macro_rules! m { ($($t:ident),*) => { - ${count(t, 100)} + ${count($t, 100)} } } @@ -299,7 +301,7 @@ fn test() { expect![[r#" macro_rules! m { ($($t:ident),*) => { - ${count(t, 100)} + ${count($t, 100)} } } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mod.rs b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mod.rs index be2a503d82b..ee806361237 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mod.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/macro_expansion_tests/mod.rs @@ -16,9 +16,15 @@ mod proc_macros; use std::{iter, ops::Range, sync}; -use base_db::{fixture::WithFixture, span::SpanData, ProcMacro, SourceDatabase}; +use base_db::SourceDatabase; use expect_test::Expect; -use hir_expand::{db::ExpandDatabase, span::SpanMapRef, InFile, MacroFileId, MacroFileIdExt}; +use hir_expand::{ + db::ExpandDatabase, + proc_macro::{ProcMacro, ProcMacroExpander, ProcMacroExpansionError, ProcMacroKind}, + span_map::SpanMapRef, + InFile, MacroFileId, MacroFileIdExt, +}; +use span::Span; use stdx::format_to; use syntax::{ ast::{self, edit::IndentLevel}, @@ -26,10 +32,10 @@ use syntax::{ SyntaxKind::{COMMENT, EOF, IDENT, LIFETIME_IDENT}, SyntaxNode, T, }; +use test_fixture::WithFixture; use crate::{ db::DefDatabase, - macro_id_to_def_id, nameres::{DefMap, MacroSubNs, ModuleSource}, resolver::HasResolver, src::HasSource, @@ -50,7 +56,7 @@ pub fn identity_when_valid(_attr: TokenStream, item: TokenStream) -> TokenStream .into(), ProcMacro { name: "identity_when_valid".into(), - kind: base_db::ProcMacroKind::Attr, + kind: ProcMacroKind::Attr, expander: sync::Arc::new(IdentityWhenValidProcMacroExpander), }, )]; @@ -90,7 +96,7 @@ pub fn identity_when_valid(_attr: TokenStream, item: TokenStream) -> TokenStream .as_call_id_with_errors(&db, krate, |path| { resolver .resolve_path_as_macro(&db, &path, Some(MacroSubNs::Bang)) - .map(|(it, _)| macro_id_to_def_id(&db, it)) + .map(|(it, _)| db.macro_def(it)) }) .unwrap(); let macro_call_id = res.value.unwrap(); @@ -307,16 +313,16 @@ fn pretty_print_macro_expansion( // compile errors. #[derive(Debug)] struct IdentityWhenValidProcMacroExpander; -impl base_db::ProcMacroExpander for IdentityWhenValidProcMacroExpander { +impl ProcMacroExpander for IdentityWhenValidProcMacroExpander { fn expand( &self, subtree: &Subtree, _: Option<&Subtree>, _: &base_db::Env, - _: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<Subtree, base_db::ProcMacroExpansionError> { + _: Span, + _: Span, + _: Span, + ) -> Result<Subtree, ProcMacroExpansionError> { let (parse, _) = ::mbe::token_tree_to_syntax_node(subtree, ::mbe::TopEntryPoint::MacroItems); if parse.errors().is_empty() { diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres.rs index 9a9fa0e02b0..52a981fd19e 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres.rs @@ -59,8 +59,11 @@ mod tests; use std::{cmp::Ord, ops::Deref}; -use base_db::{CrateId, Edition, FileId, ProcMacroKind}; -use hir_expand::{ast_id_map::FileAstId, name::Name, HirFileId, InFile, MacroCallId, MacroDefId}; +use base_db::{CrateId, Edition, FileId}; +use hir_expand::{ + ast_id_map::FileAstId, name::Name, proc_macro::ProcMacroKind, HirFileId, InFile, MacroCallId, + MacroDefId, +}; use itertools::Itertools; use la_arena::Arena; use profile::Count; @@ -97,7 +100,7 @@ pub struct DefMap { /// contains this block. block: Option<BlockInfo>, /// The modules and their data declared in this crate. - modules: Arena<ModuleData>, + pub modules: Arena<ModuleData>, krate: CrateId, /// The prelude module for this crate. This either comes from an import /// marked with the `prelude_import` attribute, or (in the normal case) from @@ -623,8 +626,9 @@ impl DefMap { self.diagnostics.as_slice() } - pub fn recursion_limit(&self) -> Option<u32> { - self.data.recursion_limit + pub fn recursion_limit(&self) -> u32 { + // 128 is the default in rustc + self.data.recursion_limit.unwrap_or(128) } } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres/attr_resolution.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres/attr_resolution.rs index a7abf445918..6288b8366bf 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres/attr_resolution.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres/attr_resolution.rs @@ -8,7 +8,6 @@ use crate::{ attr_macro_as_call_id, db::DefDatabase, item_scope::BuiltinShadowMode, - macro_id_to_def_id, nameres::path_resolution::ResolveMode, path::{ModPath, PathKind}, AstIdWithPath, LocalModuleId, UnresolvedMacro, @@ -63,7 +62,7 @@ impl DefMap { &ast_id, attr, self.krate, - macro_id_to_def_id(db, def), + db.macro_def(def), ))) } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres/collector.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres/collector.rs index b3a10a3869a..3763bfcbcfa 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres/collector.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres/collector.rs @@ -5,7 +5,7 @@ use std::{cmp::Ordering, iter, mem}; -use base_db::{span::SyntaxContextId, CrateId, Dependency, Edition, FileId}; +use base_db::{CrateId, Dependency, Edition, FileId}; use cfg::{CfgExpr, CfgOptions}; use either::Either; use hir_expand::{ @@ -15,7 +15,7 @@ use hir_expand::{ builtin_derive_macro::find_builtin_derive, builtin_fn_macro::find_builtin_macro, name::{name, AsName, Name}, - proc_macro::ProcMacroExpander, + proc_macro::CustomProcMacroExpander, ExpandResult, ExpandTo, HirFileId, InFile, MacroCallId, MacroCallKind, MacroCallLoc, MacroDefId, MacroDefKind, }; @@ -23,6 +23,7 @@ use itertools::{izip, Itertools}; use la_arena::Idx; use limit::Limit; use rustc_hash::{FxHashMap, FxHashSet}; +use span::{Span, SyntaxContextId}; use stdx::always; use syntax::{ast, SmolStr}; use triomphe::Arc; @@ -35,9 +36,9 @@ use crate::{ item_scope::{ImportId, ImportOrExternCrate, ImportType, PerNsGlobImports}, item_tree::{ self, ExternCrate, Fields, FileItemTreeId, ImportKind, ItemTree, ItemTreeId, ItemTreeNode, - MacroCall, MacroDef, MacroRules, Mod, ModItem, ModKind, TreeId, + Macro2, MacroCall, MacroRules, Mod, ModItem, ModKind, TreeId, }, - macro_call_as_call_id, macro_call_as_call_id_with_eager, macro_id_to_def_id, + macro_call_as_call_id, macro_call_as_call_id_with_eager, nameres::{ diagnostics::DefDiagnostic, mod_resolution::ModDir, @@ -53,8 +54,9 @@ use crate::{ AdtId, AstId, AstIdWithPath, ConstLoc, CrateRootModuleId, EnumLoc, EnumVariantId, ExternBlockLoc, ExternCrateId, ExternCrateLoc, FunctionId, FunctionLoc, ImplLoc, Intern, ItemContainerId, LocalModuleId, Lookup, Macro2Id, Macro2Loc, MacroExpander, MacroId, - MacroRulesId, MacroRulesLoc, ModuleDefId, ModuleId, ProcMacroId, ProcMacroLoc, StaticLoc, - StructLoc, TraitAliasLoc, TraitLoc, TypeAliasLoc, UnionLoc, UnresolvedMacro, UseId, UseLoc, + MacroRulesId, MacroRulesLoc, MacroRulesLocFlags, ModuleDefId, ModuleId, ProcMacroId, + ProcMacroLoc, StaticLoc, StructLoc, TraitAliasLoc, TraitLoc, TypeAliasLoc, UnionLoc, + UnresolvedMacro, UseId, UseLoc, }; static GLOB_RECURSION_LIMIT: Limit = Limit::new(100); @@ -86,16 +88,21 @@ pub(super) fn collect_defs(db: &dyn DefDatabase, def_map: DefMap, tree_id: TreeI // FIXME: a hacky way to create a Name from string. let name = tt::Ident { text: it.name.clone(), - span: tt::SpanData { + span: Span { range: syntax::TextRange::empty(syntax::TextSize::new(0)), - anchor: base_db::span::SpanAnchor { + anchor: span::SpanAnchor { file_id: FileId::BOGUS, - ast_id: base_db::span::ROOT_ERASED_FILE_AST_ID, + ast_id: span::ROOT_ERASED_FILE_AST_ID, }, ctx: SyntaxContextId::ROOT, }, }; - (name.as_name(), ProcMacroExpander::new(base_db::ProcMacroId(idx as u32))) + ( + name.as_name(), + CustomProcMacroExpander::new(hir_expand::proc_macro::ProcMacroId( + idx as u32, + )), + ) }) .collect()) } @@ -222,13 +229,13 @@ enum MacroDirectiveKind { FnLike { ast_id: AstIdWithPath<ast::MacroCall>, expand_to: ExpandTo, - call_site: SyntaxContextId, + call_site: Span, }, Derive { ast_id: AstIdWithPath<ast::Adt>, derive_attr: AttrId, derive_pos: usize, - call_site: SyntaxContextId, + call_site: Span, }, Attr { ast_id: AstIdWithPath<ast::Item>, @@ -253,7 +260,7 @@ struct DefCollector<'a> { /// built by the build system, and is the list of proc. macros we can actually expand. It is /// empty when proc. macro support is disabled (in which case we still do name resolution for /// them). - proc_macros: Result<Vec<(Name, ProcMacroExpander)>, Box<str>>, + proc_macros: Result<Vec<(Name, CustomProcMacroExpander)>, Box<str>>, is_proc_macro: bool, from_glob_import: PerNsGlobImports, /// If we fail to resolve an attribute on a `ModItem`, we fall back to ignoring the attribute. @@ -545,6 +552,8 @@ impl DefCollector<'_> { Edition::Edition2015 => name![rust_2015], Edition::Edition2018 => name![rust_2018], Edition::Edition2021 => name![rust_2021], + // FIXME: update this when rust_2024 exists + Edition::Edition2024 => name![rust_2021], }; let path_kind = match self.def_map.data.edition { @@ -603,18 +612,21 @@ impl DefCollector<'_> { let (expander, kind) = match self.proc_macros.as_ref().map(|it| it.iter().find(|(n, _)| n == &def.name)) { Ok(Some(&(_, expander))) => (expander, kind), - _ => (ProcMacroExpander::dummy(), kind), + _ => (CustomProcMacroExpander::dummy(), kind), }; - let proc_macro_id = - ProcMacroLoc { container: self.def_map.crate_root(), id, expander, kind } - .intern(self.db); + let proc_macro_id = ProcMacroLoc { + container: self.def_map.crate_root(), + id, + expander, + kind, + edition: self.def_map.data.edition, + } + .intern(self.db); self.define_proc_macro(def.name.clone(), proc_macro_id); let crate_data = Arc::get_mut(&mut self.def_map.data).unwrap(); if let ProcMacroKind::CustomDerive { helpers } = def.kind { - crate_data - .exported_derives - .insert(macro_id_to_def_id(self.db, proc_macro_id.into()), helpers); + crate_data.exported_derives.insert(self.db.macro_def(proc_macro_id.into()), helpers); } crate_data.fn_proc_macro_mapping.insert(fn_id, proc_macro_id); } @@ -1125,10 +1137,7 @@ impl DefCollector<'_> { BuiltinShadowMode::Module, Some(subns), ); - resolved_res - .resolved_def - .take_macros() - .map(|it| (it, macro_id_to_def_id(self.db, it))) + resolved_res.resolved_def.take_macros().map(|it| (it, self.db.macro_def(it))) }; let resolver_def_id = |path| resolver(path).map(|(_, it)| it); @@ -1143,6 +1152,9 @@ impl DefCollector<'_> { resolver_def_id, ); if let Ok(Some(call_id)) = call_id { + self.def_map.modules[directive.module_id] + .scope + .add_macro_invoc(ast_id.ast_id, call_id); push_resolved(directive, call_id); res = ReachedFixedPoint::No; @@ -1299,14 +1311,13 @@ impl DefCollector<'_> { // Not resolved to a derive helper or the derive attribute, so try to treat as a normal attribute. let call_id = attr_macro_as_call_id(self.db, file_ast_id, attr, self.def_map.krate, def); - let loc: MacroCallLoc = self.db.lookup_intern_macro_call(call_id); // If proc attribute macro expansion is disabled, skip expanding it here if !self.db.expand_proc_attr_macros() { self.def_map.diagnostics.push(DefDiagnostic::unresolved_proc_macro( directive.module_id, - loc.kind, - loc.def.krate, + self.db.lookup_intern_macro_call(call_id).kind, + def.krate, )); return recollect_without(self); } @@ -1314,14 +1325,14 @@ impl DefCollector<'_> { // Skip #[test]/#[bench] expansion, which would merely result in more memory usage // due to duplicating functions into macro expansions if matches!( - loc.def.kind, + def.kind, MacroDefKind::BuiltInAttr(expander, _) if expander.is_test() || expander.is_bench() ) { return recollect_without(self); } - if let MacroDefKind::ProcMacro(exp, ..) = loc.def.kind { + if let MacroDefKind::ProcMacro(exp, ..) = def.kind { if exp.is_dummy() { // If there's no expander for the proc macro (e.g. // because proc macros are disabled, or building the @@ -1329,8 +1340,8 @@ impl DefCollector<'_> { // expansion like we would if it was disabled self.def_map.diagnostics.push(DefDiagnostic::unresolved_proc_macro( directive.module_id, - loc.kind, - loc.def.krate, + self.db.lookup_intern_macro_call(call_id).kind, + def.krate, )); return recollect_without(self); @@ -1436,10 +1447,7 @@ impl DefCollector<'_> { BuiltinShadowMode::Module, Some(MacroSubNs::Bang), ); - resolved_res - .resolved_def - .take_macros() - .map(|it| macro_id_to_def_id(self.db, it)) + resolved_res.resolved_def.take_macros().map(|it| self.db.macro_def(it)) }, ); if let Err(UnresolvedMacro { path }) = macro_call_as_call_id { @@ -1645,7 +1653,7 @@ impl ModCollector<'_, '_> { ), ModItem::MacroCall(mac) => self.collect_macro_call(&self.item_tree[mac], container), ModItem::MacroRules(id) => self.collect_macro_rules(id, module), - ModItem::MacroDef(id) => self.collect_macro_def(id, module), + ModItem::Macro2(id) => self.collect_macro_def(id, module), ModItem::Impl(imp) => { let impl_id = ImplLoc { container: module, id: ItemTreeId::new(self.tree_id, imp) } @@ -2090,11 +2098,11 @@ impl ModCollector<'_, '_> { // FIXME: a hacky way to create a Name from string. name = tt::Ident { text: it.clone(), - span: tt::SpanData { + span: Span { range: syntax::TextRange::empty(syntax::TextSize::new(0)), - anchor: base_db::span::SpanAnchor { + anchor: span::SpanAnchor { file_id: FileId::BOGUS, - ast_id: base_db::span::ROOT_ERASED_FILE_AST_ID, + ast_id: span::ROOT_ERASED_FILE_AST_ID, }, ctx: SyntaxContextId::ROOT, }, @@ -2136,12 +2144,16 @@ impl ModCollector<'_, '_> { }; let allow_internal_unsafe = attrs.by_key("allow_internal_unsafe").exists(); + let mut flags = MacroRulesLocFlags::empty(); + flags.set(MacroRulesLocFlags::LOCAL_INNER, local_inner); + flags.set(MacroRulesLocFlags::ALLOW_INTERNAL_UNSAFE, allow_internal_unsafe); + let macro_id = MacroRulesLoc { container: module, id: ItemTreeId::new(self.tree_id, id), - local_inner, - allow_internal_unsafe, + flags, expander, + edition: self.def_collector.def_map.data.edition, } .intern(self.def_collector.db); self.def_collector.define_macro_rules( @@ -2152,7 +2164,7 @@ impl ModCollector<'_, '_> { ); } - fn collect_macro_def(&mut self, id: FileItemTreeId<MacroDef>, module: ModuleId) { + fn collect_macro_def(&mut self, id: FileItemTreeId<Macro2>, module: ModuleId) { let krate = self.def_collector.def_map.krate; let mac = &self.item_tree[id]; let ast_id = InFile::new(self.file_id(), mac.ast_id.upcast()); @@ -2207,6 +2219,7 @@ impl ModCollector<'_, '_> { id: ItemTreeId::new(self.tree_id, id), expander, allow_internal_unsafe, + edition: self.def_collector.def_map.data.edition, } .intern(self.def_collector.db); self.def_collector.define_macro_def( @@ -2220,7 +2233,7 @@ impl ModCollector<'_, '_> { Arc::get_mut(&mut self.def_collector.def_map.data) .unwrap() .exported_derives - .insert(macro_id_to_def_id(self.def_collector.db, macro_id.into()), helpers); + .insert(self.def_collector.db.macro_def(macro_id.into()), helpers); } } } @@ -2259,7 +2272,7 @@ impl ModCollector<'_, '_> { Some(MacroSubNs::Bang), ) }) - .map(|it| macro_id_to_def_id(self.def_collector.db, it)) + .map(|it| self.def_collector.db.macro_def(it)) }) }, |path| { @@ -2271,7 +2284,7 @@ impl ModCollector<'_, '_> { BuiltinShadowMode::Module, Some(MacroSubNs::Bang), ); - resolved_res.resolved_def.take_macros().map(|it| macro_id_to_def_id(db, it)) + resolved_res.resolved_def.take_macros().map(|it| db.macro_def(it)) }, ) { // FIXME: if there were errors, this mightve been in the eager expansion from an @@ -2279,10 +2292,13 @@ impl ModCollector<'_, '_> { if res.err.is_none() { // Legacy macros need to be expanded immediately, so that any macros they produce // are in scope. - if let Some(val) = res.value { + if let Some(call_id) = res.value { + self.def_collector.def_map.modules[self.module_id] + .scope + .add_macro_invoc(ast_id.ast_id, call_id); self.def_collector.collect_macro_expansion( self.module_id, - val, + call_id, self.macro_depth + 1, container, ); @@ -2296,7 +2312,7 @@ impl ModCollector<'_, '_> { self.def_collector.unresolved_macros.push(MacroDirective { module_id: self.module_id, depth: self.macro_depth + 1, - kind: MacroDirectiveKind::FnLike { ast_id, expand_to: expand_to, call_site }, + kind: MacroDirectiveKind::FnLike { ast_id, expand_to, call_site }, container, }); } @@ -2363,8 +2379,10 @@ impl ModCollector<'_, '_> { #[cfg(test)] mod tests { + use base_db::SourceDatabase; + use test_fixture::WithFixture; + use crate::{db::DefDatabase, test_db::TestDB}; - use base_db::{fixture::WithFixture, SourceDatabase}; use super::*; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres/proc_macro.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres/proc_macro.rs index 751b7beaac1..c126fdac1c6 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres/proc_macro.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres/proc_macro.rs @@ -19,11 +19,13 @@ pub enum ProcMacroKind { } impl ProcMacroKind { - pub(super) fn to_basedb_kind(&self) -> base_db::ProcMacroKind { + pub(super) fn to_basedb_kind(&self) -> hir_expand::proc_macro::ProcMacroKind { match self { - ProcMacroKind::CustomDerive { .. } => base_db::ProcMacroKind::CustomDerive, - ProcMacroKind::FnLike => base_db::ProcMacroKind::FuncLike, - ProcMacroKind::Attr => base_db::ProcMacroKind::Attr, + ProcMacroKind::CustomDerive { .. } => { + hir_expand::proc_macro::ProcMacroKind::CustomDerive + } + ProcMacroKind::FnLike => hir_expand::proc_macro::ProcMacroKind::FuncLike, + ProcMacroKind::Attr => hir_expand::proc_macro::ProcMacroKind::Attr, } } } diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests.rs index b2ffbbe4c5d..17e82dc16c4 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests.rs @@ -4,8 +4,9 @@ mod macros; mod mod_resolution; mod primitives; -use base_db::{fixture::WithFixture, SourceDatabase}; +use base_db::SourceDatabase; use expect_test::{expect, Expect}; +use test_fixture::WithFixture; use triomphe::Arc; use crate::{db::DefDatabase, nameres::DefMap, test_db::TestDB}; diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/incremental.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/incremental.rs index 78cb78e833e..6efced02718 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/incremental.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/incremental.rs @@ -1,11 +1,8 @@ use base_db::{SourceDatabase, SourceDatabaseExt}; +use test_fixture::WithFixture; use triomphe::Arc; -use crate::{ - db::DefDatabase, - nameres::tests::{TestDB, WithFixture}, - AdtId, ModuleDefId, -}; +use crate::{db::DefDatabase, nameres::tests::TestDB, AdtId, ModuleDefId}; fn check_def_map_is_not_recomputed(ra_fixture_initial: &str, ra_fixture_change: &str) { let (mut db, pos) = TestDB::with_position(ra_fixture_initial); diff --git a/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/macros.rs b/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/macros.rs index e64fa0b46f1..48fe43450a7 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/macros.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/nameres/tests/macros.rs @@ -1,6 +1,12 @@ -use super::*; +use expect_test::expect; +use test_fixture::WithFixture; + use itertools::Itertools; +use crate::nameres::tests::check; + +use super::*; + #[test] fn macro_rules_are_globally_visible() { check( diff --git a/src/tools/rust-analyzer/crates/hir-def/src/resolver.rs b/src/tools/rust-analyzer/crates/hir-def/src/resolver.rs index 2ac1516ec07..301391516d6 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/resolver.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/resolver.rs @@ -2,7 +2,10 @@ use std::{fmt, hash::BuildHasherDefault}; use base_db::CrateId; -use hir_expand::name::{name, Name}; +use hir_expand::{ + name::{name, Name}, + MacroDefId, +}; use indexmap::IndexMap; use intern::Interned; use rustc_hash::FxHashSet; @@ -406,6 +409,15 @@ impl Resolver { .take_macros_import() } + pub fn resolve_path_as_macro_def( + &self, + db: &dyn DefDatabase, + path: &ModPath, + expected_macro_kind: Option<MacroSubNs>, + ) -> Option<MacroDefId> { + self.resolve_path_as_macro(db, path, expected_macro_kind).map(|(it, _)| db.macro_def(it)) + } + /// Returns a set of names available in the current scope. /// /// Note that this is a somewhat fuzzy concept -- internally, the compiler diff --git a/src/tools/rust-analyzer/crates/hir-def/src/visibility.rs b/src/tools/rust-analyzer/crates/hir-def/src/visibility.rs index f5803653c73..49688c5ee9c 100644 --- a/src/tools/rust-analyzer/crates/hir-def/src/visibility.rs +++ b/src/tools/rust-analyzer/crates/hir-def/src/visibility.rs @@ -2,7 +2,7 @@ use std::iter; -use hir_expand::{span::SpanMapRef, InFile}; +use hir_expand::{span_map::SpanMapRef, InFile}; use la_arena::ArenaMap; use syntax::ast; use triomphe::Arc; diff --git a/src/tools/rust-analyzer/crates/hir-expand/Cargo.toml b/src/tools/rust-analyzer/crates/hir-expand/Cargo.toml index 361bbec4318..506a188a211 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/Cargo.toml +++ b/src/tools/rust-analyzer/crates/hir-expand/Cargo.toml @@ -15,7 +15,7 @@ doctest = false cov-mark = "2.0.0-pre.1" tracing.workspace = true either.workspace = true -rustc-hash = "1.1.0" +rustc-hash.workspace = true la-arena.workspace = true itertools.workspace = true hashbrown.workspace = true @@ -32,6 +32,10 @@ profile.workspace = true tt.workspace = true mbe.workspace = true limit.workspace = true +span.workspace = true [dev-dependencies] expect-test = "1.4.0" + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/ast_id_map.rs b/src/tools/rust-analyzer/crates/hir-expand/src/ast_id_map.rs index be0b72f9dfa..d0d229e1319 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/ast_id_map.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/ast_id_map.rs @@ -5,6 +5,8 @@ //! item as an ID. That way, id's don't change unless the set of items itself //! changes. +// FIXME: Consider moving this into the span crate + use std::{ any::type_name, fmt, @@ -17,9 +19,9 @@ use profile::Count; use rustc_hash::FxHasher; use syntax::{ast, AstNode, AstPtr, SyntaxNode, SyntaxNodePtr}; -use crate::db; +use crate::db::ExpandDatabase; -pub use base_db::span::ErasedFileAstId; +pub use span::ErasedFileAstId; /// `AstId` points to an AST node in any file. /// @@ -27,13 +29,13 @@ pub use base_db::span::ErasedFileAstId; pub type AstId<N> = crate::InFile<FileAstId<N>>; impl<N: AstIdNode> AstId<N> { - pub fn to_node(&self, db: &dyn db::ExpandDatabase) -> N { + pub fn to_node(&self, db: &dyn ExpandDatabase) -> N { self.to_ptr(db).to_node(&db.parse_or_expand(self.file_id)) } - pub fn to_in_file_node(&self, db: &dyn db::ExpandDatabase) -> crate::InFile<N> { + pub fn to_in_file_node(&self, db: &dyn ExpandDatabase) -> crate::InFile<N> { crate::InFile::new(self.file_id, self.to_ptr(db).to_node(&db.parse_or_expand(self.file_id))) } - pub fn to_ptr(&self, db: &dyn db::ExpandDatabase) -> AstPtr<N> { + pub fn to_ptr(&self, db: &dyn ExpandDatabase) -> AstPtr<N> { db.ast_id_map(self.file_id).get(self.value) } } @@ -41,7 +43,7 @@ impl<N: AstIdNode> AstId<N> { pub type ErasedAstId = crate::InFile<ErasedFileAstId>; impl ErasedAstId { - pub fn to_ptr(&self, db: &dyn db::ExpandDatabase) -> SyntaxNodePtr { + pub fn to_ptr(&self, db: &dyn ExpandDatabase) -> SyntaxNodePtr { db.ast_id_map(self.file_id).get_erased(self.value) } } @@ -197,6 +199,19 @@ impl AstIdMap { FileAstId { raw, covariant: PhantomData } } + pub fn ast_id_for_ptr<N: AstIdNode>(&self, ptr: AstPtr<N>) -> FileAstId<N> { + let ptr = ptr.syntax_node_ptr(); + let hash = hash_ptr(&ptr); + match self.map.raw_entry().from_hash(hash, |&idx| self.arena[idx] == ptr) { + Some((&raw, &())) => FileAstId { raw, covariant: PhantomData }, + None => panic!( + "Can't find {:?} in AstIdMap:\n{:?}", + ptr, + self.arena.iter().map(|(_id, i)| i).collect::<Vec<_>>(), + ), + } + } + pub fn get<N: AstIdNode>(&self, id: FileAstId<N>) -> AstPtr<N> { AstPtr::try_from_raw(self.arena[id.raw].clone()).unwrap() } diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/attrs.rs b/src/tools/rust-analyzer/crates/hir-expand/src/attrs.rs index b8fc30c9118..bd0f81881ee 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/attrs.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/attrs.rs @@ -1,19 +1,20 @@ //! A higher level attributes based on TokenTree, with also some shortcuts. use std::{fmt, ops}; -use base_db::{span::SyntaxContextId, CrateId}; +use base_db::CrateId; use cfg::CfgExpr; use either::Either; use intern::Interned; use mbe::{syntax_node_to_token_tree, DelimiterKind, Punct}; use smallvec::{smallvec, SmallVec}; +use span::Span; use syntax::{ast, match_ast, AstNode, AstToken, SmolStr, SyntaxNode}; use triomphe::Arc; use crate::{ db::ExpandDatabase, mod_path::ModPath, - span::SpanMapRef, + span_map::SpanMapRef, tt::{self, Subtree}, InFile, }; @@ -52,7 +53,7 @@ impl RawAttrs { id, input: Some(Interned::new(AttrInput::Literal(SmolStr::new(doc)))), path: Interned::new(ModPath::from(crate::name!(doc))), - ctxt: span_map.span_for_range(comment.syntax().text_range()).ctx, + span: span_map.span_for_range(comment.syntax().text_range()), }), }); let entries: Arc<[Attr]> = Arc::from_iter(entries); @@ -119,7 +120,7 @@ impl RawAttrs { let attrs = parts.enumerate().take(1 << AttrId::CFG_ATTR_BITS).filter_map(|(idx, attr)| { let tree = Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(attr.first()?.first_span()), token_trees: attr.to_vec(), }; Attr::from_tt(db, &tree, index.with_cfg_attr(idx)) @@ -176,7 +177,7 @@ pub struct Attr { pub id: AttrId, pub path: Interned<ModPath>, pub input: Option<Interned<AttrInput>>, - pub ctxt: SyntaxContextId, + pub span: Span, } #[derive(Debug, Clone, PartialEq, Eq, Hash)] @@ -205,6 +206,7 @@ impl Attr { id: AttrId, ) -> Option<Attr> { let path = Interned::new(ModPath::from_src(db, ast.path()?, span_map)?); + let span = span_map.span_for_range(ast.syntax().text_range()); let input = if let Some(ast::Expr::Literal(lit)) = ast.expr() { let value = match lit.kind() { ast::LiteralKind::String(string) => string.value()?.into(), @@ -212,12 +214,12 @@ impl Attr { }; Some(Interned::new(AttrInput::Literal(value))) } else if let Some(tt) = ast.token_tree() { - let tree = syntax_node_to_token_tree(tt.syntax(), span_map); + let tree = syntax_node_to_token_tree(tt.syntax(), span_map, span); Some(Interned::new(AttrInput::TokenTree(Box::new(tree)))) } else { None }; - Some(Attr { id, path, input, ctxt: span_map.span_for_range(ast.syntax().text_range()).ctx }) + Some(Attr { id, path, input, span }) } fn from_tt(db: &dyn ExpandDatabase, tt: &tt::Subtree, id: AttrId) -> Option<Attr> { @@ -265,7 +267,7 @@ impl Attr { pub fn parse_path_comma_token_tree<'a>( &'a self, db: &'a dyn ExpandDatabase, - ) -> Option<impl Iterator<Item = (ModPath, SyntaxContextId)> + 'a> { + ) -> Option<impl Iterator<Item = (ModPath, Span)> + 'a> { let args = self.token_tree_value()?; if args.delimiter.kind != DelimiterKind::Parenthesis { @@ -281,7 +283,7 @@ impl Attr { // FIXME: This is necessarily a hack. It'd be nice if we could avoid allocation // here or maybe just parse a mod path from a token tree directly let subtree = tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(tts.first()?.first_span()), token_trees: tts.to_vec(), }; let (parse, span_map) = @@ -293,7 +295,7 @@ impl Attr { return None; } let path = meta.path()?; - let call_site = span_map.span_at(path.syntax().text_range().start()).ctx; + let call_site = span_map.span_at(path.syntax().text_range().start()); Some(( ModPath::from_src(db, path, SpanMapRef::ExpansionSpanMap(&span_map))?, call_site, diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/builtin_attr_macro.rs b/src/tools/rust-analyzer/crates/hir-expand/src/builtin_attr_macro.rs index de58a495fef..55157abe671 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/builtin_attr_macro.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/builtin_attr_macro.rs @@ -1,12 +1,7 @@ //! Builtin attributes. +use span::{MacroCallId, Span}; -use base_db::{ - span::{SyntaxContextId, ROOT_ERASED_FILE_AST_ID}, - FileId, -}; -use syntax::{TextRange, TextSize}; - -use crate::{db::ExpandDatabase, name, tt, ExpandResult, MacroCallId, MacroCallKind}; +use crate::{db::ExpandDatabase, name, tt, ExpandResult, MacroCallKind}; macro_rules! register_builtin { ($expand_fn:ident: $(($name:ident, $variant:ident) => $expand:ident),* ) => { @@ -106,7 +101,12 @@ fn derive_attr_expand( MacroCallKind::Attr { attr_args: Some(attr_args), .. } if loc.def.is_attribute_derive() => { attr_args } - _ => return ExpandResult::ok(tt::Subtree::empty(tt::DelimSpan::DUMMY)), + _ => { + return ExpandResult::ok(tt::Subtree::empty(tt::DelimSpan { + open: loc.call_site, + close: loc.call_site, + })) + } }; pseudo_derive_attr_expansion(tt, derives, loc.call_site) } @@ -114,20 +114,13 @@ fn derive_attr_expand( pub fn pseudo_derive_attr_expansion( tt: &tt::Subtree, args: &tt::Subtree, - call_site: SyntaxContextId, + call_site: Span, ) -> ExpandResult<tt::Subtree> { let mk_leaf = |char| { tt::TokenTree::Leaf(tt::Leaf::Punct(tt::Punct { char, spacing: tt::Spacing::Alone, - span: tt::SpanData { - range: TextRange::empty(TextSize::new(0)), - anchor: base_db::span::SpanAnchor { - file_id: FileId::BOGUS, - ast_id: ROOT_ERASED_FILE_AST_ID, - }, - ctx: call_site, - }, + span: call_site, })) }; diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/builtin_derive_macro.rs b/src/tools/rust-analyzer/crates/hir-expand/src/builtin_derive_macro.rs index 410aa4d289e..8f240ef0732 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/builtin_derive_macro.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/builtin_derive_macro.rs @@ -1,20 +1,21 @@ //! Builtin derives. -use base_db::{span::SpanData, CrateOrigin, LangCrateOrigin}; +use base_db::{CrateOrigin, LangCrateOrigin}; use itertools::izip; use rustc_hash::FxHashSet; +use span::{MacroCallId, Span}; use stdx::never; use tracing::debug; use crate::{ hygiene::span_with_def_site_ctxt, name::{AsName, Name}, - span::SpanMapRef, + span_map::SpanMapRef, tt, }; use syntax::ast::{self, AstNode, FieldList, HasAttrs, HasGenericParams, HasName, HasTypeBounds}; -use crate::{db::ExpandDatabase, name, quote, ExpandError, ExpandResult, MacroCallId}; +use crate::{db::ExpandDatabase, name, quote, ExpandError, ExpandResult}; macro_rules! register_builtin { ( $($trait:ident => $expand:ident),* ) => { @@ -35,7 +36,7 @@ macro_rules! register_builtin { $( BuiltinDeriveExpander::$trait => $expand, )* }; - let span = db.lookup_intern_macro_call(id).span(db); + let span = db.lookup_intern_macro_call(id).call_site; let span = span_with_def_site_ctxt(db, span, id); expander(db, id, span, tt, token_map) } @@ -73,16 +74,16 @@ enum VariantShape { Unit, } -fn tuple_field_iterator(span: SpanData, n: usize) -> impl Iterator<Item = tt::Ident> { +fn tuple_field_iterator(span: Span, n: usize) -> impl Iterator<Item = tt::Ident> { (0..n).map(move |it| tt::Ident::new(format!("f{it}"), span)) } impl VariantShape { - fn as_pattern(&self, path: tt::Subtree, span: SpanData) -> tt::Subtree { + fn as_pattern(&self, path: tt::Subtree, span: Span) -> tt::Subtree { self.as_pattern_map(path, span, |it| quote!(span => #it)) } - fn field_names(&self, span: SpanData) -> Vec<tt::Ident> { + fn field_names(&self, span: Span) -> Vec<tt::Ident> { match self { VariantShape::Struct(s) => s.clone(), VariantShape::Tuple(n) => tuple_field_iterator(span, *n).collect(), @@ -93,7 +94,7 @@ impl VariantShape { fn as_pattern_map( &self, path: tt::Subtree, - span: SpanData, + span: Span, field_map: impl Fn(&tt::Ident) -> tt::Subtree, ) -> tt::Subtree { match self { @@ -143,11 +144,11 @@ enum AdtShape { } impl AdtShape { - fn as_pattern(&self, span: SpanData, name: &tt::Ident) -> Vec<tt::Subtree> { + fn as_pattern(&self, span: Span, name: &tt::Ident) -> Vec<tt::Subtree> { self.as_pattern_map(name, |it| quote!(span =>#it), span) } - fn field_names(&self, span: SpanData) -> Vec<Vec<tt::Ident>> { + fn field_names(&self, span: Span) -> Vec<Vec<tt::Ident>> { match self { AdtShape::Struct(s) => { vec![s.field_names(span)] @@ -166,7 +167,7 @@ impl AdtShape { &self, name: &tt::Ident, field_map: impl Fn(&tt::Ident) -> tt::Subtree, - span: SpanData, + span: Span, ) -> Vec<tt::Subtree> { match self { AdtShape::Struct(s) => { @@ -199,7 +200,7 @@ struct BasicAdtInfo { fn parse_adt( tm: SpanMapRef<'_>, adt: &ast::Adt, - call_site: SpanData, + call_site: Span, ) -> Result<BasicAdtInfo, ExpandError> { let (name, generic_param_list, shape) = match adt { ast::Adt::Struct(it) => ( @@ -245,7 +246,7 @@ fn parse_adt( match this { Some(it) => { param_type_set.insert(it.as_name()); - mbe::syntax_node_to_token_tree(it.syntax(), tm) + mbe::syntax_node_to_token_tree(it.syntax(), tm, call_site) } None => { tt::Subtree::empty(::tt::DelimSpan { open: call_site, close: call_site }) @@ -253,15 +254,15 @@ fn parse_adt( } }; let bounds = match ¶m { - ast::TypeOrConstParam::Type(it) => { - it.type_bound_list().map(|it| mbe::syntax_node_to_token_tree(it.syntax(), tm)) - } + ast::TypeOrConstParam::Type(it) => it + .type_bound_list() + .map(|it| mbe::syntax_node_to_token_tree(it.syntax(), tm, call_site)), ast::TypeOrConstParam::Const(_) => None, }; let ty = if let ast::TypeOrConstParam::Const(param) = param { let ty = param .ty() - .map(|ty| mbe::syntax_node_to_token_tree(ty.syntax(), tm)) + .map(|ty| mbe::syntax_node_to_token_tree(ty.syntax(), tm, call_site)) .unwrap_or_else(|| { tt::Subtree::empty(::tt::DelimSpan { open: call_site, close: call_site }) }); @@ -297,7 +298,7 @@ fn parse_adt( let name = p.path()?.qualifier()?.as_single_name_ref()?.as_name(); param_type_set.contains(&name).then_some(p) }) - .map(|it| mbe::syntax_node_to_token_tree(it.syntax(), tm)) + .map(|it| mbe::syntax_node_to_token_tree(it.syntax(), tm, call_site)) .collect(); let name_token = name_to_token(tm, name)?; Ok(BasicAdtInfo { name: name_token, shape, param_types, associated_types }) @@ -349,7 +350,7 @@ fn name_to_token( /// therefore does not get bound by the derived trait. fn expand_simple_derive( // FIXME: use - invoc_span: SpanData, + invoc_span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, trait_path: tt::Subtree, @@ -397,7 +398,7 @@ fn expand_simple_derive( ExpandResult::ok(expanded) } -fn find_builtin_crate(db: &dyn ExpandDatabase, id: MacroCallId, span: SpanData) -> tt::TokenTree { +fn find_builtin_crate(db: &dyn ExpandDatabase, id: MacroCallId, span: Span) -> tt::TokenTree { // FIXME: make hygiene works for builtin derive macro // such that $crate can be used here. let cg = db.crate_graph(); @@ -416,7 +417,7 @@ fn find_builtin_crate(db: &dyn ExpandDatabase, id: MacroCallId, span: SpanData) fn copy_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -427,7 +428,7 @@ fn copy_expand( fn clone_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -470,13 +471,13 @@ fn clone_expand( } /// This function exists since `quote! {span => => }` doesn't work. -fn fat_arrow(span: SpanData) -> tt::Subtree { +fn fat_arrow(span: Span) -> tt::Subtree { let eq = tt::Punct { char: '=', spacing: ::tt::Spacing::Joint, span }; quote! {span => #eq> } } /// This function exists since `quote! {span => && }` doesn't work. -fn and_and(span: SpanData) -> tt::Subtree { +fn and_and(span: Span) -> tt::Subtree { let and = tt::Punct { char: '&', spacing: ::tt::Spacing::Joint, span }; quote! {span => #and& } } @@ -484,7 +485,7 @@ fn and_and(span: SpanData) -> tt::Subtree { fn default_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -529,7 +530,7 @@ fn default_expand( fn debug_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -607,7 +608,7 @@ fn debug_expand( fn hash_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -660,7 +661,7 @@ fn hash_expand( fn eq_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -671,7 +672,7 @@ fn eq_expand( fn partial_eq_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -725,7 +726,7 @@ fn partial_eq_expand( fn self_and_other_patterns( adt: &BasicAdtInfo, name: &tt::Ident, - span: SpanData, + span: Span, ) -> (Vec<tt::Subtree>, Vec<tt::Subtree>) { let self_patterns = adt.shape.as_pattern_map( name, @@ -749,7 +750,7 @@ fn self_and_other_patterns( fn ord_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -760,7 +761,7 @@ fn ord_expand( left: tt::Subtree, right: tt::Subtree, rest: tt::Subtree, - span: SpanData, + span: Span, ) -> tt::Subtree { let fat_arrow1 = fat_arrow(span); let fat_arrow2 = fat_arrow(span); @@ -813,7 +814,7 @@ fn ord_expand( fn partial_ord_expand( db: &dyn ExpandDatabase, id: MacroCallId, - span: SpanData, + span: Span, tt: &ast::Adt, tm: SpanMapRef<'_>, ) -> ExpandResult<tt::Subtree> { @@ -824,7 +825,7 @@ fn partial_ord_expand( left: tt::Subtree, right: tt::Subtree, rest: tt::Subtree, - span: SpanData, + span: Span, ) -> tt::Subtree { let fat_arrow1 = fat_arrow(span); let fat_arrow2 = fat_arrow(span); diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/builtin_fn_macro.rs b/src/tools/rust-analyzer/crates/hir-expand/src/builtin_fn_macro.rs index c8f04bfee54..f99a8917623 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/builtin_fn_macro.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/builtin_fn_macro.rs @@ -1,13 +1,11 @@ //! Builtin macro -use base_db::{ - span::{SpanAnchor, SpanData, SyntaxContextId, ROOT_ERASED_FILE_AST_ID}, - AnchoredPath, Edition, FileId, -}; +use base_db::{AnchoredPath, Edition, FileId}; use cfg::CfgExpr; use either::Either; use itertools::Itertools; use mbe::{parse_exprs_with_sep, parse_to_token_tree}; +use span::{Span, SpanAnchor, SyntaxContextId, ROOT_ERASED_FILE_AST_ID}; use syntax::{ ast::{self, AstToken}, SmolStr, @@ -15,10 +13,11 @@ use syntax::{ use crate::{ db::ExpandDatabase, - hygiene::span_with_def_site_ctxt, - name, quote, + hygiene::{span_with_call_site_ctxt, span_with_def_site_ctxt}, + name::{self, known}, + quote, tt::{self, DelimSpan}, - ExpandError, ExpandResult, HirFileIdExt, MacroCallId, MacroCallLoc, + ExpandError, ExpandResult, HirFileIdExt, MacroCallId, }; macro_rules! register_builtin { @@ -44,7 +43,7 @@ macro_rules! register_builtin { $( BuiltinFnLikeExpander::$kind => $expand, )* }; - let span = db.lookup_intern_macro_call(id).span(db); + let span = db.lookup_intern_macro_call(id).call_site; let span = span_with_def_site_ctxt(db, span, id); expander(db, id, tt, span) } @@ -61,7 +60,7 @@ macro_rules! register_builtin { $( EagerExpander::$e_kind => $e_expand, )* }; - let span = db.lookup_intern_macro_call(id).span(db); + let span = db.lookup_intern_macro_call(id).call_site; let span = span_with_def_site_ctxt(db, span, id); expander(db, id, tt, span) } @@ -109,6 +108,7 @@ register_builtin! { (format_args, FormatArgs) => format_args_expand, (const_format_args, ConstFormatArgs) => format_args_expand, (format_args_nl, FormatArgsNl) => format_args_nl_expand, + (quote, Quote) => quote_expand, EAGER: (compile_error, CompileError) => compile_error_expand, @@ -122,7 +122,7 @@ register_builtin! { (option_env, OptionEnv) => option_env_expand } -fn mk_pound(span: SpanData) -> tt::Subtree { +fn mk_pound(span: Span) -> tt::Subtree { crate::quote::IntoTt::to_subtree( vec![crate::tt::Leaf::Punct(crate::tt::Punct { char: '#', @@ -138,7 +138,7 @@ fn module_path_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { // Just return a dummy result. ExpandResult::ok(quote! {span => @@ -150,13 +150,13 @@ fn line_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { // dummy implementation for type-checking purposes // Note that `line!` and `column!` will never be implemented properly, as they are by definition // not incremental ExpandResult::ok(tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(span), token_trees: vec![tt::TokenTree::Leaf(tt::Leaf::Literal(tt::Literal { text: "0u32".into(), span, @@ -168,7 +168,7 @@ fn log_syntax_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { ExpandResult::ok(quote! {span =>}) } @@ -177,7 +177,7 @@ fn trace_macros_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { ExpandResult::ok(quote! {span =>}) } @@ -186,7 +186,7 @@ fn stringify_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let pretty = ::tt::pretty(&tt.token_trees); @@ -198,32 +198,38 @@ fn stringify_expand( } fn assert_expand( - _db: &dyn ExpandDatabase, - _id: MacroCallId, + db: &dyn ExpandDatabase, + id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { - let args = parse_exprs_with_sep(tt, ','); + let call_site_span = span_with_call_site_ctxt(db, span, id); + let args = parse_exprs_with_sep(tt, ',', call_site_span); let dollar_crate = tt::Ident { text: SmolStr::new_inline("$crate"), span }; let expanded = match &*args { [cond, panic_args @ ..] => { let comma = tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(call_site_span), token_trees: vec![tt::TokenTree::Leaf(tt::Leaf::Punct(tt::Punct { char: ',', spacing: tt::Spacing::Alone, - span, + span: call_site_span, }))], }; let cond = cond.clone(); let panic_args = itertools::Itertools::intersperse(panic_args.iter().cloned(), comma); - quote! {span =>{ + let mac = if use_panic_2021(db, span) { + quote! {call_site_span => #dollar_crate::panic::panic_2021!(##panic_args) } + } else { + quote! {call_site_span => #dollar_crate::panic!(##panic_args) } + }; + quote! {call_site_span =>{ if !(#cond) { - #dollar_crate::panic!(##panic_args); + #mac; } }} } - [] => quote! {span =>{}}, + [] => quote! {call_site_span =>{}}, }; ExpandResult::ok(expanded) @@ -233,7 +239,7 @@ fn file_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { // FIXME: RA purposefully lacks knowledge of absolute file names // so just return "". @@ -250,7 +256,7 @@ fn format_args_expand( db: &dyn ExpandDatabase, id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { format_args_expand_general(db, id, tt, "", span) } @@ -259,7 +265,7 @@ fn format_args_nl_expand( db: &dyn ExpandDatabase, id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { format_args_expand_general(db, id, tt, "\\n", span) } @@ -270,7 +276,7 @@ fn format_args_expand_general( tt: &tt::Subtree, // FIXME: Make use of this so that mir interpretation works properly _end_string: &str, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let pound = mk_pound(span); let mut tt = tt.clone(); @@ -284,7 +290,7 @@ fn asm_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { // We expand all assembly snippets to `format_args!` invocations to get format syntax // highlighting for them. @@ -314,7 +320,7 @@ fn global_asm_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { // Expand to nothing (at item-level) ExpandResult::ok(quote! {span =>}) @@ -324,7 +330,7 @@ fn cfg_expand( db: &dyn ExpandDatabase, id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let loc = db.lookup_intern_macro_call(id); let expr = CfgExpr::parse(tt); @@ -337,19 +343,25 @@ fn panic_expand( db: &dyn ExpandDatabase, id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { - let loc: MacroCallLoc = db.lookup_intern_macro_call(id); let dollar_crate = tt::Ident { text: SmolStr::new_inline("$crate"), span }; + let call_site_span = span_with_call_site_ctxt(db, span, id); + + let mac = + if use_panic_2021(db, call_site_span) { known::panic_2021 } else { known::panic_2015 }; + // Expand to a macro call `$crate::panic::panic_{edition}` - let mut call = if db.crate_graph()[loc.krate].edition >= Edition::Edition2021 { - quote!(span =>#dollar_crate::panic::panic_2021!) - } else { - quote!(span =>#dollar_crate::panic::panic_2015!) - }; + let mut call = quote!(call_site_span =>#dollar_crate::panic::#mac!); // Pass the original arguments - call.token_trees.push(tt::TokenTree::Subtree(tt.clone())); + let mut subtree = tt.clone(); + subtree.delimiter = tt::Delimiter { + open: call_site_span, + close: call_site_span, + kind: tt::DelimiterKind::Parenthesis, + }; + call.token_trees.push(tt::TokenTree::Subtree(subtree)); ExpandResult::ok(call) } @@ -357,22 +369,52 @@ fn unreachable_expand( db: &dyn ExpandDatabase, id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { - let loc: MacroCallLoc = db.lookup_intern_macro_call(id); - // Expand to a macro call `$crate::panic::unreachable_{edition}` let dollar_crate = tt::Ident { text: SmolStr::new_inline("$crate"), span }; - let mut call = if db.crate_graph()[loc.krate].edition >= Edition::Edition2021 { - quote!(span =>#dollar_crate::panic::unreachable_2021!) + let call_site_span = span_with_call_site_ctxt(db, span, id); + + let mac = if use_panic_2021(db, call_site_span) { + known::unreachable_2021 } else { - quote!(span =>#dollar_crate::panic::unreachable_2015!) + known::unreachable_2015 }; + // Expand to a macro call `$crate::panic::panic_{edition}` + let mut call = quote!(call_site_span =>#dollar_crate::panic::#mac!); + // Pass the original arguments - call.token_trees.push(tt::TokenTree::Subtree(tt.clone())); + let mut subtree = tt.clone(); + subtree.delimiter = tt::Delimiter { + open: call_site_span, + close: call_site_span, + kind: tt::DelimiterKind::Parenthesis, + }; + call.token_trees.push(tt::TokenTree::Subtree(subtree)); ExpandResult::ok(call) } +fn use_panic_2021(db: &dyn ExpandDatabase, span: Span) -> bool { + // To determine the edition, we check the first span up the expansion + // stack that does not have #[allow_internal_unstable(edition_panic)]. + // (To avoid using the edition of e.g. the assert!() or debug_assert!() definition.) + loop { + let Some(expn) = db.lookup_intern_syntax_context(span.ctx).outer_expn else { + break false; + }; + let expn = db.lookup_intern_macro_call(expn); + // FIXME: Record allow_internal_unstable in the macro def (not been done yet because it + // would consume quite a bit extra memory for all call locs...) + // if let Some(features) = expn.def.allow_internal_unstable { + // if features.iter().any(|&f| f == sym::edition_panic) { + // span = expn.call_site; + // continue; + // } + // } + break expn.def.edition >= Edition::Edition2021; + } +} + fn unquote_str(lit: &tt::Literal) -> Option<String> { let lit = ast::make::tokens::literal(&lit.to_string()); let token = ast::String::cast(lit)?; @@ -395,7 +437,7 @@ fn compile_error_expand( _db: &dyn ExpandDatabase, _id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let err = match &*tt.token_trees { [tt::TokenTree::Leaf(tt::Leaf::Literal(it))] => match unquote_str(it) { @@ -412,7 +454,7 @@ fn concat_expand( _db: &dyn ExpandDatabase, _arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let mut err = None; let mut text = String::new(); @@ -459,7 +501,7 @@ fn concat_bytes_expand( _db: &dyn ExpandDatabase, _arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let mut bytes = Vec::new(); let mut err = None; @@ -543,7 +585,7 @@ fn concat_idents_expand( _db: &dyn ExpandDatabase, _arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let mut err = None; let mut ident = String::new(); @@ -596,7 +638,7 @@ fn include_expand( db: &dyn ExpandDatabase, arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let file_id = match include_input_to_file_id(db, arg_id, tt) { Ok(it) => it, @@ -629,11 +671,11 @@ fn include_bytes_expand( _db: &dyn ExpandDatabase, _arg_id: MacroCallId, _tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { // FIXME: actually read the file here if the user asked for macro expansion let res = tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(span), token_trees: vec![tt::TokenTree::Leaf(tt::Leaf::Literal(tt::Literal { text: r#"b"""#.into(), span, @@ -646,7 +688,7 @@ fn include_str_expand( db: &dyn ExpandDatabase, arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let path = match parse_string(tt) { Ok(it) => it, @@ -681,7 +723,7 @@ fn env_expand( db: &dyn ExpandDatabase, arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let key = match parse_string(tt) { Ok(it) => it, @@ -713,7 +755,7 @@ fn option_env_expand( db: &dyn ExpandDatabase, arg_id: MacroCallId, tt: &tt::Subtree, - span: SpanData, + span: Span, ) -> ExpandResult<tt::Subtree> { let key = match parse_string(tt) { Ok(it) => it, @@ -729,3 +771,15 @@ fn option_env_expand( ExpandResult::ok(expanded) } + +fn quote_expand( + _db: &dyn ExpandDatabase, + _arg_id: MacroCallId, + _tt: &tt::Subtree, + span: Span, +) -> ExpandResult<tt::Subtree> { + ExpandResult::new( + tt::Subtree::empty(tt::DelimSpan { open: span, close: span }), + ExpandError::other("quote! is not implemented"), + ) +} diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/change.rs b/src/tools/rust-analyzer/crates/hir-expand/src/change.rs new file mode 100644 index 00000000000..67b7df198e9 --- /dev/null +++ b/src/tools/rust-analyzer/crates/hir-expand/src/change.rs @@ -0,0 +1,42 @@ +//! Defines a unit of change that can applied to the database to get the next +//! state. Changes are transactional. +use base_db::{salsa::Durability, CrateGraph, FileChange, SourceDatabaseExt, SourceRoot}; +use span::FileId; +use triomphe::Arc; + +use crate::{db::ExpandDatabase, proc_macro::ProcMacros}; + +#[derive(Debug, Default)] +pub struct Change { + pub source_change: FileChange, + pub proc_macros: Option<ProcMacros>, +} + +impl Change { + pub fn new() -> Self { + Self::default() + } + + pub fn apply(self, db: &mut (impl ExpandDatabase + SourceDatabaseExt)) { + self.source_change.apply(db); + if let Some(proc_macros) = self.proc_macros { + db.set_proc_macros_with_durability(Arc::new(proc_macros), Durability::HIGH); + } + } + + pub fn change_file(&mut self, file_id: FileId, new_text: Option<Arc<str>>) { + self.source_change.change_file(file_id, new_text) + } + + pub fn set_crate_graph(&mut self, graph: CrateGraph) { + self.source_change.set_crate_graph(graph) + } + + pub fn set_proc_macros(&mut self, proc_macros: ProcMacros) { + self.proc_macros = Some(proc_macros); + } + + pub fn set_roots(&mut self, roots: Vec<SourceRoot>) { + self.source_change.set_roots(roots) + } +} diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/db.rs b/src/tools/rust-analyzer/crates/hir-expand/src/db.rs index 935669d49b5..f7a26e436de 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/db.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/db.rs @@ -1,14 +1,16 @@ //! Defines database & queries for macro expansion. +use std::sync::OnceLock; + use base_db::{ salsa::{self, debug::DebugQueryTable}, - span::SyntaxContextId, - CrateId, Edition, FileId, SourceDatabase, + CrateId, Edition, FileId, SourceDatabase, VersionReq, }; use either::Either; use limit::Limit; use mbe::{syntax_node_to_token_tree, ValueResult}; use rustc_hash::FxHashSet; +use span::{Span, SyntaxContextId}; use syntax::{ ast::{self, HasAttrs}, AstNode, Parse, SyntaxError, SyntaxNode, SyntaxToken, T, @@ -21,11 +23,16 @@ use crate::{ builtin_attr_macro::pseudo_derive_attr_expansion, builtin_fn_macro::EagerExpander, fixup::{self, reverse_fixups, SyntaxFixupUndoInfo}, - hygiene::{apply_mark, SyntaxContextData, Transparency}, - span::{RealSpanMap, SpanMap, SpanMapRef}, - tt, AstId, BuiltinAttrExpander, BuiltinDeriveExpander, BuiltinFnLikeExpander, EagerCallInfo, - ExpandError, ExpandResult, ExpandTo, ExpansionSpanMap, HirFileId, HirFileIdRepr, MacroCallId, - MacroCallKind, MacroCallLoc, MacroDefId, MacroDefKind, MacroFileId, ProcMacroExpander, + hygiene::{ + apply_mark, span_with_call_site_ctxt, span_with_def_site_ctxt, span_with_mixed_site_ctxt, + SyntaxContextData, Transparency, + }, + proc_macro::ProcMacros, + span_map::{RealSpanMap, SpanMap, SpanMapRef}, + tt, AstId, BuiltinAttrExpander, BuiltinDeriveExpander, BuiltinFnLikeExpander, + CustomProcMacroExpander, EagerCallInfo, ExpandError, ExpandResult, ExpandTo, ExpansionSpanMap, + HirFileId, HirFileIdRepr, MacroCallId, MacroCallKind, MacroCallLoc, MacroDefId, MacroDefKind, + MacroFileId, }; /// Total limit on the number of tokens produced by any macro invocation. @@ -39,10 +46,13 @@ static TOKEN_LIMIT: Limit = Limit::new(1_048_576); #[derive(Debug, Clone, Eq, PartialEq)] /// Old-style `macro_rules` or the new macros 2.0 pub struct DeclarativeMacroExpander { - pub mac: mbe::DeclarativeMacro<base_db::span::SpanData>, + pub mac: mbe::DeclarativeMacro<span::Span>, pub transparency: Transparency, } +// FIXME: Remove this once we drop support for 1.76 +static REQUIREMENT: OnceLock<VersionReq> = OnceLock::new(); + impl DeclarativeMacroExpander { pub fn expand( &self, @@ -50,25 +60,61 @@ impl DeclarativeMacroExpander { tt: tt::Subtree, call_id: MacroCallId, ) -> ExpandResult<tt::Subtree> { + let loc = db.lookup_intern_macro_call(call_id); + let toolchain = &db.crate_graph()[loc.def.krate].toolchain; + let new_meta_vars = toolchain.as_ref().map_or(false, |version| { + REQUIREMENT.get_or_init(|| VersionReq::parse(">=1.76").unwrap()).matches( + &base_db::Version { + pre: base_db::Prerelease::EMPTY, + build: base_db::BuildMetadata::EMPTY, + major: version.major, + minor: version.minor, + patch: version.patch, + }, + ) + }); match self.mac.err() { Some(e) => ExpandResult::new( - tt::Subtree::empty(tt::DelimSpan::DUMMY), + tt::Subtree::empty(tt::DelimSpan { open: loc.call_site, close: loc.call_site }), ExpandError::other(format!("invalid macro definition: {e}")), ), None => self .mac - .expand(&tt, |s| s.ctx = apply_mark(db, s.ctx, call_id, self.transparency)) + .expand( + &tt, + |s| s.ctx = apply_mark(db, s.ctx, call_id, self.transparency), + new_meta_vars, + loc.call_site, + ) .map_err(Into::into), } } - pub fn expand_unhygienic(&self, tt: tt::Subtree) -> ExpandResult<tt::Subtree> { + pub fn expand_unhygienic( + &self, + db: &dyn ExpandDatabase, + tt: tt::Subtree, + krate: CrateId, + call_site: Span, + ) -> ExpandResult<tt::Subtree> { + let toolchain = &db.crate_graph()[krate].toolchain; + let new_meta_vars = toolchain.as_ref().map_or(false, |version| { + REQUIREMENT.get_or_init(|| VersionReq::parse(">=1.76").unwrap()).matches( + &base_db::Version { + pre: base_db::Prerelease::EMPTY, + build: base_db::BuildMetadata::EMPTY, + major: version.major, + minor: version.minor, + patch: version.patch, + }, + ) + }); match self.mac.err() { Some(e) => ExpandResult::new( - tt::Subtree::empty(tt::DelimSpan::DUMMY), + tt::Subtree::empty(tt::DelimSpan { open: call_site, close: call_site }), ExpandError::other(format!("invalid macro definition: {e}")), ), - None => self.mac.expand(&tt, |_| ()).map_err(Into::into), + None => self.mac.expand(&tt, |_| (), new_meta_vars, call_site).map_err(Into::into), } } } @@ -86,11 +132,15 @@ pub enum TokenExpander { /// `derive(Copy)` and such. BuiltInDerive(BuiltinDeriveExpander), /// The thing we love the most here in rust-analyzer -- procedural macros. - ProcMacro(ProcMacroExpander), + ProcMacro(CustomProcMacroExpander), } #[salsa::query_group(ExpandDatabaseStorage)] pub trait ExpandDatabase: SourceDatabase { + /// The proc macros. + #[salsa::input] + fn proc_macros(&self) -> Arc<ProcMacros>; + fn ast_id_map(&self, file_id: HirFileId) -> Arc<AstIdMap>; /// Main public API -- parses a hir file, not caring whether it's a real @@ -164,7 +214,20 @@ pub fn span_map(db: &dyn ExpandDatabase, file_id: HirFileId) -> SpanMap { } pub fn real_span_map(db: &dyn ExpandDatabase, file_id: FileId) -> Arc<RealSpanMap> { - Arc::new(RealSpanMap::from_file(db, file_id)) + use syntax::ast::HasModuleItem; + let mut pairs = vec![(syntax::TextSize::new(0), span::ROOT_ERASED_FILE_AST_ID)]; + let ast_id_map = db.ast_id_map(file_id.into()); + let tree = db.parse(file_id).tree(); + pairs.extend( + tree.items() + .map(|item| (item.syntax().text_range().start(), ast_id_map.ast_id(&item).erase())), + ); + + Arc::new(RealSpanMap::from_file( + file_id, + pairs.into_boxed_slice(), + tree.syntax().text_range().end(), + )) } /// This expands the given macro call, but with different arguments. This is @@ -184,12 +247,13 @@ pub fn expand_speculative( // Build the subtree and token mapping for the speculative args let (mut tt, undo_info) = match loc.kind { - MacroCallKind::FnLike { .. } => { - (mbe::syntax_node_to_token_tree(speculative_args, span_map), SyntaxFixupUndoInfo::NONE) - } + MacroCallKind::FnLike { .. } => ( + mbe::syntax_node_to_token_tree(speculative_args, span_map, loc.call_site), + SyntaxFixupUndoInfo::NONE, + ), MacroCallKind::Derive { .. } | MacroCallKind::Attr { .. } => { let censor = censor_for_macro_input(&loc, speculative_args); - let mut fixups = fixup::fixup_syntax(span_map, speculative_args); + let mut fixups = fixup::fixup_syntax(span_map, speculative_args, loc.call_site); fixups.append.retain(|it, _| match it { syntax::NodeOrToken::Node(it) => !censor.contains(it), syntax::NodeOrToken::Token(_) => true, @@ -201,6 +265,7 @@ pub fn expand_speculative( span_map, fixups.append, fixups.remove, + loc.call_site, ), fixups.undo_info, ) @@ -222,8 +287,9 @@ pub fn expand_speculative( }?; match attr.token_tree() { Some(token_tree) => { - let mut tree = syntax_node_to_token_tree(token_tree.syntax(), span_map); - tree.delimiter = tt::Delimiter::DUMMY_INVISIBLE; + let mut tree = + syntax_node_to_token_tree(token_tree.syntax(), span_map, loc.call_site); + tree.delimiter = tt::Delimiter::invisible_spanned(loc.call_site); Some(tree) } @@ -237,17 +303,16 @@ pub fn expand_speculative( // Otherwise the expand query will fetch the non speculative attribute args and pass those instead. let mut speculative_expansion = match loc.def.kind { MacroDefKind::ProcMacro(expander, ..) => { - tt.delimiter = tt::Delimiter::DUMMY_INVISIBLE; - let call_site = loc.span(db); + tt.delimiter = tt::Delimiter::invisible_spanned(loc.call_site); expander.expand( db, loc.def.krate, loc.krate, &tt, attr_arg.as_ref(), - call_site, - call_site, - call_site, + span_with_def_site_ctxt(db, loc.def.span, actual_macro_call), + span_with_call_site_ctxt(db, loc.def.span, actual_macro_call), + span_with_mixed_site_ctxt(db, loc.def.span, actual_macro_call), ) } MacroDefKind::BuiltInAttr(BuiltinAttrExpander::Derive, _) => { @@ -258,9 +323,12 @@ pub fn expand_speculative( let adt = ast::Adt::cast(speculative_args.clone()).unwrap(); expander.expand(db, actual_macro_call, &adt, span_map) } - MacroDefKind::Declarative(it) => { - db.decl_macro_expander(loc.krate, it).expand_unhygienic(tt) - } + MacroDefKind::Declarative(it) => db.decl_macro_expander(loc.krate, it).expand_unhygienic( + db, + tt, + loc.def.krate, + loc.call_site, + ), MacroDefKind::BuiltIn(it, _) => it.expand(db, actual_macro_call, &tt).map_err(Into::into), MacroDefKind::BuiltInEager(it, _) => { it.expand(db, actual_macro_call, &tt).map_err(Into::into) @@ -410,12 +478,13 @@ fn macro_arg( MacroCallKind::Attr { ast_id, .. } => ast_id.to_ptr(db).to_node(&root).syntax().clone(), }; let (mut tt, undo_info) = match loc.kind { - MacroCallKind::FnLike { .. } => { - (mbe::syntax_node_to_token_tree(&syntax, map.as_ref()), SyntaxFixupUndoInfo::NONE) - } + MacroCallKind::FnLike { .. } => ( + mbe::syntax_node_to_token_tree(&syntax, map.as_ref(), loc.call_site), + SyntaxFixupUndoInfo::NONE, + ), MacroCallKind::Derive { .. } | MacroCallKind::Attr { .. } => { let censor = censor_for_macro_input(&loc, &syntax); - let mut fixups = fixup::fixup_syntax(map.as_ref(), &syntax); + let mut fixups = fixup::fixup_syntax(map.as_ref(), &syntax, loc.call_site); fixups.append.retain(|it, _| match it { syntax::NodeOrToken::Node(it) => !censor.contains(it), syntax::NodeOrToken::Token(_) => true, @@ -427,6 +496,7 @@ fn macro_arg( map.as_ref(), fixups.append.clone(), fixups.remove.clone(), + loc.call_site, ); reverse_fixups(&mut tt, &fixups.undo_info); } @@ -436,6 +506,7 @@ fn macro_arg( map, fixups.append, fixups.remove, + loc.call_site, ), fixups.undo_info, ) @@ -444,7 +515,7 @@ fn macro_arg( if loc.def.is_proc_macro() { // proc macros expect their inputs without parentheses, MBEs expect it with them included - tt.delimiter = tt::Delimiter::DUMMY_INVISIBLE; + tt.delimiter.kind = tt::DelimiterKind::Invisible; } if matches!(loc.def.kind, MacroDefKind::BuiltInEager(..)) { @@ -506,7 +577,8 @@ fn decl_macro_expander( def_crate: CrateId, id: AstId<ast::Macro>, ) -> Arc<DeclarativeMacroExpander> { - let is_2021 = db.crate_graph()[def_crate].edition >= Edition::Edition2021; + let crate_data = &db.crate_graph()[def_crate]; + let is_2021 = crate_data.edition >= Edition::Edition2021; let (root, map) = parse_with_map(db, id.file_id); let root = root.syntax_node(); @@ -530,13 +602,29 @@ fn decl_macro_expander( _ => None, } }; + let toolchain = crate_data.toolchain.as_ref(); + let new_meta_vars = toolchain.as_ref().map_or(false, |version| { + REQUIREMENT.get_or_init(|| VersionReq::parse(">=1.76").unwrap()).matches( + &base_db::Version { + pre: base_db::Prerelease::EMPTY, + build: base_db::BuildMetadata::EMPTY, + major: version.major, + minor: version.minor, + patch: version.patch, + }, + ) + }); let (mac, transparency) = match id.to_ptr(db).to_node(&root) { ast::Macro::MacroRules(macro_rules) => ( match macro_rules.token_tree() { Some(arg) => { - let tt = mbe::syntax_node_to_token_tree(arg.syntax(), map.as_ref()); - let mac = mbe::DeclarativeMacro::parse_macro_rules(&tt, is_2021); + let tt = mbe::syntax_node_to_token_tree( + arg.syntax(), + map.as_ref(), + map.span_for_range(macro_rules.macro_rules_token().unwrap().text_range()), + ); + let mac = mbe::DeclarativeMacro::parse_macro_rules(&tt, is_2021, new_meta_vars); mac } None => mbe::DeclarativeMacro::from_err( @@ -549,8 +637,12 @@ fn decl_macro_expander( ast::Macro::MacroDef(macro_def) => ( match macro_def.body() { Some(arg) => { - let tt = mbe::syntax_node_to_token_tree(arg.syntax(), map.as_ref()); - let mac = mbe::DeclarativeMacro::parse_macro2(&tt, is_2021); + let tt = mbe::syntax_node_to_token_tree( + arg.syntax(), + map.as_ref(), + map.span_for_range(macro_def.macro_token().unwrap().text_range()), + ); + let mac = mbe::DeclarativeMacro::parse_macro2(&tt, is_2021, new_meta_vars); mac } None => mbe::DeclarativeMacro::from_err( @@ -601,7 +693,7 @@ fn macro_expand( let Some((macro_arg, undo_info)) = value else { return ExpandResult { value: Arc::new(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + delimiter: tt::Delimiter::invisible_spanned(loc.call_site), token_trees: Vec::new(), }), // FIXME: We should make sure to enforce an invariant that invalid macro @@ -660,7 +752,7 @@ fn macro_expand( // Skip checking token tree limit for include! macro call if !loc.def.is_include() { // Set a hard limit for the expanded tt - if let Err(value) = check_tt_count(&tt) { + if let Err(value) = check_tt_count(&tt, loc.call_site) { return value; } } @@ -673,7 +765,7 @@ fn expand_proc_macro(db: &dyn ExpandDatabase, id: MacroCallId) -> ExpandResult<A let Some((macro_arg, undo_info)) = db.macro_arg(id).value else { return ExpandResult { value: Arc::new(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + delimiter: tt::Delimiter::invisible_spanned(loc.call_site), token_trees: Vec::new(), }), // FIXME: We should make sure to enforce an invariant that invalid macro @@ -692,22 +784,19 @@ fn expand_proc_macro(db: &dyn ExpandDatabase, id: MacroCallId) -> ExpandResult<A _ => None, }; - let call_site = loc.span(db); let ExpandResult { value: mut tt, err } = expander.expand( db, loc.def.krate, loc.krate, ¯o_arg, attr_arg, - // FIXME - call_site, - call_site, - // FIXME - call_site, + span_with_def_site_ctxt(db, loc.def.span, id), + span_with_call_site_ctxt(db, loc.def.span, id), + span_with_mixed_site_ctxt(db, loc.def.span, id), ); // Set a hard limit for the expanded tt - if let Err(value) = check_tt_count(&tt) { + if let Err(value) = check_tt_count(&tt, loc.call_site) { return value; } @@ -730,12 +819,12 @@ fn token_tree_to_syntax_node( mbe::token_tree_to_syntax_node(tt, entry_point) } -fn check_tt_count(tt: &tt::Subtree) -> Result<(), ExpandResult<Arc<tt::Subtree>>> { +fn check_tt_count(tt: &tt::Subtree, call_site: Span) -> Result<(), ExpandResult<Arc<tt::Subtree>>> { let count = tt.count(); if TOKEN_LIMIT.check(count).is_err() { Err(ExpandResult { value: Arc::new(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + delimiter: tt::Delimiter::invisible_spanned(call_site), token_trees: vec![], }), err: Some(ExpandError::other(format!( diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/eager.rs b/src/tools/rust-analyzer/crates/hir-expand/src/eager.rs index 8d55240aef5..da85c2ec7ac 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/eager.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/eager.rs @@ -18,7 +18,8 @@ //! //! //! See the full discussion : <https://rust-lang.zulipchat.com/#narrow/stream/131828-t-compiler/topic/Eager.20expansion.20of.20built-in.20macros> -use base_db::{span::SyntaxContextId, CrateId}; +use base_db::CrateId; +use span::Span; use syntax::{ted, Parse, SyntaxElement, SyntaxNode, TextSize, WalkEvent}; use triomphe::Arc; @@ -26,9 +27,9 @@ use crate::{ ast::{self, AstNode}, db::ExpandDatabase, mod_path::ModPath, - span::SpanMapRef, - EagerCallInfo, ExpandError, ExpandResult, ExpandTo, ExpansionSpanMap, InFile, MacroCallId, - MacroCallKind, MacroCallLoc, MacroDefId, MacroDefKind, + span_map::SpanMapRef, + EagerCallInfo, ExpandError, ExpandResult, ExpandTo, ExpansionSpanMap, InFile, Intern, + MacroCallId, MacroCallKind, MacroCallLoc, MacroDefId, MacroDefKind, }; pub fn expand_eager_macro_input( @@ -36,7 +37,7 @@ pub fn expand_eager_macro_input( krate: CrateId, macro_call: InFile<ast::MacroCall>, def: MacroDefId, - call_site: SyntaxContextId, + call_site: Span, resolver: &dyn Fn(ModPath) -> Option<MacroDefId>, ) -> ExpandResult<Option<MacroCallId>> { let ast_map = db.ast_id_map(macro_call.file_id); @@ -48,13 +49,14 @@ pub fn expand_eager_macro_input( // When `lazy_expand` is called, its *parent* file must already exist. // Here we store an eager macro id for the argument expanded subtree // for that purpose. - let arg_id = db.intern_macro_call(MacroCallLoc { + let arg_id = MacroCallLoc { def, krate, eager: None, kind: MacroCallKind::FnLike { ast_id: call_id, expand_to: ExpandTo::Expr }, call_site, - }); + } + .intern(db); let ExpandResult { value: (arg_exp, arg_exp_map), err: parse_err } = db.parse_macro_expansion(arg_id.as_macro_file()); @@ -81,9 +83,9 @@ pub fn expand_eager_macro_input( return ExpandResult { value: None, err }; }; - let mut subtree = mbe::syntax_node_to_token_tree(&expanded_eager_input, arg_map); + let mut subtree = mbe::syntax_node_to_token_tree(&expanded_eager_input, arg_map, call_site); - subtree.delimiter = crate::tt::Delimiter::DUMMY_INVISIBLE; + subtree.delimiter.kind = crate::tt::DelimiterKind::Invisible; let loc = MacroCallLoc { def, @@ -93,7 +95,7 @@ pub fn expand_eager_macro_input( call_site, }; - ExpandResult { value: Some(db.intern_macro_call(loc)), err } + ExpandResult { value: Some(loc.intern(db)), err } } fn lazy_expand( @@ -101,7 +103,7 @@ fn lazy_expand( def: &MacroDefId, macro_call: InFile<ast::MacroCall>, krate: CrateId, - call_site: SyntaxContextId, + call_site: Span, ) -> ExpandResult<(InFile<Parse<SyntaxNode>>, Arc<ExpansionSpanMap>)> { let ast_id = db.ast_id_map(macro_call.file_id).ast_id(¯o_call.value); @@ -121,7 +123,7 @@ fn eager_macro_recur( mut offset: TextSize, curr: InFile<SyntaxNode>, krate: CrateId, - call_site: SyntaxContextId, + call_site: Span, macro_resolver: &dyn Fn(ModPath) -> Option<MacroDefId>, ) -> ExpandResult<Option<(SyntaxNode, TextSize)>> { let original = curr.value.clone_for_update(); diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/files.rs b/src/tools/rust-analyzer/crates/hir-expand/src/files.rs index 89f0685d5b6..d0a1bef11c3 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/files.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/files.rs @@ -1,11 +1,8 @@ //! Things to wrap other things in file ids. use std::iter; -use base_db::{ - span::{HirFileId, HirFileIdRepr, MacroFileId, SyntaxContextId}, - FileId, FileRange, -}; use either::Either; +use span::{FileId, FileRange, HirFileId, HirFileIdRepr, MacroFileId, SyntaxContextId}; use syntax::{AstNode, SyntaxNode, SyntaxToken, TextRange, TextSize}; use crate::{db, ExpansionInfo, MacroFileIdExt}; @@ -345,7 +342,7 @@ impl InFile<TextRange> { } impl<N: AstNode> InFile<N> { - pub fn original_ast_node(self, db: &dyn db::ExpandDatabase) -> Option<InRealFile<N>> { + pub fn original_ast_node_rooted(self, db: &dyn db::ExpandDatabase) -> Option<InRealFile<N>> { // This kind of upmapping can only be achieved in attribute expanded files, // as we don't have node inputs otherwise and therefore can't find an `N` node in the input let file_id = match self.file_id.repr() { diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/fixup.rs b/src/tools/rust-analyzer/crates/hir-expand/src/fixup.rs index 346cd39a767..d241d94b8c4 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/fixup.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/fixup.rs @@ -1,23 +1,19 @@ //! To make attribute macros work reliably when typing, we need to take care to //! fix up syntax errors in the code we're passing to them. -use base_db::{ - span::{ErasedFileAstId, SpanAnchor, SpanData}, - FileId, -}; -use la_arena::RawIdx; use rustc_hash::{FxHashMap, FxHashSet}; use smallvec::SmallVec; +use span::{ErasedFileAstId, Span, SpanAnchor, SpanData, FIXUP_ERASED_FILE_AST_ID_MARKER}; use stdx::never; use syntax::{ ast::{self, AstNode, HasLoopBody}, match_ast, SyntaxElement, SyntaxKind, SyntaxNode, TextRange, TextSize, }; use triomphe::Arc; -use tt::{Spacing, Span}; +use tt::Spacing; use crate::{ - span::SpanMapRef, + span_map::SpanMapRef, tt::{Ident, Leaf, Punct, Subtree}, }; @@ -42,28 +38,30 @@ impl SyntaxFixupUndoInfo { pub(crate) const NONE: Self = SyntaxFixupUndoInfo { original: None }; } -// censoring -> just don't convert the node -// replacement -> censor + append -// append -> insert a fake node, here we need to assemble some dummy span that we can figure out how -// to remove later -const FIXUP_DUMMY_FILE: FileId = FileId::from_raw(FileId::MAX_FILE_ID); -const FIXUP_DUMMY_AST_ID: ErasedFileAstId = ErasedFileAstId::from_raw(RawIdx::from_u32(!0)); +// We mark spans with `FIXUP_DUMMY_AST_ID` to indicate that they are fake. +const FIXUP_DUMMY_AST_ID: ErasedFileAstId = FIXUP_ERASED_FILE_AST_ID_MARKER; const FIXUP_DUMMY_RANGE: TextRange = TextRange::empty(TextSize::new(0)); +// If the fake span has this range end, that means that the range start is an index into the +// `original` list in `SyntaxFixupUndoInfo`. const FIXUP_DUMMY_RANGE_END: TextSize = TextSize::new(!0); -pub(crate) fn fixup_syntax(span_map: SpanMapRef<'_>, node: &SyntaxNode) -> SyntaxFixups { +pub(crate) fn fixup_syntax( + span_map: SpanMapRef<'_>, + node: &SyntaxNode, + call_site: Span, +) -> SyntaxFixups { let mut append = FxHashMap::<SyntaxElement, _>::default(); let mut remove = FxHashSet::<SyntaxNode>::default(); let mut preorder = node.preorder(); let mut original = Vec::new(); let dummy_range = FIXUP_DUMMY_RANGE; - // we use a file id of `FileId(!0)` to signal a fake node, and the text range's start offset as - // the index into the replacement vec but only if the end points to !0 - let dummy_anchor = SpanAnchor { file_id: FIXUP_DUMMY_FILE, ast_id: FIXUP_DUMMY_AST_ID }; - let fake_span = |range| SpanData { - range: dummy_range, - anchor: dummy_anchor, - ctx: span_map.span_for_range(range).ctx, + let fake_span = |range| { + let span = span_map.span_for_range(range); + SpanData { + range: dummy_range, + anchor: SpanAnchor { ast_id: FIXUP_DUMMY_AST_ID, ..span.anchor }, + ctx: span.ctx, + } }; while let Some(event) = preorder.next() { let syntax::WalkEvent::Enter(node) = event else { continue }; @@ -72,15 +70,16 @@ pub(crate) fn fixup_syntax(span_map: SpanMapRef<'_>, node: &SyntaxNode) -> Synta if can_handle_error(&node) && has_error_to_handle(&node) { remove.insert(node.clone().into()); // the node contains an error node, we have to completely replace it by something valid - let original_tree = mbe::syntax_node_to_token_tree(&node, span_map); + let original_tree = mbe::syntax_node_to_token_tree(&node, span_map, call_site); let idx = original.len() as u32; original.push(original_tree); + let span = span_map.span_for_range(node_range); let replacement = Leaf::Ident(Ident { text: "__ra_fixup".into(), span: SpanData { range: TextRange::new(TextSize::new(idx), FIXUP_DUMMY_RANGE_END), - anchor: dummy_anchor, - ctx: span_map.span_for_range(node_range).ctx, + anchor: SpanAnchor { ast_id: FIXUP_DUMMY_AST_ID, ..span.anchor }, + ctx: span.ctx, }, }); append.insert(node.clone().into(), vec![replacement]); @@ -301,9 +300,10 @@ fn has_error_to_handle(node: &SyntaxNode) -> bool { pub(crate) fn reverse_fixups(tt: &mut Subtree, undo_info: &SyntaxFixupUndoInfo) { let Some(undo_info) = undo_info.original.as_deref() else { return }; let undo_info = &**undo_info; + #[allow(deprecated)] if never!( - tt.delimiter.close.anchor.file_id == FIXUP_DUMMY_FILE - || tt.delimiter.open.anchor.file_id == FIXUP_DUMMY_FILE + tt.delimiter.close.anchor.ast_id == FIXUP_DUMMY_AST_ID + || tt.delimiter.open.anchor.ast_id == FIXUP_DUMMY_AST_ID ) { tt.delimiter.close = SpanData::DUMMY; tt.delimiter.open = SpanData::DUMMY; @@ -319,7 +319,7 @@ fn reverse_fixups_(tt: &mut Subtree, undo_info: &[Subtree]) { .filter(|tt| match tt { tt::TokenTree::Leaf(leaf) => { let span = leaf.span(); - let is_real_leaf = span.anchor.file_id != FIXUP_DUMMY_FILE; + let is_real_leaf = span.anchor.ast_id != FIXUP_DUMMY_AST_ID; let is_replaced_node = span.range.end() == FIXUP_DUMMY_RANGE_END; is_real_leaf || is_replaced_node } @@ -327,8 +327,8 @@ fn reverse_fixups_(tt: &mut Subtree, undo_info: &[Subtree]) { }) .flat_map(|tt| match tt { tt::TokenTree::Subtree(mut tt) => { - if tt.delimiter.close.anchor.file_id == FIXUP_DUMMY_FILE - || tt.delimiter.open.anchor.file_id == FIXUP_DUMMY_FILE + if tt.delimiter.close.anchor.ast_id == FIXUP_DUMMY_AST_ID + || tt.delimiter.open.anchor.ast_id == FIXUP_DUMMY_AST_ID { // Even though fixup never creates subtrees with fixup spans, the old proc-macro server // might copy them if the proc-macro asks for it, so we need to filter those out @@ -339,7 +339,7 @@ fn reverse_fixups_(tt: &mut Subtree, undo_info: &[Subtree]) { SmallVec::from_const([tt.into()]) } tt::TokenTree::Leaf(leaf) => { - if leaf.span().anchor.file_id == FIXUP_DUMMY_FILE { + if leaf.span().anchor.ast_id == FIXUP_DUMMY_AST_ID { // we have a fake node here, we need to replace it again with the original let original = undo_info[u32::from(leaf.span().range.start()) as usize].clone(); if original.delimiter.kind == tt::DelimiterKind::Invisible { @@ -360,11 +360,12 @@ fn reverse_fixups_(tt: &mut Subtree, undo_info: &[Subtree]) { mod tests { use base_db::FileId; use expect_test::{expect, Expect}; + use syntax::TextRange; use triomphe::Arc; use crate::{ fixup::reverse_fixups, - span::{RealSpanMap, SpanMap}, + span_map::{RealSpanMap, SpanMap}, tt, }; @@ -397,12 +398,17 @@ mod tests { fn check(ra_fixture: &str, mut expect: Expect) { let parsed = syntax::SourceFile::parse(ra_fixture); let span_map = SpanMap::RealSpanMap(Arc::new(RealSpanMap::absolute(FileId::from_raw(0)))); - let fixups = super::fixup_syntax(span_map.as_ref(), &parsed.syntax_node()); + let fixups = super::fixup_syntax( + span_map.as_ref(), + &parsed.syntax_node(), + span_map.span_for_range(TextRange::empty(0.into())), + ); let mut tt = mbe::syntax_node_to_token_tree_modified( &parsed.syntax_node(), span_map.as_ref(), fixups.append, fixups.remove, + span_map.span_for_range(TextRange::empty(0.into())), ); let actual = format!("{tt}\n"); @@ -422,8 +428,11 @@ mod tests { // the fixed-up + reversed version should be equivalent to the original input // modulo token IDs and `Punct`s' spacing. - let original_as_tt = - mbe::syntax_node_to_token_tree(&parsed.syntax_node(), span_map.as_ref()); + let original_as_tt = mbe::syntax_node_to_token_tree( + &parsed.syntax_node(), + span_map.as_ref(), + span_map.span_for_range(TextRange::empty(0.into())), + ); assert!( check_subtree_eq(&tt, &original_as_tt), "different token tree:\n{tt:?}\n\n{original_as_tt:?}" diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/hygiene.rs b/src/tools/rust-analyzer/crates/hir-expand/src/hygiene.rs index 7b03709aced..57921543c4b 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/hygiene.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/hygiene.rs @@ -2,9 +2,12 @@ //! //! Specifically, `ast` + `Hygiene` allows you to create a `Name`. Note that, at //! this moment, this is horribly incomplete and handles only `$crate`. + +// FIXME: Consider moving this into the span crate. + use std::iter; -use base_db::span::{MacroCallId, SpanData, SyntaxContextId}; +use span::{MacroCallId, Span, SyntaxContextId}; use crate::db::ExpandDatabase; @@ -78,37 +81,29 @@ pub enum Transparency { Opaque, } -pub fn span_with_def_site_ctxt( - db: &dyn ExpandDatabase, - span: SpanData, - expn_id: MacroCallId, -) -> SpanData { +pub fn span_with_def_site_ctxt(db: &dyn ExpandDatabase, span: Span, expn_id: MacroCallId) -> Span { span_with_ctxt_from_mark(db, span, expn_id, Transparency::Opaque) } -pub fn span_with_call_site_ctxt( - db: &dyn ExpandDatabase, - span: SpanData, - expn_id: MacroCallId, -) -> SpanData { +pub fn span_with_call_site_ctxt(db: &dyn ExpandDatabase, span: Span, expn_id: MacroCallId) -> Span { span_with_ctxt_from_mark(db, span, expn_id, Transparency::Transparent) } pub fn span_with_mixed_site_ctxt( db: &dyn ExpandDatabase, - span: SpanData, + span: Span, expn_id: MacroCallId, -) -> SpanData { +) -> Span { span_with_ctxt_from_mark(db, span, expn_id, Transparency::SemiTransparent) } fn span_with_ctxt_from_mark( db: &dyn ExpandDatabase, - span: SpanData, + span: Span, expn_id: MacroCallId, transparency: Transparency, -) -> SpanData { - SpanData { ctx: apply_mark(db, SyntaxContextId::ROOT, expn_id, transparency), ..span } +) -> Span { + Span { ctx: apply_mark(db, SyntaxContextId::ROOT, expn_id, transparency), ..span } } pub(super) fn apply_mark( @@ -121,7 +116,7 @@ pub(super) fn apply_mark( return apply_mark_internal(db, ctxt, Some(call_id), transparency); } - let call_site_ctxt = db.lookup_intern_macro_call(call_id).call_site; + let call_site_ctxt = db.lookup_intern_macro_call(call_id).call_site.ctx; let mut call_site_ctxt = if transparency == Transparency::SemiTransparent { call_site_ctxt.normalize_to_macros_2_0(db) } else { @@ -154,15 +149,16 @@ fn apply_mark_internal( transparency: Transparency, ) -> SyntaxContextId { let syntax_context_data = db.lookup_intern_syntax_context(ctxt); - let mut opaque = syntax_context_data.opaque; - let mut opaque_and_semitransparent = syntax_context_data.opaque_and_semitransparent; + let mut opaque = handle_self_ref(ctxt, syntax_context_data.opaque); + let mut opaque_and_semitransparent = + handle_self_ref(ctxt, syntax_context_data.opaque_and_semitransparent); if transparency >= Transparency::Opaque { let parent = opaque; + // Unlike rustc, with salsa we can't prefetch the to be allocated ID to create cycles with + // salsa when interning, so we use a sentinel value that effectively means the current + // syntax context. let new_opaque = SyntaxContextId::SELF_REF; - // But we can't just grab the to be allocated ID either as that would not deduplicate - // things! - // So we need a new salsa store type here ... opaque = db.intern_syntax_context(SyntaxContextData { outer_expn: call_id, outer_transparency: transparency, @@ -174,6 +170,9 @@ fn apply_mark_internal( if transparency >= Transparency::SemiTransparent { let parent = opaque_and_semitransparent; + // Unlike rustc, with salsa we can't prefetch the to be allocated ID to create cycles with + // salsa when interning, so we use a sentinel value that effectively means the current + // syntax context. let new_opaque_and_semitransparent = SyntaxContextId::SELF_REF; opaque_and_semitransparent = db.intern_syntax_context(SyntaxContextData { outer_expn: call_id, diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/lib.rs b/src/tools/rust-analyzer/crates/hir-expand/src/lib.rs index d7819b315c4..b5197d4c25d 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/lib.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/lib.rs @@ -6,20 +6,21 @@ #![warn(rust_2018_idioms, unused_lifetimes)] -pub mod db; pub mod ast_id_map; -pub mod name; -pub mod hygiene; +pub mod attrs; pub mod builtin_attr_macro; pub mod builtin_derive_macro; pub mod builtin_fn_macro; -pub mod proc_macro; -pub mod quote; +pub mod db; pub mod eager; -pub mod mod_path; -pub mod attrs; -pub mod span; pub mod files; +pub mod change; +pub mod hygiene; +pub mod mod_path; +pub mod name; +pub mod proc_macro; +pub mod quote; +pub mod span_map; mod fixup; use attrs::collect_attrs; @@ -27,11 +28,9 @@ use triomphe::Arc; use std::{fmt, hash::Hash}; -use base_db::{ - span::{HirFileIdRepr, SpanData, SyntaxContextId}, - CrateId, FileId, FileRange, ProcMacroKind, -}; +use base_db::{CrateId, Edition, FileId}; use either::Either; +use span::{FileRange, HirFileIdRepr, Span, SyntaxContextId}; use syntax::{ ast::{self, AstNode}, SyntaxNode, SyntaxToken, TextRange, TextSize, @@ -42,35 +41,86 @@ use crate::{ builtin_attr_macro::BuiltinAttrExpander, builtin_derive_macro::BuiltinDeriveExpander, builtin_fn_macro::{BuiltinFnLikeExpander, EagerExpander}, - db::TokenExpander, + db::{ExpandDatabase, TokenExpander}, fixup::SyntaxFixupUndoInfo, + hygiene::SyntaxContextData, mod_path::ModPath, - proc_macro::ProcMacroExpander, - span::{ExpansionSpanMap, SpanMap}, + proc_macro::{CustomProcMacroExpander, ProcMacroKind}, + span_map::{ExpansionSpanMap, SpanMap}, }; pub use crate::ast_id_map::{AstId, ErasedAstId, ErasedFileAstId}; pub use crate::files::{InFile, InMacroFile, InRealFile}; -pub use base_db::span::{HirFileId, MacroCallId, MacroFileId}; pub use mbe::ValueResult; +pub use span::{HirFileId, MacroCallId, MacroFileId}; -pub type DeclarativeMacro = ::mbe::DeclarativeMacro<tt::SpanData>; +pub type DeclarativeMacro = ::mbe::DeclarativeMacro<tt::Span>; pub mod tt { - pub use base_db::span::SpanData; - pub use tt::{DelimiterKind, Spacing, Span, SpanAnchor}; - - pub type Delimiter = ::tt::Delimiter<SpanData>; - pub type DelimSpan = ::tt::DelimSpan<SpanData>; - pub type Subtree = ::tt::Subtree<SpanData>; - pub type Leaf = ::tt::Leaf<SpanData>; - pub type Literal = ::tt::Literal<SpanData>; - pub type Punct = ::tt::Punct<SpanData>; - pub type Ident = ::tt::Ident<SpanData>; - pub type TokenTree = ::tt::TokenTree<SpanData>; + pub use span::Span; + pub use tt::{DelimiterKind, Spacing}; + + pub type Delimiter = ::tt::Delimiter<Span>; + pub type DelimSpan = ::tt::DelimSpan<Span>; + pub type Subtree = ::tt::Subtree<Span>; + pub type Leaf = ::tt::Leaf<Span>; + pub type Literal = ::tt::Literal<Span>; + pub type Punct = ::tt::Punct<Span>; + pub type Ident = ::tt::Ident<Span>; + pub type TokenTree = ::tt::TokenTree<Span>; +} + +#[macro_export] +macro_rules! impl_intern_lookup { + ($db:ident, $id:ident, $loc:ident, $intern:ident, $lookup:ident) => { + impl $crate::Intern for $loc { + type Database<'db> = dyn $db + 'db; + type ID = $id; + fn intern<'db>(self, db: &Self::Database<'db>) -> $id { + db.$intern(self) + } + } + + impl $crate::Lookup for $id { + type Database<'db> = dyn $db + 'db; + type Data = $loc; + fn lookup<'db>(&self, db: &Self::Database<'db>) -> $loc { + db.$lookup(*self) + } + } + }; +} + +// ideally these would be defined in base-db, but the orphan rule doesn't let us +pub trait Intern { + type Database<'db>: ?Sized; + type ID; + fn intern<'db>(self, db: &Self::Database<'db>) -> Self::ID; +} + +pub trait Lookup { + type Database<'db>: ?Sized; + type Data; + fn lookup<'db>(&self, db: &Self::Database<'db>) -> Self::Data; } +impl_intern_lookup!( + ExpandDatabase, + MacroCallId, + MacroCallLoc, + intern_macro_call, + lookup_intern_macro_call +); + +impl_intern_lookup!( + ExpandDatabase, + SyntaxContextId, + SyntaxContextData, + intern_syntax_context, + lookup_intern_syntax_context +); + pub type ExpandResult<T> = ValueResult<T, ExpandError>; #[derive(Debug, PartialEq, Eq, Clone, Hash)] @@ -117,18 +167,20 @@ pub struct MacroCallLoc { pub krate: CrateId, /// Some if this is a macro call for an eager macro. Note that this is `None` /// for the eager input macro file. + // FIXME: This seems bad to save in an interned structure eager: Option<Arc<EagerCallInfo>>, pub kind: MacroCallKind, - pub call_site: SyntaxContextId, + pub call_site: Span, } #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)] pub struct MacroDefId { pub krate: CrateId, + pub edition: Edition, pub kind: MacroDefKind, pub local_inner: bool, pub allow_internal_unsafe: bool, - // pub def_site: SyntaxContextId, + pub span: Span, } #[derive(Debug, Clone, Copy, PartialEq, Eq, Hash)] @@ -138,7 +190,7 @@ pub enum MacroDefKind { BuiltInAttr(BuiltinAttrExpander, AstId<ast::Macro>), BuiltInDerive(BuiltinDeriveExpander, AstId<ast::Macro>), BuiltInEager(EagerExpander, AstId<ast::Macro>), - ProcMacro(ProcMacroExpander, ProcMacroKind, AstId<ast::Fn>), + ProcMacro(CustomProcMacroExpander, ProcMacroKind, AstId<ast::Fn>), } #[derive(Debug, Clone, PartialEq, Eq, Hash)] @@ -179,40 +231,39 @@ pub enum MacroCallKind { pub trait HirFileIdExt { /// Returns the original file of this macro call hierarchy. - fn original_file(self, db: &dyn db::ExpandDatabase) -> FileId; + fn original_file(self, db: &dyn ExpandDatabase) -> FileId; /// Returns the original file of this macro call hierarchy while going into the included file if /// one of the calls comes from an `include!``. - fn original_file_respecting_includes(self, db: &dyn db::ExpandDatabase) -> FileId; + fn original_file_respecting_includes(self, db: &dyn ExpandDatabase) -> FileId; /// If this is a macro call, returns the syntax node of the very first macro call this file resides in. - fn original_call_node(self, db: &dyn db::ExpandDatabase) -> Option<InRealFile<SyntaxNode>>; + fn original_call_node(self, db: &dyn ExpandDatabase) -> Option<InRealFile<SyntaxNode>>; /// Return expansion information if it is a macro-expansion file - fn expansion_info(self, db: &dyn db::ExpandDatabase) -> Option<ExpansionInfo>; + fn expansion_info(self, db: &dyn ExpandDatabase) -> Option<ExpansionInfo>; - fn as_builtin_derive_attr_node(&self, db: &dyn db::ExpandDatabase) - -> Option<InFile<ast::Attr>>; + fn as_builtin_derive_attr_node(&self, db: &dyn ExpandDatabase) -> Option<InFile<ast::Attr>>; } impl HirFileIdExt for HirFileId { - fn original_file(self, db: &dyn db::ExpandDatabase) -> FileId { + fn original_file(self, db: &dyn ExpandDatabase) -> FileId { let mut file_id = self; loop { match file_id.repr() { HirFileIdRepr::FileId(id) => break id, HirFileIdRepr::MacroFile(MacroFileId { macro_call_id }) => { - file_id = db.lookup_intern_macro_call(macro_call_id).kind.file_id(); + file_id = macro_call_id.lookup(db).kind.file_id(); } } } } - fn original_file_respecting_includes(mut self, db: &dyn db::ExpandDatabase) -> FileId { + fn original_file_respecting_includes(mut self, db: &dyn ExpandDatabase) -> FileId { loop { match self.repr() { - base_db::span::HirFileIdRepr::FileId(id) => break id, - base_db::span::HirFileIdRepr::MacroFile(file) => { + HirFileIdRepr::FileId(id) => break id, + HirFileIdRepr::MacroFile(file) => { let loc = db.lookup_intern_macro_call(file.macro_call_id); if loc.def.is_include() { if let Some(eager) = &loc.eager { @@ -231,7 +282,7 @@ impl HirFileIdExt for HirFileId { } } - fn original_call_node(self, db: &dyn db::ExpandDatabase) -> Option<InRealFile<SyntaxNode>> { + fn original_call_node(self, db: &dyn ExpandDatabase) -> Option<InRealFile<SyntaxNode>> { let mut call = db.lookup_intern_macro_call(self.macro_file()?.macro_call_id).to_node(db); loop { match call.file_id.repr() { @@ -246,14 +297,11 @@ impl HirFileIdExt for HirFileId { } /// Return expansion information if it is a macro-expansion file - fn expansion_info(self, db: &dyn db::ExpandDatabase) -> Option<ExpansionInfo> { + fn expansion_info(self, db: &dyn ExpandDatabase) -> Option<ExpansionInfo> { Some(ExpansionInfo::new(db, self.macro_file()?)) } - fn as_builtin_derive_attr_node( - &self, - db: &dyn db::ExpandDatabase, - ) -> Option<InFile<ast::Attr>> { + fn as_builtin_derive_attr_node(&self, db: &dyn ExpandDatabase) -> Option<InFile<ast::Attr>> { let macro_file = self.macro_file()?; let loc: MacroCallLoc = db.lookup_intern_macro_call(macro_file.macro_call_id); let attr = match loc.def.kind { @@ -265,32 +313,32 @@ impl HirFileIdExt for HirFileId { } pub trait MacroFileIdExt { - fn expansion_level(self, db: &dyn db::ExpandDatabase) -> u32; + fn expansion_level(self, db: &dyn ExpandDatabase) -> u32; /// If this is a macro call, returns the syntax node of the call. - fn call_node(self, db: &dyn db::ExpandDatabase) -> InFile<SyntaxNode>; + fn call_node(self, db: &dyn ExpandDatabase) -> InFile<SyntaxNode>; - fn expansion_info(self, db: &dyn db::ExpandDatabase) -> ExpansionInfo; + fn expansion_info(self, db: &dyn ExpandDatabase) -> ExpansionInfo; - fn is_builtin_derive(&self, db: &dyn db::ExpandDatabase) -> bool; - fn is_custom_derive(&self, db: &dyn db::ExpandDatabase) -> bool; + fn is_builtin_derive(&self, db: &dyn ExpandDatabase) -> bool; + fn is_custom_derive(&self, db: &dyn ExpandDatabase) -> bool; /// Return whether this file is an include macro - fn is_include_macro(&self, db: &dyn db::ExpandDatabase) -> bool; + fn is_include_macro(&self, db: &dyn ExpandDatabase) -> bool; - fn is_eager(&self, db: &dyn db::ExpandDatabase) -> bool; + fn is_eager(&self, db: &dyn ExpandDatabase) -> bool; /// Return whether this file is an attr macro - fn is_attr_macro(&self, db: &dyn db::ExpandDatabase) -> bool; + fn is_attr_macro(&self, db: &dyn ExpandDatabase) -> bool; /// Return whether this file is the pseudo expansion of the derive attribute. /// See [`crate::builtin_attr_macro::derive_attr_expand`]. - fn is_derive_attr_pseudo_expansion(&self, db: &dyn db::ExpandDatabase) -> bool; + fn is_derive_attr_pseudo_expansion(&self, db: &dyn ExpandDatabase) -> bool; } impl MacroFileIdExt for MacroFileId { - fn call_node(self, db: &dyn db::ExpandDatabase) -> InFile<SyntaxNode> { + fn call_node(self, db: &dyn ExpandDatabase) -> InFile<SyntaxNode> { db.lookup_intern_macro_call(self.macro_call_id).to_node(db) } - fn expansion_level(self, db: &dyn db::ExpandDatabase) -> u32 { + fn expansion_level(self, db: &dyn ExpandDatabase) -> u32 { let mut level = 0; let mut macro_file = self; loop { @@ -305,39 +353,39 @@ impl MacroFileIdExt for MacroFileId { } /// Return expansion information if it is a macro-expansion file - fn expansion_info(self, db: &dyn db::ExpandDatabase) -> ExpansionInfo { + fn expansion_info(self, db: &dyn ExpandDatabase) -> ExpansionInfo { ExpansionInfo::new(db, self) } - fn is_custom_derive(&self, db: &dyn db::ExpandDatabase) -> bool { + fn is_custom_derive(&self, db: &dyn ExpandDatabase) -> bool { matches!( db.lookup_intern_macro_call(self.macro_call_id).def.kind, MacroDefKind::ProcMacro(_, ProcMacroKind::CustomDerive, _) ) } - fn is_builtin_derive(&self, db: &dyn db::ExpandDatabase) -> bool { + fn is_builtin_derive(&self, db: &dyn ExpandDatabase) -> bool { matches!( db.lookup_intern_macro_call(self.macro_call_id).def.kind, MacroDefKind::BuiltInDerive(..) ) } - fn is_include_macro(&self, db: &dyn db::ExpandDatabase) -> bool { + fn is_include_macro(&self, db: &dyn ExpandDatabase) -> bool { db.lookup_intern_macro_call(self.macro_call_id).def.is_include() } - fn is_eager(&self, db: &dyn db::ExpandDatabase) -> bool { + fn is_eager(&self, db: &dyn ExpandDatabase) -> bool { let loc: MacroCallLoc = db.lookup_intern_macro_call(self.macro_call_id); matches!(loc.def.kind, MacroDefKind::BuiltInEager(..)) } - fn is_attr_macro(&self, db: &dyn db::ExpandDatabase) -> bool { + fn is_attr_macro(&self, db: &dyn ExpandDatabase) -> bool { let loc: MacroCallLoc = db.lookup_intern_macro_call(self.macro_call_id); matches!(loc.kind, MacroCallKind::Attr { .. }) } - fn is_derive_attr_pseudo_expansion(&self, db: &dyn db::ExpandDatabase) -> bool { + fn is_derive_attr_pseudo_expansion(&self, db: &dyn ExpandDatabase) -> bool { let loc: MacroCallLoc = db.lookup_intern_macro_call(self.macro_call_id); loc.def.is_attribute_derive() } @@ -346,15 +394,15 @@ impl MacroFileIdExt for MacroFileId { impl MacroDefId { pub fn as_lazy_macro( self, - db: &dyn db::ExpandDatabase, + db: &dyn ExpandDatabase, krate: CrateId, kind: MacroCallKind, - call_site: SyntaxContextId, + call_site: Span, ) -> MacroCallId { - db.intern_macro_call(MacroCallLoc { def: self, krate, eager: None, kind, call_site }) + MacroCallLoc { def: self, krate, eager: None, kind, call_site }.intern(db) } - pub fn definition_range(&self, db: &dyn db::ExpandDatabase) -> InFile<TextRange> { + pub fn definition_range(&self, db: &dyn ExpandDatabase) -> InFile<TextRange> { match self.kind { MacroDefKind::Declarative(id) | MacroDefKind::BuiltIn(_, id) @@ -419,19 +467,7 @@ impl MacroDefId { } impl MacroCallLoc { - pub fn span(&self, db: &dyn db::ExpandDatabase) -> SpanData { - let ast_id = self.kind.erased_ast_id(); - let file_id = self.kind.file_id(); - let range = db.ast_id_map(file_id).get_erased(ast_id).text_range(); - match file_id.repr() { - HirFileIdRepr::FileId(file_id) => db.real_span_map(file_id).span_for_range(range), - HirFileIdRepr::MacroFile(m) => { - db.parse_macro_expansion(m).value.1.span_at(range.start()) - } - } - } - - pub fn to_node(&self, db: &dyn db::ExpandDatabase) -> InFile<SyntaxNode> { + pub fn to_node(&self, db: &dyn ExpandDatabase) -> InFile<SyntaxNode> { match self.kind { MacroCallKind::FnLike { ast_id, .. } => { ast_id.with_value(ast_id.to_node(db).syntax().clone()) @@ -498,7 +534,7 @@ impl MacroCallKind { } } - fn erased_ast_id(&self) -> ErasedFileAstId { + pub fn erased_ast_id(&self) -> ErasedFileAstId { match *self { MacroCallKind::FnLike { ast_id: InFile { value, .. }, .. } => value.erase(), MacroCallKind::Derive { ast_id: InFile { value, .. }, .. } => value.erase(), @@ -509,7 +545,7 @@ impl MacroCallKind { /// Returns the original file range that best describes the location of this macro call. /// /// Unlike `MacroCallKind::original_call_range`, this also spans the item of attributes and derives. - pub fn original_call_range_with_body(self, db: &dyn db::ExpandDatabase) -> FileRange { + pub fn original_call_range_with_body(self, db: &dyn ExpandDatabase) -> FileRange { let mut kind = self; let file_id = loop { match kind.file_id().repr() { @@ -534,7 +570,7 @@ impl MacroCallKind { /// Here we try to roughly match what rustc does to improve diagnostics: fn-like macros /// get the whole `ast::MacroCall`, attribute macros get the attribute's range, and derives /// get only the specific derive that is being referred to. - pub fn original_call_range(self, db: &dyn db::ExpandDatabase) -> FileRange { + pub fn original_call_range(self, db: &dyn ExpandDatabase) -> FileRange { let mut kind = self; let file_id = loop { match kind.file_id().repr() { @@ -573,7 +609,7 @@ impl MacroCallKind { FileRange { range, file_id } } - fn arg(&self, db: &dyn db::ExpandDatabase) -> InFile<Option<SyntaxNode>> { + fn arg(&self, db: &dyn ExpandDatabase) -> InFile<Option<SyntaxNode>> { match self { MacroCallKind::FnLike { ast_id, .. } => { ast_id.to_in_file_node(db).map(|it| Some(it.token_tree()?.syntax().clone())) @@ -617,7 +653,7 @@ impl ExpansionInfo { /// Maps the passed in file range down into a macro expansion if it is the input to a macro call. pub fn map_range_down<'a>( &'a self, - span: SpanData, + span: Span, ) -> Option<InMacroFile<impl Iterator<Item = SyntaxToken> + 'a>> { let tokens = self .exp_map @@ -630,7 +666,7 @@ impl ExpansionInfo { /// Looks up the span at the given offset. pub fn span_for_offset( &self, - db: &dyn db::ExpandDatabase, + db: &dyn ExpandDatabase, offset: TextSize, ) -> (FileRange, SyntaxContextId) { debug_assert!(self.expanded.value.text_range().contains(offset)); @@ -646,12 +682,12 @@ impl ExpansionInfo { /// Maps up the text range out of the expansion hierarchy back into the original file its from. pub fn map_node_range_up( &self, - db: &dyn db::ExpandDatabase, + db: &dyn ExpandDatabase, range: TextRange, ) -> Option<(FileRange, SyntaxContextId)> { debug_assert!(self.expanded.value.text_range().contains_range(range)); let mut spans = self.exp_map.spans_for_range(range); - let SpanData { range, anchor, ctx } = spans.next()?; + let Span { range, anchor, ctx } = spans.next()?; let mut start = range.start(); let mut end = range.end(); @@ -676,7 +712,7 @@ impl ExpansionInfo { /// Maps up the text range out of the expansion into is macro call. pub fn map_range_up_once( &self, - db: &dyn db::ExpandDatabase, + db: &dyn ExpandDatabase, token: TextRange, ) -> InFile<smallvec::SmallVec<[TextRange; 1]>> { debug_assert!(self.expanded.value.text_range().contains_range(token)); @@ -705,7 +741,7 @@ impl ExpansionInfo { } } - pub fn new(db: &dyn db::ExpandDatabase, macro_file: MacroFileId) -> ExpansionInfo { + pub fn new(db: &dyn ExpandDatabase, macro_file: MacroFileId) -> ExpansionInfo { let loc: MacroCallLoc = db.lookup_intern_macro_call(macro_file.macro_call_id); let arg_tt = loc.kind.arg(db); @@ -718,7 +754,7 @@ impl ExpansionInfo { let (macro_arg, _) = db.macro_arg(macro_file.macro_call_id).value.unwrap_or_else(|| { ( Arc::new(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + delimiter: tt::Delimiter::invisible_spanned(loc.call_site), token_trees: Vec::new(), }), SyntaxFixupUndoInfo::NONE, diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/mod_path.rs b/src/tools/rust-analyzer/crates/hir-expand/src/mod_path.rs index 9534b5039f6..30b8c189f52 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/mod_path.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/mod_path.rs @@ -9,10 +9,11 @@ use crate::{ db::ExpandDatabase, hygiene::{marks_rev, SyntaxContextExt, Transparency}, name::{known, AsName, Name}, - span::SpanMapRef, + span_map::SpanMapRef, }; -use base_db::{span::SyntaxContextId, CrateId}; +use base_db::CrateId; use smallvec::SmallVec; +use span::SyntaxContextId; use syntax::{ast, AstNode}; #[derive(Debug, Clone, PartialEq, Eq, PartialOrd, Ord, Hash)] diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/name.rs b/src/tools/rust-analyzer/crates/hir-expand/src/name.rs index a321f94cd75..3d8d01e2556 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/name.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/name.rs @@ -318,6 +318,10 @@ pub mod known { new_lower_hex, new_upper_hex, from_usize, + panic_2015, + panic_2021, + unreachable_2015, + unreachable_2021, // Components of known path (type name) Iterator, IntoIterator, @@ -384,6 +388,7 @@ pub mod known { log_syntax, module_path, option_env, + quote, std_panic, stringify, trace_macros, diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/proc_macro.rs b/src/tools/rust-analyzer/crates/hir-expand/src/proc_macro.rs index de577796831..25c78fade82 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/proc_macro.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/proc_macro.rs @@ -1,18 +1,64 @@ //! Proc Macro Expander stub -use base_db::{span::SpanData, CrateId, ProcMacroExpansionError, ProcMacroId, ProcMacroKind}; +use core::fmt; +use std::{panic::RefUnwindSafe, sync}; + +use base_db::{CrateId, Env}; +use rustc_hash::FxHashMap; +use span::Span; use stdx::never; +use syntax::SmolStr; use crate::{db::ExpandDatabase, tt, ExpandError, ExpandResult}; +#[derive(Debug, Copy, Clone, PartialEq, Eq, Hash)] +pub struct ProcMacroId(pub u32); + +#[derive(Copy, Clone, Eq, PartialEq, Debug, Hash)] +pub enum ProcMacroKind { + CustomDerive, + FuncLike, + Attr, +} + +pub trait ProcMacroExpander: fmt::Debug + Send + Sync + RefUnwindSafe { + fn expand( + &self, + subtree: &tt::Subtree, + attrs: Option<&tt::Subtree>, + env: &Env, + def_site: Span, + call_site: Span, + mixed_site: Span, + ) -> Result<tt::Subtree, ProcMacroExpansionError>; +} + +#[derive(Debug)] +pub enum ProcMacroExpansionError { + Panic(String), + /// Things like "proc macro server was killed by OOM". + System(String), +} + +pub type ProcMacroLoadResult = Result<Vec<ProcMacro>, String>; + +pub type ProcMacros = FxHashMap<CrateId, ProcMacroLoadResult>; + +#[derive(Debug, Clone)] +pub struct ProcMacro { + pub name: SmolStr, + pub kind: ProcMacroKind, + pub expander: sync::Arc<dyn ProcMacroExpander>, +} + #[derive(Debug, Clone, Copy, Eq, PartialEq, Hash)] -pub struct ProcMacroExpander { +pub struct CustomProcMacroExpander { proc_macro_id: ProcMacroId, } const DUMMY_ID: u32 = !0; -impl ProcMacroExpander { +impl CustomProcMacroExpander { pub fn new(proc_macro_id: ProcMacroId) -> Self { assert_ne!(proc_macro_id.0, DUMMY_ID); Self { proc_macro_id } @@ -33,9 +79,9 @@ impl ProcMacroExpander { calling_crate: CrateId, tt: &tt::Subtree, attr_arg: Option<&tt::Subtree>, - def_site: SpanData, - call_site: SpanData, - mixed_site: SpanData, + def_site: Span, + call_site: Span, + mixed_site: Span, ) -> ExpandResult<tt::Subtree> { match self.proc_macro_id { ProcMacroId(DUMMY_ID) => ExpandResult::new( diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/quote.rs b/src/tools/rust-analyzer/crates/hir-expand/src/quote.rs index acbde26c8dd..9bdd75f9d22 100644 --- a/src/tools/rust-analyzer/crates/hir-expand/src/quote.rs +++ b/src/tools/rust-analyzer/crates/hir-expand/src/quote.rs @@ -1,6 +1,8 @@ //! A simplified version of quote-crate like quasi quote macro -use base_db::span::SpanData; +use span::Span; + +use crate::name::Name; // A helper macro quote macro // FIXME: @@ -130,12 +132,12 @@ macro_rules! quote { } pub(crate) trait IntoTt { - fn to_subtree(self, span: SpanData) -> crate::tt::Subtree; + fn to_subtree(self, span: Span) -> crate::tt::Subtree; fn to_tokens(self) -> Vec<crate::tt::TokenTree>; } impl IntoTt for Vec<crate::tt::TokenTree> { - fn to_subtree(self, span: SpanData) -> crate::tt::Subtree { + fn to_subtree(self, span: Span) -> crate::tt::Subtree { crate::tt::Subtree { delimiter: crate::tt::Delimiter::invisible_spanned(span), token_trees: self, @@ -148,7 +150,7 @@ impl IntoTt for Vec<crate::tt::TokenTree> { } impl IntoTt for crate::tt::Subtree { - fn to_subtree(self, _: SpanData) -> crate::tt::Subtree { + fn to_subtree(self, _: Span) -> crate::tt::Subtree { self } @@ -158,39 +160,39 @@ impl IntoTt for crate::tt::Subtree { } pub(crate) trait ToTokenTree { - fn to_token(self, span: SpanData) -> crate::tt::TokenTree; + fn to_token(self, span: Span) -> crate::tt::TokenTree; } impl ToTokenTree for crate::tt::TokenTree { - fn to_token(self, _: SpanData) -> crate::tt::TokenTree { + fn to_token(self, _: Span) -> crate::tt::TokenTree { self } } impl ToTokenTree for &crate::tt::TokenTree { - fn to_token(self, _: SpanData) -> crate::tt::TokenTree { + fn to_token(self, _: Span) -> crate::tt::TokenTree { self.clone() } } impl ToTokenTree for crate::tt::Subtree { - fn to_token(self, _: SpanData) -> crate::tt::TokenTree { + fn to_token(self, _: Span) -> crate::tt::TokenTree { self.into() } } macro_rules! impl_to_to_tokentrees { - ($($span:ident: $ty:ty => $this:ident $im:block);*) => { + ($($span:ident: $ty:ty => $this:ident $im:block;)*) => { $( impl ToTokenTree for $ty { - fn to_token($this, $span: SpanData) -> crate::tt::TokenTree { + fn to_token($this, $span: Span) -> crate::tt::TokenTree { let leaf: crate::tt::Leaf = $im.into(); leaf.into() } } impl ToTokenTree for &$ty { - fn to_token($this, $span: SpanData) -> crate::tt::TokenTree { + fn to_token($this, $span: Span) -> crate::tt::TokenTree { let leaf: crate::tt::Leaf = $im.clone().into(); leaf.into() } @@ -209,20 +211,19 @@ impl_to_to_tokentrees! { _span: crate::tt::Ident => self { self }; _span: crate::tt::Punct => self { self }; span: &str => self { crate::tt::Literal{text: format!("\"{}\"", self.escape_default()).into(), span}}; - span: String => self { crate::tt::Literal{text: format!("\"{}\"", self.escape_default()).into(), span}} + span: String => self { crate::tt::Literal{text: format!("\"{}\"", self.escape_default()).into(), span}}; + span: Name => self { crate::tt::Ident{text: self.to_smol_str(), span}}; } #[cfg(test)] mod tests { use crate::tt; - use base_db::{ - span::{SpanAnchor, SyntaxContextId, ROOT_ERASED_FILE_AST_ID}, - FileId, - }; + use base_db::FileId; use expect_test::expect; + use span::{SpanAnchor, SyntaxContextId, ROOT_ERASED_FILE_AST_ID}; use syntax::{TextRange, TextSize}; - const DUMMY: tt::SpanData = tt::SpanData { + const DUMMY: tt::Span = tt::Span { range: TextRange::empty(TextSize::new(0)), anchor: SpanAnchor { file_id: FileId::BOGUS, ast_id: ROOT_ERASED_FILE_AST_ID }, ctx: SyntaxContextId::ROOT, diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/span.rs b/src/tools/rust-analyzer/crates/hir-expand/src/span.rs deleted file mode 100644 index fe476a40feb..00000000000 --- a/src/tools/rust-analyzer/crates/hir-expand/src/span.rs +++ /dev/null @@ -1,124 +0,0 @@ -//! Spanmaps allow turning absolute ranges into relative ranges for incrementality purposes as well -//! as associating spans with text ranges in a particular file. -use base_db::{ - span::{ErasedFileAstId, SpanAnchor, SpanData, SyntaxContextId, ROOT_ERASED_FILE_AST_ID}, - FileId, -}; -use syntax::{ast::HasModuleItem, AstNode, TextRange, TextSize}; -use triomphe::Arc; - -use crate::db::ExpandDatabase; - -pub type ExpansionSpanMap = mbe::SpanMap<SpanData>; - -/// Spanmap for a macro file or a real file -#[derive(Clone, Debug, PartialEq, Eq)] -pub enum SpanMap { - /// Spanmap for a macro file - ExpansionSpanMap(Arc<ExpansionSpanMap>), - /// Spanmap for a real file - RealSpanMap(Arc<RealSpanMap>), -} - -#[derive(Copy, Clone)] -pub enum SpanMapRef<'a> { - /// Spanmap for a macro file - ExpansionSpanMap(&'a ExpansionSpanMap), - /// Spanmap for a real file - RealSpanMap(&'a RealSpanMap), -} - -impl mbe::SpanMapper<SpanData> for SpanMap { - fn span_for(&self, range: TextRange) -> SpanData { - self.span_for_range(range) - } -} -impl mbe::SpanMapper<SpanData> for SpanMapRef<'_> { - fn span_for(&self, range: TextRange) -> SpanData { - self.span_for_range(range) - } -} -impl mbe::SpanMapper<SpanData> for RealSpanMap { - fn span_for(&self, range: TextRange) -> SpanData { - self.span_for_range(range) - } -} - -impl SpanMap { - pub fn span_for_range(&self, range: TextRange) -> SpanData { - match self { - Self::ExpansionSpanMap(span_map) => span_map.span_at(range.start()), - Self::RealSpanMap(span_map) => span_map.span_for_range(range), - } - } - - pub fn as_ref(&self) -> SpanMapRef<'_> { - match self { - Self::ExpansionSpanMap(span_map) => SpanMapRef::ExpansionSpanMap(span_map), - Self::RealSpanMap(span_map) => SpanMapRef::RealSpanMap(span_map), - } - } -} - -impl SpanMapRef<'_> { - pub fn span_for_range(self, range: TextRange) -> SpanData { - match self { - Self::ExpansionSpanMap(span_map) => span_map.span_at(range.start()), - Self::RealSpanMap(span_map) => span_map.span_for_range(range), - } - } -} - -#[derive(PartialEq, Eq, Hash, Debug)] -pub struct RealSpanMap { - file_id: FileId, - /// Invariant: Sorted vec over TextSize - // FIXME: SortedVec<(TextSize, ErasedFileAstId)>? - pairs: Box<[(TextSize, ErasedFileAstId)]>, - end: TextSize, -} - -impl RealSpanMap { - /// Creates a real file span map that returns absolute ranges (relative ranges to the root ast id). - pub fn absolute(file_id: FileId) -> Self { - RealSpanMap { - file_id, - pairs: Box::from([(TextSize::new(0), ROOT_ERASED_FILE_AST_ID)]), - end: TextSize::new(!0), - } - } - - pub fn from_file(db: &dyn ExpandDatabase, file_id: FileId) -> Self { - let mut pairs = vec![(TextSize::new(0), ROOT_ERASED_FILE_AST_ID)]; - let ast_id_map = db.ast_id_map(file_id.into()); - let tree = db.parse(file_id).tree(); - pairs - .extend(tree.items().map(|item| { - (item.syntax().text_range().start(), ast_id_map.ast_id(&item).erase()) - })); - RealSpanMap { - file_id, - pairs: pairs.into_boxed_slice(), - end: tree.syntax().text_range().end(), - } - } - - pub fn span_for_range(&self, range: TextRange) -> SpanData { - assert!( - range.end() <= self.end, - "range {range:?} goes beyond the end of the file {:?}", - self.end - ); - let start = range.start(); - let idx = self - .pairs - .binary_search_by(|&(it, _)| it.cmp(&start).then(std::cmp::Ordering::Less)) - .unwrap_err(); - let (offset, ast_id) = self.pairs[idx - 1]; - SpanData { - range: range - offset, - anchor: SpanAnchor { file_id: self.file_id, ast_id }, - ctx: SyntaxContextId::ROOT, - } - } -} diff --git a/src/tools/rust-analyzer/crates/hir-expand/src/span_map.rs b/src/tools/rust-analyzer/crates/hir-expand/src/span_map.rs new file mode 100644 index 00000000000..4ec6e657f9e --- /dev/null +++ b/src/tools/rust-analyzer/crates/hir-expand/src/span_map.rs @@ -0,0 +1,65 @@ +//! Span maps for real files and macro expansions. +use span::Span; +use syntax::TextRange; +use triomphe::Arc; + +pub use span::RealSpanMap; + +pub type ExpansionSpanMap = span::SpanMap<Span>; + +/// Spanmap for a macro file or a real file +#[derive(Clone, Debug, PartialEq, Eq)] +pub enum SpanMap { + /// Spanmap for a macro file + ExpansionSpanMap(Arc<ExpansionSpanMap>), + /// Spanmap for a real file + RealSpanMap(Arc<RealSpanMap>), +} + +#[derive(Copy, Clone)] +pub enum SpanMapRef<'a> { + /// Spanmap for a macro file + ExpansionSpanMap(&'a ExpansionSpanMap), + /// Spanmap for a real file + RealSpanMap(&'a RealSpanMap), +} + +impl mbe::SpanMapper<Span> for SpanMap { + fn span_for(&self, range: TextRange) -> Span { + self.span_for_range(range) + } +} +impl mbe::SpanMapper<Span> for SpanMapRef<'_> { + fn span_for(&self, range: TextRange) -> Span { + self.span_for_range(range) + } +} + +impl SpanMap { + pub fn span_for_range(&self, range: TextRange) -> Span { + match self { + // FIXME: Is it correct for us to only take the span at the start? This feels somewhat + // wrong. The context will be right, but the range could be considered wrong. See + // https://github.com/rust-lang/rust/issues/23480, we probably want to fetch the span at + // the start and end, then merge them like rustc does in `Span::to + Self::ExpansionSpanMap(span_map) => span_map.span_at(range.start()), + Self::RealSpanMap(span_map) => span_map.span_for_range(range), + } + } + + pub fn as_ref(&self) -> SpanMapRef<'_> { + match self { + Self::ExpansionSpanMap(span_map) => SpanMapRef::ExpansionSpanMap(span_map), + Self::RealSpanMap(span_map) => SpanMapRef::RealSpanMap(span_map), + } + } +} + +impl SpanMapRef<'_> { + pub fn span_for_range(self, range: TextRange) -> Span { + match self { + Self::ExpansionSpanMap(span_map) => span_map.span_at(range.start()), + Self::RealSpanMap(span_map) => span_map.span_for_range(range), + } + } +} diff --git a/src/tools/rust-analyzer/crates/hir-ty/Cargo.toml b/src/tools/rust-analyzer/crates/hir-ty/Cargo.toml index bbcb76a43ff..1873e7bfe6a 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/Cargo.toml +++ b/src/tools/rust-analyzer/crates/hir-ty/Cargo.toml @@ -14,14 +14,14 @@ doctest = false [dependencies] cov-mark = "2.0.0-pre.1" itertools.workspace = true -arrayvec = "0.7.2" +arrayvec.workspace = true bitflags.workspace = true smallvec.workspace = true ena = "0.14.0" either.workspace = true oorandom = "11.1.3" tracing.workspace = true -rustc-hash = "1.1.0" +rustc-hash.workspace = true scoped-tls = "1.0.0" chalk-solve = { version = "0.95.0", default-features = false } chalk-ir = "0.95.0" @@ -54,6 +54,10 @@ project-model = { path = "../project-model" } # local deps test-utils.workspace = true +test-fixture.workspace = true [features] in-rust-tree = ["rustc-dependencies/in-rust-tree"] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/consteval/tests.rs b/src/tools/rust-analyzer/crates/hir-ty/src/consteval/tests.rs index b395e7f4a81..ac82208708a 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/consteval/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/consteval/tests.rs @@ -1,6 +1,7 @@ -use base_db::{fixture::WithFixture, FileId}; +use base_db::FileId; use chalk_ir::Substitution; use hir_def::db::DefDatabase; +use test_fixture::WithFixture; use test_utils::skip_slow_tests; use crate::{ diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/infer.rs b/src/tools/rust-analyzer/crates/hir-ty/src/infer.rs index 6f724e45874..8053300ad22 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/infer.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/infer.rs @@ -217,6 +217,10 @@ pub enum InferenceDiagnostic { name: Name, /// Contains the type the field resolves to field_with_same_name: Option<Ty>, + assoc_func_with_same_name: Option<AssocItemId>, + }, + UnresolvedAssocItem { + id: ExprOrPatId, }, // FIXME: This should be emitted in body lowering BreakOutsideOfLoop { @@ -1200,6 +1204,12 @@ impl<'a> InferenceContext<'a> { path: &ModPath, ) -> (Ty, Option<VariantId>) { let remaining = unresolved.map(|it| path.segments()[it..].len()).filter(|it| it > &0); + let ty = match ty.kind(Interner) { + TyKind::Alias(AliasTy::Projection(proj_ty)) => { + self.db.normalize_projection(proj_ty.clone(), self.table.trait_env.clone()) + } + _ => ty, + }; match remaining { None => { let variant = ty.as_adt().and_then(|(adt_id, _)| match adt_id { diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/infer/expr.rs b/src/tools/rust-analyzer/crates/hir-ty/src/infer/expr.rs index a5e77a12d8c..84954ca7e90 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/infer/expr.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/infer/expr.rs @@ -1575,11 +1575,30 @@ impl InferenceContext<'_> { } None => None, }; + + let assoc_func_with_same_name = method_resolution::iterate_method_candidates( + &canonicalized_receiver.value, + self.db, + self.table.trait_env.clone(), + self.get_traits_in_scope().as_ref().left_or_else(|&it| it), + VisibleFromModule::Filter(self.resolver.module()), + Some(method_name), + method_resolution::LookupMode::Path, + |_ty, item, visible| { + if visible { + Some(item) + } else { + None + } + }, + ); + self.result.diagnostics.push(InferenceDiagnostic::UnresolvedMethodCall { expr: tgt_expr, receiver: receiver_ty.clone(), name: method_name.clone(), field_with_same_name: field_with_same_name_exists, + assoc_func_with_same_name, }); ( receiver_ty, diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/infer/path.rs b/src/tools/rust-analyzer/crates/hir-ty/src/infer/path.rs index 49fb78f67a6..e61a070265a 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/infer/path.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/infer/path.rs @@ -340,6 +340,9 @@ impl InferenceContext<'_> { }, ); let res = res.or(not_visible); + if res.is_none() { + self.push_diagnostic(InferenceDiagnostic::UnresolvedAssocItem { id }); + } let (item, visible) = res?; let (def, container) = match item { diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/layout/tests.rs b/src/tools/rust-analyzer/crates/hir-ty/src/layout/tests.rs index 5e3a86c80e3..9937113685c 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/layout/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/layout/tests.rs @@ -1,9 +1,9 @@ use std::collections::HashMap; -use base_db::fixture::WithFixture; use chalk_ir::{AdtId, TyKind}; use either::Either; use hir_def::db::DefDatabase; +use test_fixture::WithFixture; use triomphe::Arc; use crate::{ diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/mir/eval/tests.rs b/src/tools/rust-analyzer/crates/hir-ty/src/mir/eval/tests.rs index ff30dc6dade..b0f929279a5 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/mir/eval/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/mir/eval/tests.rs @@ -1,6 +1,7 @@ -use base_db::{fixture::WithFixture, FileId}; +use base_db::FileId; use hir_def::db::DefDatabase; use syntax::{TextRange, TextSize}; +use test_fixture::WithFixture; use crate::{db::HirDatabase, test_db::TestDB, Interner, Substitution}; diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/tests.rs b/src/tools/rust-analyzer/crates/hir-ty/src/tests.rs index 1446e83fa88..c8cc61cc21b 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/tests.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/tests.rs @@ -12,7 +12,7 @@ mod diagnostics; use std::{collections::HashMap, env}; -use base_db::{fixture::WithFixture, FileRange, SourceDatabaseExt}; +use base_db::{FileRange, SourceDatabaseExt}; use expect_test::Expect; use hir_def::{ body::{Body, BodySourceMap, SyntheticSyntax}, @@ -30,6 +30,7 @@ use syntax::{ ast::{self, AstNode, HasName}, SyntaxNode, }; +use test_fixture::WithFixture; use tracing_subscriber::{layer::SubscriberExt, Registry}; use tracing_tree::HierarchicalLayer; use triomphe::Arc; diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/tests/incremental.rs b/src/tools/rust-analyzer/crates/hir-ty/src/tests/incremental.rs index 28e84e480d7..82d934009f3 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/tests/incremental.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/tests/incremental.rs @@ -1,4 +1,5 @@ -use base_db::{fixture::WithFixture, SourceDatabaseExt}; +use base_db::SourceDatabaseExt; +use test_fixture::WithFixture; use triomphe::Arc; use crate::{db::HirDatabase, test_db::TestDB}; diff --git a/src/tools/rust-analyzer/crates/hir-ty/src/tests/patterns.rs b/src/tools/rust-analyzer/crates/hir-ty/src/tests/patterns.rs index 7234af2d683..548f782f4f2 100644 --- a/src/tools/rust-analyzer/crates/hir-ty/src/tests/patterns.rs +++ b/src/tools/rust-analyzer/crates/hir-ty/src/tests/patterns.rs @@ -1155,6 +1155,40 @@ fn main() { } #[test] +fn generic_alias_with_qualified_path() { + check_types( + r#" +type Wrap<T> = T; + +struct S; + +trait Schematic { + type Props; +} + +impl Schematic for S { + type Props = X; +} + +enum X { + A { cool: u32, stuff: u32 }, + B, +} + +fn main() { + let wrapped = Wrap::<<S as Schematic>::Props>::A { + cool: 100, + stuff: 100, + }; + + if let Wrap::<<S as Schematic>::Props>::A { cool, ..} = &wrapped {} + //^^^^ &u32 +} +"#, + ); +} + +#[test] fn type_mismatch_pat_const_reference() { check_no_mismatches( r#" diff --git a/src/tools/rust-analyzer/crates/hir/Cargo.toml b/src/tools/rust-analyzer/crates/hir/Cargo.toml index 4c1dfbc294e..e4e4bcea610 100644 --- a/src/tools/rust-analyzer/crates/hir/Cargo.toml +++ b/src/tools/rust-analyzer/crates/hir/Cargo.toml @@ -12,9 +12,9 @@ rust-version.workspace = true doctest = false [dependencies] -rustc-hash = "1.1.0" +rustc-hash.workspace = true either.workspace = true -arrayvec = "0.7.2" +arrayvec.workspace = true itertools.workspace = true smallvec.workspace = true triomphe.workspace = true @@ -33,3 +33,6 @@ tt.workspace = true [features] in-rust-tree = [] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/hir/src/attrs.rs b/src/tools/rust-analyzer/crates/hir/src/attrs.rs index 18585335318..d60d20f5b7e 100644 --- a/src/tools/rust-analyzer/crates/hir/src/attrs.rs +++ b/src/tools/rust-analyzer/crates/hir/src/attrs.rs @@ -11,7 +11,7 @@ use hir_def::{ }; use hir_expand::{ name::Name, - span::{RealSpanMap, SpanMapRef}, + span_map::{RealSpanMap, SpanMapRef}, }; use hir_ty::db::HirDatabase; use syntax::{ast, AstNode}; diff --git a/src/tools/rust-analyzer/crates/hir/src/db.rs b/src/tools/rust-analyzer/crates/hir/src/db.rs index d98e3decd21..7204868464b 100644 --- a/src/tools/rust-analyzer/crates/hir/src/db.rs +++ b/src/tools/rust-analyzer/crates/hir/src/db.rs @@ -24,6 +24,6 @@ pub use hir_def::db::{ pub use hir_expand::db::{ AstIdMapQuery, DeclMacroExpanderQuery, ExpandDatabase, ExpandDatabaseStorage, ExpandProcMacroQuery, InternMacroCallQuery, InternSyntaxContextQuery, MacroArgQuery, - ParseMacroExpansionErrorQuery, ParseMacroExpansionQuery, RealSpanMapQuery, + ParseMacroExpansionErrorQuery, ParseMacroExpansionQuery, ProcMacrosQuery, RealSpanMapQuery, }; pub use hir_ty::db::*; diff --git a/src/tools/rust-analyzer/crates/hir/src/diagnostics.rs b/src/tools/rust-analyzer/crates/hir/src/diagnostics.rs index 1cb36f9b021..bf29a53913d 100644 --- a/src/tools/rust-analyzer/crates/hir/src/diagnostics.rs +++ b/src/tools/rust-analyzer/crates/hir/src/diagnostics.rs @@ -8,7 +8,7 @@ pub use hir_ty::diagnostics::{CaseType, IncorrectCase}; use base_db::CrateId; use cfg::{CfgExpr, CfgOptions}; use either::Either; -use hir_def::path::ModPath; +use hir_def::{path::ModPath, AssocItemId}; use hir_expand::{name::Name, HirFileId, InFile}; use syntax::{ast, AstPtr, SyntaxError, SyntaxNodePtr, TextRange}; @@ -62,6 +62,7 @@ diagnostics![ UndeclaredLabel, UnimplementedBuiltinMacro, UnreachableLabel, + UnresolvedAssocItem, UnresolvedExternCrate, UnresolvedField, UnresolvedImport, @@ -215,6 +216,12 @@ pub struct UnresolvedMethodCall { pub receiver: Type, pub name: Name, pub field_with_same_name: Option<Type>, + pub assoc_func_with_same_name: Option<AssocItemId>, +} + +#[derive(Debug)] +pub struct UnresolvedAssocItem { + pub expr_or_pat: InFile<AstPtr<Either<ast::Expr, Either<ast::Pat, ast::SelfParam>>>>, } #[derive(Debug)] diff --git a/src/tools/rust-analyzer/crates/hir/src/lib.rs b/src/tools/rust-analyzer/crates/hir/src/lib.rs index e0230fa3761..09b56e13824 100644 --- a/src/tools/rust-analyzer/crates/hir/src/lib.rs +++ b/src/tools/rust-analyzer/crates/hir/src/lib.rs @@ -37,7 +37,7 @@ mod display; use std::{iter, mem::discriminant, ops::ControlFlow}; use arrayvec::ArrayVec; -use base_db::{CrateDisplayName, CrateId, CrateOrigin, Edition, FileId, ProcMacroKind}; +use base_db::{CrateDisplayName, CrateId, CrateOrigin, Edition, FileId}; use either::Either; use hir_def::{ body::{BodyDiagnostic, SyntheticSyntax}, @@ -47,7 +47,6 @@ use hir_def::{ item_tree::ItemTreeNode, lang_item::LangItemTarget, layout::{self, ReprOptions, TargetDataLayout}, - macro_id_to_def_id, nameres::{self, diagnostics::DefDiagnostic}, path::ImportAlias, per_ns::PerNs, @@ -59,7 +58,7 @@ use hir_def::{ Lookup, MacroExpander, MacroId, ModuleId, StaticId, StructId, TraitAliasId, TraitId, TypeAliasId, TypeOrConstParamId, TypeParamId, UnionId, }; -use hir_expand::{attrs::collect_attrs, name::name, MacroCallKind}; +use hir_expand::{attrs::collect_attrs, name::name, proc_macro::ProcMacroKind, MacroCallKind}; use hir_ty::{ all_super_traits, autoderef, check_orphan_rules, consteval::{try_const_usize, unknown_const_as_generic, ConstEvalError, ConstExt}, @@ -125,8 +124,10 @@ pub use { }, hir_expand::{ attrs::{Attr, AttrId}, + change::Change, hygiene::{marks_rev, SyntaxContextExt}, name::{known, Name}, + proc_macro::ProcMacros, tt, ExpandResult, HirFileId, HirFileIdExt, InFile, InMacroFile, InRealFile, MacroFileId, MacroFileIdExt, }, @@ -146,7 +147,7 @@ use { hir_def::path::Path, hir_expand::{ name::AsName, - span::{ExpansionSpanMap, RealSpanMap, SpanMap, SpanMapRef}, + span_map::{ExpansionSpanMap, RealSpanMap, SpanMap, SpanMapRef}, }, }; @@ -808,7 +809,7 @@ impl Module { } fn emit_macro_def_diagnostics(db: &dyn HirDatabase, acc: &mut Vec<AnyDiagnostic>, m: Macro) { - let id = macro_id_to_def_id(db.upcast(), m.id); + let id = db.macro_def(m.id); if let hir_expand::db::TokenExpander::DeclarativeMacro(expander) = db.macro_expander(id) { if let Some(e) = expander.mac.err() { let Some(ast) = id.ast_id().left() else { @@ -1679,6 +1680,7 @@ impl DefWithBody { receiver, name, field_with_same_name, + assoc_func_with_same_name, } => { let expr = expr_syntax(*expr); @@ -1690,10 +1692,18 @@ impl DefWithBody { field_with_same_name: field_with_same_name .clone() .map(|ty| Type::new(db, DefWithBodyId::from(self), ty)), + assoc_func_with_same_name: assoc_func_with_same_name.clone(), } .into(), ) } + &hir_ty::InferenceDiagnostic::UnresolvedAssocItem { id } => { + let expr_or_pat = match id { + ExprOrPatId::ExprId(expr) => expr_syntax(expr).map(AstPtr::wrap_left), + ExprOrPatId::PatId(pat) => pat_syntax(pat).map(AstPtr::wrap_right), + }; + acc.push(UnresolvedAssocItem { expr_or_pat }.into()) + } &hir_ty::InferenceDiagnostic::BreakOutsideOfLoop { expr, is_break, @@ -2784,9 +2794,13 @@ impl AsAssocItem for DefWithBody { } } -fn as_assoc_item<ID, DEF, CTOR, AST>(db: &dyn HirDatabase, ctor: CTOR, id: ID) -> Option<AssocItem> +fn as_assoc_item<'db, ID, DEF, CTOR, AST>( + db: &(dyn HirDatabase + 'db), + ctor: CTOR, + id: ID, +) -> Option<AssocItem> where - ID: Lookup<Data = AssocItemLoc<AST>>, + ID: Lookup<Database<'db> = dyn DefDatabase + 'db, Data = AssocItemLoc<AST>>, DEF: From<ID>, CTOR: FnOnce(DEF) -> AssocItem, AST: ItemTreeNode, @@ -3520,7 +3534,7 @@ impl Impl { let src = self.source(db)?; let macro_file = src.file_id.macro_file()?; - let loc = db.lookup_intern_macro_call(macro_file.macro_call_id); + let loc = macro_file.macro_call_id.lookup(db.upcast()); let (derive_attr, derive_index) = match loc.kind { MacroCallKind::Derive { ast_id, derive_attr_index, derive_index } => { let module_id = self.id.lookup(db.upcast()).container; @@ -4652,6 +4666,9 @@ impl Callable { pub fn return_type(&self) -> Type { self.ty.derived(self.sig.ret().clone()) } + pub fn sig(&self) -> &CallableSig { + &self.sig + } } fn closure_source(db: &dyn HirDatabase, closure: ClosureId) -> Option<ast::ClosureExpr> { diff --git a/src/tools/rust-analyzer/crates/hir/src/semantics.rs b/src/tools/rust-analyzer/crates/hir/src/semantics.rs index a03ff220745..fdc604a006f 100644 --- a/src/tools/rust-analyzer/crates/hir/src/semantics.rs +++ b/src/tools/rust-analyzer/crates/hir/src/semantics.rs @@ -13,7 +13,6 @@ use either::Either; use hir_def::{ hir::Expr, lower::LowerCtx, - macro_id_to_def_id, nameres::MacroSubNs, resolver::{self, HasResolver, Resolver, TypeNs}, type_ref::Mutability, @@ -40,8 +39,8 @@ use crate::{ source_analyzer::{resolve_hir_path, SourceAnalyzer}, Access, Adjust, Adjustment, AutoBorrow, BindingMode, BuiltinAttr, Callable, ConstParam, Crate, DeriveHelper, Field, Function, HasSource, HirFileId, Impl, InFile, Label, LifetimeParam, Local, - Macro, Module, ModuleDef, Name, OverloadedDeref, Path, ScopeDef, ToolModule, Trait, Type, - TypeAlias, TypeParam, VariantDef, + Macro, Module, ModuleDef, Name, OverloadedDeref, Path, ScopeDef, Struct, ToolModule, Trait, + Type, TypeAlias, TypeParam, VariantDef, }; pub enum DescendPreference { @@ -229,6 +228,14 @@ impl<'db, DB: HirDatabase> Semantics<'db, DB> { pub fn to_module_defs(&self, file: FileId) -> impl Iterator<Item = Module> { self.imp.to_module_def(file) } + + pub fn to_struct_def(&self, s: &ast::Struct) -> Option<Struct> { + self.imp.to_def(s).map(Struct::from) + } + + pub fn to_impl_def(&self, i: &ast::Impl) -> Option<Impl> { + self.imp.to_def(i).map(Impl::from) + } } impl<'db> SemanticsImpl<'db> { @@ -341,9 +348,7 @@ impl<'db> SemanticsImpl<'db> { let macro_call = InFile::new(file_id, actual_macro_call); let krate = resolver.krate(); let macro_call_id = macro_call.as_call_id(self.db.upcast(), krate, |path| { - resolver - .resolve_path_as_macro(self.db.upcast(), &path, Some(MacroSubNs::Bang)) - .map(|(it, _)| macro_id_to_def_id(self.db.upcast(), it)) + resolver.resolve_path_as_macro_def(self.db.upcast(), &path, Some(MacroSubNs::Bang)) })?; hir_expand::db::expand_speculative( self.db.upcast(), @@ -512,8 +517,7 @@ impl<'db> SemanticsImpl<'db> { } /// Descend the token into its macro call if it is part of one, returning the tokens in the - /// expansion that it is associated with. If `offset` points into the token's range, it will - /// be considered for the mapping in case of inline format args. + /// expansion that it is associated with. pub fn descend_into_macros( &self, mode: DescendPreference, @@ -674,7 +678,7 @@ impl<'db> SemanticsImpl<'db> { _ => 0, }; // FIXME: here, the attribute's text range is used to strip away all - // entries from the start of the attribute "list" up the the invoking + // entries from the start of the attribute "list" up the invoking // attribute. But in // ``` // mod foo { @@ -850,7 +854,7 @@ impl<'db> SemanticsImpl<'db> { /// Attempts to map the node out of macro expanded files. /// This only work for attribute expansions, as other ones do not have nodes as input. pub fn original_ast_node<N: AstNode>(&self, node: N) -> Option<N> { - self.wrap_node_infile(node).original_ast_node(self.db.upcast()).map( + self.wrap_node_infile(node).original_ast_node_rooted(self.db.upcast()).map( |InRealFile { file_id, value }| { self.cache(find_root(value.syntax()), file_id.into()); value diff --git a/src/tools/rust-analyzer/crates/hir/src/source_analyzer.rs b/src/tools/rust-analyzer/crates/hir/src/source_analyzer.rs index d05118bbc28..54b4d81012f 100644 --- a/src/tools/rust-analyzer/crates/hir/src/source_analyzer.rs +++ b/src/tools/rust-analyzer/crates/hir/src/source_analyzer.rs @@ -16,7 +16,6 @@ use hir_def::{ hir::{BindingId, ExprId, Pat, PatId}, lang_item::LangItem, lower::LowerCtx, - macro_id_to_def_id, nameres::MacroSubNs, path::{ModPath, Path, PathKind}, resolver::{resolver_for_scope, Resolver, TypeNs, ValueNs}, @@ -771,9 +770,7 @@ impl SourceAnalyzer { ) -> Option<MacroFileId> { let krate = self.resolver.krate(); let macro_call_id = macro_call.as_call_id(db.upcast(), krate, |path| { - self.resolver - .resolve_path_as_macro(db.upcast(), &path, Some(MacroSubNs::Bang)) - .map(|(it, _)| macro_id_to_def_id(db.upcast(), it)) + self.resolver.resolve_path_as_macro_def(db.upcast(), &path, Some(MacroSubNs::Bang)) })?; // why the 64? Some(macro_call_id.as_macro_file()).filter(|it| it.expansion_level(db.upcast()) < 64) @@ -1163,9 +1160,40 @@ fn resolve_hir_path_qualifier( resolver: &Resolver, path: &Path, ) -> Option<PathResolution> { - resolver - .resolve_path_in_type_ns_fully(db.upcast(), &path) - .map(|ty| match ty { + (|| { + let (ty, unresolved) = match path.type_anchor() { + Some(type_ref) => { + let (_, res) = + TyLoweringContext::new_maybe_unowned(db, resolver, resolver.type_owner()) + .lower_ty_ext(type_ref); + res.map(|ty_ns| (ty_ns, path.segments().first())) + } + None => { + let (ty, remaining_idx, _) = resolver.resolve_path_in_type_ns(db.upcast(), path)?; + match remaining_idx { + Some(remaining_idx) => { + if remaining_idx + 1 == path.segments().len() { + Some((ty, path.segments().last())) + } else { + None + } + } + None => Some((ty, None)), + } + } + }?; + + // If we are in a TypeNs for a Trait, and we have an unresolved name, try to resolve it as a type + // within the trait's associated types. + if let (Some(unresolved), &TypeNs::TraitId(trait_id)) = (&unresolved, &ty) { + if let Some(type_alias_id) = + db.trait_data(trait_id).associated_type_by_name(unresolved.name) + { + return Some(PathResolution::Def(ModuleDefId::from(type_alias_id).into())); + } + } + + let res = match ty { TypeNs::SelfType(it) => PathResolution::SelfType(it.into()), TypeNs::GenericParam(id) => PathResolution::TypeParam(id.into()), TypeNs::AdtSelfType(it) | TypeNs::AdtId(it) => { @@ -1176,11 +1204,28 @@ fn resolve_hir_path_qualifier( TypeNs::BuiltinType(it) => PathResolution::Def(BuiltinType::from(it).into()), TypeNs::TraitId(it) => PathResolution::Def(Trait::from(it).into()), TypeNs::TraitAliasId(it) => PathResolution::Def(TraitAlias::from(it).into()), - }) - .or_else(|| { - resolver - .resolve_module_path_in_items(db.upcast(), path.mod_path()?) - .take_types() - .map(|it| PathResolution::Def(it.into())) - }) + }; + match unresolved { + Some(unresolved) => resolver + .generic_def() + .and_then(|def| { + hir_ty::associated_type_shorthand_candidates( + db, + def, + res.in_type_ns()?, + |name, id| (name == unresolved.name).then_some(id), + ) + }) + .map(TypeAlias::from) + .map(Into::into) + .map(PathResolution::Def), + None => Some(res), + } + })() + .or_else(|| { + resolver + .resolve_module_path_in_items(db.upcast(), path.mod_path()?) + .take_types() + .map(|it| PathResolution::Def(it.into())) + }) } diff --git a/src/tools/rust-analyzer/crates/hir/src/symbols.rs b/src/tools/rust-analyzer/crates/hir/src/symbols.rs index a2a30edeb03..4da0dfba675 100644 --- a/src/tools/rust-analyzer/crates/hir/src/symbols.rs +++ b/src/tools/rust-analyzer/crates/hir/src/symbols.rs @@ -2,13 +2,14 @@ use base_db::FileRange; use hir_def::{ + db::DefDatabase, item_scope::ItemInNs, src::{HasChildSource, HasSource}, AdtId, AssocItemId, DefWithBodyId, HasModule, ImplId, Lookup, MacroId, ModuleDefId, ModuleId, TraitId, }; use hir_expand::{HirFileId, InFile}; -use hir_ty::db::HirDatabase; +use hir_ty::{db::HirDatabase, display::HirDisplay}; use syntax::{ast::HasName, AstNode, AstPtr, SmolStr, SyntaxNode, SyntaxNodePtr}; use crate::{Module, ModuleDef, Semantics}; @@ -230,9 +231,12 @@ impl<'a> SymbolCollector<'a> { fn collect_from_impl(&mut self, impl_id: ImplId) { let impl_data = self.db.impl_data(impl_id); - for &assoc_item_id in &impl_data.items { - self.push_assoc_item(assoc_item_id) - } + let impl_name = Some(SmolStr::new(impl_data.self_ty.display(self.db).to_string())); + self.with_container_name(impl_name, |s| { + for &assoc_item_id in &impl_data.items { + s.push_assoc_item(assoc_item_id) + } + }) } fn collect_from_trait(&mut self, trait_id: TraitId) { @@ -274,9 +278,9 @@ impl<'a> SymbolCollector<'a> { } } - fn push_decl<L>(&mut self, id: L, is_assoc: bool) + fn push_decl<'db, L>(&mut self, id: L, is_assoc: bool) where - L: Lookup + Into<ModuleDefId>, + L: Lookup<Database<'db> = dyn DefDatabase + 'db> + Into<ModuleDefId>, <L as Lookup>::Data: HasSource, <<L as Lookup>::Data as HasSource>::Value: HasName, { diff --git a/src/tools/rust-analyzer/crates/ide-assists/Cargo.toml b/src/tools/rust-analyzer/crates/ide-assists/Cargo.toml index a622ec1a953..4d4bac5fb96 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/Cargo.toml +++ b/src/tools/rust-analyzer/crates/ide-assists/Cargo.toml @@ -31,7 +31,11 @@ expect-test = "1.4.0" # local deps test-utils.workspace = true +test-fixture.workspace = true sourcegen.workspace = true [features] in-rust-tree = [] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/auto_import.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/auto_import.rs index f508c42c53e..1f785b5d0a8 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/auto_import.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/auto_import.rs @@ -281,11 +281,8 @@ mod tests { use super::*; use hir::Semantics; - use ide_db::{ - assists::AssistResolveStrategy, - base_db::{fixture::WithFixture, FileRange}, - RootDatabase, - }; + use ide_db::{assists::AssistResolveStrategy, base_db::FileRange, RootDatabase}; + use test_fixture::WithFixture; use crate::tests::{ check_assist, check_assist_by_label, check_assist_not_applicable, check_assist_target, diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/bool_to_enum.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/bool_to_enum.rs index 0f2d1057c0a..b7b00e7ed06 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/bool_to_enum.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/bool_to_enum.rs @@ -16,11 +16,14 @@ use syntax::{ edit_in_place::{AttrsOwnerEdit, Indent}, make, HasName, }, - ted, AstNode, NodeOrToken, SyntaxKind, SyntaxNode, T, + AstNode, NodeOrToken, SyntaxKind, SyntaxNode, T, }; use text_edit::TextRange; -use crate::assist_context::{AssistContext, Assists}; +use crate::{ + assist_context::{AssistContext, Assists}, + utils, +}; // Assist: bool_to_enum // @@ -73,7 +76,7 @@ pub(crate) fn bool_to_enum(acc: &mut Assists, ctx: &AssistContext<'_>) -> Option let usages = definition.usages(&ctx.sema).all(); add_enum_def(edit, ctx, &usages, target_node, &target_module); - replace_usages(edit, ctx, &usages, definition, &target_module); + replace_usages(edit, ctx, usages, definition, &target_module); }, ) } @@ -169,8 +172,8 @@ fn replace_bool_expr(edit: &mut SourceChangeBuilder, expr: ast::Expr) { /// Converts an expression of type `bool` to one of the new enum type. fn bool_expr_to_enum_expr(expr: ast::Expr) -> ast::Expr { - let true_expr = make::expr_path(make::path_from_text("Bool::True")).clone_for_update(); - let false_expr = make::expr_path(make::path_from_text("Bool::False")).clone_for_update(); + let true_expr = make::expr_path(make::path_from_text("Bool::True")); + let false_expr = make::expr_path(make::path_from_text("Bool::False")); if let ast::Expr::Literal(literal) = &expr { match literal.kind() { @@ -184,7 +187,6 @@ fn bool_expr_to_enum_expr(expr: ast::Expr) -> ast::Expr { make::tail_only_block_expr(true_expr), Some(ast::ElseBranch::Block(make::tail_only_block_expr(false_expr))), ) - .clone_for_update() } } @@ -192,21 +194,19 @@ fn bool_expr_to_enum_expr(expr: ast::Expr) -> ast::Expr { fn replace_usages( edit: &mut SourceChangeBuilder, ctx: &AssistContext<'_>, - usages: &UsageSearchResult, + usages: UsageSearchResult, target_definition: Definition, target_module: &hir::Module, ) { - for (file_id, references) in usages.iter() { - edit.edit_file(*file_id); + for (file_id, references) in usages { + edit.edit_file(file_id); - let refs_with_imports = - augment_references_with_imports(edit, ctx, references, target_module); + let refs_with_imports = augment_references_with_imports(ctx, references, target_module); refs_with_imports.into_iter().rev().for_each( - |FileReferenceWithImport { range, old_name, new_name, import_data }| { + |FileReferenceWithImport { range, name, import_data }| { // replace the usages in patterns and expressions - if let Some(ident_pat) = old_name.syntax().ancestors().find_map(ast::IdentPat::cast) - { + if let Some(ident_pat) = name.syntax().ancestors().find_map(ast::IdentPat::cast) { cov_mark::hit!(replaces_record_pat_shorthand); let definition = ctx.sema.to_def(&ident_pat).map(Definition::Local); @@ -214,36 +214,35 @@ fn replace_usages( replace_usages( edit, ctx, - &def.usages(&ctx.sema).all(), + def.usages(&ctx.sema).all(), target_definition, target_module, ) } - } else if let Some(initializer) = find_assignment_usage(&new_name) { + } else if let Some(initializer) = find_assignment_usage(&name) { cov_mark::hit!(replaces_assignment); replace_bool_expr(edit, initializer); - } else if let Some((prefix_expr, inner_expr)) = find_negated_usage(&new_name) { + } else if let Some((prefix_expr, inner_expr)) = find_negated_usage(&name) { cov_mark::hit!(replaces_negation); edit.replace( prefix_expr.syntax().text_range(), format!("{} == Bool::False", inner_expr), ); - } else if let Some((record_field, initializer)) = old_name + } else if let Some((record_field, initializer)) = name .as_name_ref() .and_then(ast::RecordExprField::for_field_name) .and_then(|record_field| ctx.sema.resolve_record_field(&record_field)) .and_then(|(got_field, _, _)| { - find_record_expr_usage(&new_name, got_field, target_definition) + find_record_expr_usage(&name, got_field, target_definition) }) { cov_mark::hit!(replaces_record_expr); - let record_field = edit.make_mut(record_field); let enum_expr = bool_expr_to_enum_expr(initializer); - record_field.replace_expr(enum_expr); - } else if let Some(pat) = find_record_pat_field_usage(&old_name) { + utils::replace_record_field_expr(ctx, edit, record_field, enum_expr); + } else if let Some(pat) = find_record_pat_field_usage(&name) { match pat { ast::Pat::IdentPat(ident_pat) => { cov_mark::hit!(replaces_record_pat); @@ -253,7 +252,7 @@ fn replace_usages( replace_usages( edit, ctx, - &def.usages(&ctx.sema).all(), + def.usages(&ctx.sema).all(), target_definition, target_module, ) @@ -270,40 +269,44 @@ fn replace_usages( } _ => (), } - } else if let Some((ty_annotation, initializer)) = find_assoc_const_usage(&new_name) - { + } else if let Some((ty_annotation, initializer)) = find_assoc_const_usage(&name) { edit.replace(ty_annotation.syntax().text_range(), "Bool"); replace_bool_expr(edit, initializer); - } else if let Some(receiver) = find_method_call_expr_usage(&new_name) { + } else if let Some(receiver) = find_method_call_expr_usage(&name) { edit.replace( receiver.syntax().text_range(), format!("({} == Bool::True)", receiver), ); - } else if new_name.syntax().ancestors().find_map(ast::UseTree::cast).is_none() { + } else if name.syntax().ancestors().find_map(ast::UseTree::cast).is_none() { // for any other usage in an expression, replace it with a check that it is the true variant - if let Some((record_field, expr)) = new_name - .as_name_ref() - .and_then(ast::RecordExprField::for_field_name) - .and_then(|record_field| { - record_field.expr().map(|expr| (record_field, expr)) - }) + if let Some((record_field, expr)) = + name.as_name_ref().and_then(ast::RecordExprField::for_field_name).and_then( + |record_field| record_field.expr().map(|expr| (record_field, expr)), + ) { - record_field.replace_expr( + utils::replace_record_field_expr( + ctx, + edit, + record_field, make::expr_bin_op( expr, ast::BinaryOp::CmpOp(ast::CmpOp::Eq { negated: false }), make::expr_path(make::path_from_text("Bool::True")), - ) - .clone_for_update(), + ), ); } else { - edit.replace(range, format!("{} == Bool::True", new_name.text())); + edit.replace(range, format!("{} == Bool::True", name.text())); } } // add imports across modules where needed if let Some((import_scope, path)) = import_data { - insert_use(&import_scope, path, &ctx.config.insert_use); + let scope = match import_scope.clone() { + ImportScope::File(it) => ImportScope::File(edit.make_mut(it)), + ImportScope::Module(it) => ImportScope::Module(edit.make_mut(it)), + ImportScope::Block(it) => ImportScope::Block(edit.make_mut(it)), + }; + insert_use(&scope, path, &ctx.config.insert_use); } }, ) @@ -312,37 +315,31 @@ fn replace_usages( struct FileReferenceWithImport { range: TextRange, - old_name: ast::NameLike, - new_name: ast::NameLike, + name: ast::NameLike, import_data: Option<(ImportScope, ast::Path)>, } fn augment_references_with_imports( - edit: &mut SourceChangeBuilder, ctx: &AssistContext<'_>, - references: &[FileReference], + references: Vec<FileReference>, target_module: &hir::Module, ) -> Vec<FileReferenceWithImport> { let mut visited_modules = FxHashSet::default(); references - .iter() + .into_iter() .filter_map(|FileReference { range, name, .. }| { let name = name.clone().into_name_like()?; - ctx.sema.scope(name.syntax()).map(|scope| (*range, name, scope.module())) + ctx.sema.scope(name.syntax()).map(|scope| (range, name, scope.module())) }) .map(|(range, name, ref_module)| { - let old_name = name.clone(); - let new_name = edit.make_mut(name.clone()); - // if the referenced module is not the same as the target one and has not been seen before, add an import let import_data = if ref_module.nearest_non_block_module(ctx.db()) != *target_module && !visited_modules.contains(&ref_module) { visited_modules.insert(ref_module); - let import_scope = - ImportScope::find_insert_use_container(new_name.syntax(), &ctx.sema); + let import_scope = ImportScope::find_insert_use_container(name.syntax(), &ctx.sema); let path = ref_module .find_use_path_prefixed( ctx.sema.db, @@ -360,7 +357,7 @@ fn augment_references_with_imports( None }; - FileReferenceWithImport { range, old_name, new_name, import_data } + FileReferenceWithImport { range, name, import_data } }) .collect() } @@ -405,13 +402,12 @@ fn find_record_expr_usage( let record_field = ast::RecordExprField::for_field_name(name_ref)?; let initializer = record_field.expr()?; - if let Definition::Field(expected_field) = target_definition { - if got_field != expected_field { - return None; + match target_definition { + Definition::Field(expected_field) if got_field == expected_field => { + Some((record_field, initializer)) } + _ => None, } - - Some((record_field, initializer)) } fn find_record_pat_field_usage(name: &ast::NameLike) -> Option<ast::Pat> { @@ -466,12 +462,9 @@ fn add_enum_def( let indent = IndentLevel::from_node(&insert_before); enum_def.reindent_to(indent); - ted::insert_all( - ted::Position::before(&edit.make_syntax_mut(insert_before)), - vec![ - enum_def.syntax().clone().into(), - make::tokens::whitespace(&format!("\n\n{indent}")).into(), - ], + edit.insert( + insert_before.text_range().start(), + format!("{}\n\n{indent}", enum_def.syntax().text()), ); } @@ -801,6 +794,78 @@ fn main() { } #[test] + fn local_var_init_struct_usage() { + check_assist( + bool_to_enum, + r#" +struct Foo { + foo: bool, +} + +fn main() { + let $0foo = true; + let s = Foo { foo }; +} +"#, + r#" +struct Foo { + foo: bool, +} + +#[derive(PartialEq, Eq)] +enum Bool { True, False } + +fn main() { + let foo = Bool::True; + let s = Foo { foo: foo == Bool::True }; +} +"#, + ) + } + + #[test] + fn local_var_init_struct_usage_in_macro() { + check_assist( + bool_to_enum, + r#" +struct Struct { + boolean: bool, +} + +macro_rules! identity { + ($body:expr) => { + $body + } +} + +fn new() -> Struct { + let $0boolean = true; + identity![Struct { boolean }] +} +"#, + r#" +struct Struct { + boolean: bool, +} + +macro_rules! identity { + ($body:expr) => { + $body + } +} + +#[derive(PartialEq, Eq)] +enum Bool { True, False } + +fn new() -> Struct { + let boolean = Bool::True; + identity![Struct { boolean: boolean == Bool::True }] +} +"#, + ) + } + + #[test] fn field_struct_basic() { cov_mark::check!(replaces_record_expr); check_assist( @@ -1322,6 +1387,46 @@ fn main() { } #[test] + fn field_in_macro() { + check_assist( + bool_to_enum, + r#" +struct Struct { + $0boolean: bool, +} + +fn boolean(x: Struct) { + let Struct { boolean } = x; +} + +macro_rules! identity { ($body:expr) => { $body } } + +fn new() -> Struct { + identity!(Struct { boolean: true }) +} +"#, + r#" +#[derive(PartialEq, Eq)] +enum Bool { True, False } + +struct Struct { + boolean: Bool, +} + +fn boolean(x: Struct) { + let Struct { boolean } = x; +} + +macro_rules! identity { ($body:expr) => { $body } } + +fn new() -> Struct { + identity!(Struct { boolean: Bool::True }) +} +"#, + ) + } + + #[test] fn field_non_bool() { cov_mark::check!(not_applicable_non_bool_field); check_assist_not_applicable( diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/extract_variable.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/extract_variable.rs index e7c884dcb70..874b81d3b63 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/extract_variable.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/extract_variable.rs @@ -1,12 +1,8 @@ use hir::TypeInfo; -use stdx::format_to; use syntax::{ - ast::{self, AstNode}, - NodeOrToken, - SyntaxKind::{ - BLOCK_EXPR, BREAK_EXPR, CLOSURE_EXPR, COMMENT, LOOP_EXPR, MATCH_ARM, MATCH_GUARD, - PATH_EXPR, RETURN_EXPR, - }, + ast::{self, edit::IndentLevel, edit_in_place::Indent, make, AstNode, HasName}, + ted, NodeOrToken, + SyntaxKind::{BLOCK_EXPR, BREAK_EXPR, COMMENT, LOOP_EXPR, MATCH_GUARD, PATH_EXPR, RETURN_EXPR}, SyntaxNode, }; @@ -66,98 +62,140 @@ pub(crate) fn extract_variable(acc: &mut Assists, ctx: &AssistContext<'_>) -> Op .as_ref() .map_or(false, |it| matches!(it, ast::Expr::FieldExpr(_) | ast::Expr::MethodCallExpr(_))); - let reference_modifier = match ty.filter(|_| needs_adjust) { - Some(receiver_type) if receiver_type.is_mutable_reference() => "&mut ", - Some(receiver_type) if receiver_type.is_reference() => "&", - _ => "", - }; - - let var_modifier = match parent { - Some(ast::Expr::RefExpr(expr)) if expr.mut_token().is_some() => "mut ", - _ => "", - }; - let anchor = Anchor::from(&to_extract)?; - let indent = anchor.syntax().prev_sibling_or_token()?.as_token()?.clone(); let target = to_extract.syntax().text_range(); acc.add( AssistId("extract_variable", AssistKind::RefactorExtract), "Extract into variable", target, move |edit| { - let field_shorthand = - match to_extract.syntax().parent().and_then(ast::RecordExprField::cast) { - Some(field) => field.name_ref(), - None => None, - }; - - let mut buf = String::new(); - - let var_name = match &field_shorthand { - Some(it) => it.to_string(), - None => suggest_name::for_variable(&to_extract, &ctx.sema), + let field_shorthand = to_extract + .syntax() + .parent() + .and_then(ast::RecordExprField::cast) + .filter(|field| field.name_ref().is_some()); + + let (var_name, expr_replace) = match field_shorthand { + Some(field) => (field.to_string(), field.syntax().clone()), + None => ( + suggest_name::for_variable(&to_extract, &ctx.sema), + to_extract.syntax().clone(), + ), }; - let expr_range = match &field_shorthand { - Some(it) => it.syntax().text_range().cover(to_extract.syntax().text_range()), - None => to_extract.syntax().text_range(), + + let ident_pat = match parent { + Some(ast::Expr::RefExpr(expr)) if expr.mut_token().is_some() => { + make::ident_pat(false, true, make::name(&var_name)) + } + _ => make::ident_pat(false, false, make::name(&var_name)), }; - match anchor { - Anchor::Before(_) | Anchor::Replace(_) => { - format_to!(buf, "let {var_modifier}{var_name} = {reference_modifier}") + let to_extract = match ty.as_ref().filter(|_| needs_adjust) { + Some(receiver_type) if receiver_type.is_mutable_reference() => { + make::expr_ref(to_extract, true) } - Anchor::WrapInBlock(_) => { - format_to!(buf, "{{ let {var_name} = {reference_modifier}") + Some(receiver_type) if receiver_type.is_reference() => { + make::expr_ref(to_extract, false) } + _ => to_extract, }; - format_to!(buf, "{to_extract}"); - if let Anchor::Replace(stmt) = anchor { - cov_mark::hit!(test_extract_var_expr_stmt); - if stmt.semicolon_token().is_none() { - buf.push(';'); - } - match ctx.config.snippet_cap { - Some(cap) => { - let snip = buf.replace( - &format!("let {var_modifier}{var_name}"), - &format!("let {var_modifier}$0{var_name}"), - ); - edit.replace_snippet(cap, expr_range, snip) + let expr_replace = edit.make_syntax_mut(expr_replace); + let let_stmt = + make::let_stmt(ident_pat.into(), None, Some(to_extract)).clone_for_update(); + let name_expr = make::expr_path(make::ext::ident_path(&var_name)).clone_for_update(); + + match anchor { + Anchor::Before(place) => { + let prev_ws = place.prev_sibling_or_token().and_then(|it| it.into_token()); + let indent_to = IndentLevel::from_node(&place); + let insert_place = edit.make_syntax_mut(place); + + // Adjust ws to insert depending on if this is all inline or on separate lines + let trailing_ws = if prev_ws.is_some_and(|it| it.text().starts_with("\n")) { + format!("\n{indent_to}") + } else { + format!(" ") + }; + + ted::insert_all_raw( + ted::Position::before(insert_place), + vec![ + let_stmt.syntax().clone().into(), + make::tokens::whitespace(&trailing_ws).into(), + ], + ); + + ted::replace(expr_replace, name_expr.syntax()); + + if let Some(cap) = ctx.config.snippet_cap { + if let Some(ast::Pat::IdentPat(ident_pat)) = let_stmt.pat() { + if let Some(name) = ident_pat.name() { + edit.add_tabstop_before(cap, name); + } + } } - None => edit.replace(expr_range, buf), } - return; - } + Anchor::Replace(stmt) => { + cov_mark::hit!(test_extract_var_expr_stmt); - buf.push(';'); - - // We want to maintain the indent level, - // but we do not want to duplicate possible - // extra newlines in the indent block - let text = indent.text(); - if text.starts_with('\n') { - buf.push('\n'); - buf.push_str(text.trim_start_matches('\n')); - } else { - buf.push_str(text); - } + let stmt_replace = edit.make_mut(stmt); + ted::replace(stmt_replace.syntax(), let_stmt.syntax()); - edit.replace(expr_range, var_name.clone()); - let offset = anchor.syntax().text_range().start(); - match ctx.config.snippet_cap { - Some(cap) => { - let snip = buf.replace( - &format!("let {var_modifier}{var_name}"), - &format!("let {var_modifier}$0{var_name}"), - ); - edit.insert_snippet(cap, offset, snip) + if let Some(cap) = ctx.config.snippet_cap { + if let Some(ast::Pat::IdentPat(ident_pat)) = let_stmt.pat() { + if let Some(name) = ident_pat.name() { + edit.add_tabstop_before(cap, name); + } + } + } } - None => edit.insert(offset, buf), - } + Anchor::WrapInBlock(to_wrap) => { + let indent_to = to_wrap.indent_level(); + + let block = if to_wrap.syntax() == &expr_replace { + // Since `expr_replace` is the same that needs to be wrapped in a block, + // we can just directly replace it with a block + let block = + make::block_expr([let_stmt.into()], Some(name_expr)).clone_for_update(); + ted::replace(expr_replace, block.syntax()); + + block + } else { + // `expr_replace` is a descendant of `to_wrap`, so both steps need to be + // handled seperately, otherwise we wrap the wrong expression + let to_wrap = edit.make_mut(to_wrap); + + // Replace the target expr first so that we don't need to find where + // `expr_replace` is in the wrapped `to_wrap` + ted::replace(expr_replace, name_expr.syntax()); + + // Wrap `to_wrap` in a block + let block = make::block_expr([let_stmt.into()], Some(to_wrap.clone())) + .clone_for_update(); + ted::replace(to_wrap.syntax(), block.syntax()); + + block + }; + + if let Some(cap) = ctx.config.snippet_cap { + // Adding a tabstop to `name` requires finding the let stmt again, since + // the existing `let_stmt` is not actually added to the tree + let pat = block.statements().find_map(|stmt| { + let ast::Stmt::LetStmt(let_stmt) = stmt else { return None }; + let_stmt.pat() + }); + + if let Some(ast::Pat::IdentPat(ident_pat)) = pat { + if let Some(name) = ident_pat.name() { + edit.add_tabstop_before(cap, name); + } + } + } - if let Anchor::WrapInBlock(_) = anchor { - edit.insert(anchor.syntax().text_range().end(), " }"); + // fixup indentation of block + block.indent(indent_to); + } } }, ) @@ -181,7 +219,7 @@ fn valid_target_expr(node: SyntaxNode) -> Option<ast::Expr> { enum Anchor { Before(SyntaxNode), Replace(ast::ExprStmt), - WrapInBlock(SyntaxNode), + WrapInBlock(ast::Expr), } impl Anchor { @@ -204,16 +242,16 @@ impl Anchor { } if let Some(parent) = node.parent() { - if parent.kind() == CLOSURE_EXPR { + if let Some(parent) = ast::ClosureExpr::cast(parent.clone()) { cov_mark::hit!(test_extract_var_in_closure_no_block); - return Some(Anchor::WrapInBlock(node)); + return parent.body().map(Anchor::WrapInBlock); } - if parent.kind() == MATCH_ARM { + if let Some(parent) = ast::MatchArm::cast(parent) { if node.kind() == MATCH_GUARD { cov_mark::hit!(test_extract_var_in_match_guard); } else { cov_mark::hit!(test_extract_var_in_match_arm_no_block); - return Some(Anchor::WrapInBlock(node)); + return parent.expr().map(Anchor::WrapInBlock); } } } @@ -229,13 +267,6 @@ impl Anchor { None }) } - - fn syntax(&self) -> &SyntaxNode { - match self { - Anchor::Before(it) | Anchor::WrapInBlock(it) => it, - Anchor::Replace(stmt) => stmt.syntax(), - } - } } #[cfg(test)] @@ -502,7 +533,10 @@ fn main() { fn main() { let x = true; let tuple = match x { - true => { let $0var_name = 2 + 2; (var_name, true) } + true => { + let $0var_name = 2 + 2; + (var_name, true) + } _ => (0, false) }; } @@ -579,7 +613,10 @@ fn main() { "#, r#" fn main() { - let lambda = |x: u32| { let $0var_name = x * 2; var_name }; + let lambda = |x: u32| { + let $0var_name = x * 2; + var_name + }; } "#, ); diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_delegate_trait.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_delegate_trait.rs index f4fa6a74c6b..0d34502add9 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_delegate_trait.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_delegate_trait.rs @@ -2,22 +2,25 @@ use std::ops::Not; use crate::{ assist_context::{AssistContext, Assists}, - utils::convert_param_list_to_arg_list, + utils::{convert_param_list_to_arg_list, suggest_name}, }; use either::Either; use hir::{db::HirDatabase, HasVisibility}; use ide_db::{ assists::{AssistId, GroupLabel}, path_transform::PathTransform, + FxHashMap, FxHashSet, }; +use itertools::Itertools; use syntax::{ ast::{ self, edit::{self, AstNodeEdit}, - make, AssocItem, HasGenericParams, HasName, HasVisibility as astHasVisibility, Path, + make, AssocItem, GenericArgList, GenericParamList, HasGenericParams, HasName, + HasTypeBounds, HasVisibility as astHasVisibility, Path, }, ted::{self, Position}, - AstNode, NodeOrToken, SyntaxKind, + AstNode, NodeOrToken, SmolStr, SyntaxKind, }; // Assist: generate_delegate_trait @@ -77,7 +80,7 @@ use syntax::{ // } // // fn method_(&mut self) -> bool { -// <A as SomeTrait>::method_( &mut self.a ) +// <A as SomeTrait>::method_(&mut self.a) // } // } // ``` @@ -98,6 +101,7 @@ pub(crate) fn generate_delegate_trait(acc: &mut Assists, ctx: &AssistContext<'_> } /// A utility object that represents a struct's field. +#[derive(Debug)] struct Field { name: String, ty: ast::Type, @@ -111,44 +115,33 @@ impl Field { f: Either<ast::RecordField, (ast::TupleField, ast::TupleFieldList)>, ) -> Option<Field> { let db = ctx.sema.db; - let name: String; - let range: syntax::TextRange; - let ty: ast::Type; let module = ctx.sema.to_module_def(ctx.file_id())?; - match f { + let (name, range, ty) = match f { Either::Left(f) => { - name = f.name()?.to_string(); - ty = f.ty()?; - range = f.syntax().text_range(); + let name = f.name()?.to_string(); + (name, f.syntax().text_range(), f.ty()?) } Either::Right((f, l)) => { - name = l.fields().position(|it| it == f)?.to_string(); - ty = f.ty()?; - range = f.syntax().text_range(); + let name = l.fields().position(|it| it == f)?.to_string(); + (name, f.syntax().text_range(), f.ty()?) } }; let hir_ty = ctx.sema.resolve_type(&ty)?; let type_impls = hir::Impl::all_for_type(db, hir_ty.clone()); let mut impls = Vec::with_capacity(type_impls.len()); - let type_param = hir_ty.as_type_param(db); - if let Some(tp) = type_param { + if let Some(tp) = hir_ty.as_type_param(db) { for tb in tp.trait_bounds(db) { - impls.push(Delegee::Bound(BoundCase(tb))); + impls.push(Delegee::Bound(tb)); } }; for imp in type_impls { - match imp.trait_(db) { - Some(tr) => { - if tr.is_visible_from(db, module) { - impls.push(Delegee::Impls(ImplCase(tr, imp))) - } - } - None => (), + if let Some(tr) = imp.trait_(db).filter(|tr| tr.is_visible_from(db, module)) { + impls.push(Delegee::Impls(tr, imp)) } } @@ -161,19 +154,17 @@ impl Field { /// actually implements the trait and the second way is when the field /// has a bound type parameter. We handle these cases in different ways /// hence the enum. +#[derive(Debug)] enum Delegee { - Bound(BoundCase), - Impls(ImplCase), + Bound(hir::Trait), + Impls(hir::Trait, hir::Impl), } -struct BoundCase(hir::Trait); -struct ImplCase(hir::Trait, hir::Impl); - impl Delegee { fn signature(&self, db: &dyn HirDatabase) -> String { let mut s = String::new(); - let (Delegee::Bound(BoundCase(it)) | Delegee::Impls(ImplCase(it, _))) = self; + let (Delegee::Bound(it) | Delegee::Impls(it, _)) = self; for m in it.module(db).path_to_root(db).iter().rev() { if let Some(name) = m.name(db) { @@ -200,25 +191,33 @@ impl Struct { pub(crate) fn delegate(&self, field: Field, acc: &mut Assists, ctx: &AssistContext<'_>) { let db = ctx.db(); + for delegee in &field.impls { - // FIXME : We can omit already implemented impl_traits - // But we don't know what the &[hir::Type] argument should look like. + let trait_ = match delegee { + Delegee::Bound(b) => b, + Delegee::Impls(i, _) => i, + }; - // let trait_ = match delegee { - // Delegee::Bound(b) => b.0, - // Delegee::Impls(i) => i.1, - // }; + // Skip trait that has `Self` type, which cannot be delegated + // + // See [`test_self_ty`] + if has_self_type(*trait_, ctx).is_some() { + continue; + } + // FIXME : We can omit already implemented impl_traits + // But we don't know what the &[hir::Type] argument should look like. // if self.hir_ty.impls_trait(db, trait_, &[]) { // continue; // } let signature = delegee.signature(db); + let Some(delegate) = generate_impl(ctx, self, &field.ty, &field.name, delegee) else { continue; }; acc.add_group( - &GroupLabel("Delegate trait impl for field...".to_owned()), + &GroupLabel(format!("Generate delegate impls for field `{}`", field.name)), AssistId("generate_delegate_trait", ide_db::assists::AssistKind::Generate), format!("Generate delegate impl `{}` for `{}`", signature, field.name), field.range, @@ -241,46 +240,40 @@ fn generate_impl( delegee: &Delegee, ) -> Option<ast::Impl> { let delegate: ast::Impl; - let source: ast::Impl; - let genpar: Option<ast::GenericParamList>; let db = ctx.db(); - let base_path = make::path_from_text(&field_ty.to_string().as_str()); - let s_path = make::ext::ident_path(&strukt.name.to_string()); + let ast_strukt = &strukt.strukt; + let strukt_ty = make::ty_path(make::ext::ident_path(&strukt.name.to_string())); match delegee { Delegee::Bound(delegee) => { - let in_file = ctx.sema.source(delegee.0.to_owned())?; - let source: ast::Trait = in_file.value; + let bound_def = ctx.sema.source(delegee.to_owned())?.value; + let bound_params = bound_def.generic_param_list(); + let strukt_params = ast_strukt.generic_param_list(); delegate = make::impl_trait( - delegee.0.is_unsafe(db), - None, - None, - strukt.strukt.generic_param_list(), - None, - delegee.0.is_auto(db), - make::ty(&delegee.0.name(db).to_smol_str()), - make::ty_path(s_path), - source.where_clause(), - strukt.strukt.where_clause(), + delegee.is_unsafe(db), + bound_params.clone(), + bound_params.map(|params| params.to_generic_args()), + strukt_params.clone(), + strukt_params.map(|params| params.to_generic_args()), + delegee.is_auto(db), + make::ty(&delegee.name(db).to_smol_str()), + strukt_ty, + bound_def.where_clause(), + ast_strukt.where_clause(), None, ) .clone_for_update(); - genpar = source.generic_param_list(); - let delegate_assoc_items = delegate.get_or_create_assoc_item_list(); - let gen_args: String = - genpar.map_or_else(String::new, |params| params.to_generic_args().to_string()); - // Goto link : https://doc.rust-lang.org/reference/paths.html#qualified-paths let qualified_path_type = make::path_from_text(&format!( - "<{} as {}{}>", - base_path.to_string(), - delegee.0.name(db).to_smol_str(), - gen_args.to_string() + "<{} as {}>", + field_ty.to_string(), + delegate.trait_()?.to_string() )); - match source.assoc_item_list() { + let delegate_assoc_items = delegate.get_or_create_assoc_item_list(); + match bound_def.assoc_item_list() { Some(ai) => { ai.assoc_items() .filter(|item| matches!(item, AssocItem::MacroCall(_)).not()) @@ -295,66 +288,394 @@ fn generate_impl( None => {} }; - let target = ctx.sema.scope(strukt.strukt.syntax())?; - let source = ctx.sema.scope(source.syntax())?; - - let transform = - PathTransform::trait_impl(&target, &source, delegee.0, delegate.clone()); + let target_scope = ctx.sema.scope(strukt.strukt.syntax())?; + let source_scope = ctx.sema.scope(bound_def.syntax())?; + let transform = PathTransform::generic_transformation(&target_scope, &source_scope); transform.apply(&delegate.syntax()); } - Delegee::Impls(delegee) => { - let in_file = ctx.sema.source(delegee.1.to_owned())?; - source = in_file.value; + Delegee::Impls(trait_, old_impl) => { + let old_impl = ctx.sema.source(old_impl.to_owned())?.value; + + // `old_trait_args` contains names of generic args for trait in `old_impl` + let old_trait_args = old_impl + .trait_()? + .generic_arg_list() + .map(|l| l.generic_args().map(|arg| arg.to_string())) + .map_or_else(|| FxHashSet::default(), |it| it.collect()); + + let old_impl_params = old_impl.generic_param_list(); + + // Resolve conflicts with generic parameters in strukt. + // These generics parameters will also be used in `field_ty` and `where_clauses`, + // so we should substitude arguments in them as well. + let (renamed_strukt_params, field_ty, ty_where_clause) = if let Some(strukt_params) = + resolve_conflicts_for_strukt(ast_strukt, old_impl_params.as_ref()) + { + let strukt_args = strukt_params.to_generic_args(); + let field_ty = + subst_name_in_strukt(ctx, ast_strukt, field_ty, strukt_args.clone())?; + let wc = ast_strukt + .where_clause() + .and_then(|wc| Some(subst_name_in_strukt(ctx, ast_strukt, &wc, strukt_args)?)); + (Some(strukt_params), field_ty, wc) + } else { + (None, field_ty.clone_for_update(), None) + }; + + // Some generics used in `field_ty` may be instantiated, so they are no longer + // `generics`. We should remove them from generics params, and use the rest params. + let trait_gen_params = + remove_instantiated_params(&old_impl.self_ty()?, old_impl_params, &old_trait_args); + + // Generate generic args that applied to current impl, this step will also remove unused params + let args_for_impl = + get_args_for_impl(&old_impl, &field_ty, &trait_gen_params, &old_trait_args); + + let mut trait_gen_args = old_impl.trait_()?.generic_arg_list(); + if let Some(arg_list) = &mut trait_gen_args { + *arg_list = arg_list.clone_for_update(); + transform_impl(ctx, ast_strukt, &old_impl, &args_for_impl, &arg_list.syntax())?; + } + + let mut type_gen_args = + renamed_strukt_params.clone().map(|params| params.to_generic_args()); + if let Some(type_args) = &mut type_gen_args { + *type_args = type_args.clone_for_update(); + transform_impl(ctx, ast_strukt, &old_impl, &args_for_impl, &type_args.syntax())?; + } + + let path_type = make::ty(&trait_.name(db).to_smol_str()).clone_for_update(); + transform_impl(ctx, ast_strukt, &old_impl, &args_for_impl, &path_type.syntax())?; + delegate = make::impl_trait( - delegee.0.is_unsafe(db), - source.generic_param_list(), - None, - None, - None, - delegee.0.is_auto(db), - make::ty(&delegee.0.name(db).to_smol_str()), - make::ty_path(s_path), - source.where_clause(), - strukt.strukt.where_clause(), + trait_.is_unsafe(db), + trait_gen_params, + trait_gen_args, + renamed_strukt_params, + type_gen_args, + trait_.is_auto(db), + path_type, + strukt_ty, + old_impl.where_clause().map(|wc| wc.clone_for_update()), + ty_where_clause, None, ) .clone_for_update(); - genpar = source.generic_param_list(); - let delegate_assoc_items = delegate.get_or_create_assoc_item_list(); - let gen_args: String = - genpar.map_or_else(String::new, |params| params.to_generic_args().to_string()); // Goto link : https://doc.rust-lang.org/reference/paths.html#qualified-paths let qualified_path_type = make::path_from_text(&format!( - "<{} as {}{}>", - base_path.to_string().as_str(), - delegee.0.name(db).to_smol_str(), - gen_args.to_string().as_str() + "<{} as {}>", + field_ty.to_string(), + delegate.trait_()?.to_string() )); - source + let delegate_assoc_items = delegate.get_or_create_assoc_item_list(); + for item in old_impl .get_or_create_assoc_item_list() .assoc_items() .filter(|item| matches!(item, AssocItem::MacroCall(_)).not()) - .for_each(|item| { - let assoc = process_assoc_item(item, qualified_path_type.clone(), &field_name); - if let Some(assoc) = assoc { - delegate_assoc_items.add_item(assoc); - } - }); - - let target = ctx.sema.scope(strukt.strukt.syntax())?; - let source = ctx.sema.scope(source.syntax())?; + { + let assoc = process_assoc_item( + transform_assoc_item(ctx, ast_strukt, &old_impl, &args_for_impl, item)?, + qualified_path_type.clone(), + &field_name, + )?; + + delegate_assoc_items.add_item(assoc); + } - let transform = - PathTransform::trait_impl(&target, &source, delegee.0, delegate.clone()); - transform.apply(&delegate.syntax()); + // Remove unused where clauses + if let Some(wc) = delegate.where_clause() { + remove_useless_where_clauses(&delegate, wc)?; + } } } Some(delegate) } +fn transform_assoc_item( + ctx: &AssistContext<'_>, + strukt: &ast::Struct, + old_impl: &ast::Impl, + args: &Option<GenericArgList>, + item: AssocItem, +) -> Option<AssocItem> { + let source_scope = ctx.sema.scope(&item.syntax()).unwrap(); + let target_scope = ctx.sema.scope(&strukt.syntax())?; + let hir_old_impl = ctx.sema.to_impl_def(old_impl)?; + let item = item.clone_for_update(); + let transform = args.as_ref().map_or_else( + || PathTransform::generic_transformation(&target_scope, &source_scope), + |args| { + PathTransform::impl_transformation( + &target_scope, + &source_scope, + hir_old_impl, + args.clone(), + ) + }, + ); + transform.apply(&item.syntax()); + Some(item) +} + +fn transform_impl( + ctx: &AssistContext<'_>, + strukt: &ast::Struct, + old_impl: &ast::Impl, + args: &Option<GenericArgList>, + syntax: &syntax::SyntaxNode, +) -> Option<()> { + let source_scope = ctx.sema.scope(&old_impl.self_ty()?.syntax())?; + let target_scope = ctx.sema.scope(&strukt.syntax())?; + let hir_old_impl = ctx.sema.to_impl_def(old_impl)?; + + let transform = args.as_ref().map_or_else( + || PathTransform::generic_transformation(&target_scope, &source_scope), + |args| { + PathTransform::impl_transformation( + &target_scope, + &source_scope, + hir_old_impl, + args.clone(), + ) + }, + ); + + transform.apply(&syntax); + Some(()) +} + +fn remove_instantiated_params( + self_ty: &ast::Type, + old_impl_params: Option<GenericParamList>, + old_trait_args: &FxHashSet<String>, +) -> Option<GenericParamList> { + match self_ty { + ast::Type::PathType(path_type) => { + old_impl_params.and_then(|gpl| { + // Remove generic parameters in field_ty (which is instantiated). + let new_gpl = gpl.clone_for_update(); + + path_type + .path()? + .segments() + .filter_map(|seg| seg.generic_arg_list()) + .flat_map(|it| it.generic_args()) + // However, if the param is also used in the trait arguments, it shouldn't be removed. + .filter(|arg| !old_trait_args.contains(&arg.to_string())) + .for_each(|arg| { + new_gpl.remove_generic_arg(&arg); + }); + (new_gpl.generic_params().count() > 0).then_some(new_gpl) + }) + } + _ => old_impl_params, + } +} + +fn remove_useless_where_clauses(delegate: &ast::Impl, wc: ast::WhereClause) -> Option<()> { + let trait_args = + delegate.trait_()?.generic_arg_list().map(|trait_args| trait_args.generic_args()); + let strukt_args = + delegate.self_ty()?.generic_arg_list().map(|strukt_args| strukt_args.generic_args()); + let used_generic_names = match (trait_args, strukt_args) { + (None, None) => None, + (None, Some(y)) => Some(y.map(|arg| arg.to_string()).collect::<FxHashSet<_>>()), + (Some(x), None) => Some(x.map(|arg| arg.to_string()).collect::<FxHashSet<_>>()), + (Some(x), Some(y)) => Some(x.chain(y).map(|arg| arg.to_string()).collect::<FxHashSet<_>>()), + }; + + // Keep clauses that have generic clauses after substitution, and remove the rest + if let Some(used_generic_names) = used_generic_names { + wc.predicates() + .filter(|pred| { + pred.syntax() + .descendants_with_tokens() + .filter_map(|e| e.into_token()) + .find(|e| { + e.kind() == SyntaxKind::IDENT && used_generic_names.contains(&e.to_string()) + }) + .is_none() + }) + .for_each(|pred| { + wc.remove_predicate(pred); + }); + } else { + wc.predicates().for_each(|pred| wc.remove_predicate(pred)); + } + + if wc.predicates().count() == 0 { + // Remove useless whitespaces + wc.syntax() + .siblings_with_tokens(syntax::Direction::Prev) + .skip(1) + .take_while(|node_or_tok| node_or_tok.kind() == SyntaxKind::WHITESPACE) + .for_each(|ws| ted::remove(ws)); + wc.syntax() + .siblings_with_tokens(syntax::Direction::Next) + .skip(1) + .take_while(|node_or_tok| node_or_tok.kind() == SyntaxKind::WHITESPACE) + .for_each(|ws| ted::remove(ws)); + ted::insert( + ted::Position::after(wc.syntax()), + NodeOrToken::Token(make::token(SyntaxKind::WHITESPACE)), + ); + // Remove where clause + ted::remove(wc.syntax()); + } + + Some(()) +} + +fn get_args_for_impl( + old_impl: &ast::Impl, + field_ty: &ast::Type, + trait_params: &Option<GenericParamList>, + old_trait_args: &FxHashSet<String>, +) -> Option<ast::GenericArgList> { + // Generate generic args that should be apply to current impl + // + // For exmaple, if we have `impl<A, B, C> Trait for B<A>`, and `b: B<T>` in `S<T>`, + // then the generic `A` should be renamed to `T`. While the last two generic args + // doesn't change, it renames <B, C>. So we apply `<T, B C>` as generic arguments + // to impl. + let old_impl_params = old_impl.generic_param_list(); + let self_ty = old_impl.self_ty(); + + if let (Some(old_impl_gpl), Some(self_ty)) = (old_impl_params, self_ty) { + // Make pair of the arguments of `field_ty` and `old_strukt_args` to + // get the list for substitution + let mut arg_substs = FxHashMap::default(); + + match field_ty { + field_ty @ ast::Type::PathType(_) => { + let field_args = field_ty.generic_arg_list(); + if let (Some(field_args), Some(old_impl_args)) = + (field_args, self_ty.generic_arg_list()) + { + field_args.generic_args().zip(old_impl_args.generic_args()).for_each( + |(field_arg, impl_arg)| { + arg_substs.entry(impl_arg.to_string()).or_insert(field_arg); + }, + ) + } + } + _ => {} + } + + let args = old_impl_gpl + .to_generic_args() + .generic_args() + .map(|old_arg| { + arg_substs.get(&old_arg.to_string()).map_or_else( + || old_arg.clone(), + |replace_with| { + // The old_arg will be replaced, so it becomes redundant + let old_arg_name = old_arg.to_string(); + if old_trait_args.contains(&old_arg_name) { + // However, we should check type bounds and where clauses on old_arg, + // if it has type bound, we should keep the type bound. + // match trait_params.and_then(|params| params.remove_generic_arg(&old_arg)) { + // Some(ast::GenericParam::TypeParam(ty)) => { + // ty.type_bound_list().and_then(|bounds| ) + // } + // _ => {} + // } + if let Some(params) = trait_params { + params.remove_generic_arg(&old_arg); + } + } + replace_with.clone() + }, + ) + }) + .collect_vec(); + args.is_empty().not().then(|| make::generic_arg_list(args.into_iter())) + } else { + None + } +} + +fn subst_name_in_strukt<N>( + ctx: &AssistContext<'_>, + strukt: &ast::Struct, + item: &N, + args: GenericArgList, +) -> Option<N> +where + N: ast::AstNode, +{ + let hir_strukt = ctx.sema.to_struct_def(strukt)?; + let hir_adt = hir::Adt::from(hir_strukt); + + let item = item.clone_for_update(); + let item_scope = ctx.sema.scope(item.syntax())?; + let transform = PathTransform::adt_transformation(&item_scope, &item_scope, hir_adt, args); + transform.apply(&item.syntax()); + Some(item) +} + +fn has_self_type(trait_: hir::Trait, ctx: &AssistContext<'_>) -> Option<()> { + let trait_source = ctx.sema.source(trait_)?.value; + trait_source + .syntax() + .descendants_with_tokens() + .filter_map(|e| e.into_token()) + .find(|e| e.kind() == SyntaxKind::SELF_TYPE_KW) + .map(|_| ()) +} + +fn resolve_conflicts_for_strukt( + strukt: &ast::Struct, + old_impl_params: Option<&ast::GenericParamList>, +) -> Option<ast::GenericParamList> { + match (strukt.generic_param_list(), old_impl_params) { + (Some(old_strukt_params), Some(old_impl_params)) => { + let params = make::generic_param_list(std::iter::empty()).clone_for_update(); + + for old_strukt_param in old_strukt_params.generic_params() { + // Get old name from `strukt`` + let mut name = SmolStr::from(match &old_strukt_param { + ast::GenericParam::ConstParam(c) => c.name()?.to_string(), + ast::GenericParam::LifetimeParam(l) => { + l.lifetime()?.lifetime_ident_token()?.to_string() + } + ast::GenericParam::TypeParam(t) => t.name()?.to_string(), + }); + + // The new name cannot be conflicted with generics in trait, and the renamed names. + name = suggest_name::for_unique_generic_name(&name, old_impl_params); + name = suggest_name::for_unique_generic_name(&name, ¶ms); + match old_strukt_param { + ast::GenericParam::ConstParam(c) => { + if let Some(const_ty) = c.ty() { + let const_param = make::const_param(make::name(&name), const_ty); + params.add_generic_param(ast::GenericParam::ConstParam( + const_param.clone_for_update(), + )); + } + } + p @ ast::GenericParam::LifetimeParam(_) => { + params.add_generic_param(p.clone_for_update()); + } + ast::GenericParam::TypeParam(t) => { + let type_bounds = t.type_bound_list(); + let type_param = make::type_param(make::name(&name), type_bounds); + params.add_generic_param(ast::GenericParam::TypeParam( + type_param.clone_for_update(), + )); + } + } + } + Some(params) + } + (Some(old_strukt_gpl), None) => Some(old_strukt_gpl), + _ => None, + } +} + fn process_assoc_item( item: syntax::ast::AssocItem, qual_path_ty: ast::Path, @@ -381,10 +702,14 @@ fn const_assoc_item(item: syntax::ast::Const, qual_path_ty: ast::Path) -> Option // <Base as Trait<GenArgs>>::ConstName; // FIXME : We can't rely on `make::path_qualified` for now but it would be nice to replace the following with it. // make::path_qualified(qual_path_ty, path_expr_segment.as_single_segment().unwrap()); - let qualpath = qualpath(qual_path_ty, path_expr_segment); - let inner = - make::item_const(item.visibility(), item.name()?, item.ty()?, make::expr_path(qualpath)) - .clone_for_update(); + let qualified_path = qualified_path(qual_path_ty, path_expr_segment); + let inner = make::item_const( + item.visibility(), + item.name()?, + item.ty()?, + make::expr_path(qualified_path), + ) + .clone_for_update(); Some(AssocItem::Const(inner)) } @@ -395,7 +720,7 @@ fn func_assoc_item( base_name: &str, ) -> Option<AssocItem> { let path_expr_segment = make::path_from_text(item.name()?.to_string().as_str()); - let qualpath = qualpath(qual_path_ty, path_expr_segment); + let qualified_path = qualified_path(qual_path_ty, path_expr_segment); let call = match item.param_list() { // Methods and funcs should be handled separately. @@ -413,31 +738,33 @@ fn func_assoc_item( let param_count = l.params().count(); let args = convert_param_list_to_arg_list(l).clone_for_update(); - + let pos_after_l_paren = Position::after(args.l_paren_token()?); if param_count > 0 { // Add SelfParam and a TOKEN::COMMA - ted::insert_all( - Position::after(args.l_paren_token()?), + ted::insert_all_raw( + pos_after_l_paren, vec![ NodeOrToken::Node(tail_expr_self.syntax().clone_for_update()), - NodeOrToken::Token(make::token(SyntaxKind::WHITESPACE)), NodeOrToken::Token(make::token(SyntaxKind::COMMA)), + NodeOrToken::Token(make::token(SyntaxKind::WHITESPACE)), ], ); } else { // Add SelfParam only - ted::insert( - Position::after(args.l_paren_token()?), + ted::insert_raw( + pos_after_l_paren, NodeOrToken::Node(tail_expr_self.syntax().clone_for_update()), ); } - make::expr_call(make::expr_path(qualpath), args) + make::expr_call(make::expr_path(qualified_path), args) + } + None => { + make::expr_call(make::expr_path(qualified_path), convert_param_list_to_arg_list(l)) } - None => make::expr_call(make::expr_path(qualpath), convert_param_list_to_arg_list(l)), }, None => make::expr_call( - make::expr_path(qualpath), + make::expr_path(qualified_path), convert_param_list_to_arg_list(make::param_list(None, Vec::new())), ), } @@ -463,8 +790,8 @@ fn func_assoc_item( fn ty_assoc_item(item: syntax::ast::TypeAlias, qual_path_ty: Path) -> Option<AssocItem> { let path_expr_segment = make::path_from_text(item.name()?.to_string().as_str()); - let qualpath = qualpath(qual_path_ty, path_expr_segment); - let ty = make::ty_path(qualpath); + let qualified_path = qualified_path(qual_path_ty, path_expr_segment); + let ty = make::ty_path(qualified_path); let ident = item.name()?.to_string(); let alias = make::ty_alias( @@ -479,7 +806,7 @@ fn ty_assoc_item(item: syntax::ast::TypeAlias, qual_path_ty: Path) -> Option<Ass Some(AssocItem::TypeAlias(alias)) } -fn qualpath(qual_path_ty: ast::Path, path_expr_seg: ast::Path) -> ast::Path { +fn qualified_path(qual_path_ty: ast::Path, path_expr_seg: ast::Path) -> ast::Path { make::path_from_text(&format!("{}::{}", qual_path_ty.to_string(), path_expr_seg.to_string())) } @@ -511,6 +838,29 @@ impl Trait for Base {} } #[test] + fn test_self_ty() { + // trait whith `Self` type cannot be delegated + // + // See the function `fn f() -> Self`. + // It should be `fn f() -> Base` in `Base`, and `fn f() -> S` in `S` + check_assist_not_applicable( + generate_delegate_trait, + r#" +struct Base(()); +struct S(B$0ase); +trait Trait { + fn f() -> Self; +} +impl Trait for Base { + fn f() -> Base { + Base(()) + } +} +"#, + ); + } + + #[test] fn test_struct_struct_basic() { check_assist( generate_delegate_trait, @@ -628,7 +978,7 @@ unsafe impl Trait for S { } unsafe fn a_method(&self) { - <Base as Trait>::a_method( &self.base ) + <Base as Trait>::a_method(&self.base) } } @@ -673,6 +1023,245 @@ where } #[test] + fn test_fields_with_generics() { + check_assist( + generate_delegate_trait, + r#" +struct B<T> { + a: T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T1, T2> Trait<T1> for B<T2> { + fn f(&self, a: T1) -> T1 { a } +} + +struct A {} +struct S { + b :$0 B<A>, +} +"#, + r#" +struct B<T> { + a: T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T1, T2> Trait<T1> for B<T2> { + fn f(&self, a: T1) -> T1 { a } +} + +struct A {} +struct S { + b : B<A>, +} + +impl<T1> Trait<T1> for S { + fn f(&self, a: T1) -> T1 { + <B<A> as Trait<T1>>::f(&self.b, a) + } +} +"#, + ); + } + + #[test] + fn test_generics_with_conflict_names() { + check_assist( + generate_delegate_trait, + r#" +struct B<T> { + a: T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T, T0> Trait<T> for B<T0> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> { + b : $0B<T>, +} +"#, + r#" +struct B<T> { + a: T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T, T0> Trait<T> for B<T0> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> { + b : B<T>, +} + +impl<T, T1> Trait<T> for S<T1> { + fn f(&self, a: T) -> T { + <B<T1> as Trait<T>>::f(&self.b, a) + } +} +"#, + ); + } + + #[test] + fn test_lifetime_with_conflict_names() { + check_assist( + generate_delegate_trait, + r#" +struct B<'a, T> { + a: &'a T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<'a, T, T0> Trait<T> for B<'a, T0> { + fn f(&self, a: T) -> T { a } +} + +struct S<'a, T> { + b : $0B<'a, T>, +} +"#, + r#" +struct B<'a, T> { + a: &'a T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<'a, T, T0> Trait<T> for B<'a, T0> { + fn f(&self, a: T) -> T { a } +} + +struct S<'a, T> { + b : B<'a, T>, +} + +impl<'a, T, T1> Trait<T> for S<'a, T1> { + fn f(&self, a: T) -> T { + <B<'a, T1> as Trait<T>>::f(&self.b, a) + } +} +"#, + ); + } + + #[test] + fn test_multiple_generics() { + check_assist( + generate_delegate_trait, + r#" +struct B<T1, T2> { + a: T1, + b: T2 +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T, T0> Trait<T> for B<T, T0> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> { + b :$0 B<i32, T>, +} +"#, + r#" +struct B<T1, T2> { + a: T1, + b: T2 +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T, T0> Trait<T> for B<T, T0> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> { + b : B<i32, T>, +} + +impl<T1> Trait<i32> for S<T1> { + fn f(&self, a: i32) -> i32 { + <B<i32, T1> as Trait<i32>>::f(&self.b, a) + } +} +"#, + ); + } + + #[test] + fn test_generics_multiplex() { + check_assist( + generate_delegate_trait, + r#" +struct B<T> { + a: T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T> Trait<T> for B<T> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> { + b : $0B<T>, +} +"#, + r#" +struct B<T> { + a: T +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T> Trait<T> for B<T> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> { + b : B<T>, +} + +impl<T0> Trait<T0> for S<T0> { + fn f(&self, a: T0) -> T0 { + <B<T0> as Trait<T0>>::f(&self.b, a) + } +} +"#, + ); + } + + #[test] fn test_complex_without_where() { check_assist( generate_delegate_trait, @@ -719,7 +1308,7 @@ impl<'a, T, const C: usize> Trait<'a, T, C> for S { } fn assoc_method(&self, p: ()) { - <Base as Trait<'a, T, C>>::assoc_method( &self.field , p) + <Base as Trait<'a, T, C>>::assoc_method(&self.field, p) } } @@ -789,7 +1378,7 @@ where } fn assoc_method(&self, p: ()) { - <Base as Trait<'b, C, D>>::assoc_method( &self.field , p) + <Base as Trait<'b, C, D>>::assoc_method(&self.field, p) } } @@ -875,7 +1464,7 @@ where } fn assoc_method(&self, p: ()) { - <Base as Trait<'b, A, B>>::assoc_method( &self.field , p) + <Base as Trait<'b, A, B>>::assoc_method(&self.field, p) } } @@ -924,6 +1513,132 @@ where } #[test] + fn test_type_bound_with_generics_1() { + check_assist( + generate_delegate_trait, + r#" +trait AnotherTrait {} +struct B<T, T1> +where + T1: AnotherTrait +{ + a: T, + b: T1 +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T, T0, T1: AnotherTrait> Trait<T> for B<T0, T1> { + fn f(&self, a: T) -> T { a } +} + +struct S<T, T1> +where + T1: AnotherTrait +{ + b : $0B<T, T1>, +}"#, + r#" +trait AnotherTrait {} +struct B<T, T1> +where + T1: AnotherTrait +{ + a: T, + b: T1 +} + +trait Trait<T> { + fn f(&self, a: T) -> T; +} + +impl<T, T0, T1: AnotherTrait> Trait<T> for B<T0, T1> { + fn f(&self, a: T) -> T { a } +} + +struct S<T, T1> +where + T1: AnotherTrait +{ + b : B<T, T1>, +} + +impl<T, T2, T10> Trait<T> for S<T2, T10> +where + T10: AnotherTrait +{ + fn f(&self, a: T) -> T { + <B<T2, T10> as Trait<T>>::f(&self.b, a) + } +}"#, + ); + } + + #[test] + fn test_type_bound_with_generics_2() { + check_assist( + generate_delegate_trait, + r#" +trait AnotherTrait {} +struct B<T1> +where + T1: AnotherTrait +{ + b: T1 +} + +trait Trait<T1> { + fn f(&self, a: T1) -> T1; +} + +impl<T, T1: AnotherTrait> Trait<T> for B<T1> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> +where + T: AnotherTrait +{ + b : $0B<T>, +}"#, + r#" +trait AnotherTrait {} +struct B<T1> +where + T1: AnotherTrait +{ + b: T1 +} + +trait Trait<T1> { + fn f(&self, a: T1) -> T1; +} + +impl<T, T1: AnotherTrait> Trait<T> for B<T1> { + fn f(&self, a: T) -> T { a } +} + +struct S<T> +where + T: AnotherTrait +{ + b : B<T>, +} + +impl<T, T0> Trait<T> for S<T0> +where + T0: AnotherTrait +{ + fn f(&self, a: T) -> T { + <B<T0> as Trait<T>>::f(&self.b, a) + } +}"#, + ); + } + + #[test] fn test_docstring_example() { check_assist( generate_delegate_trait, @@ -975,7 +1690,7 @@ impl SomeTrait for B { } fn method_(&mut self) -> bool { - <A as SomeTrait>::method_( &mut self.a ) + <A as SomeTrait>::method_(&mut self.a) } } "#, @@ -1043,7 +1758,7 @@ impl some_module::SomeTrait for B { } fn method_(&mut self) -> bool { - <some_module::A as some_module::SomeTrait>::method_( &mut self.a ) + <some_module::A as some_module::SomeTrait>::method_(&mut self.a) } }"#, ) diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_enum_variant.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_enum_variant.rs index 1a1e992e28a..2aaf9d0679d 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_enum_variant.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_enum_variant.rs @@ -114,7 +114,7 @@ fn add_variant_to_accumulator( parent: PathParent, ) -> Option<()> { let db = ctx.db(); - let InRealFile { file_id, value: enum_node } = adt.source(db)?.original_ast_node(db)?; + let InRealFile { file_id, value: enum_node } = adt.source(db)?.original_ast_node_rooted(db)?; acc.add( AssistId("generate_enum_variant", AssistKind::Generate), diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_function.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_function.rs index a113c817f7e..5bb200e84a4 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_function.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/generate_function.rs @@ -8,20 +8,21 @@ use ide_db::{ famous_defs::FamousDefs, helpers::is_editable_crate, path_transform::PathTransform, + source_change::SourceChangeBuilder, FxHashMap, FxHashSet, RootDatabase, SnippetCap, }; +use itertools::Itertools; use stdx::to_lower_snake_case; use syntax::{ ast::{ - self, - edit::{AstNodeEdit, IndentLevel}, - make, AstNode, CallExpr, HasArgList, HasGenericParams, HasModuleItem, HasTypeBounds, + self, edit::IndentLevel, edit_in_place::Indent, make, AstNode, CallExpr, HasArgList, + HasGenericParams, HasModuleItem, HasTypeBounds, }, - SyntaxKind, SyntaxNode, TextRange, TextSize, + ted, SyntaxKind, SyntaxNode, TextRange, T, }; use crate::{ - utils::{convert_reference_type, find_struct_impl, render_snippet, Cursor}, + utils::{convert_reference_type, find_struct_impl}, AssistContext, AssistId, AssistKind, Assists, }; @@ -65,7 +66,7 @@ fn gen_fn(acc: &mut Assists, ctx: &AssistContext<'_>) -> Option<()> { } let fn_name = &*name_ref.text(); - let TargetInfo { target_module, adt_name, target, file, insert_offset } = + let TargetInfo { target_module, adt_name, target, file } = fn_target_info(ctx, path, &call, fn_name)?; if let Some(m) = target_module { @@ -77,16 +78,7 @@ fn gen_fn(acc: &mut Assists, ctx: &AssistContext<'_>) -> Option<()> { let function_builder = FunctionBuilder::from_call(ctx, &call, fn_name, target_module, target)?; let text_range = call.syntax().text_range(); let label = format!("Generate {} function", function_builder.fn_name); - add_func_to_accumulator( - acc, - ctx, - text_range, - function_builder, - insert_offset, - file, - adt_name, - label, - ) + add_func_to_accumulator(acc, ctx, text_range, function_builder, file, adt_name, label) } struct TargetInfo { @@ -94,7 +86,6 @@ struct TargetInfo { adt_name: Option<hir::Name>, target: GeneratedFunctionTarget, file: FileId, - insert_offset: TextSize, } impl TargetInfo { @@ -103,9 +94,8 @@ impl TargetInfo { adt_name: Option<hir::Name>, target: GeneratedFunctionTarget, file: FileId, - insert_offset: TextSize, ) -> Self { - Self { target_module, adt_name, target, file, insert_offset } + Self { target_module, adt_name, target, file } } } @@ -156,7 +146,7 @@ fn gen_method(acc: &mut Assists, ctx: &AssistContext<'_>) -> Option<()> { } let (impl_, file) = get_adt_source(ctx, &adt, fn_name.text().as_str())?; - let (target, insert_offset) = get_method_target(ctx, &impl_, &adt)?; + let target = get_method_target(ctx, &impl_, &adt)?; let function_builder = FunctionBuilder::from_method_call( ctx, @@ -169,16 +159,7 @@ fn gen_method(acc: &mut Assists, ctx: &AssistContext<'_>) -> Option<()> { let text_range = call.syntax().text_range(); let adt_name = if impl_.is_none() { Some(adt.name(ctx.sema.db)) } else { None }; let label = format!("Generate {} method", function_builder.fn_name); - add_func_to_accumulator( - acc, - ctx, - text_range, - function_builder, - insert_offset, - file, - adt_name, - label, - ) + add_func_to_accumulator(acc, ctx, text_range, function_builder, file, adt_name, label) } fn add_func_to_accumulator( @@ -186,23 +167,28 @@ fn add_func_to_accumulator( ctx: &AssistContext<'_>, text_range: TextRange, function_builder: FunctionBuilder, - insert_offset: TextSize, file: FileId, adt_name: Option<hir::Name>, label: String, ) -> Option<()> { - acc.add(AssistId("generate_function", AssistKind::Generate), label, text_range, |builder| { - let indent = IndentLevel::from_node(function_builder.target.syntax()); - let function_template = function_builder.render(adt_name.is_some()); - let mut func = function_template.to_string(ctx.config.snippet_cap); + acc.add(AssistId("generate_function", AssistKind::Generate), label, text_range, |edit| { + edit.edit_file(file); + + let target = function_builder.target.clone(); + let function_template = function_builder.render(); + let func = function_template.to_ast(ctx.config.snippet_cap, edit); + if let Some(name) = adt_name { + let name = make::ty_path(make::ext::ident_path(&format!("{}", name.display(ctx.db())))); + // FIXME: adt may have generic params. - func = format!("\n{indent}impl {} {{\n{func}\n{indent}}}", name.display(ctx.db())); - } - builder.edit_file(file); - match ctx.config.snippet_cap { - Some(cap) => builder.insert_snippet(cap, insert_offset, func), - None => builder.insert(insert_offset, func), + let impl_ = make::impl_(None, None, name, None, None).clone_for_update(); + + func.indent(IndentLevel(1)); + impl_.get_or_create_assoc_item_list().add_item(func.into()); + target.insert_impl_at(edit, impl_); + } else { + target.insert_fn_at(edit, func); } }) } @@ -220,36 +206,33 @@ fn get_adt_source( } struct FunctionTemplate { - leading_ws: String, fn_def: ast::Fn, ret_type: Option<ast::RetType>, should_focus_return_type: bool, - trailing_ws: String, tail_expr: ast::Expr, } impl FunctionTemplate { - fn to_string(&self, cap: Option<SnippetCap>) -> String { - let Self { leading_ws, fn_def, ret_type, should_focus_return_type, trailing_ws, tail_expr } = - self; - - let f = match cap { - Some(cap) => { - let cursor = if *should_focus_return_type { - // Focus the return type if there is one - match ret_type { - Some(ret_type) => ret_type.syntax(), - None => tail_expr.syntax(), + fn to_ast(&self, cap: Option<SnippetCap>, edit: &mut SourceChangeBuilder) -> ast::Fn { + let Self { fn_def, ret_type, should_focus_return_type, tail_expr } = self; + + if let Some(cap) = cap { + if *should_focus_return_type { + // Focus the return type if there is one + match ret_type { + Some(ret_type) => { + edit.add_placeholder_snippet(cap, ret_type.clone()); } - } else { - tail_expr.syntax() - }; - render_snippet(cap, fn_def.syntax(), Cursor::Replace(cursor)) + None => { + edit.add_placeholder_snippet(cap, tail_expr.clone()); + } + } + } else { + edit.add_placeholder_snippet(cap, tail_expr.clone()); } - None => fn_def.to_string(), - }; + } - format!("{leading_ws}{f}{trailing_ws}") + fn_def.clone() } } @@ -356,7 +339,7 @@ impl FunctionBuilder { }) } - fn render(self, is_method: bool) -> FunctionTemplate { + fn render(self) -> FunctionTemplate { let placeholder_expr = make::ext::expr_todo(); let fn_body = make::block_expr(vec![], Some(placeholder_expr)); let visibility = match self.visibility { @@ -364,7 +347,7 @@ impl FunctionBuilder { Visibility::Crate => Some(make::visibility_pub_crate()), Visibility::Pub => Some(make::visibility_pub()), }; - let mut fn_def = make::fn_( + let fn_def = make::fn_( visibility, self.fn_name, self.generic_param_list, @@ -375,34 +358,10 @@ impl FunctionBuilder { self.is_async, false, // FIXME : const and unsafe are not handled yet. false, - ); - let leading_ws; - let trailing_ws; - - match self.target { - GeneratedFunctionTarget::BehindItem(it) => { - let mut indent = IndentLevel::from_node(&it); - if is_method { - indent = indent + 1; - leading_ws = format!("{indent}"); - } else { - leading_ws = format!("\n\n{indent}"); - } - - fn_def = fn_def.indent(indent); - trailing_ws = String::new(); - } - GeneratedFunctionTarget::InEmptyItemList(it) => { - let indent = IndentLevel::from_node(&it); - let leading_indent = indent + 1; - leading_ws = format!("\n{leading_indent}"); - fn_def = fn_def.indent(leading_indent); - trailing_ws = format!("\n{indent}"); - } - }; + ) + .clone_for_update(); FunctionTemplate { - leading_ws, ret_type: fn_def.ret_type(), // PANIC: we guarantee we always create a function body with a tail expr tail_expr: fn_def @@ -412,7 +371,6 @@ impl FunctionBuilder { .expect("function body should have a tail expression"), should_focus_return_type: self.should_focus_return_type, fn_def, - trailing_ws, } } } @@ -456,40 +414,37 @@ fn get_fn_target_info( target_module: Option<Module>, call: CallExpr, ) -> Option<TargetInfo> { - let (target, file, insert_offset) = get_fn_target(ctx, target_module, call)?; - Some(TargetInfo::new(target_module, None, target, file, insert_offset)) + let (target, file) = get_fn_target(ctx, target_module, call)?; + Some(TargetInfo::new(target_module, None, target, file)) } fn get_fn_target( ctx: &AssistContext<'_>, target_module: Option<Module>, call: CallExpr, -) -> Option<(GeneratedFunctionTarget, FileId, TextSize)> { +) -> Option<(GeneratedFunctionTarget, FileId)> { let mut file = ctx.file_id(); let target = match target_module { Some(target_module) => { - let module_source = target_module.definition_source(ctx.db()); - let (in_file, target) = next_space_for_fn_in_module(ctx.sema.db, &module_source)?; + let (in_file, target) = next_space_for_fn_in_module(ctx.db(), target_module); file = in_file; target } None => next_space_for_fn_after_call_site(ast::CallableExpr::Call(call))?, }; - Some((target.clone(), file, get_insert_offset(&target))) + Some((target.clone(), file)) } fn get_method_target( ctx: &AssistContext<'_>, impl_: &Option<ast::Impl>, adt: &Adt, -) -> Option<(GeneratedFunctionTarget, TextSize)> { +) -> Option<GeneratedFunctionTarget> { let target = match impl_ { - Some(impl_) => next_space_for_fn_in_impl(impl_)?, - None => { - GeneratedFunctionTarget::BehindItem(adt.source(ctx.sema.db)?.syntax().value.clone()) - } + Some(impl_) => GeneratedFunctionTarget::InImpl(impl_.clone()), + None => GeneratedFunctionTarget::AfterItem(adt.source(ctx.sema.db)?.syntax().value.clone()), }; - Some((target.clone(), get_insert_offset(&target))) + Some(target) } fn assoc_fn_target_info( @@ -505,36 +460,120 @@ fn assoc_fn_target_info( return None; } let (impl_, file) = get_adt_source(ctx, &adt, fn_name)?; - let (target, insert_offset) = get_method_target(ctx, &impl_, &adt)?; + let target = get_method_target(ctx, &impl_, &adt)?; let adt_name = if impl_.is_none() { Some(adt.name(ctx.sema.db)) } else { None }; - Some(TargetInfo::new(target_module, adt_name, target, file, insert_offset)) -} - -fn get_insert_offset(target: &GeneratedFunctionTarget) -> TextSize { - match target { - GeneratedFunctionTarget::BehindItem(it) => it.text_range().end(), - GeneratedFunctionTarget::InEmptyItemList(it) => it.text_range().start() + TextSize::of('{'), - } + Some(TargetInfo::new(target_module, adt_name, target, file)) } #[derive(Clone)] enum GeneratedFunctionTarget { - BehindItem(SyntaxNode), + AfterItem(SyntaxNode), InEmptyItemList(SyntaxNode), + InImpl(ast::Impl), } impl GeneratedFunctionTarget { fn syntax(&self) -> &SyntaxNode { match self { - GeneratedFunctionTarget::BehindItem(it) => it, + GeneratedFunctionTarget::AfterItem(it) => it, GeneratedFunctionTarget::InEmptyItemList(it) => it, + GeneratedFunctionTarget::InImpl(it) => it.syntax(), } } fn parent(&self) -> SyntaxNode { match self { - GeneratedFunctionTarget::BehindItem(it) => it.parent().expect("item without parent"), + GeneratedFunctionTarget::AfterItem(it) => it.parent().expect("item without parent"), GeneratedFunctionTarget::InEmptyItemList(it) => it.clone(), + GeneratedFunctionTarget::InImpl(it) => it.syntax().clone(), + } + } + + fn insert_impl_at(&self, edit: &mut SourceChangeBuilder, impl_: ast::Impl) { + match self { + GeneratedFunctionTarget::AfterItem(item) => { + let item = edit.make_syntax_mut(item.clone()); + let position = if item.parent().is_some() { + ted::Position::after(&item) + } else { + ted::Position::first_child_of(&item) + }; + + let indent = IndentLevel::from_node(&item); + let leading_ws = make::tokens::whitespace(&format!("\n{indent}")); + impl_.indent(indent); + + ted::insert_all(position, vec![leading_ws.into(), impl_.syntax().clone().into()]); + } + GeneratedFunctionTarget::InEmptyItemList(item_list) => { + let item_list = edit.make_syntax_mut(item_list.clone()); + let insert_after = + item_list.children_with_tokens().find_or_first(|child| child.kind() == T!['{']); + let position = match insert_after { + Some(child) => ted::Position::after(child), + None => ted::Position::first_child_of(&item_list), + }; + + let indent = IndentLevel::from_node(&item_list); + let leading_indent = indent + 1; + let leading_ws = make::tokens::whitespace(&format!("\n{leading_indent}")); + impl_.indent(indent); + + ted::insert_all(position, vec![leading_ws.into(), impl_.syntax().clone().into()]); + } + GeneratedFunctionTarget::InImpl(_) => { + unreachable!("can't insert an impl inside an impl") + } + } + } + + fn insert_fn_at(&self, edit: &mut SourceChangeBuilder, func: ast::Fn) { + match self { + GeneratedFunctionTarget::AfterItem(item) => { + let item = edit.make_syntax_mut(item.clone()); + let position = if item.parent().is_some() { + ted::Position::after(&item) + } else { + ted::Position::first_child_of(&item) + }; + + let indent = IndentLevel::from_node(&item); + let leading_ws = make::tokens::whitespace(&format!("\n\n{indent}")); + func.indent(indent); + + ted::insert_all_raw( + position, + vec![leading_ws.into(), func.syntax().clone().into()], + ); + } + GeneratedFunctionTarget::InEmptyItemList(item_list) => { + let item_list = edit.make_syntax_mut(item_list.clone()); + let insert_after = + item_list.children_with_tokens().find_or_first(|child| child.kind() == T!['{']); + let position = match insert_after { + Some(child) => ted::Position::after(child), + None => ted::Position::first_child_of(&item_list), + }; + + let indent = IndentLevel::from_node(&item_list); + let leading_indent = indent + 1; + let leading_ws = make::tokens::whitespace(&format!("\n{leading_indent}")); + let trailing_ws = make::tokens::whitespace(&format!("\n{indent}")); + func.indent(leading_indent); + + ted::insert_all( + position, + vec![leading_ws.into(), func.syntax().clone().into(), trailing_ws.into()], + ); + } + GeneratedFunctionTarget::InImpl(impl_) => { + let impl_ = edit.make_mut(impl_.clone()); + + let leading_indent = impl_.indent_level() + 1; + func.indent(leading_indent); + + impl_.get_or_create_assoc_item_list().add_item(func.into()); + } } } } @@ -1026,43 +1065,40 @@ fn next_space_for_fn_after_call_site(expr: ast::CallableExpr) -> Option<Generate } last_ancestor = Some(next_ancestor); } - last_ancestor.map(GeneratedFunctionTarget::BehindItem) + last_ancestor.map(GeneratedFunctionTarget::AfterItem) } fn next_space_for_fn_in_module( - db: &dyn hir::db::ExpandDatabase, - module_source: &hir::InFile<hir::ModuleSource>, -) -> Option<(FileId, GeneratedFunctionTarget)> { - let file = module_source.file_id.original_file(db); + db: &dyn hir::db::HirDatabase, + target_module: hir::Module, +) -> (FileId, GeneratedFunctionTarget) { + let module_source = target_module.definition_source(db); + let file = module_source.file_id.original_file(db.upcast()); let assist_item = match &module_source.value { hir::ModuleSource::SourceFile(it) => match it.items().last() { - Some(last_item) => GeneratedFunctionTarget::BehindItem(last_item.syntax().clone()), - None => GeneratedFunctionTarget::BehindItem(it.syntax().clone()), + Some(last_item) => GeneratedFunctionTarget::AfterItem(last_item.syntax().clone()), + None => GeneratedFunctionTarget::AfterItem(it.syntax().clone()), }, hir::ModuleSource::Module(it) => match it.item_list().and_then(|it| it.items().last()) { - Some(last_item) => GeneratedFunctionTarget::BehindItem(last_item.syntax().clone()), - None => GeneratedFunctionTarget::InEmptyItemList(it.item_list()?.syntax().clone()), + Some(last_item) => GeneratedFunctionTarget::AfterItem(last_item.syntax().clone()), + None => { + let item_list = + it.item_list().expect("module definition source should have an item list"); + GeneratedFunctionTarget::InEmptyItemList(item_list.syntax().clone()) + } }, hir::ModuleSource::BlockExpr(it) => { if let Some(last_item) = it.statements().take_while(|stmt| matches!(stmt, ast::Stmt::Item(_))).last() { - GeneratedFunctionTarget::BehindItem(last_item.syntax().clone()) + GeneratedFunctionTarget::AfterItem(last_item.syntax().clone()) } else { GeneratedFunctionTarget::InEmptyItemList(it.syntax().clone()) } } }; - Some((file, assist_item)) -} -fn next_space_for_fn_in_impl(impl_: &ast::Impl) -> Option<GeneratedFunctionTarget> { - let assoc_item_list = impl_.assoc_item_list()?; - if let Some(last_item) = assoc_item_list.assoc_items().last() { - Some(GeneratedFunctionTarget::BehindItem(last_item.syntax().clone())) - } else { - Some(GeneratedFunctionTarget::InEmptyItemList(assoc_item_list.syntax().clone())) - } + (file, assist_item) } #[derive(Clone, Copy)] diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/inline_call.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/inline_call.rs index 5b9cc5f66cd..2eb7089b7c3 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/inline_call.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/inline_call.rs @@ -315,17 +315,6 @@ fn inline( } else { fn_body.clone_for_update() }; - if let Some(imp) = body.syntax().ancestors().find_map(ast::Impl::cast) { - if !node.syntax().ancestors().any(|anc| &anc == imp.syntax()) { - if let Some(t) = imp.self_ty() { - body.syntax() - .descendants_with_tokens() - .filter_map(NodeOrToken::into_token) - .filter(|tok| tok.kind() == SyntaxKind::SELF_TYPE_KW) - .for_each(|tok| ted::replace(tok, t.syntax())); - } - } - } let usages_for_locals = |local| { Definition::Local(local) .usages(sema) @@ -381,6 +370,27 @@ fn inline( } } + // We should place the following code after last usage of `usages_for_locals` + // because `ted::replace` will change the offset in syntax tree, which makes + // `FileReference` incorrect + if let Some(imp) = + sema.ancestors_with_macros(fn_body.syntax().clone()).find_map(ast::Impl::cast) + { + if !node.syntax().ancestors().any(|anc| &anc == imp.syntax()) { + if let Some(t) = imp.self_ty() { + while let Some(self_tok) = body + .syntax() + .descendants_with_tokens() + .filter_map(NodeOrToken::into_token) + .find(|tok| tok.kind() == SyntaxKind::SELF_TYPE_KW) + { + let replace_with = t.clone_subtree().syntax().clone_for_update(); + ted::replace(self_tok, replace_with); + } + } + } + } + let mut func_let_vars: BTreeSet<String> = BTreeSet::new(); // grab all of the local variable declarations in the function @@ -1510,4 +1520,106 @@ fn main() { "#, ); } + + #[test] + fn inline_call_with_multiple_self_types_eq() { + check_assist( + inline_call, + r#" +#[derive(PartialEq, Eq)] +enum Enum { + A, + B, +} + +impl Enum { + fn a_or_b_eq(&self) -> bool { + self == &Self::A || self == &Self::B + } +} + +fn a() -> bool { + Enum::A.$0a_or_b_eq() +} +"#, + r#" +#[derive(PartialEq, Eq)] +enum Enum { + A, + B, +} + +impl Enum { + fn a_or_b_eq(&self) -> bool { + self == &Self::A || self == &Self::B + } +} + +fn a() -> bool { + { + let ref this = Enum::A; + this == &Enum::A || this == &Enum::B + } +} +"#, + ) + } + + #[test] + fn inline_call_with_self_type_in_macros() { + check_assist( + inline_call, + r#" +trait Trait<T1> { + fn f(a: T1) -> Self; +} + +macro_rules! impl_from { + ($t: ty) => { + impl Trait<$t> for $t { + fn f(a: $t) -> Self { + a as Self + } + } + }; +} + +struct A {} + +impl_from!(A); + +fn main() { + let a: A = A{}; + let b = <A as Trait<A>>::$0f(a); +} +"#, + r#" +trait Trait<T1> { + fn f(a: T1) -> Self; +} + +macro_rules! impl_from { + ($t: ty) => { + impl Trait<$t> for $t { + fn f(a: $t) -> Self { + a as Self + } + } + }; +} + +struct A {} + +impl_from!(A); + +fn main() { + let a: A = A{}; + let b = { + let a = a; + a as A + }; +} +"#, + ) + } } diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/introduce_named_generic.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/introduce_named_generic.rs index b0d35c02d67..b1daa7802ed 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/introduce_named_generic.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/introduce_named_generic.rs @@ -18,7 +18,7 @@ use crate::{utils::suggest_name, AssistContext, AssistId, AssistKind, Assists}; // ``` pub(crate) fn introduce_named_generic(acc: &mut Assists, ctx: &AssistContext<'_>) -> Option<()> { let impl_trait_type = ctx.find_node_at_offset::<ast::ImplTraitType>()?; - let param = impl_trait_type.syntax().parent().and_then(ast::Param::cast)?; + let param = impl_trait_type.syntax().ancestors().find_map(|node| ast::Param::cast(node))?; let fn_ = param.syntax().ancestors().find_map(ast::Fn::cast)?; let type_bound_list = impl_trait_type.type_bound_list()?; @@ -31,15 +31,16 @@ pub(crate) fn introduce_named_generic(acc: &mut Assists, ctx: &AssistContext<'_> |edit| { let impl_trait_type = edit.make_mut(impl_trait_type); let fn_ = edit.make_mut(fn_); - - let type_param_name = suggest_name::for_generic_parameter(&impl_trait_type); + let fn_generic_param_list = fn_.get_or_create_generic_param_list(); + let type_param_name = + suggest_name::for_impl_trait_as_generic(&impl_trait_type, &fn_generic_param_list); let type_param = make::type_param(make::name(&type_param_name), Some(type_bound_list)) .clone_for_update(); let new_ty = make::ty(&type_param_name).clone_for_update(); ted::replace(impl_trait_type.syntax(), new_ty.syntax()); - fn_.get_or_create_generic_param_list().add_generic_param(type_param.into()); + fn_generic_param_list.add_generic_param(type_param.into()); if let Some(cap) = ctx.config.snippet_cap { if let Some(generic_param) = @@ -111,12 +112,19 @@ fn foo<$0B: Bar #[test] fn replace_impl_trait_with_exist_generic_letter() { - // FIXME: This is wrong, we should pick a different name if the one we - // want is already bound. check_assist( introduce_named_generic, r#"fn foo<B>(bar: $0impl Bar) {}"#, - r#"fn foo<B, $0B: Bar>(bar: B) {}"#, + r#"fn foo<B, $0B0: Bar>(bar: B0) {}"#, + ); + } + + #[test] + fn replace_impl_trait_with_more_exist_generic_letter() { + check_assist( + introduce_named_generic, + r#"fn foo<B, B0, B1, B3>(bar: $0impl Bar) {}"#, + r#"fn foo<B, B0, B1, B3, $0B2: Bar>(bar: B2) {}"#, ); } @@ -149,4 +157,22 @@ fn foo< r#"fn foo<$0F: Foo + Bar>(bar: F) {}"#, ); } + + #[test] + fn replace_impl_with_mut() { + check_assist( + introduce_named_generic, + r#"fn f(iter: &mut $0impl Iterator<Item = i32>) {}"#, + r#"fn f<$0I: Iterator<Item = i32>>(iter: &mut I) {}"#, + ); + } + + #[test] + fn replace_impl_inside() { + check_assist( + introduce_named_generic, + r#"fn f(x: &mut Vec<$0impl Iterator<Item = i32>>) {}"#, + r#"fn f<$0I: Iterator<Item = i32>>(x: &mut Vec<I>) {}"#, + ); + } } diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/promote_local_to_const.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/promote_local_to_const.rs index 6ed9bd85fcc..67fea772c79 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/promote_local_to_const.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/promote_local_to_const.rs @@ -11,7 +11,10 @@ use syntax::{ ted, AstNode, WalkEvent, }; -use crate::assist_context::{AssistContext, Assists}; +use crate::{ + assist_context::{AssistContext, Assists}, + utils, +}; // Assist: promote_local_to_const // @@ -79,15 +82,13 @@ pub(crate) fn promote_local_to_const(acc: &mut Assists, ctx: &AssistContext<'_>) let name_ref = make::name_ref(&name); for usage in usages { - let Some(usage) = usage.name.as_name_ref().cloned() else { continue }; - if let Some(record_field) = ast::RecordExprField::for_name_ref(&usage) { - let record_field = edit.make_mut(record_field); - let name_expr = - make::expr_path(make::path_from_text(&name)).clone_for_update(); - record_field.replace_expr(name_expr); + let Some(usage_name) = usage.name.as_name_ref().cloned() else { continue }; + if let Some(record_field) = ast::RecordExprField::for_name_ref(&usage_name) { + let name_expr = make::expr_path(make::path_from_text(&name)); + utils::replace_record_field_expr(ctx, edit, record_field, name_expr); } else { - let usage = edit.make_mut(usage); - ted::replace(usage.syntax(), name_ref.clone_for_update().syntax()); + let usage_range = usage.range; + edit.replace(usage_range, name_ref.syntax().text()); } } } @@ -213,6 +214,76 @@ fn main() { } #[test] + fn usage_in_macro() { + check_assist( + promote_local_to_const, + r" +macro_rules! identity { + ($body:expr) => { + $body + } +} + +fn baz() -> usize { + let $0foo = 2; + identity![foo] +} +", + r" +macro_rules! identity { + ($body:expr) => { + $body + } +} + +fn baz() -> usize { + const $0FOO: usize = 2; + identity![FOO] +} +", + ) + } + + #[test] + fn usage_shorthand_in_macro() { + check_assist( + promote_local_to_const, + r" +struct Foo { + foo: usize, +} + +macro_rules! identity { + ($body:expr) => { + $body + }; +} + +fn baz() -> Foo { + let $0foo = 2; + identity![Foo { foo }] +} +", + r" +struct Foo { + foo: usize, +} + +macro_rules! identity { + ($body:expr) => { + $body + }; +} + +fn baz() -> Foo { + const $0FOO: usize = 2; + identity![Foo { foo: FOO }] +} +", + ) + } + + #[test] fn not_applicable_non_const_meth_call() { cov_mark::check!(promote_local_non_const); check_assist_not_applicable( diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/remove_unused_imports.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/remove_unused_imports.rs index ee44064e7c5..859ed1476c4 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/remove_unused_imports.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/remove_unused_imports.rs @@ -423,7 +423,7 @@ mod z { struct X(); struct Y(); mod z { - use super::{X}; + use super::X; fn w() { let x = X(); @@ -495,7 +495,7 @@ struct X(); mod y { struct Y(); mod z { - use crate::{X}; + use crate::X; fn f() { let x = X(); } @@ -526,7 +526,7 @@ struct X(); mod y { struct Y(); mod z { - use crate::{y::Y}; + use crate::y::Y; fn f() { let y = Y(); } @@ -537,6 +537,184 @@ mod y { } #[test] + fn remove_unused_auto_remove_brace_nested() { + check_assist( + remove_unused_imports, + r#" +mod a { + pub struct A(); +} +mod b { + struct F(); + mod c { + $0use {{super::{{ + {d::{{{{{{{S, U}}}}}}}}, + {{{{e::{H, L, {{{R}}}}}}}}, + F, super::a::A + }}}};$0 + fn f() { + let f = F(); + let l = L(); + let a = A(); + let s = S(); + let h = H(); + } + } + + mod d { + pub struct S(); + pub struct U(); + } + + mod e { + pub struct H(); + pub struct L(); + pub struct R(); + } +} +"#, + r#" +mod a { + pub struct A(); +} +mod b { + struct F(); + mod c { + use super::{ + d::S, + e::{H, L}, + F, super::a::A + }; + fn f() { + let f = F(); + let l = L(); + let a = A(); + let s = S(); + let h = H(); + } + } + + mod d { + pub struct S(); + pub struct U(); + } + + mod e { + pub struct H(); + pub struct L(); + pub struct R(); + } +} +"#, + ); + } + + #[test] + fn remove_comma_after_auto_remove_brace() { + check_assist( + remove_unused_imports, + r#" +mod m { + pub mod x { + pub struct A; + pub struct B; + } + pub mod y { + pub struct C; + } +} + +$0use m::{ + x::{A, B}, + y::C, +};$0 + +fn main() { + B; +} +"#, + r#" +mod m { + pub mod x { + pub struct A; + pub struct B; + } + pub mod y { + pub struct C; + } +} + +use m:: + x::B +; + +fn main() { + B; +} +"#, + ); + check_assist( + remove_unused_imports, + r#" +mod m { + pub mod x { + pub struct A; + pub struct B; + } + pub mod y { + pub struct C; + pub struct D; + } + pub mod z { + pub struct E; + pub struct F; + } +} + +$0use m::{ + x::{A, B}, + y::{C, D,}, + z::{E, F}, +};$0 + +fn main() { + B; + C; + F; +} +"#, + r#" +mod m { + pub mod x { + pub struct A; + pub struct B; + } + pub mod y { + pub struct C; + pub struct D; + } + pub mod z { + pub struct E; + pub struct F; + } +} + +use m::{ + x::B, + y::C, + z::F, +}; + +fn main() { + B; + C; + F; +} +"#, + ); + } + + #[test] fn remove_nested_all_unused() { check_assist( remove_unused_imports, diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/replace_is_method_with_if_let_method.rs b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/replace_is_method_with_if_let_method.rs index b1daaea1ed1..09759019baa 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/handlers/replace_is_method_with_if_let_method.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/handlers/replace_is_method_with_if_let_method.rs @@ -1,4 +1,7 @@ -use syntax::ast::{self, AstNode}; +use syntax::{ + ast::{self, make, AstNode}, + ted, +}; use crate::{utils::suggest_name, AssistContext, AssistId, AssistKind, Assists}; @@ -42,19 +45,34 @@ pub(crate) fn replace_is_method_with_if_let_method( suggest_name::for_variable(&receiver, &ctx.sema) }; - let target = call_expr.syntax().text_range(); - let (assist_id, message, text) = if name_ref.text() == "is_some" { ("replace_is_some_with_if_let_some", "Replace `is_some` with `if let Some`", "Some") } else { ("replace_is_ok_with_if_let_ok", "Replace `is_ok` with `if let Ok`", "Ok") }; - acc.add(AssistId(assist_id, AssistKind::RefactorRewrite), message, target, |edit| { - let var_name = format!("${{0:{}}}", var_name); - let replacement = format!("let {}({}) = {}", text, var_name, receiver); - edit.replace(target, replacement); - }) + acc.add( + AssistId(assist_id, AssistKind::RefactorRewrite), + message, + call_expr.syntax().text_range(), + |edit| { + let call_expr = edit.make_mut(call_expr); + + let var_pat = make::ident_pat(false, false, make::name(&var_name)); + let pat = make::tuple_struct_pat(make::ext::ident_path(text), [var_pat.into()]); + let let_expr = make::expr_let(pat.into(), receiver).clone_for_update(); + + if let Some(cap) = ctx.config.snippet_cap { + if let Some(ast::Pat::TupleStructPat(pat)) = let_expr.pat() { + if let Some(first_var) = pat.fields().next() { + edit.add_placeholder_snippet(cap, first_var); + } + } + } + + ted::replace(call_expr.syntax(), let_expr.syntax()); + }, + ) } _ => return None, } diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/tests.rs b/src/tools/rust-analyzer/crates/ide-assists/src/tests.rs index 25b3d6d9da9..95b9eb52948 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/tests.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/tests.rs @@ -5,13 +5,14 @@ mod sourcegen; use expect_test::expect; use hir::Semantics; use ide_db::{ - base_db::{fixture::WithFixture, FileId, FileRange, SourceDatabaseExt}, + base_db::{FileId, FileRange, SourceDatabaseExt}, imports::insert_use::{ImportGranularity, InsertUseConfig}, source_change::FileSystemEdit, RootDatabase, SnippetCap, }; use stdx::{format_to, trim_indent}; use syntax::TextRange; +use test_fixture::WithFixture; use test_utils::{assert_eq_text, extract_offset}; use crate::{ @@ -504,16 +505,33 @@ pub fn test_some_range(a: int) -> bool { TextEdit { indels: [ Indel { - insert: "let $0var_name = 5;\n ", - delete: 45..45, + insert: "let", + delete: 45..47, }, Indel { insert: "var_name", - delete: 59..60, + delete: 48..60, + }, + Indel { + insert: "=", + delete: 61..81, + }, + Indel { + insert: "5;\n if let 2..6 = var_name {\n true\n } else {\n false\n }", + delete: 82..108, }, ], }, - None, + Some( + SnippetEdit( + [ + ( + 0, + 49..49, + ), + ], + ), + ), ), }, file_system_edits: [], @@ -566,16 +584,33 @@ pub fn test_some_range(a: int) -> bool { TextEdit { indels: [ Indel { - insert: "let $0var_name = 5;\n ", - delete: 45..45, + insert: "let", + delete: 45..47, }, Indel { insert: "var_name", - delete: 59..60, + delete: 48..60, + }, + Indel { + insert: "=", + delete: 61..81, + }, + Indel { + insert: "5;\n if let 2..6 = var_name {\n true\n } else {\n false\n }", + delete: 82..108, }, ], }, - None, + Some( + SnippetEdit( + [ + ( + 0, + 49..49, + ), + ], + ), + ), ), }, file_system_edits: [], diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/tests/generated.rs b/src/tools/rust-analyzer/crates/ide-assists/src/tests/generated.rs index da5822bba9c..0c2331796f9 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/tests/generated.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/tests/generated.rs @@ -1153,7 +1153,7 @@ impl SomeTrait for B { } fn method_(&mut self) -> bool { - <A as SomeTrait>::method_( &mut self.a ) + <A as SomeTrait>::method_(&mut self.a) } } "#####, diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/utils.rs b/src/tools/rust-analyzer/crates/ide-assists/src/utils.rs index f51e99a914e..927a8e3c19a 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/utils.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/utils.rs @@ -813,3 +813,21 @@ fn test_required_hashes() { assert_eq!(3, required_hashes("#ab\"##c")); assert_eq!(5, required_hashes("#ab\"##\"####c")); } + +/// Replaces the record expression, handling field shorthands including inside macros. +pub(crate) fn replace_record_field_expr( + ctx: &AssistContext<'_>, + edit: &mut SourceChangeBuilder, + record_field: ast::RecordExprField, + initializer: ast::Expr, +) { + if let Some(ast::Expr::PathExpr(path_expr)) = record_field.expr() { + // replace field shorthand + let file_range = ctx.sema.original_range(path_expr.syntax()); + edit.insert(file_range.range.end(), format!(": {}", initializer.syntax().text())) + } else if let Some(expr) = record_field.expr() { + // just replace expr + let file_range = ctx.sema.original_range(expr.syntax()); + edit.replace(file_range.range, initializer.syntax().text()); + } +} diff --git a/src/tools/rust-analyzer/crates/ide-assists/src/utils/suggest_name.rs b/src/tools/rust-analyzer/crates/ide-assists/src/utils/suggest_name.rs index 16704d598ef..b4c6cbff2a4 100644 --- a/src/tools/rust-analyzer/crates/ide-assists/src/utils/suggest_name.rs +++ b/src/tools/rust-analyzer/crates/ide-assists/src/utils/suggest_name.rs @@ -1,5 +1,7 @@ //! This module contains functions to suggest names for expressions, functions and other items +use std::collections::HashSet; + use hir::Semantics; use ide_db::RootDatabase; use itertools::Itertools; @@ -58,12 +60,59 @@ const USELESS_METHODS: &[&str] = &[ "into_future", ]; -pub(crate) fn for_generic_parameter(ty: &ast::ImplTraitType) -> SmolStr { +/// Suggest a unique name for generic parameter. +/// +/// `existing_params` is used to check if the name conflicts with existing +/// generic parameters. +/// +/// The function checks if the name conflicts with existing generic parameters. +/// If so, it will try to resolve the conflict by adding a number suffix, e.g. +/// `T`, `T0`, `T1`, ... +pub(crate) fn for_unique_generic_name( + name: &str, + existing_params: &ast::GenericParamList, +) -> SmolStr { + let param_names = existing_params + .generic_params() + .map(|param| match param { + ast::GenericParam::TypeParam(t) => t.name().unwrap().to_string(), + p => p.to_string(), + }) + .collect::<HashSet<_>>(); + let mut name = name.to_string(); + let base_len = name.len(); + let mut count = 0; + while param_names.contains(&name) { + name.truncate(base_len); + name.push_str(&count.to_string()); + count += 1; + } + + name.into() +} + +/// Suggest name of impl trait type +/// +/// `existing_params` is used to check if the name conflicts with existing +/// generic parameters. +/// +/// # Current implementation +/// +/// In current implementation, the function tries to get the name from the first +/// character of the name for the first type bound. +/// +/// If the name conflicts with existing generic parameters, it will try to +/// resolve the conflict with `for_unique_generic_name`. +pub(crate) fn for_impl_trait_as_generic( + ty: &ast::ImplTraitType, + existing_params: &ast::GenericParamList, +) -> SmolStr { let c = ty .type_bound_list() .and_then(|bounds| bounds.syntax().text().char_at(0.into())) .unwrap_or('T'); - c.encode_utf8(&mut [0; 4]).into() + + for_unique_generic_name(c.encode_utf8(&mut [0; 4]), existing_params) } /// Suggest name of variable for given expression @@ -275,7 +324,8 @@ fn from_field_name(expr: &ast::Expr) -> Option<String> { #[cfg(test)] mod tests { - use ide_db::base_db::{fixture::WithFixture, FileRange}; + use ide_db::base_db::FileRange; + use test_fixture::WithFixture; use super::*; diff --git a/src/tools/rust-analyzer/crates/ide-completion/Cargo.toml b/src/tools/rust-analyzer/crates/ide-completion/Cargo.toml index 60f90a41b96..7fbcf3d19e0 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/Cargo.toml +++ b/src/tools/rust-analyzer/crates/ide-completion/Cargo.toml @@ -35,3 +35,7 @@ expect-test = "1.4.0" # local deps test-utils.workspace = true +test-fixture.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute.rs b/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute.rs index 466f0b1fb7f..9155caa2e0b 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute.rs @@ -26,6 +26,7 @@ mod cfg; mod derive; mod lint; mod repr; +mod macro_use; pub(crate) use self::derive::complete_derive_path; @@ -35,6 +36,7 @@ pub(crate) fn complete_known_attribute_input( ctx: &CompletionContext<'_>, &colon_prefix: &bool, fake_attribute_under_caret: &ast::Attr, + extern_crate: Option<&ast::ExternCrate>, ) -> Option<()> { let attribute = fake_attribute_under_caret; let name_ref = match attribute.path() { @@ -66,6 +68,9 @@ pub(crate) fn complete_known_attribute_input( lint::complete_lint(acc, ctx, colon_prefix, &existing_lints, &lints); } "cfg" => cfg::complete_cfg(acc, ctx), + "macro_use" => { + macro_use::complete_macro_use(acc, ctx, extern_crate, &parse_tt_as_comma_sep_paths(tt)?) + } _ => (), } Some(()) diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute/macro_use.rs b/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute/macro_use.rs new file mode 100644 index 00000000000..f45f9cba258 --- /dev/null +++ b/src/tools/rust-analyzer/crates/ide-completion/src/completions/attribute/macro_use.rs @@ -0,0 +1,35 @@ +//! Completion for macros in `#[macro_use(...)]` +use hir::ModuleDef; +use ide_db::SymbolKind; +use syntax::ast; + +use crate::{context::CompletionContext, item::CompletionItem, Completions}; + +pub(super) fn complete_macro_use( + acc: &mut Completions, + ctx: &CompletionContext<'_>, + extern_crate: Option<&ast::ExternCrate>, + existing_imports: &[ast::Path], +) { + let Some(extern_crate) = extern_crate else { return }; + let Some(extern_crate) = ctx.sema.to_def(extern_crate) else { return }; + let Some(krate) = extern_crate.resolved_crate(ctx.db) else { return }; + + for mod_def in krate.root_module().declarations(ctx.db) { + if let ModuleDef::Macro(mac) = mod_def { + let mac_name = mac.name(ctx.db); + let Some(mac_name) = mac_name.as_str() else { continue }; + + let existing_import = existing_imports + .iter() + .filter_map(|p| p.as_single_name_ref()) + .find(|n| n.text() == mac_name); + if existing_import.is_some() { + continue; + } + + let item = CompletionItem::new(SymbolKind::Macro, ctx.source_range(), mac_name); + item.add_to(acc, ctx.db); + } + } +} diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/completions/dot.rs b/src/tools/rust-analyzer/crates/ide-completion/src/completions/dot.rs index 613a35dcb10..53a1c8405c2 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/completions/dot.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/completions/dot.rs @@ -27,6 +27,8 @@ pub(crate) fn complete_dot( } let is_field_access = matches!(dot_access.kind, DotAccessKind::Field { .. }); + let is_method_acces_with_parens = + matches!(dot_access.kind, DotAccessKind::Method { has_parens: true }); complete_fields( acc, @@ -35,6 +37,7 @@ pub(crate) fn complete_dot( |acc, field, ty| acc.add_field(ctx, dot_access, None, field, &ty), |acc, field, ty| acc.add_tuple_field(ctx, None, field, &ty), is_field_access, + is_method_acces_with_parens, ); complete_methods(ctx, receiver_ty, |func| acc.add_method(ctx, dot_access, func, None, None)); @@ -83,6 +86,7 @@ pub(crate) fn complete_undotted_self( }, |acc, field, ty| acc.add_tuple_field(ctx, Some(hir::known::SELF_PARAM), field, &ty), true, + false, ); complete_methods(ctx, &ty, |func| { acc.add_method( @@ -106,12 +110,14 @@ fn complete_fields( mut named_field: impl FnMut(&mut Completions, hir::Field, hir::Type), mut tuple_index: impl FnMut(&mut Completions, usize, hir::Type), is_field_access: bool, + is_method_acess_with_parens: bool, ) { let mut seen_names = FxHashSet::default(); for receiver in receiver.autoderef(ctx.db) { for (field, ty) in receiver.fields(ctx.db) { if seen_names.insert(field.name(ctx.db)) - && (is_field_access || ty.is_fn() || ty.is_closure()) + && (is_field_access + || (is_method_acess_with_parens && (ty.is_fn() || ty.is_closure()))) { named_field(acc, field, ty); } @@ -120,7 +126,8 @@ fn complete_fields( // Tuples are always the last type in a deref chain, so just check if the name is // already seen without inserting into the hashset. if !seen_names.contains(&hir::Name::new_tuple_field(i)) - && (is_field_access || ty.is_fn() || ty.is_closure()) + && (is_field_access + || (is_method_acess_with_parens && (ty.is_fn() || ty.is_closure()))) { // Tuple fields are always public (tuple struct fields are handled above). tuple_index(acc, i, ty); @@ -1236,4 +1243,24 @@ fn foo() { "#, ) } + + #[test] + fn test_fn_field_dot_access_method_has_parens_false() { + check( + r#" +struct Foo { baz: fn() } +impl Foo { + fn bar<T>(self, t: T): T { t } +} + +fn baz() { + let foo = Foo{ baz: || {} }; + foo.ba$0::<>; +} +"#, + expect![[r#" + me bar(…) fn(self, T) + "#]], + ); + } } diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/context.rs b/src/tools/rust-analyzer/crates/ide-completion/src/context.rs index 0da7ba6d000..108b040de6b 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/context.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/context.rs @@ -371,6 +371,7 @@ pub(super) enum CompletionAnalysis { UnexpandedAttrTT { colon_prefix: bool, fake_attribute_under_caret: Option<ast::Attr>, + extern_crate: Option<ast::ExternCrate>, }, } @@ -693,7 +694,7 @@ impl<'a> CompletionContext<'a> { let krate = scope.krate(); let module = scope.module(); - let toolchain = db.crate_graph()[krate.into()].channel; + let toolchain = db.crate_graph()[krate.into()].channel(); // `toolchain == None` means we're in some detached files. Since we have no information on // the toolchain being used, let's just allow unstable items to be listed. let is_nightly = matches!(toolchain, Some(base_db::ReleaseChannel::Nightly) | None); diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/context/analysis.rs b/src/tools/rust-analyzer/crates/ide-completion/src/context/analysis.rs index 1e6b2f319aa..7da66483657 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/context/analysis.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/context/analysis.rs @@ -1,7 +1,7 @@ //! Module responsible for analyzing the code surrounding the cursor for completion. use std::iter; -use hir::{HasSource, Semantics, Type, TypeInfo, Variant}; +use hir::{Semantics, Type, TypeInfo, Variant}; use ide_db::{active_parameter::ActiveParameter, RootDatabase}; use syntax::{ algo::{find_node_at_offset, non_trivia_sibling}, @@ -254,11 +254,13 @@ fn analyze( { let colon_prefix = previous_non_trivia_token(self_token.clone()) .map_or(false, |it| T![:] == it.kind()); + CompletionAnalysis::UnexpandedAttrTT { fake_attribute_under_caret: fake_ident_token .parent_ancestors() .find_map(ast::Attr::cast), colon_prefix, + extern_crate: p.ancestors().find_map(ast::ExternCrate::cast), } } else { return None; @@ -359,7 +361,12 @@ fn expected_type_and_name( let ty = it.pat() .and_then(|pat| sema.type_of_pat(&pat)) .or_else(|| it.initializer().and_then(|it| sema.type_of_expr(&it))) - .map(TypeInfo::original); + .map(TypeInfo::original) + .filter(|ty| { + // don't infer the let type if the expr is a function, + // preventing parenthesis from vanishing + it.ty().is_some() || !ty.is_fn() + }); let name = match it.pat() { Some(ast::Pat::IdentPat(ident)) => ident.name().map(NameOrNameRef::Name), Some(_) | None => None, @@ -413,20 +420,16 @@ fn expected_type_and_name( })().unwrap_or((None, None)) }, ast::RecordExprField(it) => { + let field_ty = sema.resolve_record_field(&it).map(|(_, _, ty)| ty); + let field_name = it.field_name().map(NameOrNameRef::NameRef); if let Some(expr) = it.expr() { cov_mark::hit!(expected_type_struct_field_with_leading_char); - ( - sema.type_of_expr(&expr).map(TypeInfo::original), - it.field_name().map(NameOrNameRef::NameRef), - ) + let ty = field_ty + .or_else(|| sema.type_of_expr(&expr).map(TypeInfo::original)); + (ty, field_name) } else { cov_mark::hit!(expected_type_struct_field_followed_by_comma); - let ty = sema.resolve_record_field(&it) - .map(|(_, _, ty)| ty); - ( - ty, - it.field_name().map(NameOrNameRef::NameRef), - ) + (field_ty, field_name) } }, // match foo { $0 } @@ -740,13 +743,13 @@ fn classify_name_ref( match sema.resolve_path(&segment.parent_path().top_path())? { hir::PathResolution::Def(def) => match def { hir::ModuleDef::Function(func) => { - func.source(sema.db)?.value.generic_param_list() + sema.source(func)?.value.generic_param_list() } hir::ModuleDef::Adt(adt) => { - adt.source(sema.db)?.value.generic_param_list() + sema.source(adt)?.value.generic_param_list() } hir::ModuleDef::Variant(variant) => { - variant.parent_enum(sema.db).source(sema.db)?.value.generic_param_list() + sema.source(variant.parent_enum(sema.db))?.value.generic_param_list() } hir::ModuleDef::Trait(trait_) => { if let ast::GenericArg::AssocTypeArg(arg) = &arg { @@ -772,14 +775,14 @@ fn classify_name_ref( return None; } else { in_trait = Some(trait_); - trait_.source(sema.db)?.value.generic_param_list() + sema.source(trait_)?.value.generic_param_list() } } hir::ModuleDef::TraitAlias(trait_) => { - trait_.source(sema.db)?.value.generic_param_list() + sema.source(trait_)?.value.generic_param_list() } hir::ModuleDef::TypeAlias(ty_) => { - ty_.source(sema.db)?.value.generic_param_list() + sema.source(ty_)?.value.generic_param_list() } _ => None, }, @@ -788,7 +791,7 @@ fn classify_name_ref( }, ast::MethodCallExpr(call) => { let func = sema.resolve_method_call(&call)?; - func.source(sema.db)?.value.generic_param_list() + sema.source(func)?.value.generic_param_list() }, ast::AssocTypeArg(arg) => { let trait_ = ast::PathSegment::cast(arg.syntax().parent()?.parent()?)?; @@ -805,7 +808,7 @@ fn classify_name_ref( }, _ => None, })?; - assoc_ty.source(sema.db)?.value.generic_param_list() + sema.source(*assoc_ty)?.value.generic_param_list() } _ => None, }, diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/lib.rs b/src/tools/rust-analyzer/crates/ide-completion/src/lib.rs index 37a2828e8dc..ff324e7a56d 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/lib.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/lib.rs @@ -211,12 +211,14 @@ pub fn completions( CompletionAnalysis::UnexpandedAttrTT { colon_prefix, fake_attribute_under_caret: Some(attr), + extern_crate, } => { completions::attribute::complete_known_attribute_input( acc, ctx, colon_prefix, attr, + extern_crate.as_ref(), ); } CompletionAnalysis::UnexpandedAttrTT { .. } | CompletionAnalysis::String { .. } => (), diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/render.rs b/src/tools/rust-analyzer/crates/ide-completion/src/render.rs index 2ea3f74d18b..581d557e831 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/render.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/render.rs @@ -837,11 +837,11 @@ fn main() { } "#, expect![[r#" - fn main [] - fn test [] + fn main() [] + fn test(…) [] md dep [] fn function (use dep::test_mod_a::function) [requires_import] - fn function (use dep::test_mod_b::function) [requires_import] + fn function(…) (use dep::test_mod_b::function) [requires_import] "#]], ); } diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/render/function.rs b/src/tools/rust-analyzer/crates/ide-completion/src/render/function.rs index d23ed71fdcc..b306bede653 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/render/function.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/render/function.rs @@ -305,12 +305,15 @@ fn params( return None; } - // Don't add parentheses if the expected type is some function reference. - if let Some(ty) = &ctx.expected_type { - // FIXME: check signature matches? - if ty.is_fn() { - cov_mark::hit!(no_call_parens_if_fn_ptr_needed); - return None; + // Don't add parentheses if the expected type is a function reference with the same signature. + if let Some(expected) = ctx.expected_type.as_ref().filter(|e| e.is_fn()) { + if let Some(expected) = expected.as_callable(ctx.db) { + if let Some(completed) = func.ty(ctx.db).as_callable(ctx.db) { + if expected.sig() == completed.sig() { + cov_mark::hit!(no_call_parens_if_fn_ptr_needed); + return None; + } + } } } diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/tests.rs b/src/tools/rust-analyzer/crates/ide-completion/src/tests.rs index f28afacc586..f13754e2ded 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/tests.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/tests.rs @@ -26,12 +26,13 @@ mod visibility; use expect_test::Expect; use hir::PrefixKind; use ide_db::{ - base_db::{fixture::ChangeFixture, FileLoader, FilePosition}, + base_db::{FileLoader, FilePosition}, imports::insert_use::{ImportGranularity, InsertUseConfig}, RootDatabase, SnippetCap, }; use itertools::Itertools; use stdx::{format_to, trim_indent}; +use test_fixture::ChangeFixture; use test_utils::assert_eq_text; use crate::{ diff --git a/src/tools/rust-analyzer/crates/ide-completion/src/tests/attribute.rs b/src/tools/rust-analyzer/crates/ide-completion/src/tests/attribute.rs index d8c134c533b..351abe9850b 100644 --- a/src/tools/rust-analyzer/crates/ide-completion/src/tests/attribute.rs +++ b/src/tools/rust-analyzer/crates/ide-completion/src/tests/attribute.rs @@ -1067,3 +1067,82 @@ mod repr { ); } } + +mod macro_use { + use super::*; + + #[test] + fn completes_macros() { + check( + r#" +//- /dep.rs crate:dep +#[macro_export] +macro_rules! foo { + () => {}; +} + +#[macro_export] +macro_rules! bar { + () => {}; +} + +//- /main.rs crate:main deps:dep +#[macro_use($0)] +extern crate dep; +"#, + expect![[r#" + ma bar + ma foo + "#]], + ) + } + + #[test] + fn only_completes_exported_macros() { + check( + r#" +//- /dep.rs crate:dep +#[macro_export] +macro_rules! foo { + () => {}; +} + +macro_rules! bar { + () => {}; +} + +//- /main.rs crate:main deps:dep +#[macro_use($0)] +extern crate dep; +"#, + expect![[r#" + ma foo + "#]], + ) + } + + #[test] + fn does_not_completes_already_imported_macros() { + check( + r#" +//- /dep.rs crate:dep +#[macro_export] +macro_rules! foo { + () => {}; +} + +#[macro_export] +macro_rules! bar { + () => {}; +} + +//- /main.rs crate:main deps:dep +#[macro_use(foo, $0)] +extern crate dep; +"#, + expect![[r#" + ma bar + "#]], + ) + } +} diff --git a/src/tools/rust-analyzer/crates/ide-db/Cargo.toml b/src/tools/rust-analyzer/crates/ide-db/Cargo.toml index 4a2e770f193..f14d9ed1b93 100644 --- a/src/tools/rust-analyzer/crates/ide-db/Cargo.toml +++ b/src/tools/rust-analyzer/crates/ide-db/Cargo.toml @@ -16,11 +16,11 @@ cov-mark = "2.0.0-pre.1" tracing.workspace = true rayon.workspace = true fst = { version = "0.4.7", default-features = false } -rustc-hash = "1.1.0" +rustc-hash.workspace = true once_cell = "1.17.0" either.workspace = true itertools.workspace = true -arrayvec = "0.7.2" +arrayvec.workspace = true indexmap.workspace = true memchr = "2.6.4" triomphe.workspace = true @@ -34,6 +34,7 @@ profile.workspace = true stdx.workspace = true syntax.workspace = true text-edit.workspace = true +span.workspace = true # ide should depend only on the top-level `hir` package. if you need # something from some `hir-xxx` subpackage, reexport the API via `hir`. hir.workspace = true @@ -47,4 +48,8 @@ xshell.workspace = true # local deps test-utils.workspace = true +test-fixture.workspace = true sourcegen.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/ide-db/src/apply_change.rs b/src/tools/rust-analyzer/crates/ide-db/src/apply_change.rs index 343be870c9e..db6cd128e83 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/apply_change.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/apply_change.rs @@ -5,13 +5,13 @@ use base_db::{ debug::{DebugQueryTable, TableEntry}, Database, Durability, Query, QueryTable, }, - Change, SourceRootId, + SourceRootId, }; use profile::{memory_usage, Bytes}; use rustc_hash::FxHashSet; use triomphe::Arc; -use crate::{symbol_index::SymbolsDatabase, RootDatabase}; +use crate::{symbol_index::SymbolsDatabase, Change, RootDatabase}; impl RootDatabase { pub fn request_cancellation(&mut self) { @@ -23,7 +23,7 @@ impl RootDatabase { let _p = profile::span("RootDatabase::apply_change"); self.request_cancellation(); tracing::trace!("apply_change {:?}", change); - if let Some(roots) = &change.roots { + if let Some(roots) = &change.source_change.roots { let mut local_roots = FxHashSet::default(); let mut library_roots = FxHashSet::default(); for (idx, root) in roots.iter().enumerate() { @@ -87,7 +87,6 @@ impl RootDatabase { // SourceDatabase base_db::ParseQuery base_db::CrateGraphQuery - base_db::ProcMacrosQuery // SourceDatabaseExt base_db::FileTextQuery @@ -104,6 +103,7 @@ impl RootDatabase { hir::db::MacroArgQuery hir::db::ParseMacroExpansionQuery hir::db::RealSpanMapQuery + hir::db::ProcMacrosQuery // DefDatabase hir::db::FileItemTreeQuery diff --git a/src/tools/rust-analyzer/crates/ide-db/src/documentation.rs b/src/tools/rust-analyzer/crates/ide-db/src/documentation.rs index 26f3cd28a27..cc8e8431708 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/documentation.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/documentation.rs @@ -138,15 +138,13 @@ pub fn docs_from_attrs(attrs: &hir::Attrs) -> Option<String> { for doc in docs { // str::lines doesn't yield anything for the empty string if !doc.is_empty() { - buf.extend(Itertools::intersperse( - doc.lines().map(|line| { - line.char_indices() - .nth(indent) - .map_or(line, |(offset, _)| &line[offset..]) - .trim_end() - }), - "\n", - )); + // We don't trim trailing whitespace from doc comments as multiple trailing spaces + // indicates a hard line break in Markdown. + let lines = doc.lines().map(|line| { + line.char_indices().nth(indent).map_or(line, |(offset, _)| &line[offset..]) + }); + + buf.extend(Itertools::intersperse(lines, "\n")); } buf.push('\n'); } diff --git a/src/tools/rust-analyzer/crates/ide-db/src/imports/insert_use/tests.rs b/src/tools/rust-analyzer/crates/ide-db/src/imports/insert_use/tests.rs index 01d2f1970c3..a3abce89642 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/imports/insert_use/tests.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/imports/insert_use/tests.rs @@ -1,6 +1,6 @@ -use base_db::fixture::WithFixture; use hir::PrefixKind; use stdx::trim_indent; +use test_fixture::WithFixture; use test_utils::{assert_eq_text, CURSOR_MARKER}; use super::*; diff --git a/src/tools/rust-analyzer/crates/ide-db/src/lib.rs b/src/tools/rust-analyzer/crates/ide-db/src/lib.rs index fefc05e5355..128971994f6 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/lib.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/lib.rs @@ -43,6 +43,8 @@ pub mod syntax_helpers { pub use parser::LexedStr; } +pub use hir::Change; + use std::{fmt, mem::ManuallyDrop}; use base_db::{ diff --git a/src/tools/rust-analyzer/crates/ide-db/src/path_transform.rs b/src/tools/rust-analyzer/crates/ide-db/src/path_transform.rs index fb4c0c12691..8c1a6e6e40b 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/path_transform.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/path_transform.rs @@ -82,6 +82,34 @@ impl<'a> PathTransform<'a> { } } + pub fn impl_transformation( + target_scope: &'a SemanticsScope<'a>, + source_scope: &'a SemanticsScope<'a>, + impl_: hir::Impl, + generic_arg_list: ast::GenericArgList, + ) -> PathTransform<'a> { + PathTransform { + source_scope, + target_scope, + generic_def: Some(impl_.into()), + substs: get_type_args_from_arg_list(generic_arg_list).unwrap_or_default(), + } + } + + pub fn adt_transformation( + target_scope: &'a SemanticsScope<'a>, + source_scope: &'a SemanticsScope<'a>, + adt: hir::Adt, + generic_arg_list: ast::GenericArgList, + ) -> PathTransform<'a> { + PathTransform { + source_scope, + target_scope, + generic_def: Some(adt.into()), + substs: get_type_args_from_arg_list(generic_arg_list).unwrap_or_default(), + } + } + pub fn generic_transformation( target_scope: &'a SemanticsScope<'a>, source_scope: &'a SemanticsScope<'a>, diff --git a/src/tools/rust-analyzer/crates/ide-db/src/rename.rs b/src/tools/rust-analyzer/crates/ide-db/src/rename.rs index d2b6a732689..7f28965885a 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/rename.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/rename.rs @@ -22,9 +22,10 @@ //! Our current behavior is ¯\_(ツ)_/¯. use std::fmt; -use base_db::{span::SyntaxContextId, AnchoredPathBuf, FileId, FileRange}; +use base_db::{AnchoredPathBuf, FileId, FileRange}; use either::Either; use hir::{FieldSource, HasSource, HirFileIdExt, InFile, ModuleSource, Semantics}; +use span::SyntaxContextId; use stdx::{never, TupleExt}; use syntax::{ ast::{self, HasName}, @@ -515,7 +516,7 @@ fn source_edit_from_def( if let Definition::Local(local) = def { let mut file_id = None; for source in local.sources(sema.db) { - let source = match source.source.clone().original_ast_node(sema.db) { + let source = match source.source.clone().original_ast_node_rooted(sema.db) { Some(source) => source, None => match source .source @@ -559,7 +560,7 @@ fn source_edit_from_def( } } else { // Foo { ref mut field } -> Foo { field: ref mut new_name } - // ^ insert `field: ` + // original_ast_node_rootedd: ` // ^^^^^ replace this with `new_name` edit.insert( pat.syntax().text_range().start(), diff --git a/src/tools/rust-analyzer/crates/ide-db/src/symbol_index.rs b/src/tools/rust-analyzer/crates/ide-db/src/symbol_index.rs index be8566b759c..f5f0f0576f2 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/symbol_index.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/symbol_index.rs @@ -378,9 +378,9 @@ impl Query { #[cfg(test)] mod tests { - use base_db::fixture::WithFixture; use expect_test::expect_file; use hir::symbols::SymbolCollector; + use test_fixture::WithFixture; use super::*; @@ -414,6 +414,12 @@ impl Struct { fn impl_fn() {} } +struct StructT<T>; + +impl <T> StructT<T> { + fn generic_impl_fn() {} +} + trait Trait { fn trait_fn(&self); } diff --git a/src/tools/rust-analyzer/crates/ide-db/src/test_data/test_symbol_index_collection.txt b/src/tools/rust-analyzer/crates/ide-db/src/test_data/test_symbol_index_collection.txt index c9875c7f8f2..f0b97779c73 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/test_data/test_symbol_index_collection.txt +++ b/src/tools/rust-analyzer/crates/ide-db/src/test_data/test_symbol_index_collection.txt @@ -23,12 +23,12 @@ ), ptr: SyntaxNodePtr { kind: TYPE_ALIAS, - range: 397..417, + range: 470..490, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 402..407, + range: 475..480, }, ), }, @@ -51,12 +51,12 @@ ), ptr: SyntaxNodePtr { kind: CONST, - range: 340..361, + range: 413..434, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 346..351, + range: 419..424, }, ), }, @@ -79,12 +79,12 @@ ), ptr: SyntaxNodePtr { kind: CONST, - range: 520..592, + range: 593..665, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 526..542, + range: 599..615, }, ), }, @@ -139,12 +139,12 @@ ), ptr: SyntaxNodePtr { kind: USE_TREE, - range: 654..676, + range: 727..749, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 663..676, + range: 736..749, }, ), }, @@ -197,12 +197,12 @@ ), ptr: SyntaxNodePtr { kind: STATIC, - range: 362..396, + range: 435..469, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 369..375, + range: 442..448, }, ), }, @@ -276,7 +276,7 @@ Struct( Struct { id: StructId( - 4, + 5, ), }, ), @@ -287,12 +287,12 @@ ), ptr: SyntaxNodePtr { kind: STRUCT, - range: 318..336, + range: 391..409, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 325..335, + range: 398..408, }, ), }, @@ -308,7 +308,7 @@ Struct( Struct { id: StructId( - 5, + 6, ), }, ), @@ -319,12 +319,12 @@ ), ptr: SyntaxNodePtr { kind: STRUCT, - range: 555..581, + range: 628..654, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 562..580, + range: 635..653, }, ), }, @@ -340,7 +340,37 @@ Struct( Struct { id: StructId( - 6, + 7, + ), + }, + ), + ), + loc: DeclarationLocation { + hir_file_id: FileId( + 0, + ), + ptr: SyntaxNodePtr { + kind: STRUCT, + range: 552..580, + }, + name_ptr: AstPtr( + SyntaxNodePtr { + kind: NAME, + range: 559..579, + }, + ), + }, + container_name: None, + is_alias: false, + is_assoc: false, + }, + FileSymbol { + name: "StructT", + def: Adt( + Struct( + Struct { + id: StructId( + 2, ), }, ), @@ -351,12 +381,12 @@ ), ptr: SyntaxNodePtr { kind: STRUCT, - range: 479..507, + range: 261..279, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 486..506, + range: 268..275, }, ), }, @@ -379,12 +409,12 @@ ), ptr: SyntaxNodePtr { kind: TRAIT, - range: 261..300, + range: 334..373, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 267..272, + range: 340..345, }, ), }, @@ -409,12 +439,12 @@ ), ptr: SyntaxNodePtr { kind: USE_TREE, - range: 682..696, + range: 755..769, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 691..696, + range: 764..769, }, ), }, @@ -469,12 +499,12 @@ ), ptr: SyntaxNodePtr { kind: MODULE, - range: 419..457, + range: 492..530, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 423..428, + range: 496..501, }, ), }, @@ -499,12 +529,12 @@ ), ptr: SyntaxNodePtr { kind: MODULE, - range: 594..604, + range: 667..677, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 598..603, + range: 671..676, }, ), }, @@ -543,6 +573,36 @@ is_assoc: false, }, FileSymbol { + name: "generic_impl_fn", + def: Function( + Function { + id: FunctionId( + 3, + ), + }, + ), + loc: DeclarationLocation { + hir_file_id: FileId( + 0, + ), + ptr: SyntaxNodePtr { + kind: FN, + range: 307..330, + }, + name_ptr: AstPtr( + SyntaxNodePtr { + kind: NAME, + range: 310..325, + }, + ), + }, + container_name: Some( + "StructT<T>", + ), + is_alias: false, + is_assoc: true, + }, + FileSymbol { name: "impl_fn", def: Function( Function { @@ -566,7 +626,9 @@ }, ), }, - container_name: None, + container_name: Some( + "Struct", + ), is_alias: false, is_assoc: true, }, @@ -615,12 +677,12 @@ ), ptr: SyntaxNodePtr { kind: FN, - range: 302..338, + range: 375..411, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 305..309, + range: 378..382, }, ), }, @@ -645,12 +707,12 @@ ), ptr: SyntaxNodePtr { kind: USE_TREE, - range: 611..648, + range: 684..721, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 628..648, + range: 701..721, }, ), }, @@ -673,12 +735,12 @@ ), ptr: SyntaxNodePtr { kind: FN, - range: 279..298, + range: 352..371, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 282..290, + range: 355..363, }, ), }, @@ -705,7 +767,7 @@ Struct( Struct { id: StructId( - 2, + 3, ), }, ), @@ -716,12 +778,12 @@ ), ptr: SyntaxNodePtr { kind: STRUCT, - range: 435..455, + range: 508..528, }, name_ptr: AstPtr( SyntaxNodePtr { kind: NAME, - range: 442..454, + range: 515..527, }, ), }, @@ -776,7 +838,7 @@ Struct( Struct { id: StructId( - 3, + 4, ), }, ), @@ -836,7 +898,7 @@ Struct( Struct { id: StructId( - 3, + 4, ), }, ), @@ -866,7 +928,7 @@ Struct( Struct { id: StructId( - 3, + 4, ), }, ), diff --git a/src/tools/rust-analyzer/crates/ide-db/src/traits.rs b/src/tools/rust-analyzer/crates/ide-db/src/traits.rs index 9abbc344142..bbdfd81d653 100644 --- a/src/tools/rust-analyzer/crates/ide-db/src/traits.rs +++ b/src/tools/rust-analyzer/crates/ide-db/src/traits.rs @@ -113,10 +113,11 @@ fn assoc_item_of_trait( #[cfg(test)] mod tests { - use base_db::{fixture::ChangeFixture, FilePosition}; + use base_db::FilePosition; use expect_test::{expect, Expect}; use hir::Semantics; use syntax::ast::{self, AstNode}; + use test_fixture::ChangeFixture; use crate::RootDatabase; diff --git a/src/tools/rust-analyzer/crates/ide-diagnostics/Cargo.toml b/src/tools/rust-analyzer/crates/ide-diagnostics/Cargo.toml index f4055024cc3..3ed48457a28 100644 --- a/src/tools/rust-analyzer/crates/ide-diagnostics/Cargo.toml +++ b/src/tools/rust-analyzer/crates/ide-diagnostics/Cargo.toml @@ -32,7 +32,11 @@ expect-test = "1.4.0" # local deps test-utils.workspace = true +test-fixture.workspace = true sourcegen.workspace = true [features] in-rust-tree = [] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/trait_impl_redundant_assoc_item.rs b/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/trait_impl_redundant_assoc_item.rs index 82001439146..c202264bb56 100644 --- a/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/trait_impl_redundant_assoc_item.rs +++ b/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/trait_impl_redundant_assoc_item.rs @@ -76,4 +76,24 @@ impl Marker for Foo { "#, ) } + + #[test] + fn dont_work_for_negative_impl() { + check_diagnostics( + r#" +trait Marker { + const FLAG: bool = false; + fn boo(); + fn foo () {} +} +struct Foo; +impl !Marker for Foo { + type T = i32; + const FLAG: bool = true; + fn bar() {} + fn boo() {} +} + "#, + ) + } } diff --git a/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_assoc_item.rs b/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_assoc_item.rs new file mode 100644 index 00000000000..f1c95993c84 --- /dev/null +++ b/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_assoc_item.rs @@ -0,0 +1,52 @@ +use crate::{Diagnostic, DiagnosticCode, DiagnosticsContext}; + +// Diagnostic: unresolved-assoc-item +// +// This diagnostic is triggered if the referenced associated item does not exist. +pub(crate) fn unresolved_assoc_item( + ctx: &DiagnosticsContext<'_>, + d: &hir::UnresolvedAssocItem, +) -> Diagnostic { + Diagnostic::new_with_syntax_node_ptr( + ctx, + DiagnosticCode::RustcHardError("E0599"), + "no such associated item", + d.expr_or_pat.clone().map(Into::into), + ) +} + +#[cfg(test)] +mod tests { + use crate::tests::check_diagnostics; + + #[test] + fn bare() { + check_diagnostics( + r#" +struct S; + +fn main() { + let _ = S::Assoc; + //^^^^^^^^ error: no such associated item +} +"#, + ); + } + + #[test] + fn unimplemented_trait() { + check_diagnostics( + r#" +struct S; +trait Foo { + const X: u32; +} + +fn main() { + let _ = S::X; + //^^^^ error: no such associated item +} +"#, + ); + } +} diff --git a/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_method.rs b/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_method.rs index 464b0a710ea..60a45a05a4a 100644 --- a/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_method.rs +++ b/src/tools/rust-analyzer/crates/ide-diagnostics/src/handlers/unresolved_method.rs @@ -1,11 +1,14 @@ -use hir::{db::ExpandDatabase, HirDisplay}; +use hir::{db::ExpandDatabase, AssocItem, HirDisplay, InFile}; use ide_db::{ assists::{Assist, AssistId, AssistKind}, base_db::FileRange, label::Label, source_change::SourceChange, }; -use syntax::{ast, AstNode, TextRange}; +use syntax::{ + ast::{self, make, HasArgList}, + AstNode, SmolStr, TextRange, +}; use text_edit::TextEdit; use crate::{adjusted_display_range_new, Diagnostic, DiagnosticCode, DiagnosticsContext}; @@ -17,15 +20,17 @@ pub(crate) fn unresolved_method( ctx: &DiagnosticsContext<'_>, d: &hir::UnresolvedMethodCall, ) -> Diagnostic { - let field_suffix = if d.field_with_same_name.is_some() { + let suffix = if d.field_with_same_name.is_some() { ", but a field with a similar name exists" + } else if d.assoc_func_with_same_name.is_some() { + ", but an associated function with a similar name exists" } else { "" }; Diagnostic::new( DiagnosticCode::RustcHardError("E0599"), format!( - "no method `{}` on type `{}`{field_suffix}", + "no method `{}` on type `{}`{suffix}", d.name.display(ctx.sema.db), d.receiver.display(ctx.sema.db) ), @@ -46,11 +51,27 @@ pub(crate) fn unresolved_method( } fn fixes(ctx: &DiagnosticsContext<'_>, d: &hir::UnresolvedMethodCall) -> Option<Vec<Assist>> { - if let Some(ty) = &d.field_with_same_name { + let field_fix = if let Some(ty) = &d.field_with_same_name { field_fix(ctx, d, ty) } else { // FIXME: add quickfix None + }; + + let assoc_func_fix = assoc_func_fix(ctx, d); + + let mut fixes = vec![]; + if let Some(field_fix) = field_fix { + fixes.push(field_fix); + } + if let Some(assoc_func_fix) = assoc_func_fix { + fixes.push(assoc_func_fix); + } + + if fixes.is_empty() { + None + } else { + Some(fixes) } } @@ -58,7 +79,7 @@ fn field_fix( ctx: &DiagnosticsContext<'_>, d: &hir::UnresolvedMethodCall, ty: &hir::Type, -) -> Option<Vec<Assist>> { +) -> Option<Assist> { if !ty.impls_fnonce(ctx.sema.db) { return None; } @@ -78,7 +99,7 @@ fn field_fix( } _ => return None, }; - Some(vec![Assist { + Some(Assist { id: AssistId("expected-method-found-field-fix", AssistKind::QuickFix), label: Label::new("Use parentheses to call the value of the field".to_string()), group: None, @@ -88,7 +109,95 @@ fn field_fix( (file_id, TextEdit::insert(range.end(), ")".to_owned())), ])), trigger_signature_help: false, - }]) + }) +} + +fn assoc_func_fix(ctx: &DiagnosticsContext<'_>, d: &hir::UnresolvedMethodCall) -> Option<Assist> { + if let Some(assoc_item_id) = d.assoc_func_with_same_name { + let db = ctx.sema.db; + + let expr_ptr = &d.expr; + let root = db.parse_or_expand(expr_ptr.file_id); + let expr: ast::Expr = expr_ptr.value.to_node(&root); + + let call = ast::MethodCallExpr::cast(expr.syntax().clone())?; + let range = InFile::new(expr_ptr.file_id, call.syntax().text_range()) + .original_node_file_range_rooted(db) + .range; + + let receiver = call.receiver()?; + let receiver_type = &ctx.sema.type_of_expr(&receiver)?.original; + + let need_to_take_receiver_as_first_arg = match hir::AssocItem::from(assoc_item_id) { + AssocItem::Function(f) => { + let assoc_fn_params = f.assoc_fn_params(db); + if assoc_fn_params.is_empty() { + false + } else { + assoc_fn_params + .first() + .map(|first_arg| { + // For generic type, say `Box`, take `Box::into_raw(b: Self)` as example, + // type of `b` is `Self`, which is `Box<T, A>`, containing unspecified generics. + // However, type of `receiver` is specified, it could be `Box<i32, Global>` or something like that, + // so `first_arg.ty() == receiver_type` evaluate to `false` here. + // Here add `first_arg.ty().as_adt() == receiver_type.as_adt()` as guard, + // apply `.as_adt()` over `Box<T, A>` or `Box<i32, Global>` gets `Box`, so we get `true` here. + + // FIXME: it fails when type of `b` is `Box` with other generic param different from `receiver` + first_arg.ty() == receiver_type + || first_arg.ty().as_adt() == receiver_type.as_adt() + }) + .unwrap_or(false) + } + } + _ => false, + }; + + let mut receiver_type_adt_name = receiver_type.as_adt()?.name(db).to_smol_str().to_string(); + + let generic_parameters: Vec<SmolStr> = receiver_type.generic_parameters(db).collect(); + // if receiver should be pass as first arg in the assoc func, + // we could omit generic parameters cause compiler can deduce it automatically + if !need_to_take_receiver_as_first_arg && !generic_parameters.is_empty() { + let generic_parameters = generic_parameters.join(", ").to_string(); + receiver_type_adt_name = + format!("{}::<{}>", receiver_type_adt_name, generic_parameters); + } + + let method_name = call.name_ref()?; + let assoc_func_call = format!("{}::{}()", receiver_type_adt_name, method_name); + + let assoc_func_call = make::expr_path(make::path_from_text(&assoc_func_call)); + + let args: Vec<_> = if need_to_take_receiver_as_first_arg { + std::iter::once(receiver).chain(call.arg_list()?.args()).collect() + } else { + call.arg_list()?.args().collect() + }; + let args = make::arg_list(args); + + let assoc_func_call_expr_string = make::expr_call(assoc_func_call, args).to_string(); + + let file_id = ctx.sema.original_range_opt(call.receiver()?.syntax())?.file_id; + + Some(Assist { + id: AssistId("method_call_to_assoc_func_call_fix", AssistKind::QuickFix), + label: Label::new(format!( + "Use associated func call instead: `{}`", + assoc_func_call_expr_string + )), + group: None, + target: range, + source_change: Some(SourceChange::from_text_edit( + file_id, + TextEdit::replace(range, assoc_func_call_expr_string), + )), + trigger_signature_help: false, + }) + } else { + None + } } #[cfg(test)] @@ -96,6 +205,85 @@ mod tests { use crate::tests::{check_diagnostics, check_fix}; #[test] + fn test_assoc_func_fix() { + check_fix( + r#" +struct A {} + +impl A { + fn hello() {} +} +fn main() { + let a = A{}; + a.hello$0(); +} +"#, + r#" +struct A {} + +impl A { + fn hello() {} +} +fn main() { + let a = A{}; + A::hello(); +} +"#, + ); + } + + #[test] + fn test_assoc_func_diagnostic() { + check_diagnostics( + r#" +struct A {} +impl A { + fn hello() {} +} +fn main() { + let a = A{}; + a.hello(); + // ^^^^^ 💡 error: no method `hello` on type `A`, but an associated function with a similar name exists +} +"#, + ); + } + + #[test] + fn test_assoc_func_fix_with_generic() { + check_fix( + r#" +struct A<T, U> { + a: T, + b: U +} + +impl<T, U> A<T, U> { + fn foo() {} +} +fn main() { + let a = A {a: 0, b: ""}; + a.foo()$0; +} +"#, + r#" +struct A<T, U> { + a: T, + b: U +} + +impl<T, U> A<T, U> { + fn foo() {} +} +fn main() { + let a = A {a: 0, b: ""}; + A::<i32, &str>::foo(); +} +"#, + ); + } + + #[test] fn smoke_test() { check_diagnostics( r#" diff --git a/src/tools/rust-analyzer/crates/ide-diagnostics/src/lib.rs b/src/tools/rust-analyzer/crates/ide-diagnostics/src/lib.rs index 579386c72ef..c7ad09e7ebd 100644 --- a/src/tools/rust-analyzer/crates/ide-diagnostics/src/lib.rs +++ b/src/tools/rust-analyzer/crates/ide-diagnostics/src/lib.rs @@ -51,6 +51,7 @@ mod handlers { pub(crate) mod typed_hole; pub(crate) mod type_mismatch; pub(crate) mod unimplemented_builtin_macro; + pub(crate) mod unresolved_assoc_item; pub(crate) mod unresolved_extern_crate; pub(crate) mod unresolved_field; pub(crate) mod unresolved_method; @@ -371,7 +372,8 @@ pub fn diagnostics( AnyDiagnostic::TypeMismatch(d) => handlers::type_mismatch::type_mismatch(&ctx, &d), AnyDiagnostic::UndeclaredLabel(d) => handlers::undeclared_label::undeclared_label(&ctx, &d), AnyDiagnostic::UnimplementedBuiltinMacro(d) => handlers::unimplemented_builtin_macro::unimplemented_builtin_macro(&ctx, &d), - AnyDiagnostic::UnreachableLabel(d) => handlers::unreachable_label:: unreachable_label(&ctx, &d), + AnyDiagnostic::UnreachableLabel(d) => handlers::unreachable_label::unreachable_label(&ctx, &d), + AnyDiagnostic::UnresolvedAssocItem(d) => handlers::unresolved_assoc_item::unresolved_assoc_item(&ctx, &d), AnyDiagnostic::UnresolvedExternCrate(d) => handlers::unresolved_extern_crate::unresolved_extern_crate(&ctx, &d), AnyDiagnostic::UnresolvedField(d) => handlers::unresolved_field::unresolved_field(&ctx, &d), AnyDiagnostic::UnresolvedImport(d) => handlers::unresolved_import::unresolved_import(&ctx, &d), diff --git a/src/tools/rust-analyzer/crates/ide-diagnostics/src/tests.rs b/src/tools/rust-analyzer/crates/ide-diagnostics/src/tests.rs index 48e0363c9ca..67912a3a03e 100644 --- a/src/tools/rust-analyzer/crates/ide-diagnostics/src/tests.rs +++ b/src/tools/rust-analyzer/crates/ide-diagnostics/src/tests.rs @@ -3,12 +3,11 @@ mod sourcegen; use expect_test::Expect; use ide_db::{ - assists::AssistResolveStrategy, - base_db::{fixture::WithFixture, SourceDatabaseExt}, - LineIndexDatabase, RootDatabase, + assists::AssistResolveStrategy, base_db::SourceDatabaseExt, LineIndexDatabase, RootDatabase, }; use itertools::Itertools; use stdx::trim_indent; +use test_fixture::WithFixture; use test_utils::{assert_eq_text, extract_annotations, MiniCore}; use crate::{DiagnosticsConfig, ExprFillDefaultMode, Severity}; diff --git a/src/tools/rust-analyzer/crates/ide-ssr/Cargo.toml b/src/tools/rust-analyzer/crates/ide-ssr/Cargo.toml index 56b29f92b82..57b1f9465ad 100644 --- a/src/tools/rust-analyzer/crates/ide-ssr/Cargo.toml +++ b/src/tools/rust-analyzer/crates/ide-ssr/Cargo.toml @@ -31,3 +31,7 @@ expect-test = "1.4.0" # local deps test-utils.workspace = true +test-fixture.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/ide-ssr/src/tests.rs b/src/tools/rust-analyzer/crates/ide-ssr/src/tests.rs index 424ba3d7fd5..7c7d146cb4a 100644 --- a/src/tools/rust-analyzer/crates/ide-ssr/src/tests.rs +++ b/src/tools/rust-analyzer/crates/ide-ssr/src/tests.rs @@ -65,8 +65,8 @@ fn parser_undefined_placeholder_in_replacement() { /// `code` may optionally contain a cursor marker `$0`. If it doesn't, then the position will be /// the start of the file. If there's a second cursor marker, then we'll return a single range. pub(crate) fn single_file(code: &str) -> (ide_db::RootDatabase, FilePosition, Vec<FileRange>) { - use ide_db::base_db::fixture::WithFixture; use ide_db::symbol_index::SymbolsDatabase; + use test_fixture::{WithFixture, WORKSPACE}; let (mut db, file_id, range_or_offset) = if code.contains(test_utils::CURSOR_MARKER) { ide_db::RootDatabase::with_range_or_offset(code) } else { @@ -86,7 +86,7 @@ pub(crate) fn single_file(code: &str) -> (ide_db::RootDatabase, FilePosition, Ve } } let mut local_roots = FxHashSet::default(); - local_roots.insert(ide_db::base_db::fixture::WORKSPACE); + local_roots.insert(WORKSPACE); db.set_local_roots_with_durability(Arc::new(local_roots), Durability::HIGH); (db, position, selections) } diff --git a/src/tools/rust-analyzer/crates/ide/Cargo.toml b/src/tools/rust-analyzer/crates/ide/Cargo.toml index 0943574ec1b..9f0a2f30f65 100644 --- a/src/tools/rust-analyzer/crates/ide/Cargo.toml +++ b/src/tools/rust-analyzer/crates/ide/Cargo.toml @@ -14,7 +14,7 @@ doctest = false [dependencies] cov-mark = "2.0.0-pre.1" crossbeam-channel = "0.5.5" -arrayvec = "0.7.4" +arrayvec.workspace = true either.workspace = true itertools.workspace = true tracing.workspace = true @@ -50,6 +50,10 @@ expect-test = "1.4.0" # local deps test-utils.workspace = true +test-fixture.workspace = true [features] in-rust-tree = ["ide-assists/in-rust-tree", "ide-diagnostics/in-rust-tree"] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/ide/src/annotations.rs b/src/tools/rust-analyzer/crates/ide/src/annotations.rs index d7f82b4af3e..f49c5af0af1 100644 --- a/src/tools/rust-analyzer/crates/ide/src/annotations.rs +++ b/src/tools/rust-analyzer/crates/ide/src/annotations.rs @@ -3,8 +3,9 @@ use ide_db::{ base_db::{FileId, FilePosition, FileRange}, defs::Definition, helpers::visit_file_defs, - RootDatabase, + FxHashSet, RootDatabase, }; +use itertools::Itertools; use syntax::{ast::HasName, AstNode, TextRange}; use crate::{ @@ -23,13 +24,13 @@ mod fn_references; // and running/debugging binaries. // // image::https://user-images.githubusercontent.com/48062697/113020672-b7c34f00-917a-11eb-8f6e-858735660a0e.png[] -#[derive(Debug)] +#[derive(Debug, Hash, PartialEq, Eq)] pub struct Annotation { pub range: TextRange, pub kind: AnnotationKind, } -#[derive(Debug)] +#[derive(Debug, Hash, PartialEq, Eq)] pub enum AnnotationKind { Runnable(Runnable), HasImpls { pos: FilePosition, data: Option<Vec<NavigationTarget>> }, @@ -56,7 +57,7 @@ pub(crate) fn annotations( config: &AnnotationConfig, file_id: FileId, ) -> Vec<Annotation> { - let mut annotations = Vec::default(); + let mut annotations = FxHashSet::default(); if config.annotate_runnables { for runnable in runnables(db, file_id) { @@ -66,7 +67,7 @@ pub(crate) fn annotations( let range = runnable.nav.focus_or_full_range(); - annotations.push(Annotation { range, kind: AnnotationKind::Runnable(runnable) }); + annotations.insert(Annotation { range, kind: AnnotationKind::Runnable(runnable) }); } } @@ -99,13 +100,13 @@ pub(crate) fn annotations( }) .for_each(|range| { let (annotation_range, target_position) = mk_ranges(range); - annotations.push(Annotation { + annotations.insert(Annotation { range: annotation_range, kind: AnnotationKind::HasReferences { pos: target_position, data: None, }, - }) + }); }) } if config.annotate_references || config.annotate_impls { @@ -131,14 +132,14 @@ pub(crate) fn annotations( }; let (annotation_range, target_pos) = mk_ranges(range); if config.annotate_impls && !matches!(def, Definition::Const(_)) { - annotations.push(Annotation { + annotations.insert(Annotation { range: annotation_range, kind: AnnotationKind::HasImpls { pos: target_pos, data: None }, }); } if config.annotate_references { - annotations.push(Annotation { + annotations.insert(Annotation { range: annotation_range, kind: AnnotationKind::HasReferences { pos: target_pos, data: None }, }); @@ -149,7 +150,7 @@ pub(crate) fn annotations( node: InFile<T>, source_file_id: FileId, ) -> Option<(TextRange, Option<TextRange>)> { - if let Some(InRealFile { file_id, value }) = node.original_ast_node(db) { + if let Some(InRealFile { file_id, value }) = node.original_ast_node_rooted(db) { if file_id == source_file_id { return Some(( value.syntax().text_range(), @@ -171,7 +172,7 @@ pub(crate) fn annotations( })); } - annotations + annotations.into_iter().sorted_by_key(|a| (a.range.start(), a.range.end())).collect() } pub(crate) fn resolve_annotation(db: &RootDatabase, mut annotation: Annotation) -> Annotation { @@ -253,25 +254,6 @@ fn main() { expect![[r#" [ Annotation { - range: 53..57, - kind: Runnable( - Runnable { - use_name_in_title: false, - nav: NavigationTarget { - file_id: FileId( - 0, - ), - full_range: 50..85, - focus_range: 53..57, - name: "main", - kind: Function, - }, - kind: Bin, - cfg: None, - }, - ), - }, - Annotation { range: 6..10, kind: HasReferences { pos: FilePosition { @@ -308,6 +290,25 @@ fn main() { }, Annotation { range: 53..57, + kind: Runnable( + Runnable { + use_name_in_title: false, + nav: NavigationTarget { + file_id: FileId( + 0, + ), + full_range: 50..85, + focus_range: 53..57, + name: "main", + kind: Function, + }, + kind: Bin, + cfg: None, + }, + ), + }, + Annotation { + range: 53..57, kind: HasReferences { pos: FilePosition { file_id: FileId( @@ -338,27 +339,8 @@ fn main() { expect![[r#" [ Annotation { - range: 17..21, - kind: Runnable( - Runnable { - use_name_in_title: false, - nav: NavigationTarget { - file_id: FileId( - 0, - ), - full_range: 14..48, - focus_range: 17..21, - name: "main", - kind: Function, - }, - kind: Bin, - cfg: None, - }, - ), - }, - Annotation { range: 7..11, - kind: HasImpls { + kind: HasReferences { pos: FilePosition { file_id: FileId( 0, @@ -366,13 +348,20 @@ fn main() { offset: 7, }, data: Some( - [], + [ + FileRange { + file_id: FileId( + 0, + ), + range: 41..45, + }, + ], ), }, }, Annotation { range: 7..11, - kind: HasReferences { + kind: HasImpls { pos: FilePosition { file_id: FileId( 0, @@ -380,19 +369,31 @@ fn main() { offset: 7, }, data: Some( - [ - FileRange { - file_id: FileId( - 0, - ), - range: 41..45, - }, - ], + [], ), }, }, Annotation { range: 17..21, + kind: Runnable( + Runnable { + use_name_in_title: false, + nav: NavigationTarget { + file_id: FileId( + 0, + ), + full_range: 14..48, + focus_range: 17..21, + name: "main", + kind: Function, + }, + kind: Bin, + cfg: None, + }, + ), + }, + Annotation { + range: 17..21, kind: HasReferences { pos: FilePosition { file_id: FileId( @@ -427,27 +428,8 @@ fn main() { expect![[r#" [ Annotation { - range: 69..73, - kind: Runnable( - Runnable { - use_name_in_title: false, - nav: NavigationTarget { - file_id: FileId( - 0, - ), - full_range: 66..100, - focus_range: 69..73, - name: "main", - kind: Function, - }, - kind: Bin, - cfg: None, - }, - ), - }, - Annotation { range: 7..11, - kind: HasImpls { + kind: HasReferences { pos: FilePosition { file_id: FileId( 0, @@ -456,14 +438,17 @@ fn main() { }, data: Some( [ - NavigationTarget { + FileRange { file_id: FileId( 0, ), - full_range: 36..64, - focus_range: 57..61, - name: "impl", - kind: Impl, + range: 57..61, + }, + FileRange { + file_id: FileId( + 0, + ), + range: 93..97, }, ], ), @@ -471,7 +456,7 @@ fn main() { }, Annotation { range: 7..11, - kind: HasReferences { + kind: HasImpls { pos: FilePosition { file_id: FileId( 0, @@ -480,17 +465,14 @@ fn main() { }, data: Some( [ - FileRange { - file_id: FileId( - 0, - ), - range: 57..61, - }, - FileRange { + NavigationTarget { file_id: FileId( 0, ), - range: 93..97, + full_range: 36..64, + focus_range: 57..61, + name: "impl", + kind: Impl, }, ], ), @@ -555,6 +537,25 @@ fn main() { ), }, }, + Annotation { + range: 69..73, + kind: Runnable( + Runnable { + use_name_in_title: false, + nav: NavigationTarget { + file_id: FileId( + 0, + ), + full_range: 66..100, + focus_range: 69..73, + name: "main", + kind: Function, + }, + kind: Bin, + cfg: None, + }, + ), + }, ] "#]], ); @@ -623,27 +624,8 @@ fn main() { expect![[r#" [ Annotation { - range: 61..65, - kind: Runnable( - Runnable { - use_name_in_title: false, - nav: NavigationTarget { - file_id: FileId( - 0, - ), - full_range: 58..95, - focus_range: 61..65, - name: "main", - kind: Function, - }, - kind: Bin, - cfg: None, - }, - ), - }, - Annotation { range: 7..11, - kind: HasImpls { + kind: HasReferences { pos: FilePosition { file_id: FileId( 0, @@ -652,14 +634,17 @@ fn main() { }, data: Some( [ - NavigationTarget { + FileRange { file_id: FileId( 0, ), - full_range: 14..56, - focus_range: 19..23, - name: "impl", - kind: Impl, + range: 19..23, + }, + FileRange { + file_id: FileId( + 0, + ), + range: 74..78, }, ], ), @@ -667,7 +652,7 @@ fn main() { }, Annotation { range: 7..11, - kind: HasReferences { + kind: HasImpls { pos: FilePosition { file_id: FileId( 0, @@ -676,17 +661,14 @@ fn main() { }, data: Some( [ - FileRange { - file_id: FileId( - 0, - ), - range: 19..23, - }, - FileRange { + NavigationTarget { file_id: FileId( 0, ), - range: 74..78, + full_range: 14..56, + focus_range: 19..23, + name: "impl", + kind: Impl, }, ], ), @@ -727,6 +709,25 @@ fn main() { ), }, }, + Annotation { + range: 61..65, + kind: Runnable( + Runnable { + use_name_in_title: false, + nav: NavigationTarget { + file_id: FileId( + 0, + ), + full_range: 58..95, + focus_range: 61..65, + name: "main", + kind: Function, + }, + kind: Bin, + cfg: None, + }, + ), + }, ] "#]], ); @@ -747,6 +748,20 @@ mod tests { [ Annotation { range: 3..7, + kind: HasReferences { + pos: FilePosition { + file_id: FileId( + 0, + ), + offset: 3, + }, + data: Some( + [], + ), + }, + }, + Annotation { + range: 3..7, kind: Runnable( Runnable { use_name_in_title: false, @@ -812,20 +827,6 @@ mod tests { }, ), }, - Annotation { - range: 3..7, - kind: HasReferences { - pos: FilePosition { - file_id: FileId( - 0, - ), - offset: 3, - }, - data: Some( - [], - ), - }, - }, ] "#]], ); @@ -877,7 +878,7 @@ struct Foo; [ Annotation { range: 0..71, - kind: HasImpls { + kind: HasReferences { pos: FilePosition { file_id: FileId( 0, @@ -891,7 +892,7 @@ struct Foo; }, Annotation { range: 0..71, - kind: HasReferences { + kind: HasImpls { pos: FilePosition { file_id: FileId( 0, diff --git a/src/tools/rust-analyzer/crates/ide/src/doc_links.rs b/src/tools/rust-analyzer/crates/ide/src/doc_links.rs index 9760f9daf0a..a36082bafcf 100644 --- a/src/tools/rust-analyzer/crates/ide/src/doc_links.rs +++ b/src/tools/rust-analyzer/crates/ide/src/doc_links.rs @@ -492,7 +492,7 @@ fn get_doc_base_urls( let Some(krate) = def.krate(db) else { return Default::default() }; let Some(display_name) = krate.display_name(db) else { return Default::default() }; let crate_data = &db.crate_graph()[krate.into()]; - let channel = crate_data.channel.map_or("nightly", ReleaseChannel::as_str); + let channel = crate_data.channel().unwrap_or(ReleaseChannel::Nightly).as_str(); let (web_base, local_base) = match &crate_data.origin { // std and co do not specify `html_root_url` any longer so we gotta handwrite this ourself. diff --git a/src/tools/rust-analyzer/crates/ide/src/fixture.rs b/src/tools/rust-analyzer/crates/ide/src/fixture.rs index 2e5903c0602..3b19b85c4bc 100644 --- a/src/tools/rust-analyzer/crates/ide/src/fixture.rs +++ b/src/tools/rust-analyzer/crates/ide/src/fixture.rs @@ -1,5 +1,5 @@ //! Utilities for creating `Analysis` instances for tests. -use ide_db::base_db::fixture::ChangeFixture; +use test_fixture::ChangeFixture; use test_utils::{extract_annotations, RangeOrOffset}; use crate::{Analysis, AnalysisHost, FileId, FilePosition, FileRange}; diff --git a/src/tools/rust-analyzer/crates/ide/src/goto_definition.rs b/src/tools/rust-analyzer/crates/ide/src/goto_definition.rs index 7491879a67f..e0beba8fb38 100644 --- a/src/tools/rust-analyzer/crates/ide/src/goto_definition.rs +++ b/src/tools/rust-analyzer/crates/ide/src/goto_definition.rs @@ -4,7 +4,7 @@ use crate::{ doc_links::token_as_doc_comment, navigation_target::ToNav, FilePosition, NavigationTarget, RangeInfo, TryToNav, }; -use hir::{AsAssocItem, AssocItem, DescendPreference, Semantics}; +use hir::{AsAssocItem, AssocItem, DescendPreference, ModuleDef, Semantics}; use ide_db::{ base_db::{AnchoredPath, FileId, FileLoader}, defs::{Definition, IdentClass}, @@ -73,10 +73,15 @@ pub(crate) fn goto_definition( .into_iter() .filter_map(|token| { let parent = token.parent()?; + if let Some(tt) = ast::TokenTree::cast(parent.clone()) { if let Some(x) = try_lookup_include_path(sema, tt, token.clone(), file_id) { return Some(vec![x]); } + + if let Some(x) = try_lookup_macro_def_in_macro_use(sema, token.clone()) { + return Some(vec![x]); + } } Some( IdentClass::classify_node(sema, &parent)? @@ -140,6 +145,27 @@ fn try_lookup_include_path( }) } +fn try_lookup_macro_def_in_macro_use( + sema: &Semantics<'_, RootDatabase>, + token: SyntaxToken, +) -> Option<NavigationTarget> { + let extern_crate = token.parent()?.ancestors().find_map(ast::ExternCrate::cast)?; + let extern_crate = sema.to_def(&extern_crate)?; + let krate = extern_crate.resolved_crate(sema.db)?; + + for mod_def in krate.root_module().declarations(sema.db) { + if let ModuleDef::Macro(mac) = mod_def { + if mac.name(sema.db).as_str() == Some(token.text()) { + if let Some(nav) = mac.try_to_nav(sema.db) { + return Some(nav.call_site); + } + } + } + } + + None +} + /// finds the trait definition of an impl'd item, except function /// e.g. /// ```rust @@ -2081,4 +2107,47 @@ fn test() { "#, ); } + + #[test] + fn goto_macro_def_from_macro_use() { + check( + r#" +//- /main.rs crate:main deps:mac +#[macro_use(foo$0)] +extern crate mac; + +//- /mac.rs crate:mac +#[macro_export] +macro_rules! foo { + //^^^ + () => {}; +} + "#, + ); + + check( + r#" +//- /main.rs crate:main deps:mac +#[macro_use(foo, bar$0, baz)] +extern crate mac; + +//- /mac.rs crate:mac +#[macro_export] +macro_rules! foo { + () => {}; +} + +#[macro_export] +macro_rules! bar { + //^^^ + () => {}; +} + +#[macro_export] +macro_rules! baz { + () => {}; +} + "#, + ); + } } diff --git a/src/tools/rust-analyzer/crates/ide/src/goto_implementation.rs b/src/tools/rust-analyzer/crates/ide/src/goto_implementation.rs index 6384db39d7c..c1a4a7b1fc7 100644 --- a/src/tools/rust-analyzer/crates/ide/src/goto_implementation.rs +++ b/src/tools/rust-analyzer/crates/ide/src/goto_implementation.rs @@ -4,7 +4,6 @@ use ide_db::{ helpers::pick_best_token, RootDatabase, }; -use itertools::Itertools; use syntax::{ast, AstNode, SyntaxKind::*, T}; use crate::{FilePosition, NavigationTarget, RangeInfo, TryToNav}; @@ -34,10 +33,10 @@ pub(crate) fn goto_implementation( })?; let range = original_token.text_range(); let navs = - sema.descend_into_macros(DescendPreference::None, original_token) - .into_iter() - .filter_map(|token| token.parent().and_then(ast::NameLike::cast)) - .filter_map(|node| match &node { + sema.descend_into_macros_single(DescendPreference::SameText, original_token) + .parent() + .and_then(ast::NameLike::cast) + .and_then(|node| match &node { ast::NameLike::Name(name) => { NameClass::classify(&sema, name).and_then(|class| match class { NameClass::Definition(it) | NameClass::ConstReference(it) => Some(it), @@ -52,8 +51,7 @@ pub(crate) fn goto_implementation( }), ast::NameLike::Lifetime(_) => None, }) - .unique() - .filter_map(|def| { + .and_then(|def| { let navs = match def { Definition::Trait(trait_) => impls_for_trait(&sema, trait_), Definition::Adt(adt) => impls_for_ty(&sema, adt.ty(sema.db)), @@ -75,8 +73,7 @@ pub(crate) fn goto_implementation( }; Some(navs) }) - .flatten() - .collect(); + .unwrap_or_default(); Some(RangeInfo { range, info: navs }) } diff --git a/src/tools/rust-analyzer/crates/ide/src/lib.rs b/src/tools/rust-analyzer/crates/ide/src/lib.rs index a19952e4cae..6ff16b9e2f7 100644 --- a/src/tools/rust-analyzer/crates/ide/src/lib.rs +++ b/src/tools/rust-analyzer/crates/ide/src/lib.rs @@ -67,6 +67,7 @@ use std::ffi::OsStr; use cfg::CfgOptions; use fetch_crates::CrateInfo; +use hir::Change; use ide_db::{ base_db::{ salsa::{self, ParallelDatabase}, @@ -122,7 +123,7 @@ pub use ide_completion::{ }; pub use ide_db::{ base_db::{ - Cancelled, Change, CrateGraph, CrateId, Edition, FileId, FilePosition, FileRange, + Cancelled, CrateGraph, CrateId, Edition, FileChange, FileId, FilePosition, FileRange, SourceRoot, SourceRootId, }, documentation::Documentation, @@ -183,7 +184,7 @@ impl AnalysisHost { /// Applies changes to the current state of the world. If there are /// outstanding snapshots, they will be canceled. pub fn apply_change(&mut self, change: Change) { - self.db.apply_change(change) + self.db.apply_change(change); } /// NB: this clears the database diff --git a/src/tools/rust-analyzer/crates/ide/src/markdown_remove.rs b/src/tools/rust-analyzer/crates/ide/src/markdown_remove.rs index 718868c8747..fa01875e204 100644 --- a/src/tools/rust-analyzer/crates/ide/src/markdown_remove.rs +++ b/src/tools/rust-analyzer/crates/ide/src/markdown_remove.rs @@ -6,6 +6,7 @@ use pulldown_cmark::{Event, Parser, Tag}; /// Currently limited in styling, i.e. no ascii tables or lists pub(crate) fn remove_markdown(markdown: &str) -> String { let mut out = String::new(); + out.reserve_exact(markdown.len()); let parser = Parser::new(markdown); for event in parser { @@ -13,10 +14,7 @@ pub(crate) fn remove_markdown(markdown: &str) -> String { Event::Text(text) | Event::Code(text) => out.push_str(&text), Event::SoftBreak => out.push(' '), Event::HardBreak | Event::Rule | Event::End(Tag::CodeBlock(_)) => out.push('\n'), - Event::End(Tag::Paragraph) => { - out.push('\n'); - out.push('\n'); - } + Event::End(Tag::Paragraph) => out.push_str("\n\n"), Event::Start(_) | Event::End(_) | Event::Html(_) @@ -25,7 +23,10 @@ pub(crate) fn remove_markdown(markdown: &str) -> String { } } - if let Some(p) = out.rfind(|c| c != '\n') { + if let Some(mut p) = out.rfind(|c| c != '\n') { + while !out.is_char_boundary(p + 1) { + p += 1; + } out.drain(p + 1..); } @@ -153,4 +154,10 @@ book] or the [Reference]. For more information on the various types of functions and how they're used, consult the Rust book or the Reference."#]].assert_eq(&res); } + + #[test] + fn on_char_boundary() { + expect!["a┘"].assert_eq(&remove_markdown("```text\na┘\n```")); + expect!["وقار"].assert_eq(&remove_markdown("```\nوقار\n```\n")); + } } diff --git a/src/tools/rust-analyzer/crates/ide/src/shuffle_crate_graph.rs b/src/tools/rust-analyzer/crates/ide/src/shuffle_crate_graph.rs index f85700daf1f..bf6ad47a495 100644 --- a/src/tools/rust-analyzer/crates/ide/src/shuffle_crate_graph.rs +++ b/src/tools/rust-analyzer/crates/ide/src/shuffle_crate_graph.rs @@ -1,5 +1,6 @@ +use hir::{db::ExpandDatabase, ProcMacros}; use ide_db::{ - base_db::{salsa::Durability, CrateGraph, ProcMacros, SourceDatabase}, + base_db::{salsa::Durability, CrateGraph, SourceDatabase}, FxHashMap, RootDatabase, }; use triomphe::Arc; @@ -39,7 +40,7 @@ pub(crate) fn shuffle_crate_graph(db: &mut RootDatabase) { data.is_proc_macro, data.origin.clone(), data.target_layout.clone(), - data.channel, + data.toolchain.clone(), ); new_proc_macros.insert(new_id, proc_macros[&old_id].clone()); map.insert(old_id, new_id); diff --git a/src/tools/rust-analyzer/crates/ide/src/signature_help.rs b/src/tools/rust-analyzer/crates/ide/src/signature_help.rs index 990376a4965..483fb76d91c 100644 --- a/src/tools/rust-analyzer/crates/ide/src/signature_help.rs +++ b/src/tools/rust-analyzer/crates/ide/src/signature_help.rs @@ -646,8 +646,9 @@ mod tests { use std::iter; use expect_test::{expect, Expect}; - use ide_db::base_db::{fixture::ChangeFixture, FilePosition}; + use ide_db::base_db::FilePosition; use stdx::format_to; + use test_fixture::ChangeFixture; use crate::RootDatabase; diff --git a/src/tools/rust-analyzer/crates/ide/src/ssr.rs b/src/tools/rust-analyzer/crates/ide/src/ssr.rs index d8d81869a2f..f0d18fdefa7 100644 --- a/src/tools/rust-analyzer/crates/ide/src/ssr.rs +++ b/src/tools/rust-analyzer/crates/ide/src/ssr.rs @@ -59,10 +59,11 @@ mod tests { use expect_test::expect; use ide_assists::{Assist, AssistResolveStrategy}; use ide_db::{ - base_db::{fixture::WithFixture, salsa::Durability, FileRange}, + base_db::{salsa::Durability, FileRange}, symbol_index::SymbolsDatabase, FxHashSet, RootDatabase, }; + use test_fixture::WithFixture; use triomphe::Arc; use super::ssr_assists; @@ -70,7 +71,7 @@ mod tests { fn get_assists(ra_fixture: &str, resolve: AssistResolveStrategy) -> Vec<Assist> { let (mut db, file_id, range_or_offset) = RootDatabase::with_range_or_offset(ra_fixture); let mut local_roots = FxHashSet::default(); - local_roots.insert(ide_db::base_db::fixture::WORKSPACE); + local_roots.insert(test_fixture::WORKSPACE); db.set_local_roots_with_durability(Arc::new(local_roots), Durability::HIGH); ssr_assists(&db, &resolve, FileRange { file_id, range: range_or_offset.into() }) } diff --git a/src/tools/rust-analyzer/crates/ide/src/status.rs b/src/tools/rust-analyzer/crates/ide/src/status.rs index e7f97ebe6f7..b2b305c1d38 100644 --- a/src/tools/rust-analyzer/crates/ide/src/status.rs +++ b/src/tools/rust-analyzer/crates/ide/src/status.rs @@ -10,7 +10,7 @@ use ide_db::{ debug::{DebugQueryTable, TableEntry}, Query, QueryTable, }, - CrateId, FileId, FileTextQuery, ParseQuery, SourceDatabase, SourceRootId, + CrateData, FileId, FileTextQuery, ParseQuery, SourceDatabase, SourceRootId, }, symbol_index::ModuleSymbolsQuery, }; @@ -54,25 +54,54 @@ pub(crate) fn status(db: &RootDatabase, file_id: Option<FileId>) -> String { format_to!(buf, "{} block def maps\n", collect_query_count(BlockDefMapQuery.in_db(db))); if let Some(file_id) = file_id { - format_to!(buf, "\nFile info:\n"); + format_to!(buf, "\nCrates for file {}:\n", file_id.index()); let crates = crate::parent_module::crates_for(db, file_id); if crates.is_empty() { format_to!(buf, "Does not belong to any crate"); } let crate_graph = db.crate_graph(); - for krate in crates { - let display_crate = |krate: CrateId| match &crate_graph[krate].display_name { - Some(it) => format!("{it}({})", krate.into_raw()), - None => format!("{}", krate.into_raw()), - }; - format_to!(buf, "Crate: {}\n", display_crate(krate)); - format_to!(buf, "Enabled cfgs: {:?}\n", crate_graph[krate].cfg_options); - let deps = crate_graph[krate] - .dependencies + for crate_id in crates { + let CrateData { + root_file_id, + edition, + version, + display_name, + cfg_options, + potential_cfg_options, + env, + dependencies, + origin, + is_proc_macro, + target_layout, + toolchain, + } = &crate_graph[crate_id]; + format_to!( + buf, + "Crate: {}\n", + match display_name { + Some(it) => format!("{it}({})", crate_id.into_raw()), + None => format!("{}", crate_id.into_raw()), + } + ); + format_to!(buf, " Root module file id: {}\n", root_file_id.index()); + format_to!(buf, " Edition: {}\n", edition); + format_to!(buf, " Version: {}\n", version.as_deref().unwrap_or("n/a")); + format_to!(buf, " Enabled cfgs: {:?}\n", cfg_options); + format_to!(buf, " Potential cfgs: {:?}\n", potential_cfg_options); + format_to!(buf, " Env: {:?}\n", env); + format_to!(buf, " Origin: {:?}\n", origin); + format_to!(buf, " Is a proc macro crate: {}\n", is_proc_macro); + format_to!(buf, " Workspace Target Layout: {:?}\n", target_layout); + format_to!( + buf, + " Workspace Toolchain: {}\n", + toolchain.as_ref().map_or_else(|| "n/a".into(), |v| v.to_string()) + ); + let deps = dependencies .iter() - .map(|dep| format!("{}={:?}", dep.name, dep.crate_id)) + .map(|dep| format!("{}={}", dep.name, dep.crate_id.into_raw())) .format(", "); - format_to!(buf, "Dependencies: {}\n", deps); + format_to!(buf, " Dependencies: {}\n", deps); } } diff --git a/src/tools/rust-analyzer/crates/intern/Cargo.toml b/src/tools/rust-analyzer/crates/intern/Cargo.toml index d9184b0fb6f..67b4164ce1f 100644 --- a/src/tools/rust-analyzer/crates/intern/Cargo.toml +++ b/src/tools/rust-analyzer/crates/intern/Cargo.toml @@ -16,5 +16,8 @@ doctest = false # We need to freeze the version of the crate, as the raw-api feature is considered unstable dashmap.workspace = true hashbrown.workspace = true -rustc-hash = "1.1.0" +rustc-hash.workspace = true triomphe.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/limit/Cargo.toml b/src/tools/rust-analyzer/crates/limit/Cargo.toml index c0888690992..c89722cc40d 100644 --- a/src/tools/rust-analyzer/crates/limit/Cargo.toml +++ b/src/tools/rust-analyzer/crates/limit/Cargo.toml @@ -11,3 +11,6 @@ rust-version.workspace = true [features] tracking = [] default = ["tracking"] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/load-cargo/Cargo.toml b/src/tools/rust-analyzer/crates/load-cargo/Cargo.toml index 31b9f6c76d0..dcab6328a4e 100644 --- a/src/tools/rust-analyzer/crates/load-cargo/Cargo.toml +++ b/src/tools/rust-analyzer/crates/load-cargo/Cargo.toml @@ -12,7 +12,7 @@ authors.workspace = true [dependencies] anyhow.workspace = true -crossbeam-channel = "0.5.5" +crossbeam-channel.workspace = true itertools.workspace = true tracing.workspace = true @@ -23,3 +23,9 @@ project-model.workspace = true tt.workspace = true vfs.workspace = true vfs-notify.workspace = true +span.workspace = true + +hir-expand.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/load-cargo/src/lib.rs b/src/tools/rust-analyzer/crates/load-cargo/src/lib.rs index db9654220dd..556ed73a04c 100644 --- a/src/tools/rust-analyzer/crates/load-cargo/src/lib.rs +++ b/src/tools/rust-analyzer/crates/load-cargo/src/lib.rs @@ -5,17 +5,19 @@ use std::{collections::hash_map::Entry, mem, path::Path, sync}; use crossbeam_channel::{unbounded, Receiver}; -use ide::{AnalysisHost, Change, SourceRoot}; +use hir_expand::proc_macro::{ + ProcMacro, ProcMacroExpander, ProcMacroExpansionError, ProcMacroKind, ProcMacroLoadResult, + ProcMacros, +}; +use ide::{AnalysisHost, SourceRoot}; use ide_db::{ - base_db::{ - span::SpanData, CrateGraph, Env, ProcMacro, ProcMacroExpander, ProcMacroExpansionError, - ProcMacroKind, ProcMacroLoadResult, ProcMacros, - }, - FxHashMap, + base_db::{CrateGraph, Env}, + Change, FxHashMap, }; use itertools::Itertools; use proc_macro_api::{MacroDylib, ProcMacroServer}; use project_model::{CargoConfig, PackageRoot, ProjectManifest, ProjectWorkspace}; +use span::Span; use tt::DelimSpan; use vfs::{file_set::FileSetConfig, loader::Handle, AbsPath, AbsPathBuf, VfsPath}; @@ -374,13 +376,13 @@ struct Expander(proc_macro_api::ProcMacro); impl ProcMacroExpander for Expander { fn expand( &self, - subtree: &tt::Subtree<SpanData>, - attrs: Option<&tt::Subtree<SpanData>>, + subtree: &tt::Subtree<Span>, + attrs: Option<&tt::Subtree<Span>>, env: &Env, - def_site: SpanData, - call_site: SpanData, - mixed_site: SpanData, - ) -> Result<tt::Subtree<SpanData>, ProcMacroExpansionError> { + def_site: Span, + call_site: Span, + mixed_site: Span, + ) -> Result<tt::Subtree<Span>, ProcMacroExpansionError> { let env = env.iter().map(|(k, v)| (k.to_string(), v.to_string())).collect(); match self.0.expand(subtree, attrs, env, def_site, call_site, mixed_site) { Ok(Ok(subtree)) => Ok(subtree), @@ -397,13 +399,13 @@ struct IdentityExpander; impl ProcMacroExpander for IdentityExpander { fn expand( &self, - subtree: &tt::Subtree<SpanData>, - _: Option<&tt::Subtree<SpanData>>, + subtree: &tt::Subtree<Span>, + _: Option<&tt::Subtree<Span>>, _: &Env, - _: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<tt::Subtree<SpanData>, ProcMacroExpansionError> { + _: Span, + _: Span, + _: Span, + ) -> Result<tt::Subtree<Span>, ProcMacroExpansionError> { Ok(subtree.clone()) } } @@ -415,13 +417,13 @@ struct EmptyExpander; impl ProcMacroExpander for EmptyExpander { fn expand( &self, - _: &tt::Subtree<SpanData>, - _: Option<&tt::Subtree<SpanData>>, + _: &tt::Subtree<Span>, + _: Option<&tt::Subtree<Span>>, _: &Env, - call_site: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<tt::Subtree<SpanData>, ProcMacroExpansionError> { + call_site: Span, + _: Span, + _: Span, + ) -> Result<tt::Subtree<Span>, ProcMacroExpansionError> { Ok(tt::Subtree::empty(DelimSpan { open: call_site, close: call_site })) } } diff --git a/src/tools/rust-analyzer/crates/mbe/Cargo.toml b/src/tools/rust-analyzer/crates/mbe/Cargo.toml index adab1003d10..2046fa943a8 100644 --- a/src/tools/rust-analyzer/crates/mbe/Cargo.toml +++ b/src/tools/rust-analyzer/crates/mbe/Cargo.toml @@ -13,7 +13,7 @@ doctest = false [dependencies] cov-mark = "2.0.0-pre.1" -rustc-hash = "1.1.0" +rustc-hash.workspace = true smallvec.workspace = true tracing.workspace = true @@ -22,6 +22,13 @@ syntax.workspace = true parser.workspace = true tt.workspace = true stdx.workspace = true +span.workspace = true [dev-dependencies] test-utils.workspace = true + +[features] +in-rust-tree = ["parser/in-rust-tree", "syntax/in-rust-tree"] + +[lints] +workspace = true diff --git a/src/tools/rust-analyzer/crates/mbe/src/benchmark.rs b/src/tools/rust-analyzer/crates/mbe/src/benchmark.rs index f503aecce2c..6c3917b37f1 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/benchmark.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/benchmark.rs @@ -20,7 +20,10 @@ fn benchmark_parse_macro_rules() { let rules = macro_rules_fixtures_tt(); let hash: usize = { let _pt = bench("mbe parse macro rules"); - rules.values().map(|it| DeclarativeMacro::parse_macro_rules(it, true).rules.len()).sum() + rules + .values() + .map(|it| DeclarativeMacro::parse_macro_rules(it, true, true).rules.len()) + .sum() }; assert_eq!(hash, 1144); } @@ -38,7 +41,7 @@ fn benchmark_expand_macro_rules() { invocations .into_iter() .map(|(id, tt)| { - let res = rules[&id].expand(&tt, |_| ()); + let res = rules[&id].expand(&tt, |_| (), true, DUMMY); assert!(res.err.is_none()); res.value.token_trees.len() }) @@ -50,7 +53,7 @@ fn benchmark_expand_macro_rules() { fn macro_rules_fixtures() -> FxHashMap<String, DeclarativeMacro<DummyTestSpanData>> { macro_rules_fixtures_tt() .into_iter() - .map(|(id, tt)| (id, DeclarativeMacro::parse_macro_rules(&tt, true))) + .map(|(id, tt)| (id, DeclarativeMacro::parse_macro_rules(&tt, true, true))) .collect() } @@ -64,8 +67,11 @@ fn macro_rules_fixtures_tt() -> FxHashMap<String, tt::Subtree<DummyTestSpanData> .filter_map(ast::MacroRules::cast) .map(|rule| { let id = rule.name().unwrap().to_string(); - let def_tt = - syntax_node_to_token_tree(rule.token_tree().unwrap().syntax(), DummyTestSpanMap); + let def_tt = syntax_node_to_token_tree( + rule.token_tree().unwrap().syntax(), + DummyTestSpanMap, + DUMMY, + ); (id, def_tt) }) .collect() @@ -105,7 +111,7 @@ fn invocation_fixtures( for op in rule.lhs.iter() { collect_from_op(op, &mut subtree, &mut seed); } - if it.expand(&subtree, |_| ()).err.is_none() { + if it.expand(&subtree, |_| (), true, DUMMY).err.is_none() { res.push((name.clone(), subtree)); break; } @@ -199,7 +205,7 @@ fn invocation_fixtures( }); parent.token_trees.push(subtree.into()); } - Op::Ignore { .. } | Op::Index { .. } | Op::Count { .. } => {} + Op::Ignore { .. } | Op::Index { .. } | Op::Count { .. } | Op::Length { .. } => {} }; // Simple linear congruential generator for deterministic result diff --git a/src/tools/rust-analyzer/crates/mbe/src/expander.rs b/src/tools/rust-analyzer/crates/mbe/src/expander.rs index 0e755f69bf7..60483809dc1 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/expander.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/expander.rs @@ -16,6 +16,8 @@ pub(crate) fn expand_rules<S: Span>( input: &tt::Subtree<S>, marker: impl Fn(&mut S) + Copy, is_2021: bool, + new_meta_vars: bool, + call_site: S, ) -> ExpandResult<tt::Subtree<S>> { let mut match_: Option<(matcher::Match<S>, &crate::Rule<S>)> = None; for rule in rules { @@ -25,8 +27,13 @@ pub(crate) fn expand_rules<S: Span>( // If we find a rule that applies without errors, we're done. // Unconditionally returning the transcription here makes the // `test_repeat_bad_var` test fail. - let ExpandResult { value, err: transcribe_err } = - transcriber::transcribe(&rule.rhs, &new_match.bindings, marker); + let ExpandResult { value, err: transcribe_err } = transcriber::transcribe( + &rule.rhs, + &new_match.bindings, + marker, + new_meta_vars, + call_site, + ); if transcribe_err.is_none() { return ExpandResult::ok(value); } @@ -45,11 +52,14 @@ pub(crate) fn expand_rules<S: Span>( if let Some((match_, rule)) = match_ { // if we got here, there was no match without errors let ExpandResult { value, err: transcribe_err } = - transcriber::transcribe(&rule.rhs, &match_.bindings, marker); + transcriber::transcribe(&rule.rhs, &match_.bindings, marker, new_meta_vars, call_site); ExpandResult { value, err: match_.err.or(transcribe_err) } } else { ExpandResult::new( - tt::Subtree { delimiter: tt::Delimiter::DUMMY_INVISIBLE, token_trees: vec![] }, + tt::Subtree { + delimiter: tt::Delimiter::invisible_spanned(call_site), + token_trees: vec![], + }, ExpandError::NoMatchingRule, ) } @@ -121,6 +131,7 @@ enum Binding<S> { #[derive(Debug, Clone, PartialEq, Eq)] enum Fragment<S> { + Empty, /// token fragments are just copy-pasted into the output Tokens(tt::TokenTree<S>), /// Expr ast fragments are surrounded with `()` on insertion to preserve diff --git a/src/tools/rust-analyzer/crates/mbe/src/expander/matcher.rs b/src/tools/rust-analyzer/crates/mbe/src/expander/matcher.rs index 012b02a3f87..40b4c7cdd65 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/expander/matcher.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/expander/matcher.rs @@ -63,7 +63,7 @@ use std::rc::Rc; use smallvec::{smallvec, SmallVec}; use syntax::SmolStr; -use tt::Span; +use tt::{DelimSpan, Span}; use crate::{ expander::{Binding, Bindings, ExpandResult, Fragment}, @@ -74,11 +74,7 @@ use crate::{ impl<S: Span> Bindings<S> { fn push_optional(&mut self, name: &SmolStr) { - // FIXME: Do we have a better way to represent an empty token ? - // Insert an empty subtree for empty token - let tt = - tt::Subtree { delimiter: tt::Delimiter::DUMMY_INVISIBLE, token_trees: vec![] }.into(); - self.inner.insert(name.clone(), Binding::Fragment(Fragment::Tokens(tt))); + self.inner.insert(name.clone(), Binding::Fragment(Fragment::Empty)); } fn push_empty(&mut self, name: &SmolStr) { @@ -387,6 +383,7 @@ fn match_loop_inner<'t, S: Span>( eof_items: &mut SmallVec<[MatchState<'t, S>; 1]>, error_items: &mut SmallVec<[MatchState<'t, S>; 1]>, is_2021: bool, + delim_span: tt::DelimSpan<S>, ) { macro_rules! try_push { ($items: expr, $it:expr) => { @@ -474,7 +471,7 @@ fn match_loop_inner<'t, S: Span>( cur_items.push(new_item); } cur_items.push(MatchState { - dot: tokens.iter_delimited(None), + dot: tokens.iter_delimited(delim_span), stack: Default::default(), up: Some(Box::new(item)), sep: separator.clone(), @@ -489,7 +486,7 @@ fn match_loop_inner<'t, S: Span>( if let Ok(subtree) = src.clone().expect_subtree() { if subtree.delimiter.kind == delimiter.kind { item.stack.push(item.dot); - item.dot = tokens.iter_delimited(Some(*delimiter)); + item.dot = tokens.iter_delimited_with(*delimiter); cur_items.push(item); } } @@ -497,7 +494,7 @@ fn match_loop_inner<'t, S: Span>( OpDelimited::Op(Op::Var { kind, name, .. }) => { if let &Some(kind) = kind { let mut fork = src.clone(); - let match_res = match_meta_var(kind, &mut fork, is_2021); + let match_res = match_meta_var(kind, &mut fork, is_2021, delim_span); match match_res.err { None => { // Some meta variables are optional (e.g. vis) @@ -588,7 +585,9 @@ fn match_loop_inner<'t, S: Span>( item.is_error = true; error_items.push(item); } - OpDelimited::Op(Op::Ignore { .. } | Op::Index { .. } | Op::Count { .. }) => { + OpDelimited::Op( + Op::Ignore { .. } | Op::Index { .. } | Op::Count { .. } | Op::Length { .. }, + ) => { stdx::never!("metavariable expression in lhs found"); } OpDelimited::Open => { @@ -609,6 +608,7 @@ fn match_loop_inner<'t, S: Span>( } fn match_loop<S: Span>(pattern: &MetaTemplate<S>, src: &tt::Subtree<S>, is_2021: bool) -> Match<S> { + let span = src.delimiter.delim_span(); let mut src = TtIter::new(src); let mut stack: SmallVec<[TtIter<'_, S>; 1]> = SmallVec::new(); let mut res = Match::default(); @@ -617,7 +617,7 @@ fn match_loop<S: Span>(pattern: &MetaTemplate<S>, src: &tt::Subtree<S>, is_2021: let mut bindings_builder = BindingsBuilder::default(); let mut cur_items = smallvec![MatchState { - dot: pattern.iter_delimited(None), + dot: pattern.iter_delimited(span), stack: Default::default(), up: None, sep: None, @@ -648,6 +648,7 @@ fn match_loop<S: Span>(pattern: &MetaTemplate<S>, src: &tt::Subtree<S>, is_2021: &mut eof_items, &mut error_items, is_2021, + span, ); stdx::always!(cur_items.is_empty()); @@ -761,12 +762,13 @@ fn match_meta_var<S: Span>( kind: MetaVarKind, input: &mut TtIter<'_, S>, is_2021: bool, + delim_span: DelimSpan<S>, ) -> ExpandResult<Option<Fragment<S>>> { let fragment = match kind { MetaVarKind::Path => { - return input - .expect_fragment(parser::PrefixEntryPoint::Path) - .map(|it| it.map(tt::TokenTree::subtree_or_wrap).map(Fragment::Path)); + return input.expect_fragment(parser::PrefixEntryPoint::Path).map(|it| { + it.map(|it| tt::TokenTree::subtree_or_wrap(it, delim_span)).map(Fragment::Path) + }); } MetaVarKind::Ty => parser::PrefixEntryPoint::Ty, MetaVarKind::Pat if is_2021 => parser::PrefixEntryPoint::PatTop, @@ -795,7 +797,7 @@ fn match_meta_var<S: Span>( return input.expect_fragment(parser::PrefixEntryPoint::Expr).map(|tt| { tt.map(|tt| match tt { tt::TokenTree::Leaf(leaf) => tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(*leaf.span()), token_trees: vec![leaf.into()], }, tt::TokenTree::Subtree(mut s) => { @@ -829,7 +831,7 @@ fn match_meta_var<S: Span>( match neg { None => lit.into(), Some(neg) => tt::TokenTree::Subtree(tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(*literal.span()), token_trees: vec![neg, lit.into()], }), } @@ -851,18 +853,21 @@ fn collect_vars<S: Span>(collector_fun: &mut impl FnMut(SmolStr), pattern: &Meta Op::Subtree { tokens, .. } => collect_vars(collector_fun, tokens), Op::Repeat { tokens, .. } => collect_vars(collector_fun, tokens), Op::Literal(_) | Op::Ident(_) | Op::Punct(_) => {} - Op::Ignore { .. } | Op::Index { .. } | Op::Count { .. } => { + Op::Ignore { .. } | Op::Index { .. } | Op::Count { .. } | Op::Length { .. } => { stdx::never!("metavariable expression in lhs found"); } } } } impl<S: Span> MetaTemplate<S> { - fn iter_delimited(&self, delimited: Option<tt::Delimiter<S>>) -> OpDelimitedIter<'_, S> { + fn iter_delimited_with(&self, delimiter: tt::Delimiter<S>) -> OpDelimitedIter<'_, S> { + OpDelimitedIter { inner: &self.0, idx: 0, delimited: delimiter } + } + fn iter_delimited(&self, span: tt::DelimSpan<S>) -> OpDelimitedIter<'_, S> { OpDelimitedIter { inner: &self.0, idx: 0, - delimited: delimited.unwrap_or(tt::Delimiter::DUMMY_INVISIBLE), + delimited: tt::Delimiter::invisible_delim_spanned(span), } } } @@ -958,11 +963,13 @@ impl<S: Span> TtIter<'_, S> { self.expect_lifetime() } else { let puncts = self.expect_glued_punct()?; + let delimiter = tt::Delimiter { + open: puncts.first().unwrap().span, + close: puncts.last().unwrap().span, + kind: tt::DelimiterKind::Invisible, + }; let token_trees = puncts.into_iter().map(|p| tt::Leaf::Punct(p).into()).collect(); - Ok(tt::TokenTree::Subtree(tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), - token_trees, - })) + Ok(tt::TokenTree::Subtree(tt::Subtree { delimiter, token_trees })) } } else { self.next().ok_or(()).cloned() @@ -977,7 +984,11 @@ impl<S: Span> TtIter<'_, S> { let ident = self.expect_ident_or_underscore()?; Ok(tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter { + open: punct.span, + close: ident.span, + kind: tt::DelimiterKind::Invisible, + }, token_trees: vec![ tt::Leaf::Punct(*punct).into(), tt::Leaf::Ident(ident.clone()).into(), diff --git a/src/tools/rust-analyzer/crates/mbe/src/expander/transcriber.rs b/src/tools/rust-analyzer/crates/mbe/src/expander/transcriber.rs index 7a3e8653c28..6e79cdaa0b9 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/expander/transcriber.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/expander/transcriber.rs @@ -59,12 +59,12 @@ impl<S: Span> Bindings<S> { token_trees: token_trees.clone(), }; Ok(match f { - Fragment::Tokens(_) => unreachable!(), + Fragment::Tokens(_) | Fragment::Empty => unreachable!(), Fragment::Expr(_) => Fragment::Expr, Fragment::Path(_) => Fragment::Path, }(subtree)) } - Binding::Fragment(it @ Fragment::Tokens(_)) => Ok(it.clone()), + Binding::Fragment(it @ (Fragment::Tokens(_) | Fragment::Empty)) => Ok(it.clone()), // emit some reasonable default expansion for missing bindings, // this gives better recovery than emitting the `$fragment-name` verbatim Binding::Missing(it) => Ok({ @@ -87,10 +87,7 @@ impl<S: Span> Bindings<S> { })), // FIXME: Meta and Item should get proper defaults MetaVarKind::Meta | MetaVarKind::Item | MetaVarKind::Tt | MetaVarKind::Vis => { - Fragment::Tokens(tt::TokenTree::Subtree(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, - token_trees: vec![], - })) + Fragment::Empty } MetaVarKind::Path | MetaVarKind::Ty @@ -131,8 +128,10 @@ pub(super) fn transcribe<S: Span>( template: &MetaTemplate<S>, bindings: &Bindings<S>, marker: impl Fn(&mut S) + Copy, + new_meta_vars: bool, + call_site: S, ) -> ExpandResult<tt::Subtree<S>> { - let mut ctx = ExpandCtx { bindings, nesting: Vec::new() }; + let mut ctx = ExpandCtx { bindings, nesting: Vec::new(), new_meta_vars, call_site }; let mut arena: Vec<tt::TokenTree<S>> = Vec::new(); expand_subtree(&mut ctx, template, None, &mut arena, marker) } @@ -152,6 +151,8 @@ struct NestingState { struct ExpandCtx<'a, S> { bindings: &'a Bindings<S>, nesting: Vec<NestingState>, + new_meta_vars: bool, + call_site: S, } fn expand_subtree<S: Span>( @@ -206,13 +207,13 @@ fn expand_subtree<S: Span>( Op::Var { name, id, .. } => { let ExpandResult { value: fragment, err: e } = expand_var(ctx, name, *id, marker); err = err.or(e); - push_fragment(arena, fragment); + push_fragment(ctx, arena, fragment); } Op::Repeat { tokens: subtree, kind, separator } => { let ExpandResult { value: fragment, err: e } = expand_repeat(ctx, subtree, *kind, separator, arena, marker); err = err.or(e); - push_fragment(arena, fragment) + push_fragment(ctx, arena, fragment) } Op::Ignore { name, id } => { // Expand the variable, but ignore the result. This registers the repetition count. @@ -225,8 +226,20 @@ fn expand_subtree<S: Span>( arena.push( tt::Leaf::Literal(tt::Literal { text: index.to_string().into(), - // FIXME - span: S::DUMMY, + span: ctx.call_site, + }) + .into(), + ); + } + Op::Length { depth } => { + let length = ctx.nesting.get(ctx.nesting.len() - 1 - depth).map_or(0, |_nest| { + // FIXME: to be implemented + 0 + }); + arena.push( + tt::Leaf::Literal(tt::Literal { + text: length.to_string().into(), + span: ctx.call_site, }) .into(), ); @@ -268,7 +281,13 @@ fn expand_subtree<S: Span>( } } - let c = match count(ctx, binding, 0, *depth) { + let res = if ctx.new_meta_vars { + count(ctx, binding, 0, depth.unwrap_or(0)) + } else { + count_old(ctx, binding, 0, *depth) + }; + + let c = match res { Ok(c) => c, Err(e) => { // XXX: It *might* make sense to emit a dummy integer value like `0` here. @@ -285,8 +304,7 @@ fn expand_subtree<S: Span>( arena.push( tt::Leaf::Literal(tt::Literal { text: c.to_string().into(), - // FIXME - span: S::DUMMY, + span: ctx.call_site, }) .into(), ); @@ -297,7 +315,7 @@ fn expand_subtree<S: Span>( let tts = arena.drain(start_elements..).collect(); ExpandResult { value: tt::Subtree { - delimiter: delimiter.unwrap_or_else(tt::Delimiter::dummy_invisible), + delimiter: delimiter.unwrap_or_else(|| tt::Delimiter::invisible_spanned(ctx.call_site)), token_trees: tts, }, err, @@ -330,7 +348,7 @@ fn expand_var<S: Span>( // ``` // We just treat it a normal tokens let tt = tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + delimiter: tt::Delimiter::invisible_spanned(id), token_trees: vec![ tt::Leaf::from(tt::Punct { char: '$', spacing: tt::Spacing::Alone, span: id }) .into(), @@ -342,10 +360,8 @@ fn expand_var<S: Span>( } Err(e) => ExpandResult { value: Fragment::Tokens(tt::TokenTree::Subtree(tt::Subtree::empty(tt::DelimSpan { - // FIXME - open: S::DUMMY, - // FIXME - close: S::DUMMY, + open: ctx.call_site, + close: ctx.call_site, }))), err: Some(e), }, @@ -389,7 +405,7 @@ fn expand_repeat<S: Span>( return ExpandResult { value: Fragment::Tokens( tt::Subtree { - delimiter: tt::Delimiter::dummy_invisible(), + delimiter: tt::Delimiter::invisible_spanned(ctx.call_site), token_trees: vec![], } .into(), @@ -403,7 +419,7 @@ fn expand_repeat<S: Span>( continue; } - t.delimiter = tt::Delimiter::DUMMY_INVISIBLE; + t.delimiter.kind = tt::DelimiterKind::Invisible; push_subtree(&mut buf, t); if let Some(sep) = separator { @@ -437,7 +453,11 @@ fn expand_repeat<S: Span>( // Check if it is a single token subtree without any delimiter // e.g {Delimiter:None> ['>'] /Delimiter:None>} - let tt = tt::Subtree { delimiter: tt::Delimiter::DUMMY_INVISIBLE, token_trees: buf }.into(); + let tt = tt::Subtree { + delimiter: tt::Delimiter::invisible_spanned(ctx.call_site), + token_trees: buf, + } + .into(); if RepeatKind::OneOrMore == kind && counter == 0 { return ExpandResult { @@ -448,14 +468,19 @@ fn expand_repeat<S: Span>( ExpandResult { value: Fragment::Tokens(tt), err } } -fn push_fragment<S: Span>(buf: &mut Vec<tt::TokenTree<S>>, fragment: Fragment<S>) { +fn push_fragment<S: Span>( + ctx: &ExpandCtx<'_, S>, + buf: &mut Vec<tt::TokenTree<S>>, + fragment: Fragment<S>, +) { match fragment { Fragment::Tokens(tt::TokenTree::Subtree(tt)) => push_subtree(buf, tt), Fragment::Expr(sub) => { push_subtree(buf, sub); } - Fragment::Path(tt) => fix_up_and_push_path_tt(buf, tt), + Fragment::Path(tt) => fix_up_and_push_path_tt(ctx, buf, tt), Fragment::Tokens(tt) => buf.push(tt), + Fragment::Empty => (), } } @@ -469,7 +494,11 @@ fn push_subtree<S>(buf: &mut Vec<tt::TokenTree<S>>, tt: tt::Subtree<S>) { /// Inserts the path separator `::` between an identifier and its following generic /// argument list, and then pushes into the buffer. See [`Fragment::Path`] for why /// we need this fixup. -fn fix_up_and_push_path_tt<S: Span>(buf: &mut Vec<tt::TokenTree<S>>, subtree: tt::Subtree<S>) { +fn fix_up_and_push_path_tt<S: Span>( + ctx: &ExpandCtx<'_, S>, + buf: &mut Vec<tt::TokenTree<S>>, + subtree: tt::Subtree<S>, +) { stdx::always!(matches!(subtree.delimiter.kind, tt::DelimiterKind::Invisible)); let mut prev_was_ident = false; // Note that we only need to fix up the top-level `TokenTree`s because the @@ -486,8 +515,7 @@ fn fix_up_and_push_path_tt<S: Span>(buf: &mut Vec<tt::TokenTree<S>>, subtree: tt tt::Leaf::Punct(tt::Punct { char: ':', spacing: tt::Spacing::Joint, - // FIXME - span: S::DUMMY, + span: ctx.call_site, }) .into(), ); @@ -495,8 +523,7 @@ fn fix_up_and_push_path_tt<S: Span>(buf: &mut Vec<tt::TokenTree<S>>, subtree: tt tt::Leaf::Punct(tt::Punct { char: ':', spacing: tt::Spacing::Alone, - // FIXME - span: S::DUMMY, + span: ctx.call_site, }) .into(), ); @@ -512,14 +539,33 @@ fn fix_up_and_push_path_tt<S: Span>(buf: &mut Vec<tt::TokenTree<S>>, subtree: tt fn count<S>( ctx: &ExpandCtx<'_, S>, binding: &Binding<S>, + depth_curr: usize, + depth_max: usize, +) -> Result<usize, CountError> { + match binding { + Binding::Nested(bs) => { + if depth_curr == depth_max { + Ok(bs.len()) + } else { + bs.iter().map(|b| count(ctx, b, depth_curr + 1, depth_max)).sum() + } + } + Binding::Empty => Ok(0), + Binding::Fragment(_) | Binding::Missing(_) => Ok(1), + } +} + +fn count_old<S>( + ctx: &ExpandCtx<'_, S>, + binding: &Binding<S>, our_depth: usize, count_depth: Option<usize>, ) -> Result<usize, CountError> { match binding { Binding::Nested(bs) => match count_depth { - None => bs.iter().map(|b| count(ctx, b, our_depth + 1, None)).sum(), + None => bs.iter().map(|b| count_old(ctx, b, our_depth + 1, None)).sum(), Some(0) => Ok(bs.len()), - Some(d) => bs.iter().map(|b| count(ctx, b, our_depth + 1, Some(d - 1))).sum(), + Some(d) => bs.iter().map(|b| count_old(ctx, b, our_depth + 1, Some(d - 1))).sum(), }, Binding::Empty => Ok(0), Binding::Fragment(_) | Binding::Missing(_) => { diff --git a/src/tools/rust-analyzer/crates/mbe/src/lib.rs b/src/tools/rust-analyzer/crates/mbe/src/lib.rs index 9331798589f..2622d7eac10 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/lib.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/lib.rs @@ -16,7 +16,6 @@ mod to_parser_input; #[cfg(test)] mod benchmark; -mod token_map; use stdx::impl_from; use tt::Span; @@ -30,15 +29,12 @@ use crate::{ // FIXME: we probably should re-think `token_tree_to_syntax_node` interfaces pub use ::parser::TopEntryPoint; -pub use tt::{Delimiter, DelimiterKind, Punct, SyntaxContext}; - -pub use crate::{ - syntax_bridge::{ - parse_exprs_with_sep, parse_to_token_tree, parse_to_token_tree_static_span, - syntax_node_to_token_tree, syntax_node_to_token_tree_modified, token_tree_to_syntax_node, - SpanMapper, - }, - token_map::SpanMap, +pub use tt::{Delimiter, DelimiterKind, Punct}; + +pub use crate::syntax_bridge::{ + parse_exprs_with_sep, parse_to_token_tree, parse_to_token_tree_static_span, + syntax_node_to_token_tree, syntax_node_to_token_tree_modified, token_tree_to_syntax_node, + SpanMapper, }; pub use crate::syntax_bridge::dummy_test_span_utils::*; @@ -151,7 +147,12 @@ impl<S: Span> DeclarativeMacro<S> { } /// The old, `macro_rules! m {}` flavor. - pub fn parse_macro_rules(tt: &tt::Subtree<S>, is_2021: bool) -> DeclarativeMacro<S> { + pub fn parse_macro_rules( + tt: &tt::Subtree<S>, + is_2021: bool, + // FIXME: Remove this once we drop support for rust 1.76 (defaults to true then) + new_meta_vars: bool, + ) -> DeclarativeMacro<S> { // Note: this parsing can be implemented using mbe machinery itself, by // matching against `$($lhs:tt => $rhs:tt);*` pattern, but implementing // manually seems easier. @@ -160,7 +161,7 @@ impl<S: Span> DeclarativeMacro<S> { let mut err = None; while src.len() > 0 { - let rule = match Rule::parse(&mut src, true) { + let rule = match Rule::parse(&mut src, true, new_meta_vars) { Ok(it) => it, Err(e) => { err = Some(Box::new(e)); @@ -187,7 +188,12 @@ impl<S: Span> DeclarativeMacro<S> { } /// The new, unstable `macro m {}` flavor. - pub fn parse_macro2(tt: &tt::Subtree<S>, is_2021: bool) -> DeclarativeMacro<S> { + pub fn parse_macro2( + tt: &tt::Subtree<S>, + is_2021: bool, + // FIXME: Remove this once we drop support for rust 1.76 (defaults to true then) + new_meta_vars: bool, + ) -> DeclarativeMacro<S> { let mut src = TtIter::new(tt); let mut rules = Vec::new(); let mut err = None; @@ -195,7 +201,7 @@ impl<S: Span> DeclarativeMacro<S> { if tt::DelimiterKind::Brace == tt.delimiter.kind { cov_mark::hit!(parse_macro_def_rules); while src.len() > 0 { - let rule = match Rule::parse(&mut src, true) { + let rule = match Rule::parse(&mut src, true, new_meta_vars) { Ok(it) => it, Err(e) => { err = Some(Box::new(e)); @@ -214,7 +220,7 @@ impl<S: Span> DeclarativeMacro<S> { } } else { cov_mark::hit!(parse_macro_def_simple); - match Rule::parse(&mut src, false) { + match Rule::parse(&mut src, false, new_meta_vars) { Ok(rule) => { if src.len() != 0 { err = Some(Box::new(ParseError::expected("remaining tokens in macro def"))); @@ -245,13 +251,19 @@ impl<S: Span> DeclarativeMacro<S> { &self, tt: &tt::Subtree<S>, marker: impl Fn(&mut S) + Copy, + new_meta_vars: bool, + call_site: S, ) -> ExpandResult<tt::Subtree<S>> { - expander::expand_rules(&self.rules, &tt, marker, self.is_2021) + expander::expand_rules(&self.rules, &tt, marker, self.is_2021, new_meta_vars, call_site) } } impl<S: Span> Rule<S> { - fn parse(src: &mut TtIter<'_, S>, expect_arrow: bool) -> Result<Self, ParseError> { + fn parse( + src: &mut TtIter<'_, S>, + expect_arrow: bool, + new_meta_vars: bool, + ) -> Result<Self, ParseError> { let lhs = src.expect_subtree().map_err(|()| ParseError::expected("expected subtree"))?; if expect_arrow { src.expect_char('=').map_err(|()| ParseError::expected("expected `=`"))?; @@ -260,7 +272,7 @@ impl<S: Span> Rule<S> { let rhs = src.expect_subtree().map_err(|()| ParseError::expected("expected subtree"))?; let lhs = MetaTemplate::parse_pattern(lhs)?; - let rhs = MetaTemplate::parse_template(rhs)?; + let rhs = MetaTemplate::parse_template(rhs, new_meta_vars)?; Ok(crate::Rule { lhs, rhs }) } diff --git a/src/tools/rust-analyzer/crates/mbe/src/parser.rs b/src/tools/rust-analyzer/crates/mbe/src/parser.rs index 00ba35377a4..afdbbef2314 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/parser.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/parser.rs @@ -25,23 +25,26 @@ pub(crate) struct MetaTemplate<S>(pub(crate) Box<[Op<S>]>); impl<S: Span> MetaTemplate<S> { pub(crate) fn parse_pattern(pattern: &tt::Subtree<S>) -> Result<Self, ParseError> { - MetaTemplate::parse(pattern, Mode::Pattern) + MetaTemplate::parse(pattern, Mode::Pattern, false) } - pub(crate) fn parse_template(template: &tt::Subtree<S>) -> Result<Self, ParseError> { - MetaTemplate::parse(template, Mode::Template) + pub(crate) fn parse_template( + template: &tt::Subtree<S>, + new_meta_vars: bool, + ) -> Result<Self, ParseError> { + MetaTemplate::parse(template, Mode::Template, new_meta_vars) } pub(crate) fn iter(&self) -> impl Iterator<Item = &Op<S>> { self.0.iter() } - fn parse(tt: &tt::Subtree<S>, mode: Mode) -> Result<Self, ParseError> { + fn parse(tt: &tt::Subtree<S>, mode: Mode, new_meta_vars: bool) -> Result<Self, ParseError> { let mut src = TtIter::new(tt); let mut res = Vec::new(); while let Some(first) = src.peek_n(0) { - let op = next_op(first, &mut src, mode)?; + let op = next_op(first, &mut src, mode, new_meta_vars)?; res.push(op); } @@ -51,12 +54,35 @@ impl<S: Span> MetaTemplate<S> { #[derive(Clone, Debug, PartialEq, Eq)] pub(crate) enum Op<S> { - Var { name: SmolStr, kind: Option<MetaVarKind>, id: S }, - Ignore { name: SmolStr, id: S }, - Index { depth: usize }, - Count { name: SmolStr, depth: Option<usize> }, - Repeat { tokens: MetaTemplate<S>, kind: RepeatKind, separator: Option<Separator<S>> }, - Subtree { tokens: MetaTemplate<S>, delimiter: tt::Delimiter<S> }, + Var { + name: SmolStr, + kind: Option<MetaVarKind>, + id: S, + }, + Ignore { + name: SmolStr, + id: S, + }, + Index { + depth: usize, + }, + Length { + depth: usize, + }, + Count { + name: SmolStr, + // FIXME: `usize`` once we drop support for 1.76 + depth: Option<usize>, + }, + Repeat { + tokens: MetaTemplate<S>, + kind: RepeatKind, + separator: Option<Separator<S>>, + }, + Subtree { + tokens: MetaTemplate<S>, + delimiter: tt::Delimiter<S>, + }, Literal(tt::Literal<S>), Punct(SmallVec<[tt::Punct<S>; 3]>), Ident(tt::Ident<S>), @@ -122,6 +148,7 @@ fn next_op<S: Span>( first_peeked: &tt::TokenTree<S>, src: &mut TtIter<'_, S>, mode: Mode, + new_meta_vars: bool, ) -> Result<Op<S>, ParseError> { let res = match first_peeked { tt::TokenTree::Leaf(tt::Leaf::Punct(p @ tt::Punct { char: '$', .. })) => { @@ -135,14 +162,14 @@ fn next_op<S: Span>( tt::TokenTree::Subtree(subtree) => match subtree.delimiter.kind { tt::DelimiterKind::Parenthesis => { let (separator, kind) = parse_repeat(src)?; - let tokens = MetaTemplate::parse(subtree, mode)?; + let tokens = MetaTemplate::parse(subtree, mode, new_meta_vars)?; Op::Repeat { tokens, separator, kind } } tt::DelimiterKind::Brace => match mode { Mode::Template => { - parse_metavar_expr(&mut TtIter::new(subtree)).map_err(|()| { - ParseError::unexpected("invalid metavariable expression") - })? + parse_metavar_expr(new_meta_vars, &mut TtIter::new(subtree)).map_err( + |()| ParseError::unexpected("invalid metavariable expression"), + )? } Mode::Pattern => { return Err(ParseError::unexpected( @@ -206,7 +233,7 @@ fn next_op<S: Span>( tt::TokenTree::Subtree(subtree) => { src.next().expect("first token already peeked"); - let tokens = MetaTemplate::parse(subtree, mode)?; + let tokens = MetaTemplate::parse(subtree, mode, new_meta_vars)?; Op::Subtree { tokens, delimiter: subtree.delimiter } } }; @@ -287,7 +314,7 @@ fn parse_repeat<S: Span>( Err(ParseError::InvalidRepeat) } -fn parse_metavar_expr<S: Span>(src: &mut TtIter<'_, S>) -> Result<Op<S>, ()> { +fn parse_metavar_expr<S: Span>(new_meta_vars: bool, src: &mut TtIter<'_, S>) -> Result<Op<S>, ()> { let func = src.expect_ident()?; let args = src.expect_subtree()?; @@ -299,14 +326,19 @@ fn parse_metavar_expr<S: Span>(src: &mut TtIter<'_, S>) -> Result<Op<S>, ()> { let op = match &*func.text { "ignore" => { + if new_meta_vars { + args.expect_dollar()?; + } let ident = args.expect_ident()?; Op::Ignore { name: ident.text.clone(), id: ident.span } } "index" => Op::Index { depth: parse_depth(&mut args)? }, + "length" => Op::Length { depth: parse_depth(&mut args)? }, "count" => { + if new_meta_vars { + args.expect_dollar()?; + } let ident = args.expect_ident()?; - // `${count(t)}` and `${count(t,)}` have different meanings. Not sure if this is a bug - // but that's how it's implemented in rustc as of this writing. See rust-lang/rust#111904. let depth = if try_eat_comma(&mut args) { Some(parse_depth(&mut args)?) } else { None }; Op::Count { name: ident.text.clone(), depth } } diff --git a/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge.rs b/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge.rs index b89bfd74a6e..8fa04ab983f 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge.rs @@ -1,6 +1,7 @@ //! Conversions between [`SyntaxNode`] and [`tt::TokenTree`]. use rustc_hash::{FxHashMap, FxHashSet}; +use span::{SpanAnchor, SpanData, SpanMap}; use stdx::{never, non_empty_vec::NonEmptyVec}; use syntax::{ ast::{self, make::tokens::doc_comment}, @@ -10,10 +11,10 @@ use syntax::{ }; use tt::{ buffer::{Cursor, TokenBuffer}, - Span, SpanData, SyntaxContext, + Span, }; -use crate::{to_parser_input::to_parser_input, tt_iter::TtIter, SpanMap}; +use crate::{to_parser_input::to_parser_input, tt_iter::TtIter}; #[cfg(test)] mod tests; @@ -36,66 +37,70 @@ impl<S: Span, SM: SpanMapper<S>> SpanMapper<S> for &SM { /// Dummy things for testing where spans don't matter. pub(crate) mod dummy_test_span_utils { + use super::*; - pub type DummyTestSpanData = tt::SpanData<DummyTestSpanAnchor, DummyTestSyntaxContext>; - pub const DUMMY: DummyTestSpanData = DummyTestSpanData::DUMMY; + pub type DummyTestSpanData = span::SpanData<DummyTestSyntaxContext>; + pub const DUMMY: DummyTestSpanData = span::SpanData { + range: TextRange::empty(TextSize::new(0)), + anchor: span::SpanAnchor { + file_id: span::FileId::BOGUS, + ast_id: span::ROOT_ERASED_FILE_AST_ID, + }, + ctx: DummyTestSyntaxContext, + }; - #[derive(Debug, Copy, Clone, PartialEq, Eq, Hash)] - pub struct DummyTestSpanAnchor; - impl tt::SpanAnchor for DummyTestSpanAnchor { - const DUMMY: Self = DummyTestSpanAnchor; - } #[derive(Debug, Copy, Clone, PartialEq, Eq)] pub struct DummyTestSyntaxContext; - impl SyntaxContext for DummyTestSyntaxContext { - const DUMMY: Self = DummyTestSyntaxContext; - } pub struct DummyTestSpanMap; - impl SpanMapper<tt::SpanData<DummyTestSpanAnchor, DummyTestSyntaxContext>> for DummyTestSpanMap { - fn span_for( - &self, - range: syntax::TextRange, - ) -> tt::SpanData<DummyTestSpanAnchor, DummyTestSyntaxContext> { - tt::SpanData { range, anchor: DummyTestSpanAnchor, ctx: DummyTestSyntaxContext } + impl SpanMapper<span::SpanData<DummyTestSyntaxContext>> for DummyTestSpanMap { + fn span_for(&self, range: syntax::TextRange) -> span::SpanData<DummyTestSyntaxContext> { + span::SpanData { + range, + anchor: span::SpanAnchor { + file_id: span::FileId::BOGUS, + ast_id: span::ROOT_ERASED_FILE_AST_ID, + }, + ctx: DummyTestSyntaxContext, + } } } } /// Converts a syntax tree to a [`tt::Subtree`] using the provided span map to populate the /// subtree's spans. -pub fn syntax_node_to_token_tree<Anchor, Ctx, SpanMap>( +pub fn syntax_node_to_token_tree<Ctx, SpanMap>( node: &SyntaxNode, map: SpanMap, -) -> tt::Subtree<SpanData<Anchor, Ctx>> + span: SpanData<Ctx>, +) -> tt::Subtree<SpanData<Ctx>> where - SpanData<Anchor, Ctx>: Span, - Anchor: Copy, - Ctx: SyntaxContext, - SpanMap: SpanMapper<SpanData<Anchor, Ctx>>, + SpanData<Ctx>: Span, + Ctx: Copy, + SpanMap: SpanMapper<SpanData<Ctx>>, { - let mut c = Converter::new(node, map, Default::default(), Default::default()); + let mut c = Converter::new(node, map, Default::default(), Default::default(), span); convert_tokens(&mut c) } /// Converts a syntax tree to a [`tt::Subtree`] using the provided span map to populate the /// subtree's spans. Additionally using the append and remove parameters, the additional tokens can /// be injected or hidden from the output. -pub fn syntax_node_to_token_tree_modified<Anchor, Ctx, SpanMap>( +pub fn syntax_node_to_token_tree_modified<Ctx, SpanMap>( node: &SyntaxNode, map: SpanMap, - append: FxHashMap<SyntaxElement, Vec<tt::Leaf<SpanData<Anchor, Ctx>>>>, + append: FxHashMap<SyntaxElement, Vec<tt::Leaf<SpanData<Ctx>>>>, remove: FxHashSet<SyntaxNode>, -) -> tt::Subtree<SpanData<Anchor, Ctx>> + call_site: SpanData<Ctx>, +) -> tt::Subtree<SpanData<Ctx>> where - SpanMap: SpanMapper<SpanData<Anchor, Ctx>>, - SpanData<Anchor, Ctx>: Span, - Anchor: Copy, - Ctx: SyntaxContext, + SpanMap: SpanMapper<SpanData<Ctx>>, + SpanData<Ctx>: Span, + Ctx: Copy, { - let mut c = Converter::new(node, map, append, remove); + let mut c = Converter::new(node, map, append, remove, call_site); convert_tokens(&mut c) } @@ -113,14 +118,13 @@ where /// Converts a [`tt::Subtree`] back to a [`SyntaxNode`]. /// The produced `SpanMap` contains a mapping from the syntax nodes offsets to the subtree's spans. -pub fn token_tree_to_syntax_node<Anchor, Ctx>( - tt: &tt::Subtree<SpanData<Anchor, Ctx>>, +pub fn token_tree_to_syntax_node<Ctx>( + tt: &tt::Subtree<SpanData<Ctx>>, entry_point: parser::TopEntryPoint, -) -> (Parse<SyntaxNode>, SpanMap<SpanData<Anchor, Ctx>>) +) -> (Parse<SyntaxNode>, SpanMap<SpanData<Ctx>>) where - SpanData<Anchor, Ctx>: Span, - Anchor: Copy, - Ctx: SyntaxContext, + SpanData<Ctx>: Span, + Ctx: Copy, { let buffer = match tt { tt::Subtree { @@ -150,21 +154,20 @@ where /// Convert a string to a `TokenTree`. The spans of the subtree will be anchored to the provided /// anchor with the given context. -pub fn parse_to_token_tree<Anchor, Ctx>( - anchor: Anchor, +pub fn parse_to_token_tree<Ctx>( + anchor: SpanAnchor, ctx: Ctx, text: &str, -) -> Option<tt::Subtree<SpanData<Anchor, Ctx>>> +) -> Option<tt::Subtree<SpanData<Ctx>>> where - SpanData<Anchor, Ctx>: Span, - Anchor: Copy, - Ctx: SyntaxContext, + SpanData<Ctx>: Span, + Ctx: Copy, { let lexed = parser::LexedStr::new(text); if lexed.errors().next().is_some() { return None; } - let mut conv = RawConverter { lexed, pos: 0, anchor, ctx }; + let mut conv = RawConverter { lexed, anchor, pos: 0, ctx }; Some(convert_tokens(&mut conv)) } @@ -182,7 +185,11 @@ where } /// Split token tree with separate expr: $($e:expr)SEP* -pub fn parse_exprs_with_sep<S: Span>(tt: &tt::Subtree<S>, sep: char) -> Vec<tt::Subtree<S>> { +pub fn parse_exprs_with_sep<S: Span>( + tt: &tt::Subtree<S>, + sep: char, + span: S, +) -> Vec<tt::Subtree<S>> { if tt.token_trees.is_empty() { return Vec::new(); } @@ -195,7 +202,7 @@ pub fn parse_exprs_with_sep<S: Span>(tt: &tt::Subtree<S>, sep: char) -> Vec<tt:: res.push(match expanded.value { None => break, - Some(tt) => tt.subtree_or_wrap(), + Some(tt) => tt.subtree_or_wrap(tt::DelimSpan { open: span, close: span }), }); let mut fork = iter.clone(); @@ -207,7 +214,7 @@ pub fn parse_exprs_with_sep<S: Span>(tt: &tt::Subtree<S>, sep: char) -> Vec<tt:: if iter.peek_n(0).is_some() { res.push(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + delimiter: tt::Delimiter::invisible_spanned(span), token_trees: iter.cloned().collect(), }); } @@ -220,7 +227,10 @@ where C: TokenConverter<S>, S: Span, { - let entry = tt::Subtree { delimiter: tt::Delimiter::DUMMY_INVISIBLE, token_trees: vec![] }; + let entry = tt::Subtree { + delimiter: tt::Delimiter::invisible_spanned(conv.call_site()), + token_trees: vec![], + }; let mut stack = NonEmptyVec::new(entry); while let Some((token, abs_range)) = conv.bump() { @@ -401,9 +411,20 @@ fn doc_comment_text(comment: &ast::Comment) -> SmolStr { text = &text[0..text.len() - 2]; } - // Quote the string + let mut num_of_hashes = 0; + let mut count = 0; + for ch in text.chars() { + count = match ch { + '"' => 1, + '#' if count > 0 => count + 1, + _ => 0, + }; + num_of_hashes = num_of_hashes.max(count); + } + + // Quote raw string with delimiters // Note that `tt::Literal` expect an escaped string - let text = format!("\"{}\"", text.escape_debug()); + let text = format!("r{delim}\"{text}\"{delim}", delim = "#".repeat(num_of_hashes)); text.into() } @@ -450,10 +471,10 @@ fn convert_doc_comment<S: Copy>( } /// A raw token (straight from lexer) converter -struct RawConverter<'a, Anchor, Ctx> { +struct RawConverter<'a, Ctx> { lexed: parser::LexedStr<'a>, pos: usize, - anchor: Anchor, + anchor: SpanAnchor, ctx: Ctx, } /// A raw token (straight from lexer) converter that gives every token the same span. @@ -485,18 +506,20 @@ trait TokenConverter<S>: Sized { fn peek(&self) -> Option<Self::Token>; fn span_for(&self, range: TextRange) -> S; + + fn call_site(&self) -> S; } -impl<Anchor, S, Ctx> SrcToken<RawConverter<'_, Anchor, Ctx>, S> for usize { - fn kind(&self, ctx: &RawConverter<'_, Anchor, Ctx>) -> SyntaxKind { +impl<S, Ctx> SrcToken<RawConverter<'_, Ctx>, S> for usize { + fn kind(&self, ctx: &RawConverter<'_, Ctx>) -> SyntaxKind { ctx.lexed.kind(*self) } - fn to_char(&self, ctx: &RawConverter<'_, Anchor, Ctx>) -> Option<char> { + fn to_char(&self, ctx: &RawConverter<'_, Ctx>) -> Option<char> { ctx.lexed.text(*self).chars().next() } - fn to_text(&self, ctx: &RawConverter<'_, Anchor, Ctx>) -> SmolStr { + fn to_text(&self, ctx: &RawConverter<'_, Ctx>) -> SmolStr { ctx.lexed.text(*self).into() } } @@ -515,18 +538,17 @@ impl<S: Span> SrcToken<StaticRawConverter<'_, S>, S> for usize { } } -impl<Anchor: Copy, Ctx: SyntaxContext> TokenConverter<SpanData<Anchor, Ctx>> - for RawConverter<'_, Anchor, Ctx> +impl<Ctx: Copy> TokenConverter<SpanData<Ctx>> for RawConverter<'_, Ctx> where - SpanData<Anchor, Ctx>: Span, + SpanData<Ctx>: Span, { type Token = usize; fn convert_doc_comment( &self, &token: &usize, - span: SpanData<Anchor, Ctx>, - ) -> Option<Vec<tt::TokenTree<SpanData<Anchor, Ctx>>>> { + span: SpanData<Ctx>, + ) -> Option<Vec<tt::TokenTree<SpanData<Ctx>>>> { let text = self.lexed.text(token); convert_doc_comment(&doc_comment(text), span) } @@ -550,9 +572,13 @@ where Some(self.pos) } - fn span_for(&self, range: TextRange) -> SpanData<Anchor, Ctx> { + fn span_for(&self, range: TextRange) -> SpanData<Ctx> { SpanData { range, anchor: self.anchor, ctx: self.ctx } } + + fn call_site(&self) -> SpanData<Ctx> { + SpanData { range: TextRange::empty(0.into()), anchor: self.anchor, ctx: self.ctx } + } } impl<S> TokenConverter<S> for StaticRawConverter<'_, S> @@ -588,6 +614,10 @@ where fn span_for(&self, _: TextRange) -> S { self.span } + + fn call_site(&self) -> S { + self.span + } } struct Converter<SpanMap, S> { @@ -600,6 +630,7 @@ struct Converter<SpanMap, S> { map: SpanMap, append: FxHashMap<SyntaxElement, Vec<tt::Leaf<S>>>, remove: FxHashSet<SyntaxNode>, + call_site: S, } impl<SpanMap, S> Converter<SpanMap, S> { @@ -608,6 +639,7 @@ impl<SpanMap, S> Converter<SpanMap, S> { map: SpanMap, append: FxHashMap<SyntaxElement, Vec<tt::Leaf<S>>>, remove: FxHashSet<SyntaxNode>, + call_site: S, ) -> Self { let mut this = Converter { current: None, @@ -617,6 +649,7 @@ impl<SpanMap, S> Converter<SpanMap, S> { map, append, remove, + call_site, current_leafs: vec![], }; let first = this.next_token(); @@ -776,24 +809,27 @@ where fn span_for(&self, range: TextRange) -> S { self.map.span_for(range) } + fn call_site(&self) -> S { + self.call_site + } } -struct TtTreeSink<'a, Anchor, Ctx> +struct TtTreeSink<'a, Ctx> where - SpanData<Anchor, Ctx>: Span, + SpanData<Ctx>: Span, { buf: String, - cursor: Cursor<'a, SpanData<Anchor, Ctx>>, + cursor: Cursor<'a, SpanData<Ctx>>, text_pos: TextSize, inner: SyntaxTreeBuilder, - token_map: SpanMap<SpanData<Anchor, Ctx>>, + token_map: SpanMap<SpanData<Ctx>>, } -impl<'a, Anchor, Ctx> TtTreeSink<'a, Anchor, Ctx> +impl<'a, Ctx> TtTreeSink<'a, Ctx> where - SpanData<Anchor, Ctx>: Span, + SpanData<Ctx>: Span, { - fn new(cursor: Cursor<'a, SpanData<Anchor, Ctx>>) -> Self { + fn new(cursor: Cursor<'a, SpanData<Ctx>>) -> Self { TtTreeSink { buf: String::new(), cursor, @@ -803,7 +839,7 @@ where } } - fn finish(mut self) -> (Parse<SyntaxNode>, SpanMap<SpanData<Anchor, Ctx>>) { + fn finish(mut self) -> (Parse<SyntaxNode>, SpanMap<SpanData<Ctx>>) { self.token_map.finish(); (self.inner.finish(), self.token_map) } @@ -821,9 +857,9 @@ fn delim_to_str(d: tt::DelimiterKind, closing: bool) -> Option<&'static str> { Some(&texts[idx..texts.len() - (1 - idx)]) } -impl<Anchor, Ctx> TtTreeSink<'_, Anchor, Ctx> +impl<Ctx> TtTreeSink<'_, Ctx> where - SpanData<Anchor, Ctx>: Span, + SpanData<Ctx>: Span, { /// Parses a float literal as if it was a one to two name ref nodes with a dot inbetween. /// This occurs when a float literal is used as a field access. diff --git a/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge/tests.rs b/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge/tests.rs index bd8187a148a..e5569138dbf 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge/tests.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/syntax_bridge/tests.rs @@ -7,11 +7,11 @@ use tt::{ Leaf, Punct, Spacing, }; -use crate::{syntax_node_to_token_tree, DummyTestSpanData, DummyTestSpanMap}; +use crate::{syntax_node_to_token_tree, DummyTestSpanData, DummyTestSpanMap, DUMMY}; fn check_punct_spacing(fixture: &str) { let source_file = ast::SourceFile::parse(fixture).ok().unwrap(); - let subtree = syntax_node_to_token_tree(source_file.syntax(), DummyTestSpanMap); + let subtree = syntax_node_to_token_tree(source_file.syntax(), DummyTestSpanMap, DUMMY); let mut annotations: HashMap<_, _> = extract_annotations(fixture) .into_iter() .map(|(range, annotation)| { diff --git a/src/tools/rust-analyzer/crates/mbe/src/tt_iter.rs b/src/tools/rust-analyzer/crates/mbe/src/tt_iter.rs index 40e8a2385f4..71513ef4391 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/tt_iter.rs +++ b/src/tools/rust-analyzer/crates/mbe/src/tt_iter.rs @@ -51,6 +51,13 @@ impl<'a, S: Span> TtIter<'a, S> { } } + pub(crate) fn expect_dollar(&mut self) -> Result<(), ()> { + match self.expect_leaf()? { + tt::Leaf::Punct(tt::Punct { char: '$', .. }) => Ok(()), + _ => Err(()), + } + } + pub(crate) fn expect_ident(&mut self) -> Result<&'a tt::Ident<S>, ()> { match self.expect_leaf()? { tt::Leaf::Ident(it) if it.text != "_" => Ok(it), @@ -169,10 +176,10 @@ impl<'a, S: Span> TtIter<'a, S> { } self.inner = self.inner.as_slice()[res.len()..].iter(); - let res = match res.len() { - 0 | 1 => res.pop(), - _ => Some(tt::TokenTree::Subtree(tt::Subtree { - delimiter: tt::Delimiter::DUMMY_INVISIBLE, + let res = match &*res { + [] | [_] => res.pop(), + [first, ..] => Some(tt::TokenTree::Subtree(tt::Subtree { + delimiter: tt::Delimiter::invisible_spanned(first.first_span()), token_trees: res, })), }; diff --git a/src/tools/rust-analyzer/crates/parser/Cargo.toml b/src/tools/rust-analyzer/crates/parser/Cargo.toml index efb326323f9..0c63484634b 100644 --- a/src/tools/rust-analyzer/crates/parser/Cargo.toml +++ b/src/tools/rust-analyzer/crates/parser/Cargo.toml @@ -25,3 +25,6 @@ sourcegen.workspace = true [features] in-rust-tree = ["rustc-dependencies/in-rust-tree"] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/paths/Cargo.toml b/src/tools/rust-analyzer/crates/paths/Cargo.toml index 28b54be5212..3d8752b5a82 100644 --- a/src/tools/rust-analyzer/crates/paths/Cargo.toml +++ b/src/tools/rust-analyzer/crates/paths/Cargo.toml @@ -16,3 +16,6 @@ doctest = false # serde-derive crate. Even though we don't activate the derive feature here, # someone else in the crate graph certainly does! # serde.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/proc-macro-api/Cargo.toml b/src/tools/rust-analyzer/crates/proc-macro-api/Cargo.toml index 2cbbc9489a2..49a0979f4f5 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-api/Cargo.toml +++ b/src/tools/rust-analyzer/crates/proc-macro-api/Cargo.toml @@ -33,7 +33,11 @@ tt.workspace = true stdx.workspace = true profile.workspace = true text-size.workspace = true +span.workspace = true # Ideally this crate would not depend on salsa things, but we need span information here which wraps # InternIds for the syntax context base-db.workspace = true la-arena.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/proc-macro-api/src/lib.rs b/src/tools/rust-analyzer/crates/proc-macro-api/src/lib.rs index f697ecd3518..a87becd63e2 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-api/src/lib.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-api/src/lib.rs @@ -11,16 +11,19 @@ pub mod msg; mod process; mod version; -use base_db::span::SpanData; use indexmap::IndexSet; use paths::AbsPathBuf; +use span::Span; use std::{fmt, io, sync::Mutex}; use triomphe::Arc; use serde::{Deserialize, Serialize}; use crate::{ - msg::{ExpandMacro, ExpnGlobals, FlatTree, PanicMessage, HAS_GLOBAL_SPANS}, + msg::{ + deserialize_span_data_index_map, flat::serialize_span_data_index_map, ExpandMacro, + ExpnGlobals, FlatTree, PanicMessage, HAS_GLOBAL_SPANS, RUST_ANALYZER_SPAN_SUPPORT, + }, process::ProcMacroProcessSrv, }; @@ -136,13 +139,13 @@ impl ProcMacro { pub fn expand( &self, - subtree: &tt::Subtree<SpanData>, - attr: Option<&tt::Subtree<SpanData>>, + subtree: &tt::Subtree<Span>, + attr: Option<&tt::Subtree<Span>>, env: Vec<(String, String)>, - def_site: SpanData, - call_site: SpanData, - mixed_site: SpanData, - ) -> Result<Result<tt::Subtree<SpanData>, PanicMessage>, ServerError> { + def_site: Span, + call_site: Span, + mixed_site: Span, + ) -> Result<Result<tt::Subtree<Span>, PanicMessage>, ServerError> { let version = self.process.lock().unwrap_or_else(|e| e.into_inner()).version(); let current_dir = env .iter() @@ -166,6 +169,11 @@ impl ProcMacro { call_site, mixed_site, }, + span_data_table: if version >= RUST_ANALYZER_SPAN_SUPPORT { + serialize_span_data_index_map(&span_data_table) + } else { + Vec::new() + }, }; let response = self @@ -178,9 +186,14 @@ impl ProcMacro { msg::Response::ExpandMacro(it) => { Ok(it.map(|tree| FlatTree::to_subtree_resolved(tree, version, &span_data_table))) } - msg::Response::ListMacros(..) | msg::Response::ApiVersionCheck(..) => { - Err(ServerError { message: "unexpected response".to_string(), io: None }) - } + msg::Response::ExpandMacroExtended(it) => Ok(it.map(|resp| { + FlatTree::to_subtree_resolved( + resp.tree, + version, + &deserialize_span_data_index_map(&resp.span_data_table), + ) + })), + _ => Err(ServerError { message: "unexpected response".to_string(), io: None }), } } } diff --git a/src/tools/rust-analyzer/crates/proc-macro-api/src/msg.rs b/src/tools/rust-analyzer/crates/proc-macro-api/src/msg.rs index 1d3e45aff38..557ddba5c78 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-api/src/msg.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-api/src/msg.rs @@ -10,28 +10,63 @@ use serde::{de::DeserializeOwned, Deserialize, Serialize}; use crate::ProcMacroKind; -pub use crate::msg::flat::{FlatTree, TokenId}; +pub use crate::msg::flat::{ + deserialize_span_data_index_map, serialize_span_data_index_map, FlatTree, SpanDataIndexMap, + TokenId, +}; // The versions of the server protocol pub const NO_VERSION_CHECK_VERSION: u32 = 0; pub const VERSION_CHECK_VERSION: u32 = 1; pub const ENCODE_CLOSE_SPAN_VERSION: u32 = 2; pub const HAS_GLOBAL_SPANS: u32 = 3; +pub const RUST_ANALYZER_SPAN_SUPPORT: u32 = 4; -pub const CURRENT_API_VERSION: u32 = HAS_GLOBAL_SPANS; +pub const CURRENT_API_VERSION: u32 = RUST_ANALYZER_SPAN_SUPPORT; #[derive(Debug, Serialize, Deserialize)] pub enum Request { + /// Since [`NO_VERSION_CHECK_VERSION`] ListMacros { dylib_path: PathBuf }, + /// Since [`NO_VERSION_CHECK_VERSION`] ExpandMacro(ExpandMacro), + /// Since [`VERSION_CHECK_VERSION`] ApiVersionCheck {}, + /// Since [`RUST_ANALYZER_SPAN_SUPPORT`] + SetConfig(ServerConfig), +} + +#[derive(Copy, Clone, Default, Debug, Serialize, Deserialize)] +pub enum SpanMode { + #[default] + Id, + RustAnalyzer, } #[derive(Debug, Serialize, Deserialize)] pub enum Response { + /// Since [`NO_VERSION_CHECK_VERSION`] ListMacros(Result<Vec<(String, ProcMacroKind)>, String>), + /// Since [`NO_VERSION_CHECK_VERSION`] ExpandMacro(Result<FlatTree, PanicMessage>), + /// Since [`NO_VERSION_CHECK_VERSION`] ApiVersionCheck(u32), + /// Since [`RUST_ANALYZER_SPAN_SUPPORT`] + SetConfig(ServerConfig), + /// Since [`RUST_ANALYZER_SPAN_SUPPORT`] + ExpandMacroExtended(Result<ExpandMacroExtended, PanicMessage>), +} + +#[derive(Debug, Serialize, Deserialize, Default)] +#[serde(default)] +pub struct ServerConfig { + pub span_mode: SpanMode, +} + +#[derive(Debug, Serialize, Deserialize)] +pub struct ExpandMacroExtended { + pub tree: FlatTree, + pub span_data_table: Vec<u32>, } #[derive(Debug, Serialize, Deserialize)] @@ -64,9 +99,12 @@ pub struct ExpandMacro { #[serde(skip_serializing_if = "ExpnGlobals::skip_serializing_if")] #[serde(default)] pub has_global_spans: ExpnGlobals, + #[serde(skip_serializing_if = "Vec::is_empty")] + #[serde(default)] + pub span_data_table: Vec<u32>, } -#[derive(Default, Debug, Serialize, Deserialize)] +#[derive(Copy, Clone, Default, Debug, Serialize, Deserialize)] pub struct ExpnGlobals { #[serde(skip_serializing)] #[serde(default)] @@ -136,29 +174,27 @@ fn write_json(out: &mut impl Write, msg: &str) -> io::Result<()> { #[cfg(test)] mod tests { - use base_db::{ - span::{ErasedFileAstId, SpanAnchor, SpanData, SyntaxContextId}, - FileId, - }; + use base_db::FileId; use la_arena::RawIdx; + use span::{ErasedFileAstId, Span, SpanAnchor, SyntaxContextId}; use text_size::{TextRange, TextSize}; use tt::{Delimiter, DelimiterKind, Ident, Leaf, Literal, Punct, Spacing, Subtree, TokenTree}; use super::*; - fn fixture_token_tree() -> Subtree<SpanData> { + fn fixture_token_tree() -> Subtree<Span> { let anchor = SpanAnchor { file_id: FileId::from_raw(0), ast_id: ErasedFileAstId::from_raw(RawIdx::from(0)), }; let mut subtree = Subtree { delimiter: Delimiter { - open: SpanData { + open: Span { range: TextRange::empty(TextSize::new(0)), anchor, ctx: SyntaxContextId::ROOT, }, - close: SpanData { + close: Span { range: TextRange::empty(TextSize::new(13)), anchor, ctx: SyntaxContextId::ROOT, @@ -170,7 +206,7 @@ mod tests { subtree.token_trees.push(TokenTree::Leaf( Ident { text: "struct".into(), - span: SpanData { + span: Span { range: TextRange::at(TextSize::new(0), TextSize::of("struct")), anchor, ctx: SyntaxContextId::ROOT, @@ -181,7 +217,7 @@ mod tests { subtree.token_trees.push(TokenTree::Leaf( Ident { text: "Foo".into(), - span: SpanData { + span: Span { range: TextRange::at(TextSize::new(5), TextSize::of("Foo")), anchor, ctx: SyntaxContextId::ROOT, @@ -192,7 +228,7 @@ mod tests { subtree.token_trees.push(TokenTree::Leaf(Leaf::Literal(Literal { text: "Foo".into(), - span: SpanData { + span: Span { range: TextRange::at(TextSize::new(8), TextSize::of("Foo")), anchor, ctx: SyntaxContextId::ROOT, @@ -200,7 +236,7 @@ mod tests { }))); subtree.token_trees.push(TokenTree::Leaf(Leaf::Punct(Punct { char: '@', - span: SpanData { + span: Span { range: TextRange::at(TextSize::new(11), TextSize::of('@')), anchor, ctx: SyntaxContextId::ROOT, @@ -209,12 +245,12 @@ mod tests { }))); subtree.token_trees.push(TokenTree::Subtree(Subtree { delimiter: Delimiter { - open: SpanData { + open: Span { range: TextRange::at(TextSize::new(12), TextSize::of('{')), anchor, ctx: SyntaxContextId::ROOT, }, - close: SpanData { + close: Span { range: TextRange::at(TextSize::new(13), TextSize::of('}')), anchor, ctx: SyntaxContextId::ROOT, @@ -243,6 +279,7 @@ mod tests { call_site: 0, mixed_site: 0, }, + span_data_table: Vec::new(), }; let json = serde_json::to_string(&task).unwrap(); diff --git a/src/tools/rust-analyzer/crates/proc-macro-api/src/msg/flat.rs b/src/tools/rust-analyzer/crates/proc-macro-api/src/msg/flat.rs index 5835718628e..8dfaba52625 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-api/src/msg/flat.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-api/src/msg/flat.rs @@ -37,13 +37,46 @@ use std::collections::{HashMap, VecDeque}; -use base_db::span::SpanData; use indexmap::IndexSet; +use la_arena::RawIdx; use serde::{Deserialize, Serialize}; +use span::{ErasedFileAstId, FileId, Span, SpanAnchor, SyntaxContextId}; +use text_size::TextRange; use crate::msg::ENCODE_CLOSE_SPAN_VERSION; -type SpanDataIndexMap = IndexSet<SpanData>; +pub type SpanDataIndexMap = IndexSet<Span>; + +pub fn serialize_span_data_index_map(map: &SpanDataIndexMap) -> Vec<u32> { + map.iter() + .flat_map(|span| { + [ + span.anchor.file_id.index(), + span.anchor.ast_id.into_raw().into_u32(), + span.range.start().into(), + span.range.end().into(), + span.ctx.into_u32(), + ] + }) + .collect() +} + +pub fn deserialize_span_data_index_map(map: &[u32]) -> SpanDataIndexMap { + debug_assert!(map.len() % 5 == 0); + map.chunks_exact(5) + .map(|span| { + let &[file_id, ast_id, start, end, e] = span else { unreachable!() }; + Span { + anchor: SpanAnchor { + file_id: FileId::from_raw(file_id), + ast_id: ErasedFileAstId::from_raw(RawIdx::from_u32(ast_id)), + }, + range: TextRange::new(start.into(), end.into()), + ctx: SyntaxContextId::from_u32(e), + } + }) + .collect() +} #[derive(Clone, Copy, PartialEq, Eq, Hash)] pub struct TokenId(pub u32); @@ -54,9 +87,7 @@ impl std::fmt::Debug for TokenId { } } -impl tt::Span for TokenId { - const DUMMY: Self = TokenId(!0); -} +impl tt::Span for TokenId {} #[derive(Serialize, Deserialize, Debug)] pub struct FlatTree { @@ -93,7 +124,7 @@ struct IdentRepr { impl FlatTree { pub fn new( - subtree: &tt::Subtree<SpanData>, + subtree: &tt::Subtree<Span>, version: u32, span_data_table: &mut SpanDataIndexMap, ) -> FlatTree { @@ -158,7 +189,7 @@ impl FlatTree { self, version: u32, span_data_table: &SpanDataIndexMap, - ) -> tt::Subtree<SpanData> { + ) -> tt::Subtree<Span> { Reader { subtree: if version >= ENCODE_CLOSE_SPAN_VERSION { read_vec(self.subtree, SubtreeRepr::read_with_close_span) @@ -281,13 +312,13 @@ impl IdentRepr { } } -trait Span: Copy { +trait InternableSpan: Copy { type Table; fn token_id_of(table: &mut Self::Table, s: Self) -> TokenId; fn span_for_token_id(table: &Self::Table, id: TokenId) -> Self; } -impl Span for TokenId { +impl InternableSpan for TokenId { type Table = (); fn token_id_of((): &mut Self::Table, token_id: Self) -> TokenId { token_id @@ -297,8 +328,8 @@ impl Span for TokenId { id } } -impl Span for SpanData { - type Table = IndexSet<SpanData>; +impl InternableSpan for Span { + type Table = IndexSet<Span>; fn token_id_of(table: &mut Self::Table, span: Self) -> TokenId { TokenId(table.insert_full(span).0 as u32) } @@ -307,7 +338,7 @@ impl Span for SpanData { } } -struct Writer<'a, 'span, S: Span> { +struct Writer<'a, 'span, S: InternableSpan> { work: VecDeque<(usize, &'a tt::Subtree<S>)>, string_table: HashMap<&'a str, u32>, span_data_table: &'span mut S::Table, @@ -320,7 +351,7 @@ struct Writer<'a, 'span, S: Span> { text: Vec<String>, } -impl<'a, 'span, S: Span> Writer<'a, 'span, S> { +impl<'a, 'span, S: InternableSpan> Writer<'a, 'span, S> { fn write(&mut self, root: &'a tt::Subtree<S>) { self.enqueue(root); while let Some((idx, subtree)) = self.work.pop_front() { @@ -393,7 +424,7 @@ impl<'a, 'span, S: Span> Writer<'a, 'span, S> { } } -struct Reader<'span, S: Span> { +struct Reader<'span, S: InternableSpan> { subtree: Vec<SubtreeRepr>, literal: Vec<LiteralRepr>, punct: Vec<PunctRepr>, @@ -403,7 +434,7 @@ struct Reader<'span, S: Span> { span_data_table: &'span S::Table, } -impl<'span, S: Span> Reader<'span, S> { +impl<'span, S: InternableSpan> Reader<'span, S> { pub(crate) fn read(self) -> tt::Subtree<S> { let mut res: Vec<Option<tt::Subtree<S>>> = vec![None; self.subtree.len()]; let read_span = |id| S::span_for_token_id(self.span_data_table, id); diff --git a/src/tools/rust-analyzer/crates/proc-macro-api/src/process.rs b/src/tools/rust-analyzer/crates/proc-macro-api/src/process.rs index 9a20fa63ed7..3494164c067 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-api/src/process.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-api/src/process.rs @@ -9,7 +9,7 @@ use paths::{AbsPath, AbsPathBuf}; use stdx::JodChild; use crate::{ - msg::{Message, Request, Response, CURRENT_API_VERSION}, + msg::{Message, Request, Response, SpanMode, CURRENT_API_VERSION, RUST_ANALYZER_SPAN_SUPPORT}, ProcMacroKind, ServerError, }; @@ -19,6 +19,7 @@ pub(crate) struct ProcMacroProcessSrv { stdin: ChildStdin, stdout: BufReader<ChildStdout>, version: u32, + mode: SpanMode, } impl ProcMacroProcessSrv { @@ -27,7 +28,13 @@ impl ProcMacroProcessSrv { let mut process = Process::run(process_path.clone(), null_stderr)?; let (stdin, stdout) = process.stdio().expect("couldn't access child stdio"); - io::Result::Ok(ProcMacroProcessSrv { _process: process, stdin, stdout, version: 0 }) + io::Result::Ok(ProcMacroProcessSrv { + _process: process, + stdin, + stdout, + version: 0, + mode: SpanMode::Id, + }) }; let mut srv = create_srv(true)?; tracing::info!("sending version check"); @@ -43,6 +50,11 @@ impl ProcMacroProcessSrv { tracing::info!("got version {v}"); srv = create_srv(false)?; srv.version = v; + if srv.version > RUST_ANALYZER_SPAN_SUPPORT { + if let Ok(mode) = srv.enable_rust_analyzer_spans() { + srv.mode = mode; + } + } Ok(srv) } Err(e) => { @@ -62,9 +74,19 @@ impl ProcMacroProcessSrv { match response { Response::ApiVersionCheck(version) => Ok(version), - Response::ExpandMacro { .. } | Response::ListMacros { .. } => { - Err(ServerError { message: "unexpected response".to_string(), io: None }) - } + _ => Err(ServerError { message: "unexpected response".to_string(), io: None }), + } + } + + fn enable_rust_analyzer_spans(&mut self) -> Result<SpanMode, ServerError> { + let request = Request::SetConfig(crate::msg::ServerConfig { + span_mode: crate::msg::SpanMode::RustAnalyzer, + }); + let response = self.send_task(request)?; + + match response { + Response::SetConfig(crate::msg::ServerConfig { span_mode }) => Ok(span_mode), + _ => Err(ServerError { message: "unexpected response".to_string(), io: None }), } } @@ -78,9 +100,7 @@ impl ProcMacroProcessSrv { match response { Response::ListMacros(it) => Ok(it), - Response::ExpandMacro { .. } | Response::ApiVersionCheck { .. } => { - Err(ServerError { message: "unexpected response".to_string(), io: None }) - } + _ => Err(ServerError { message: "unexpected response".to_string(), io: None }), } } diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv-cli/Cargo.toml b/src/tools/rust-analyzer/crates/proc-macro-srv-cli/Cargo.toml index 8f03c6ec7b5..a559ba01755 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv-cli/Cargo.toml +++ b/src/tools/rust-analyzer/crates/proc-macro-srv-cli/Cargo.toml @@ -14,7 +14,12 @@ proc-macro-api.workspace = true [features] sysroot-abi = ["proc-macro-srv/sysroot-abi"] +in-rust-tree = ["proc-macro-srv/in-rust-tree", "sysroot-abi"] + [[bin]] name = "rust-analyzer-proc-macro-srv" path = "src/main.rs" + +[lints] +workspace = true diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv-cli/src/main.rs b/src/tools/rust-analyzer/crates/proc-macro-srv-cli/src/main.rs index 50ce586fc42..87f7555b02c 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv-cli/src/main.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv-cli/src/main.rs @@ -1,5 +1,9 @@ //! A standalone binary for `proc-macro-srv`. //! Driver for proc macro server +#![cfg_attr(feature = "in-rust-tree", feature(rustc_private))] +#[cfg(feature = "in-rust-tree")] +extern crate rustc_driver as _; + use std::io; fn main() -> std::io::Result<()> { @@ -39,10 +43,22 @@ fn run() -> io::Result<()> { msg::Request::ListMacros { dylib_path } => { msg::Response::ListMacros(srv.list_macros(&dylib_path)) } - msg::Request::ExpandMacro(task) => msg::Response::ExpandMacro(srv.expand(task)), + msg::Request::ExpandMacro(task) => match srv.span_mode() { + msg::SpanMode::Id => msg::Response::ExpandMacro(srv.expand(task).map(|(it, _)| it)), + msg::SpanMode::RustAnalyzer => msg::Response::ExpandMacroExtended( + srv.expand(task).map(|(tree, span_data_table)| msg::ExpandMacroExtended { + tree, + span_data_table, + }), + ), + }, msg::Request::ApiVersionCheck {} => { msg::Response::ApiVersionCheck(proc_macro_api::msg::CURRENT_API_VERSION) } + msg::Request::SetConfig(config) => { + srv.set_span_mode(config.span_mode); + msg::Response::SetConfig(config) + } }; write_response(res)? } diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/Cargo.toml b/src/tools/rust-analyzer/crates/proc-macro-srv/Cargo.toml index 99993f16e27..9c4375559c1 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/Cargo.toml +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/Cargo.toml @@ -26,13 +26,19 @@ stdx.workspace = true tt.workspace = true mbe.workspace = true paths.workspace = true +base-db.workspace = true +span.workspace = true proc-macro-api.workspace = true [dev-dependencies] expect-test = "1.4.0" # used as proc macro test targets -proc-macro-test.workspace = true +proc-macro-test.path = "./proc-macro-test" [features] -sysroot-abi = [] +sysroot-abi = ["proc-macro-test/sysroot-abi"] +in-rust-tree = ["mbe/in-rust-tree", "sysroot-abi"] + +[lints] +workspace = true diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/Cargo.toml b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/Cargo.toml new file mode 100644 index 00000000000..55be6bc23bb --- /dev/null +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/Cargo.toml @@ -0,0 +1,19 @@ +[package] +name = "proc-macro-test" +version = "0.0.0" +publish = false + +edition = "2021" +license = "MIT OR Apache-2.0" + +[lib] +doctest = false + +[build-dependencies] +cargo_metadata = "0.18.1" + +# local deps +toolchain = { path = "../../toolchain", version = "0.0.0" } + +[features] +sysroot-abi = [] diff --git a/src/tools/rust-analyzer/crates/proc-macro-test/build.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/build.rs index 7827157865a..7299147686d 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-test/build.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/build.rs @@ -70,6 +70,9 @@ fn main() { // instance to use the same target directory. .arg("--target-dir") .arg(&target_dir); + if cfg!(feature = "sysroot-abi") { + cmd.args(["--features", "sysroot-abi"]); + } if let Ok(target) = std::env::var("TARGET") { cmd.args(["--target", &target]); diff --git a/src/tools/rust-analyzer/crates/proc-macro-test/imp/.gitignore b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/imp/.gitignore index 2c96eb1b651..2c96eb1b651 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-test/imp/.gitignore +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/imp/.gitignore diff --git a/src/tools/rust-analyzer/crates/proc-macro-test/imp/Cargo.toml b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/imp/Cargo.toml index 2a36737cef0..dc94fcd61a4 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-test/imp/Cargo.toml +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/imp/Cargo.toml @@ -9,8 +9,11 @@ publish = false doctest = false proc-macro = true -[workspace] - [dependencies] # this crate should not have any dependencies, since it uses its own workspace, # and its own `Cargo.lock` + +[features] +sysroot-abi = [] + +[workspace] diff --git a/src/tools/rust-analyzer/crates/proc-macro-test/imp/src/lib.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/imp/src/lib.rs index 32510fba2f8..b8aad4acefc 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-test/imp/src/lib.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/imp/src/lib.rs @@ -1,6 +1,10 @@ //! Exports a few trivial procedural macros for testing. +#![allow(unexpected_cfgs)] +#![cfg(feature = "sysroot-abi")] +#![cfg(any(feature = "sysroot-abi", rust_analyzer))] #![warn(rust_2018_idioms, unused_lifetimes)] +#![feature(proc_macro_span, proc_macro_def_site)] use proc_macro::{Group, Ident, Literal, Punct, Span, TokenStream, TokenTree}; @@ -49,6 +53,29 @@ pub fn fn_like_mk_idents(_args: TokenStream) -> TokenStream { TokenStream::from_iter(trees) } +#[proc_macro] +pub fn fn_like_span_join(args: TokenStream) -> TokenStream { + let args = &mut args.into_iter(); + let first = args.next().unwrap(); + let second = args.next().unwrap(); + TokenStream::from(TokenTree::from(Ident::new_raw( + "joined", + first.span().join(second.span()).unwrap(), + ))) +} + +#[proc_macro] +pub fn fn_like_span_ops(args: TokenStream) -> TokenStream { + let args = &mut args.into_iter(); + let mut first = args.next().unwrap(); + first.set_span(Span::def_site()); + let mut second = args.next().unwrap(); + second.set_span(second.span().resolved_at(Span::def_site())); + let mut third = args.next().unwrap(); + third.set_span(third.span().start()); + TokenStream::from_iter(vec![first, second, third]) +} + #[proc_macro_attribute] pub fn attr_noop(_args: TokenStream, item: TokenStream) -> TokenStream { item diff --git a/src/tools/rust-analyzer/crates/proc-macro-test/src/lib.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/src/lib.rs index 739c6ec6f44..739c6ec6f44 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-test/src/lib.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/proc-macro-test/src/lib.rs diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/dylib.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/dylib.rs index f20e6832f6e..52b4cced5f5 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/dylib.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/dylib.rs @@ -11,7 +11,10 @@ use libloading::Library; use memmap2::Mmap; use object::Object; use paths::AbsPath; -use proc_macro_api::{msg::TokenId, read_dylib_info, ProcMacroKind}; +use proc_macro::bridge; +use proc_macro_api::{read_dylib_info, ProcMacroKind}; + +use crate::ProcMacroSrvSpan; const NEW_REGISTRAR_SYMBOL: &str = "_rustc_proc_macro_decls_"; @@ -147,15 +150,18 @@ impl Expander { Ok(Expander { inner: library }) } - pub fn expand( + pub fn expand<S: ProcMacroSrvSpan>( &self, macro_name: &str, - macro_body: &crate::tt::Subtree, - attributes: Option<&crate::tt::Subtree>, - def_site: TokenId, - call_site: TokenId, - mixed_site: TokenId, - ) -> Result<crate::tt::Subtree, String> { + macro_body: tt::Subtree<S>, + attributes: Option<tt::Subtree<S>>, + def_site: S, + call_site: S, + mixed_site: S, + ) -> Result<tt::Subtree<S>, String> + where + <S::Server as bridge::server::Types>::TokenStream: Default, + { let result = self .inner .proc_macros diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/lib.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/lib.rs index 56529f71d85..f1575a5b0bd 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/lib.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/lib.rs @@ -11,11 +11,12 @@ //! rustc rather than `unstable`. (Although in general ABI compatibility is still an issue)… #![cfg(any(feature = "sysroot-abi", rust_analyzer))] -#![feature(proc_macro_internals, proc_macro_diagnostic, proc_macro_span)] +#![feature(proc_macro_internals, proc_macro_diagnostic, proc_macro_span, rustc_private)] #![warn(rust_2018_idioms, unused_lifetimes)] #![allow(unreachable_pub, internal_features)] extern crate proc_macro; +extern crate rustc_driver as _; mod dylib; mod server; @@ -32,36 +33,67 @@ use std::{ }; use proc_macro_api::{ - msg::{self, ExpnGlobals, TokenId, CURRENT_API_VERSION}, + msg::{ + self, deserialize_span_data_index_map, serialize_span_data_index_map, ExpnGlobals, + SpanMode, TokenId, CURRENT_API_VERSION, + }, ProcMacroKind, }; +use span::Span; -mod tt { - pub use proc_macro_api::msg::TokenId; +use crate::server::TokenStream; - pub use ::tt::*; +// see `build.rs` +include!(concat!(env!("OUT_DIR"), "/rustc_version.rs")); - pub type Subtree = ::tt::Subtree<TokenId>; - pub type TokenTree = ::tt::TokenTree<TokenId>; - pub type Delimiter = ::tt::Delimiter<TokenId>; - pub type Leaf = ::tt::Leaf<TokenId>; - pub type Literal = ::tt::Literal<TokenId>; - pub type Punct = ::tt::Punct<TokenId>; - pub type Ident = ::tt::Ident<TokenId>; +trait ProcMacroSrvSpan: tt::Span { + type Server: proc_macro::bridge::server::Server<TokenStream = TokenStream<Self>>; + fn make_server(call_site: Self, def_site: Self, mixed_site: Self) -> Self::Server; } -// see `build.rs` -include!(concat!(env!("OUT_DIR"), "/rustc_version.rs")); +impl ProcMacroSrvSpan for TokenId { + type Server = server::token_id::TokenIdServer; + + fn make_server(call_site: Self, def_site: Self, mixed_site: Self) -> Self::Server { + Self::Server { interner: &server::SYMBOL_INTERNER, call_site, def_site, mixed_site } + } +} +impl ProcMacroSrvSpan for Span { + type Server = server::rust_analyzer_span::RaSpanServer; + fn make_server(call_site: Self, def_site: Self, mixed_site: Self) -> Self::Server { + Self::Server { + interner: &server::SYMBOL_INTERNER, + call_site, + def_site, + mixed_site, + tracked_env_vars: Default::default(), + tracked_paths: Default::default(), + } + } +} #[derive(Default)] pub struct ProcMacroSrv { expanders: HashMap<(PathBuf, SystemTime), dylib::Expander>, + span_mode: SpanMode, } const EXPANDER_STACK_SIZE: usize = 8 * 1024 * 1024; impl ProcMacroSrv { - pub fn expand(&mut self, task: msg::ExpandMacro) -> Result<msg::FlatTree, msg::PanicMessage> { + pub fn set_span_mode(&mut self, span_mode: SpanMode) { + self.span_mode = span_mode; + } + + pub fn span_mode(&self) -> SpanMode { + self.span_mode + } + + pub fn expand( + &mut self, + task: msg::ExpandMacro, + ) -> Result<(msg::FlatTree, Vec<u32>), msg::PanicMessage> { + let span_mode = self.span_mode; let expander = self.expander(task.lib.as_ref()).map_err(|err| { debug_assert!(false, "should list macros before asking to expand"); msg::PanicMessage(format!("failed to load macro: {err}")) @@ -71,10 +103,10 @@ impl ProcMacroSrv { for (k, v) in &task.env { env::set_var(k, v); } - let prev_working_dir = match task.current_dir { + let prev_working_dir = match &task.current_dir { Some(dir) => { let prev_working_dir = std::env::current_dir().ok(); - if let Err(err) = std::env::set_current_dir(&dir) { + if let Err(err) = std::env::set_current_dir(dir) { eprintln!("Failed to set the current working dir to {dir}. Error: {err:?}") } prev_working_dir @@ -83,38 +115,15 @@ impl ProcMacroSrv { }; let ExpnGlobals { def_site, call_site, mixed_site, .. } = task.has_global_spans; - let def_site = TokenId(def_site as u32); - let call_site = TokenId(call_site as u32); - let mixed_site = TokenId(mixed_site as u32); - - let macro_body = task.macro_body.to_subtree_unresolved(CURRENT_API_VERSION); - let attributes = task.attributes.map(|it| it.to_subtree_unresolved(CURRENT_API_VERSION)); - let result = thread::scope(|s| { - let thread = thread::Builder::new() - .stack_size(EXPANDER_STACK_SIZE) - .name(task.macro_name.clone()) - .spawn_scoped(s, || { - expander - .expand( - &task.macro_name, - ¯o_body, - attributes.as_ref(), - def_site, - call_site, - mixed_site, - ) - .map(|it| msg::FlatTree::new_raw(&it, CURRENT_API_VERSION)) - }); - let res = match thread { - Ok(handle) => handle.join(), - Err(e) => std::panic::resume_unwind(Box::new(e)), - }; - - match res { - Ok(res) => res, - Err(e) => std::panic::resume_unwind(e), + + let result = match span_mode { + SpanMode::Id => { + expand_id(task, expander, def_site, call_site, mixed_site).map(|it| (it, vec![])) } - }); + SpanMode::RustAnalyzer => { + expand_ra_span(task, expander, def_site, call_site, mixed_site) + } + }; prev_env.rollback(); @@ -155,6 +164,98 @@ impl ProcMacroSrv { } } +fn expand_id( + task: msg::ExpandMacro, + expander: &dylib::Expander, + def_site: usize, + call_site: usize, + mixed_site: usize, +) -> Result<msg::FlatTree, String> { + let def_site = TokenId(def_site as u32); + let call_site = TokenId(call_site as u32); + let mixed_site = TokenId(mixed_site as u32); + + let macro_body = task.macro_body.to_subtree_unresolved(CURRENT_API_VERSION); + let attributes = task.attributes.map(|it| it.to_subtree_unresolved(CURRENT_API_VERSION)); + let result = thread::scope(|s| { + let thread = thread::Builder::new() + .stack_size(EXPANDER_STACK_SIZE) + .name(task.macro_name.clone()) + .spawn_scoped(s, || { + expander + .expand( + &task.macro_name, + macro_body, + attributes, + def_site, + call_site, + mixed_site, + ) + .map(|it| msg::FlatTree::new_raw(&it, CURRENT_API_VERSION)) + }); + let res = match thread { + Ok(handle) => handle.join(), + Err(e) => std::panic::resume_unwind(Box::new(e)), + }; + + match res { + Ok(res) => res, + Err(e) => std::panic::resume_unwind(e), + } + }); + result +} + +fn expand_ra_span( + task: msg::ExpandMacro, + expander: &dylib::Expander, + def_site: usize, + call_site: usize, + mixed_site: usize, +) -> Result<(msg::FlatTree, Vec<u32>), String> { + let mut span_data_table = deserialize_span_data_index_map(&task.span_data_table); + + let def_site = span_data_table[def_site]; + let call_site = span_data_table[call_site]; + let mixed_site = span_data_table[mixed_site]; + + let macro_body = task.macro_body.to_subtree_resolved(CURRENT_API_VERSION, &span_data_table); + let attributes = + task.attributes.map(|it| it.to_subtree_resolved(CURRENT_API_VERSION, &span_data_table)); + let result = thread::scope(|s| { + let thread = thread::Builder::new() + .stack_size(EXPANDER_STACK_SIZE) + .name(task.macro_name.clone()) + .spawn_scoped(s, || { + expander + .expand( + &task.macro_name, + macro_body, + attributes, + def_site, + call_site, + mixed_site, + ) + .map(|it| { + ( + msg::FlatTree::new(&it, CURRENT_API_VERSION, &mut span_data_table), + serialize_span_data_index_map(&span_data_table), + ) + }) + }); + let res = match thread { + Ok(handle) => handle.join(), + Err(e) => std::panic::resume_unwind(Box::new(e)), + }; + + match res { + Ok(res) => res, + Err(e) => std::panic::resume_unwind(e), + } + }); + result +} + pub struct PanicMessage { message: Option<String>, } diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/proc_macros.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/proc_macros.rs index 716b85d096d..3fe968c81ca 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/proc_macros.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/proc_macros.rs @@ -2,9 +2,9 @@ use libloading::Library; use proc_macro::bridge; -use proc_macro_api::{msg::TokenId, ProcMacroKind, RustCInfo}; +use proc_macro_api::{ProcMacroKind, RustCInfo}; -use crate::{dylib::LoadProcMacroDylibError, server::SYMBOL_INTERNER, tt}; +use crate::{dylib::LoadProcMacroDylibError, ProcMacroSrvSpan}; pub(crate) struct ProcMacros { exported_macros: Vec<bridge::client::ProcMacro>, @@ -40,19 +40,19 @@ impl ProcMacros { Err(LoadProcMacroDylibError::AbiMismatch(info.version_string)) } - pub(crate) fn expand( + pub(crate) fn expand<S: ProcMacroSrvSpan>( &self, macro_name: &str, - macro_body: &tt::Subtree, - attributes: Option<&tt::Subtree>, - def_site: TokenId, - call_site: TokenId, - mixed_site: TokenId, - ) -> Result<tt::Subtree, crate::PanicMessage> { - let parsed_body = crate::server::TokenStream::with_subtree(macro_body.clone()); + macro_body: tt::Subtree<S>, + attributes: Option<tt::Subtree<S>>, + def_site: S, + call_site: S, + mixed_site: S, + ) -> Result<tt::Subtree<S>, crate::PanicMessage> { + let parsed_body = crate::server::TokenStream::with_subtree(macro_body); - let parsed_attributes = attributes.map_or(crate::server::TokenStream::new(), |attr| { - crate::server::TokenStream::with_subtree(attr.clone()) + let parsed_attributes = attributes.map_or_else(crate::server::TokenStream::new, |attr| { + crate::server::TokenStream::with_subtree(attr) }); for proc_macro in &self.exported_macros { @@ -62,12 +62,7 @@ impl ProcMacros { { let res = client.run( &bridge::server::SameThread, - crate::server::RustAnalyzer { - interner: &SYMBOL_INTERNER, - call_site, - def_site, - mixed_site, - }, + S::make_server(call_site, def_site, mixed_site), parsed_body, false, ); @@ -78,12 +73,7 @@ impl ProcMacros { bridge::client::ProcMacro::Bang { name, client } if *name == macro_name => { let res = client.run( &bridge::server::SameThread, - crate::server::RustAnalyzer { - interner: &SYMBOL_INTERNER, - call_site, - def_site, - mixed_site, - }, + S::make_server(call_site, def_site, mixed_site), parsed_body, false, ); @@ -94,13 +84,7 @@ impl ProcMacros { bridge::client::ProcMacro::Attr { name, client } if *name == macro_name => { let res = client.run( &bridge::server::SameThread, - crate::server::RustAnalyzer { - interner: &SYMBOL_INTERNER, - - call_site, - def_site, - mixed_site, - }, + S::make_server(call_site, def_site, mixed_site), parsed_attributes, parsed_body, false, @@ -113,7 +97,7 @@ impl ProcMacros { } } - Err(bridge::PanicMessage::String("Nothing to expand".to_string()).into()) + Err(bridge::PanicMessage::String(format!("proc-macro `{macro_name}` is missing")).into()) } pub(crate) fn list_macros(&self) -> Vec<(String, ProcMacroKind)> { diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/server.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server.rs index 917d8a6e26a..1854322ddb5 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/server.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server.rs @@ -8,226 +8,18 @@ //! //! FIXME: No span and source file information is implemented yet -use proc_macro::bridge::{self, server}; +use proc_macro::bridge; mod token_stream; -use proc_macro_api::msg::TokenId; pub use token_stream::TokenStream; -use token_stream::TokenStreamBuilder; +pub mod token_id; +pub mod rust_analyzer_span; mod symbol; pub use symbol::*; +use tt::Spacing; -use std::{ - iter, - ops::{Bound, Range}, -}; - -use crate::tt; - -type Group = tt::Subtree; -type TokenTree = tt::TokenTree; -#[allow(unused)] -type Punct = tt::Punct; -type Spacing = tt::Spacing; -#[allow(unused)] -type Literal = tt::Literal; -type Span = tt::TokenId; - -#[derive(Clone)] -pub struct SourceFile { - // FIXME stub -} - -pub struct FreeFunctions; - -pub struct RustAnalyzer { - // FIXME: store span information here. - pub(crate) interner: SymbolInternerRef, - pub call_site: TokenId, - pub def_site: TokenId, - pub mixed_site: TokenId, -} - -impl server::Types for RustAnalyzer { - type FreeFunctions = FreeFunctions; - type TokenStream = TokenStream; - type SourceFile = SourceFile; - type Span = Span; - type Symbol = Symbol; -} - -impl server::FreeFunctions for RustAnalyzer { - fn injected_env_var(&mut self, _var: &str) -> Option<String> { - None - } - - fn track_env_var(&mut self, _var: &str, _value: Option<&str>) { - // FIXME: track env var accesses - // https://github.com/rust-lang/rust/pull/71858 - } - fn track_path(&mut self, _path: &str) {} - - fn literal_from_str( - &mut self, - s: &str, - ) -> Result<bridge::Literal<Self::Span, Self::Symbol>, ()> { - // FIXME: keep track of LitKind and Suffix - Ok(bridge::Literal { - kind: bridge::LitKind::Err, - symbol: Symbol::intern(self.interner, s), - suffix: None, - span: self.call_site, - }) - } - - fn emit_diagnostic(&mut self, _: bridge::Diagnostic<Self::Span>) { - // FIXME handle diagnostic - } -} - -impl server::TokenStream for RustAnalyzer { - fn is_empty(&mut self, stream: &Self::TokenStream) -> bool { - stream.is_empty() - } - fn from_str(&mut self, src: &str) -> Self::TokenStream { - Self::TokenStream::from_str(src, self.call_site).expect("cannot parse string") - } - fn to_string(&mut self, stream: &Self::TokenStream) -> String { - stream.to_string() - } - fn from_token_tree( - &mut self, - tree: bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>, - ) -> Self::TokenStream { - match tree { - bridge::TokenTree::Group(group) => { - let group = Group { - delimiter: delim_to_internal(group.delimiter, group.span), - token_trees: match group.stream { - Some(stream) => stream.into_iter().collect(), - None => Vec::new(), - }, - }; - let tree = TokenTree::from(group); - Self::TokenStream::from_iter(iter::once(tree)) - } - - bridge::TokenTree::Ident(ident) => { - let text = ident.sym.text(self.interner); - let text = - if ident.is_raw { ::tt::SmolStr::from_iter(["r#", &text]) } else { text }; - let ident: tt::Ident = tt::Ident { text, span: ident.span }; - let leaf = tt::Leaf::from(ident); - let tree = TokenTree::from(leaf); - Self::TokenStream::from_iter(iter::once(tree)) - } - - bridge::TokenTree::Literal(literal) => { - let literal = LiteralFormatter(literal); - let text = literal.with_stringify_parts(self.interner, |parts| { - ::tt::SmolStr::from_iter(parts.iter().copied()) - }); - - let literal = tt::Literal { text, span: literal.0.span }; - let leaf = tt::Leaf::from(literal); - let tree = TokenTree::from(leaf); - Self::TokenStream::from_iter(iter::once(tree)) - } - - bridge::TokenTree::Punct(p) => { - let punct = tt::Punct { - char: p.ch as char, - spacing: if p.joint { Spacing::Joint } else { Spacing::Alone }, - span: p.span, - }; - let leaf = tt::Leaf::from(punct); - let tree = TokenTree::from(leaf); - Self::TokenStream::from_iter(iter::once(tree)) - } - } - } - - fn expand_expr(&mut self, self_: &Self::TokenStream) -> Result<Self::TokenStream, ()> { - Ok(self_.clone()) - } - - fn concat_trees( - &mut self, - base: Option<Self::TokenStream>, - trees: Vec<bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>>, - ) -> Self::TokenStream { - let mut builder = TokenStreamBuilder::new(); - if let Some(base) = base { - builder.push(base); - } - for tree in trees { - builder.push(self.from_token_tree(tree)); - } - builder.build() - } - - fn concat_streams( - &mut self, - base: Option<Self::TokenStream>, - streams: Vec<Self::TokenStream>, - ) -> Self::TokenStream { - let mut builder = TokenStreamBuilder::new(); - if let Some(base) = base { - builder.push(base); - } - for stream in streams { - builder.push(stream); - } - builder.build() - } - - fn into_trees( - &mut self, - stream: Self::TokenStream, - ) -> Vec<bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>> { - stream - .into_iter() - .map(|tree| match tree { - tt::TokenTree::Leaf(tt::Leaf::Ident(ident)) => { - bridge::TokenTree::Ident(bridge::Ident { - sym: Symbol::intern(self.interner, ident.text.trim_start_matches("r#")), - is_raw: ident.text.starts_with("r#"), - span: ident.span, - }) - } - tt::TokenTree::Leaf(tt::Leaf::Literal(lit)) => { - bridge::TokenTree::Literal(bridge::Literal { - // FIXME: handle literal kinds - kind: bridge::LitKind::Err, - symbol: Symbol::intern(self.interner, &lit.text), - // FIXME: handle suffixes - suffix: None, - span: lit.span, - }) - } - tt::TokenTree::Leaf(tt::Leaf::Punct(punct)) => { - bridge::TokenTree::Punct(bridge::Punct { - ch: punct.char as u8, - joint: punct.spacing == Spacing::Joint, - span: punct.span, - }) - } - tt::TokenTree::Subtree(subtree) => bridge::TokenTree::Group(bridge::Group { - delimiter: delim_to_external(subtree.delimiter), - stream: if subtree.token_trees.is_empty() { - None - } else { - Some(subtree.token_trees.into_iter().collect()) - }, - span: bridge::DelimSpan::from_single(subtree.delimiter.open), - }), - }) - .collect() - } -} - -fn delim_to_internal(d: proc_macro::Delimiter, span: bridge::DelimSpan<Span>) -> tt::Delimiter { +fn delim_to_internal<S>(d: proc_macro::Delimiter, span: bridge::DelimSpan<S>) -> tt::Delimiter<S> { let kind = match d { proc_macro::Delimiter::Parenthesis => tt::DelimiterKind::Parenthesis, proc_macro::Delimiter::Brace => tt::DelimiterKind::Brace, @@ -237,7 +29,7 @@ fn delim_to_internal(d: proc_macro::Delimiter, span: bridge::DelimSpan<Span>) -> tt::Delimiter { open: span.open, close: span.close, kind } } -fn delim_to_external(d: tt::Delimiter) -> proc_macro::Delimiter { +fn delim_to_external<S>(d: tt::Delimiter<S>) -> proc_macro::Delimiter { match d.kind { tt::DelimiterKind::Parenthesis => proc_macro::Delimiter::Parenthesis, tt::DelimiterKind::Brace => proc_macro::Delimiter::Brace, @@ -262,121 +54,9 @@ fn spacing_to_external(spacing: Spacing) -> proc_macro::Spacing { } } -impl server::SourceFile for RustAnalyzer { - // FIXME these are all stubs - fn eq(&mut self, _file1: &Self::SourceFile, _file2: &Self::SourceFile) -> bool { - true - } - fn path(&mut self, _file: &Self::SourceFile) -> String { - String::new() - } - fn is_real(&mut self, _file: &Self::SourceFile) -> bool { - true - } -} - -impl server::Span for RustAnalyzer { - fn debug(&mut self, span: Self::Span) -> String { - format!("{:?}", span.0) - } - fn source_file(&mut self, _span: Self::Span) -> Self::SourceFile { - SourceFile {} - } - fn save_span(&mut self, _span: Self::Span) -> usize { - // FIXME stub - 0 - } - fn recover_proc_macro_span(&mut self, _id: usize) -> Self::Span { - // FIXME stub - self.call_site - } - /// Recent feature, not yet in the proc_macro - /// - /// See PR: - /// https://github.com/rust-lang/rust/pull/55780 - fn source_text(&mut self, _span: Self::Span) -> Option<String> { - None - } - - fn parent(&mut self, _span: Self::Span) -> Option<Self::Span> { - // FIXME handle span - None - } - fn source(&mut self, span: Self::Span) -> Self::Span { - // FIXME handle span - span - } - fn byte_range(&mut self, _span: Self::Span) -> Range<usize> { - // FIXME handle span - Range { start: 0, end: 0 } - } - fn join(&mut self, first: Self::Span, _second: Self::Span) -> Option<Self::Span> { - // Just return the first span again, because some macros will unwrap the result. - Some(first) - } - fn subspan( - &mut self, - span: Self::Span, - _start: Bound<usize>, - _end: Bound<usize>, - ) -> Option<Self::Span> { - // Just return the span again, because some macros will unwrap the result. - Some(span) - } - fn resolved_at(&mut self, _span: Self::Span, _at: Self::Span) -> Self::Span { - // FIXME handle span - self.call_site - } - - fn end(&mut self, _self_: Self::Span) -> Self::Span { - self.call_site - } - - fn start(&mut self, _self_: Self::Span) -> Self::Span { - self.call_site - } - - fn line(&mut self, _span: Self::Span) -> usize { - // FIXME handle line - 0 - } - - fn column(&mut self, _span: Self::Span) -> usize { - // FIXME handle column - 0 - } -} - -impl server::Symbol for RustAnalyzer { - fn normalize_and_validate_ident(&mut self, string: &str) -> Result<Self::Symbol, ()> { - // FIXME: nfc-normalize and validate idents - Ok(<Self as server::Server>::intern_symbol(string)) - } -} - -impl server::Server for RustAnalyzer { - fn globals(&mut self) -> bridge::ExpnGlobals<Self::Span> { - bridge::ExpnGlobals { - def_site: self.def_site, - call_site: self.call_site, - mixed_site: self.mixed_site, - } - } - - fn intern_symbol(ident: &str) -> Self::Symbol { - // FIXME: should be `self.interner` once the proc-macro api allows it. - Symbol::intern(&SYMBOL_INTERNER, &::tt::SmolStr::from(ident)) - } - - fn with_symbol_string(symbol: &Self::Symbol, f: impl FnOnce(&str)) { - // FIXME: should be `self.interner` once the proc-macro api allows it. - f(symbol.text(&SYMBOL_INTERNER).as_str()) - } -} - -struct LiteralFormatter(bridge::Literal<tt::TokenId, Symbol>); +struct LiteralFormatter<S>(bridge::Literal<S, Symbol>); -impl LiteralFormatter { +impl<S> LiteralFormatter<S> { /// Invokes the callback with a `&[&str]` consisting of each part of the /// literal's representation. This is done to allow the `ToString` and /// `Display` implementations to borrow references to symbol values, and @@ -427,66 +107,3 @@ impl LiteralFormatter { f(symbol.as_str(), suffix.as_str()) } } - -#[cfg(test)] -mod tests { - use super::*; - - #[test] - fn test_ra_server_to_string() { - let s = TokenStream { - token_trees: vec![ - tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { - text: "struct".into(), - span: tt::TokenId(0), - })), - tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { - text: "T".into(), - span: tt::TokenId(0), - })), - tt::TokenTree::Subtree(tt::Subtree { - delimiter: tt::Delimiter { - open: tt::TokenId(0), - close: tt::TokenId(0), - kind: tt::DelimiterKind::Brace, - }, - token_trees: vec![], - }), - ], - }; - - assert_eq!(s.to_string(), "struct T {}"); - } - - #[test] - fn test_ra_server_from_str() { - let subtree_paren_a = tt::TokenTree::Subtree(tt::Subtree { - delimiter: tt::Delimiter { - open: tt::TokenId(0), - close: tt::TokenId(0), - kind: tt::DelimiterKind::Parenthesis, - }, - token_trees: vec![tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { - text: "a".into(), - span: tt::TokenId(0), - }))], - }); - - let t1 = TokenStream::from_str("(a)", tt::TokenId(0)).unwrap(); - assert_eq!(t1.token_trees.len(), 1); - assert_eq!(t1.token_trees[0], subtree_paren_a); - - let t2 = TokenStream::from_str("(a);", tt::TokenId(0)).unwrap(); - assert_eq!(t2.token_trees.len(), 2); - assert_eq!(t2.token_trees[0], subtree_paren_a); - - let underscore = TokenStream::from_str("_", tt::TokenId(0)).unwrap(); - assert_eq!( - underscore.token_trees[0], - tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { - text: "_".into(), - span: tt::TokenId(0), - })) - ); - } -} diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/rust_analyzer_span.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/rust_analyzer_span.rs new file mode 100644 index 00000000000..bcf3600d273 --- /dev/null +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/rust_analyzer_span.rs @@ -0,0 +1,411 @@ +//! proc-macro server backend based on rust-analyzer's internal span represention +//! This backend is used solely by rust-analyzer as it ties into rust-analyzer internals. +//! +//! It is an unfortunate result of how the proc-macro API works that we need to look into the +//! concrete representation of the spans, and as such, RustRover cannot make use of this unless they +//! change their representation to be compatible with rust-analyzer's. +use std::{ + collections::{HashMap, HashSet}, + iter, + ops::{Bound, Range}, +}; + +use ::tt::{TextRange, TextSize}; +use proc_macro::bridge::{self, server}; +use span::{Span, FIXUP_ERASED_FILE_AST_ID_MARKER}; + +use crate::server::{ + delim_to_external, delim_to_internal, token_stream::TokenStreamBuilder, LiteralFormatter, + Symbol, SymbolInternerRef, SYMBOL_INTERNER, +}; +mod tt { + pub use ::tt::*; + + pub type Subtree = ::tt::Subtree<super::Span>; + pub type TokenTree = ::tt::TokenTree<super::Span>; + pub type Leaf = ::tt::Leaf<super::Span>; + pub type Literal = ::tt::Literal<super::Span>; + pub type Punct = ::tt::Punct<super::Span>; + pub type Ident = ::tt::Ident<super::Span>; +} + +type TokenStream = crate::server::TokenStream<Span>; + +#[derive(Clone)] +pub struct SourceFile; +pub struct FreeFunctions; + +pub struct RaSpanServer { + pub(crate) interner: SymbolInternerRef, + // FIXME: Report this back to the caller to track as dependencies + pub tracked_env_vars: HashMap<Box<str>, Option<Box<str>>>, + // FIXME: Report this back to the caller to track as dependencies + pub tracked_paths: HashSet<Box<str>>, + pub call_site: Span, + pub def_site: Span, + pub mixed_site: Span, +} + +impl server::Types for RaSpanServer { + type FreeFunctions = FreeFunctions; + type TokenStream = TokenStream; + type SourceFile = SourceFile; + type Span = Span; + type Symbol = Symbol; +} + +impl server::FreeFunctions for RaSpanServer { + fn injected_env_var(&mut self, _: &str) -> Option<std::string::String> { + None + } + + fn track_env_var(&mut self, var: &str, value: Option<&str>) { + self.tracked_env_vars.insert(var.into(), value.map(Into::into)); + } + fn track_path(&mut self, path: &str) { + self.tracked_paths.insert(path.into()); + } + + fn literal_from_str( + &mut self, + s: &str, + ) -> Result<bridge::Literal<Self::Span, Self::Symbol>, ()> { + // FIXME: keep track of LitKind and Suffix + Ok(bridge::Literal { + kind: bridge::LitKind::Err, + symbol: Symbol::intern(self.interner, s), + suffix: None, + span: self.call_site, + }) + } + + fn emit_diagnostic(&mut self, _: bridge::Diagnostic<Self::Span>) { + // FIXME handle diagnostic + } +} + +impl server::TokenStream for RaSpanServer { + fn is_empty(&mut self, stream: &Self::TokenStream) -> bool { + stream.is_empty() + } + fn from_str(&mut self, src: &str) -> Self::TokenStream { + Self::TokenStream::from_str(src, self.call_site).expect("cannot parse string") + } + fn to_string(&mut self, stream: &Self::TokenStream) -> String { + stream.to_string() + } + fn from_token_tree( + &mut self, + tree: bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>, + ) -> Self::TokenStream { + match tree { + bridge::TokenTree::Group(group) => { + let group = tt::Subtree { + delimiter: delim_to_internal(group.delimiter, group.span), + token_trees: match group.stream { + Some(stream) => stream.into_iter().collect(), + None => Vec::new(), + }, + }; + let tree = tt::TokenTree::from(group); + Self::TokenStream::from_iter(iter::once(tree)) + } + + bridge::TokenTree::Ident(ident) => { + let text = ident.sym.text(self.interner); + let text = + if ident.is_raw { ::tt::SmolStr::from_iter(["r#", &text]) } else { text }; + let ident: tt::Ident = tt::Ident { text, span: ident.span }; + let leaf = tt::Leaf::from(ident); + let tree = tt::TokenTree::from(leaf); + Self::TokenStream::from_iter(iter::once(tree)) + } + + bridge::TokenTree::Literal(literal) => { + let literal = LiteralFormatter(literal); + let text = literal.with_stringify_parts(self.interner, |parts| { + ::tt::SmolStr::from_iter(parts.iter().copied()) + }); + + let literal = tt::Literal { text, span: literal.0.span }; + let leaf: tt::Leaf = tt::Leaf::from(literal); + let tree = tt::TokenTree::from(leaf); + Self::TokenStream::from_iter(iter::once(tree)) + } + + bridge::TokenTree::Punct(p) => { + let punct = tt::Punct { + char: p.ch as char, + spacing: if p.joint { tt::Spacing::Joint } else { tt::Spacing::Alone }, + span: p.span, + }; + let leaf = tt::Leaf::from(punct); + let tree = tt::TokenTree::from(leaf); + Self::TokenStream::from_iter(iter::once(tree)) + } + } + } + + fn expand_expr(&mut self, self_: &Self::TokenStream) -> Result<Self::TokenStream, ()> { + // FIXME: requires db, more importantly this requires name resolution so we would need to + // eagerly expand this proc-macro, but we can't know that this proc-macro is eager until we + // expand it ... + // This calls for some kind of marker that a proc-macro wants to access this eager API, + // otherwise we need to treat every proc-macro eagerly / or not support this. + Ok(self_.clone()) + } + + fn concat_trees( + &mut self, + base: Option<Self::TokenStream>, + trees: Vec<bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>>, + ) -> Self::TokenStream { + let mut builder = TokenStreamBuilder::new(); + if let Some(base) = base { + builder.push(base); + } + for tree in trees { + builder.push(self.from_token_tree(tree)); + } + builder.build() + } + + fn concat_streams( + &mut self, + base: Option<Self::TokenStream>, + streams: Vec<Self::TokenStream>, + ) -> Self::TokenStream { + let mut builder = TokenStreamBuilder::new(); + if let Some(base) = base { + builder.push(base); + } + for stream in streams { + builder.push(stream); + } + builder.build() + } + + fn into_trees( + &mut self, + stream: Self::TokenStream, + ) -> Vec<bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>> { + stream + .into_iter() + .map(|tree| match tree { + tt::TokenTree::Leaf(tt::Leaf::Ident(ident)) => { + bridge::TokenTree::Ident(bridge::Ident { + sym: Symbol::intern(self.interner, ident.text.trim_start_matches("r#")), + is_raw: ident.text.starts_with("r#"), + span: ident.span, + }) + } + tt::TokenTree::Leaf(tt::Leaf::Literal(lit)) => { + bridge::TokenTree::Literal(bridge::Literal { + // FIXME: handle literal kinds + kind: bridge::LitKind::Err, + symbol: Symbol::intern(self.interner, &lit.text), + // FIXME: handle suffixes + suffix: None, + span: lit.span, + }) + } + tt::TokenTree::Leaf(tt::Leaf::Punct(punct)) => { + bridge::TokenTree::Punct(bridge::Punct { + ch: punct.char as u8, + joint: punct.spacing == tt::Spacing::Joint, + span: punct.span, + }) + } + tt::TokenTree::Subtree(subtree) => bridge::TokenTree::Group(bridge::Group { + delimiter: delim_to_external(subtree.delimiter), + stream: if subtree.token_trees.is_empty() { + None + } else { + Some(subtree.token_trees.into_iter().collect()) + }, + span: bridge::DelimSpan::from_single(subtree.delimiter.open), + }), + }) + .collect() + } +} + +impl server::SourceFile for RaSpanServer { + // FIXME these are all stubs + fn eq(&mut self, _file1: &Self::SourceFile, _file2: &Self::SourceFile) -> bool { + true + } + fn path(&mut self, _file: &Self::SourceFile) -> String { + String::new() + } + fn is_real(&mut self, _file: &Self::SourceFile) -> bool { + true + } +} + +impl server::Span for RaSpanServer { + fn debug(&mut self, span: Self::Span) -> String { + format!("{:?}", span) + } + fn source_file(&mut self, _span: Self::Span) -> Self::SourceFile { + // FIXME stub, requires db + SourceFile {} + } + fn save_span(&mut self, _span: Self::Span) -> usize { + // FIXME stub, requires builtin quote! implementation + 0 + } + fn recover_proc_macro_span(&mut self, _id: usize) -> Self::Span { + // FIXME stub, requires builtin quote! implementation + self.call_site + } + /// Recent feature, not yet in the proc_macro + /// + /// See PR: + /// https://github.com/rust-lang/rust/pull/55780 + fn source_text(&mut self, _span: Self::Span) -> Option<String> { + // FIXME requires db, needs special handling wrt fixup spans + None + } + + fn parent(&mut self, _span: Self::Span) -> Option<Self::Span> { + // FIXME requires db, looks up the parent call site + None + } + fn source(&mut self, span: Self::Span) -> Self::Span { + // FIXME requires db, returns the top level call site + span + } + fn byte_range(&mut self, span: Self::Span) -> Range<usize> { + // FIXME requires db to resolve the ast id, THIS IS NOT INCREMENTAL + Range { start: span.range.start().into(), end: span.range.end().into() } + } + fn join(&mut self, first: Self::Span, second: Self::Span) -> Option<Self::Span> { + // We can't modify the span range for fixup spans, those are meaningful to fixup, so just + // prefer the non-fixup span. + if first.anchor.ast_id == FIXUP_ERASED_FILE_AST_ID_MARKER { + return Some(second); + } + if second.anchor.ast_id == FIXUP_ERASED_FILE_AST_ID_MARKER { + return Some(first); + } + // FIXME: Once we can talk back to the client, implement a "long join" request for anchors + // that differ in [AstId]s as joining those spans requires resolving the AstIds. + if first.anchor != second.anchor { + return None; + } + // Differing context, we can't merge these so prefer the one that's root + if first.ctx != second.ctx { + if first.ctx.is_root() { + return Some(second); + } else if second.ctx.is_root() { + return Some(first); + } + } + Some(Span { + range: first.range.cover(second.range), + anchor: second.anchor, + ctx: second.ctx, + }) + } + fn subspan( + &mut self, + span: Self::Span, + start: Bound<usize>, + end: Bound<usize>, + ) -> Option<Self::Span> { + // We can't modify the span range for fixup spans, those are meaningful to fixup. + if span.anchor.ast_id == FIXUP_ERASED_FILE_AST_ID_MARKER { + return Some(span); + } + let length = span.range.len().into(); + + let start: u32 = match start { + Bound::Included(lo) => lo, + Bound::Excluded(lo) => lo.checked_add(1)?, + Bound::Unbounded => 0, + } + .try_into() + .ok()?; + + let end: u32 = match end { + Bound::Included(hi) => hi.checked_add(1)?, + Bound::Excluded(hi) => hi, + Bound::Unbounded => span.range.len().into(), + } + .try_into() + .ok()?; + + // Bounds check the values, preventing addition overflow and OOB spans. + let span_start = span.range.start().into(); + if (u32::MAX - start) < span_start + || (u32::MAX - end) < span_start + || start >= end + || end > length + { + return None; + } + + Some(Span { + range: TextRange::new(TextSize::from(start), TextSize::from(end)) + span.range.start(), + ..span + }) + } + + fn resolved_at(&mut self, span: Self::Span, at: Self::Span) -> Self::Span { + Span { ctx: at.ctx, ..span } + } + + fn end(&mut self, span: Self::Span) -> Self::Span { + // We can't modify the span range for fixup spans, those are meaningful to fixup. + if span.anchor.ast_id == FIXUP_ERASED_FILE_AST_ID_MARKER { + return span; + } + Span { range: TextRange::empty(span.range.end()), ..span } + } + + fn start(&mut self, span: Self::Span) -> Self::Span { + // We can't modify the span range for fixup spans, those are meaningful to fixup. + if span.anchor.ast_id == FIXUP_ERASED_FILE_AST_ID_MARKER { + return span; + } + Span { range: TextRange::empty(span.range.start()), ..span } + } + + fn line(&mut self, _span: Self::Span) -> usize { + // FIXME requires db to resolve line index, THIS IS NOT INCREMENTAL + 0 + } + + fn column(&mut self, _span: Self::Span) -> usize { + // FIXME requires db to resolve line index, THIS IS NOT INCREMENTAL + 0 + } +} + +impl server::Symbol for RaSpanServer { + fn normalize_and_validate_ident(&mut self, string: &str) -> Result<Self::Symbol, ()> { + // FIXME: nfc-normalize and validate idents + Ok(<Self as server::Server>::intern_symbol(string)) + } +} + +impl server::Server for RaSpanServer { + fn globals(&mut self) -> bridge::ExpnGlobals<Self::Span> { + bridge::ExpnGlobals { + def_site: self.def_site, + call_site: self.call_site, + mixed_site: self.mixed_site, + } + } + + fn intern_symbol(ident: &str) -> Self::Symbol { + // FIXME: should be `self.interner` once the proc-macro api allows it. + Symbol::intern(&SYMBOL_INTERNER, &::tt::SmolStr::from(ident)) + } + + fn with_symbol_string(symbol: &Self::Symbol, f: impl FnOnce(&str)) { + // FIXME: should be `self.interner` once the proc-macro api allows it. + f(symbol.text(&SYMBOL_INTERNER).as_str()) + } +} diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_id.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_id.rs new file mode 100644 index 00000000000..12526ad4f3a --- /dev/null +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_id.rs @@ -0,0 +1,380 @@ +//! proc-macro server backend based on [`proc_macro_api::msg::TokenId`] as the backing span. +//! This backend is rather inflexible, used by RustRover and older rust-analyzer versions. +use std::{ + iter, + ops::{Bound, Range}, +}; + +use proc_macro::bridge::{self, server}; + +use crate::server::{ + delim_to_external, delim_to_internal, token_stream::TokenStreamBuilder, LiteralFormatter, + Symbol, SymbolInternerRef, SYMBOL_INTERNER, +}; +mod tt { + pub use proc_macro_api::msg::TokenId; + + pub use ::tt::*; + + pub type Subtree = ::tt::Subtree<TokenId>; + pub type TokenTree = ::tt::TokenTree<TokenId>; + pub type Leaf = ::tt::Leaf<TokenId>; + pub type Literal = ::tt::Literal<TokenId>; + pub type Punct = ::tt::Punct<TokenId>; + pub type Ident = ::tt::Ident<TokenId>; +} +type Group = tt::Subtree; +type TokenTree = tt::TokenTree; +#[allow(unused)] +type Punct = tt::Punct; +type Spacing = tt::Spacing; +#[allow(unused)] +type Literal = tt::Literal; +type Span = tt::TokenId; +type TokenStream = crate::server::TokenStream<Span>; + +#[derive(Clone)] +pub struct SourceFile; +pub struct FreeFunctions; + +pub struct TokenIdServer { + pub(crate) interner: SymbolInternerRef, + pub call_site: Span, + pub def_site: Span, + pub mixed_site: Span, +} + +impl server::Types for TokenIdServer { + type FreeFunctions = FreeFunctions; + type TokenStream = TokenStream; + type SourceFile = SourceFile; + type Span = Span; + type Symbol = Symbol; +} + +impl server::FreeFunctions for TokenIdServer { + fn injected_env_var(&mut self, _: &str) -> Option<std::string::String> { + None + } + fn track_env_var(&mut self, _var: &str, _value: Option<&str>) {} + fn track_path(&mut self, _path: &str) {} + fn literal_from_str( + &mut self, + s: &str, + ) -> Result<bridge::Literal<Self::Span, Self::Symbol>, ()> { + // FIXME: keep track of LitKind and Suffix + Ok(bridge::Literal { + kind: bridge::LitKind::Err, + symbol: Symbol::intern(self.interner, s), + suffix: None, + span: self.call_site, + }) + } + + fn emit_diagnostic(&mut self, _: bridge::Diagnostic<Self::Span>) {} +} + +impl server::TokenStream for TokenIdServer { + fn is_empty(&mut self, stream: &Self::TokenStream) -> bool { + stream.is_empty() + } + fn from_str(&mut self, src: &str) -> Self::TokenStream { + Self::TokenStream::from_str(src, self.call_site).expect("cannot parse string") + } + fn to_string(&mut self, stream: &Self::TokenStream) -> String { + stream.to_string() + } + fn from_token_tree( + &mut self, + tree: bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>, + ) -> Self::TokenStream { + match tree { + bridge::TokenTree::Group(group) => { + let group = Group { + delimiter: delim_to_internal(group.delimiter, group.span), + token_trees: match group.stream { + Some(stream) => stream.into_iter().collect(), + None => Vec::new(), + }, + }; + let tree = TokenTree::from(group); + Self::TokenStream::from_iter(iter::once(tree)) + } + + bridge::TokenTree::Ident(ident) => { + let text = ident.sym.text(self.interner); + let text = + if ident.is_raw { ::tt::SmolStr::from_iter(["r#", &text]) } else { text }; + let ident: tt::Ident = tt::Ident { text, span: ident.span }; + let leaf = tt::Leaf::from(ident); + let tree = TokenTree::from(leaf); + Self::TokenStream::from_iter(iter::once(tree)) + } + + bridge::TokenTree::Literal(literal) => { + let literal = LiteralFormatter(literal); + let text = literal.with_stringify_parts(self.interner, |parts| { + ::tt::SmolStr::from_iter(parts.iter().copied()) + }); + + let literal = tt::Literal { text, span: literal.0.span }; + let leaf = tt::Leaf::from(literal); + let tree = TokenTree::from(leaf); + Self::TokenStream::from_iter(iter::once(tree)) + } + + bridge::TokenTree::Punct(p) => { + let punct = tt::Punct { + char: p.ch as char, + spacing: if p.joint { Spacing::Joint } else { Spacing::Alone }, + span: p.span, + }; + let leaf = tt::Leaf::from(punct); + let tree = TokenTree::from(leaf); + Self::TokenStream::from_iter(iter::once(tree)) + } + } + } + + fn expand_expr(&mut self, self_: &Self::TokenStream) -> Result<Self::TokenStream, ()> { + Ok(self_.clone()) + } + + fn concat_trees( + &mut self, + base: Option<Self::TokenStream>, + trees: Vec<bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>>, + ) -> Self::TokenStream { + let mut builder = TokenStreamBuilder::new(); + if let Some(base) = base { + builder.push(base); + } + for tree in trees { + builder.push(self.from_token_tree(tree)); + } + builder.build() + } + + fn concat_streams( + &mut self, + base: Option<Self::TokenStream>, + streams: Vec<Self::TokenStream>, + ) -> Self::TokenStream { + let mut builder = TokenStreamBuilder::new(); + if let Some(base) = base { + builder.push(base); + } + for stream in streams { + builder.push(stream); + } + builder.build() + } + + fn into_trees( + &mut self, + stream: Self::TokenStream, + ) -> Vec<bridge::TokenTree<Self::TokenStream, Self::Span, Self::Symbol>> { + stream + .into_iter() + .map(|tree| match tree { + tt::TokenTree::Leaf(tt::Leaf::Ident(ident)) => { + bridge::TokenTree::Ident(bridge::Ident { + sym: Symbol::intern(self.interner, ident.text.trim_start_matches("r#")), + is_raw: ident.text.starts_with("r#"), + span: ident.span, + }) + } + tt::TokenTree::Leaf(tt::Leaf::Literal(lit)) => { + bridge::TokenTree::Literal(bridge::Literal { + // FIXME: handle literal kinds + kind: bridge::LitKind::Err, + symbol: Symbol::intern(self.interner, &lit.text), + // FIXME: handle suffixes + suffix: None, + span: lit.span, + }) + } + tt::TokenTree::Leaf(tt::Leaf::Punct(punct)) => { + bridge::TokenTree::Punct(bridge::Punct { + ch: punct.char as u8, + joint: punct.spacing == Spacing::Joint, + span: punct.span, + }) + } + tt::TokenTree::Subtree(subtree) => bridge::TokenTree::Group(bridge::Group { + delimiter: delim_to_external(subtree.delimiter), + stream: if subtree.token_trees.is_empty() { + None + } else { + Some(subtree.token_trees.into_iter().collect()) + }, + span: bridge::DelimSpan::from_single(subtree.delimiter.open), + }), + }) + .collect() + } +} + +impl server::SourceFile for TokenIdServer { + fn eq(&mut self, _file1: &Self::SourceFile, _file2: &Self::SourceFile) -> bool { + true + } + fn path(&mut self, _file: &Self::SourceFile) -> String { + String::new() + } + fn is_real(&mut self, _file: &Self::SourceFile) -> bool { + true + } +} + +impl server::Span for TokenIdServer { + fn debug(&mut self, span: Self::Span) -> String { + format!("{:?}", span.0) + } + fn source_file(&mut self, _span: Self::Span) -> Self::SourceFile { + SourceFile {} + } + fn save_span(&mut self, _span: Self::Span) -> usize { + 0 + } + fn recover_proc_macro_span(&mut self, _id: usize) -> Self::Span { + self.call_site + } + /// Recent feature, not yet in the proc_macro + /// + /// See PR: + /// https://github.com/rust-lang/rust/pull/55780 + fn source_text(&mut self, _span: Self::Span) -> Option<String> { + None + } + + fn parent(&mut self, _span: Self::Span) -> Option<Self::Span> { + None + } + fn source(&mut self, span: Self::Span) -> Self::Span { + span + } + fn byte_range(&mut self, _span: Self::Span) -> Range<usize> { + Range { start: 0, end: 0 } + } + fn join(&mut self, first: Self::Span, _second: Self::Span) -> Option<Self::Span> { + // Just return the first span again, because some macros will unwrap the result. + Some(first) + } + fn subspan( + &mut self, + span: Self::Span, + _start: Bound<usize>, + _end: Bound<usize>, + ) -> Option<Self::Span> { + // Just return the span again, because some macros will unwrap the result. + Some(span) + } + fn resolved_at(&mut self, _span: Self::Span, _at: Self::Span) -> Self::Span { + self.call_site + } + + fn end(&mut self, _self_: Self::Span) -> Self::Span { + self.call_site + } + + fn start(&mut self, _self_: Self::Span) -> Self::Span { + self.call_site + } + + fn line(&mut self, _span: Self::Span) -> usize { + 0 + } + + fn column(&mut self, _span: Self::Span) -> usize { + 0 + } +} + +impl server::Symbol for TokenIdServer { + fn normalize_and_validate_ident(&mut self, string: &str) -> Result<Self::Symbol, ()> { + // FIXME: nfc-normalize and validate idents + Ok(<Self as server::Server>::intern_symbol(string)) + } +} + +impl server::Server for TokenIdServer { + fn globals(&mut self) -> bridge::ExpnGlobals<Self::Span> { + bridge::ExpnGlobals { + def_site: self.def_site, + call_site: self.call_site, + mixed_site: self.mixed_site, + } + } + + fn intern_symbol(ident: &str) -> Self::Symbol { + Symbol::intern(&SYMBOL_INTERNER, &::tt::SmolStr::from(ident)) + } + + fn with_symbol_string(symbol: &Self::Symbol, f: impl FnOnce(&str)) { + f(symbol.text(&SYMBOL_INTERNER).as_str()) + } +} + +#[cfg(test)] +mod tests { + use super::*; + + #[test] + fn test_ra_server_to_string() { + let s = TokenStream { + token_trees: vec![ + tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { + text: "struct".into(), + span: tt::TokenId(0), + })), + tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { + text: "T".into(), + span: tt::TokenId(0), + })), + tt::TokenTree::Subtree(tt::Subtree { + delimiter: tt::Delimiter { + open: tt::TokenId(0), + close: tt::TokenId(0), + kind: tt::DelimiterKind::Brace, + }, + token_trees: vec![], + }), + ], + }; + + assert_eq!(s.to_string(), "struct T {}"); + } + + #[test] + fn test_ra_server_from_str() { + let subtree_paren_a = tt::TokenTree::Subtree(tt::Subtree { + delimiter: tt::Delimiter { + open: tt::TokenId(0), + close: tt::TokenId(0), + kind: tt::DelimiterKind::Parenthesis, + }, + token_trees: vec![tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { + text: "a".into(), + span: tt::TokenId(0), + }))], + }); + + let t1 = TokenStream::from_str("(a)", tt::TokenId(0)).unwrap(); + assert_eq!(t1.token_trees.len(), 1); + assert_eq!(t1.token_trees[0], subtree_paren_a); + + let t2 = TokenStream::from_str("(a);", tt::TokenId(0)).unwrap(); + assert_eq!(t2.token_trees.len(), 2); + assert_eq!(t2.token_trees[0], subtree_paren_a); + + let underscore = TokenStream::from_str("_", tt::TokenId(0)).unwrap(); + assert_eq!( + underscore.token_trees[0], + tt::TokenTree::Leaf(tt::Leaf::Ident(tt::Ident { + text: "_".into(), + span: tt::TokenId(0), + })) + ); + } +} diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_stream.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_stream.rs index 36be8825038..8f669a30494 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_stream.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/server/token_stream.rs @@ -1,20 +1,24 @@ //! TokenStream implementation used by sysroot ABI -use proc_macro_api::msg::TokenId; +use tt::TokenTree; -use crate::tt::{self, TokenTree}; +#[derive(Debug, Clone)] +pub struct TokenStream<S> { + pub(super) token_trees: Vec<TokenTree<S>>, +} -#[derive(Debug, Default, Clone)] -pub struct TokenStream { - pub(super) token_trees: Vec<TokenTree>, +impl<S> Default for TokenStream<S> { + fn default() -> Self { + Self { token_trees: vec![] } + } } -impl TokenStream { +impl<S> TokenStream<S> { pub(crate) fn new() -> Self { - TokenStream::default() + TokenStream { token_trees: vec![] } } - pub(crate) fn with_subtree(subtree: tt::Subtree) -> Self { + pub(crate) fn with_subtree(subtree: tt::Subtree<S>) -> Self { if subtree.delimiter.kind != tt::DelimiterKind::Invisible { TokenStream { token_trees: vec![TokenTree::Subtree(subtree)] } } else { @@ -22,7 +26,10 @@ impl TokenStream { } } - pub(crate) fn into_subtree(self, call_site: TokenId) -> tt::Subtree { + pub(crate) fn into_subtree(self, call_site: S) -> tt::Subtree<S> + where + S: Copy, + { tt::Subtree { delimiter: tt::Delimiter { open: call_site, @@ -39,37 +46,37 @@ impl TokenStream { } /// Creates a token stream containing a single token tree. -impl From<TokenTree> for TokenStream { - fn from(tree: TokenTree) -> TokenStream { +impl<S> From<TokenTree<S>> for TokenStream<S> { + fn from(tree: TokenTree<S>) -> TokenStream<S> { TokenStream { token_trees: vec![tree] } } } /// Collects a number of token trees into a single stream. -impl FromIterator<TokenTree> for TokenStream { - fn from_iter<I: IntoIterator<Item = TokenTree>>(trees: I) -> Self { +impl<S> FromIterator<TokenTree<S>> for TokenStream<S> { + fn from_iter<I: IntoIterator<Item = TokenTree<S>>>(trees: I) -> Self { trees.into_iter().map(TokenStream::from).collect() } } /// A "flattening" operation on token streams, collects token trees /// from multiple token streams into a single stream. -impl FromIterator<TokenStream> for TokenStream { - fn from_iter<I: IntoIterator<Item = TokenStream>>(streams: I) -> Self { +impl<S> FromIterator<TokenStream<S>> for TokenStream<S> { + fn from_iter<I: IntoIterator<Item = TokenStream<S>>>(streams: I) -> Self { let mut builder = TokenStreamBuilder::new(); streams.into_iter().for_each(|stream| builder.push(stream)); builder.build() } } -impl Extend<TokenTree> for TokenStream { - fn extend<I: IntoIterator<Item = TokenTree>>(&mut self, trees: I) { +impl<S> Extend<TokenTree<S>> for TokenStream<S> { + fn extend<I: IntoIterator<Item = TokenTree<S>>>(&mut self, trees: I) { self.extend(trees.into_iter().map(TokenStream::from)); } } -impl Extend<TokenStream> for TokenStream { - fn extend<I: IntoIterator<Item = TokenStream>>(&mut self, streams: I) { +impl<S> Extend<TokenStream<S>> for TokenStream<S> { + fn extend<I: IntoIterator<Item = TokenStream<S>>>(&mut self, streams: I) { for item in streams { for tkn in item { match tkn { @@ -87,22 +94,21 @@ impl Extend<TokenStream> for TokenStream { } } -pub(super) struct TokenStreamBuilder { - acc: TokenStream, +pub(super) struct TokenStreamBuilder<S> { + acc: TokenStream<S>, } /// pub(super)lic implementation details for the `TokenStream` type, such as iterators. pub(super) mod token_stream { - use proc_macro_api::msg::TokenId; - use super::{tt, TokenStream, TokenTree}; + use super::{TokenStream, TokenTree}; /// An iterator over `TokenStream`'s `TokenTree`s. /// The iteration is "shallow", e.g., the iterator doesn't recurse into delimited groups, /// and returns whole groups as token trees. - impl IntoIterator for TokenStream { - type Item = TokenTree; - type IntoIter = std::vec::IntoIter<TokenTree>; + impl<S> IntoIterator for TokenStream<S> { + type Item = TokenTree<S>; + type IntoIter = std::vec::IntoIter<TokenTree<S>>; fn into_iter(self) -> Self::IntoIter { self.token_trees.into_iter() @@ -119,71 +125,34 @@ pub(super) mod token_stream { /// NOTE: some errors may cause panics instead of returning `LexError`. We reserve the right to /// change these errors into `LexError`s later. #[rustfmt::skip] - impl /*FromStr for*/ TokenStream { + impl<S: tt::Span> /*FromStr for*/ TokenStream<S> { // type Err = LexError; - pub(crate) fn from_str(src: &str, call_site: TokenId) -> Result<TokenStream, LexError> { + pub(crate) fn from_str(src: &str, call_site: S) -> Result<TokenStream<S>, LexError> { let subtree = mbe::parse_to_token_tree_static_span(call_site, src).ok_or("Failed to parse from mbe")?; - let subtree = subtree_replace_token_ids_with_call_site(subtree,call_site); Ok(TokenStream::with_subtree(subtree)) } } - impl ToString for TokenStream { + impl<S> ToString for TokenStream<S> { fn to_string(&self) -> String { ::tt::pretty(&self.token_trees) } } - - fn subtree_replace_token_ids_with_call_site( - subtree: tt::Subtree, - call_site: TokenId, - ) -> tt::Subtree { - tt::Subtree { - delimiter: tt::Delimiter { open: call_site, close: call_site, ..subtree.delimiter }, - token_trees: subtree - .token_trees - .into_iter() - .map(|it| token_tree_replace_token_ids_with_call_site(it, call_site)) - .collect(), - } - } - - fn token_tree_replace_token_ids_with_call_site( - tt: tt::TokenTree, - call_site: TokenId, - ) -> tt::TokenTree { - match tt { - tt::TokenTree::Leaf(leaf) => { - tt::TokenTree::Leaf(leaf_replace_token_ids_with_call_site(leaf, call_site)) - } - tt::TokenTree::Subtree(subtree) => { - tt::TokenTree::Subtree(subtree_replace_token_ids_with_call_site(subtree, call_site)) - } - } - } - - fn leaf_replace_token_ids_with_call_site(leaf: tt::Leaf, call_site: TokenId) -> tt::Leaf { - match leaf { - tt::Leaf::Literal(lit) => tt::Leaf::Literal(tt::Literal { span: call_site, ..lit }), - tt::Leaf::Punct(punct) => tt::Leaf::Punct(tt::Punct { span: call_site, ..punct }), - tt::Leaf::Ident(ident) => tt::Leaf::Ident(tt::Ident { span: call_site, ..ident }), - } - } } -impl TokenStreamBuilder { - pub(super) fn new() -> TokenStreamBuilder { +impl<S> TokenStreamBuilder<S> { + pub(super) fn new() -> TokenStreamBuilder<S> { TokenStreamBuilder { acc: TokenStream::new() } } - pub(super) fn push(&mut self, stream: TokenStream) { + pub(super) fn push(&mut self, stream: TokenStream<S>) { self.acc.extend(stream.into_iter()) } - pub(super) fn build(self) -> TokenStream { + pub(super) fn build(self) -> TokenStream<S> { self.acc } } diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/mod.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/mod.rs index b04e3ca19ac..87d832cc76f 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/mod.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/mod.rs @@ -8,7 +8,7 @@ use expect_test::expect; #[test] fn test_derive_empty() { - assert_expand("DeriveEmpty", r#"struct S;"#, expect!["SUBTREE $$ 1 1"]); + assert_expand("DeriveEmpty", r#"struct S;"#, expect!["SUBTREE $$ 1 1"], expect!["SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"]); } #[test] @@ -23,6 +23,13 @@ fn test_derive_error() { SUBTREE () 1 1 LITERAL "#[derive(DeriveError)] struct S ;" 1 PUNCH ; [alone] 1"##]], + expect![[r##" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT compile_error SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH ! [alone] SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + SUBTREE () SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL "#[derive(DeriveError)] struct S ;" SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH ; [alone] SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"##]], ); } @@ -40,6 +47,15 @@ fn test_fn_like_macro_noop() { LITERAL 1 1 PUNCH , [alone] 1 SUBTREE [] 1 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT ident SpanData { range: 0..5, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 5..6, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 0 SpanData { range: 7..8, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 8..9, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 1 SpanData { range: 10..11, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 11..12, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + SUBTREE [] SpanData { range: 13..14, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 14..15, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], ); } @@ -53,6 +69,11 @@ fn test_fn_like_macro_clone_ident_subtree() { IDENT ident 1 PUNCH , [alone] 1 SUBTREE [] 1 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT ident SpanData { range: 0..5, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 5..6, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + SUBTREE [] SpanData { range: 7..8, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 7..8, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], ); } @@ -64,6 +85,41 @@ fn test_fn_like_macro_clone_raw_ident() { expect![[r#" SUBTREE $$ 1 1 IDENT r#async 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT r#async SpanData { range: 0..7, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], + ); +} + +#[test] +fn test_fn_like_fn_like_span_join() { + assert_expand( + "fn_like_span_join", + "foo bar", + expect![[r#" + SUBTREE $$ 1 1 + IDENT r#joined 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT r#joined SpanData { range: 0..11, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], + ); +} + +#[test] +fn test_fn_like_fn_like_span_ops() { + assert_expand( + "fn_like_span_ops", + "set_def_site resolved_at_def_site start_span", + expect![[r#" + SUBTREE $$ 1 1 + IDENT set_def_site 0 + IDENT resolved_at_def_site 1 + IDENT start_span 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT set_def_site SpanData { range: 0..150, anchor: SpanAnchor(FileId(41), 1), ctx: SyntaxContextId(0) } + IDENT resolved_at_def_site SpanData { range: 13..33, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT start_span SpanData { range: 34..34, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], ); } @@ -81,6 +137,15 @@ fn test_fn_like_mk_literals() { LITERAL 3.14 1 LITERAL 123i64 1 LITERAL 123 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL b"byte_string" SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 'c' SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL "string" SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 3.14f64 SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 3.14 SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 123i64 SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 123 SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], ); } @@ -93,6 +158,10 @@ fn test_fn_like_mk_idents() { SUBTREE $$ 1 1 IDENT standard 1 IDENT r#raw 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT standard SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT r#raw SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], ); } @@ -113,6 +182,18 @@ fn test_fn_like_macro_clone_literals() { LITERAL 3.14f32 1 PUNCH , [alone] 1 LITERAL "hello bridge" 1"#]], + expect![[r#" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 1u16 SpanData { range: 0..4, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 4..5, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 2_u32 SpanData { range: 6..11, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 11..12, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH - [alone] SpanData { range: 13..14, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 4i64 SpanData { range: 14..18, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 18..19, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL 3.14f32 SpanData { range: 20..27, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH , [alone] SpanData { range: 27..28, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL "hello bridge" SpanData { range: 29..43, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"#]], ); } @@ -132,6 +213,13 @@ fn test_attr_macro() { SUBTREE () 1 1 LITERAL "#[attr_error(some arguments)] mod m {}" 1 PUNCH ; [alone] 1"##]], + expect![[r##" + SUBTREE $$ SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + IDENT compile_error SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH ! [alone] SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + SUBTREE () SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + LITERAL "#[attr_error(some arguments)] mod m {}" SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) } + PUNCH ; [alone] SpanData { range: 0..100, anchor: SpanAnchor(FileId(42), 2), ctx: SyntaxContextId(0) }"##]], ); } @@ -147,6 +235,8 @@ fn list_test_macros() { fn_like_clone_tokens [FuncLike] fn_like_mk_literals [FuncLike] fn_like_mk_idents [FuncLike] + fn_like_span_join [FuncLike] + fn_like_span_ops [FuncLike] attr_noop [Attr] attr_panic [Attr] attr_error [Attr] diff --git a/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/utils.rs b/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/utils.rs index c12096d140c..9a1311d9550 100644 --- a/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/utils.rs +++ b/src/tools/rust-analyzer/crates/proc-macro-srv/src/tests/utils.rs @@ -2,47 +2,96 @@ use expect_test::Expect; use proc_macro_api::msg::TokenId; +use span::{ErasedFileAstId, FileId, Span, SpanAnchor, SyntaxContextId}; +use tt::TextRange; use crate::{dylib, proc_macro_test_dylib_path, ProcMacroSrv}; -fn parse_string(code: &str, call_site: TokenId) -> Option<crate::server::TokenStream> { - // This is a bit strange. We need to parse a string into a token stream into - // order to create a tt::SubTree from it in fixtures. `into_subtree` is - // implemented by all the ABIs we have so we arbitrarily choose one ABI to - // write a `parse_string` function for and use that. The tests don't really - // care which ABI we're using as the `into_subtree` function isn't part of - // the ABI and shouldn't change between ABI versions. - crate::server::TokenStream::from_str(code, call_site).ok() +fn parse_string(call_site: TokenId, src: &str) -> crate::server::TokenStream<TokenId> { + crate::server::TokenStream::with_subtree( + mbe::parse_to_token_tree_static_span(call_site, src).unwrap(), + ) } -pub fn assert_expand(macro_name: &str, ra_fixture: &str, expect: Expect) { - assert_expand_impl(macro_name, ra_fixture, None, expect); +fn parse_string_spanned( + anchor: SpanAnchor, + call_site: SyntaxContextId, + src: &str, +) -> crate::server::TokenStream<Span> { + crate::server::TokenStream::with_subtree( + mbe::parse_to_token_tree(anchor, call_site, src).unwrap(), + ) } -pub fn assert_expand_attr(macro_name: &str, ra_fixture: &str, attr_args: &str, expect: Expect) { - assert_expand_impl(macro_name, ra_fixture, Some(attr_args), expect); +pub fn assert_expand(macro_name: &str, ra_fixture: &str, expect: Expect, expect_s: Expect) { + assert_expand_impl(macro_name, ra_fixture, None, expect, expect_s); } -fn assert_expand_impl(macro_name: &str, input: &str, attr: Option<&str>, expect: Expect) { +pub fn assert_expand_attr( + macro_name: &str, + ra_fixture: &str, + attr_args: &str, + expect: Expect, + expect_s: Expect, +) { + assert_expand_impl(macro_name, ra_fixture, Some(attr_args), expect, expect_s); +} + +fn assert_expand_impl( + macro_name: &str, + input: &str, + attr: Option<&str>, + expect: Expect, + expect_s: Expect, +) { + let path = proc_macro_test_dylib_path(); + let expander = dylib::Expander::new(&path).unwrap(); + let def_site = TokenId(0); let call_site = TokenId(1); let mixed_site = TokenId(2); - let path = proc_macro_test_dylib_path(); - let expander = dylib::Expander::new(&path).unwrap(); - let fixture = parse_string(input, call_site).unwrap(); - let attr = attr.map(|attr| parse_string(attr, call_site).unwrap().into_subtree(call_site)); + let input_ts = parse_string(call_site, input); + let attr_ts = attr.map(|attr| parse_string(call_site, attr).into_subtree(call_site)); let res = expander .expand( macro_name, - &fixture.into_subtree(call_site), - attr.as_ref(), + input_ts.into_subtree(call_site), + attr_ts, def_site, call_site, mixed_site, ) .unwrap(); expect.assert_eq(&format!("{res:?}")); + + let def_site = Span { + range: TextRange::new(0.into(), 150.into()), + anchor: SpanAnchor { + file_id: FileId::from_raw(41), + ast_id: ErasedFileAstId::from_raw(From::from(1)), + }, + ctx: SyntaxContextId::ROOT, + }; + let call_site = Span { + range: TextRange::new(0.into(), 100.into()), + anchor: SpanAnchor { + file_id: FileId::from_raw(42), + ast_id: ErasedFileAstId::from_raw(From::from(2)), + }, + ctx: SyntaxContextId::ROOT, + }; + let mixed_site = call_site; + + let fixture = parse_string_spanned(call_site.anchor, call_site.ctx, input); + let attr = attr.map(|attr| { + parse_string_spanned(call_site.anchor, call_site.ctx, attr).into_subtree(call_site) + }); + + let res = expander + .expand(macro_name, fixture.into_subtree(call_site), attr, def_site, call_site, mixed_site) + .unwrap(); + expect_s.assert_eq(&format!("{res:?}")); } pub(crate) fn list() -> Vec<String> { diff --git a/src/tools/rust-analyzer/crates/proc-macro-test/Cargo.toml b/src/tools/rust-analyzer/crates/proc-macro-test/Cargo.toml deleted file mode 100644 index 12d7c07d3ed..00000000000 --- a/src/tools/rust-analyzer/crates/proc-macro-test/Cargo.toml +++ /dev/null @@ -1,20 +0,0 @@ -[package] -name = "proc-macro-test" -version = "0.0.0" -publish = false - -authors.workspace = true -edition.workspace = true -license.workspace = true -rust-version.workspace = true - -[lib] -doctest = false - -[build-dependencies] -cargo_metadata.workspace = true - -proc-macro-test-impl = { path = "imp", version = "0.0.0" } - -# local deps -toolchain.workspace = true diff --git a/src/tools/rust-analyzer/crates/profile/Cargo.toml b/src/tools/rust-analyzer/crates/profile/Cargo.toml index 56ce9d11c08..5350023c88f 100644 --- a/src/tools/rust-analyzer/crates/profile/Cargo.toml +++ b/src/tools/rust-analyzer/crates/profile/Cargo.toml @@ -31,3 +31,6 @@ jemalloc = ["jemalloc-ctl"] # Uncomment to enable for the whole crate graph # default = [ "cpu_profiler" ] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/project-model/Cargo.toml b/src/tools/rust-analyzer/crates/project-model/Cargo.toml index 3e48de6456b..3552ed19162 100644 --- a/src/tools/rust-analyzer/crates/project-model/Cargo.toml +++ b/src/tools/rust-analyzer/crates/project-model/Cargo.toml @@ -14,8 +14,8 @@ doctest = false [dependencies] anyhow.workspace = true cargo_metadata.workspace = true -rustc-hash = "1.1.0" -semver = "1.0.14" +rustc-hash.workspace = true +semver.workspace = true serde_json.workspace = true serde.workspace = true tracing.workspace = true @@ -33,3 +33,6 @@ toolchain.workspace = true [dev-dependencies] expect-test = "1.4.0" + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/project-model/src/cargo_workspace.rs b/src/tools/rust-analyzer/crates/project-model/src/cargo_workspace.rs index ca3d6e0596c..d89c4598afc 100644 --- a/src/tools/rust-analyzer/crates/project-model/src/cargo_workspace.rs +++ b/src/tools/rust-analyzer/crates/project-model/src/cargo_workspace.rs @@ -330,6 +330,7 @@ impl CargoWorkspace { cargo_metadata::Edition::E2015 => Edition::Edition2015, cargo_metadata::Edition::E2018 => Edition::Edition2018, cargo_metadata::Edition::E2021 => Edition::Edition2021, + cargo_metadata::Edition::_E2024 => Edition::Edition2024, _ => { tracing::error!("Unsupported edition `{:?}`", edition); Edition::CURRENT diff --git a/src/tools/rust-analyzer/crates/project-model/src/project_json.rs b/src/tools/rust-analyzer/crates/project-model/src/project_json.rs index 931eba11576..cf3231498f3 100644 --- a/src/tools/rust-analyzer/crates/project-model/src/project_json.rs +++ b/src/tools/rust-analyzer/crates/project-model/src/project_json.rs @@ -213,6 +213,8 @@ enum EditionData { Edition2018, #[serde(rename = "2021")] Edition2021, + #[serde(rename = "2024")] + Edition2024, } impl From<EditionData> for Edition { @@ -221,6 +223,7 @@ impl From<EditionData> for Edition { EditionData::Edition2015 => Edition::Edition2015, EditionData::Edition2018 => Edition::Edition2018, EditionData::Edition2021 => Edition::Edition2021, + EditionData::Edition2024 => Edition::Edition2024, } } } diff --git a/src/tools/rust-analyzer/crates/project-model/src/workspace.rs b/src/tools/rust-analyzer/crates/project-model/src/workspace.rs index 9333570354a..4057493fa3a 100644 --- a/src/tools/rust-analyzer/crates/project-model/src/workspace.rs +++ b/src/tools/rust-analyzer/crates/project-model/src/workspace.rs @@ -7,7 +7,7 @@ use std::{collections::VecDeque, fmt, fs, iter, process::Command, str::FromStr, use anyhow::{format_err, Context}; use base_db::{ CrateDisplayName, CrateGraph, CrateId, CrateName, CrateOrigin, Dependency, DependencyKind, - Edition, Env, FileId, LangCrateOrigin, ProcMacroPaths, ReleaseChannel, TargetLayoutLoadResult, + Edition, Env, FileId, LangCrateOrigin, ProcMacroPaths, TargetLayoutLoadResult, }; use cfg::{CfgDiff, CfgOptions}; use paths::{AbsPath, AbsPathBuf}; @@ -619,7 +619,7 @@ impl ProjectWorkspace { sysroot.as_ref().ok(), extra_env, Err("rust-project.json projects have no target layout set".into()), - toolchain.as_ref().and_then(|it| ReleaseChannel::from_str(it.pre.as_str())), + toolchain.clone(), ) } ProjectWorkspace::Cargo { @@ -644,7 +644,7 @@ impl ProjectWorkspace { Ok(it) => Ok(Arc::from(it.as_str())), Err(it) => Err(Arc::from(it.as_str())), }, - toolchain.as_ref().and_then(|it| ReleaseChannel::from_str(it.pre.as_str())), + toolchain.as_ref(), ), ProjectWorkspace::DetachedFiles { files, sysroot, rustc_cfg } => { detached_files_to_crate_graph( @@ -733,7 +733,7 @@ fn project_json_to_crate_graph( sysroot: Option<&Sysroot>, extra_env: &FxHashMap<String, String>, target_layout: TargetLayoutLoadResult, - channel: Option<ReleaseChannel>, + toolchain: Option<Version>, ) -> (CrateGraph, ProcMacroPaths) { let mut res = (CrateGraph::default(), ProcMacroPaths::default()); let (crate_graph, proc_macros) = &mut res; @@ -744,7 +744,7 @@ fn project_json_to_crate_graph( rustc_cfg.clone(), target_layout.clone(), load, - channel, + toolchain.as_ref(), ) }); @@ -807,7 +807,7 @@ fn project_json_to_crate_graph( CrateOrigin::Local { repo: None, name: None } }, target_layout.clone(), - channel, + toolchain.clone(), ); if *is_proc_macro { if let Some(path) = proc_macro_dylib_path.clone() { @@ -853,7 +853,7 @@ fn cargo_to_crate_graph( forced_cfg: Option<CfgOptions>, build_scripts: &WorkspaceBuildScripts, target_layout: TargetLayoutLoadResult, - channel: Option<ReleaseChannel>, + toolchain: Option<&Version>, ) -> (CrateGraph, ProcMacroPaths) { let _p = profile::span("cargo_to_crate_graph"); let mut res = (CrateGraph::default(), ProcMacroPaths::default()); @@ -866,7 +866,7 @@ fn cargo_to_crate_graph( rustc_cfg.clone(), target_layout.clone(), load, - channel, + toolchain, ), None => (SysrootPublicDeps::default(), None), }; @@ -950,7 +950,7 @@ fn cargo_to_crate_graph( is_proc_macro, target_layout.clone(), false, - channel, + toolchain.cloned(), ); if kind == TargetKind::Lib { lib_tgt = Some((crate_id, name.clone())); @@ -1038,7 +1038,7 @@ fn cargo_to_crate_graph( rustc_build_scripts }, target_layout, - channel, + toolchain, ); } } @@ -1117,7 +1117,7 @@ fn handle_rustc_crates( override_cfg: &CfgOverrides, build_scripts: &WorkspaceBuildScripts, target_layout: TargetLayoutLoadResult, - channel: Option<ReleaseChannel>, + toolchain: Option<&Version>, ) { let mut rustc_pkg_crates = FxHashMap::default(); // The root package of the rustc-dev component is rustc_driver, so we match that @@ -1172,7 +1172,7 @@ fn handle_rustc_crates( rustc_workspace[tgt].is_proc_macro, target_layout.clone(), true, - channel, + toolchain.cloned(), ); pkg_to_lib_crate.insert(pkg, crate_id); // Add dependencies on core / std / alloc for this crate @@ -1248,7 +1248,7 @@ fn add_target_crate_root( is_proc_macro: bool, target_layout: TargetLayoutLoadResult, rustc_crate: bool, - channel: Option<ReleaseChannel>, + toolchain: Option<Version>, ) -> CrateId { let edition = pkg.edition; let potential_cfg_options = if pkg.features.is_empty() { @@ -1304,7 +1304,7 @@ fn add_target_crate_root( CrateOrigin::Library { repo: pkg.repository.clone(), name: pkg.name.clone() } }, target_layout, - channel, + toolchain, ); if is_proc_macro { let proc_macro = match build_data.as_ref().map(|it| it.proc_macro_dylib_path.as_ref()) { @@ -1346,7 +1346,7 @@ fn sysroot_to_crate_graph( rustc_cfg: Vec<CfgFlag>, target_layout: TargetLayoutLoadResult, load: &mut dyn FnMut(&AbsPath) -> Option<FileId>, - channel: Option<ReleaseChannel>, + toolchain: Option<&Version>, ) -> (SysrootPublicDeps, Option<CrateId>) { let _p = profile::span("sysroot_to_crate_graph"); let cfg_options = create_cfg_options(rustc_cfg.clone()); @@ -1357,7 +1357,7 @@ fn sysroot_to_crate_graph( rustc_cfg, cfg_options, target_layout, - channel, + toolchain, crate_graph, sysroot, ), @@ -1380,7 +1380,7 @@ fn sysroot_to_crate_graph( false, CrateOrigin::Lang(LangCrateOrigin::from(&*sysroot[krate].name)), target_layout.clone(), - channel, + toolchain.cloned(), ); Some((krate, crate_id)) }) @@ -1412,7 +1412,7 @@ fn handle_hack_cargo_workspace( rustc_cfg: Vec<CfgFlag>, cfg_options: CfgOptions, target_layout: Result<Arc<str>, Arc<str>>, - channel: Option<ReleaseChannel>, + toolchain: Option<&Version>, crate_graph: &mut CrateGraph, sysroot: &Sysroot, ) -> FxHashMap<SysrootCrate, CrateId> { @@ -1426,7 +1426,7 @@ fn handle_hack_cargo_workspace( Some(cfg_options), &WorkspaceBuildScripts::default(), target_layout, - channel, + toolchain, ); crate_graph.extend(cg, &mut pm); for crate_name in ["std", "alloc", "core"] { diff --git a/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model.txt b/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model.txt index e98f016ca7d..d8d9e559e5c 100644 --- a/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model.txt +++ b/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model.txt @@ -62,7 +62,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 1: CrateData { root_file_id: FileId( @@ -135,7 +135,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 2: CrateData { root_file_id: FileId( @@ -208,7 +208,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 3: CrateData { root_file_id: FileId( @@ -281,7 +281,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 4: CrateData { root_file_id: FileId( @@ -350,6 +350,6 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, } \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_selective_overrides.txt b/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_selective_overrides.txt index e98f016ca7d..d8d9e559e5c 100644 --- a/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_selective_overrides.txt +++ b/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_selective_overrides.txt @@ -62,7 +62,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 1: CrateData { root_file_id: FileId( @@ -135,7 +135,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 2: CrateData { root_file_id: FileId( @@ -208,7 +208,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 3: CrateData { root_file_id: FileId( @@ -281,7 +281,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 4: CrateData { root_file_id: FileId( @@ -350,6 +350,6 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, } \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_wildcard_overrides.txt b/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_wildcard_overrides.txt index 7ecd53572e2..e0ba5ed498f 100644 --- a/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_wildcard_overrides.txt +++ b/src/tools/rust-analyzer/crates/project-model/test_data/output/cargo_hello_world_project_model_with_wildcard_overrides.txt @@ -61,7 +61,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 1: CrateData { root_file_id: FileId( @@ -133,7 +133,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 2: CrateData { root_file_id: FileId( @@ -205,7 +205,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 3: CrateData { root_file_id: FileId( @@ -277,7 +277,7 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, 4: CrateData { root_file_id: FileId( @@ -346,6 +346,6 @@ target_layout: Err( "target_data_layout not loaded", ), - channel: None, + toolchain: None, }, } \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/project-model/test_data/output/rust_project_hello_world_project_model.txt b/src/tools/rust-analyzer/crates/project-model/test_data/output/rust_project_hello_world_project_model.txt index 581a6afc148..e35f0fc7327 100644 --- a/src/tools/rust-analyzer/crates/project-model/test_data/output/rust_project_hello_world_project_model.txt +++ b/src/tools/rust-analyzer/crates/project-model/test_data/output/rust_project_hello_world_project_model.txt @@ -39,7 +39,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 1: CrateData { root_file_id: FileId( @@ -72,7 +72,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 2: CrateData { root_file_id: FileId( @@ -105,7 +105,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 3: CrateData { root_file_id: FileId( @@ -138,7 +138,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 4: CrateData { root_file_id: FileId( @@ -188,7 +188,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 5: CrateData { root_file_id: FileId( @@ -221,7 +221,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 6: CrateData { root_file_id: FileId( @@ -319,7 +319,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 7: CrateData { root_file_id: FileId( @@ -352,7 +352,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 8: CrateData { root_file_id: FileId( @@ -385,7 +385,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 9: CrateData { root_file_id: FileId( @@ -418,7 +418,7 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, 10: CrateData { root_file_id: FileId( @@ -495,6 +495,6 @@ target_layout: Err( "rust-project.json projects have no target layout set", ), - channel: None, + toolchain: None, }, } \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/Cargo.toml b/src/tools/rust-analyzer/crates/rust-analyzer/Cargo.toml index 39ac338aa1a..ad24d6d28cd 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/Cargo.toml +++ b/src/tools/rust-analyzer/crates/rust-analyzer/Cargo.toml @@ -24,12 +24,12 @@ crossbeam-channel = "0.5.5" dissimilar.workspace = true itertools.workspace = true scip = "0.3.1" -lsp-types = { version = "=0.94.0", features = ["proposed"] } +lsp-types = { version = "=0.95.0", features = ["proposed"] } parking_lot = "0.12.1" xflags = "0.3.0" oorandom = "11.1.3" rayon.workspace = true -rustc-hash = "1.1.0" +rustc-hash.workspace = true serde_json = { workspace = true, features = ["preserve_order"] } serde.workspace = true num_cpus = "1.15.0" @@ -76,6 +76,7 @@ expect-test = "1.4.0" xshell.workspace = true test-utils.workspace = true +test-fixture.workspace = true sourcegen.workspace = true mbe.workspace = true @@ -93,3 +94,6 @@ in-rust-tree = [ "hir-def/in-rust-tree", "hir-ty/in-rust-tree", ] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/bin/main.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/bin/main.rs index 8472e49de98..7432f0f7a7c 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/bin/main.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/bin/main.rs @@ -5,8 +5,7 @@ #![warn(rust_2018_idioms, unused_lifetimes)] #![cfg_attr(feature = "in-rust-tree", feature(rustc_private))] #[cfg(feature = "in-rust-tree")] -#[allow(unused_extern_crates)] -extern crate rustc_driver; +extern crate rustc_driver as _; mod logger; mod rustc_wrapper; @@ -172,7 +171,15 @@ fn run_server() -> anyhow::Result<()> { let (connection, io_threads) = Connection::stdio(); - let (initialize_id, initialize_params) = connection.initialize_start()?; + let (initialize_id, initialize_params) = match connection.initialize_start() { + Ok(it) => it, + Err(e) => { + if e.channel_is_disconnected() { + io_threads.join()?; + } + return Err(e.into()); + } + }; tracing::info!("InitializeParams: {}", initialize_params); let lsp_types::InitializeParams { root_uri, @@ -240,7 +247,12 @@ fn run_server() -> anyhow::Result<()> { let initialize_result = serde_json::to_value(initialize_result).unwrap(); - connection.initialize_finish(initialize_id, initialize_result)?; + if let Err(e) = connection.initialize_finish(initialize_id, initialize_result) { + if e.channel_is_disconnected() { + io_threads.join()?; + } + return Err(e.into()); + } if !config.has_linked_projects() && config.detached_files().is_empty() { config.rediscover_workspaces(); diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/caps.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/caps.rs index 8c9261ab05e..94eab97e8fc 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/caps.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/caps.rs @@ -157,6 +157,8 @@ pub fn server_capabilities(config: &Config) -> ServerCapabilities { "ssr": true, "workspaceSymbolScopeKindFiltering": true, })), + diagnostic_provider: None, + inline_completion_provider: None, } } diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/cargo_target_spec.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/cargo_target_spec.rs index 728bade0d0a..0190ca3cab8 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/cargo_target_spec.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/cargo_target_spec.rs @@ -209,7 +209,7 @@ mod tests { use super::*; use cfg::CfgExpr; - use mbe::{syntax_node_to_token_tree, DummyTestSpanMap}; + use mbe::{syntax_node_to_token_tree, DummyTestSpanMap, DUMMY}; use syntax::{ ast::{self, AstNode}, SmolStr, @@ -219,7 +219,7 @@ mod tests { let cfg_expr = { let source_file = ast::SourceFile::parse(cfg).ok().unwrap(); let tt = source_file.syntax().descendants().find_map(ast::TokenTree::cast).unwrap(); - let tt = syntax_node_to_token_tree(tt.syntax(), &DummyTestSpanMap); + let tt = syntax_node_to_token_tree(tt.syntax(), &DummyTestSpanMap, DUMMY); CfgExpr::parse(&tt) }; diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/rustc_tests.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/rustc_tests.rs index c89b88ac0f9..b8f6138161e 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/rustc_tests.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/rustc_tests.rs @@ -4,8 +4,8 @@ use std::{ cell::RefCell, collections::HashMap, fs::read_to_string, panic::AssertUnwindSafe, path::PathBuf, }; -use hir::Crate; -use ide::{AnalysisHost, Change, DiagnosticCode, DiagnosticsConfig}; +use hir::{Change, Crate}; +use ide::{AnalysisHost, DiagnosticCode, DiagnosticsConfig}; use profile::StopWatch; use project_model::{CargoConfig, ProjectWorkspace, RustLibSource, Sysroot}; diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/scip.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/scip.rs index 30e11402cd8..95c8798d43c 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/scip.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/cli/scip.rs @@ -278,8 +278,8 @@ fn token_to_symbol(token: &TokenStaticData) -> Option<scip_types::Symbol> { mod test { use super::*; use ide::{AnalysisHost, FilePosition, StaticIndex, TextSize}; - use ide_db::base_db::fixture::ChangeFixture; use scip::symbol::format_symbol; + use test_fixture::ChangeFixture; fn position(ra_fixture: &str) -> (AnalysisHost, FilePosition) { let mut host = AnalysisHost::default(); diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/config.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/config.rs index 258f7410639..88fb3708449 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/config.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/config.rs @@ -7,7 +7,11 @@ //! configure the server itself, feature flags are passed into analysis, and //! tweak things like automatic insertion of `()` in completions. -use std::{fmt, iter, ops::Not, path::PathBuf}; +use std::{ + fmt, iter, + ops::Not, + path::{Path, PathBuf}, +}; use cfg::{CfgAtom, CfgDiff}; use flycheck::FlycheckConfig; @@ -105,6 +109,9 @@ config_data! { /// ``` /// . cargo_buildScripts_overrideCommand: Option<Vec<String>> = "null", + /// Rerun proc-macros building/build-scripts running when proc-macro + /// or build-script sources change and are saved. + cargo_buildScripts_rebuildOnSave: bool = "false", /// Use `RUSTC_WRAPPER=rust-analyzer` when running build scripts to /// avoid checking unnecessary things. cargo_buildScripts_useRustcWrapper: bool = "true", @@ -164,15 +171,15 @@ config_data! { /// Specifies the working directory for running checks. /// - "workspace": run checks for workspaces in the corresponding workspaces' root directories. // FIXME: Ideally we would support this in some way - /// This falls back to "root" if `#rust-analyzer.cargo.check.invocationStrategy#` is set to `once`. + /// This falls back to "root" if `#rust-analyzer.check.invocationStrategy#` is set to `once`. /// - "root": run checks in the project's root directory. - /// This config only has an effect when `#rust-analyzer.cargo.check.overrideCommand#` + /// This config only has an effect when `#rust-analyzer.check.overrideCommand#` /// is set. check_invocationLocation | checkOnSave_invocationLocation: InvocationLocation = "\"workspace\"", /// Specifies the invocation strategy to use when running the check command. /// If `per_workspace` is set, the command will be executed for each workspace. /// If `once` is set, the command will be executed once. - /// This config only has an effect when `#rust-analyzer.cargo.check.overrideCommand#` + /// This config only has an effect when `#rust-analyzer.check.overrideCommand#` /// is set. check_invocationStrategy | checkOnSave_invocationStrategy: InvocationStrategy = "\"per_workspace\"", /// Whether to pass `--no-default-features` to Cargo. Defaults to @@ -191,8 +198,8 @@ config_data! { /// If there are multiple linked projects/workspaces, this command is invoked for /// each of them, with the working directory being the workspace root /// (i.e., the folder containing the `Cargo.toml`). This can be overwritten - /// by changing `#rust-analyzer.cargo.check.invocationStrategy#` and - /// `#rust-analyzer.cargo.check.invocationLocation#`. + /// by changing `#rust-analyzer.check.invocationStrategy#` and + /// `#rust-analyzer.check.invocationLocation#`. /// /// An example command would be: /// @@ -917,7 +924,19 @@ impl Config { pub fn has_linked_projects(&self) -> bool { !self.data.linkedProjects.is_empty() } - pub fn linked_projects(&self) -> Vec<LinkedProject> { + pub fn linked_manifests(&self) -> impl Iterator<Item = &Path> + '_ { + self.data.linkedProjects.iter().filter_map(|it| match it { + ManifestOrProjectJson::Manifest(p) => Some(&**p), + ManifestOrProjectJson::ProjectJson(_) => None, + }) + } + pub fn has_linked_project_jsons(&self) -> bool { + self.data + .linkedProjects + .iter() + .any(|it| matches!(it, ManifestOrProjectJson::ProjectJson(_))) + } + pub fn linked_or_discovered_projects(&self) -> Vec<LinkedProject> { match self.data.linkedProjects.as_slice() { [] => { let exclude_dirs: Vec<_> = @@ -952,15 +971,6 @@ impl Config { } } - pub fn add_linked_projects(&mut self, linked_projects: Vec<ProjectJsonData>) { - let mut linked_projects = linked_projects - .into_iter() - .map(ManifestOrProjectJson::ProjectJson) - .collect::<Vec<ManifestOrProjectJson>>(); - - self.data.linkedProjects.append(&mut linked_projects); - } - pub fn did_save_text_document_dynamic_registration(&self) -> bool { let caps = try_or_def!(self.caps.text_document.as_ref()?.synchronization.clone()?); caps.did_save == Some(true) && caps.dynamic_registration == Some(true) @@ -1369,6 +1379,10 @@ impl Config { self.data.checkOnSave } + pub fn script_rebuild_on_save(&self) -> bool { + self.data.cargo_buildScripts_rebuildOnSave + } + pub fn runnables(&self) -> RunnablesConfig { RunnablesConfig { override_cargo: self.data.runnables_command.clone(), diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/global_state.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/global_state.rs index 0f31fe16054..f57a27305f0 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/global_state.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/global_state.rs @@ -7,7 +7,8 @@ use std::time::Instant; use crossbeam_channel::{unbounded, Receiver, Sender}; use flycheck::FlycheckHandle; -use ide::{Analysis, AnalysisHost, Cancellable, Change, FileId}; +use hir::Change; +use ide::{Analysis, AnalysisHost, Cancellable, FileId}; use ide_db::base_db::{CrateId, FileLoader, ProcMacroPaths, SourceDatabase}; use load_cargo::SourceRootConfig; use lsp_types::{SemanticTokens, Url}; diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/notification.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/notification.rs index f9070d27353..7e6219991b6 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/notification.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/notification.rs @@ -130,6 +130,13 @@ pub(crate) fn handle_did_save_text_document( state: &mut GlobalState, params: DidSaveTextDocumentParams, ) -> anyhow::Result<()> { + if state.config.script_rebuild_on_save() && state.proc_macro_changed { + // reset the flag + state.proc_macro_changed = false; + // rebuild the proc macros + state.fetch_build_data_queue.request_op("ScriptRebuildOnSave".to_owned(), ()); + } + if let Ok(vfs_path) = from_proto::vfs_path(¶ms.text_document.uri) { // Re-fetch workspaces if a workspace related file has changed if let Some(abs_path) = vfs_path.as_path() { diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/request.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/request.rs index d8a590c8088..f1317ce2b40 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/request.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/handlers/request.rs @@ -453,7 +453,7 @@ pub(crate) fn handle_document_symbol( pub(crate) fn handle_workspace_symbol( snap: GlobalStateSnapshot, params: WorkspaceSymbolParams, -) -> anyhow::Result<Option<Vec<SymbolInformation>>> { +) -> anyhow::Result<Option<lsp_types::WorkspaceSymbolResponse>> { let _p = profile::span("handle_workspace_symbol"); let config = snap.config.workspace_symbol(); @@ -479,7 +479,7 @@ pub(crate) fn handle_workspace_symbol( res = exec_query(&snap, query)?; } - return Ok(Some(res)); + return Ok(Some(lsp_types::WorkspaceSymbolResponse::Nested(res))); fn decide_search_scope_and_kind( params: &WorkspaceSymbolParams, @@ -519,13 +519,12 @@ pub(crate) fn handle_workspace_symbol( fn exec_query( snap: &GlobalStateSnapshot, query: Query, - ) -> anyhow::Result<Vec<SymbolInformation>> { + ) -> anyhow::Result<Vec<lsp_types::WorkspaceSymbol>> { let mut res = Vec::new(); for nav in snap.analysis.symbol_search(query)? { let container_name = nav.container_name.as_ref().map(|v| v.to_string()); - #[allow(deprecated)] - let info = SymbolInformation { + let info = lsp_types::WorkspaceSymbol { name: match &nav.alias { Some(alias) => format!("{} (alias for {})", alias, nav.name), None => format!("{}", nav.name), @@ -534,10 +533,11 @@ pub(crate) fn handle_workspace_symbol( .kind .map(to_proto::symbol_kind) .unwrap_or(lsp_types::SymbolKind::VARIABLE), + // FIXME: Set deprecation tags: None, - location: to_proto::location_from_nav(snap, nav)?, container_name, - deprecated: None, + location: lsp_types::OneOf::Left(to_proto::location_from_nav(snap, nav)?), + data: None, }; res.push(info); } @@ -801,7 +801,7 @@ pub(crate) fn handle_runnables( } } None => { - if !snap.config.linked_projects().is_empty() { + if !snap.config.linked_or_discovered_projects().is_empty() { res.push(lsp_ext::Runnable { label: "cargo check --workspace".to_string(), location: None, diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/integrated_benchmarks.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/integrated_benchmarks.rs index 41ff17f5e43..d94f7cefa60 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/integrated_benchmarks.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/integrated_benchmarks.rs @@ -10,7 +10,8 @@ //! in release mode in VS Code. There's however "rust-analyzer: Copy Run Command Line" //! which you can use to paste the command in terminal and add `--release` manually. -use ide::{CallableSnippets, Change, CompletionConfig, FilePosition, TextSize}; +use hir::Change; +use ide::{CallableSnippets, CompletionConfig, FilePosition, TextSize}; use ide_db::{ imports::insert_use::{ImportGranularity, InsertUseConfig}, SnippetCap, diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/ext.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/ext.rs index ad56899163d..35c8fad3741 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/ext.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/ext.rs @@ -627,7 +627,7 @@ pub enum WorkspaceSymbol {} impl Request for WorkspaceSymbol { type Params = WorkspaceSymbolParams; - type Result = Option<Vec<lsp_types::SymbolInformation>>; + type Result = Option<lsp_types::WorkspaceSymbolResponse>; const METHOD: &'static str = "workspace/symbol"; } diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/to_proto.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/to_proto.rs index dae560c5de1..7f3c3aa7a15 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/to_proto.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/to_proto.rs @@ -857,7 +857,7 @@ pub(crate) fn location_from_nav( ) -> Cancellable<lsp_types::Location> { let url = url(snap, nav.file_id); let line_index = snap.file_line_index(nav.file_id)?; - let range = range(&line_index, nav.full_range); + let range = range(&line_index, nav.focus_or_full_range()); let loc = lsp_types::Location::new(url, range); Ok(loc) } diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/utils.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/utils.rs index b388b317599..a4417e4d4a1 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/utils.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/lsp/utils.rs @@ -171,30 +171,19 @@ pub(crate) fn apply_document_changes( file_contents: impl FnOnce() -> String, mut content_changes: Vec<lsp_types::TextDocumentContentChangeEvent>, ) -> String { - // Skip to the last full document change, as it invalidates all previous changes anyways. - let mut start = content_changes - .iter() - .rev() - .position(|change| change.range.is_none()) - .map(|idx| content_changes.len() - idx - 1) - .unwrap_or(0); - - let mut text: String = match content_changes.get_mut(start) { - // peek at the first content change as an optimization - Some(lsp_types::TextDocumentContentChangeEvent { range: None, text, .. }) => { - let text = mem::take(text); - start += 1; - - // The only change is a full document update - if start == content_changes.len() { - return text; + // If at least one of the changes is a full document change, use the last + // of them as the starting point and ignore all previous changes. + let (mut text, content_changes) = + match content_changes.iter().rposition(|change| change.range.is_none()) { + Some(idx) => { + let text = mem::take(&mut content_changes[idx].text); + (text, &content_changes[idx + 1..]) } - text - } - Some(_) => file_contents(), - // we received no content changes - None => return file_contents(), - }; + None => (file_contents(), &content_changes[..]), + }; + if content_changes.is_empty() { + return text; + } let mut line_index = LineIndex { // the index will be overwritten in the bottom loop's first iteration diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/src/reload.rs b/src/tools/rust-analyzer/crates/rust-analyzer/src/reload.rs index 7ab528f4975..91dc6c2e4b4 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/src/reload.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/src/reload.rs @@ -16,10 +16,9 @@ use std::{iter, mem}; use flycheck::{FlycheckConfig, FlycheckHandle}; -use hir::db::DefDatabase; -use ide::Change; +use hir::{db::DefDatabase, Change, ProcMacros}; use ide_db::{ - base_db::{salsa::Durability, CrateGraph, ProcMacroPaths, ProcMacros}, + base_db::{salsa::Durability, CrateGraph, ProcMacroPaths}, FxHashMap, }; use itertools::Itertools; @@ -81,7 +80,8 @@ impl GlobalState { &self.config.lru_query_capacities().cloned().unwrap_or_default(), ); } - if self.config.linked_projects() != old_config.linked_projects() { + if self.config.linked_or_discovered_projects() != old_config.linked_or_discovered_projects() + { self.fetch_workspaces_queue.request_op("linked projects changed".to_string(), false) } else if self.config.flycheck() != old_config.flycheck() { self.reload_flycheck(); @@ -129,7 +129,7 @@ impl GlobalState { status.health = lsp_ext::Health::Warning; message.push_str("Auto-reloading is disabled and the workspace has changed, a manual workspace reload is required.\n\n"); } - if self.config.linked_projects().is_empty() + if self.config.linked_or_discovered_projects().is_empty() && self.config.detached_files().is_empty() && self.config.notifications().cargo_toml_not_found { @@ -175,7 +175,21 @@ impl GlobalState { if let Err(_) = self.fetch_workspace_error() { status.health = lsp_ext::Health::Error; - message.push_str("Failed to load workspaces.\n\n"); + message.push_str("Failed to load workspaces."); + + if self.config.has_linked_projects() { + message.push_str( + "`rust-analyzer.linkedProjects` have been specified, which may be incorrect. Specified project paths:\n", + ); + message.push_str(&format!( + " {}", + self.config.linked_manifests().map(|it| it.display()).format("\n ") + )); + if self.config.has_linked_project_jsons() { + message.push_str("\nAdditionally, one or more project jsons are specified") + } + } + message.push_str("\n\n"); } if !message.is_empty() { @@ -188,7 +202,7 @@ impl GlobalState { tracing::info!(%cause, "will fetch workspaces"); self.task_pool.handle.spawn_with_sender(ThreadIntent::Worker, { - let linked_projects = self.config.linked_projects(); + let linked_projects = self.config.linked_or_discovered_projects(); let detached_files = self.config.detached_files().to_vec(); let cargo_config = self.config.cargo(); diff --git a/src/tools/rust-analyzer/crates/rust-analyzer/tests/slow-tests/main.rs b/src/tools/rust-analyzer/crates/rust-analyzer/tests/slow-tests/main.rs index ec8e5c6dd96..78411e2d58d 100644 --- a/src/tools/rust-analyzer/crates/rust-analyzer/tests/slow-tests/main.rs +++ b/src/tools/rust-analyzer/crates/rust-analyzer/tests/slow-tests/main.rs @@ -832,7 +832,7 @@ fn main() { } #[test] -#[cfg(feature = "sysroot-abi")] +#[cfg(any(feature = "sysroot-abi", rust_analyzer))] fn resolve_proc_macro() { use expect_test::expect; if skip_slow_tests() { diff --git a/src/tools/rust-analyzer/crates/rustc-dependencies/Cargo.toml b/src/tools/rust-analyzer/crates/rustc-dependencies/Cargo.toml index 1b3b6ec735e..0bf04301df1 100644 --- a/src/tools/rust-analyzer/crates/rustc-dependencies/Cargo.toml +++ b/src/tools/rust-analyzer/crates/rustc-dependencies/Cargo.toml @@ -18,3 +18,6 @@ ra-ap-rustc_abi = { version = "0.21.0", default-features = false } [features] in-rust-tree = [] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/sourcegen/Cargo.toml b/src/tools/rust-analyzer/crates/sourcegen/Cargo.toml index 0514af8e783..d5ea4c39aa1 100644 --- a/src/tools/rust-analyzer/crates/sourcegen/Cargo.toml +++ b/src/tools/rust-analyzer/crates/sourcegen/Cargo.toml @@ -2,6 +2,7 @@ name = "sourcegen" version = "0.0.0" description = "TBD" +publish = false authors.workspace = true edition.workspace = true @@ -13,3 +14,6 @@ doctest = false [dependencies] xshell.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/span/Cargo.toml b/src/tools/rust-analyzer/crates/span/Cargo.toml new file mode 100644 index 00000000000..69b88b5a17b --- /dev/null +++ b/src/tools/rust-analyzer/crates/span/Cargo.toml @@ -0,0 +1,21 @@ +[package] +name = "span" +version = "0.0.0" +rust-version.workspace = true +edition.workspace = true +license.workspace = true +authors.workspace = true + + +[dependencies] +la-arena.workspace = true +rust-analyzer-salsa.workspace = true + + +# local deps +vfs.workspace = true +syntax.workspace = true +stdx.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/base-db/src/span.rs b/src/tools/rust-analyzer/crates/span/src/lib.rs index d8990eb7cae..7617acde64a 100644 --- a/src/tools/rust-analyzer/crates/base-db/src/span.rs +++ b/src/tools/rust-analyzer/crates/span/src/lib.rs @@ -1,10 +1,28 @@ //! File and span related types. -// FIXME: This should probably be moved into its own crate. +// FIXME: This should be moved into its own crate to get rid of the dependency inversion, base-db +// has business depending on tt, tt should depend on a span crate only (which unforunately will have +// to depend on salsa) use std::fmt; use salsa::InternId; -use tt::SyntaxContext; -use vfs::FileId; + +mod map; + +pub use crate::map::{RealSpanMap, SpanMap}; +pub use syntax::{TextRange, TextSize}; +pub use vfs::FileId; + +#[derive(Clone, Copy, Debug, PartialEq, Eq, Hash)] +pub struct FilePosition { + pub file_id: FileId, + pub offset: TextSize, +} + +#[derive(Clone, Copy, Debug, Eq, PartialEq, Hash)] +pub struct FileRange { + pub file_id: FileId, + pub range: TextRange, +} pub type ErasedFileAstId = la_arena::Idx<syntax::SyntaxNodePtr>; @@ -12,7 +30,33 @@ pub type ErasedFileAstId = la_arena::Idx<syntax::SyntaxNodePtr>; pub const ROOT_ERASED_FILE_AST_ID: ErasedFileAstId = la_arena::Idx::from_raw(la_arena::RawIdx::from_u32(0)); -pub type SpanData = tt::SpanData<SpanAnchor, SyntaxContextId>; +/// FileId used as the span for syntax node fixups. Any Span containing this file id is to be +/// considered fake. +pub const FIXUP_ERASED_FILE_AST_ID_MARKER: ErasedFileAstId = + // we pick the second to last for this in case we every consider making this a NonMaxU32, this + // is required to be stable for the proc-macro-server + la_arena::Idx::from_raw(la_arena::RawIdx::from_u32(!0 - 1)); + +#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)] +pub struct SpanData<Ctx> { + /// The text range of this span, relative to the anchor. + /// We need the anchor for incrementality, as storing absolute ranges will require + /// recomputation on every change in a file at all times. + pub range: TextRange, + pub anchor: SpanAnchor, + /// The syntax context of the span. + pub ctx: Ctx, +} +impl Span { + #[deprecated = "dummy spans will panic if surfaced incorrectly, as such they should be replaced appropriately"] + pub const DUMMY: Self = SpanData { + range: TextRange::empty(TextSize::new(0)), + anchor: SpanAnchor { file_id: FileId::BOGUS, ast_id: ROOT_ERASED_FILE_AST_ID }, + ctx: SyntaxContextId::ROOT, + }; +} + +pub type Span = SpanData<SyntaxContextId>; #[derive(Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Hash)] pub struct SyntaxContextId(InternId); @@ -33,7 +77,15 @@ impl fmt::Debug for SyntaxContextId { } } } -crate::impl_intern_key!(SyntaxContextId); + +impl salsa::InternKey for SyntaxContextId { + fn from_intern_id(v: salsa::InternId) -> Self { + SyntaxContextId(v) + } + fn as_intern_id(&self) -> salsa::InternId { + self.0 + } +} impl fmt::Display for SyntaxContextId { fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { @@ -41,9 +93,6 @@ impl fmt::Display for SyntaxContextId { } } -impl SyntaxContext for SyntaxContextId { - const DUMMY: Self = Self::ROOT; -} // inherent trait impls please tyvm impl SyntaxContextId { pub const ROOT: Self = SyntaxContextId(unsafe { InternId::new_unchecked(0) }); @@ -55,6 +104,14 @@ impl SyntaxContextId { pub fn is_root(self) -> bool { self == Self::ROOT } + + pub fn into_u32(self) -> u32 { + self.0.as_u32() + } + + pub fn from_u32(u32: u32) -> Self { + Self(InternId::from(u32)) + } } #[derive(Copy, Clone, PartialEq, Eq, Hash)] @@ -69,10 +126,6 @@ impl fmt::Debug for SpanAnchor { } } -impl tt::SpanAnchor for SpanAnchor { - const DUMMY: Self = SpanAnchor { file_id: FileId::BOGUS, ast_id: ROOT_ERASED_FILE_AST_ID }; -} - /// Input to the analyzer is a set of files, where each file is identified by /// `FileId` and contains source code. However, another source of source code in /// Rust are macros: each macro can be thought of as producing a "temporary @@ -90,6 +143,7 @@ impl tt::SpanAnchor for SpanAnchor { /// The two variants are encoded in a single u32 which are differentiated by the MSB. /// If the MSB is 0, the value represents a `FileId`, otherwise the remaining 31 bits represent a /// `MacroCallId`. +// FIXME: Give this a better fitting name #[derive(Clone, Copy, PartialEq, Eq, Hash, PartialOrd, Ord)] pub struct HirFileId(u32); @@ -120,7 +174,15 @@ pub struct MacroFileId { /// `println!("Hello, {}", world)`. #[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord, Hash)] pub struct MacroCallId(salsa::InternId); -crate::impl_intern_key!(MacroCallId); + +impl salsa::InternKey for MacroCallId { + fn from_intern_id(v: salsa::InternId) -> Self { + MacroCallId(v) + } + fn as_intern_id(&self) -> salsa::InternId { + self.0 + } +} impl MacroCallId { pub fn as_file(self) -> HirFileId { diff --git a/src/tools/rust-analyzer/crates/mbe/src/token_map.rs b/src/tools/rust-analyzer/crates/span/src/map.rs index 7d15812f8cb..d69df91b63e 100644 --- a/src/tools/rust-analyzer/crates/mbe/src/token_map.rs +++ b/src/tools/rust-analyzer/crates/span/src/map.rs @@ -1,18 +1,23 @@ -//! Mapping between `TokenId`s and the token's position in macro definitions or inputs. +//! A map that maps a span to every position in a file. Usually maps a span to some range of positions. +//! Allows bidirectional lookup. use std::hash::Hash; use stdx::{always, itertools::Itertools}; use syntax::{TextRange, TextSize}; -use tt::Span; +use vfs::FileId; + +use crate::{ErasedFileAstId, Span, SpanAnchor, SyntaxContextId, ROOT_ERASED_FILE_AST_ID}; /// Maps absolute text ranges for the corresponding file to the relevant span data. #[derive(Debug, PartialEq, Eq, Clone, Hash)] -pub struct SpanMap<S: Span> { +pub struct SpanMap<S> { spans: Vec<(TextSize, S)>, + // FIXME: Should be + // spans: Vec<(TextSize, crate::SyntaxContextId)>, } -impl<S: Span> SpanMap<S> { +impl<S: Copy> SpanMap<S> { /// Creates a new empty [`SpanMap`]. pub fn empty() -> Self { Self { spans: Vec::new() } @@ -44,7 +49,10 @@ impl<S: Span> SpanMap<S> { /// Returns all [`TextRange`]s that correspond to the given span. /// /// Note this does a linear search through the entire backing vector. - pub fn ranges_with_span(&self, span: S) -> impl Iterator<Item = TextRange> + '_ { + pub fn ranges_with_span(&self, span: S) -> impl Iterator<Item = TextRange> + '_ + where + S: Eq, + { // FIXME: This should ignore the syntax context! self.spans.iter().enumerate().filter_map(move |(idx, &(end, s))| { if s != span { @@ -74,3 +82,50 @@ impl<S: Span> SpanMap<S> { self.spans.iter().copied() } } + +#[derive(PartialEq, Eq, Hash, Debug)] +pub struct RealSpanMap { + file_id: FileId, + /// Invariant: Sorted vec over TextSize + // FIXME: SortedVec<(TextSize, ErasedFileAstId)>? + pairs: Box<[(TextSize, ErasedFileAstId)]>, + end: TextSize, +} + +impl RealSpanMap { + /// Creates a real file span map that returns absolute ranges (relative ranges to the root ast id). + pub fn absolute(file_id: FileId) -> Self { + RealSpanMap { + file_id, + pairs: Box::from([(TextSize::new(0), ROOT_ERASED_FILE_AST_ID)]), + end: TextSize::new(!0), + } + } + + pub fn from_file( + file_id: FileId, + pairs: Box<[(TextSize, ErasedFileAstId)]>, + end: TextSize, + ) -> Self { + Self { file_id, pairs, end } + } + + pub fn span_for_range(&self, range: TextRange) -> Span { + assert!( + range.end() <= self.end, + "range {range:?} goes beyond the end of the file {:?}", + self.end + ); + let start = range.start(); + let idx = self + .pairs + .binary_search_by(|&(it, _)| it.cmp(&start).then(std::cmp::Ordering::Less)) + .unwrap_err(); + let (offset, ast_id) = self.pairs[idx - 1]; + Span { + range: range - offset, + anchor: SpanAnchor { file_id: self.file_id, ast_id }, + ctx: SyntaxContextId::ROOT, + } + } +} diff --git a/src/tools/rust-analyzer/crates/stdx/Cargo.toml b/src/tools/rust-analyzer/crates/stdx/Cargo.toml index c914ae2144b..e6014cf812e 100644 --- a/src/tools/rust-analyzer/crates/stdx/Cargo.toml +++ b/src/tools/rust-analyzer/crates/stdx/Cargo.toml @@ -27,3 +27,6 @@ winapi = { version = "0.3.9", features = ["winerror"] } [features] # Uncomment to enable for the whole crate graph # default = [ "backtrace" ] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/syntax/Cargo.toml b/src/tools/rust-analyzer/crates/syntax/Cargo.toml index 7a7c0d267fe..40a93fec2ce 100644 --- a/src/tools/rust-analyzer/crates/syntax/Cargo.toml +++ b/src/tools/rust-analyzer/crates/syntax/Cargo.toml @@ -17,7 +17,7 @@ cov-mark = "2.0.0-pre.1" either.workspace = true itertools.workspace = true rowan = "0.15.15" -rustc-hash = "1.1.0" +rustc-hash.workspace = true once_cell = "1.17.0" indexmap.workspace = true smol_str.workspace = true @@ -42,3 +42,6 @@ sourcegen.workspace = true [features] in-rust-tree = ["rustc-dependencies/in-rust-tree"] + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/syntax/fuzz/Cargo.toml b/src/tools/rust-analyzer/crates/syntax/fuzz/Cargo.toml index 6070222f1f1..ebf538aa247 100644 --- a/src/tools/rust-analyzer/crates/syntax/fuzz/Cargo.toml +++ b/src/tools/rust-analyzer/crates/syntax/fuzz/Cargo.toml @@ -24,3 +24,6 @@ path = "fuzz_targets/parser.rs" [[bin]] name = "reparse" path = "fuzz_targets/reparse.rs" + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/syntax/src/ast/edit_in_place.rs b/src/tools/rust-analyzer/crates/syntax/src/ast/edit_in_place.rs index 37d8212042d..4c2878f49f0 100644 --- a/src/tools/rust-analyzer/crates/syntax/src/ast/edit_in_place.rs +++ b/src/tools/rust-analyzer/crates/syntax/src/ast/edit_in_place.rs @@ -13,7 +13,7 @@ use crate::{ SyntaxNode, SyntaxToken, }; -use super::{HasArgList, HasName}; +use super::{GenericParam, HasArgList, HasName}; pub trait GenericParamsOwnerEdit: ast::HasGenericParams { fn get_or_create_generic_param_list(&self) -> ast::GenericParamList; @@ -272,6 +272,36 @@ impl ast::GenericParamList { } } + /// Find the params corresponded to generic arg + pub fn find_generic_arg(&self, generic_arg: &ast::GenericArg) -> Option<GenericParam> { + self.generic_params().find_map(move |param| match (¶m, &generic_arg) { + (ast::GenericParam::LifetimeParam(a), ast::GenericArg::LifetimeArg(b)) => { + (a.lifetime()?.lifetime_ident_token()?.text() + == b.lifetime()?.lifetime_ident_token()?.text()) + .then_some(param) + } + (ast::GenericParam::TypeParam(a), ast::GenericArg::TypeArg(b)) => { + debug_assert_eq!(b.syntax().first_token(), b.syntax().last_token()); + (a.name()?.text() == b.syntax().first_token()?.text()).then_some(param) + } + (ast::GenericParam::ConstParam(a), ast::GenericArg::TypeArg(b)) => { + debug_assert_eq!(b.syntax().first_token(), b.syntax().last_token()); + (a.name()?.text() == b.syntax().first_token()?.text()).then_some(param) + } + _ => None, + }) + } + + /// Removes the corresponding generic arg + pub fn remove_generic_arg(&self, generic_arg: &ast::GenericArg) -> Option<GenericParam> { + let param_to_remove = self.find_generic_arg(generic_arg); + + if let Some(param) = ¶m_to_remove { + self.remove_generic_param(param.clone()); + } + param_to_remove + } + /// Constructs a matching [`ast::GenericArgList`] pub fn to_generic_args(&self) -> ast::GenericArgList { let args = self.generic_params().filter_map(|param| match param { @@ -300,6 +330,20 @@ impl ast::WhereClause { } ted::append_child(self.syntax(), predicate.syntax()); } + + pub fn remove_predicate(&self, predicate: ast::WherePred) { + if let Some(previous) = predicate.syntax().prev_sibling() { + if let Some(next_token) = previous.next_sibling_or_token() { + ted::remove_all(next_token..=predicate.syntax().clone().into()); + } + } else if let Some(next) = predicate.syntax().next_sibling() { + if let Some(next_token) = next.prev_sibling_or_token() { + ted::remove_all(predicate.syntax().clone().into()..=next_token); + } + } else { + ted::remove(predicate.syntax()); + } + } } impl ast::TypeParam { @@ -414,6 +458,7 @@ impl ast::UseTree { u.remove_recursive(); } } + u.remove_unnecessary_braces(); } } diff --git a/src/tools/rust-analyzer/crates/syntax/src/ast/make.rs b/src/tools/rust-analyzer/crates/syntax/src/ast/make.rs index ad63cc55862..2abbfc81f67 100644 --- a/src/tools/rust-analyzer/crates/syntax/src/ast/make.rs +++ b/src/tools/rust-analyzer/crates/syntax/src/ast/make.rs @@ -207,10 +207,28 @@ fn merge_gen_params( (None, Some(bs)) => Some(bs), (Some(ps), None) => Some(ps), (Some(ps), Some(bs)) => { - for b in bs.generic_params() { - ps.add_generic_param(b); - } - Some(ps) + // make sure lifetime is placed before other generic params + let generic_params = ps.generic_params().merge_by(bs.generic_params(), |_, b| { + !matches!(b, ast::GenericParam::LifetimeParam(_)) + }); + Some(generic_param_list(generic_params)) + } + } +} + +fn merge_where_clause( + ps: Option<ast::WhereClause>, + bs: Option<ast::WhereClause>, +) -> Option<ast::WhereClause> { + match (ps, bs) { + (None, None) => None, + (None, Some(bs)) => Some(bs), + (Some(ps), None) => Some(ps), + (Some(ps), Some(bs)) => { + let preds = where_clause(std::iter::empty()).clone_for_update(); + ps.predicates().for_each(|p| preds.add_predicate(p)); + bs.predicates().for_each(|p| preds.add_predicate(p)); + Some(preds) } } } @@ -251,9 +269,9 @@ pub fn impl_( pub fn impl_trait( is_unsafe: bool, trait_gen_params: Option<ast::GenericParamList>, - trait_gen_args: Option<ast::GenericParamList>, + trait_gen_args: Option<ast::GenericArgList>, type_gen_params: Option<ast::GenericParamList>, - type_gen_args: Option<ast::GenericParamList>, + type_gen_args: Option<ast::GenericArgList>, is_negative: bool, path_type: ast::Type, ty: ast::Type, @@ -262,15 +280,9 @@ pub fn impl_trait( body: Option<Vec<either::Either<ast::Attr, ast::AssocItem>>>, ) -> ast::Impl { let is_unsafe = if is_unsafe { "unsafe " } else { "" }; - let ty_gen_args = match merge_gen_params(type_gen_params.clone(), type_gen_args) { - Some(pars) => pars.to_generic_args().to_string(), - None => String::new(), - }; - let tr_gen_args = match merge_gen_params(trait_gen_params.clone(), trait_gen_args) { - Some(pars) => pars.to_generic_args().to_string(), - None => String::new(), - }; + let trait_gen_args = trait_gen_args.map(|args| args.to_string()).unwrap_or_default(); + let type_gen_args = type_gen_args.map(|args| args.to_string()).unwrap_or_default(); let gen_params = match merge_gen_params(trait_gen_params, type_gen_params) { Some(pars) => pars.to_string(), @@ -279,25 +291,15 @@ pub fn impl_trait( let is_negative = if is_negative { "! " } else { "" }; - let where_clause = match (ty_where_clause, trait_where_clause) { - (None, None) => " ".to_string(), - (None, Some(tr)) => format!("\n{}\n", tr).to_string(), - (Some(ty), None) => format!("\n{}\n", ty).to_string(), - (Some(ty), Some(tr)) => { - let updated = ty.clone_for_update(); - tr.predicates().for_each(|p| { - ty.add_predicate(p); - }); - format!("\n{}\n", updated).to_string() - } - }; + let where_clause = merge_where_clause(ty_where_clause, trait_where_clause) + .map_or_else(|| " ".to_string(), |wc| format!("\n{}\n", wc)); let body = match body { Some(bd) => bd.iter().map(|elem| elem.to_string()).join(""), None => String::new(), }; - ast_from_text(&format!("{is_unsafe}impl{gen_params} {is_negative}{path_type}{tr_gen_args} for {ty}{ty_gen_args}{where_clause}{{{}}}" , body)) + ast_from_text(&format!("{is_unsafe}impl{gen_params} {is_negative}{path_type}{trait_gen_args} for {ty}{type_gen_args}{where_clause}{{{}}}" , body)) } pub fn impl_trait_type(bounds: ast::TypeBoundList) -> ast::ImplTraitType { @@ -922,6 +924,10 @@ pub fn type_param(name: ast::Name, bounds: Option<ast::TypeBoundList>) -> ast::T ast_from_text(&format!("fn f<{name}{bounds}>() {{ }}")) } +pub fn const_param(name: ast::Name, ty: ast::Type) -> ast::ConstParam { + ast_from_text(&format!("fn f<const {name}: {ty}>() {{ }}")) +} + pub fn lifetime_param(lifetime: ast::Lifetime) -> ast::LifetimeParam { ast_from_text(&format!("fn f<{lifetime}>() {{ }}")) } @@ -948,9 +954,7 @@ pub fn turbofish_generic_arg_list( ast_from_text(&format!("const S: T::<{args}> = ();")) } -pub(crate) fn generic_arg_list( - args: impl IntoIterator<Item = ast::GenericArg>, -) -> ast::GenericArgList { +pub fn generic_arg_list(args: impl IntoIterator<Item = ast::GenericArg>) -> ast::GenericArgList { let args = args.into_iter().join(", "); ast_from_text(&format!("const S: T<{args}> = ();")) } diff --git a/src/tools/rust-analyzer/crates/syntax/src/ast/node_ext.rs b/src/tools/rust-analyzer/crates/syntax/src/ast/node_ext.rs index f81dff8840c..a7e4899fb7e 100644 --- a/src/tools/rust-analyzer/crates/syntax/src/ast/node_ext.rs +++ b/src/tools/rust-analyzer/crates/syntax/src/ast/node_ext.rs @@ -11,7 +11,7 @@ use rowan::{GreenNodeData, GreenTokenData}; use crate::{ ast::{self, support, AstNode, AstToken, HasAttrs, HasGenericParams, HasName, SyntaxNode}, - NodeOrToken, SmolStr, SyntaxElement, SyntaxToken, TokenText, T, + ted, NodeOrToken, SmolStr, SyntaxElement, SyntaxToken, TokenText, T, }; impl ast::Lifetime { @@ -323,6 +323,10 @@ impl ast::UseTree { pub fn is_simple_path(&self) -> bool { self.use_tree_list().is_none() && self.star_token().is_none() } + + pub fn parent_use_tree_list(&self) -> Option<ast::UseTreeList> { + self.syntax().parent().and_then(ast::UseTreeList::cast) + } } impl ast::UseTreeList { @@ -340,6 +344,34 @@ impl ast::UseTreeList { .find_map(ast::Comment::cast) .is_some() } + + pub fn comma(&self) -> impl Iterator<Item = SyntaxToken> { + self.syntax() + .children_with_tokens() + .filter_map(|it| it.into_token().filter(|it| it.kind() == T![,])) + } + + /// Remove the unnecessary braces in current `UseTreeList` + pub fn remove_unnecessary_braces(mut self) { + let remove_brace_in_use_tree_list = |u: &ast::UseTreeList| { + let use_tree_count = u.use_trees().count(); + if use_tree_count == 1 { + u.l_curly_token().map(ted::remove); + u.r_curly_token().map(ted::remove); + u.comma().for_each(ted::remove); + } + }; + + // take `use crate::{{{{A}}}}` for example + // the below remove the innermost {}, got `use crate::{{{A}}}` + remove_brace_in_use_tree_list(&self); + + // the below remove othe unnecessary {}, got `use crate::A` + while let Some(parent_use_tree_list) = self.parent_use_tree().parent_use_tree_list() { + remove_brace_in_use_tree_list(&parent_use_tree_list); + self = parent_use_tree_list; + } + } } impl ast::Impl { @@ -585,6 +617,16 @@ impl ast::Item { } } +impl ast::Type { + pub fn generic_arg_list(&self) -> Option<ast::GenericArgList> { + if let ast::Type::PathType(path_type) = self { + path_type.path()?.segment()?.generic_arg_list() + } else { + None + } + } +} + #[derive(Debug, Clone, PartialEq, Eq)] pub enum FieldKind { Name(ast::NameRef), diff --git a/src/tools/rust-analyzer/crates/test-fixture/Cargo.toml b/src/tools/rust-analyzer/crates/test-fixture/Cargo.toml new file mode 100644 index 00000000000..35e39229894 --- /dev/null +++ b/src/tools/rust-analyzer/crates/test-fixture/Cargo.toml @@ -0,0 +1,21 @@ +[package] +name = "test-fixture" +version = "0.0.0" +rust-version.workspace = true +edition.workspace = true +license.workspace = true +authors.workspace = true +publish = false + +[dependencies] +hir-expand.workspace = true +test-utils.workspace = true +tt.workspace = true +cfg.workspace = true +base-db.workspace = true +rustc-hash.workspace = true +span.workspace = true +stdx.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/base-db/src/fixture.rs b/src/tools/rust-analyzer/crates/test-fixture/src/lib.rs index bfdd21555f0..1a042b2dea2 100644 --- a/src/tools/rust-analyzer/crates/base-db/src/fixture.rs +++ b/src/tools/rust-analyzer/crates/test-fixture/src/lib.rs @@ -1,27 +1,30 @@ //! A set of high-level utility fixture methods to use in tests. -use std::{mem, str::FromStr, sync}; +use std::{mem, ops::Not, str::FromStr, sync}; +use base_db::{ + CrateDisplayName, CrateGraph, CrateId, CrateName, CrateOrigin, Dependency, DependencyKind, + Edition, Env, FileChange, FileSet, LangCrateOrigin, SourceDatabaseExt, SourceRoot, Version, + VfsPath, +}; use cfg::CfgOptions; +use hir_expand::{ + change::Change, + db::ExpandDatabase, + proc_macro::{ + ProcMacro, ProcMacroExpander, ProcMacroExpansionError, ProcMacroKind, ProcMacros, + }, +}; use rustc_hash::FxHashMap; +use span::{FileId, FilePosition, FileRange, Span}; use test_utils::{ extract_range_or_offset, Fixture, FixtureWithProjectMeta, RangeOrOffset, CURSOR_MARKER, ESCAPED_CURSOR_MARKER, }; -use triomphe::Arc; use tt::{Leaf, Subtree, TokenTree}; -use vfs::{file_set::FileSet, VfsPath}; - -use crate::{ - input::{CrateName, CrateOrigin, LangCrateOrigin}, - span::SpanData, - Change, CrateDisplayName, CrateGraph, CrateId, Dependency, DependencyKind, Edition, Env, - FileId, FilePosition, FileRange, ProcMacro, ProcMacroExpander, ProcMacroExpansionError, - ProcMacros, ReleaseChannel, SourceDatabaseExt, SourceRoot, SourceRootId, -}; -pub const WORKSPACE: SourceRootId = SourceRootId(0); +pub const WORKSPACE: base_db::SourceRootId = base_db::SourceRootId(0); -pub trait WithFixture: Default + SourceDatabaseExt + 'static { +pub trait WithFixture: Default + ExpandDatabase + SourceDatabaseExt + 'static { #[track_caller] fn with_single_file(ra_fixture: &str) -> (Self, FileId) { let fixture = ChangeFixture::parse(ra_fixture); @@ -80,6 +83,7 @@ pub trait WithFixture: Default + SourceDatabaseExt + 'static { let fixture = ChangeFixture::parse(ra_fixture); let mut db = Self::default(); fixture.change.apply(&mut db); + let (file_id, range_or_offset) = fixture .file_position .expect("Could not find file position in fixture. Did you forget to add an `$0`?"); @@ -95,7 +99,7 @@ pub trait WithFixture: Default + SourceDatabaseExt + 'static { } } -impl<DB: SourceDatabaseExt + Default + 'static> WithFixture for DB {} +impl<DB: ExpandDatabase + SourceDatabaseExt + Default + 'static> WithFixture for DB {} pub struct ChangeFixture { pub file_position: Option<(FileId, RangeOrOffset)>, @@ -116,13 +120,11 @@ impl ChangeFixture { ) -> ChangeFixture { let FixtureWithProjectMeta { fixture, mini_core, proc_macro_names, toolchain } = FixtureWithProjectMeta::parse(ra_fixture); - let toolchain = toolchain - .map(|it| { - ReleaseChannel::from_str(&it) - .unwrap_or_else(|| panic!("unknown release channel found: {it}")) - }) - .unwrap_or(ReleaseChannel::Stable); - let mut change = Change::new(); + let toolchain = Some({ + let channel = toolchain.as_deref().unwrap_or("stable"); + Version::parse(&format!("1.76.0-{channel}")).unwrap() + }); + let mut source_change = FileChange::new(); let mut files = Vec::new(); let mut crate_graph = CrateGraph::default(); @@ -187,9 +189,9 @@ impl ChangeFixture { origin, meta.target_data_layout .as_deref() - .map(Arc::from) + .map(From::from) .ok_or_else(|| "target_data_layout unset".into()), - Some(toolchain), + toolchain.clone(), ); let prev = crates.insert(crate_name.clone(), crate_id); assert!(prev.is_none(), "multiple crates with same name: {}", crate_name); @@ -206,7 +208,7 @@ impl ChangeFixture { default_target_data_layout = meta.target_data_layout; } - change.change_file(file_id, Some(Arc::from(text))); + source_change.change_file(file_id, Some(text.into())); let path = VfsPath::new_virtual_path(meta.path); file_set.insert(file_id, path); files.push(file_id); @@ -229,7 +231,7 @@ impl ChangeFixture { default_target_data_layout .map(|it| it.into()) .ok_or_else(|| "target_data_layout unset".into()), - Some(toolchain), + toolchain.clone(), ); } else { for (from, to, prelude) in crate_deps { @@ -261,7 +263,7 @@ impl ChangeFixture { fs.insert(core_file, VfsPath::new_virtual_path("/sysroot/core/lib.rs".to_string())); roots.push(SourceRoot::new_library(fs)); - change.change_file(core_file, Some(Arc::from(mini_core.source_code()))); + source_change.change_file(core_file, Some(mini_core.source_code().into())); let all_crates = crate_graph.crates_in_topological_order(); @@ -276,7 +278,7 @@ impl ChangeFixture { false, CrateOrigin::Lang(LangCrateOrigin::Core), target_layout.clone(), - Some(toolchain), + toolchain.clone(), ); for krate in all_crates { @@ -306,7 +308,7 @@ impl ChangeFixture { ); roots.push(SourceRoot::new_library(fs)); - change.change_file(proc_lib_file, Some(Arc::from(source))); + source_change.change_file(proc_lib_file, Some(source.into())); let all_crates = crate_graph.crates_in_topological_order(); @@ -321,7 +323,7 @@ impl ChangeFixture { true, CrateOrigin::Local { repo: None, name: None }, target_layout, - Some(toolchain), + toolchain, ); proc_macros.insert(proc_macros_crate, Ok(proc_macro)); @@ -344,11 +346,17 @@ impl ChangeFixture { SourceRootKind::Library => SourceRoot::new_library(mem::take(&mut file_set)), }; roots.push(root); - change.set_roots(roots); - change.set_crate_graph(crate_graph); - change.set_proc_macros(proc_macros); - - ChangeFixture { file_position, files, change } + source_change.set_roots(roots); + source_change.set_crate_graph(crate_graph); + + ChangeFixture { + file_position, + files, + change: Change { + source_change, + proc_macros: proc_macros.is_empty().not().then(|| proc_macros), + }, + } } } @@ -364,7 +372,7 @@ pub fn identity(_attr: TokenStream, item: TokenStream) -> TokenStream { .into(), ProcMacro { name: "identity".into(), - kind: crate::ProcMacroKind::Attr, + kind: ProcMacroKind::Attr, expander: sync::Arc::new(IdentityProcMacroExpander), }, ), @@ -378,7 +386,7 @@ pub fn derive_identity(item: TokenStream) -> TokenStream { .into(), ProcMacro { name: "DeriveIdentity".into(), - kind: crate::ProcMacroKind::CustomDerive, + kind: ProcMacroKind::CustomDerive, expander: sync::Arc::new(IdentityProcMacroExpander), }, ), @@ -392,7 +400,7 @@ pub fn input_replace(attr: TokenStream, _item: TokenStream) -> TokenStream { .into(), ProcMacro { name: "input_replace".into(), - kind: crate::ProcMacroKind::Attr, + kind: ProcMacroKind::Attr, expander: sync::Arc::new(AttributeInputReplaceProcMacroExpander), }, ), @@ -406,7 +414,7 @@ pub fn mirror(input: TokenStream) -> TokenStream { .into(), ProcMacro { name: "mirror".into(), - kind: crate::ProcMacroKind::FuncLike, + kind: ProcMacroKind::FuncLike, expander: sync::Arc::new(MirrorProcMacroExpander), }, ), @@ -420,7 +428,7 @@ pub fn shorten(input: TokenStream) -> TokenStream { .into(), ProcMacro { name: "shorten".into(), - kind: crate::ProcMacroKind::FuncLike, + kind: ProcMacroKind::FuncLike, expander: sync::Arc::new(ShortenProcMacroExpander), }, ), @@ -539,13 +547,13 @@ struct IdentityProcMacroExpander; impl ProcMacroExpander for IdentityProcMacroExpander { fn expand( &self, - subtree: &Subtree<SpanData>, - _: Option<&Subtree<SpanData>>, + subtree: &Subtree<Span>, + _: Option<&Subtree<Span>>, _: &Env, - _: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<Subtree<SpanData>, ProcMacroExpansionError> { + _: Span, + _: Span, + _: Span, + ) -> Result<Subtree<Span>, ProcMacroExpansionError> { Ok(subtree.clone()) } } @@ -556,13 +564,13 @@ struct AttributeInputReplaceProcMacroExpander; impl ProcMacroExpander for AttributeInputReplaceProcMacroExpander { fn expand( &self, - _: &Subtree<SpanData>, - attrs: Option<&Subtree<SpanData>>, + _: &Subtree<Span>, + attrs: Option<&Subtree<Span>>, _: &Env, - _: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<Subtree<SpanData>, ProcMacroExpansionError> { + _: Span, + _: Span, + _: Span, + ) -> Result<Subtree<Span>, ProcMacroExpansionError> { attrs .cloned() .ok_or_else(|| ProcMacroExpansionError::Panic("Expected attribute input".into())) @@ -574,14 +582,14 @@ struct MirrorProcMacroExpander; impl ProcMacroExpander for MirrorProcMacroExpander { fn expand( &self, - input: &Subtree<SpanData>, - _: Option<&Subtree<SpanData>>, + input: &Subtree<Span>, + _: Option<&Subtree<Span>>, _: &Env, - _: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<Subtree<SpanData>, ProcMacroExpansionError> { - fn traverse(input: &Subtree<SpanData>) -> Subtree<SpanData> { + _: Span, + _: Span, + _: Span, + ) -> Result<Subtree<Span>, ProcMacroExpansionError> { + fn traverse(input: &Subtree<Span>) -> Subtree<Span> { let mut token_trees = vec![]; for tt in input.token_trees.iter().rev() { let tt = match tt { @@ -604,16 +612,16 @@ struct ShortenProcMacroExpander; impl ProcMacroExpander for ShortenProcMacroExpander { fn expand( &self, - input: &Subtree<SpanData>, - _: Option<&Subtree<SpanData>>, + input: &Subtree<Span>, + _: Option<&Subtree<Span>>, _: &Env, - _: SpanData, - _: SpanData, - _: SpanData, - ) -> Result<Subtree<SpanData>, ProcMacroExpansionError> { + _: Span, + _: Span, + _: Span, + ) -> Result<Subtree<Span>, ProcMacroExpansionError> { return Ok(traverse(input)); - fn traverse(input: &Subtree<SpanData>) -> Subtree<SpanData> { + fn traverse(input: &Subtree<Span>) -> Subtree<Span> { let token_trees = input .token_trees .iter() @@ -625,7 +633,7 @@ impl ProcMacroExpander for ShortenProcMacroExpander { Subtree { delimiter: input.delimiter, token_trees } } - fn modify_leaf(leaf: &Leaf<SpanData>) -> Leaf<SpanData> { + fn modify_leaf(leaf: &Leaf<Span>) -> Leaf<Span> { let mut leaf = leaf.clone(); match &mut leaf { Leaf::Literal(it) => { diff --git a/src/tools/rust-analyzer/crates/test-utils/Cargo.toml b/src/tools/rust-analyzer/crates/test-utils/Cargo.toml index 438b599ffaa..56067d83417 100644 --- a/src/tools/rust-analyzer/crates/test-utils/Cargo.toml +++ b/src/tools/rust-analyzer/crates/test-utils/Cargo.toml @@ -15,7 +15,10 @@ doctest = false # Avoid adding deps here, this crate is widely used in tests it should compile fast! dissimilar = "1.0.7" text-size.workspace = true -rustc-hash = "1.1.0" +rustc-hash.workspace = true stdx.workspace = true profile.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/test-utils/src/minicore.rs b/src/tools/rust-analyzer/crates/test-utils/src/minicore.rs index f766747d707..1f3136404c6 100644 --- a/src/tools/rust-analyzer/crates/test-utils/src/minicore.rs +++ b/src/tools/rust-analyzer/crates/test-utils/src/minicore.rs @@ -1381,6 +1381,7 @@ mod macros { // region:assert #[macro_export] #[rustc_builtin_macro] + #[allow_internal_unstable(core_panic, edition_panic, generic_assert_internals)] macro_rules! assert { ($($arg:tt)*) => { /* compiler built-in */ @@ -1389,6 +1390,7 @@ mod macros { // endregion:assert // region:fmt + #[allow_internal_unstable(fmt_internals, const_fmt_arguments_new)] #[macro_export] #[rustc_builtin_macro] macro_rules! const_format_args { @@ -1396,6 +1398,7 @@ mod macros { ($fmt:expr, $($args:tt)*) => {{ /* compiler built-in */ }}; } + #[allow_internal_unstable(fmt_internals)] #[macro_export] #[rustc_builtin_macro] macro_rules! format_args { @@ -1403,6 +1406,7 @@ mod macros { ($fmt:expr, $($args:tt)*) => {{ /* compiler built-in */ }}; } + #[allow_internal_unstable(fmt_internals)] #[macro_export] #[rustc_builtin_macro] macro_rules! format_args_nl { diff --git a/src/tools/rust-analyzer/crates/text-edit/Cargo.toml b/src/tools/rust-analyzer/crates/text-edit/Cargo.toml index 4620cc72d0a..f745674794c 100644 --- a/src/tools/rust-analyzer/crates/text-edit/Cargo.toml +++ b/src/tools/rust-analyzer/crates/text-edit/Cargo.toml @@ -14,3 +14,6 @@ doctest = false [dependencies] itertools.workspace = true text-size.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/toolchain/Cargo.toml b/src/tools/rust-analyzer/crates/toolchain/Cargo.toml index a283f9a8842..f9b120772f0 100644 --- a/src/tools/rust-analyzer/crates/toolchain/Cargo.toml +++ b/src/tools/rust-analyzer/crates/toolchain/Cargo.toml @@ -13,3 +13,6 @@ doctest = false [dependencies] home = "0.5.4" + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/tt/Cargo.toml b/src/tools/rust-analyzer/crates/tt/Cargo.toml index 57222449790..77683fd48af 100644 --- a/src/tools/rust-analyzer/crates/tt/Cargo.toml +++ b/src/tools/rust-analyzer/crates/tt/Cargo.toml @@ -16,3 +16,9 @@ smol_str.workspace = true text-size.workspace = true stdx.workspace = true + +# FIXME: Remove this dependency once the `Span` trait is gone (that is once Span::DUMMY has been removed) +span.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/tt/src/lib.rs b/src/tools/rust-analyzer/crates/tt/src/lib.rs index 481d575403a..b3b0eeda75a 100644 --- a/src/tools/rust-analyzer/crates/tt/src/lib.rs +++ b/src/tools/rust-analyzer/crates/tt/src/lib.rs @@ -11,46 +11,10 @@ use stdx::impl_from; pub use smol_str::SmolStr; pub use text_size::{TextRange, TextSize}; -#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)] -pub struct SpanData<Anchor, Ctx> { - /// The text range of this span, relative to the anchor. - /// We need the anchor for incrementality, as storing absolute ranges will require - /// recomputation on every change in a file at all times. - pub range: TextRange, - pub anchor: Anchor, - /// The syntax context of the span. - pub ctx: Ctx, -} - -impl<Anchor: SpanAnchor, Ctx: SyntaxContext> Span for SpanData<Anchor, Ctx> { - #[allow(deprecated)] - const DUMMY: Self = SpanData { - range: TextRange::empty(TextSize::new(0)), - anchor: Anchor::DUMMY, - ctx: Ctx::DUMMY, - }; -} - -pub trait Span: std::fmt::Debug + Copy + Sized + Eq { - // FIXME: Should not exist. Dummy spans will always be wrong if they leak somewhere. Instead, - // the call site or def site spans should be used in relevant places, its just that we don't - // expose those everywhere in the yet. - const DUMMY: Self; -} +pub trait Span: std::fmt::Debug + Copy + Sized + Eq {} -// FIXME: Should not exist -pub trait SpanAnchor: - std::fmt::Debug + Copy + Sized + Eq + Copy + fmt::Debug + std::hash::Hash -{ - #[deprecated(note = "this should not exist")] - const DUMMY: Self; -} - -// FIXME: Should not exist -pub trait SyntaxContext: std::fmt::Debug + Copy + Sized + Eq { - #[deprecated(note = "this should not exist")] - const DUMMY: Self; -} +impl<Ctx> Span for span::SpanData<Ctx> where span::SpanData<Ctx>: std::fmt::Debug + Copy + Sized + Eq +{} #[derive(Debug, Clone, PartialEq, Eq, Hash)] pub enum TokenTree<S> { @@ -66,15 +30,7 @@ impl<S: Span> TokenTree<S> { }) } - pub fn subtree_or_wrap(self) -> Subtree<S> { - match self { - TokenTree::Leaf(_) => { - Subtree { delimiter: Delimiter::DUMMY_INVISIBLE, token_trees: vec![self] } - } - TokenTree::Subtree(s) => s, - } - } - pub fn subtree_or_wrap2(self, span: DelimSpan<S>) -> Subtree<S> { + pub fn subtree_or_wrap(self, span: DelimSpan<S>) -> Subtree<S> { match self { TokenTree::Leaf(_) => Subtree { delimiter: Delimiter::invisible_delim_spanned(span), @@ -83,6 +39,13 @@ impl<S: Span> TokenTree<S> { TokenTree::Subtree(s) => s, } } + + pub fn first_span(&self) -> S { + match self { + TokenTree::Leaf(l) => *l.span(), + TokenTree::Subtree(s) => s.delimiter.open, + } + } } #[derive(Debug, Clone, PartialEq, Eq, Hash)] @@ -134,11 +97,6 @@ pub struct DelimSpan<S> { pub close: S, } -impl<S: Span> DelimSpan<S> { - // FIXME should not exist - pub const DUMMY: Self = Self { open: S::DUMMY, close: S::DUMMY }; -} - #[derive(Clone, Copy, Debug, PartialEq, Eq, Hash)] pub struct Delimiter<S> { pub open: S, @@ -147,15 +105,6 @@ pub struct Delimiter<S> { } impl<S: Span> Delimiter<S> { - // FIXME should not exist - pub const DUMMY_INVISIBLE: Self = - Self { open: S::DUMMY, close: S::DUMMY, kind: DelimiterKind::Invisible }; - - // FIXME should not exist - pub const fn dummy_invisible() -> Self { - Self::DUMMY_INVISIBLE - } - pub const fn invisible_spanned(span: S) -> Self { Delimiter { open: span, close: span, kind: DelimiterKind::Invisible } } diff --git a/src/tools/rust-analyzer/crates/vfs-notify/Cargo.toml b/src/tools/rust-analyzer/crates/vfs-notify/Cargo.toml index fe6cb0a2c3f..a6d5027c3a6 100644 --- a/src/tools/rust-analyzer/crates/vfs-notify/Cargo.toml +++ b/src/tools/rust-analyzer/crates/vfs-notify/Cargo.toml @@ -20,3 +20,6 @@ notify = "6.1.1" stdx.workspace = true vfs.workspace = true paths.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/crates/vfs/Cargo.toml b/src/tools/rust-analyzer/crates/vfs/Cargo.toml index 11409f2eb81..c88f3466559 100644 --- a/src/tools/rust-analyzer/crates/vfs/Cargo.toml +++ b/src/tools/rust-analyzer/crates/vfs/Cargo.toml @@ -12,10 +12,13 @@ rust-version.workspace = true doctest = false [dependencies] -rustc-hash = "1.1.0" +rustc-hash.workspace = true fst = "0.4.7" indexmap.workspace = true nohash-hasher.workspace = true paths.workspace = true stdx.workspace = true + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/docs/dev/architecture.md b/src/tools/rust-analyzer/docs/dev/architecture.md index b7d585cafb3..4303a800a04 100644 --- a/src/tools/rust-analyzer/docs/dev/architecture.md +++ b/src/tools/rust-analyzer/docs/dev/architecture.md @@ -134,29 +134,29 @@ This is to enable parallel parsing of all files. **Architecture Invariant:** Syntax trees are by design incomplete and do not enforce well-formedness. If an AST method returns an `Option`, it *can* be `None` at runtime, even if this is forbidden by the grammar. -### `crates/base_db` +### `crates/base-db` We use the [salsa](https://github.com/salsa-rs/salsa) crate for incremental and on-demand computation. Roughly, you can think of salsa as a key-value store, but it can also compute derived values using specified functions. -The `base_db` crate provides basic infrastructure for interacting with salsa. +The `base-db` crate provides basic infrastructure for interacting with salsa. Crucially, it defines most of the "input" queries: facts supplied by the client of the analyzer. Reading the docs of the `base_db::input` module should be useful: everything else is strictly derived from those inputs. **Architecture Invariant:** particularities of the build system are *not* the part of the ground state. -In particular, `base_db` knows nothing about cargo. +In particular, `base-db` knows nothing about cargo. For example, `cfg` flags are a part of `base_db`, but `feature`s are not. A `foo` feature is a Cargo-level concept, which is lowered by Cargo to `--cfg feature=foo` argument on the command line. The `CrateGraph` structure is used to represent the dependencies between the crates abstractly. -**Architecture Invariant:** `base_db` doesn't know about file system and file paths. +**Architecture Invariant:** `base-db` doesn't know about file system and file paths. Files are represented with opaque `FileId`, there's no operation to get an `std::path::Path` out of the `FileId`. -### `crates/hir_expand`, `crates/hir_def`, `crates/hir_ty` +### `crates/hir-expand`, `crates/hir-def`, `crates/hir_ty` These crates are the *brain* of rust-analyzer. This is the compiler part of the IDE. -`hir_xxx` crates have a strong [ECS](https://en.wikipedia.org/wiki/Entity_component_system) flavor, in that they work with raw ids and directly query the database. +`hir-xxx` crates have a strong [ECS](https://en.wikipedia.org/wiki/Entity_component_system) flavor, in that they work with raw ids and directly query the database. There's little abstraction here. These crates integrate deeply with salsa and chalk. @@ -186,7 +186,7 @@ If you think about "using rust-analyzer as a library", `hir` crate is most likel It wraps ECS-style internal API into a more OO-flavored API (with an extra `db` argument for each call). **Architecture Invariant:** `hir` provides a static, fully resolved view of the code. -While internal `hir_*` crates _compute_ things, `hir`, from the outside, looks like an inert data structure. +While internal `hir-*` crates _compute_ things, `hir`, from the outside, looks like an inert data structure. `hir` also handles the delicate task of going from syntax to the corresponding `hir`. Remember that the mapping here is one-to-many. @@ -200,7 +200,7 @@ Then we look for our node in the set of children. This is the heart of many IDE features, like goto definition, which start with figuring out the hir node at the cursor. This is some kind of (yet unnamed) uber-IDE pattern, as it is present in Roslyn and Kotlin as well. -### `crates/ide` +### `crates/ide`, `crates/ide-db`, `crates/ide-assists`, `crates/ide-completion`, `crates/ide-diagnostics`, `crates/ide-ssr` The `ide` crate builds on top of `hir` semantic model to provide high-level IDE features like completion or goto definition. It is an **API Boundary**. @@ -217,8 +217,8 @@ Shout outs to LSP developers for popularizing the idea that "UI" is a good place `AnalysisHost` is a state to which you can transactionally `apply_change`. `Analysis` is an immutable snapshot of the state. -Internally, `ide` is split across several crates. `ide_assists`, `ide_completion` and `ide_ssr` implement large isolated features. -`ide_db` implements common IDE functionality (notably, reference search is implemented here). +Internally, `ide` is split across several crates. `ide-assists`, `ide-completion`, `ide-diagnostics` and `ide-ssr` implement large isolated features. +`ide-db` implements common IDE functionality (notably, reference search is implemented here). The `ide` contains a public API/façade, as well as implementation for a plethora of smaller features. **Architecture Invariant:** `ide` crate strives to provide a _perfect_ API. @@ -251,14 +251,14 @@ This is a tricky business. **Architecture Invariant:** `rust-analyzer` should be partially available even when the build is broken. Reloading process should not prevent IDE features from working. -### `crates/toolchain`, `crates/project_model`, `crates/flycheck` +### `crates/toolchain`, `crates/project-model`, `crates/flycheck` These crates deal with invoking `cargo` to learn about project structure and get compiler errors for the "check on save" feature. -They use `crates/path` heavily instead of `std::path`. +They use `crates/paths` heavily instead of `std::path`. A single `rust-analyzer` process can serve many projects, so it is important that server's current directory does not leak. -### `crates/mbe`, `crates/tt`, `crates/proc_macro_api`, `crates/proc_macro_srv` +### `crates/mbe`, `crates/tt`, `crates/proc-macro-api`, `crates/proc-macro-srv`, `crates/proc-macro-srv-cli` These crates implement macros as token tree -> token tree transforms. They are independent from the rest of the code. @@ -268,8 +268,8 @@ They are independent from the rest of the code. And it also handles the actual parsing and expansion of declarative macro (a-la "Macros By Example" or mbe). For proc macros, the client-server model are used. -We start a separate process (`proc_macro_srv`) which loads and runs the proc-macros for us. -And the client (`proc_macro_api`) provides an interface to talk to that server separately. +We start a separate process (`proc-macro-srv-cli`) which loads and runs the proc-macros for us. +And the client (`proc-macro-api`) provides an interface to talk to that server separately. And then token trees are passed from client, and the server will load the corresponding dynamic library (which built by `cargo`). And due to the fact the api for getting result from proc macro are always unstable in `rustc`, @@ -283,7 +283,7 @@ And they may be non-deterministic which conflict how `salsa` works, so special a This crate is responsible for parsing, evaluation and general definition of `cfg` attributes. -### `crates/vfs`, `crates/vfs-notify` +### `crates/vfs`, `crates/vfs-notify`, `crates/paths` These crates implement a virtual file system. They provide consistent snapshots of the underlying file system and insulate messy OS paths. @@ -301,6 +301,25 @@ as copies of unstable std items we would like to make use of already, like `std: This crate contains utilities for CPU and memory profiling. +### `crates/intern` + +This crate contains infrastructure for globally interning things via `Arc`. + +### `crates/load-cargo` + +This crate exposes several utilities for loading projects, used by the main `rust-analyzer` crate +and other downstream consumers. + +### `crates/rustc-dependencies` + +This crate wraps the `rustc_*` crates rust-analyzer relies on and conditionally points them to +mirrored crates-io releases such that rust-analyzer keeps building on stable. + +### `crates/span` + +This crate exposes types and functions related to rust-analyzer's span for macros. + +A span is effectively a text range relative to some item in a file with a given `SyntaxContext` (hygiene). ## Cross-Cutting Concerns diff --git a/src/tools/rust-analyzer/docs/dev/lsp-extensions.md b/src/tools/rust-analyzer/docs/dev/lsp-extensions.md index b66c9c943a1..3251dd75268 100644 --- a/src/tools/rust-analyzer/docs/dev/lsp-extensions.md +++ b/src/tools/rust-analyzer/docs/dev/lsp-extensions.md @@ -1,5 +1,5 @@ <!--- -lsp/ext.rs hash: 121482ee911854da +lsp/ext.rs hash: dff0b009e82ef06a If you need to change the above hash to make the test pass, please check if you need to adjust this doc as well and ping this issue: diff --git a/src/tools/rust-analyzer/docs/user/generated_config.adoc b/src/tools/rust-analyzer/docs/user/generated_config.adoc index 8a2d0808443..c3f249e0ce2 100644 --- a/src/tools/rust-analyzer/docs/user/generated_config.adoc +++ b/src/tools/rust-analyzer/docs/user/generated_config.adoc @@ -71,6 +71,12 @@ cargo check --quiet --workspace --message-format=json --all-targets ``` . -- +[[rust-analyzer.cargo.buildScripts.rebuildOnSave]]rust-analyzer.cargo.buildScripts.rebuildOnSave (default: `false`):: ++ +-- +Rerun proc-macros building/build-scripts running when proc-macro +or build-script sources change and are saved. +-- [[rust-analyzer.cargo.buildScripts.useRustcWrapper]]rust-analyzer.cargo.buildScripts.useRustcWrapper (default: `true`):: + -- @@ -179,9 +185,9 @@ For example for `cargo check`: `dead_code`, `unused_imports`, `unused_variables` -- Specifies the working directory for running checks. - "workspace": run checks for workspaces in the corresponding workspaces' root directories. - This falls back to "root" if `#rust-analyzer.cargo.check.invocationStrategy#` is set to `once`. + This falls back to "root" if `#rust-analyzer.check.invocationStrategy#` is set to `once`. - "root": run checks in the project's root directory. -This config only has an effect when `#rust-analyzer.cargo.check.overrideCommand#` +This config only has an effect when `#rust-analyzer.check.overrideCommand#` is set. -- [[rust-analyzer.check.invocationStrategy]]rust-analyzer.check.invocationStrategy (default: `"per_workspace"`):: @@ -190,7 +196,7 @@ is set. Specifies the invocation strategy to use when running the check command. If `per_workspace` is set, the command will be executed for each workspace. If `once` is set, the command will be executed once. -This config only has an effect when `#rust-analyzer.cargo.check.overrideCommand#` +This config only has an effect when `#rust-analyzer.check.overrideCommand#` is set. -- [[rust-analyzer.check.noDefaultFeatures]]rust-analyzer.check.noDefaultFeatures (default: `null`):: @@ -215,8 +221,8 @@ Cargo, you might also want to change If there are multiple linked projects/workspaces, this command is invoked for each of them, with the working directory being the workspace root (i.e., the folder containing the `Cargo.toml`). This can be overwritten -by changing `#rust-analyzer.cargo.check.invocationStrategy#` and -`#rust-analyzer.cargo.check.invocationLocation#`. +by changing `#rust-analyzer.check.invocationStrategy#` and +`#rust-analyzer.check.invocationLocation#`. An example command would be: diff --git a/src/tools/rust-analyzer/editors/code/package-lock.json b/src/tools/rust-analyzer/editors/code/package-lock.json index 1c94f13d745..8b9d5d4a746 100644 --- a/src/tools/rust-analyzer/editors/code/package-lock.json +++ b/src/tools/rust-analyzer/editors/code/package-lock.json @@ -21,7 +21,7 @@ "@types/vscode": "~1.78.1", "@typescript-eslint/eslint-plugin": "^6.0.0", "@typescript-eslint/parser": "^6.0.0", - "@vscode/test-electron": "^2.3.3", + "@vscode/test-electron": "^2.3.8", "@vscode/vsce": "^2.19.0", "esbuild": "^0.18.12", "eslint": "^8.44.0", @@ -763,15 +763,15 @@ } }, "node_modules/@vscode/test-electron": { - "version": "2.3.3", - "resolved": "https://registry.npmjs.org/@vscode/test-electron/-/test-electron-2.3.3.tgz", - "integrity": "sha512-hgXCkDP0ibboF1K6seqQYyHAzCURgTwHS/6QU7slhwznDLwsRwg9bhfw1CZdyUEw8vvCmlrKWnd7BlQnI0BC4w==", + "version": "2.3.8", + "resolved": "https://registry.npmjs.org/@vscode/test-electron/-/test-electron-2.3.8.tgz", + "integrity": "sha512-b4aZZsBKtMGdDljAsOPObnAi7+VWIaYl3ylCz1jTs+oV6BZ4TNHcVNC3xUn0azPeszBmwSBDQYfFESIaUQnrOg==", "dev": true, "dependencies": { "http-proxy-agent": "^4.0.1", "https-proxy-agent": "^5.0.0", "jszip": "^3.10.1", - "semver": "^7.3.8" + "semver": "^7.5.2" }, "engines": { "node": ">=16" diff --git a/src/tools/rust-analyzer/editors/code/package.json b/src/tools/rust-analyzer/editors/code/package.json index cfaf4213277..27ed8ac502b 100644 --- a/src/tools/rust-analyzer/editors/code/package.json +++ b/src/tools/rust-analyzer/editors/code/package.json @@ -57,7 +57,7 @@ "@types/vscode": "~1.78.1", "@typescript-eslint/eslint-plugin": "^6.0.0", "@typescript-eslint/parser": "^6.0.0", - "@vscode/test-electron": "^2.3.3", + "@vscode/test-electron": "^2.3.8", "@vscode/vsce": "^2.19.0", "esbuild": "^0.18.12", "eslint": "^8.44.0", @@ -586,6 +586,11 @@ "type": "string" } }, + "rust-analyzer.cargo.buildScripts.rebuildOnSave": { + "markdownDescription": "Rerun proc-macros building/build-scripts running when proc-macro\nor build-script sources change and are saved.", + "default": false, + "type": "boolean" + }, "rust-analyzer.cargo.buildScripts.useRustcWrapper": { "markdownDescription": "Use `RUSTC_WRAPPER=rust-analyzer` when running build scripts to\navoid checking unnecessary things.", "default": true, @@ -731,7 +736,7 @@ "uniqueItems": true }, "rust-analyzer.check.invocationLocation": { - "markdownDescription": "Specifies the working directory for running checks.\n- \"workspace\": run checks for workspaces in the corresponding workspaces' root directories.\n This falls back to \"root\" if `#rust-analyzer.cargo.check.invocationStrategy#` is set to `once`.\n- \"root\": run checks in the project's root directory.\nThis config only has an effect when `#rust-analyzer.cargo.check.overrideCommand#`\nis set.", + "markdownDescription": "Specifies the working directory for running checks.\n- \"workspace\": run checks for workspaces in the corresponding workspaces' root directories.\n This falls back to \"root\" if `#rust-analyzer.check.invocationStrategy#` is set to `once`.\n- \"root\": run checks in the project's root directory.\nThis config only has an effect when `#rust-analyzer.check.overrideCommand#`\nis set.", "default": "workspace", "type": "string", "enum": [ @@ -744,7 +749,7 @@ ] }, "rust-analyzer.check.invocationStrategy": { - "markdownDescription": "Specifies the invocation strategy to use when running the check command.\nIf `per_workspace` is set, the command will be executed for each workspace.\nIf `once` is set, the command will be executed once.\nThis config only has an effect when `#rust-analyzer.cargo.check.overrideCommand#`\nis set.", + "markdownDescription": "Specifies the invocation strategy to use when running the check command.\nIf `per_workspace` is set, the command will be executed for each workspace.\nIf `once` is set, the command will be executed once.\nThis config only has an effect when `#rust-analyzer.check.overrideCommand#`\nis set.", "default": "per_workspace", "type": "string", "enum": [ @@ -765,7 +770,7 @@ ] }, "rust-analyzer.check.overrideCommand": { - "markdownDescription": "Override the command rust-analyzer uses instead of `cargo check` for\ndiagnostics on save. The command is required to output json and\nshould therefore include `--message-format=json` or a similar option\n(if your client supports the `colorDiagnosticOutput` experimental\ncapability, you can use `--message-format=json-diagnostic-rendered-ansi`).\n\nIf you're changing this because you're using some tool wrapping\nCargo, you might also want to change\n`#rust-analyzer.cargo.buildScripts.overrideCommand#`.\n\nIf there are multiple linked projects/workspaces, this command is invoked for\neach of them, with the working directory being the workspace root\n(i.e., the folder containing the `Cargo.toml`). This can be overwritten\nby changing `#rust-analyzer.cargo.check.invocationStrategy#` and\n`#rust-analyzer.cargo.check.invocationLocation#`.\n\nAn example command would be:\n\n```bash\ncargo check --workspace --message-format=json --all-targets\n```\n.", + "markdownDescription": "Override the command rust-analyzer uses instead of `cargo check` for\ndiagnostics on save. The command is required to output json and\nshould therefore include `--message-format=json` or a similar option\n(if your client supports the `colorDiagnosticOutput` experimental\ncapability, you can use `--message-format=json-diagnostic-rendered-ansi`).\n\nIf you're changing this because you're using some tool wrapping\nCargo, you might also want to change\n`#rust-analyzer.cargo.buildScripts.overrideCommand#`.\n\nIf there are multiple linked projects/workspaces, this command is invoked for\neach of them, with the working directory being the workspace root\n(i.e., the folder containing the `Cargo.toml`). This can be overwritten\nby changing `#rust-analyzer.check.invocationStrategy#` and\n`#rust-analyzer.check.invocationLocation#`.\n\nAn example command would be:\n\n```bash\ncargo check --workspace --message-format=json --all-targets\n```\n.", "default": null, "type": [ "null", @@ -1690,11 +1695,14 @@ "name": "rust-panic", "patterns": [ { - "regexp": "^thread '.*' panicked at '(.*)', (.*):(\\d*):(\\d*)$", - "message": 1, - "file": 2, - "line": 3, - "column": 4 + "regexp": "^thread '.*' panicked at (.*):(\\d*):(\\d*):$", + "file": 1, + "line": 2, + "column": 3 + }, + { + "regexp": "(.*)", + "message": 1 } ] } diff --git a/src/tools/rust-analyzer/editors/code/src/debug.ts b/src/tools/rust-analyzer/editors/code/src/debug.ts index 06034e16480..d9c6b6ac456 100644 --- a/src/tools/rust-analyzer/editors/code/src/debug.ts +++ b/src/tools/rust-analyzer/editors/code/src/debug.ts @@ -135,8 +135,10 @@ async function getDebugConfiguration( let sourceFileMap = debugOptions.sourceFileMap; if (sourceFileMap === "auto") { // let's try to use the default toolchain - const commitHash = await getRustcId(wsFolder); - const sysroot = await getSysroot(wsFolder); + const [commitHash, sysroot] = await Promise.all([ + getRustcId(wsFolder), + getSysroot(wsFolder), + ]); const rustlib = path.normalize(sysroot + "/lib/rustlib/src/rust"); sourceFileMap = {}; sourceFileMap[`/rustc/${commitHash}/`] = rustlib; diff --git a/src/tools/rust-analyzer/editors/code/src/run.ts b/src/tools/rust-analyzer/editors/code/src/run.ts index 778cbc5762a..fc3f1acce54 100644 --- a/src/tools/rust-analyzer/editors/code/src/run.ts +++ b/src/tools/rust-analyzer/editors/code/src/run.ts @@ -43,7 +43,7 @@ export async function selectRunnable( return; } - // clear the list before we hook up listeners to to avoid invoking them + // clear the list before we hook up listeners to avoid invoking them // if the user happens to accept the placeholder item quickPick.items = []; diff --git a/src/tools/rust-analyzer/lib/la-arena/Cargo.toml b/src/tools/rust-analyzer/lib/la-arena/Cargo.toml index 01f2b87b39d..589d026142b 100644 --- a/src/tools/rust-analyzer/lib/la-arena/Cargo.toml +++ b/src/tools/rust-analyzer/lib/la-arena/Cargo.toml @@ -8,3 +8,6 @@ documentation = "https://docs.rs/la-arena" categories = ["data-structures", "memory-management", "rust-patterns"] edition = "2021" rust-version = "1.56" + +[lints] +workspace = true diff --git a/src/tools/rust-analyzer/lib/line-index/Cargo.toml b/src/tools/rust-analyzer/lib/line-index/Cargo.toml index 494a7fa979a..77e187de1ed 100644 --- a/src/tools/rust-analyzer/lib/line-index/Cargo.toml +++ b/src/tools/rust-analyzer/lib/line-index/Cargo.toml @@ -9,3 +9,6 @@ edition = "2021" [dependencies] text-size = "1.1.1" nohash-hasher = "0.2.0" + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/lib/lsp-server/Cargo.toml b/src/tools/rust-analyzer/lib/lsp-server/Cargo.toml index 2a70aedbe8e..a89eb4b144c 100644 --- a/src/tools/rust-analyzer/lib/lsp-server/Cargo.toml +++ b/src/tools/rust-analyzer/lib/lsp-server/Cargo.toml @@ -1,6 +1,6 @@ [package] name = "lsp-server" -version = "0.7.5" +version = "0.7.6" description = "Generic LSP server scaffold." license = "MIT OR Apache-2.0" repository = "https://github.com/rust-lang/rust-analyzer/tree/master/lib/lsp-server" @@ -10,8 +10,11 @@ edition = "2021" log = "0.4.17" serde_json = "1.0.108" serde = { version = "1.0.192", features = ["derive"] } -crossbeam-channel = "0.5.6" +crossbeam-channel = "0.5.8" [dev-dependencies] -lsp-types = "=0.94" +lsp-types = "=0.95" ctrlc = "3.4.1" + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/lib/lsp-server/examples/goto_def.rs b/src/tools/rust-analyzer/lib/lsp-server/examples/goto_def.rs index 2f270afbbf1..71f66254069 100644 --- a/src/tools/rust-analyzer/lib/lsp-server/examples/goto_def.rs +++ b/src/tools/rust-analyzer/lib/lsp-server/examples/goto_def.rs @@ -64,7 +64,15 @@ fn main() -> Result<(), Box<dyn Error + Sync + Send>> { ..Default::default() }) .unwrap(); - let initialization_params = connection.initialize(server_capabilities)?; + let initialization_params = match connection.initialize(server_capabilities) { + Ok(it) => it, + Err(e) => { + if e.channel_is_disconnected() { + io_threads.join()?; + } + return Err(e.into()); + } + }; main_loop(connection, initialization_params)?; io_threads.join()?; diff --git a/src/tools/rust-analyzer/lib/lsp-server/src/error.rs b/src/tools/rust-analyzer/lib/lsp-server/src/error.rs index 755b3fd9596..ebdd153b5b3 100644 --- a/src/tools/rust-analyzer/lib/lsp-server/src/error.rs +++ b/src/tools/rust-analyzer/lib/lsp-server/src/error.rs @@ -3,7 +3,22 @@ use std::fmt; use crate::{Notification, Request}; #[derive(Debug, Clone, PartialEq)] -pub struct ProtocolError(pub(crate) String); +pub struct ProtocolError(String, bool); + +impl ProtocolError { + pub(crate) fn new(msg: impl Into<String>) -> Self { + ProtocolError(msg.into(), false) + } + + pub(crate) fn disconnected() -> ProtocolError { + ProtocolError("disconnected channel".into(), true) + } + + /// Whether this error occured due to a disconnected channel. + pub fn channel_is_disconnected(&self) -> bool { + self.1 + } +} impl std::error::Error for ProtocolError {} diff --git a/src/tools/rust-analyzer/lib/lsp-server/src/lib.rs b/src/tools/rust-analyzer/lib/lsp-server/src/lib.rs index 2797a6b60de..6b732d47029 100644 --- a/src/tools/rust-analyzer/lib/lsp-server/src/lib.rs +++ b/src/tools/rust-analyzer/lib/lsp-server/src/lib.rs @@ -17,7 +17,7 @@ use std::{ net::{TcpListener, TcpStream, ToSocketAddrs}, }; -use crossbeam_channel::{Receiver, RecvTimeoutError, Sender}; +use crossbeam_channel::{Receiver, RecvError, RecvTimeoutError, Sender}; pub use crate::{ error::{ExtractError, ProtocolError}, @@ -158,11 +158,7 @@ impl Connection { Err(RecvTimeoutError::Timeout) => { continue; } - Err(e) => { - return Err(ProtocolError(format!( - "expected initialize request, got error: {e}" - ))) - } + Err(RecvTimeoutError::Disconnected) => return Err(ProtocolError::disconnected()), }; match msg { @@ -181,12 +177,14 @@ impl Connection { continue; } msg => { - return Err(ProtocolError(format!("expected initialize request, got {msg:?}"))); + return Err(ProtocolError::new(format!( + "expected initialize request, got {msg:?}" + ))); } }; } - return Err(ProtocolError(String::from( + return Err(ProtocolError::new(String::from( "Initialization has been aborted during initialization", ))); } @@ -201,12 +199,10 @@ impl Connection { self.sender.send(resp.into()).unwrap(); match &self.receiver.recv() { Ok(Message::Notification(n)) if n.is_initialized() => Ok(()), - Ok(msg) => { - Err(ProtocolError(format!(r#"expected initialized notification, got: {msg:?}"#))) - } - Err(e) => { - Err(ProtocolError(format!("expected initialized notification, got error: {e}",))) - } + Ok(msg) => Err(ProtocolError::new(format!( + r#"expected initialized notification, got: {msg:?}"# + ))), + Err(RecvError) => Err(ProtocolError::disconnected()), } } @@ -231,10 +227,8 @@ impl Connection { Err(RecvTimeoutError::Timeout) => { continue; } - Err(e) => { - return Err(ProtocolError(format!( - "expected initialized notification, got error: {e}", - ))); + Err(RecvTimeoutError::Disconnected) => { + return Err(ProtocolError::disconnected()); } }; @@ -243,14 +237,14 @@ impl Connection { return Ok(()); } msg => { - return Err(ProtocolError(format!( + return Err(ProtocolError::new(format!( r#"expected initialized notification, got: {msg:?}"# ))); } } } - return Err(ProtocolError(String::from( + return Err(ProtocolError::new(String::from( "Initialization has been aborted during initialization", ))); } @@ -359,9 +353,18 @@ impl Connection { match &self.receiver.recv_timeout(std::time::Duration::from_secs(30)) { Ok(Message::Notification(n)) if n.is_exit() => (), Ok(msg) => { - return Err(ProtocolError(format!("unexpected message during shutdown: {msg:?}"))) + return Err(ProtocolError::new(format!( + "unexpected message during shutdown: {msg:?}" + ))) + } + Err(RecvTimeoutError::Timeout) => { + return Err(ProtocolError::new(format!("timed out waiting for exit notification"))) + } + Err(RecvTimeoutError::Disconnected) => { + return Err(ProtocolError::new(format!( + "channel disconnected waiting for exit notification" + ))) } - Err(e) => return Err(ProtocolError(format!("unexpected error during shutdown: {e}"))), } Ok(true) } @@ -426,7 +429,7 @@ mod tests { initialize_start_test(TestCase { test_messages: vec![notification_msg.clone()], - expected_resp: Err(ProtocolError(format!( + expected_resp: Err(ProtocolError::new(format!( "expected initialize request, got {:?}", notification_msg ))), diff --git a/src/tools/rust-analyzer/lib/lsp-server/src/msg.rs b/src/tools/rust-analyzer/lib/lsp-server/src/msg.rs index 730ad51f424..ba318dd1690 100644 --- a/src/tools/rust-analyzer/lib/lsp-server/src/msg.rs +++ b/src/tools/rust-analyzer/lib/lsp-server/src/msg.rs @@ -264,12 +264,12 @@ fn read_msg_text(inp: &mut dyn BufRead) -> io::Result<Option<String>> { let mut parts = buf.splitn(2, ": "); let header_name = parts.next().unwrap(); let header_value = - parts.next().ok_or_else(|| invalid_data!("malformed header: {:?}", buf))?; + parts.next().ok_or_else(|| invalid_data(format!("malformed header: {:?}", buf)))?; if header_name.eq_ignore_ascii_case("Content-Length") { size = Some(header_value.parse::<usize>().map_err(invalid_data)?); } } - let size: usize = size.ok_or_else(|| invalid_data!("no Content-Length"))?; + let size: usize = size.ok_or_else(|| invalid_data("no Content-Length".to_string()))?; let mut buf = buf.into_bytes(); buf.resize(size, 0); inp.read_exact(&mut buf)?; diff --git a/src/tools/rust-analyzer/lib/lsp-server/src/stdio.rs b/src/tools/rust-analyzer/lib/lsp-server/src/stdio.rs index e487b9b4622..cea199d0293 100644 --- a/src/tools/rust-analyzer/lib/lsp-server/src/stdio.rs +++ b/src/tools/rust-analyzer/lib/lsp-server/src/stdio.rs @@ -15,8 +15,7 @@ pub(crate) fn stdio_transport() -> (Sender<Message>, Receiver<Message>, IoThread let writer = thread::spawn(move || { let stdout = stdout(); let mut stdout = stdout.lock(); - writer_receiver.into_iter().try_for_each(|it| it.write(&mut stdout))?; - Ok(()) + writer_receiver.into_iter().try_for_each(|it| it.write(&mut stdout)) }); let (reader_sender, reader_receiver) = bounded::<Message>(0); let reader = thread::spawn(move || { diff --git a/src/tools/rust-analyzer/xtask/Cargo.toml b/src/tools/rust-analyzer/xtask/Cargo.toml index 1c785b60a3d..863a63ac82e 100644 --- a/src/tools/rust-analyzer/xtask/Cargo.toml +++ b/src/tools/rust-analyzer/xtask/Cargo.toml @@ -15,3 +15,6 @@ xflags = "0.3.0" time = { version = "0.3", default-features = false } zip = { version = "0.6", default-features = false, features = ["deflate", "time"] } # Avoid adding more dependencies to this crate + +[lints] +workspace = true \ No newline at end of file diff --git a/src/tools/rust-analyzer/xtask/src/release/changelog.rs b/src/tools/rust-analyzer/xtask/src/release/changelog.rs index 67538414840..817863336dd 100644 --- a/src/tools/rust-analyzer/xtask/src/release/changelog.rs +++ b/src/tools/rust-analyzer/xtask/src/release/changelog.rs @@ -30,34 +30,52 @@ pub(crate) fn get_changelog( // we don't use an HTTPS client or JSON parser to keep the build times low let pr = pr_num.to_string(); - let pr_json = - cmd!(sh, "curl -s -H {accept} -H {authorization} {pr_url}/{pr}").read()?; + let cmd = &cmd!(sh, "curl --fail -s -H {accept} -H {authorization} {pr_url}/{pr}"); + let pr_json = match cmd.read() { + Ok(pr_json) => pr_json, + Err(e) => { + // most likely a rust-lang/rust PR + eprintln!("Cannot get info for #{pr}: {e}"); + continue; + } + }; + let pr_title = cmd!(sh, "jq .title").stdin(&pr_json).read()?; let pr_title = unescape(&pr_title[1..pr_title.len() - 1]); let pr_comment = cmd!(sh, "jq .body").stdin(pr_json).read()?; - let comments_json = - cmd!(sh, "curl -s -H {accept} -H {authorization} {pr_url}/{pr}/comments").read()?; - let pr_comments = cmd!(sh, "jq .[].body").stdin(comments_json).read()?; - - let l = iter::once(pr_comment.as_str()) - .chain(pr_comments.lines()) - .rev() - .find_map(|it| { - let it = unescape(&it[1..it.len() - 1]); - it.lines().find_map(parse_changelog_line) - }) - .into_iter() - .next() - .unwrap_or_else(|| parse_title_line(&pr_title)); - let s = match l.kind { + let cmd = + &cmd!(sh, "curl --fail -s -H {accept} -H {authorization} {pr_url}/{pr}/comments"); + let pr_info = match cmd.read() { + Ok(comments_json) => { + let pr_comments = cmd!(sh, "jq .[].body").stdin(comments_json).read()?; + + iter::once(pr_comment.as_str()) + .chain(pr_comments.lines()) + .rev() + .find_map(|it| { + let it = unescape(&it[1..it.len() - 1]); + it.lines().find_map(parse_changelog_line) + }) + .into_iter() + .next() + } + Err(e) => { + eprintln!("Cannot get comments for #{pr}: {e}"); + None + } + }; + + let pr_info = pr_info.unwrap_or_else(|| parse_title_line(&pr_title)); + let s = match pr_info.kind { PrKind::Feature => &mut features, PrKind::Fix => &mut fixes, PrKind::Internal => &mut internal, PrKind::Other => &mut others, PrKind::Skip => continue, }; - writeln!(s, "* pr:{pr_num}[] {}", l.message.as_deref().unwrap_or(&pr_title)).unwrap(); + writeln!(s, "* pr:{pr_num}[] {}", pr_info.message.as_deref().unwrap_or(&pr_title)) + .unwrap(); } } diff --git a/src/tools/rustfmt/src/expr.rs b/src/tools/rustfmt/src/expr.rs index 7808f891336..4b86c2acdc5 100644 --- a/src/tools/rustfmt/src/expr.rs +++ b/src/tools/rustfmt/src/expr.rs @@ -1947,7 +1947,7 @@ fn rewrite_unary_op( } pub(crate) enum RhsAssignKind<'ast> { - Expr(&'ast ast::ExprKind, Span), + Expr(&'ast ast::ExprKind, #[allow(dead_code)] Span), Bounds, Ty, } diff --git a/src/tools/rustfmt/src/parse/session.rs b/src/tools/rustfmt/src/parse/session.rs index 8303c03e1eb..2663f16b8e8 100644 --- a/src/tools/rustfmt/src/parse/session.rs +++ b/src/tools/rustfmt/src/parse/session.rs @@ -2,7 +2,7 @@ use std::path::Path; use std::sync::atomic::{AtomicBool, Ordering}; use rustc_data_structures::sync::{IntoDynSyncSend, Lrc}; -use rustc_errors::emitter::{DynEmitter, Emitter, EmitterWriter}; +use rustc_errors::emitter::{DynEmitter, Emitter, HumanEmitter}; use rustc_errors::translation::Translate; use rustc_errors::{ColorConfig, DiagCtxt, Diagnostic, Level as DiagnosticLevel}; use rustc_session::parse::ParseSess as RawParseSess; @@ -139,7 +139,7 @@ fn default_dcx( rustc_driver::DEFAULT_LOCALE_RESOURCES.to_vec(), false, ); - Box::new(EmitterWriter::stderr(emit_color, fallback_bundle).sm(Some(source_map.clone()))) + Box::new(HumanEmitter::stderr(emit_color, fallback_bundle).sm(Some(source_map.clone()))) }; DiagCtxt::with_emitter(Box::new(SilentOnIgnoredFilesEmitter { has_non_ignorable_parser_errors: false, diff --git a/src/tools/tidy/src/ui_tests.rs b/src/tools/tidy/src/ui_tests.rs index dfa386b49de..b4745d4883c 100644 --- a/src/tools/tidy/src/ui_tests.rs +++ b/src/tools/tidy/src/ui_tests.rs @@ -10,7 +10,7 @@ use std::path::{Path, PathBuf}; const ENTRY_LIMIT: usize = 900; // FIXME: The following limits should be reduced eventually. -const ISSUES_ENTRY_LIMIT: usize = 1852; +const ISSUES_ENTRY_LIMIT: usize = 1849; const ROOT_ENTRY_LIMIT: usize = 867; const EXPECTED_TEST_FILE_EXTENSIONS: &[&str] = &[ diff --git a/tests/assembly/asm/s390x-types.rs b/tests/assembly/asm/s390x-types.rs index 2fb404dd9b2..c39a82c3b1c 100644 --- a/tests/assembly/asm/s390x-types.rs +++ b/tests/assembly/asm/s390x-types.rs @@ -112,6 +112,30 @@ check!(reg_i32, i32, reg, "lgr"); // CHECK: #NO_APP check!(reg_i64, i64, reg, "lgr"); +// CHECK-LABEL: reg_i8_addr: +// CHECK: #APP +// CHECK: lgr %r{{[0-9]+}}, %r{{[0-9]+}} +// CHECK: #NO_APP +check!(reg_i8_addr, i8, reg_addr, "lgr"); + +// CHECK-LABEL: reg_i16_addr: +// CHECK: #APP +// CHECK: lgr %r{{[0-9]+}}, %r{{[0-9]+}} +// CHECK: #NO_APP +check!(reg_i16_addr, i16, reg_addr, "lgr"); + +// CHECK-LABEL: reg_i32_addr: +// CHECK: #APP +// CHECK: lgr %r{{[0-9]+}}, %r{{[0-9]+}} +// CHECK: #NO_APP +check!(reg_i32_addr, i32, reg_addr, "lgr"); + +// CHECK-LABEL: reg_i64_addr: +// CHECK: #APP +// CHECK: lgr %r{{[0-9]+}}, %r{{[0-9]+}} +// CHECK: #NO_APP +check!(reg_i64_addr, i64, reg_addr, "lgr"); + // CHECK-LABEL: reg_f32: // CHECK: #APP // CHECK: ler %f{{[0-9]+}}, %f{{[0-9]+}} diff --git a/tests/codegen-units/item-collection/generic-drop-glue.rs b/tests/codegen-units/item-collection/generic-drop-glue.rs index 6df4ff7e58b..ca477d06610 100644 --- a/tests/codegen-units/item-collection/generic-drop-glue.rs +++ b/tests/codegen-units/item-collection/generic-drop-glue.rs @@ -34,9 +34,9 @@ enum EnumNoDrop<T1, T2> { } -struct NonGenericNoDrop(#[allow(unused_tuple_struct_fields)] i32); +struct NonGenericNoDrop(#[allow(dead_code)] i32); -struct NonGenericWithDrop(#[allow(unused_tuple_struct_fields)] i32); +struct NonGenericWithDrop(#[allow(dead_code)] i32); //~ MONO_ITEM fn std::ptr::drop_in_place::<NonGenericWithDrop> - shim(Some(NonGenericWithDrop)) @@ generic_drop_glue-cgu.0[Internal] impl Drop for NonGenericWithDrop { diff --git a/tests/codegen-units/item-collection/transitive-drop-glue.rs b/tests/codegen-units/item-collection/transitive-drop-glue.rs index e286c800b7c..5f20637b40f 100644 --- a/tests/codegen-units/item-collection/transitive-drop-glue.rs +++ b/tests/codegen-units/item-collection/transitive-drop-glue.rs @@ -6,9 +6,9 @@ #![feature(start)] //~ MONO_ITEM fn std::ptr::drop_in_place::<Root> - shim(Some(Root)) @@ transitive_drop_glue-cgu.0[Internal] -struct Root(#[allow(unused_tuple_struct_fields)] Intermediate); +struct Root(#[allow(dead_code)] Intermediate); //~ MONO_ITEM fn std::ptr::drop_in_place::<Intermediate> - shim(Some(Intermediate)) @@ transitive_drop_glue-cgu.0[Internal] -struct Intermediate(#[allow(unused_tuple_struct_fields)] Leaf); +struct Intermediate(#[allow(dead_code)] Leaf); //~ MONO_ITEM fn std::ptr::drop_in_place::<Leaf> - shim(Some(Leaf)) @@ transitive_drop_glue-cgu.0[Internal] struct Leaf; @@ -17,9 +17,9 @@ impl Drop for Leaf { fn drop(&mut self) {} } -struct RootGen<T>(#[allow(unused_tuple_struct_fields)] IntermediateGen<T>); -struct IntermediateGen<T>(#[allow(unused_tuple_struct_fields)] LeafGen<T>); -struct LeafGen<T>(#[allow(unused_tuple_struct_fields)] T); +struct RootGen<T>(#[allow(dead_code)] IntermediateGen<T>); +struct IntermediateGen<T>(#[allow(dead_code)] LeafGen<T>); +struct LeafGen<T>(#[allow(dead_code)] T); impl<T> Drop for LeafGen<T> { fn drop(&mut self) {} diff --git a/tests/codegen-units/item-collection/unsizing.rs b/tests/codegen-units/item-collection/unsizing.rs index 111a7231209..34f52ce4e61 100644 --- a/tests/codegen-units/item-collection/unsizing.rs +++ b/tests/codegen-units/item-collection/unsizing.rs @@ -40,7 +40,7 @@ impl Trait for u32 { } #[derive(Clone, Copy)] -struct Wrapper<T: ?Sized>(#[allow(unused_tuple_struct_fields)] *const T); +struct Wrapper<T: ?Sized>(#[allow(dead_code)] *const T); impl<T: ?Sized + Unsize<U>, U: ?Sized> CoerceUnsized<Wrapper<U>> for Wrapper<T> {} diff --git a/tests/codegen/align-byval.rs b/tests/codegen/align-byval.rs index e2446e02ef4..c6e3a8ef5f0 100644 --- a/tests/codegen/align-byval.rs +++ b/tests/codegen/align-byval.rs @@ -106,21 +106,21 @@ pub struct ForceAlign16 { pub unsafe fn call_na1(x: NaturalAlign1) { // CHECK: start: - // m68k: [[ALLOCA:%[a-z0-9+]]] = alloca { i8, i8 }, align 1 - // m68k: call void @natural_align_1({{.*}}byval({ i8, i8 }) align 1{{.*}} [[ALLOCA]]) + // m68k: [[ALLOCA:%[a-z0-9+]]] = alloca %NaturalAlign1, align 1 + // m68k: call void @natural_align_1({{.*}}byval(%NaturalAlign1) align 1{{.*}} [[ALLOCA]]) - // wasm: [[ALLOCA:%[a-z0-9+]]] = alloca { i8, i8 }, align 1 - // wasm: call void @natural_align_1({{.*}}byval({ i8, i8 }) align 1{{.*}} [[ALLOCA]]) + // wasm: [[ALLOCA:%[a-z0-9+]]] = alloca %NaturalAlign1, align 1 + // wasm: call void @natural_align_1({{.*}}byval(%NaturalAlign1) align 1{{.*}} [[ALLOCA]]) // x86_64-linux: call void @natural_align_1(i16 // x86_64-windows: call void @natural_align_1(i16 - // i686-linux: [[ALLOCA:%[a-z0-9+]]] = alloca { i8, i8 }, align 4 - // i686-linux: call void @natural_align_1({{.*}}byval({ i8, i8 }) align 4{{.*}} [[ALLOCA]]) + // i686-linux: [[ALLOCA:%[a-z0-9+]]] = alloca %NaturalAlign1, align 4 + // i686-linux: call void @natural_align_1({{.*}}byval(%NaturalAlign1) align 4{{.*}} [[ALLOCA]]) - // i686-windows: [[ALLOCA:%[a-z0-9+]]] = alloca { i8, i8 }, align 4 - // i686-windows: call void @natural_align_1({{.*}}byval({ i8, i8 }) align 4{{.*}} [[ALLOCA]]) + // i686-windows: [[ALLOCA:%[a-z0-9+]]] = alloca %NaturalAlign1, align 4 + // i686-windows: call void @natural_align_1({{.*}}byval(%NaturalAlign1) align 4{{.*}} [[ALLOCA]]) natural_align_1(x); } @@ -199,17 +199,17 @@ pub unsafe fn call_fa16(x: ForceAlign16) { } extern "C" { - // m68k: declare void @natural_align_1({{.*}}byval({ i8, i8 }) align 1{{.*}}) + // m68k: declare void @natural_align_1({{.*}}byval(%NaturalAlign1) align 1{{.*}}) - // wasm: declare void @natural_align_1({{.*}}byval({ i8, i8 }) align 1{{.*}}) + // wasm: declare void @natural_align_1({{.*}}byval(%NaturalAlign1) align 1{{.*}}) // x86_64-linux: declare void @natural_align_1(i16) // x86_64-windows: declare void @natural_align_1(i16) - // i686-linux: declare void @natural_align_1({{.*}}byval({ i8, i8 }) align 4{{.*}}) + // i686-linux: declare void @natural_align_1({{.*}}byval(%NaturalAlign1) align 4{{.*}}) - // i686-windows: declare void @natural_align_1({{.*}}byval({ i8, i8 }) align 4{{.*}}) + // i686-windows: declare void @natural_align_1({{.*}}byval(%NaturalAlign1) align 4{{.*}}) fn natural_align_1(x: NaturalAlign1); // m68k: declare void @natural_align_2({{.*}}byval(%NaturalAlign2) align 2{{.*}}) diff --git a/tests/codegen/align-struct.rs b/tests/codegen/align-struct.rs index 40bba6d5254..d483a2ba151 100644 --- a/tests/codegen/align-struct.rs +++ b/tests/codegen/align-struct.rs @@ -57,7 +57,7 @@ pub fn nested64(a: Align64, b: i32, c: i32, d: i8) -> Nested64 { // CHECK-LABEL: @enum4 #[no_mangle] pub fn enum4(a: i32) -> Enum4 { -// CHECK: %e4 = alloca { i32, i32 }, align 4 +// CHECK: %e4 = alloca %Enum4, align 4 let e4 = Enum4::A(a); e4 } diff --git a/tests/codegen/function-arguments-noopt.rs b/tests/codegen/function-arguments-noopt.rs index 8fe6c790dda..1bd735cc1af 100644 --- a/tests/codegen/function-arguments-noopt.rs +++ b/tests/codegen/function-arguments-noopt.rs @@ -55,7 +55,7 @@ pub fn struct_call(x: S, f: fn(S) -> S) -> S { f(x) } -// CHECK: { i8, i8 } @enum_(i1 zeroext %x.0, i8 %x.1) +// CHECK: { i1, i8 } @enum_(i1 zeroext %x.0, i8 %x.1) #[no_mangle] pub fn enum_(x: Option<u8>) -> Option<u8> { x @@ -64,6 +64,6 @@ pub fn enum_(x: Option<u8>) -> Option<u8> { // CHECK-LABEL: @enum_call #[no_mangle] pub fn enum_call(x: Option<u8>, f: fn(Option<u8>) -> Option<u8>) -> Option<u8> { - // CHECK: call { i8, i8 } %f(i1 zeroext %x.0, i8 %x.1) + // CHECK: call { i1, i8 } %f(i1 zeroext %x.0, i8 %x.1) f(x) } diff --git a/tests/codegen/function-arguments.rs b/tests/codegen/function-arguments.rs index a218596da1d..64ebd3c05af 100644 --- a/tests/codegen/function-arguments.rs +++ b/tests/codegen/function-arguments.rs @@ -275,7 +275,7 @@ pub fn enum_id_1(x: Option<Result<u16, u16>>) -> Option<Result<u16, u16>> { x } -// CHECK: { i8, i8 } @enum_id_2(i1 noundef zeroext %x.0, i8 %x.1) +// CHECK: { i1, i8 } @enum_id_2(i1 noundef zeroext %x.0, i8 %x.1) #[no_mangle] pub fn enum_id_2(x: Option<u8>) -> Option<u8> { x diff --git a/tests/codegen/intrinsics/transmute.rs b/tests/codegen/intrinsics/transmute.rs index e64af33ab6c..eff16050875 100644 --- a/tests/codegen/intrinsics/transmute.rs +++ b/tests/codegen/intrinsics/transmute.rs @@ -190,7 +190,7 @@ pub unsafe fn check_byte_from_bool(x: bool) -> u8 { // CHECK-LABEL: @check_to_pair( #[no_mangle] pub unsafe fn check_to_pair(x: u64) -> Option<i32> { - // CHECK: %_0 = alloca { i32, i32 }, align 4 + // CHECK: %_0 = alloca %"core::option::Option<i32>", align 4 // CHECK: store i64 %x, ptr %_0, align 4 transmute(x) } @@ -203,10 +203,10 @@ pub unsafe fn check_from_pair(x: Option<i32>) -> u64 { const { assert!(std::mem::align_of::<Option<i32>>() == 4) }; // CHECK: %_0 = alloca i64, align 8 - // CHECK: store i32 %x.0, ptr %0, align 8 - // CHECK: store i32 %x.1, ptr %1, align 4 - // CHECK: %2 = load i64, ptr %_0, align 8 - // CHECK: ret i64 %2 + // CHECK: store i32 %x.0, ptr %_0, align 8 + // CHECK: store i32 %x.1, ptr %0, align 4 + // CHECK: %[[R:.+]] = load i64, ptr %_0, align 8 + // CHECK: ret i64 %[[R]] transmute(x) } diff --git a/tests/codegen/maybeuninit-rvo.rs b/tests/codegen/maybeuninit-rvo.rs new file mode 100644 index 00000000000..feed513e1fb --- /dev/null +++ b/tests/codegen/maybeuninit-rvo.rs @@ -0,0 +1,33 @@ +// compile-flags: -O +#![feature(c_unwind)] +#![crate_type = "lib"] + +pub struct Foo([u8; 1000]); + +extern "C" { + fn init(p: *mut Foo); +} + +pub fn new_from_uninit() -> Foo { + // CHECK-LABEL: new_from_uninit + // CHECK-NOT: call void @llvm.memcpy. + let mut x = std::mem::MaybeUninit::uninit(); + unsafe { + init(x.as_mut_ptr()); + x.assume_init() + } +} + +extern "C-unwind" { + fn init_unwind(p: *mut Foo); +} + +pub fn new_from_uninit_unwind() -> Foo { + // CHECK-LABEL: new_from_uninit + // CHECK: call void @llvm.memcpy. + let mut x = std::mem::MaybeUninit::uninit(); + unsafe { + init_unwind(x.as_mut_ptr()); + x.assume_init() + } +} diff --git a/tests/codegen/personality_lifetimes.rs b/tests/codegen/personality_lifetimes.rs index b39718a8d08..e2bc0ebcb37 100644 --- a/tests/codegen/personality_lifetimes.rs +++ b/tests/codegen/personality_lifetimes.rs @@ -24,7 +24,7 @@ pub fn test() { let _s = S; // Check that the personality slot alloca gets a lifetime start in each cleanup block, not just // in the first one. - // CHECK: [[SLOT:%[0-9]+]] = alloca { ptr, i32 } + // CHECK: [[SLOT:%[0-9]+]] = alloca { ptr, i32{{.*}} } // CHECK-LABEL: cleanup: // CHECK: call void @llvm.lifetime.start.{{.*}}({{.*}}) // CHECK-LABEL: cleanup1: diff --git a/tests/codegen/refs.rs b/tests/codegen/refs.rs index 1c7746a3079..9e1205f5d1d 100644 --- a/tests/codegen/refs.rs +++ b/tests/codegen/refs.rs @@ -13,9 +13,8 @@ pub fn helper(_: usize) { pub fn ref_dst(s: &[u8]) { // We used to generate an extra alloca and memcpy to ref the dst, so check that we copy // directly to the alloca for "x" -// CHECK: [[X0:%[0-9]+]] = getelementptr inbounds { ptr, [[USIZE]] }, {{.*}} %x, i32 0, i32 0 -// CHECK: store ptr %s.0, {{.*}} [[X0]] -// CHECK: [[X1:%[0-9]+]] = getelementptr inbounds { ptr, [[USIZE]] }, {{.*}} %x, i32 0, i32 1 +// CHECK: store ptr %s.0, {{.*}} %x +// CHECK: [[X1:%[0-9]+]] = getelementptr inbounds i8, {{.*}} %x, {{i32 4|i64 8}} // CHECK: store [[USIZE]] %s.1, {{.*}} [[X1]] let x = &*s; diff --git a/tests/codegen/scalar-pair-bool.rs b/tests/codegen/scalar-pair-bool.rs index 8e8365b6a67..a8d16bc8f29 100644 --- a/tests/codegen/scalar-pair-bool.rs +++ b/tests/codegen/scalar-pair-bool.rs @@ -2,25 +2,25 @@ #![crate_type = "lib"] -// CHECK: define{{.*}}{ i8, i8 } @pair_bool_bool(i1 noundef zeroext %pair.0, i1 noundef zeroext %pair.1) +// CHECK: define{{.*}}{ i1, i1 } @pair_bool_bool(i1 noundef zeroext %pair.0, i1 noundef zeroext %pair.1) #[no_mangle] pub fn pair_bool_bool(pair: (bool, bool)) -> (bool, bool) { pair } -// CHECK: define{{.*}}{ i8, i32 } @pair_bool_i32(i1 noundef zeroext %pair.0, i32 noundef %pair.1) +// CHECK: define{{.*}}{ i1, i32 } @pair_bool_i32(i1 noundef zeroext %pair.0, i32 noundef %pair.1) #[no_mangle] pub fn pair_bool_i32(pair: (bool, i32)) -> (bool, i32) { pair } -// CHECK: define{{.*}}{ i32, i8 } @pair_i32_bool(i32 noundef %pair.0, i1 noundef zeroext %pair.1) +// CHECK: define{{.*}}{ i32, i1 } @pair_i32_bool(i32 noundef %pair.0, i1 noundef zeroext %pair.1) #[no_mangle] pub fn pair_i32_bool(pair: (i32, bool)) -> (i32, bool) { pair } -// CHECK: define{{.*}}{ i8, i8 } @pair_and_or(i1 noundef zeroext %_1.0, i1 noundef zeroext %_1.1) +// CHECK: define{{.*}}{ i1, i1 } @pair_and_or(i1 noundef zeroext %_1.0, i1 noundef zeroext %_1.1) #[no_mangle] pub fn pair_and_or((a, b): (bool, bool)) -> (bool, bool) { // Make sure it can operate directly on the unpacked args diff --git a/tests/codegen/slice-iter-nonnull.rs b/tests/codegen/slice-iter-nonnull.rs index 8749226d401..1e691cc34c9 100644 --- a/tests/codegen/slice-iter-nonnull.rs +++ b/tests/codegen/slice-iter-nonnull.rs @@ -15,7 +15,7 @@ // CHECK-LABEL: @slice_iter_next( #[no_mangle] pub fn slice_iter_next<'a>(it: &mut std::slice::Iter<'a, u32>) -> Option<&'a u32> { - // CHECK: %[[ENDP:.+]] = getelementptr{{.+}}ptr %it,{{.+}} 1 + // CHECK: %[[ENDP:.+]] = getelementptr inbounds i8, ptr %it, {{i32 4|i64 8}} // CHECK: %[[END:.+]] = load ptr, ptr %[[ENDP]] // CHECK-SAME: !nonnull // CHECK-SAME: !noundef @@ -32,7 +32,7 @@ pub fn slice_iter_next<'a>(it: &mut std::slice::Iter<'a, u32>) -> Option<&'a u32 // CHECK-LABEL: @slice_iter_next_back( #[no_mangle] pub fn slice_iter_next_back<'a>(it: &mut std::slice::Iter<'a, u32>) -> Option<&'a u32> { - // CHECK: %[[ENDP:.+]] = getelementptr{{.+}}ptr %it,{{.+}} 1 + // CHECK: %[[ENDP:.+]] = getelementptr inbounds i8, ptr %it, {{i32 4|i64 8}} // CHECK: %[[END:.+]] = load ptr, ptr %[[ENDP]] // CHECK-SAME: !nonnull // CHECK-SAME: !noundef @@ -84,7 +84,7 @@ pub fn slice_iter_mut_new(slice: &mut [u32]) -> std::slice::IterMut<'_, u32> { // CHECK-LABEL: @slice_iter_is_empty #[no_mangle] pub fn slice_iter_is_empty(it: &std::slice::Iter<'_, u32>) -> bool { - // CHECK: %[[ENDP:.+]] = getelementptr{{.+}}ptr %it,{{.+}} 1 + // CHECK: %[[ENDP:.+]] = getelementptr inbounds i8, ptr %it, {{i32 4|i64 8}} // CHECK: %[[END:.+]] = load ptr, ptr %[[ENDP]] // CHECK-SAME: !nonnull // CHECK-SAME: !noundef @@ -100,7 +100,7 @@ pub fn slice_iter_is_empty(it: &std::slice::Iter<'_, u32>) -> bool { // CHECK-LABEL: @slice_iter_len #[no_mangle] pub fn slice_iter_len(it: &std::slice::Iter<'_, u32>) -> usize { - // CHECK: %[[ENDP:.+]] = getelementptr{{.+}}ptr %it,{{.+}} 1 + // CHECK: %[[ENDP:.+]] = getelementptr inbounds i8, ptr %it, {{i32 4|i64 8}} // CHECK: %[[END:.+]] = load ptr, ptr %[[ENDP]] // CHECK-SAME: !nonnull // CHECK-SAME: !noundef diff --git a/tests/codegen/zst-offset.rs b/tests/codegen/zst-offset.rs index cef4b9bdaaf..56dfd96ab2c 100644 --- a/tests/codegen/zst-offset.rs +++ b/tests/codegen/zst-offset.rs @@ -22,7 +22,7 @@ pub fn scalar_layout(s: &(u64, ())) { // CHECK-LABEL: @scalarpair_layout #[no_mangle] pub fn scalarpair_layout(s: &(u64, u32, ())) { -// CHECK: getelementptr i8, {{.+}}, [[USIZE]] 12 +// CHECK: getelementptr inbounds i8, {{.+}}, [[USIZE]] 12 let x = &s.2; witness(&x); // keep variable in an alloca } diff --git a/tests/coverage/color.coverage b/tests/coverage/color.coverage new file mode 100644 index 00000000000..bc49fff9cb7 --- /dev/null +++ b/tests/coverage/color.coverage @@ -0,0 +1,13 @@ + LL| |// edition: 2021 + LL| |// ignore-mode-coverage-map + LL| |// ignore-windows + LL| |// llvm-cov-flags: --use-color + LL| | + LL| |// Verify that telling `llvm-cov` to use colored output actually works. + LL| |// Ignored on Windows because we can't tell the tool to use ANSI escapes. + LL| | + LL| 1|fn main() { + LL| [0;35m1[0m| for [0;41m_i[0m in 0..0 [0;41m{}[0m + ^0 ^0 + LL| 1|} + diff --git a/tests/coverage/color.rs b/tests/coverage/color.rs new file mode 100644 index 00000000000..bd727946c78 --- /dev/null +++ b/tests/coverage/color.rs @@ -0,0 +1,11 @@ +// edition: 2021 +// ignore-mode-coverage-map +// ignore-windows +// llvm-cov-flags: --use-color + +// Verify that telling `llvm-cov` to use colored output actually works. +// Ignored on Windows because we can't tell the tool to use ANSI escapes. + +fn main() { + for _i in 0..0 {} +} diff --git a/tests/coverage/ignore_map.coverage b/tests/coverage/ignore_map.coverage new file mode 100644 index 00000000000..04bcb5bec6e --- /dev/null +++ b/tests/coverage/ignore_map.coverage @@ -0,0 +1,4 @@ + LL| |// ignore-mode-coverage-map + LL| | + LL| 1|fn main() {} + diff --git a/tests/coverage/ignore_map.rs b/tests/coverage/ignore_map.rs new file mode 100644 index 00000000000..71b82e8fc9d --- /dev/null +++ b/tests/coverage/ignore_map.rs @@ -0,0 +1,3 @@ +// ignore-mode-coverage-map + +fn main() {} diff --git a/tests/coverage/ignore_run.cov-map b/tests/coverage/ignore_run.cov-map new file mode 100644 index 00000000000..9865efae0a1 --- /dev/null +++ b/tests/coverage/ignore_run.cov-map @@ -0,0 +1,8 @@ +Function name: ignore_run::main +Raw bytes (9): 0x[01, 01, 00, 01, 01, 03, 01, 00, 0d] +Number of files: 1 +- file 0 => global file 1 +Number of expressions: 0 +Number of file 0 mappings: 1 +- Code(Counter(0)) at (prev + 3, 1) to (start + 0, 13) + diff --git a/tests/coverage/ignore_run.rs b/tests/coverage/ignore_run.rs new file mode 100644 index 00000000000..87108867a05 --- /dev/null +++ b/tests/coverage/ignore_run.rs @@ -0,0 +1,3 @@ +// ignore-mode-coverage-run + +fn main() {} diff --git a/tests/coverage/macro_name_span.cov-map b/tests/coverage/macro_name_span.cov-map index b84628fc788..a18e5f14861 100644 --- a/tests/coverage/macro_name_span.cov-map +++ b/tests/coverage/macro_name_span.cov-map @@ -1,15 +1,15 @@ Function name: macro_name_span::affected_function -Raw bytes (9): 0x[01, 01, 00, 01, 01, 06, 1b, 00, 20] +Raw bytes (9): 0x[01, 01, 00, 01, 01, 16, 1c, 02, 06] Number of files: 1 - file 0 => global file 1 Number of expressions: 0 Number of file 0 mappings: 1 -- Code(Counter(0)) at (prev + 6, 27) to (start + 0, 32) +- Code(Counter(0)) at (prev + 22, 28) to (start + 2, 6) Function name: macro_name_span::main -Raw bytes (9): 0x[01, 02, 00, 01, 01, 0b, 01, 02, 02] +Raw bytes (9): 0x[01, 01, 00, 01, 01, 0b, 01, 02, 02] Number of files: 1 -- file 0 => global file 2 +- file 0 => global file 1 Number of expressions: 0 Number of file 0 mappings: 1 - Code(Counter(0)) at (prev + 11, 1) to (start + 2, 2) diff --git a/tests/coverage/macro_name_span.coverage b/tests/coverage/macro_name_span.coverage index cadf7024657..28c88b1defa 100644 --- a/tests/coverage/macro_name_span.coverage +++ b/tests/coverage/macro_name_span.coverage @@ -1,16 +1,3 @@ -$DIR/auxiliary/macro_name_span_helper.rs: - LL| |// edition: 2021 - LL| | - LL| |#[macro_export] - LL| |macro_rules! macro_that_defines_a_function { - LL| | (fn $name:ident () $body:tt) => { - LL| 1| fn $name () -> () $body - LL| | } - LL| |} - LL| | - LL| |// Non-executable comment. - -$DIR/macro_name_span.rs: LL| |// edition: 2021 LL| | LL| |// Regression test for <https://github.com/rust-lang/rust/issues/117788>. @@ -32,8 +19,8 @@ $DIR/macro_name_span.rs: LL| |} LL| | LL| |macro_name_span_helper::macro_that_defines_a_function! { - LL| | fn affected_function() { - LL| | macro_with_an_unreasonably_and_egregiously_long_name!(); - LL| | } + LL| 1| fn affected_function() { + LL| 1| macro_with_an_unreasonably_and_egregiously_long_name!(); + LL| 1| } LL| |} diff --git a/tests/mir-opt/building/custom/terminators.rs b/tests/mir-opt/building/custom/terminators.rs index a83a6c07461..01c132cf3e7 100644 --- a/tests/mir-opt/building/custom/terminators.rs +++ b/tests/mir-opt/building/custom/terminators.rs @@ -13,7 +13,7 @@ fn ident<T>(t: T) -> T { fn direct_call(x: i32) -> i32 { mir!( { - Call(RET = ident(x), retblock, UnwindContinue()) + Call(RET = ident(x), ReturnTo(retblock), UnwindContinue()) } retblock = { @@ -27,7 +27,7 @@ fn direct_call(x: i32) -> i32 { fn indirect_call(x: i32, f: fn(i32) -> i32) -> i32 { mir!( { - Call(RET = f(x), retblock, UnwindContinue()) + Call(RET = f(x), ReturnTo(retblock), UnwindContinue()) } retblock = { @@ -49,7 +49,7 @@ impl<'a> Drop for WriteOnDrop<'a> { fn drop_first<'a>(a: WriteOnDrop<'a>, b: WriteOnDrop<'a>) { mir!( { - Drop(a, retblock, UnwindContinue()) + Drop(a, ReturnTo(retblock), UnwindContinue()) } retblock = { @@ -64,7 +64,7 @@ fn drop_first<'a>(a: WriteOnDrop<'a>, b: WriteOnDrop<'a>) { fn drop_second<'a>(a: WriteOnDrop<'a>, b: WriteOnDrop<'a>) { mir!( { - Drop(b, retblock, UnwindContinue()) + Drop(b, ReturnTo(retblock), UnwindContinue()) } retblock = { diff --git a/tests/mir-opt/building/custom/unwind_action.rs b/tests/mir-opt/building/custom/unwind_action.rs index e3c4ffac358..0dfbf780f67 100644 --- a/tests/mir-opt/building/custom/unwind_action.rs +++ b/tests/mir-opt/building/custom/unwind_action.rs @@ -11,7 +11,7 @@ use core::intrinsics::mir::*; pub fn a() { mir!( { - Call(RET = a(), bb1, UnwindUnreachable()) + Call(RET = a(), ReturnTo(bb1), UnwindUnreachable()) } bb1 = { Return() @@ -26,7 +26,7 @@ pub fn a() { pub fn b() { mir!( { - Call(RET = b(), bb1, UnwindContinue()) + Call(RET = b(), ReturnTo(bb1), UnwindContinue()) } bb1 = { Return() @@ -41,7 +41,7 @@ pub fn b() { pub fn c() { mir!( { - Call(RET = c(), bb1, UnwindTerminate(ReasonAbi)) + Call(RET = c(), ReturnTo(bb1), UnwindTerminate(ReasonAbi)) } bb1 = { Return() @@ -56,7 +56,7 @@ pub fn c() { pub fn d() { mir!( { - Call(RET = d(), bb1, UnwindCleanup(bb2)) + Call(RET = d(), ReturnTo(bb1), UnwindCleanup(bb2)) } bb1 = { Return() diff --git a/tests/mir-opt/copy-prop/borrowed_local.rs b/tests/mir-opt/copy-prop/borrowed_local.rs index a44e65164af..af40f5bce8b 100644 --- a/tests/mir-opt/copy-prop/borrowed_local.rs +++ b/tests/mir-opt/copy-prop/borrowed_local.rs @@ -22,11 +22,11 @@ fn f() -> bool { let b = a; // We cannot propagate the place `a`. let r2 = &b; - Call(RET = cmp_ref(r1, r2), next, UnwindContinue()) + Call(RET = cmp_ref(r1, r2), ReturnTo(next), UnwindContinue()) } next = { // But we can propagate the value `a`. - Call(RET = opaque(b), ret, UnwindContinue()) + Call(RET = opaque(b), ReturnTo(ret), UnwindContinue()) } ret = { Return() diff --git a/tests/mir-opt/copy-prop/calls.rs b/tests/mir-opt/copy-prop/calls.rs index bc6760707cc..a6b5d511805 100644 --- a/tests/mir-opt/copy-prop/calls.rs +++ b/tests/mir-opt/copy-prop/calls.rs @@ -26,7 +26,7 @@ fn multiple_edges(t: bool) -> u8 { match t { true => bbt, _ => ret } } bbt = { - Call(x = dummy(13), ret, UnwindContinue()) + Call(x = dummy(13), ReturnTo(ret), UnwindContinue()) } ret = { // `x` is not assigned on the `bb0 -> ret` edge, diff --git a/tests/mir-opt/copy-prop/custom_move_arg.f.CopyProp.panic-unwind.diff b/tests/mir-opt/copy-prop/custom_move_arg.f.CopyProp.panic-unwind.diff index eb40183c1c9..7ba85301051 100644 --- a/tests/mir-opt/copy-prop/custom_move_arg.f.CopyProp.panic-unwind.diff +++ b/tests/mir-opt/copy-prop/custom_move_arg.f.CopyProp.panic-unwind.diff @@ -8,14 +8,14 @@ bb0: { - _2 = _1; -- _0 = opaque::<NotCopy>(move _1) -> [return: bb1, unwind continue]; -+ _0 = opaque::<NotCopy>(_1) -> [return: bb1, unwind continue]; +- _0 = opaque::<NotCopy>(move _1) -> [return: bb1, unwind unreachable]; ++ _0 = opaque::<NotCopy>(_1) -> [return: bb1, unwind unreachable]; } bb1: { - _3 = move _2; -- _0 = opaque::<NotCopy>(_3) -> [return: bb2, unwind continue]; -+ _0 = opaque::<NotCopy>(_1) -> [return: bb2, unwind continue]; +- _0 = opaque::<NotCopy>(_3) -> [return: bb2, unwind unreachable]; ++ _0 = opaque::<NotCopy>(_1) -> [return: bb2, unwind unreachable]; } bb2: { diff --git a/tests/mir-opt/copy-prop/custom_move_arg.rs b/tests/mir-opt/copy-prop/custom_move_arg.rs index 8593d9fa9ab..1ee294fcfd9 100644 --- a/tests/mir-opt/copy-prop/custom_move_arg.rs +++ b/tests/mir-opt/copy-prop/custom_move_arg.rs @@ -10,15 +10,15 @@ use core::intrinsics::mir::*; struct NotCopy(bool); // EMIT_MIR custom_move_arg.f.CopyProp.diff -#[custom_mir(dialect = "analysis", phase = "post-cleanup")] +#[custom_mir(dialect = "runtime")] fn f(_1: NotCopy) { mir!({ let _2 = _1; - Call(RET = opaque(Move(_1)), bb1, UnwindContinue()) + Call(RET = opaque(Move(_1)), ReturnTo(bb1), UnwindUnreachable()) } bb1 = { let _3 = Move(_2); - Call(RET = opaque(_3), bb2, UnwindContinue()) + Call(RET = opaque(_3), ReturnTo(bb2), UnwindUnreachable()) } bb2 = { Return() diff --git a/tests/mir-opt/copy-prop/move_projection.f.CopyProp.panic-unwind.diff b/tests/mir-opt/copy-prop/move_projection.f.CopyProp.panic-unwind.diff index ad3889639e0..b2b89968d70 100644 --- a/tests/mir-opt/copy-prop/move_projection.f.CopyProp.panic-unwind.diff +++ b/tests/mir-opt/copy-prop/move_projection.f.CopyProp.panic-unwind.diff @@ -9,13 +9,13 @@ bb0: { - _2 = _1; - _3 = move (_2.0: u8); -- _0 = opaque::<Foo>(move _1) -> [return: bb1, unwind continue]; +- _0 = opaque::<Foo>(move _1) -> [return: bb1, unwind unreachable]; + _3 = (_1.0: u8); -+ _0 = opaque::<Foo>(_1) -> [return: bb1, unwind continue]; ++ _0 = opaque::<Foo>(_1) -> [return: bb1, unwind unreachable]; } bb1: { - _0 = opaque::<u8>(move _3) -> [return: bb2, unwind continue]; + _0 = opaque::<u8>(move _3) -> [return: bb2, unwind unreachable]; } bb2: { diff --git a/tests/mir-opt/copy-prop/move_projection.rs b/tests/mir-opt/copy-prop/move_projection.rs index 438a90dddd0..f31e82c1f03 100644 --- a/tests/mir-opt/copy-prop/move_projection.rs +++ b/tests/mir-opt/copy-prop/move_projection.rs @@ -11,17 +11,17 @@ fn opaque(_: impl Sized) -> bool { true } struct Foo(u8); -#[custom_mir(dialect = "analysis", phase = "post-cleanup")] +#[custom_mir(dialect = "runtime")] fn f(a: Foo) -> bool { mir!( { let b = a; // This is a move out of a copy, so must become a copy of `a.0`. let c = Move(b.0); - Call(RET = opaque(Move(a)), bb1, UnwindContinue()) + Call(RET = opaque(Move(a)), ReturnTo(bb1), UnwindUnreachable()) } bb1 = { - Call(RET = opaque(Move(c)), ret, UnwindContinue()) + Call(RET = opaque(Move(c)), ReturnTo(ret), UnwindUnreachable()) } ret = { Return() diff --git a/tests/mir-opt/dead-store-elimination/call_arg_copy.rs b/tests/mir-opt/dead-store-elimination/call_arg_copy.rs index b2eb64756f9..490a4aa502c 100644 --- a/tests/mir-opt/dead-store-elimination/call_arg_copy.rs +++ b/tests/mir-opt/dead-store-elimination/call_arg_copy.rs @@ -28,7 +28,7 @@ struct Packed { fn move_packed(packed: Packed) { mir!( { - Call(RET = use_both(0, packed.y), ret, UnwindContinue()) + Call(RET = use_both(0, packed.y), ReturnTo(ret), UnwindContinue()) } ret = { Return() diff --git a/tests/mir-opt/dead-store-elimination/cycle.rs b/tests/mir-opt/dead-store-elimination/cycle.rs index c9ad06a9da2..13e5411275d 100644 --- a/tests/mir-opt/dead-store-elimination/cycle.rs +++ b/tests/mir-opt/dead-store-elimination/cycle.rs @@ -20,7 +20,7 @@ fn cycle(mut x: i32, mut y: i32, mut z: i32) { mir!( let condition: bool; { - Call(condition = cond(), bb1, UnwindContinue()) + Call(condition = cond(), ReturnTo(bb1), UnwindContinue()) } bb1 = { match condition { true => bb2, _ => ret } @@ -30,7 +30,7 @@ fn cycle(mut x: i32, mut y: i32, mut z: i32) { z = y; y = x; x = temp; - Call(condition = cond(), bb1, UnwindContinue()) + Call(condition = cond(), ReturnTo(bb1), UnwindContinue()) } ret = { Return() diff --git a/tests/mir-opt/dest-prop/unreachable.f.DestinationPropagation.panic-abort.diff b/tests/mir-opt/dest-prop/unreachable.f.DestinationPropagation.panic-abort.diff deleted file mode 100644 index 80b5681ad06..00000000000 --- a/tests/mir-opt/dest-prop/unreachable.f.DestinationPropagation.panic-abort.diff +++ /dev/null @@ -1,82 +0,0 @@ -- // MIR for `f` before DestinationPropagation -+ // MIR for `f` after DestinationPropagation - - fn f(_1: T) -> () { - debug a => _1; - let mut _0: (); - let _2: T; - let mut _3: bool; - let _4: (); - let mut _5: T; - let mut _6: T; - let _7: (); - let mut _8: T; - let mut _9: T; - scope 1 { -- debug b => _2; -+ debug b => _1; - } - - bb0: { -- StorageLive(_2); -- _2 = _1; -+ nop; -+ nop; - StorageLive(_3); - _3 = const false; -- goto -> bb3; -+ goto -> bb1; - } - - bb1: { -- StorageLive(_4); -- StorageLive(_5); -- _5 = _1; -- StorageLive(_6); -- _6 = _1; -- _4 = g::<T>(_1, _1) -> [return: bb2, unwind unreachable]; -- } -- -- bb2: { -- StorageDead(_6); -- StorageDead(_5); -- StorageDead(_4); -- _0 = const (); -- goto -> bb5; -- } -- -- bb3: { - StorageLive(_7); -- StorageLive(_8); -- _8 = _1; -- StorageLive(_9); -- _9 = _1; -- _7 = g::<T>(_1, _1) -> [return: bb4, unwind unreachable]; -+ nop; -+ nop; -+ nop; -+ nop; -+ _7 = g::<T>(_1, _1) -> [return: bb2, unwind unreachable]; - } - -- bb4: { -- StorageDead(_9); -- StorageDead(_8); -+ bb2: { -+ nop; -+ nop; - StorageDead(_7); - _0 = const (); -- goto -> bb5; -+ goto -> bb3; - } - -- bb5: { -+ bb3: { - StorageDead(_3); -- StorageDead(_2); -+ nop; - return; - } - } - diff --git a/tests/mir-opt/dest-prop/unreachable.f.DestinationPropagation.panic-unwind.diff b/tests/mir-opt/dest-prop/unreachable.f.DestinationPropagation.panic-unwind.diff deleted file mode 100644 index eae7dd17b48..00000000000 --- a/tests/mir-opt/dest-prop/unreachable.f.DestinationPropagation.panic-unwind.diff +++ /dev/null @@ -1,82 +0,0 @@ -- // MIR for `f` before DestinationPropagation -+ // MIR for `f` after DestinationPropagation - - fn f(_1: T) -> () { - debug a => _1; - let mut _0: (); - let _2: T; - let mut _3: bool; - let _4: (); - let mut _5: T; - let mut _6: T; - let _7: (); - let mut _8: T; - let mut _9: T; - scope 1 { -- debug b => _2; -+ debug b => _1; - } - - bb0: { -- StorageLive(_2); -- _2 = _1; -+ nop; -+ nop; - StorageLive(_3); - _3 = const false; -- goto -> bb3; -+ goto -> bb1; - } - - bb1: { -- StorageLive(_4); -- StorageLive(_5); -- _5 = _1; -- StorageLive(_6); -- _6 = _1; -- _4 = g::<T>(_1, _1) -> [return: bb2, unwind continue]; -- } -- -- bb2: { -- StorageDead(_6); -- StorageDead(_5); -- StorageDead(_4); -- _0 = const (); -- goto -> bb5; -- } -- -- bb3: { - StorageLive(_7); -- StorageLive(_8); -- _8 = _1; -- StorageLive(_9); -- _9 = _1; -- _7 = g::<T>(_1, _1) -> [return: bb4, unwind continue]; -+ nop; -+ nop; -+ nop; -+ nop; -+ _7 = g::<T>(_1, _1) -> [return: bb2, unwind continue]; - } - -- bb4: { -- StorageDead(_9); -- StorageDead(_8); -+ bb2: { -+ nop; -+ nop; - StorageDead(_7); - _0 = const (); -- goto -> bb5; -+ goto -> bb3; - } - -- bb5: { -+ bb3: { - StorageDead(_3); -- StorageDead(_2); -+ nop; - return; - } - } - diff --git a/tests/mir-opt/dest-prop/unreachable.rs b/tests/mir-opt/dest-prop/unreachable.rs deleted file mode 100644 index 0bde157ff61..00000000000 --- a/tests/mir-opt/dest-prop/unreachable.rs +++ /dev/null @@ -1,20 +0,0 @@ -// skip-filecheck -// EMIT_MIR_FOR_EACH_PANIC_STRATEGY -// Check that unreachable code is removed after the destination propagation. -// Regression test for issue #105428. -// -// compile-flags: --crate-type=lib -Zmir-opt-level=0 -// compile-flags: -Zmir-enable-passes=+GVN,+SimplifyConstCondition-after-const-prop,+DestinationPropagation - -// EMIT_MIR unreachable.f.DestinationPropagation.diff -pub fn f<T: Copy>(a: T) { - let b = a; - if false { - g(a, b); - } else { - g(b, b); - } -} - -#[inline(never)] -pub fn g<T: Copy>(_: T, _: T) {} diff --git a/tests/mir-opt/gvn.rs b/tests/mir-opt/gvn.rs index db131f7f97d..23e33a0fa49 100644 --- a/tests/mir-opt/gvn.rs +++ b/tests/mir-opt/gvn.rs @@ -529,31 +529,31 @@ fn duplicate_slice() -> (bool, bool) { // CHECK: [[a:_.*]] = (const "a",); // CHECK: [[au:_.*]] = ([[a]].0: &str) as u128 (Transmute); let a = ("a",); - Call(au = transmute::<_, u128>(a.0), bb1, UnwindContinue()) + Call(au = transmute::<_, u128>(a.0), ReturnTo(bb1), UnwindContinue()) } bb1 = { // CHECK: [[c:_.*]] = identity::<&str>(([[a]].0: &str)) - Call(c = identity(a.0), bb2, UnwindContinue()) + Call(c = identity(a.0), ReturnTo(bb2), UnwindContinue()) } bb2 = { // CHECK: [[cu:_.*]] = [[c]] as u128 (Transmute); - Call(cu = transmute::<_, u128>(c), bb3, UnwindContinue()) + Call(cu = transmute::<_, u128>(c), ReturnTo(bb3), UnwindContinue()) } bb3 = { // This slice is different from `a.0`. Hence `bu` is not `au`. // CHECK: [[b:_.*]] = const "a"; // CHECK: [[bu:_.*]] = [[b]] as u128 (Transmute); let b = "a"; - Call(bu = transmute::<_, u128>(b), bb4, UnwindContinue()) + Call(bu = transmute::<_, u128>(b), ReturnTo(bb4), UnwindContinue()) } bb4 = { // This returns a copy of `b`, which is not `a`. // CHECK: [[d:_.*]] = identity::<&str>([[b]]) - Call(d = identity(b), bb5, UnwindContinue()) + Call(d = identity(b), ReturnTo(bb5), UnwindContinue()) } bb5 = { // CHECK: [[du:_.*]] = [[d]] as u128 (Transmute); - Call(du = transmute::<_, u128>(d), bb6, UnwindContinue()) + Call(du = transmute::<_, u128>(d), ReturnTo(bb6), UnwindContinue()) } bb6 = { // `direct` must not fold to `true`, as `indirect` will not. diff --git a/tests/mir-opt/inline/indirect_destination.rs b/tests/mir-opt/inline/indirect_destination.rs index 2842e23366e..82143d85c25 100644 --- a/tests/mir-opt/inline/indirect_destination.rs +++ b/tests/mir-opt/inline/indirect_destination.rs @@ -25,7 +25,7 @@ pub fn f(a: *mut u8) { Goto(bb1) } bb1 = { - Call(*a = g(), bb1, UnwindUnreachable()) + Call(*a = g(), ReturnTo(bb1), UnwindUnreachable()) } } } diff --git a/tests/mir-opt/reference_prop.rs b/tests/mir-opt/reference_prop.rs index 8adfbb4535b..b71ad90abb1 100644 --- a/tests/mir-opt/reference_prop.rs +++ b/tests/mir-opt/reference_prop.rs @@ -696,7 +696,7 @@ fn multiple_storage() { // As there are multiple `StorageLive` statements for `x`, we cannot know if this `z`'s // pointer address is the address of `x`, so do nothing. let y = *z; - Call(RET = opaque(y), retblock, UnwindContinue()) + Call(RET = opaque(y), ReturnTo(retblock), UnwindContinue()) } retblock = { @@ -724,7 +724,7 @@ fn dominate_storage() { } bb1 = { let c = *r; - Call(RET = opaque(c), bb2, UnwindContinue()) + Call(RET = opaque(c), ReturnTo(bb2), UnwindContinue()) } bb2 = { StorageDead(x); @@ -760,18 +760,18 @@ fn maybe_dead(m: bool) { bb1 = { StorageDead(x); StorageDead(y); - Call(RET = opaque(u), bb2, UnwindContinue()) + Call(RET = opaque(u), ReturnTo(bb2), UnwindContinue()) } bb2 = { // As `x` may be `StorageDead`, `a` may be dangling, so we do nothing. let z = *a; - Call(RET = opaque(z), bb3, UnwindContinue()) + Call(RET = opaque(z), ReturnTo(bb3), UnwindContinue()) } bb3 = { // As `y` may be `StorageDead`, `b` may be dangling, so we do nothing. // This implies that we also do not substitute `b` in `bb0`. let t = *b; - Call(RET = opaque(t), retblock, UnwindContinue()) + Call(RET = opaque(t), ReturnTo(retblock), UnwindContinue()) } retblock = { Return() diff --git a/tests/mir-opt/spanview_block.main.built.after.html b/tests/mir-opt/spanview_block.main.built.after.html deleted file mode 100644 index 54ef00f56f3..00000000000 --- a/tests/mir-opt/spanview_block.main.built.after.html +++ /dev/null @@ -1,67 +0,0 @@ -<!DOCTYPE html> -<html lang="en"> -<head> -<meta charset="utf-8"> -<title>spanview_block.main.built.after</title> -<style> - .line { - counter-increment: line; - } - .line:before { - content: counter(line) ": "; - font-family: Menlo, Monaco, monospace; - font-style: italic; - width: 3.8em; - display: inline-block; - text-align: right; - filter: opacity(50%); - -webkit-user-select: none; - } - .code { - color: #dddddd; - background-color: #222222; - font-family: Menlo, Monaco, monospace; - line-height: 1.4em; - border-bottom: 2px solid #222222; - white-space: pre; - display: inline-block; - } - .odd { - background-color: #55bbff; - color: #223311; - } - .even { - background-color: #ee7756; - color: #551133; - } - .code { - --index: calc(var(--layer) - 1); - padding-top: calc(var(--index) * 0.15em); - filter: - hue-rotate(calc(var(--index) * 25deg)) - saturate(calc(100% - (var(--index) * 2%))) - brightness(calc(100% - (var(--index) * 1.5%))); - } - .annotation { - color: #4444ff; - font-family: monospace; - font-style: italic; - display: none; - -webkit-user-select: none; - } - body:active .annotation { - /* requires holding mouse down anywhere on the page */ - display: inline-block; - } - span:hover .annotation { - /* requires hover over a span ONLY on its first line */ - display: inline-block; - } -</style> -</head> -<body> -<div class="code" style="counter-reset: line 5"><span class="line"><span class="code" style="--layer: 0">fn main() </span><span><span class="code even" style="--layer: 1" title="0: $DIR/spanview_block.rs:6:11: 6:13: - 6:11-6:13: Assign: _0 = const () - 6:13-6:13: Return: return"><span class="annotation">0⦊</span>{}<span class="annotation">⦉0</span></span></span></span></div> -</body> -</html> diff --git a/tests/mir-opt/spanview_block.rs b/tests/mir-opt/spanview_block.rs deleted file mode 100644 index e8bc3d16348..00000000000 --- a/tests/mir-opt/spanview_block.rs +++ /dev/null @@ -1,6 +0,0 @@ -// skip-filecheck -// Test spanview block output -// compile-flags: -Z dump-mir-spanview=block - -// EMIT_MIR spanview_block.main.built.after.html -fn main() {} diff --git a/tests/mir-opt/spanview_statement.main.built.after.html b/tests/mir-opt/spanview_statement.main.built.after.html deleted file mode 100644 index 5e782b05f3b..00000000000 --- a/tests/mir-opt/spanview_statement.main.built.after.html +++ /dev/null @@ -1,67 +0,0 @@ -<!DOCTYPE html> -<html lang="en"> -<head> -<meta charset="utf-8"> -<title>spanview_statement.main.built.after</title> -<style> - .line { - counter-increment: line; - } - .line:before { - content: counter(line) ": "; - font-family: Menlo, Monaco, monospace; - font-style: italic; - width: 3.8em; - display: inline-block; - text-align: right; - filter: opacity(50%); - -webkit-user-select: none; - } - .code { - color: #dddddd; - background-color: #222222; - font-family: Menlo, Monaco, monospace; - line-height: 1.4em; - border-bottom: 2px solid #222222; - white-space: pre; - display: inline-block; - } - .odd { - background-color: #55bbff; - color: #223311; - } - .even { - background-color: #ee7756; - color: #551133; - } - .code { - --index: calc(var(--layer) - 1); - padding-top: calc(var(--index) * 0.15em); - filter: - hue-rotate(calc(var(--index) * 25deg)) - saturate(calc(100% - (var(--index) * 2%))) - brightness(calc(100% - (var(--index) * 1.5%))); - } - .annotation { - color: #4444ff; - font-family: monospace; - font-style: italic; - display: none; - -webkit-user-select: none; - } - body:active .annotation { - /* requires holding mouse down anywhere on the page */ - display: inline-block; - } - span:hover .annotation { - /* requires hover over a span ONLY on its first line */ - display: inline-block; - } -</style> -</head> -<body> -<div class="code" style="counter-reset: line 5"><span class="line"><span class="code" style="--layer: 0">fn main() </span><span><span class="code even" style="--layer: 1" title="0[0]: $DIR/spanview_statement.rs:6:11: 6:13: - 6:11-6:13: Assign: _0 = const ()"><span class="annotation">0[0]⦊</span>{}<span class="annotation">⦉0[0]</span></span></span><span><span class="code odd" style="--layer: 1" title="0:Return: $DIR/spanview_statement.rs:6:13: 6:13: - 6:13-6:13: Return: return"><span class="annotation">0:Return⦊</span>‸<span class="annotation">⦉0:Return</span></span></span></span></div> -</body> -</html> diff --git a/tests/mir-opt/spanview_statement.rs b/tests/mir-opt/spanview_statement.rs deleted file mode 100644 index d547e6cb1e0..00000000000 --- a/tests/mir-opt/spanview_statement.rs +++ /dev/null @@ -1,6 +0,0 @@ -// skip-filecheck -// Test spanview output (the default value for `-Z dump-mir-spanview` is "statement") -// compile-flags: -Z dump-mir-spanview - -// EMIT_MIR spanview_statement.main.built.after.html -fn main() {} diff --git a/tests/mir-opt/spanview_terminator.main.built.after.html b/tests/mir-opt/spanview_terminator.main.built.after.html deleted file mode 100644 index 2a651489e23..00000000000 --- a/tests/mir-opt/spanview_terminator.main.built.after.html +++ /dev/null @@ -1,66 +0,0 @@ -<!DOCTYPE html> -<html lang="en"> -<head> -<meta charset="utf-8"> -<title>spanview_terminator.main.built.after</title> -<style> - .line { - counter-increment: line; - } - .line:before { - content: counter(line) ": "; - font-family: Menlo, Monaco, monospace; - font-style: italic; - width: 3.8em; - display: inline-block; - text-align: right; - filter: opacity(50%); - -webkit-user-select: none; - } - .code { - color: #dddddd; - background-color: #222222; - font-family: Menlo, Monaco, monospace; - line-height: 1.4em; - border-bottom: 2px solid #222222; - white-space: pre; - display: inline-block; - } - .odd { - background-color: #55bbff; - color: #223311; - } - .even { - background-color: #ee7756; - color: #551133; - } - .code { - --index: calc(var(--layer) - 1); - padding-top: calc(var(--index) * 0.15em); - filter: - hue-rotate(calc(var(--index) * 25deg)) - saturate(calc(100% - (var(--index) * 2%))) - brightness(calc(100% - (var(--index) * 1.5%))); - } - .annotation { - color: #4444ff; - font-family: monospace; - font-style: italic; - display: none; - -webkit-user-select: none; - } - body:active .annotation { - /* requires holding mouse down anywhere on the page */ - display: inline-block; - } - span:hover .annotation { - /* requires hover over a span ONLY on its first line */ - display: inline-block; - } -</style> -</head> -<body> -<div class="code" style="counter-reset: line 5"><span class="line"><span class="code" style="--layer: 0">fn main() {}</span><span><span class="code even" style="--layer: 1" title="0:Return: $DIR/spanview_terminator.rs:6:13: 6:13: - 6:13-6:13: Return: return"><span class="annotation">0:Return⦊</span>‸<span class="annotation">⦉0:Return</span></span></span></span></div> -</body> -</html> diff --git a/tests/mir-opt/spanview_terminator.rs b/tests/mir-opt/spanview_terminator.rs deleted file mode 100644 index a2c68b98ef5..00000000000 --- a/tests/mir-opt/spanview_terminator.rs +++ /dev/null @@ -1,6 +0,0 @@ -// skip-filecheck -// Test spanview terminator output -// compile-flags: -Z dump-mir-spanview=terminator - -// EMIT_MIR spanview_terminator.main.built.after.html -fn main() {} diff --git a/tests/run-make-fulldeps/hotplug_codegen_backend/Makefile b/tests/run-make-fulldeps/hotplug_codegen_backend/Makefile index 6752091e699..3a5a66b6755 100644 --- a/tests/run-make-fulldeps/hotplug_codegen_backend/Makefile +++ b/tests/run-make-fulldeps/hotplug_codegen_backend/Makefile @@ -7,7 +7,6 @@ include ../../run-make/tools.mk # -Zbinary-dep-depinfo is used. all: - /bin/echo || exit 0 # This test requires /bin/echo to exist $(RUSTC) the_backend.rs --crate-name the_backend --crate-type dylib \ -o $(TMPDIR)/the_backend.dylib diff --git a/tests/run-make/sanitizer-cdylib-link/Makefile b/tests/run-make/sanitizer-cdylib-link/Makefile index 691585268bf..10d94afc39e 100644 --- a/tests/run-make/sanitizer-cdylib-link/Makefile +++ b/tests/run-make/sanitizer-cdylib-link/Makefile @@ -12,5 +12,5 @@ LOG := $(TMPDIR)/log.txt all: $(RUSTC) -g -Z sanitizer=address --crate-type cdylib --target $(TARGET) library.rs - $(RUSTC) -g -Z sanitizer=address --crate-type bin --target $(TARGET) -llibrary program.rs + $(RUSTC) -g -Z sanitizer=address --crate-type bin --target $(TARGET) program.rs LD_LIBRARY_PATH=$(TMPDIR) $(TMPDIR)/program 2>&1 | $(CGREP) stack-buffer-overflow diff --git a/tests/run-make/sanitizer-cdylib-link/program.rs b/tests/run-make/sanitizer-cdylib-link/program.rs index ef053aa2e7a..1026c7f89ba 100644 --- a/tests/run-make/sanitizer-cdylib-link/program.rs +++ b/tests/run-make/sanitizer-cdylib-link/program.rs @@ -1,3 +1,5 @@ +#[cfg_attr(windows, link(name = "library.dll.lib", modifiers = "+verbatim"))] +#[cfg_attr(not(windows), link(name = "library"))] extern "C" { fn overflow(); } diff --git a/tests/run-make/sanitizer-dylib-link/Makefile b/tests/run-make/sanitizer-dylib-link/Makefile index b0a91e5b197..c5a698db3a0 100644 --- a/tests/run-make/sanitizer-dylib-link/Makefile +++ b/tests/run-make/sanitizer-dylib-link/Makefile @@ -12,5 +12,5 @@ LOG := $(TMPDIR)/log.txt all: $(RUSTC) -g -Z sanitizer=address --crate-type dylib --target $(TARGET) library.rs - $(RUSTC) -g -Z sanitizer=address --crate-type bin --target $(TARGET) -llibrary program.rs + $(RUSTC) -g -Z sanitizer=address --crate-type bin --target $(TARGET) program.rs LD_LIBRARY_PATH=$(TMPDIR) $(TMPDIR)/program 2>&1 | $(CGREP) stack-buffer-overflow diff --git a/tests/run-make/sanitizer-dylib-link/program.rs b/tests/run-make/sanitizer-dylib-link/program.rs index ef053aa2e7a..1026c7f89ba 100644 --- a/tests/run-make/sanitizer-dylib-link/program.rs +++ b/tests/run-make/sanitizer-dylib-link/program.rs @@ -1,3 +1,5 @@ +#[cfg_attr(windows, link(name = "library.dll.lib", modifiers = "+verbatim"))] +#[cfg_attr(not(windows), link(name = "library"))] extern "C" { fn overflow(); } diff --git a/tests/run-make/sanitizer-staticlib-link/program.rs b/tests/run-make/sanitizer-staticlib-link/program.rs index ec59bdb11c8..5fac0e73966 100644 --- a/tests/run-make/sanitizer-staticlib-link/program.rs +++ b/tests/run-make/sanitizer-staticlib-link/program.rs @@ -1,4 +1,4 @@ -#[link(name = "library")] +#[link(name = "library", kind = "static")] extern "C" { fn overflow(); } diff --git a/tests/rustdoc-ui/issues/issue-105742.stderr b/tests/rustdoc-ui/issues/issue-105742.stderr index ad1020a1f08..d5a9031075f 100644 --- a/tests/rustdoc-ui/issues/issue-105742.stderr +++ b/tests/rustdoc-ui/issues/issue-105742.stderr @@ -323,6 +323,10 @@ LL | || Output = <Self as SVec>::Item> as SVec>::Item, LL | | LL | | > { | |__^ ...because it uses `Self` as a type parameter +help: consider using an opaque type instead + | +LL | pub fn next<'a, T>(s: &'a mut impl SVec<Item = T, Output = T>) { + | ~~~~ error[E0107]: missing generics for associated type `SVec::Item` --> $DIR/issue-105742.rs:15:21 diff --git a/tests/rustdoc-ui/issues/issue-81662-shortness.rs b/tests/rustdoc-ui/issues/issue-81662-shortness.rs index 0240d217bee..79fb65dec48 100644 --- a/tests/rustdoc-ui/issues/issue-81662-shortness.rs +++ b/tests/rustdoc-ui/issues/issue-81662-shortness.rs @@ -1,4 +1,6 @@ // compile-flags:--test --error-format=short +// check-stdout +// error-pattern:cannot find function `foo` in this scope // normalize-stdout-test: "tests/rustdoc-ui/issues" -> "$$DIR" // normalize-stdout-test "finished in \d+\.\d+s" -> "finished in $$TIME" // failure-status: 101 @@ -6,7 +8,6 @@ /// ```rust /// foo(); /// ``` -//~^^ ERROR cannot find function `foo` in this scope fn foo() { println!("Hello, world!"); } diff --git a/tests/rustdoc-ui/issues/issue-81662-shortness.stdout b/tests/rustdoc-ui/issues/issue-81662-shortness.stdout index 6313dde32c5..f32f51e12f2 100644 --- a/tests/rustdoc-ui/issues/issue-81662-shortness.stdout +++ b/tests/rustdoc-ui/issues/issue-81662-shortness.stdout @@ -1,16 +1,16 @@ running 1 test -test $DIR/issue-81662-shortness.rs - foo (line 6) ... FAILED +test $DIR/issue-81662-shortness.rs - foo (line 8) ... FAILED failures: ----- $DIR/issue-81662-shortness.rs - foo (line 6) stdout ---- -$DIR/issue-81662-shortness.rs:7:1: error[E0425]: cannot find function `foo` in this scope +---- $DIR/issue-81662-shortness.rs - foo (line 8) stdout ---- +$DIR/issue-81662-shortness.rs:9:1: error[E0425]: cannot find function `foo` in this scope error: aborting due to 1 previous error Couldn't compile the test. failures: - $DIR/issue-81662-shortness.rs - foo (line 6) + $DIR/issue-81662-shortness.rs - foo (line 8) test result: FAILED. 0 passed; 1 failed; 0 ignored; 0 measured; 0 filtered out; finished in $TIME diff --git a/tests/rustdoc/check-source-code-urls-to-def.rs b/tests/rustdoc/check-source-code-urls-to-def.rs index b803c7e9e86..c31c579030e 100644 --- a/tests/rustdoc/check-source-code-urls-to-def.rs +++ b/tests/rustdoc/check-source-code-urls-to-def.rs @@ -62,7 +62,7 @@ pub trait AnotherTrait2 {} // @has - '//pre[@class="rust"]//a[@href="#61"]' 'AnotherTrait2' pub fn foo4() { - let x: Vec<AnotherTrait2> = Vec::new(); + let x: Vec<&dyn AnotherTrait2> = Vec::new(); } // @has - '//pre[@class="rust"]//a[@href="../../foo/primitive.bool.html"]' 'bool' diff --git a/tests/rustdoc/jump-to-def-doc-links-calls.rs b/tests/rustdoc/jump-to-def-doc-links-calls.rs new file mode 100644 index 00000000000..549d068528e --- /dev/null +++ b/tests/rustdoc/jump-to-def-doc-links-calls.rs @@ -0,0 +1,27 @@ +// compile-flags: -Zunstable-options --generate-link-to-definition + +#![crate_name = "foo"] + +// @has 'src/foo/jump-to-def-doc-links-calls.rs.html' + +// @has - '//a[@href="../../foo/struct.Bar.html"]' 'Bar' +pub struct Bar; + +impl std::default::Default for Bar { + // @has - '//a[@href="#20-22"]' 'Self::new' + fn default() -> Self { + Self::new() + } +} + +// @has - '//a[@href="#8"]' 'Bar' +impl Bar { + // @has - '//a[@href="#24-26"]' 'Self::bar' + pub fn new()-> Self { + Self::bar() + } + + pub fn bar() -> Self { + Self + } +} diff --git a/tests/ui-fulldeps/session-diagnostic/diagnostic-derive-doc-comment-field.stderr b/tests/ui-fulldeps/session-diagnostic/diagnostic-derive-doc-comment-field.stderr index bdcf54bd190..f07b69326b0 100644 --- a/tests/ui-fulldeps/session-diagnostic/diagnostic-derive-doc-comment-field.stderr +++ b/tests/ui-fulldeps/session-diagnostic/diagnostic-derive-doc-comment-field.stderr @@ -8,7 +8,7 @@ LL | arg: NotIntoDiagnosticArg, | ^^^^^^^^^^^^^^^^^^^^ the trait `IntoDiagnosticArg` is not implemented for `NotIntoDiagnosticArg` | = help: normalized in stderr -note: required by a bound in `DiagnosticBuilder::<'a, G>::set_arg` +note: required by a bound in `DiagnosticBuilder::<'a, G>::arg` --> $COMPILER_DIR/rustc_errors/src/diagnostic_builder.rs:LL:CC = note: this error originates in the macro `forward` (in Nightly builds, run with -Z macro-backtrace for more info) @@ -22,7 +22,7 @@ LL | arg: NotIntoDiagnosticArg, | ^^^^^^^^^^^^^^^^^^^^ the trait `IntoDiagnosticArg` is not implemented for `NotIntoDiagnosticArg` | = help: normalized in stderr -note: required by a bound in `Diagnostic::set_arg` +note: required by a bound in `Diagnostic::arg` --> $COMPILER_DIR/rustc_errors/src/diagnostic.rs:LL:CC error: aborting due to 2 previous errors diff --git a/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.rs b/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.rs index 63fb78ee919..f553aa96505 100644 --- a/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.rs +++ b/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.rs @@ -741,7 +741,7 @@ struct SubdiagnosticEagerCorrect { } // Check that formatting of `correct` in suggestion doesn't move the binding for that field, making -// the `set_arg` call a compile error; and that isn't worked around by moving the `set_arg` call +// the `arg` call a compile error; and that isn't worked around by moving the `arg` call // after the `span_suggestion` call - which breaks eager translation. #[derive(Subdiagnostic)] diff --git a/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.stderr b/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.stderr index d8ba65d297e..f376c034587 100644 --- a/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.stderr +++ b/tests/ui-fulldeps/session-diagnostic/diagnostic-derive.stderr @@ -654,7 +654,7 @@ LL | other: Hello, | ^^^^^ the trait `IntoDiagnosticArg` is not implemented for `Hello` | = help: normalized in stderr -note: required by a bound in `DiagnosticBuilder::<'a, G>::set_arg` +note: required by a bound in `DiagnosticBuilder::<'a, G>::arg` --> $COMPILER_DIR/rustc_errors/src/diagnostic_builder.rs:LL:CC = note: this error originates in the macro `forward` (in Nightly builds, run with -Z macro-backtrace for more info) diff --git a/tests/ui/allocator/no_std-alloc-error-handler-custom.rs b/tests/ui/allocator/no_std-alloc-error-handler-custom.rs index 28926243390..2323cf46d6f 100644 --- a/tests/ui/allocator/no_std-alloc-error-handler-custom.rs +++ b/tests/ui/allocator/no_std-alloc-error-handler-custom.rs @@ -74,7 +74,7 @@ fn panic(panic_info: &core::panic::PanicInfo) -> ! { extern "C" fn rust_eh_personality() {} #[derive(Default, Debug)] -struct Page(#[allow(unused_tuple_struct_fields)] [[u64; 32]; 16]); +struct Page(#[allow(dead_code)] [[u64; 32]; 16]); #[no_mangle] fn main(_argc: i32, _argv: *const *const u8) -> isize { diff --git a/tests/ui/allocator/no_std-alloc-error-handler-default.rs b/tests/ui/allocator/no_std-alloc-error-handler-default.rs index 56409e71339..488434a9a72 100644 --- a/tests/ui/allocator/no_std-alloc-error-handler-default.rs +++ b/tests/ui/allocator/no_std-alloc-error-handler-default.rs @@ -61,7 +61,7 @@ fn panic(panic_info: &core::panic::PanicInfo) -> ! { extern "C" fn rust_eh_personality() {} #[derive(Default, Debug)] -struct Page(#[allow(unused_tuple_struct_fields)] [[u64; 32]; 16]); +struct Page(#[allow(dead_code)] [[u64; 32]; 16]); #[no_mangle] fn main(_argc: i32, _argv: *const *const u8) -> isize { diff --git a/tests/ui/annotate-snippet/missing-type.rs b/tests/ui/annotate-snippet/missing-type.rs index b0d8b5fbaf2..f5facc16b31 100644 --- a/tests/ui/annotate-snippet/missing-type.rs +++ b/tests/ui/annotate-snippet/missing-type.rs @@ -1,5 +1,6 @@ // compile-flags: --error-format human-annotate-rs -Z unstable-options +// error-pattern:cannot find type `Iter` in this scope pub fn main() { - let x: Iter; //~ ERROR cannot find type `Iter` in this scope + let x: Iter; } diff --git a/tests/ui/annotate-snippet/missing-type.stderr b/tests/ui/annotate-snippet/missing-type.stderr index c16f022a77f..89ce19c182f 100644 --- a/tests/ui/annotate-snippet/missing-type.stderr +++ b/tests/ui/annotate-snippet/missing-type.stderr @@ -1,5 +1,5 @@ error[E0412]: cannot find type `Iter` in this scope - --> $DIR/missing-type.rs:4:12 + --> $DIR/missing-type.rs:5:12 | LL | let x: Iter; | ^^^^ not found in this scope diff --git a/tests/ui/annotate-snippet/multispan.rs b/tests/ui/annotate-snippet/multispan.rs index 69d7e1a9d11..d7241b80364 100644 --- a/tests/ui/annotate-snippet/multispan.rs +++ b/tests/ui/annotate-snippet/multispan.rs @@ -1,4 +1,5 @@ // aux-build:multispan.rs +// error-pattern:hello to you, too! // compile-flags: --error-format human-annotate-rs -Z unstable-options #![feature(proc_macro_hygiene)] @@ -12,17 +13,17 @@ fn main() { hello!(); // Exactly one 'hi'. - hello!(hi); //~ ERROR hello to you, too! + hello!(hi); // Now two, back to back. - hello!(hi hi); //~ ERROR hello to you, too! + hello!(hi hi); // Now three, back to back. - hello!(hi hi hi); //~ ERROR hello to you, too! + hello!(hi hi hi); // Now several, with spacing. - hello!(hi hey hi yo hi beep beep hi hi); //~ ERROR hello to you, too! - hello!(hi there, hi how are you? hi... hi.); //~ ERROR hello to you, too! - hello!(whoah. hi di hi di ho); //~ ERROR hello to you, too! - hello!(hi good hi and good bye); //~ ERROR hello to you, too! + hello!(hi hey hi yo hi beep beep hi hi); + hello!(hi there, hi how are you? hi... hi.); + hello!(whoah. hi di hi di ho); + hello!(hi good hi and good bye); } diff --git a/tests/ui/annotate-snippet/multispan.stderr b/tests/ui/annotate-snippet/multispan.stderr index baed54c59a4..833b6773032 100644 --- a/tests/ui/annotate-snippet/multispan.stderr +++ b/tests/ui/annotate-snippet/multispan.stderr @@ -1,41 +1,41 @@ error: hello to you, too! - --> $DIR/multispan.rs:15:5 + --> $DIR/multispan.rs:16:5 | LL | hello!(hi); | ^^^^^^^^^^ | error: hello to you, too! - --> $DIR/multispan.rs:18:5 + --> $DIR/multispan.rs:19:5 | LL | hello!(hi hi); | ^^^^^^^^^^^^^ | error: hello to you, too! - --> $DIR/multispan.rs:21:5 + --> $DIR/multispan.rs:22:5 | LL | hello!(hi hi hi); | ^^^^^^^^^^^^^^^^ | error: hello to you, too! - --> $DIR/multispan.rs:24:5 + --> $DIR/multispan.rs:25:5 | LL | hello!(hi hey hi yo hi beep beep hi hi); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | error: hello to you, too! - --> $DIR/multispan.rs:25:5 + --> $DIR/multispan.rs:26:5 | LL | hello!(hi there, hi how are you? hi... hi.); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | error: hello to you, too! - --> $DIR/multispan.rs:26:5 + --> $DIR/multispan.rs:27:5 | LL | hello!(whoah. hi di hi di ho); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | error: hello to you, too! - --> $DIR/multispan.rs:27:5 + --> $DIR/multispan.rs:28:5 | LL | hello!(hi good hi and good bye); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ diff --git a/tests/ui/array-slice-vec/show-boxed-slice.rs b/tests/ui/array-slice-vec/show-boxed-slice.rs index c10f779b1f6..3ae3686e423 100644 --- a/tests/ui/array-slice-vec/show-boxed-slice.rs +++ b/tests/ui/array-slice-vec/show-boxed-slice.rs @@ -1,7 +1,7 @@ // run-pass #[derive(Debug)] -struct Foo(#[allow(unused_tuple_struct_fields)] Box<[u8]>); +struct Foo(#[allow(dead_code)] Box<[u8]>); pub fn main() { println!("{:?}", Foo(Box::new([0, 1, 2]))); diff --git a/tests/ui/asm/aarch64/const.rs b/tests/ui/asm/aarch64/const.rs index de299bfdbdf..0b02c99abf6 100644 --- a/tests/ui/asm/aarch64/const.rs +++ b/tests/ui/asm/aarch64/const.rs @@ -1,8 +1,6 @@ // only-aarch64 // run-pass // needs-asm-support -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![feature(asm_const)] diff --git a/tests/ui/asm/bad-arch.rs b/tests/ui/asm/bad-arch.rs index 93309899bf3..3eeb76f3d00 100644 --- a/tests/ui/asm/bad-arch.rs +++ b/tests/ui/asm/bad-arch.rs @@ -1,7 +1,5 @@ // compile-flags: --target sparc-unknown-linux-gnu // needs-llvm-components: sparc -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![feature(no_core, lang_items, rustc_attrs)] #![no_core] diff --git a/tests/ui/asm/bad-arch.mirunsafeck.stderr b/tests/ui/asm/bad-arch.stderr index d7af296152f..23aad9908ef 100644 --- a/tests/ui/asm/bad-arch.mirunsafeck.stderr +++ b/tests/ui/asm/bad-arch.stderr @@ -1,11 +1,11 @@ error[E0472]: inline assembly is unsupported on this target - --> $DIR/bad-arch.rs:22:9 + --> $DIR/bad-arch.rs:20:9 | LL | asm!(""); | ^^^^^^^^ error[E0472]: inline assembly is unsupported on this target - --> $DIR/bad-arch.rs:27:1 + --> $DIR/bad-arch.rs:25:1 | LL | global_asm!(""); | ^^^^^^^^^^^^^^^ diff --git a/tests/ui/asm/bad-arch.thirunsafeck.stderr b/tests/ui/asm/bad-arch.thirunsafeck.stderr deleted file mode 100644 index d7af296152f..00000000000 --- a/tests/ui/asm/bad-arch.thirunsafeck.stderr +++ /dev/null @@ -1,17 +0,0 @@ -error[E0472]: inline assembly is unsupported on this target - --> $DIR/bad-arch.rs:22:9 - | -LL | asm!(""); - | ^^^^^^^^ - -error[E0472]: inline assembly is unsupported on this target - --> $DIR/bad-arch.rs:27:1 - | -LL | global_asm!(""); - | ^^^^^^^^^^^^^^^ - | - = note: this error originates in the macro `global_asm` (in Nightly builds, run with -Z macro-backtrace for more info) - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0472`. diff --git a/tests/ui/asm/bad-template.aarch64_thirunsafeck.stderr b/tests/ui/asm/bad-template.aarch64.stderr index b16f9a06c2a..4ffcd2303b7 100644 --- a/tests/ui/asm/bad-template.aarch64_thirunsafeck.stderr +++ b/tests/ui/asm/bad-template.aarch64.stderr @@ -1,5 +1,5 @@ error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:31:15 + --> $DIR/bad-template.rs:27:15 | LL | asm!("{}"); | ^^ from here @@ -7,7 +7,7 @@ LL | asm!("{}"); = note: no arguments were given error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:33:15 + --> $DIR/bad-template.rs:29:15 | LL | asm!("{1}", in(reg) foo); | ^^^ from here @@ -15,7 +15,7 @@ LL | asm!("{1}", in(reg) foo); = note: there is 1 argument error: argument never used - --> $DIR/bad-template.rs:33:21 + --> $DIR/bad-template.rs:29:21 | LL | asm!("{1}", in(reg) foo); | ^^^^^^^^^^^ argument never used @@ -23,13 +23,13 @@ LL | asm!("{1}", in(reg) foo); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` error: there is no argument named `a` - --> $DIR/bad-template.rs:36:16 + --> $DIR/bad-template.rs:32:16 | LL | asm!("{a}"); | ^ error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:38:15 + --> $DIR/bad-template.rs:34:15 | LL | asm!("{}", a = in(reg) foo); | ^^ --------------- named argument @@ -38,13 +38,13 @@ LL | asm!("{}", a = in(reg) foo); | = note: no positional arguments were given note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:38:20 + --> $DIR/bad-template.rs:34:20 | LL | asm!("{}", a = in(reg) foo); | ^^^^^^^^^^^^^^^ error: named argument never used - --> $DIR/bad-template.rs:38:20 + --> $DIR/bad-template.rs:34:20 | LL | asm!("{}", a = in(reg) foo); | ^^^^^^^^^^^^^^^ named argument never used @@ -52,7 +52,7 @@ LL | asm!("{}", a = in(reg) foo); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:41:15 + --> $DIR/bad-template.rs:37:15 | LL | asm!("{1}", a = in(reg) foo); | ^^^ from here @@ -60,7 +60,7 @@ LL | asm!("{1}", a = in(reg) foo); = note: no positional arguments were given error: named argument never used - --> $DIR/bad-template.rs:41:21 + --> $DIR/bad-template.rs:37:21 | LL | asm!("{1}", a = in(reg) foo); | ^^^^^^^^^^^^^^^ named argument never used @@ -68,7 +68,7 @@ LL | asm!("{1}", a = in(reg) foo); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:48:15 + --> $DIR/bad-template.rs:44:15 | LL | asm!("{}", in("x0") foo); | ^^ ------------ explicit register argument @@ -77,24 +77,24 @@ LL | asm!("{}", in("x0") foo); | = note: no positional arguments were given note: explicit register arguments cannot be used in the asm template - --> $DIR/bad-template.rs:48:20 + --> $DIR/bad-template.rs:44:20 | LL | asm!("{}", in("x0") foo); | ^^^^^^^^^^^^ help: use the register name directly in the assembly code - --> $DIR/bad-template.rs:48:20 + --> $DIR/bad-template.rs:44:20 | LL | asm!("{}", in("x0") foo); | ^^^^^^^^^^^^ error: asm template modifier must be a single character - --> $DIR/bad-template.rs:50:17 + --> $DIR/bad-template.rs:46:17 | LL | asm!("{:foo}", in(reg) foo); | ^^^ error: multiple unused asm arguments - --> $DIR/bad-template.rs:53:18 + --> $DIR/bad-template.rs:49:18 | LL | asm!("", in(reg) 0, in(reg) 1); | ^^^^^^^^^ ^^^^^^^^^ argument never used @@ -104,7 +104,7 @@ LL | asm!("", in(reg) 0, in(reg) 1); = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:59:14 + --> $DIR/bad-template.rs:55:14 | LL | global_asm!("{}"); | ^^ from here @@ -112,7 +112,7 @@ LL | global_asm!("{}"); = note: no arguments were given error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:61:14 + --> $DIR/bad-template.rs:57:14 | LL | global_asm!("{1}", const FOO); | ^^^ from here @@ -120,7 +120,7 @@ LL | global_asm!("{1}", const FOO); = note: there is 1 argument error: argument never used - --> $DIR/bad-template.rs:61:20 + --> $DIR/bad-template.rs:57:20 | LL | global_asm!("{1}", const FOO); | ^^^^^^^^^ argument never used @@ -128,13 +128,13 @@ LL | global_asm!("{1}", const FOO); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` error: there is no argument named `a` - --> $DIR/bad-template.rs:64:15 + --> $DIR/bad-template.rs:60:15 | LL | global_asm!("{a}"); | ^ error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:66:14 + --> $DIR/bad-template.rs:62:14 | LL | global_asm!("{}", a = const FOO); | ^^ ------------- named argument @@ -143,13 +143,13 @@ LL | global_asm!("{}", a = const FOO); | = note: no positional arguments were given note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:66:19 + --> $DIR/bad-template.rs:62:19 | LL | global_asm!("{}", a = const FOO); | ^^^^^^^^^^^^^ error: named argument never used - --> $DIR/bad-template.rs:66:19 + --> $DIR/bad-template.rs:62:19 | LL | global_asm!("{}", a = const FOO); | ^^^^^^^^^^^^^ named argument never used @@ -157,7 +157,7 @@ LL | global_asm!("{}", a = const FOO); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:69:14 + --> $DIR/bad-template.rs:65:14 | LL | global_asm!("{1}", a = const FOO); | ^^^ from here @@ -165,7 +165,7 @@ LL | global_asm!("{1}", a = const FOO); = note: no positional arguments were given error: named argument never used - --> $DIR/bad-template.rs:69:20 + --> $DIR/bad-template.rs:65:20 | LL | global_asm!("{1}", a = const FOO); | ^^^^^^^^^^^^^ named argument never used @@ -173,13 +173,13 @@ LL | global_asm!("{1}", a = const FOO); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: asm template modifier must be a single character - --> $DIR/bad-template.rs:72:16 + --> $DIR/bad-template.rs:68:16 | LL | global_asm!("{:foo}", const FOO); | ^^^ error: multiple unused asm arguments - --> $DIR/bad-template.rs:74:17 + --> $DIR/bad-template.rs:70:17 | LL | global_asm!("", const FOO, const FOO); | ^^^^^^^^^ ^^^^^^^^^ argument never used @@ -189,7 +189,7 @@ LL | global_asm!("", const FOO, const FOO); = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` warning: formatting may not be suitable for sub-register argument - --> $DIR/bad-template.rs:50:15 + --> $DIR/bad-template.rs:46:15 | LL | asm!("{:foo}", in(reg) foo); | ^^^^^^ --- for this argument diff --git a/tests/ui/asm/bad-template.aarch64_mirunsafeck.stderr b/tests/ui/asm/bad-template.aarch64_mirunsafeck.stderr deleted file mode 100644 index b16f9a06c2a..00000000000 --- a/tests/ui/asm/bad-template.aarch64_mirunsafeck.stderr +++ /dev/null @@ -1,202 +0,0 @@ -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:31:15 - | -LL | asm!("{}"); - | ^^ from here - | - = note: no arguments were given - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:33:15 - | -LL | asm!("{1}", in(reg) foo); - | ^^^ from here - | - = note: there is 1 argument - -error: argument never used - --> $DIR/bad-template.rs:33:21 - | -LL | asm!("{1}", in(reg) foo); - | ^^^^^^^^^^^ argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` - -error: there is no argument named `a` - --> $DIR/bad-template.rs:36:16 - | -LL | asm!("{a}"); - | ^ - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:38:15 - | -LL | asm!("{}", a = in(reg) foo); - | ^^ --------------- named argument - | | - | from here - | - = note: no positional arguments were given -note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:38:20 - | -LL | asm!("{}", a = in(reg) foo); - | ^^^^^^^^^^^^^^^ - -error: named argument never used - --> $DIR/bad-template.rs:38:20 - | -LL | asm!("{}", a = in(reg) foo); - | ^^^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:41:15 - | -LL | asm!("{1}", a = in(reg) foo); - | ^^^ from here - | - = note: no positional arguments were given - -error: named argument never used - --> $DIR/bad-template.rs:41:21 - | -LL | asm!("{1}", a = in(reg) foo); - | ^^^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:48:15 - | -LL | asm!("{}", in("x0") foo); - | ^^ ------------ explicit register argument - | | - | from here - | - = note: no positional arguments were given -note: explicit register arguments cannot be used in the asm template - --> $DIR/bad-template.rs:48:20 - | -LL | asm!("{}", in("x0") foo); - | ^^^^^^^^^^^^ -help: use the register name directly in the assembly code - --> $DIR/bad-template.rs:48:20 - | -LL | asm!("{}", in("x0") foo); - | ^^^^^^^^^^^^ - -error: asm template modifier must be a single character - --> $DIR/bad-template.rs:50:17 - | -LL | asm!("{:foo}", in(reg) foo); - | ^^^ - -error: multiple unused asm arguments - --> $DIR/bad-template.rs:53:18 - | -LL | asm!("", in(reg) 0, in(reg) 1); - | ^^^^^^^^^ ^^^^^^^^^ argument never used - | | - | argument never used - | - = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:59:14 - | -LL | global_asm!("{}"); - | ^^ from here - | - = note: no arguments were given - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:61:14 - | -LL | global_asm!("{1}", const FOO); - | ^^^ from here - | - = note: there is 1 argument - -error: argument never used - --> $DIR/bad-template.rs:61:20 - | -LL | global_asm!("{1}", const FOO); - | ^^^^^^^^^ argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` - -error: there is no argument named `a` - --> $DIR/bad-template.rs:64:15 - | -LL | global_asm!("{a}"); - | ^ - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:66:14 - | -LL | global_asm!("{}", a = const FOO); - | ^^ ------------- named argument - | | - | from here - | - = note: no positional arguments were given -note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:66:19 - | -LL | global_asm!("{}", a = const FOO); - | ^^^^^^^^^^^^^ - -error: named argument never used - --> $DIR/bad-template.rs:66:19 - | -LL | global_asm!("{}", a = const FOO); - | ^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:69:14 - | -LL | global_asm!("{1}", a = const FOO); - | ^^^ from here - | - = note: no positional arguments were given - -error: named argument never used - --> $DIR/bad-template.rs:69:20 - | -LL | global_asm!("{1}", a = const FOO); - | ^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: asm template modifier must be a single character - --> $DIR/bad-template.rs:72:16 - | -LL | global_asm!("{:foo}", const FOO); - | ^^^ - -error: multiple unused asm arguments - --> $DIR/bad-template.rs:74:17 - | -LL | global_asm!("", const FOO, const FOO); - | ^^^^^^^^^ ^^^^^^^^^ argument never used - | | - | argument never used - | - = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` - -warning: formatting may not be suitable for sub-register argument - --> $DIR/bad-template.rs:50:15 - | -LL | asm!("{:foo}", in(reg) foo); - | ^^^^^^ --- for this argument - | - = help: use `{0:w}` to have the register formatted as `w0` - = help: or use `{0:x}` to keep the default formatting of `x0` - = note: `#[warn(asm_sub_register)]` on by default - -error: aborting due to 21 previous errors; 1 warning emitted - diff --git a/tests/ui/asm/bad-template.rs b/tests/ui/asm/bad-template.rs index 55637174792..a6a233a36ec 100644 --- a/tests/ui/asm/bad-template.rs +++ b/tests/ui/asm/bad-template.rs @@ -1,14 +1,10 @@ -// revisions: x86_64_mirunsafeck aarch64_mirunsafeck x86_64_thirunsafeck aarch64_thirunsafeck +// revisions: x86_64 aarch64 -// [x86_64_thirunsafeck] compile-flags: -Z thir-unsafeck --target x86_64-unknown-linux-gnu -// [aarch64_thirunsafeck] compile-flags: -Z thir-unsafeck --target aarch64-unknown-linux-gnu -// [x86_64_mirunsafeck] compile-flags: --target x86_64-unknown-linux-gnu -// [aarch64_mirunsafeck] compile-flags: --target aarch64-unknown-linux-gnu +// [x86_64] compile-flags: --target x86_64-unknown-linux-gnu +// [aarch64] compile-flags: --target aarch64-unknown-linux-gnu -// [x86_64_thirunsafeck] needs-llvm-components: x86 -// [x86_64_mirunsafeck] needs-llvm-components: x86 -// [aarch64_thirunsafeck] needs-llvm-components: aarch64 -// [aarch64_mirunsafeck] needs-llvm-components: aarch64 +// [x86_64] needs-llvm-components: x86 +// [aarch64] needs-llvm-components: aarch64 #![feature(no_core, lang_items, rustc_attrs, asm_const)] #![no_core] @@ -41,12 +37,12 @@ fn main() { asm!("{1}", a = in(reg) foo); //~^ ERROR invalid reference to argument at index 1 //~^^ ERROR named argument never used - #[cfg(any(x86_64_thirunsafeck, x86_64_mirunsafeck))] + #[cfg(any(x86_64))] asm!("{}", in("eax") foo); - //[x86_64_thirunsafeck,x86_64_mirunsafeck]~^ ERROR invalid reference to argument at index 0 - #[cfg(any(aarch64_thirunsafeck, aarch64_mirunsafeck))] + //[x86_64]~^ ERROR invalid reference to argument at index 0 + #[cfg(any(aarch64))] asm!("{}", in("x0") foo); - //[aarch64_thirunsafeck,aarch64_mirunsafeck]~^ ERROR invalid reference to argument at index 0 + //[aarch64]~^ ERROR invalid reference to argument at index 0 asm!("{:foo}", in(reg) foo); //~^ ERROR asm template modifier must be a single character //~| WARN formatting may not be suitable for sub-register argument [asm_sub_register] diff --git a/tests/ui/asm/bad-template.x86_64_thirunsafeck.stderr b/tests/ui/asm/bad-template.x86_64.stderr index 41ac37c33c2..52a7789b98c 100644 --- a/tests/ui/asm/bad-template.x86_64_thirunsafeck.stderr +++ b/tests/ui/asm/bad-template.x86_64.stderr @@ -1,5 +1,5 @@ error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:31:15 + --> $DIR/bad-template.rs:27:15 | LL | asm!("{}"); | ^^ from here @@ -7,7 +7,7 @@ LL | asm!("{}"); = note: no arguments were given error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:33:15 + --> $DIR/bad-template.rs:29:15 | LL | asm!("{1}", in(reg) foo); | ^^^ from here @@ -15,7 +15,7 @@ LL | asm!("{1}", in(reg) foo); = note: there is 1 argument error: argument never used - --> $DIR/bad-template.rs:33:21 + --> $DIR/bad-template.rs:29:21 | LL | asm!("{1}", in(reg) foo); | ^^^^^^^^^^^ argument never used @@ -23,13 +23,13 @@ LL | asm!("{1}", in(reg) foo); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` error: there is no argument named `a` - --> $DIR/bad-template.rs:36:16 + --> $DIR/bad-template.rs:32:16 | LL | asm!("{a}"); | ^ error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:38:15 + --> $DIR/bad-template.rs:34:15 | LL | asm!("{}", a = in(reg) foo); | ^^ --------------- named argument @@ -38,13 +38,13 @@ LL | asm!("{}", a = in(reg) foo); | = note: no positional arguments were given note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:38:20 + --> $DIR/bad-template.rs:34:20 | LL | asm!("{}", a = in(reg) foo); | ^^^^^^^^^^^^^^^ error: named argument never used - --> $DIR/bad-template.rs:38:20 + --> $DIR/bad-template.rs:34:20 | LL | asm!("{}", a = in(reg) foo); | ^^^^^^^^^^^^^^^ named argument never used @@ -52,7 +52,7 @@ LL | asm!("{}", a = in(reg) foo); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:41:15 + --> $DIR/bad-template.rs:37:15 | LL | asm!("{1}", a = in(reg) foo); | ^^^ from here @@ -60,7 +60,7 @@ LL | asm!("{1}", a = in(reg) foo); = note: no positional arguments were given error: named argument never used - --> $DIR/bad-template.rs:41:21 + --> $DIR/bad-template.rs:37:21 | LL | asm!("{1}", a = in(reg) foo); | ^^^^^^^^^^^^^^^ named argument never used @@ -68,7 +68,7 @@ LL | asm!("{1}", a = in(reg) foo); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:45:15 + --> $DIR/bad-template.rs:41:15 | LL | asm!("{}", in("eax") foo); | ^^ ------------- explicit register argument @@ -77,24 +77,24 @@ LL | asm!("{}", in("eax") foo); | = note: no positional arguments were given note: explicit register arguments cannot be used in the asm template - --> $DIR/bad-template.rs:45:20 + --> $DIR/bad-template.rs:41:20 | LL | asm!("{}", in("eax") foo); | ^^^^^^^^^^^^^ help: use the register name directly in the assembly code - --> $DIR/bad-template.rs:45:20 + --> $DIR/bad-template.rs:41:20 | LL | asm!("{}", in("eax") foo); | ^^^^^^^^^^^^^ error: asm template modifier must be a single character - --> $DIR/bad-template.rs:50:17 + --> $DIR/bad-template.rs:46:17 | LL | asm!("{:foo}", in(reg) foo); | ^^^ error: multiple unused asm arguments - --> $DIR/bad-template.rs:53:18 + --> $DIR/bad-template.rs:49:18 | LL | asm!("", in(reg) 0, in(reg) 1); | ^^^^^^^^^ ^^^^^^^^^ argument never used @@ -104,7 +104,7 @@ LL | asm!("", in(reg) 0, in(reg) 1); = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:59:14 + --> $DIR/bad-template.rs:55:14 | LL | global_asm!("{}"); | ^^ from here @@ -112,7 +112,7 @@ LL | global_asm!("{}"); = note: no arguments were given error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:61:14 + --> $DIR/bad-template.rs:57:14 | LL | global_asm!("{1}", const FOO); | ^^^ from here @@ -120,7 +120,7 @@ LL | global_asm!("{1}", const FOO); = note: there is 1 argument error: argument never used - --> $DIR/bad-template.rs:61:20 + --> $DIR/bad-template.rs:57:20 | LL | global_asm!("{1}", const FOO); | ^^^^^^^^^ argument never used @@ -128,13 +128,13 @@ LL | global_asm!("{1}", const FOO); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` error: there is no argument named `a` - --> $DIR/bad-template.rs:64:15 + --> $DIR/bad-template.rs:60:15 | LL | global_asm!("{a}"); | ^ error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:66:14 + --> $DIR/bad-template.rs:62:14 | LL | global_asm!("{}", a = const FOO); | ^^ ------------- named argument @@ -143,13 +143,13 @@ LL | global_asm!("{}", a = const FOO); | = note: no positional arguments were given note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:66:19 + --> $DIR/bad-template.rs:62:19 | LL | global_asm!("{}", a = const FOO); | ^^^^^^^^^^^^^ error: named argument never used - --> $DIR/bad-template.rs:66:19 + --> $DIR/bad-template.rs:62:19 | LL | global_asm!("{}", a = const FOO); | ^^^^^^^^^^^^^ named argument never used @@ -157,7 +157,7 @@ LL | global_asm!("{}", a = const FOO); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:69:14 + --> $DIR/bad-template.rs:65:14 | LL | global_asm!("{1}", a = const FOO); | ^^^ from here @@ -165,7 +165,7 @@ LL | global_asm!("{1}", a = const FOO); = note: no positional arguments were given error: named argument never used - --> $DIR/bad-template.rs:69:20 + --> $DIR/bad-template.rs:65:20 | LL | global_asm!("{1}", a = const FOO); | ^^^^^^^^^^^^^ named argument never used @@ -173,13 +173,13 @@ LL | global_asm!("{1}", a = const FOO); = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` error: asm template modifier must be a single character - --> $DIR/bad-template.rs:72:16 + --> $DIR/bad-template.rs:68:16 | LL | global_asm!("{:foo}", const FOO); | ^^^ error: multiple unused asm arguments - --> $DIR/bad-template.rs:74:17 + --> $DIR/bad-template.rs:70:17 | LL | global_asm!("", const FOO, const FOO); | ^^^^^^^^^ ^^^^^^^^^ argument never used @@ -189,7 +189,7 @@ LL | global_asm!("", const FOO, const FOO); = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` warning: formatting may not be suitable for sub-register argument - --> $DIR/bad-template.rs:50:15 + --> $DIR/bad-template.rs:46:15 | LL | asm!("{:foo}", in(reg) foo); | ^^^^^^ --- for this argument diff --git a/tests/ui/asm/bad-template.x86_64_mirunsafeck.stderr b/tests/ui/asm/bad-template.x86_64_mirunsafeck.stderr deleted file mode 100644 index 41ac37c33c2..00000000000 --- a/tests/ui/asm/bad-template.x86_64_mirunsafeck.stderr +++ /dev/null @@ -1,202 +0,0 @@ -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:31:15 - | -LL | asm!("{}"); - | ^^ from here - | - = note: no arguments were given - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:33:15 - | -LL | asm!("{1}", in(reg) foo); - | ^^^ from here - | - = note: there is 1 argument - -error: argument never used - --> $DIR/bad-template.rs:33:21 - | -LL | asm!("{1}", in(reg) foo); - | ^^^^^^^^^^^ argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` - -error: there is no argument named `a` - --> $DIR/bad-template.rs:36:16 - | -LL | asm!("{a}"); - | ^ - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:38:15 - | -LL | asm!("{}", a = in(reg) foo); - | ^^ --------------- named argument - | | - | from here - | - = note: no positional arguments were given -note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:38:20 - | -LL | asm!("{}", a = in(reg) foo); - | ^^^^^^^^^^^^^^^ - -error: named argument never used - --> $DIR/bad-template.rs:38:20 - | -LL | asm!("{}", a = in(reg) foo); - | ^^^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:41:15 - | -LL | asm!("{1}", a = in(reg) foo); - | ^^^ from here - | - = note: no positional arguments were given - -error: named argument never used - --> $DIR/bad-template.rs:41:21 - | -LL | asm!("{1}", a = in(reg) foo); - | ^^^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:45:15 - | -LL | asm!("{}", in("eax") foo); - | ^^ ------------- explicit register argument - | | - | from here - | - = note: no positional arguments were given -note: explicit register arguments cannot be used in the asm template - --> $DIR/bad-template.rs:45:20 - | -LL | asm!("{}", in("eax") foo); - | ^^^^^^^^^^^^^ -help: use the register name directly in the assembly code - --> $DIR/bad-template.rs:45:20 - | -LL | asm!("{}", in("eax") foo); - | ^^^^^^^^^^^^^ - -error: asm template modifier must be a single character - --> $DIR/bad-template.rs:50:17 - | -LL | asm!("{:foo}", in(reg) foo); - | ^^^ - -error: multiple unused asm arguments - --> $DIR/bad-template.rs:53:18 - | -LL | asm!("", in(reg) 0, in(reg) 1); - | ^^^^^^^^^ ^^^^^^^^^ argument never used - | | - | argument never used - | - = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:59:14 - | -LL | global_asm!("{}"); - | ^^ from here - | - = note: no arguments were given - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:61:14 - | -LL | global_asm!("{1}", const FOO); - | ^^^ from here - | - = note: there is 1 argument - -error: argument never used - --> $DIR/bad-template.rs:61:20 - | -LL | global_asm!("{1}", const FOO); - | ^^^^^^^^^ argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {0} */"` - -error: there is no argument named `a` - --> $DIR/bad-template.rs:64:15 - | -LL | global_asm!("{a}"); - | ^ - -error: invalid reference to argument at index 0 - --> $DIR/bad-template.rs:66:14 - | -LL | global_asm!("{}", a = const FOO); - | ^^ ------------- named argument - | | - | from here - | - = note: no positional arguments were given -note: named arguments cannot be referenced by position - --> $DIR/bad-template.rs:66:19 - | -LL | global_asm!("{}", a = const FOO); - | ^^^^^^^^^^^^^ - -error: named argument never used - --> $DIR/bad-template.rs:66:19 - | -LL | global_asm!("{}", a = const FOO); - | ^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: invalid reference to argument at index 1 - --> $DIR/bad-template.rs:69:14 - | -LL | global_asm!("{1}", a = const FOO); - | ^^^ from here - | - = note: no positional arguments were given - -error: named argument never used - --> $DIR/bad-template.rs:69:20 - | -LL | global_asm!("{1}", a = const FOO); - | ^^^^^^^^^^^^^ named argument never used - | - = help: if this argument is intentionally unused, consider using it in an asm comment: `"/* {a} */"` - -error: asm template modifier must be a single character - --> $DIR/bad-template.rs:72:16 - | -LL | global_asm!("{:foo}", const FOO); - | ^^^ - -error: multiple unused asm arguments - --> $DIR/bad-template.rs:74:17 - | -LL | global_asm!("", const FOO, const FOO); - | ^^^^^^^^^ ^^^^^^^^^ argument never used - | | - | argument never used - | - = help: if these arguments are intentionally unused, consider using them in an asm comment: `"/* {0} {1} */"` - -warning: formatting may not be suitable for sub-register argument - --> $DIR/bad-template.rs:50:15 - | -LL | asm!("{:foo}", in(reg) foo); - | ^^^^^^ --- for this argument - | - = help: use `{0:e}` to have the register formatted as `eax` - = help: or use `{0:r}` to keep the default formatting of `rax` - = note: `#[warn(asm_sub_register)]` on by default - -error: aborting due to 21 previous errors; 1 warning emitted - diff --git a/tests/ui/asm/named-asm-labels.rs b/tests/ui/asm/named-asm-labels.rs index 160dbf617c4..24586b39aac 100644 --- a/tests/ui/asm/named-asm-labels.rs +++ b/tests/ui/asm/named-asm-labels.rs @@ -120,6 +120,27 @@ fn main() { // is there an example that is valid x86 for this test? asm!(":bbb nop"); + // non-ascii characters are not allowed in labels, so should not trigger the lint + asm!("Ù: nop"); + asm!("testÙ: nop"); + asm!("_Ù_: nop"); + + // Format arguments should be conservatively assumed to be valid characters in labels + // Would emit `test_rax:` or similar + #[allow(asm_sub_register)] + { + asm!("test_{}: nop", in(reg) 10); //~ ERROR avoid using named labels + } + asm!("test_{}: nop", const 10); //~ ERROR avoid using named labels + asm!("test_{}: nop", sym main); //~ ERROR avoid using named labels + asm!("{}_test: nop", const 10); //~ ERROR avoid using named labels + asm!("test_{}_test: nop", const 10); //~ ERROR avoid using named labels + asm!("{}: nop", const 10); //~ ERROR avoid using named labels + + asm!("{uwu}: nop", uwu = const 10); //~ ERROR avoid using named labels + asm!("{0}: nop", const 10); //~ ERROR avoid using named labels + asm!("{1}: nop", "/* {0} */", const 10, const 20); //~ ERROR avoid using named labels + // Test include_str in asm asm!(include_str!("named-asm-labels.s")); //~ ERROR avoid using named labels diff --git a/tests/ui/asm/named-asm-labels.stderr b/tests/ui/asm/named-asm-labels.stderr index c8380629e12..89c05849967 100644 --- a/tests/ui/asm/named-asm-labels.stderr +++ b/tests/ui/asm/named-asm-labels.stderr @@ -245,7 +245,88 @@ LL | ab: nop // ab: does foo = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:124:14 + --> $DIR/named-asm-labels.rs:132:19 + | +LL | asm!("test_{}: nop", in(reg) 10); + | ^^^^^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:134:15 + | +LL | asm!("test_{}: nop", const 10); + | ^^^^^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:135:15 + | +LL | asm!("test_{}: nop", sym main); + | ^^^^^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:136:15 + | +LL | asm!("{}_test: nop", const 10); + | ^^^^^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:137:15 + | +LL | asm!("test_{}_test: nop", const 10); + | ^^^^^^^^^^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:138:15 + | +LL | asm!("{}: nop", const 10); + | ^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:140:15 + | +LL | asm!("{uwu}: nop", uwu = const 10); + | ^^^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:141:15 + | +LL | asm!("{0}: nop", const 10); + | ^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:142:15 + | +LL | asm!("{1}: nop", "/* {0} */", const 10, const 20); + | ^^^ + | + = help: only local labels of the form `<number>:` should be used in inline asm + = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information + +error: avoid using named labels in inline assembly + --> $DIR/named-asm-labels.rs:145:14 | LL | asm!(include_str!("named-asm-labels.s")); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ @@ -254,7 +335,7 @@ LL | asm!(include_str!("named-asm-labels.s")); = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information warning: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:134:19 + --> $DIR/named-asm-labels.rs:155:19 | LL | asm!("warned: nop"); | ^^^^^^ @@ -262,13 +343,13 @@ LL | asm!("warned: nop"); = help: only local labels of the form `<number>:` should be used in inline asm = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information note: the lint level is defined here - --> $DIR/named-asm-labels.rs:132:16 + --> $DIR/named-asm-labels.rs:153:16 | LL | #[warn(named_asm_labels)] | ^^^^^^^^^^^^^^^^ error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:143:20 + --> $DIR/named-asm-labels.rs:164:20 | LL | unsafe { asm!(".Lfoo: mov rax, {}; ret;", "nop", const 1, options(noreturn)) } | ^^^^^ @@ -277,7 +358,7 @@ LL | unsafe { asm!(".Lfoo: mov rax, {}; ret;", "nop", const 1, options(noret = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:149:20 + --> $DIR/named-asm-labels.rs:170:20 | LL | unsafe { asm!(".Lbar: mov rax, {}; ret;", "nop", const 1, options(noreturn)) } | ^^^^^ @@ -286,7 +367,7 @@ LL | unsafe { asm!(".Lbar: mov rax, {}; ret;", "nop", const 1, options(noret = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:157:20 + --> $DIR/named-asm-labels.rs:178:20 | LL | unsafe { asm!(".Laaa: nop; ret;", options(noreturn)) } | ^^^^^ @@ -295,7 +376,7 @@ LL | unsafe { asm!(".Laaa: nop; ret;", options(noreturn)) } = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:167:24 + --> $DIR/named-asm-labels.rs:188:24 | LL | unsafe { asm!(".Lbbb: nop; ret;", options(noreturn)) } | ^^^^^ @@ -304,7 +385,7 @@ LL | unsafe { asm!(".Lbbb: nop; ret;", options(noreturn)) } = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:176:15 + --> $DIR/named-asm-labels.rs:197:15 | LL | asm!("closure1: nop"); | ^^^^^^^^ @@ -313,7 +394,7 @@ LL | asm!("closure1: nop"); = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:180:15 + --> $DIR/named-asm-labels.rs:201:15 | LL | asm!("closure2: nop"); | ^^^^^^^^ @@ -322,7 +403,7 @@ LL | asm!("closure2: nop"); = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information error: avoid using named labels in inline assembly - --> $DIR/named-asm-labels.rs:190:19 + --> $DIR/named-asm-labels.rs:211:19 | LL | asm!("closure3: nop"); | ^^^^^^^^ @@ -330,5 +411,5 @@ LL | asm!("closure3: nop"); = help: only local labels of the form `<number>:` should be used in inline asm = note: see the asm section of Rust By Example <https://doc.rust-lang.org/nightly/rust-by-example/unsafe/asm.html#labels> for more information -error: aborting due to 35 previous errors; 1 warning emitted +error: aborting due to 44 previous errors; 1 warning emitted diff --git a/tests/ui/asm/x86_64/const.rs b/tests/ui/asm/x86_64/const.rs index d523ae021a5..f9a2ab6269f 100644 --- a/tests/ui/asm/x86_64/const.rs +++ b/tests/ui/asm/x86_64/const.rs @@ -1,8 +1,6 @@ // only-x86_64 // run-pass // needs-asm-support -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![feature(asm_const)] diff --git a/tests/ui/associated-consts/associated-const-type-parameters.rs b/tests/ui/associated-consts/associated-const-type-parameters.rs index e7ead1045e6..b62d47458be 100644 --- a/tests/ui/associated-consts/associated-const-type-parameters.rs +++ b/tests/ui/associated-consts/associated-const-type-parameters.rs @@ -17,7 +17,7 @@ impl Foo for Def { const X: i32 = 97; } -struct Proxy<T>(#[allow(unused_tuple_struct_fields)] T); +struct Proxy<T>(#[allow(dead_code)] T); impl<T: Foo> Foo for Proxy<T> { const X: i32 = T::X; diff --git a/tests/ui/associated-type-bounds/duplicate.stderr b/tests/ui/associated-type-bounds/duplicate.stderr index 3888e62230f..38b812dfdd4 100644 --- a/tests/ui/associated-type-bounds/duplicate.stderr +++ b/tests/ui/associated-type-bounds/duplicate.stderr @@ -7,6 +7,30 @@ LL | struct SI1<T: Iterator<Item: Copy, Item: Send>> { | `Item` bound here first error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified + --> $DIR/duplicate.rs:255:40 + | +LL | type TADyn1 = dyn Iterator<Item: Copy, Item: Send>; + | ---------- ^^^^^^^^^^ re-bound here + | | + | `Item` bound here first + +error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified + --> $DIR/duplicate.rs:257:44 + | +LL | type TADyn2 = Box<dyn Iterator<Item: Copy, Item: Copy>>; + | ---------- ^^^^^^^^^^ re-bound here + | | + | `Item` bound here first + +error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified + --> $DIR/duplicate.rs:259:43 + | +LL | type TADyn3 = dyn Iterator<Item: 'static, Item: 'static>; + | ------------- ^^^^^^^^^^^^^ re-bound here + | | + | `Item` bound here first + +error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified --> $DIR/duplicate.rs:11:36 | LL | struct SI2<T: Iterator<Item: Copy, Item: Copy>> { @@ -491,30 +515,6 @@ LL | Self: Iterator<Item: 'static, Item: 'static>, = note: duplicate diagnostic emitted due to `-Z deduplicate-diagnostics=no` error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified - --> $DIR/duplicate.rs:255:40 - | -LL | type TADyn1 = dyn Iterator<Item: Copy, Item: Send>; - | ---------- ^^^^^^^^^^ re-bound here - | | - | `Item` bound here first - -error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified - --> $DIR/duplicate.rs:257:44 - | -LL | type TADyn2 = Box<dyn Iterator<Item: Copy, Item: Copy>>; - | ---------- ^^^^^^^^^^ re-bound here - | | - | `Item` bound here first - -error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified - --> $DIR/duplicate.rs:259:43 - | -LL | type TADyn3 = dyn Iterator<Item: 'static, Item: 'static>; - | ------------- ^^^^^^^^^^^^^ re-bound here - | | - | `Item` bound here first - -error[E0719]: the value of the associated type `Item` in trait `Iterator` is already specified --> $DIR/duplicate.rs:243:34 | LL | type A: Iterator<Item: Copy, Item: Send>; diff --git a/tests/ui/associated-types/associated-types-method.rs b/tests/ui/associated-types/associated-types-method.rs index 45df3ac20c2..6a6456cbbec 100644 --- a/tests/ui/associated-types/associated-types-method.rs +++ b/tests/ui/associated-types/associated-types-method.rs @@ -5,7 +5,7 @@ trait Device { type Resources; } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Foo<D, R>(D, R); trait Tr { diff --git a/tests/ui/associated-types/associated-types-no-suitable-supertrait.stderr b/tests/ui/associated-types/associated-types-no-suitable-supertrait.stderr index 9ebc45387e8..5443699eb01 100644 --- a/tests/ui/associated-types/associated-types-no-suitable-supertrait.stderr +++ b/tests/ui/associated-types/associated-types-no-suitable-supertrait.stderr @@ -1,4 +1,16 @@ error[E0277]: the trait bound `(T, U): Get` is not satisfied + --> $DIR/associated-types-no-suitable-supertrait.rs:22:5 + | +LL | fn uhoh<U:Get>(&self, foo: U, bar: <(T, U) as Get>::Value) {} + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ the trait `Get` is not implemented for `(T, U)` + | +help: this trait has no implementations, consider adding one + --> $DIR/associated-types-no-suitable-supertrait.rs:12:1 + | +LL | trait Get { + | ^^^^^^^^^ + +error[E0277]: the trait bound `(T, U): Get` is not satisfied --> $DIR/associated-types-no-suitable-supertrait.rs:22:40 | LL | fn uhoh<U:Get>(&self, foo: U, bar: <(T, U) as Get>::Value) {} @@ -21,18 +33,6 @@ help: consider further restricting `Self` LL | fn uhoh<U:Get>(&self, foo: U, bar: <Self as Get>::Value) where Self: Get {} | +++++++++++++++ -error[E0277]: the trait bound `(T, U): Get` is not satisfied - --> $DIR/associated-types-no-suitable-supertrait.rs:22:5 - | -LL | fn uhoh<U:Get>(&self, foo: U, bar: <(T, U) as Get>::Value) {} - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ the trait `Get` is not implemented for `(T, U)` - | -help: this trait has no implementations, consider adding one - --> $DIR/associated-types-no-suitable-supertrait.rs:12:1 - | -LL | trait Get { - | ^^^^^^^^^ - error: aborting due to 3 previous errors For more information about this error, try `rustc --explain E0277`. diff --git a/tests/ui/associated-types/associated-types-struct-field-numbered.rs b/tests/ui/associated-types/associated-types-struct-field-numbered.rs index 8612911d8f8..b71b71b25f5 100644 --- a/tests/ui/associated-types/associated-types-struct-field-numbered.rs +++ b/tests/ui/associated-types/associated-types-struct-field-numbered.rs @@ -9,7 +9,7 @@ pub trait UnifyKey { fn dummy(&self) { } } -pub struct Node<K:UnifyKey>(#[allow(unused_tuple_struct_fields)] K, K::Value); +pub struct Node<K:UnifyKey>(#[allow(dead_code)] K, K::Value); fn foo<K : UnifyKey<Value=Option<V>>,V : Clone>(node: &Node<K>) -> Option<V> { node.1.clone() diff --git a/tests/ui/associated-types/defaults-cyclic-fail-1.rs b/tests/ui/associated-types/defaults-cyclic-fail-1.rs index 61ef013236e..1ec5faca7c5 100644 --- a/tests/ui/associated-types/defaults-cyclic-fail-1.rs +++ b/tests/ui/associated-types/defaults-cyclic-fail-1.rs @@ -24,13 +24,13 @@ impl Tr for u32 { // ...but not in an impl that redefines one of the types. impl Tr for bool { type A = Box<Self::B>; - //~^ ERROR overflow evaluating the requirement `<bool as Tr>::B == _` + //~^ ERROR overflow evaluating the requirement `<bool as Tr>::A == _` } // (the error is shown twice for some reason) impl Tr for usize { type B = &'static Self::A; - //~^ ERROR overflow evaluating the requirement `<usize as Tr>::A == _` + //~^ ERROR overflow evaluating the requirement `<usize as Tr>::B == _` } fn main() { diff --git a/tests/ui/associated-types/defaults-cyclic-fail-1.stderr b/tests/ui/associated-types/defaults-cyclic-fail-1.stderr index 008eddcb29d..876fdaec296 100644 --- a/tests/ui/associated-types/defaults-cyclic-fail-1.stderr +++ b/tests/ui/associated-types/defaults-cyclic-fail-1.stderr @@ -1,10 +1,10 @@ -error[E0275]: overflow evaluating the requirement `<bool as Tr>::B == _` +error[E0275]: overflow evaluating the requirement `<bool as Tr>::A == _` --> $DIR/defaults-cyclic-fail-1.rs:26:14 | LL | type A = Box<Self::B>; | ^^^^^^^^^^^^ -error[E0275]: overflow evaluating the requirement `<usize as Tr>::A == _` +error[E0275]: overflow evaluating the requirement `<usize as Tr>::B == _` --> $DIR/defaults-cyclic-fail-1.rs:32:14 | LL | type B = &'static Self::A; diff --git a/tests/ui/associated-types/defaults-cyclic-fail-2.rs b/tests/ui/associated-types/defaults-cyclic-fail-2.rs index e91c9f2d29a..bec1bde71a1 100644 --- a/tests/ui/associated-types/defaults-cyclic-fail-2.rs +++ b/tests/ui/associated-types/defaults-cyclic-fail-2.rs @@ -25,13 +25,13 @@ impl Tr for u32 { impl Tr for bool { type A = Box<Self::B>; - //~^ ERROR overflow evaluating the requirement `<bool as Tr>::B == _` + //~^ ERROR overflow evaluating the requirement `<bool as Tr>::A == _` } // (the error is shown twice for some reason) impl Tr for usize { type B = &'static Self::A; - //~^ ERROR overflow evaluating the requirement `<usize as Tr>::A == _` + //~^ ERROR overflow evaluating the requirement `<usize as Tr>::B == _` } fn main() { diff --git a/tests/ui/associated-types/defaults-cyclic-fail-2.stderr b/tests/ui/associated-types/defaults-cyclic-fail-2.stderr index d0fbab07715..ec0c9973c0a 100644 --- a/tests/ui/associated-types/defaults-cyclic-fail-2.stderr +++ b/tests/ui/associated-types/defaults-cyclic-fail-2.stderr @@ -1,10 +1,10 @@ -error[E0275]: overflow evaluating the requirement `<bool as Tr>::B == _` +error[E0275]: overflow evaluating the requirement `<bool as Tr>::A == _` --> $DIR/defaults-cyclic-fail-2.rs:27:14 | LL | type A = Box<Self::B>; | ^^^^^^^^^^^^ -error[E0275]: overflow evaluating the requirement `<usize as Tr>::A == _` +error[E0275]: overflow evaluating the requirement `<usize as Tr>::B == _` --> $DIR/defaults-cyclic-fail-2.rs:33:14 | LL | type B = &'static Self::A; diff --git a/tests/ui/associated-types/issue-25700-1.rs b/tests/ui/associated-types/issue-25700-1.rs index 5e71a52ba4e..79652dc882b 100644 --- a/tests/ui/associated-types/issue-25700-1.rs +++ b/tests/ui/associated-types/issue-25700-1.rs @@ -1,5 +1,5 @@ // run-pass -struct S<T: 'static>(#[allow(unused_tuple_struct_fields)] Option<&'static T>); +struct S<T: 'static>(#[allow(dead_code)] Option<&'static T>); trait Tr { type Out; } impl<T> Tr for T { type Out = T; } diff --git a/tests/ui/associated-types/issue-25700-2.rs b/tests/ui/associated-types/issue-25700-2.rs index 89b1db496f9..f745da4a5cb 100644 --- a/tests/ui/associated-types/issue-25700-2.rs +++ b/tests/ui/associated-types/issue-25700-2.rs @@ -3,9 +3,9 @@ pub trait Parser { type Input; } -pub struct Iter<P: Parser>(#[allow(unused_tuple_struct_fields)] P, P::Input); +pub struct Iter<P: Parser>(#[allow(dead_code)] P, P::Input); -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] pub struct Map<P, F>(P, F); impl<P, F> Parser for Map<P, F> where F: FnMut(P) { type Input = u8; diff --git a/tests/ui/associated-types/issue-25700.rs b/tests/ui/associated-types/issue-25700.rs index e5b9a97523d..a377e37349d 100644 --- a/tests/ui/associated-types/issue-25700.rs +++ b/tests/ui/associated-types/issue-25700.rs @@ -1,4 +1,4 @@ -struct S<T: 'static>(#[allow(unused_tuple_struct_fields)] Option<&'static T>); +struct S<T: 'static>(#[allow(dead_code)] Option<&'static T>); trait Tr { type Out; } impl<T> Tr for T { type Out = T; } diff --git a/tests/ui/async-await/async-await.rs b/tests/ui/async-await/async-await.rs index 9cabf16f8bb..63941a79139 100644 --- a/tests/ui/async-await/async-await.rs +++ b/tests/ui/async-await/async-await.rs @@ -1,8 +1,7 @@ // run-pass -// revisions: default nomiropt thirunsafeck +// revisions: default nomiropt //[nomiropt]compile-flags: -Z mir-opt-level=0 -//[thirunsafeck]compile-flags: -Zthir-unsafeck #![allow(unused)] diff --git a/tests/ui/async-await/async-fn-size-moved-locals.rs b/tests/ui/async-await/async-fn-size-moved-locals.rs index 79b7239f359..fb64bb6db63 100644 --- a/tests/ui/async-await/async-fn-size-moved-locals.rs +++ b/tests/ui/async-await/async-fn-size-moved-locals.rs @@ -17,7 +17,7 @@ use std::pin::Pin; use std::task::{Context, Poll}; const BIG_FUT_SIZE: usize = 1024; -struct BigFut(#[allow(unused_tuple_struct_fields)] [u8; BIG_FUT_SIZE]); +struct BigFut(#[allow(dead_code)] [u8; BIG_FUT_SIZE]); impl BigFut { fn new() -> Self { diff --git a/tests/ui/async-await/async-fn-size-uninit-locals.rs b/tests/ui/async-await/async-fn-size-uninit-locals.rs index 54617269354..fee3e27cfb8 100644 --- a/tests/ui/async-await/async-fn-size-uninit-locals.rs +++ b/tests/ui/async-await/async-fn-size-uninit-locals.rs @@ -17,7 +17,7 @@ use std::pin::Pin; use std::task::{Context, Poll}; const BIG_FUT_SIZE: usize = 1024; -struct Big(#[allow(unused_tuple_struct_fields)] [u8; BIG_FUT_SIZE]); +struct Big(#[allow(dead_code)] [u8; BIG_FUT_SIZE]); impl Big { fn new() -> Self { diff --git a/tests/ui/async-await/async-unsafe-fn-call-in-safe.mir.stderr b/tests/ui/async-await/async-unsafe-fn-call-in-safe.mir.stderr deleted file mode 100644 index f9e5bf675cb..00000000000 --- a/tests/ui/async-await/async-unsafe-fn-call-in-safe.mir.stderr +++ /dev/null @@ -1,35 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:14:5 - | -LL | S::f(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:17:5 - | -LL | f(); - | ^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:23:5 - | -LL | S::f(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:26:5 - | -LL | f(); - | ^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 4 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/async-await/async-unsafe-fn-call-in-safe.rs b/tests/ui/async-await/async-unsafe-fn-call-in-safe.rs index 14cc0dc614f..7695853000d 100644 --- a/tests/ui/async-await/async-unsafe-fn-call-in-safe.rs +++ b/tests/ui/async-await/async-unsafe-fn-call-in-safe.rs @@ -1,6 +1,4 @@ // edition:2018 -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck struct S; @@ -12,18 +10,14 @@ async unsafe fn f() {} async fn g() { S::f(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `S::f` is unsafe + //~^ ERROR call to unsafe function `S::f` is unsafe f(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `f` is unsafe + //~^ ERROR call to unsafe function `f` is unsafe } fn main() { S::f(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `S::f` is unsafe + //~^ ERROR call to unsafe function `S::f` is unsafe f(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `f` is unsafe + //~^ ERROR call to unsafe function `f` is unsafe } diff --git a/tests/ui/async-await/async-unsafe-fn-call-in-safe.thir.stderr b/tests/ui/async-await/async-unsafe-fn-call-in-safe.stderr index ba3303fe793..b25794c0892 100644 --- a/tests/ui/async-await/async-unsafe-fn-call-in-safe.thir.stderr +++ b/tests/ui/async-await/async-unsafe-fn-call-in-safe.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `S::f` is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:14:5 + --> $DIR/async-unsafe-fn-call-in-safe.rs:12:5 | LL | S::f(); | ^^^^^^ call to unsafe function @@ -7,7 +7,7 @@ LL | S::f(); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `f` is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:17:5 + --> $DIR/async-unsafe-fn-call-in-safe.rs:14:5 | LL | f(); | ^^^ call to unsafe function @@ -15,7 +15,7 @@ LL | f(); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `S::f` is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:23:5 + --> $DIR/async-unsafe-fn-call-in-safe.rs:19:5 | LL | S::f(); | ^^^^^^ call to unsafe function @@ -23,7 +23,7 @@ LL | S::f(); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `f` is unsafe and requires unsafe function or block - --> $DIR/async-unsafe-fn-call-in-safe.rs:26:5 + --> $DIR/async-unsafe-fn-call-in-safe.rs:21:5 | LL | f(); | ^^^ call to unsafe function diff --git a/tests/ui/async-await/issue-66312.stderr b/tests/ui/async-await/issue-66312.stderr index dad5807cb50..2875af8a97e 100644 --- a/tests/ui/async-await/issue-66312.stderr +++ b/tests/ui/async-await/issue-66312.stderr @@ -1,3 +1,9 @@ +error[E0308]: mismatched types + --> $DIR/issue-66312.rs:9:8 + | +LL | if x.is_some() { + | ^^^^^^^^^^^ expected `bool`, found `()` + error[E0307]: invalid `self` parameter type: T --> $DIR/issue-66312.rs:4:22 | @@ -7,12 +13,6 @@ LL | fn is_some(self: T); = note: type of `self` must be `Self` or a type that dereferences to it = help: consider changing to `self`, `&self`, `&mut self`, `self: Box<Self>`, `self: Rc<Self>`, `self: Arc<Self>`, or `self: Pin<P>` (where P is one of the previous types except `Self`) -error[E0308]: mismatched types - --> $DIR/issue-66312.rs:9:8 - | -LL | if x.is_some() { - | ^^^^^^^^^^^ expected `bool`, found `()` - error: aborting due to 2 previous errors Some errors have detailed explanations: E0307, E0308. diff --git a/tests/ui/auto-traits/auto-traits.rs b/tests/ui/auto-traits/auto-traits.rs index 7b52d9c176e..6d8e1a52ec1 100644 --- a/tests/ui/auto-traits/auto-traits.rs +++ b/tests/ui/auto-traits/auto-traits.rs @@ -9,7 +9,7 @@ unsafe auto trait AutoUnsafe {} impl !Auto for bool {} impl !AutoUnsafe for bool {} -struct AutoBool(#[allow(unused_tuple_struct_fields)] bool); +struct AutoBool(#[allow(dead_code)] bool); impl Auto for AutoBool {} unsafe impl AutoUnsafe for AutoBool {} diff --git a/tests/ui/bench/issue-32062.rs b/tests/ui/bench/issue-32062.rs index 7eb52196e16..99b8b7c6012 100644 --- a/tests/ui/bench/issue-32062.rs +++ b/tests/ui/bench/issue-32062.rs @@ -15,7 +15,7 @@ trait Parser { } } -struct Token<T>(#[allow(unused_tuple_struct_fields)] T::Item) where T: Iterator; +struct Token<T>(#[allow(dead_code)] T::Item) where T: Iterator; impl<T> Parser for Token<T> where T: Iterator { type Input = T; @@ -25,7 +25,7 @@ impl<T> Parser for Token<T> where T: Iterator { } } -struct Chain<L, R>(#[allow(unused_tuple_struct_fields)] L, #[allow(unused_tuple_struct_fields)] R); +struct Chain<L, R>(#[allow(dead_code)] L, #[allow(dead_code)] R); impl<L, R> Parser for Chain<L, R> where L: Parser, R: Parser<Input = L::Input> { type Input = L::Input; diff --git a/tests/ui/binding/issue-53114-safety-checks.stderr b/tests/ui/binding/issue-53114-safety-checks.stderr index 349c4639a9e..b7d805d9171 100644 --- a/tests/ui/binding/issue-53114-safety-checks.stderr +++ b/tests/ui/binding/issue-53114-safety-checks.stderr @@ -1,63 +1,3 @@ -error[E0793]: reference to packed field is unaligned - --> $DIR/issue-53114-safety-checks.rs:23:13 - | -LL | let _ = &p.b; - | ^^^^ - | - = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses - = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) - = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) - -error[E0793]: reference to packed field is unaligned - --> $DIR/issue-53114-safety-checks.rs:28:17 - | -LL | let (_,) = (&p.b,); - | ^^^^ - | - = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses - = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) - = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) - -error[E0793]: reference to packed field is unaligned - --> $DIR/issue-53114-safety-checks.rs:37:16 - | -LL | let _: _ = &p.b; - | ^^^^ - | - = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses - = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) - = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) - -error[E0793]: reference to packed field is unaligned - --> $DIR/issue-53114-safety-checks.rs:42:20 - | -LL | let (_,): _ = (&p.b,); - | ^^^^ - | - = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses - = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) - = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) - -error[E0793]: reference to packed field is unaligned - --> $DIR/issue-53114-safety-checks.rs:51:11 - | -LL | match &p.b { _ => { } } - | ^^^^ - | - = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses - = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) - = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) - -error[E0793]: reference to packed field is unaligned - --> $DIR/issue-53114-safety-checks.rs:56:12 - | -LL | match (&p.b,) { (_,) => { } } - | ^^^^ - | - = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses - = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) - = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) - error[E0133]: access to union field is unsafe and requires unsafe function or block --> $DIR/issue-53114-safety-checks.rs:24:13 | @@ -67,10 +7,10 @@ LL | let _ = u1.a; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-53114-safety-checks.rs:25:13 + --> $DIR/issue-53114-safety-checks.rs:25:14 | LL | let _ = &u2.a; - | ^^^^^ access to union field + | ^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior @@ -83,13 +23,33 @@ LL | let (_,) = (u1.a,); = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-53114-safety-checks.rs:30:17 + --> $DIR/issue-53114-safety-checks.rs:30:18 | LL | let (_,) = (&u2.a,); - | ^^^^^ access to union field + | ^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior +error[E0793]: reference to packed field is unaligned + --> $DIR/issue-53114-safety-checks.rs:23:13 + | +LL | let _ = &p.b; + | ^^^^ + | + = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses + = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) + = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) + +error[E0793]: reference to packed field is unaligned + --> $DIR/issue-53114-safety-checks.rs:28:17 + | +LL | let (_,) = (&p.b,); + | ^^^^ + | + = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses + = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) + = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) + error[E0133]: access to union field is unsafe and requires unsafe function or block --> $DIR/issue-53114-safety-checks.rs:38:16 | @@ -99,10 +59,10 @@ LL | let _: _ = u1.a; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-53114-safety-checks.rs:39:16 + --> $DIR/issue-53114-safety-checks.rs:39:17 | LL | let _: _ = &u2.a; - | ^^^^^ access to union field + | ^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior @@ -115,13 +75,33 @@ LL | let (_,): _ = (u1.a,); = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-53114-safety-checks.rs:44:20 + --> $DIR/issue-53114-safety-checks.rs:44:21 | LL | let (_,): _ = (&u2.a,); - | ^^^^^ access to union field + | ^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior +error[E0793]: reference to packed field is unaligned + --> $DIR/issue-53114-safety-checks.rs:37:16 + | +LL | let _: _ = &p.b; + | ^^^^ + | + = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses + = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) + = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) + +error[E0793]: reference to packed field is unaligned + --> $DIR/issue-53114-safety-checks.rs:42:20 + | +LL | let (_,): _ = (&p.b,); + | ^^^^ + | + = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses + = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) + = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) + error[E0133]: access to union field is unsafe and requires unsafe function or block --> $DIR/issue-53114-safety-checks.rs:52:11 | @@ -131,10 +111,10 @@ LL | match u1.a { _ => { } } = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-53114-safety-checks.rs:53:11 + --> $DIR/issue-53114-safety-checks.rs:53:12 | LL | match &u2.a { _ => { } } - | ^^^^^ access to union field + | ^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior @@ -147,13 +127,33 @@ LL | match (u1.a,) { (_,) => { } } = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-53114-safety-checks.rs:58:12 + --> $DIR/issue-53114-safety-checks.rs:58:13 | LL | match (&u2.a,) { (_,) => { } } - | ^^^^^ access to union field + | ^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior +error[E0793]: reference to packed field is unaligned + --> $DIR/issue-53114-safety-checks.rs:51:11 + | +LL | match &p.b { _ => { } } + | ^^^^ + | + = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses + = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) + = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) + +error[E0793]: reference to packed field is unaligned + --> $DIR/issue-53114-safety-checks.rs:56:12 + | +LL | match (&p.b,) { (_,) => { } } + | ^^^^ + | + = note: packed structs are only aligned by one byte, and many modern architectures penalize unaligned field accesses + = note: creating a misaligned reference is undefined behavior (even if that reference is never dereferenced) + = help: copy the field contents to a local variable, or replace the reference with a raw pointer and use `read_unaligned`/`write_unaligned` (loads and stores via `*p` must be properly aligned even when using raw pointers) + error: aborting due to 18 previous errors Some errors have detailed explanations: E0133, E0793. diff --git a/tests/ui/binding/match-tag.rs b/tests/ui/binding/match-tag.rs index 407716aa28a..6914a1c6b6d 100644 --- a/tests/ui/binding/match-tag.rs +++ b/tests/ui/binding/match-tag.rs @@ -3,7 +3,7 @@ #![allow(non_camel_case_types)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] enum color { rgb(isize, isize, isize), rgba(isize, isize, isize, isize), diff --git a/tests/ui/binding/or-pattern.rs b/tests/ui/binding/or-pattern.rs index 47623a3d722..07559e414dc 100644 --- a/tests/ui/binding/or-pattern.rs +++ b/tests/ui/binding/or-pattern.rs @@ -1,7 +1,7 @@ // run-pass #![allow(non_camel_case_types)] -enum blah { a(isize, isize, #[allow(unused_tuple_struct_fields)] usize), b(isize, isize), c, } +enum blah { a(isize, isize, #[allow(dead_code)] usize), b(isize, isize), c, } fn or_alt(q: blah) -> isize { match q { blah::a(x, y, _) | blah::b(x, y) => { return x + y; } blah::c => { return 0; } } diff --git a/tests/ui/binding/simple-generic-match.rs b/tests/ui/binding/simple-generic-match.rs index 2cf050d011d..acac32b8231 100644 --- a/tests/ui/binding/simple-generic-match.rs +++ b/tests/ui/binding/simple-generic-match.rs @@ -3,6 +3,6 @@ // pretty-expanded FIXME #23616 -enum clam<T> { a(#[allow(unused_tuple_struct_fields)] T), } +enum clam<T> { a(#[allow(dead_code)] T), } pub fn main() { let c = clam::a(2); match c { clam::a::<isize>(_) => { } } } diff --git a/tests/ui/binop/binary-op-suggest-deref.stderr b/tests/ui/binop/binary-op-suggest-deref.stderr index f5de64e3ab1..68b5a24bf97 100644 --- a/tests/ui/binop/binary-op-suggest-deref.stderr +++ b/tests/ui/binop/binary-op-suggest-deref.stderr @@ -270,11 +270,6 @@ note: an implementation of `PartialEq<&&{integer}>` might be missing for `Foo` | LL | struct Foo; | ^^^^^^^^^^ must implement `PartialEq<&&{integer}>` -help: consider annotating `Foo` with `#[derive(PartialEq)]` - | -LL + #[derive(PartialEq)] -LL | struct Foo; - | error[E0277]: can't compare `&String` with `str` --> $DIR/binary-op-suggest-deref.rs:69:20 diff --git a/tests/ui/builtin-superkinds/builtin-superkinds-in-metadata2.rs b/tests/ui/builtin-superkinds/builtin-superkinds-in-metadata2.rs index cdde48871ea..2edc52c6f55 100644 --- a/tests/ui/builtin-superkinds/builtin-superkinds-in-metadata2.rs +++ b/tests/ui/builtin-superkinds/builtin-superkinds-in-metadata2.rs @@ -12,7 +12,7 @@ use trait_superkinds_in_metadata::RequiresCopy; use std::marker; #[derive(Copy, Clone)] -struct X<T>(#[allow(unused_tuple_struct_fields)] T); +struct X<T>(#[allow(dead_code)] T); impl<T:Sync> RequiresShare for X<T> { } diff --git a/tests/ui/closures/2229_closure_analysis/issue-88118-2.stderr b/tests/ui/closures/2229_closure_analysis/issue-88118-2.stderr index b3cb558f976..34b3eab2345 100644 --- a/tests/ui/closures/2229_closure_analysis/issue-88118-2.stderr +++ b/tests/ui/closures/2229_closure_analysis/issue-88118-2.stderr @@ -1,8 +1,8 @@ warning: irrefutable `if let` guard pattern - --> $DIR/issue-88118-2.rs:10:29 + --> $DIR/issue-88118-2.rs:10:25 | LL | Registry if let _ = registry.try_find_description() => { } - | ^ + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | = note: this pattern will always match, so the guard is useless = help: consider removing the guard and adding a `let` inside the match arm diff --git a/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.fixed b/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.fixed index b74b5e94e2b..e8ca5ccdc54 100644 --- a/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.fixed +++ b/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.fixed @@ -51,10 +51,10 @@ fn test_sync_trait() { } /* Test Clone Trait Migration */ -struct S(Foo); +struct S(#[allow(dead_code)] Foo); struct T(i32); -struct U(S, T); +struct U(#[allow(dead_code)] S, T); impl Clone for U { fn clone(&self) -> Self { diff --git a/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.rs b/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.rs index e4965e33cc1..fb464b7f1e1 100644 --- a/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.rs +++ b/tests/ui/closures/2229_closure_analysis/migrations/auto_traits.rs @@ -51,10 +51,10 @@ fn test_sync_trait() { } /* Test Clone Trait Migration */ -struct S(Foo); +struct S(#[allow(dead_code)] Foo); struct T(i32); -struct U(S, T); +struct U(#[allow(dead_code)] S, T); impl Clone for U { fn clone(&self) -> Self { diff --git a/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.fixed b/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.fixed index bde8c749731..7c4e5c0f9a5 100644 --- a/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.fixed +++ b/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.fixed @@ -18,10 +18,10 @@ impl Foo { } } -struct S(#[allow(unused_tuple_struct_fields)] Foo); +struct S(#[allow(dead_code)] Foo); #[derive(Clone)] -struct T(#[allow(unused_tuple_struct_fields)] i32); +struct T(#[allow(dead_code)] i32); struct U(S, T); diff --git a/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.rs b/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.rs index 584c52ea134..f979db11b7e 100644 --- a/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.rs +++ b/tests/ui/closures/2229_closure_analysis/migrations/multi_diagnostics.rs @@ -18,10 +18,10 @@ impl Foo { } } -struct S(#[allow(unused_tuple_struct_fields)] Foo); +struct S(#[allow(dead_code)] Foo); #[derive(Clone)] -struct T(#[allow(unused_tuple_struct_fields)] i32); +struct T(#[allow(dead_code)] i32); struct U(S, T); diff --git a/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.fixed b/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.fixed index e99dbb5ab3a..672aa4be686 100644 --- a/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.fixed +++ b/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.fixed @@ -13,7 +13,7 @@ impl Drop for Foo { } #[derive(Debug)] -struct ConstainsDropField(Foo, #[allow(unused_tuple_struct_fields)] Foo); +struct ConstainsDropField(Foo, #[allow(dead_code)] Foo); // `t` needs Drop because one of its elements needs drop, // therefore precise capture might affect drop ordering diff --git a/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.rs b/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.rs index 62a984c9eeb..9c751064688 100644 --- a/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.rs +++ b/tests/ui/closures/2229_closure_analysis/migrations/significant_drop.rs @@ -13,7 +13,7 @@ impl Drop for Foo { } #[derive(Debug)] -struct ConstainsDropField(Foo, #[allow(unused_tuple_struct_fields)] Foo); +struct ConstainsDropField(Foo, #[allow(dead_code)] Foo); // `t` needs Drop because one of its elements needs drop, // therefore precise capture might affect drop ordering diff --git a/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.rs b/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.rs index bdb3eb23c38..76a0f291410 100644 --- a/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.rs +++ b/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - // Ensure we get unsafe function after coercion unsafe fn add(a: i32, b: i32) -> i32 { a + b diff --git a/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.mir.stderr b/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.stderr index 2f9c7973b5a..190b4792ebc 100644 --- a/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.mir.stderr +++ b/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/closure_no_cap_coerce_many_unsafe_0.rs:15:23 + --> $DIR/closure_no_cap_coerce_many_unsafe_0.rs:12:23 | LL | let result: i32 = foo(5, 5); | ^^^^^^^^^ call to unsafe function @@ -7,7 +7,7 @@ LL | let result: i32 = foo(5, 5); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/closure_no_cap_coerce_many_unsafe_0.rs:24:23 + --> $DIR/closure_no_cap_coerce_many_unsafe_0.rs:21:23 | LL | let result: i32 = foo(5, 5); | ^^^^^^^^^ call to unsafe function diff --git a/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.thir.stderr b/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.thir.stderr deleted file mode 100644 index 2f9c7973b5a..00000000000 --- a/tests/ui/closures/closure_no_cap_coerce_many_unsafe_0.thir.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/closure_no_cap_coerce_many_unsafe_0.rs:15:23 - | -LL | let result: i32 = foo(5, 5); - | ^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/closure_no_cap_coerce_many_unsafe_0.rs:24:23 - | -LL | let result: i32 = foo(5, 5); - | ^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.mir.stderr b/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.mir.stderr deleted file mode 100644 index 57922770310..00000000000 --- a/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/coerce-unsafe-closure-to-unsafe-fn-ptr.rs:5:31 - | -LL | let _: unsafe fn() = || { ::std::pin::Pin::new_unchecked(&0_u8); }; - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.rs b/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.rs index 57358fbdd84..36777693fab 100644 --- a/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.rs +++ b/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - fn main() { let _: unsafe fn() = || { ::std::pin::Pin::new_unchecked(&0_u8); }; //~^ ERROR E0133 diff --git a/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.thir.stderr b/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.stderr index fb237231d65..f5cb3e2b5f8 100644 --- a/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.thir.stderr +++ b/tests/ui/closures/coerce-unsafe-closure-to-unsafe-fn-ptr.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `Pin::<P>::new_unchecked` is unsafe and requires unsafe function or block - --> $DIR/coerce-unsafe-closure-to-unsafe-fn-ptr.rs:5:31 + --> $DIR/coerce-unsafe-closure-to-unsafe-fn-ptr.rs:2:31 | LL | let _: unsafe fn() = || { ::std::pin::Pin::new_unchecked(&0_u8); }; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/closures/thir-unsafeck-issue-85871.rs b/tests/ui/closures/thir-unsafeck-issue-85871.rs index aea539b74df..a4a487c4dc2 100644 --- a/tests/ui/closures/thir-unsafeck-issue-85871.rs +++ b/tests/ui/closures/thir-unsafeck-issue-85871.rs @@ -1,6 +1,5 @@ // Tests that no ICE occurs when a closure appears inside a node // that does not have a body when compiling with -// compile-flags: -Zthir-unsafeck=yes // check-pass #![allow(dead_code)] diff --git a/tests/ui/codegen/issue-16602-3.rs b/tests/ui/codegen/issue-16602-3.rs index ca1ab3cc7fe..2307cfb81c7 100644 --- a/tests/ui/codegen/issue-16602-3.rs +++ b/tests/ui/codegen/issue-16602-3.rs @@ -2,7 +2,7 @@ #![allow(unused_variables)] #![allow(unused_assignments)] #[derive(Debug)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] enum Foo { Bar(u32, u32), Baz(&'static u32, &'static u32) diff --git a/tests/ui/coercion/issue-14589.rs b/tests/ui/coercion/issue-14589.rs index d35ee5c731e..f92385f8d72 100644 --- a/tests/ui/coercion/issue-14589.rs +++ b/tests/ui/coercion/issue-14589.rs @@ -20,5 +20,5 @@ impl<T> Test<T> { } trait Foo { fn dummy(&self) { }} -struct Output(#[allow(unused_tuple_struct_fields)] isize); +struct Output(#[allow(dead_code)] isize); impl Foo for Output {} diff --git a/tests/ui/command/command-pre-exec.rs b/tests/ui/command/command-pre-exec.rs index d366c5ffbfd..e8a909eecc1 100644 --- a/tests/ui/command/command-pre-exec.rs +++ b/tests/ui/command/command-pre-exec.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![allow(stable_features)] // ignore-windows - this is a unix-specific test diff --git a/tests/ui/const-generics/const-argument-cross-crate.rs b/tests/ui/const-generics/const-argument-cross-crate.rs index 5693409e992..ff9cebdf7ec 100644 --- a/tests/ui/const-generics/const-argument-cross-crate.rs +++ b/tests/ui/const-generics/const-argument-cross-crate.rs @@ -4,7 +4,7 @@ extern crate const_generic_lib; -struct Container(#[allow(unused_tuple_struct_fields)] const_generic_lib::Alias); +struct Container(#[allow(dead_code)] const_generic_lib::Alias); fn main() { let res = const_generic_lib::function(const_generic_lib::Struct([14u8, 1u8, 2u8])); diff --git a/tests/ui/const-generics/generic_const_exprs/associated-consts.rs b/tests/ui/const-generics/generic_const_exprs/associated-consts.rs index b839008d424..3bc72fe7faa 100644 --- a/tests/ui/const-generics/generic_const_exprs/associated-consts.rs +++ b/tests/ui/const-generics/generic_const_exprs/associated-consts.rs @@ -16,7 +16,7 @@ impl BlockCipher for BarCipher { const BLOCK_SIZE: usize = 32; } -pub struct Block<C>(#[allow(unused_tuple_struct_fields)] C); +pub struct Block<C>(#[allow(dead_code)] C); pub fn test<C: BlockCipher, const M: usize>() where diff --git a/tests/ui/const-generics/inhabited-assoc-ty-ice-1.rs b/tests/ui/const-generics/inhabited-assoc-ty-ice-1.rs index b385406b020..b4f44dac62d 100644 --- a/tests/ui/const-generics/inhabited-assoc-ty-ice-1.rs +++ b/tests/ui/const-generics/inhabited-assoc-ty-ice-1.rs @@ -9,7 +9,7 @@ trait Foo { const ASSOC: usize = 1; } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Iced<T: Foo>(T, [(); T::ASSOC]) where [(); T::ASSOC]: ; diff --git a/tests/ui/const-generics/inhabited-assoc-ty-ice-2.rs b/tests/ui/const-generics/inhabited-assoc-ty-ice-2.rs index 216d29c7cd4..d6d0a80ab11 100644 --- a/tests/ui/const-generics/inhabited-assoc-ty-ice-2.rs +++ b/tests/ui/const-generics/inhabited-assoc-ty-ice-2.rs @@ -9,7 +9,7 @@ trait Foo { const ASSOC: usize = 1; } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Iced<T: Foo>(T, [(); T::ASSOC]) where [(); T::ASSOC]: ; diff --git a/tests/ui/const-generics/issues/issue-83765.rs b/tests/ui/const-generics/issues/issue-83765.rs index 71c164ab0a5..0959f771c22 100644 --- a/tests/ui/const-generics/issues/issue-83765.rs +++ b/tests/ui/const-generics/issues/issue-83765.rs @@ -4,6 +4,7 @@ trait TensorDimension { const DIM: usize; //~^ ERROR cycle detected when resolving instance + //~| ERROR cycle detected when resolving instance // FIXME Given the current state of the compiler its expected that we cycle here, // but the cycle is still wrong. const ISSCALAR: bool = Self::DIM == 0; @@ -79,6 +80,7 @@ impl<'a, R, T: Broadcastable, F: Fn(T::Element) -> R, const DIM: usize> TensorSi for BMap<'a, R, T, F, DIM> { fn size(&self) -> [usize; DIM] { + //~^ ERROR: method not compatible with trait self.reference.size() } } @@ -88,6 +90,7 @@ impl<'a, R, T: Broadcastable, F: Fn(T::Element) -> R, const DIM: usize> Broadcas { type Element = R; fn bget(&self, index: [usize; DIM]) -> Option<Self::Element> { + //~^ ERROR: method not compatible with trait self.reference.bget(index).map(&self.closure) } } diff --git a/tests/ui/const-generics/issues/issue-83765.stderr b/tests/ui/const-generics/issues/issue-83765.stderr index d9956875cf8..c3292314f23 100644 --- a/tests/ui/const-generics/issues/issue-83765.stderr +++ b/tests/ui/const-generics/issues/issue-83765.stderr @@ -17,6 +17,44 @@ LL | trait TensorDimension { | ^^^^^^^^^^^^^^^^^^^^^ = note: see https://rustc-dev-guide.rust-lang.org/overview.html#queries and https://rustc-dev-guide.rust-lang.org/query.html for more information -error: aborting due to 1 previous error +error[E0391]: cycle detected when resolving instance `<LazyUpdim<'_, T, <T as TensorDimension>::DIM, DIM> as TensorDimension>::DIM` + --> $DIR/issue-83765.rs:5:5 + | +LL | const DIM: usize; + | ^^^^^^^^^^^^^^^^ + | +note: ...which requires computing candidate for `<LazyUpdim<'_, T, <T as TensorDimension>::DIM, DIM> as TensorDimension>`... + --> $DIR/issue-83765.rs:4:1 + | +LL | trait TensorDimension { + | ^^^^^^^^^^^^^^^^^^^^^ + = note: ...which again requires resolving instance `<LazyUpdim<'_, T, <T as TensorDimension>::DIM, DIM> as TensorDimension>::DIM`, completing the cycle +note: cycle used when checking that `<impl at $DIR/issue-83765.rs:56:1: 56:97>` is well-formed + --> $DIR/issue-83765.rs:56:1 + | +LL | impl<'a, T: Broadcastable, const DIM: usize> Broadcastable for LazyUpdim<'a, T, { T::DIM }, DIM> { + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + = note: see https://rustc-dev-guide.rust-lang.org/overview.html#queries and https://rustc-dev-guide.rust-lang.org/query.html for more information + +error[E0308]: method not compatible with trait + --> $DIR/issue-83765.rs:82:5 + | +LL | fn size(&self) -> [usize; DIM] { + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ expected `Self::DIM`, found `DIM` + | + = note: expected constant `Self::DIM` + found constant `DIM` + +error[E0308]: method not compatible with trait + --> $DIR/issue-83765.rs:92:5 + | +LL | fn bget(&self, index: [usize; DIM]) -> Option<Self::Element> { + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ expected `Self::DIM`, found `DIM` + | + = note: expected constant `Self::DIM` + found constant `DIM` + +error: aborting due to 4 previous errors -For more information about this error, try `rustc --explain E0391`. +Some errors have detailed explanations: E0308, E0391. +For more information about an error, try `rustc --explain E0308`. diff --git a/tests/ui/consts/assoc-const.rs b/tests/ui/consts/assoc-const.rs index f542f2dcb52..021bcb40102 100644 --- a/tests/ui/consts/assoc-const.rs +++ b/tests/ui/consts/assoc-const.rs @@ -6,7 +6,7 @@ trait Nat { } struct Zero; -struct Succ<N>(#[allow(unused_tuple_struct_fields)] N); +struct Succ<N>(#[allow(dead_code)] N); impl Nat for Zero { const VALUE: usize = 0; diff --git a/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.rs b/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.rs index 6c4f0a5accf..95fb9ef4260 100644 --- a/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.rs +++ b/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.rs @@ -1,15 +1,12 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![feature(const_extern_fn)] -const unsafe extern "C" fn foo() -> usize { 5 } +const unsafe extern "C" fn foo() -> usize { + 5 +} fn main() { let a: [u8; foo()]; - //[mir]~^ call to unsafe function is unsafe and requires unsafe function or block - //[thir]~^^ call to unsafe function `foo` is unsafe and requires unsafe function or block + //~^ call to unsafe function `foo` is unsafe and requires unsafe function or block foo(); - //[mir]~^ ERROR call to unsafe function is unsafe and requires unsafe function or block - //[thir]~^^ ERROR call to unsafe function `foo` is unsafe and requires unsafe function or block + //~^ ERROR call to unsafe function `foo` is unsafe and requires unsafe function or block } diff --git a/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.stderr b/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.stderr new file mode 100644 index 00000000000..6f59b2f2055 --- /dev/null +++ b/tests/ui/consts/const-extern-fn/const-extern-fn-requires-unsafe.stderr @@ -0,0 +1,19 @@ +error[E0133]: call to unsafe function `foo` is unsafe and requires unsafe function or block + --> $DIR/const-extern-fn-requires-unsafe.rs:10:5 + | +LL | foo(); + | ^^^^^ call to unsafe function + | + = note: consult the function's documentation for information on how to avoid undefined behavior + +error[E0133]: call to unsafe function `foo` is unsafe and requires unsafe function or block + --> $DIR/const-extern-fn-requires-unsafe.rs:8:17 + | +LL | let a: [u8; foo()]; + | ^^^^^ call to unsafe function + | + = note: consult the function's documentation for information on how to avoid undefined behavior + +error: aborting due to 2 previous errors + +For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/consts/const-needs_drop.rs b/tests/ui/consts/const-needs_drop.rs index 11ee7084ce8..bf622e38939 100644 --- a/tests/ui/consts/const-needs_drop.rs +++ b/tests/ui/consts/const-needs_drop.rs @@ -2,10 +2,10 @@ use std::mem; -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Trivial(u8, f32); -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct NonTrivial(u8, String); const CONST_U8: bool = mem::needs_drop::<u8>(); diff --git a/tests/ui/consts/const-size_of_val-align_of_val.rs b/tests/ui/consts/const-size_of_val-align_of_val.rs index e8323e4ae60..cd678176761 100644 --- a/tests/ui/consts/const-size_of_val-align_of_val.rs +++ b/tests/ui/consts/const-size_of_val-align_of_val.rs @@ -5,7 +5,7 @@ use std::{mem, ptr}; -struct Foo(#[allow(unused_tuple_struct_fields)] u32); +struct Foo(#[allow(dead_code)] u32); #[derive(Clone, Copy)] struct Bar { diff --git a/tests/ui/consts/const-unsized.stderr b/tests/ui/consts/const-unsized.stderr index 674f0cb99e7..f70c9b2e077 100644 --- a/tests/ui/consts/const-unsized.stderr +++ b/tests/ui/consts/const-unsized.stderr @@ -6,39 +6,23 @@ LL | const CONST_0: dyn Debug + Sync = *(&0 as &(dyn Debug + Sync)); | = help: the trait `Sized` is not implemented for `(dyn Debug + Sync + 'static)` -error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/const-unsized.rs:7:18 - | -LL | const CONST_FOO: str = *"foo"; - | ^^^ doesn't have a size known at compile-time - | - = help: the trait `Sized` is not implemented for `str` - error[E0277]: the size for values of type `(dyn Debug + Sync + 'static)` cannot be known at compilation time - --> $DIR/const-unsized.rs:11:18 + --> $DIR/const-unsized.rs:3:35 | -LL | static STATIC_1: dyn Debug + Sync = *(&1 as &(dyn Debug + Sync)); - | ^^^^^^^^^^^^^^^^ doesn't have a size known at compile-time +LL | const CONST_0: dyn Debug + Sync = *(&0 as &(dyn Debug + Sync)); + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^ doesn't have a size known at compile-time | = help: the trait `Sized` is not implemented for `(dyn Debug + Sync + 'static)` + = note: constant expressions must have a statically known size error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/const-unsized.rs:15:20 + --> $DIR/const-unsized.rs:7:18 | -LL | static STATIC_BAR: str = *"bar"; - | ^^^ doesn't have a size known at compile-time +LL | const CONST_FOO: str = *"foo"; + | ^^^ doesn't have a size known at compile-time | = help: the trait `Sized` is not implemented for `str` -error[E0277]: the size for values of type `(dyn Debug + Sync + 'static)` cannot be known at compilation time - --> $DIR/const-unsized.rs:3:35 - | -LL | const CONST_0: dyn Debug + Sync = *(&0 as &(dyn Debug + Sync)); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^ doesn't have a size known at compile-time - | - = help: the trait `Sized` is not implemented for `(dyn Debug + Sync + 'static)` - = note: constant expressions must have a statically known size - error[E0277]: the size for values of type `str` cannot be known at compilation time --> $DIR/const-unsized.rs:7:24 | @@ -49,6 +33,14 @@ LL | const CONST_FOO: str = *"foo"; = note: constant expressions must have a statically known size error[E0277]: the size for values of type `(dyn Debug + Sync + 'static)` cannot be known at compilation time + --> $DIR/const-unsized.rs:11:18 + | +LL | static STATIC_1: dyn Debug + Sync = *(&1 as &(dyn Debug + Sync)); + | ^^^^^^^^^^^^^^^^ doesn't have a size known at compile-time + | + = help: the trait `Sized` is not implemented for `(dyn Debug + Sync + 'static)` + +error[E0277]: the size for values of type `(dyn Debug + Sync + 'static)` cannot be known at compilation time --> $DIR/const-unsized.rs:11:37 | LL | static STATIC_1: dyn Debug + Sync = *(&1 as &(dyn Debug + Sync)); @@ -58,6 +50,14 @@ LL | static STATIC_1: dyn Debug + Sync = *(&1 as &(dyn Debug + Sync)); = note: constant expressions must have a statically known size error[E0277]: the size for values of type `str` cannot be known at compilation time + --> $DIR/const-unsized.rs:15:20 + | +LL | static STATIC_BAR: str = *"bar"; + | ^^^ doesn't have a size known at compile-time + | + = help: the trait `Sized` is not implemented for `str` + +error[E0277]: the size for values of type `str` cannot be known at compilation time --> $DIR/const-unsized.rs:15:26 | LL | static STATIC_BAR: str = *"bar"; diff --git a/tests/ui/consts/const_in_pattern/null-raw-ptr-issue-119270.rs b/tests/ui/consts/const_in_pattern/null-raw-ptr-issue-119270.rs index 03e91f2b3b1..436a2d0de74 100644 --- a/tests/ui/consts/const_in_pattern/null-raw-ptr-issue-119270.rs +++ b/tests/ui/consts/const_in_pattern/null-raw-ptr-issue-119270.rs @@ -1,7 +1,7 @@ // run-pass // Eventually this will be rejected (when the future-compat lints are turned into hard errors), and // then this test can be removed. But meanwhile we should ensure that this works and does not ICE. -struct NoDerive(i32); +struct NoDerive(#[allow(dead_code)] i32); #[derive(PartialEq)] struct WrapEmbedded(*const NoDerive); diff --git a/tests/ui/consts/const_in_pattern/warn_corner_cases.rs b/tests/ui/consts/const_in_pattern/warn_corner_cases.rs index 15cf3c84d85..d23d85335f8 100644 --- a/tests/ui/consts/const_in_pattern/warn_corner_cases.rs +++ b/tests/ui/consts/const_in_pattern/warn_corner_cases.rs @@ -15,7 +15,7 @@ #![warn(indirect_structural_match)] #[derive(Copy, Clone, Debug)] -struct NoDerive(#[allow(unused_tuple_struct_fields)] u32); +struct NoDerive(#[allow(dead_code)] u32); // This impl makes `NoDerive` irreflexive. impl PartialEq for NoDerive { fn eq(&self, _: &Self) -> bool { false } } diff --git a/tests/ui/consts/issue-16538.mir.stderr b/tests/ui/consts/issue-16538.mir.stderr deleted file mode 100644 index e320df4b7ad..00000000000 --- a/tests/ui/consts/issue-16538.mir.stderr +++ /dev/null @@ -1,29 +0,0 @@ -error[E0015]: cannot call non-const fn `Y::foo` in statics - --> $DIR/issue-16538.rs:14:23 - | -LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^ - | - = note: calls in statics are limited to constant functions, tuple structs and tuple variants - = note: consider wrapping this expression in `Lazy::new(|| ...)` from the `once_cell` crate: https://crates.io/crates/once_cell - -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-16538.rs:14:30 - | -LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); - | ^^^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-16538.rs:14:21 - | -LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 3 previous errors - -Some errors have detailed explanations: E0015, E0133. -For more information about an error, try `rustc --explain E0015`. diff --git a/tests/ui/consts/issue-16538.rs b/tests/ui/consts/issue-16538.rs index 270fa301414..31f334fb405 100644 --- a/tests/ui/consts/issue-16538.rs +++ b/tests/ui/consts/issue-16538.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - mod Y { pub type X = usize; extern "C" { diff --git a/tests/ui/consts/issue-16538.thir.stderr b/tests/ui/consts/issue-16538.stderr index 4a862869274..834ffa8d3a0 100644 --- a/tests/ui/consts/issue-16538.thir.stderr +++ b/tests/ui/consts/issue-16538.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-16538.rs:14:22 + --> $DIR/issue-16538.rs:11:22 | LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^ dereference of raw pointer @@ -7,7 +7,7 @@ LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-16538.rs:14:30 + --> $DIR/issue-16538.rs:11:30 | LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); | ^^^^ use of extern static @@ -15,7 +15,7 @@ LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior error[E0015]: cannot call non-const fn `Y::foo` in statics - --> $DIR/issue-16538.rs:14:23 + --> $DIR/issue-16538.rs:11:23 | LL | static foo: &Y::X = &*Y::foo(Y::x as *const Y::X); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^ diff --git a/tests/ui/consts/issue-39974.stderr b/tests/ui/consts/issue-39974.stderr index 4bde599039e..114c4cfeaf7 100644 --- a/tests/ui/consts/issue-39974.stderr +++ b/tests/ui/consts/issue-39974.stderr @@ -1,10 +1,4 @@ error[E0308]: mismatched types - --> $DIR/issue-39974.rs:5:19 - | -LL | f: [[f64; 2]; LENGTH], - | ^^^^^^ expected `usize`, found `f64` - -error[E0308]: mismatched types --> $DIR/issue-39974.rs:1:21 | LL | const LENGTH: f64 = 2; @@ -13,6 +7,12 @@ LL | const LENGTH: f64 = 2; | expected `f64`, found integer | help: use a float literal: `2.0` +error[E0308]: mismatched types + --> $DIR/issue-39974.rs:5:19 + | +LL | f: [[f64; 2]; LENGTH], + | ^^^^^^ expected `usize`, found `f64` + error: aborting due to 2 previous errors For more information about this error, try `rustc --explain E0308`. diff --git a/tests/ui/consts/issue-70773-mir-typeck-lt-norm.rs b/tests/ui/consts/issue-70773-mir-typeck-lt-norm.rs index dd56faa3185..f82ec005a01 100644 --- a/tests/ui/consts/issue-70773-mir-typeck-lt-norm.rs +++ b/tests/ui/consts/issue-70773-mir-typeck-lt-norm.rs @@ -1,7 +1,7 @@ // run-pass const HASH_LEN: usize = 20; -struct Hash(#[allow(unused_tuple_struct_fields)] [u8; HASH_LEN]); +struct Hash(#[allow(dead_code)] [u8; HASH_LEN]); fn init_hash(_: &mut [u8; HASH_LEN]) {} fn foo<'a>() -> &'a () { diff --git a/tests/ui/consts/promoted_const_call4.rs b/tests/ui/consts/promoted_const_call4.rs index 82a17b7bf86..bb97957179f 100644 --- a/tests/ui/consts/promoted_const_call4.rs +++ b/tests/ui/consts/promoted_const_call4.rs @@ -4,7 +4,7 @@ use std::sync::atomic::*; static FLAG: AtomicBool = AtomicBool::new(false); -struct NoisyDrop(&'static str); +struct NoisyDrop(#[allow(dead_code)] &'static str); impl Drop for NoisyDrop { fn drop(&mut self) { FLAG.store(true, Ordering::SeqCst); diff --git a/tests/ui/consts/rvalue-static-promotion.rs b/tests/ui/consts/rvalue-static-promotion.rs index c48d9eae928..f42e8b70593 100644 --- a/tests/ui/consts/rvalue-static-promotion.rs +++ b/tests/ui/consts/rvalue-static-promotion.rs @@ -4,7 +4,7 @@ use std::cell::Cell; const NONE_CELL_STRING: Option<Cell<String>> = None; -struct Foo<T>(#[allow(unused_tuple_struct_fields)] T); +struct Foo<T>(#[allow(dead_code)] T); impl<T> Foo<T> { const FOO: Option<Box<T>> = None; } diff --git a/tests/ui/consts/transmute-const.rs b/tests/ui/consts/transmute-const.rs index c5c3dfc4cc7..65e5700d083 100644 --- a/tests/ui/consts/transmute-const.rs +++ b/tests/ui/consts/transmute-const.rs @@ -3,7 +3,7 @@ use std::mem; #[repr(transparent)] -struct Foo(#[allow(unused_tuple_struct_fields)] u32); +struct Foo(#[allow(dead_code)] u32); const TRANSMUTED_U32: u32 = unsafe { mem::transmute(Foo(3)) }; diff --git a/tests/ui/coroutine/gen_block.e2024.stderr b/tests/ui/coroutine/gen_block.e2024.stderr index f250e2f79c7..e32f80dafa0 100644 --- a/tests/ui/coroutine/gen_block.e2024.stderr +++ b/tests/ui/coroutine/gen_block.e2024.stderr @@ -8,10 +8,10 @@ LL | let _ = || yield true; = help: add `#![feature(coroutines)]` to the crate attributes to enable error[E0282]: type annotations needed - --> $DIR/gen_block.rs:6:17 + --> $DIR/gen_block.rs:6:13 | LL | let x = gen {}; - | ^^ cannot infer type + | ^^^^^^ cannot infer type error: aborting due to 2 previous errors diff --git a/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.mir.stderr b/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.mir.stderr deleted file mode 100644 index 11dc57bcf46..00000000000 --- a/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45729-unsafe-in-coroutine.rs:8:9 - | -LL | *(1 as *mut u32) = 42; - | ^^^^^^^^^^^^^^^^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.rs b/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.rs index 7961b58597c..dab9c81bc8f 100644 --- a/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.rs +++ b/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![feature(coroutines)] fn main() { diff --git a/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.thir.stderr b/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.stderr index a61689a0df5..19949b42939 100644 --- a/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.thir.stderr +++ b/tests/ui/coroutine/issue-45729-unsafe-in-coroutine.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45729-unsafe-in-coroutine.rs:8:9 + --> $DIR/issue-45729-unsafe-in-coroutine.rs:5:9 | LL | *(1 as *mut u32) = 42; | ^^^^^^^^^^^^^^^^ dereference of raw pointer diff --git a/tests/ui/coroutine/size-moved-locals.rs b/tests/ui/coroutine/size-moved-locals.rs index 10f988cc066..fa657e3b275 100644 --- a/tests/ui/coroutine/size-moved-locals.rs +++ b/tests/ui/coroutine/size-moved-locals.rs @@ -18,7 +18,7 @@ use std::ops::Coroutine; const FOO_SIZE: usize = 1024; -struct Foo(#[allow(unused_tuple_struct_fields)] [u8; FOO_SIZE]); +struct Foo(#[allow(dead_code)] [u8; FOO_SIZE]); impl Drop for Foo { fn drop(&mut self) {} diff --git a/tests/ui/coroutine/sized-yield.stderr b/tests/ui/coroutine/sized-yield.stderr index 40663ac12de..bbecaffa95a 100644 --- a/tests/ui/coroutine/sized-yield.stderr +++ b/tests/ui/coroutine/sized-yield.stderr @@ -1,8 +1,8 @@ error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/sized-yield.rs:8:27 + --> $DIR/sized-yield.rs:8:19 | LL | let mut gen = move || { - | ___________________________^ + | ___________________^ LL | | LL | | yield s[..]; LL | | }; diff --git a/tests/ui/coroutine/static-mut-reference-across-yield.rs b/tests/ui/coroutine/static-mut-reference-across-yield.rs index 07f810856a7..0ed849e0e7d 100644 --- a/tests/ui/coroutine/static-mut-reference-across-yield.rs +++ b/tests/ui/coroutine/static-mut-reference-across-yield.rs @@ -1,6 +1,4 @@ // build-pass -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![feature(coroutines)] diff --git a/tests/ui/derive-uninhabited-enum-38885.rs b/tests/ui/derive-uninhabited-enum-38885.rs index 0089453ef0f..c11df030025 100644 --- a/tests/ui/derive-uninhabited-enum-38885.rs +++ b/tests/ui/derive-uninhabited-enum-38885.rs @@ -9,7 +9,7 @@ enum Void {} #[derive(Debug)] enum Foo { - Bar(u8), + Bar(#[allow(dead_code)] u8), Void(Void), //~ WARN variant `Void` is never constructed } diff --git a/tests/ui/derive-uninhabited-enum-38885.stderr b/tests/ui/derive-uninhabited-enum-38885.stderr index 3fabf446dc3..bcd8f6b7b53 100644 --- a/tests/ui/derive-uninhabited-enum-38885.stderr +++ b/tests/ui/derive-uninhabited-enum-38885.stderr @@ -3,7 +3,7 @@ warning: variant `Void` is never constructed | LL | enum Foo { | --- variant in this enum -LL | Bar(u8), +LL | Bar(#[allow(dead_code)] u8), LL | Void(Void), | ^^^^ | diff --git a/tests/ui/deriving/deriving-clone-generic-tuple-struct.rs b/tests/ui/deriving/deriving-clone-generic-tuple-struct.rs index 3480ccc1089..331d7298216 100644 --- a/tests/ui/deriving/deriving-clone-generic-tuple-struct.rs +++ b/tests/ui/deriving/deriving-clone-generic-tuple-struct.rs @@ -2,7 +2,7 @@ // pretty-expanded FIXME #23616 #[derive(Clone)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S<T>(T, ()); pub fn main() { diff --git a/tests/ui/deriving/deriving-copyclone.rs b/tests/ui/deriving/deriving-copyclone.rs index f8403b1feac..099feceae81 100644 --- a/tests/ui/deriving/deriving-copyclone.rs +++ b/tests/ui/deriving/deriving-copyclone.rs @@ -23,7 +23,7 @@ impl Clone for Liar { /// This struct is actually Copy... at least, it thinks it is! #[derive(Copy, Clone)] -struct Innocent(#[allow(unused_tuple_struct_fields)] Liar); +struct Innocent(#[allow(dead_code)] Liar); impl Innocent { fn new() -> Self { diff --git a/tests/ui/deriving/issue-58319.rs b/tests/ui/deriving/issue-58319.rs index 8041bd5bb3c..754f5032d16 100644 --- a/tests/ui/deriving/issue-58319.rs +++ b/tests/ui/deriving/issue-58319.rs @@ -3,7 +3,7 @@ fn main() {} #[derive(Clone)] pub struct Little; #[derive(Clone)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] pub struct Big( Little, Little, diff --git a/tests/ui/diagnostic-width/flag-json.rs b/tests/ui/diagnostic-width/flag-json.rs index 51a1fb447c7..820f1a049e1 100644 --- a/tests/ui/diagnostic-width/flag-json.rs +++ b/tests/ui/diagnostic-width/flag-json.rs @@ -1,9 +1,9 @@ // compile-flags: --diagnostic-width=20 --error-format=json +// error-pattern:expected `()`, found integer // This test checks that `-Z output-width` effects the JSON error output by restricting it to an // arbitrarily low value so that the effect is visible. fn main() { let _: () = 42; - //~^ ERROR arguments to this function are incorrect } diff --git a/tests/ui/diagnostic-width/flag-json.stderr b/tests/ui/diagnostic-width/flag-json.stderr index f3bf4f97942..0a4b54ebc85 100644 --- a/tests/ui/diagnostic-width/flag-json.stderr +++ b/tests/ui/diagnostic-width/flag-json.stderr @@ -24,8 +24,8 @@ This error occurs when an expression was used in a place where the compiler expected an expression of a different type. It can occur in several cases, the most common being when calling a function and passing an argument which has a different type than the matching type in the function declaration. -"},"level":"error","spans":[{"file_name":"$DIR/flag-json.rs","byte_start":243,"byte_end":245,"line_start":7,"line_end":7,"column_start":17,"column_end":19,"is_primary":true,"text":[{"text":" let _: () = 42;","highlight_start":17,"highlight_end":19}],"label":"expected `()`, found integer","suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/flag-json.rs","byte_start":238,"byte_end":240,"line_start":7,"line_end":7,"column_start":12,"column_end":14,"is_primary":false,"text":[{"text":" let _: () = 42;","highlight_start":12,"highlight_end":14}],"label":"expected due to this","suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[],"rendered":"error[E0308]: mismatched types - --> $DIR/flag-json.rs:7:17 +"},"level":"error","spans":[{"file_name":"$DIR/flag-json.rs","byte_start":289,"byte_end":291,"line_start":8,"line_end":8,"column_start":17,"column_end":19,"is_primary":true,"text":[{"text":" let _: () = 42;","highlight_start":17,"highlight_end":19}],"label":"expected `()`, found integer","suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/flag-json.rs","byte_start":284,"byte_end":286,"line_start":8,"line_end":8,"column_start":12,"column_end":14,"is_primary":false,"text":[{"text":" let _: () = 42;","highlight_start":12,"highlight_end":14}],"label":"expected due to this","suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[],"rendered":"error[E0308]: mismatched types + --> $DIR/flag-json.rs:8:17 | LL | ..._: () = 42; | -- ^^ expected `()`, found integer diff --git a/tests/ui/drop/dropck-eyepatch-reorder.rs b/tests/ui/drop/dropck-eyepatch-reorder.rs index 0d7af3d4f61..4a56c45aa92 100644 --- a/tests/ui/drop/dropck-eyepatch-reorder.rs +++ b/tests/ui/drop/dropck-eyepatch-reorder.rs @@ -12,10 +12,10 @@ trait Foo { fn foo(&self, _: &str); } struct Dt<A: Foo>(&'static str, A); struct Dr<'a, B:'a+Foo>(&'static str, &'a B); -struct Pt<A: Foo, B: Foo>(&'static str, #[allow(unused_tuple_struct_fields)] A, B); -struct Pr<'a, 'b, B:'a+'b+Foo>(&'static str, #[allow(unused_tuple_struct_fields)] &'a B, &'b B); -struct St<A: Foo>(&'static str, #[allow(unused_tuple_struct_fields)] A); -struct Sr<'a, B:'a+Foo>(&'static str, #[allow(unused_tuple_struct_fields)] &'a B); +struct Pt<A: Foo, B: Foo>(&'static str, #[allow(dead_code)] A, B); +struct Pr<'a, 'b, B:'a+'b+Foo>(&'static str, #[allow(dead_code)] &'a B, &'b B); +struct St<A: Foo>(&'static str, #[allow(dead_code)] A); +struct Sr<'a, B:'a+Foo>(&'static str, #[allow(dead_code)] &'a B); impl<A: Foo> Drop for Dt<A> { fn drop(&mut self) { println!("drop {}", self.0); self.1.foo(self.0); } diff --git a/tests/ui/drop/dropck-eyepatch.rs b/tests/ui/drop/dropck-eyepatch.rs index 3c4840d5c7a..ff5a52b906b 100644 --- a/tests/ui/drop/dropck-eyepatch.rs +++ b/tests/ui/drop/dropck-eyepatch.rs @@ -35,10 +35,10 @@ trait Foo { fn foo(&self, _: &str); } struct Dt<A: Foo>(&'static str, A); struct Dr<'a, B:'a+Foo>(&'static str, &'a B); -struct Pt<A,B: Foo>(&'static str, #[allow(unused_tuple_struct_fields)] A, B); -struct Pr<'a, 'b, B:'a+'b+Foo>(&'static str, #[allow(unused_tuple_struct_fields)] &'a B, &'b B); -struct St<A: Foo>(&'static str, #[allow(unused_tuple_struct_fields)] A); -struct Sr<'a, B:'a+Foo>(&'static str, #[allow(unused_tuple_struct_fields)] &'a B); +struct Pt<A,B: Foo>(&'static str, #[allow(dead_code)] A, B); +struct Pr<'a, 'b, B:'a+'b+Foo>(&'static str, #[allow(dead_code)] &'a B, &'b B); +struct St<A: Foo>(&'static str, #[allow(dead_code)] A); +struct Sr<'a, B:'a+Foo>(&'static str, #[allow(dead_code)] &'a B); impl<A: Foo> Drop for Dt<A> { fn drop(&mut self) { println!("drop {}", self.0); self.1.foo(self.0); } diff --git a/tests/ui/drop/dynamic-drop.rs b/tests/ui/drop/dynamic-drop.rs index d35913ed641..4745cceb516 100644 --- a/tests/ui/drop/dynamic-drop.rs +++ b/tests/ui/drop/dynamic-drop.rs @@ -103,7 +103,7 @@ fn dynamic_drop(a: &Allocator, c: bool) { }; } -struct TwoPtrs<'a>(Ptr<'a>, #[allow(unused_tuple_struct_fields)] Ptr<'a>); +struct TwoPtrs<'a>(Ptr<'a>, #[allow(dead_code)] Ptr<'a>); fn struct_dynamic_drop(a: &Allocator, c0: bool, c1: bool, c: bool) { for i in 0..2 { let x; diff --git a/tests/ui/dropck/issue-24805-dropck-itemless.rs b/tests/ui/dropck/issue-24805-dropck-itemless.rs index 45761b61c3e..4d71389351b 100644 --- a/tests/ui/dropck/issue-24805-dropck-itemless.rs +++ b/tests/ui/dropck/issue-24805-dropck-itemless.rs @@ -19,7 +19,7 @@ impl<'a, T> UserDefined for &'a T { } // ``` macro_rules! impl_drop { ($Bound:ident, $Id:ident) => { - struct $Id<T: $Bound>(#[allow(unused_tuple_struct_fields)] T); + struct $Id<T: $Bound>(#[allow(dead_code)] T); unsafe impl <#[may_dangle] T: $Bound> Drop for $Id<T> { fn drop(&mut self) { } } diff --git a/tests/ui/dropck/issue-28498-ugeh-with-passed-to-fn.rs b/tests/ui/dropck/issue-28498-ugeh-with-passed-to-fn.rs index 04d0d32033a..d2b620f6940 100644 --- a/tests/ui/dropck/issue-28498-ugeh-with-passed-to-fn.rs +++ b/tests/ui/dropck/issue-28498-ugeh-with-passed-to-fn.rs @@ -21,7 +21,7 @@ impl Drop for ScribbleOnDrop { } } -struct Foo<T>(u32, T, #[allow(unused_tuple_struct_fields)] Box<for <'r> fn(&'r T) -> String>); +struct Foo<T>(u32, T, #[allow(dead_code)] Box<for <'r> fn(&'r T) -> String>); unsafe impl<#[may_dangle] T> Drop for Foo<T> { fn drop(&mut self) { diff --git a/tests/ui/dyn-star/drop.rs b/tests/ui/dyn-star/drop.rs index 1478498c0a9..1acfe2f2d1c 100644 --- a/tests/ui/dyn-star/drop.rs +++ b/tests/ui/dyn-star/drop.rs @@ -6,7 +6,7 @@ use std::fmt::Debug; #[derive(Debug)] -struct Foo(usize); +struct Foo(#[allow(dead_code)] usize); impl Drop for Foo { fn drop(&mut self) { diff --git a/tests/ui/enum-discriminant/discriminant_value-wrapper.rs b/tests/ui/enum-discriminant/discriminant_value-wrapper.rs index 8e162d5c455..1f6bb0cdc3a 100644 --- a/tests/ui/enum-discriminant/discriminant_value-wrapper.rs +++ b/tests/ui/enum-discriminant/discriminant_value-wrapper.rs @@ -4,7 +4,7 @@ use std::mem; -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] enum ADT { First(u32, u32), Second(u64) diff --git a/tests/ui/enum-discriminant/discriminant_value.rs b/tests/ui/enum-discriminant/discriminant_value.rs index f3dfac298ad..2864cd40da0 100644 --- a/tests/ui/enum-discriminant/discriminant_value.rs +++ b/tests/ui/enum-discriminant/discriminant_value.rs @@ -27,14 +27,14 @@ enum CLike3 { D } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] enum ADT { First(u32, u32), Second(u64) } enum NullablePointer { - Something(#[allow(unused_tuple_struct_fields)] &'static u32), + Something(#[allow(dead_code)] &'static u32), Nothing } diff --git a/tests/ui/error-codes/E0133.mir.stderr b/tests/ui/error-codes/E0133.mir.stderr deleted file mode 100644 index f8703ef0633..00000000000 --- a/tests/ui/error-codes/E0133.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/E0133.rs:7:5 - | -LL | f(); - | ^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/error-codes/E0133.rs b/tests/ui/error-codes/E0133.rs index dee1475ba21..52494ce6078 100644 --- a/tests/ui/error-codes/E0133.rs +++ b/tests/ui/error-codes/E0133.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - unsafe fn f() { return; } fn main() { diff --git a/tests/ui/error-codes/E0133.thir.stderr b/tests/ui/error-codes/E0133.stderr index fd4d42bcb8b..5e3e49fb644 100644 --- a/tests/ui/error-codes/E0133.thir.stderr +++ b/tests/ui/error-codes/E0133.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `f` is unsafe and requires unsafe function or block - --> $DIR/E0133.rs:7:5 + --> $DIR/E0133.rs:4:5 | LL | f(); | ^^^ call to unsafe function diff --git a/tests/ui/extern/issue-28324.mir.stderr b/tests/ui/extern/issue-28324.mir.stderr deleted file mode 100644 index 9376ac35e21..00000000000 --- a/tests/ui/extern/issue-28324.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-28324.rs:8:24 - | -LL | pub static BAZ: u32 = *&error_message_count; - | ^^^^^^^^^^^^^^^^^^^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/extern/issue-28324.rs b/tests/ui/extern/issue-28324.rs index fbe83e325ed..f74726e8166 100644 --- a/tests/ui/extern/issue-28324.rs +++ b/tests/ui/extern/issue-28324.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - extern "C" { static error_message_count: u32; } diff --git a/tests/ui/extern/issue-28324.thir.stderr b/tests/ui/extern/issue-28324.stderr index 8857f379ad1..94ff2131993 100644 --- a/tests/ui/extern/issue-28324.thir.stderr +++ b/tests/ui/extern/issue-28324.stderr @@ -1,5 +1,5 @@ error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-28324.rs:8:25 + --> $DIR/issue-28324.rs:5:25 | LL | pub static BAZ: u32 = *&error_message_count; | ^^^^^^^^^^^^^^^^^^^ use of extern static diff --git a/tests/ui/feature-gates/feature-gate-gen_blocks.e2024.stderr b/tests/ui/feature-gates/feature-gate-gen_blocks.e2024.stderr index c582ca7ba3d..526354f6cfb 100644 --- a/tests/ui/feature-gates/feature-gate-gen_blocks.e2024.stderr +++ b/tests/ui/feature-gates/feature-gate-gen_blocks.e2024.stderr @@ -35,16 +35,16 @@ LL | async gen {}; = help: add `#![feature(gen_blocks)]` to the crate attributes to enable error[E0282]: type annotations needed - --> $DIR/feature-gate-gen_blocks.rs:5:9 + --> $DIR/feature-gate-gen_blocks.rs:5:5 | LL | gen {}; - | ^^ cannot infer type + | ^^^^^^ cannot infer type error[E0282]: type annotations needed - --> $DIR/feature-gate-gen_blocks.rs:12:15 + --> $DIR/feature-gate-gen_blocks.rs:12:5 | LL | async gen {}; - | ^^ cannot infer type + | ^^^^^^^^^^^^ cannot infer type error: aborting due to 6 previous errors diff --git a/tests/ui/feature-gates/feature-gate-unsized_fn_params.stderr b/tests/ui/feature-gates/feature-gate-unsized_fn_params.stderr index 92c71392672..b11c30eaad4 100644 --- a/tests/ui/feature-gates/feature-gate-unsized_fn_params.stderr +++ b/tests/ui/feature-gates/feature-gate-unsized_fn_params.stderr @@ -29,8 +29,8 @@ LL | fn bar(x: impl Foo) { | ++++ help: function arguments must have a statically known size, borrowed types always have a known size | -LL | fn bar(x: &Foo) { - | + +LL | fn bar(x: &dyn Foo) { + | ++++ error[E0277]: the size for values of type `[()]` cannot be known at compilation time --> $DIR/feature-gate-unsized_fn_params.rs:25:8 @@ -40,7 +40,7 @@ LL | fn qux(_: [()]) {} | = help: the trait `Sized` is not implemented for `[()]` = help: unsized fn params are gated as an unstable feature -help: function arguments must have a statically known size, borrowed types always have a known size +help: function arguments must have a statically known size, borrowed slices always have a known size | LL | fn qux(_: &[()]) {} | + diff --git a/tests/ui/generic-associated-types/issue-84931.stderr b/tests/ui/generic-associated-types/issue-84931.stderr index 04e14b9c746..71d112277a3 100644 --- a/tests/ui/generic-associated-types/issue-84931.stderr +++ b/tests/ui/generic-associated-types/issue-84931.stderr @@ -1,16 +1,3 @@ -error[E0309]: the parameter type `T` may not live long enough - --> $DIR/issue-84931.rs:14:21 - | -LL | type Item<'a> = &'a mut T; - | -- ^^^^^^^^^ ...so that the reference type `&'a mut T` does not outlive the data it points at - | | - | the parameter type `T` must be valid for the lifetime `'a` as defined here... - | -help: consider adding an explicit lifetime bound - | -LL | type Item<'a> = &'a mut T where T: 'a; - | +++++++++++ - error[E0477]: the type `StreamingSliceIter<'b, T>` does not fulfill the required lifetime --> $DIR/issue-84931.rs:14:21 | @@ -30,6 +17,19 @@ help: copy the `where` clause predicates from the trait LL | type Item<'a> = &'a mut T where Self: 'a; | ++++++++++++++ +error[E0309]: the parameter type `T` may not live long enough + --> $DIR/issue-84931.rs:14:21 + | +LL | type Item<'a> = &'a mut T; + | -- ^^^^^^^^^ ...so that the reference type `&'a mut T` does not outlive the data it points at + | | + | the parameter type `T` must be valid for the lifetime `'a` as defined here... + | +help: consider adding an explicit lifetime bound + | +LL | type Item<'a> = &'a mut T where T: 'a; + | +++++++++++ + error: aborting due to 2 previous errors Some errors have detailed explanations: E0309, E0477. diff --git a/tests/ui/generic-associated-types/unsatisfied-item-lifetime-bound.stderr b/tests/ui/generic-associated-types/unsatisfied-item-lifetime-bound.stderr index f73ed5956da..8d21b9172c8 100644 --- a/tests/ui/generic-associated-types/unsatisfied-item-lifetime-bound.stderr +++ b/tests/ui/generic-associated-types/unsatisfied-item-lifetime-bound.stderr @@ -12,6 +12,26 @@ LL | #![warn(unused_lifetimes)] | ^^^^^^^^^^^^^^^^ error[E0478]: lifetime bound not satisfied + --> $DIR/unsatisfied-item-lifetime-bound.rs:9:18 + | +LL | type Y<'a: 'static>; + | ------------------- definition of `Y` from trait +... +LL | type Y<'a> = &'a (); + | ^^^^^^ + | +note: lifetime parameter instantiated with the lifetime `'a` as defined here + --> $DIR/unsatisfied-item-lifetime-bound.rs:9:12 + | +LL | type Y<'a> = &'a (); + | ^^ + = note: but lifetime parameter must outlive the static lifetime +help: copy the `where` clause predicates from the trait + | +LL | type Y<'a> = &'a () where 'a: 'static; + | +++++++++++++++++ + +error[E0478]: lifetime bound not satisfied --> $DIR/unsatisfied-item-lifetime-bound.rs:14:8 | LL | f: <T as X>::Y<'a>, @@ -50,26 +70,6 @@ LL | struct D<'a> { | ^^ = note: but lifetime parameter must outlive the static lifetime -error[E0478]: lifetime bound not satisfied - --> $DIR/unsatisfied-item-lifetime-bound.rs:9:18 - | -LL | type Y<'a: 'static>; - | ------------------- definition of `Y` from trait -... -LL | type Y<'a> = &'a (); - | ^^^^^^ - | -note: lifetime parameter instantiated with the lifetime `'a` as defined here - --> $DIR/unsatisfied-item-lifetime-bound.rs:9:12 - | -LL | type Y<'a> = &'a (); - | ^^ - = note: but lifetime parameter must outlive the static lifetime -help: copy the `where` clause predicates from the trait - | -LL | type Y<'a> = &'a () where 'a: 'static; - | +++++++++++++++++ - error: aborting due to 4 previous errors; 1 warning emitted For more information about this error, try `rustc --explain E0478`. diff --git a/tests/ui/generics/generic-default-type-params-cross-crate.rs b/tests/ui/generics/generic-default-type-params-cross-crate.rs index 834b15be1c5..f798901132b 100644 --- a/tests/ui/generics/generic-default-type-params-cross-crate.rs +++ b/tests/ui/generics/generic-default-type-params-cross-crate.rs @@ -5,7 +5,7 @@ extern crate default_type_params_xc; -struct Vec<T, A = default_type_params_xc::Heap>(#[allow(unused_tuple_struct_fields)] Option<(T,A)>); +struct Vec<T, A = default_type_params_xc::Heap>(#[allow(dead_code)] Option<(T,A)>); struct Foo; diff --git a/tests/ui/generics/generic-ivec-leak.rs b/tests/ui/generics/generic-ivec-leak.rs index 9610bdcb338..7a1d10a646d 100644 --- a/tests/ui/generics/generic-ivec-leak.rs +++ b/tests/ui/generics/generic-ivec-leak.rs @@ -1,5 +1,5 @@ // run-pass #![allow(non_camel_case_types)] -enum wrapper<T> { wrapped(#[allow(unused_tuple_struct_fields)] T), } +enum wrapper<T> { wrapped(#[allow(dead_code)] T), } pub fn main() { let _w = wrapper::wrapped(vec![1, 2, 3, 4, 5]); } diff --git a/tests/ui/generics/generic-newtype-struct.rs b/tests/ui/generics/generic-newtype-struct.rs index aa879f01a58..92523b76f98 100644 --- a/tests/ui/generics/generic-newtype-struct.rs +++ b/tests/ui/generics/generic-newtype-struct.rs @@ -1,7 +1,7 @@ // run-pass // pretty-expanded FIXME #23616 -struct S<T>(#[allow(unused_tuple_struct_fields)] T); +struct S<T>(#[allow(dead_code)] T); pub fn main() { let _s = S(2); diff --git a/tests/ui/generics/generic-no-mangle.fixed b/tests/ui/generics/generic-no-mangle.fixed index 501acb6e163..aa6d6310f5f 100644 --- a/tests/ui/generics/generic-no-mangle.fixed +++ b/tests/ui/generics/generic-no-mangle.fixed @@ -76,7 +76,7 @@ impl<T> Trait2<T> for Foo { fn qux<'a>(x: &'a i32) -> &i32 { x } //~ ERROR functions generic over types or consts must be mangled } -pub struct Bar<T>(#[allow(unused_tuple_struct_fields)] T); +pub struct Bar<T>(#[allow(dead_code)] T); impl<T> Bar<T> { @@ -111,7 +111,7 @@ impl<T> Trait3 for Bar<T> { fn baz<U>() {} //~ ERROR functions generic over types or consts must be mangled } -pub struct Baz<'a>(#[allow(unused_tuple_struct_fields)] &'a i32); +pub struct Baz<'a>(#[allow(dead_code)] &'a i32); impl<'a> Baz<'a> { #[no_mangle] diff --git a/tests/ui/generics/generic-no-mangle.rs b/tests/ui/generics/generic-no-mangle.rs index 74e407078e8..8a59ca75aaf 100644 --- a/tests/ui/generics/generic-no-mangle.rs +++ b/tests/ui/generics/generic-no-mangle.rs @@ -76,7 +76,7 @@ impl<T> Trait2<T> for Foo { fn qux<'a>(x: &'a i32) -> &i32 { x } //~ ERROR functions generic over types or consts must be mangled } -pub struct Bar<T>(#[allow(unused_tuple_struct_fields)] T); +pub struct Bar<T>(#[allow(dead_code)] T); impl<T> Bar<T> { #[no_mangle] @@ -111,7 +111,7 @@ impl<T> Trait3 for Bar<T> { fn baz<U>() {} //~ ERROR functions generic over types or consts must be mangled } -pub struct Baz<'a>(#[allow(unused_tuple_struct_fields)] &'a i32); +pub struct Baz<'a>(#[allow(dead_code)] &'a i32); impl<'a> Baz<'a> { #[no_mangle] diff --git a/tests/ui/generics/generic-recursive-tag.rs b/tests/ui/generics/generic-recursive-tag.rs index b344da1c7dd..5490822975a 100644 --- a/tests/ui/generics/generic-recursive-tag.rs +++ b/tests/ui/generics/generic-recursive-tag.rs @@ -1,7 +1,7 @@ // run-pass #![allow(non_camel_case_types)] -enum list<T> { #[allow(unused_tuple_struct_fields)] cons(Box<T>, Box<list<T>>), nil, } +enum list<T> { #[allow(dead_code)] cons(Box<T>, Box<list<T>>), nil, } pub fn main() { let _a: list<isize> = diff --git a/tests/ui/generics/generic-tag-corruption.rs b/tests/ui/generics/generic-tag-corruption.rs index 35de3c1f712..ae20a94d9fd 100644 --- a/tests/ui/generics/generic-tag-corruption.rs +++ b/tests/ui/generics/generic-tag-corruption.rs @@ -5,6 +5,6 @@ // This used to cause memory corruption in stage 0. // pretty-expanded FIXME #23616 -enum thing<K> { some(#[allow(unused_tuple_struct_fields)] K), } +enum thing<K> { some(#[allow(dead_code)] K), } pub fn main() { let _x = thing::some("hi".to_string()); } diff --git a/tests/ui/generics/generic-tag-local.rs b/tests/ui/generics/generic-tag-local.rs index c5772e84193..121ec74f8b7 100644 --- a/tests/ui/generics/generic-tag-local.rs +++ b/tests/ui/generics/generic-tag-local.rs @@ -3,6 +3,6 @@ // pretty-expanded FIXME #23616 -enum clam<T> { a(#[allow(unused_tuple_struct_fields)] T), } +enum clam<T> { a(#[allow(dead_code)] T), } pub fn main() { let _c = clam::a(3); } diff --git a/tests/ui/generics/generic-tag.rs b/tests/ui/generics/generic-tag.rs index 31fc2178d6d..9e844c72552 100644 --- a/tests/ui/generics/generic-tag.rs +++ b/tests/ui/generics/generic-tag.rs @@ -6,7 +6,7 @@ #![allow(unused_variables)] -enum option<T> { some(#[allow(unused_tuple_struct_fields)] Box<T>), none, } +enum option<T> { some(#[allow(dead_code)] Box<T>), none, } pub fn main() { let mut a: option<isize> = option::some::<isize>(Box::new(10)); diff --git a/tests/ui/half-open-range-patterns/range_pat_interactions2.rs b/tests/ui/half-open-range-patterns/range_pat_interactions2.rs index 4615ebd688a..0e96cfe7858 100644 --- a/tests/ui/half-open-range-patterns/range_pat_interactions2.rs +++ b/tests/ui/half-open-range-patterns/range_pat_interactions2.rs @@ -8,8 +8,7 @@ fn main() { for x in -9 + 1..=(9 - 2) { match x as i32 { 0..=(5+1) => errors_only.push(x), - //~^ error: inclusive range with no end - //~| error: expected one of `=>`, `if`, or `|`, found `(` + //~^ error: expected `)`, found `+` 1 | -3..0 => first_or.push(x), y @ (0..5 | 6) => or_two.push(y), y @ 0..const { 5 + 1 } => assert_eq!(y, 5), diff --git a/tests/ui/half-open-range-patterns/range_pat_interactions2.stderr b/tests/ui/half-open-range-patterns/range_pat_interactions2.stderr index 13a5542a474..a54f29a3b32 100644 --- a/tests/ui/half-open-range-patterns/range_pat_interactions2.stderr +++ b/tests/ui/half-open-range-patterns/range_pat_interactions2.stderr @@ -1,17 +1,8 @@ -error[E0586]: inclusive range with no end - --> $DIR/range_pat_interactions2.rs:10:14 +error: expected `)`, found `+` + --> $DIR/range_pat_interactions2.rs:10:19 | LL | 0..=(5+1) => errors_only.push(x), - | ^^^ help: use `..` instead - | - = note: inclusive ranges must be bounded at the end (`..=b` or `a..=b`) - -error: expected one of `=>`, `if`, or `|`, found `(` - --> $DIR/range_pat_interactions2.rs:10:17 - | -LL | 0..=(5+1) => errors_only.push(x), - | ^ expected one of `=>`, `if`, or `|` + | ^ expected `)` -error: aborting due to 2 previous errors +error: aborting due to 1 previous error -For more information about this error, try `rustc --explain E0586`. diff --git a/tests/ui/impl-trait/bounds_regression.rs b/tests/ui/impl-trait/bounds_regression.rs index f32d83c0c40..89b0e3c55f9 100644 --- a/tests/ui/impl-trait/bounds_regression.rs +++ b/tests/ui/impl-trait/bounds_regression.rs @@ -15,7 +15,7 @@ pub fn future_from_coroutine< GenFuture(x) } -struct GenFuture<T: FakeCoroutine<Yield = ()>>(#[allow(unused_tuple_struct_fields)] T); +struct GenFuture<T: FakeCoroutine<Yield = ()>>(#[allow(dead_code)] T); impl<T: FakeCoroutine<Yield = ()>> FakeFuture for GenFuture<T> { type Output = T::Return; diff --git a/tests/ui/impl-trait/in-trait/cycle-effective-visibilities-during-object-safety.rs b/tests/ui/impl-trait/in-trait/cycle-effective-visibilities-during-object-safety.rs new file mode 100644 index 00000000000..650cb3870d5 --- /dev/null +++ b/tests/ui/impl-trait/in-trait/cycle-effective-visibilities-during-object-safety.rs @@ -0,0 +1,28 @@ +trait Marker {} +impl Marker for u32 {} + +trait MyTrait { + fn foo(&self) -> impl Marker; +} + +struct Outer; + +impl MyTrait for Outer { + fn foo(&self) -> impl Marker { + 42 + } +} + +impl dyn MyTrait { + //~^ ERROR the trait `MyTrait` cannot be made into an object + fn other(&self) -> impl Marker { + //~^ ERROR the trait `MyTrait` cannot be made into an object + MyTrait::foo(&self) + //~^ ERROR the trait bound `&dyn MyTrait: MyTrait` is not satisfied + //~| ERROR the trait bound `&dyn MyTrait: MyTrait` is not satisfied + //~| ERROR the trait bound `&dyn MyTrait: MyTrait` is not satisfied + //~| ERROR the trait `MyTrait` cannot be made into an object + } +} + +fn main() {} diff --git a/tests/ui/impl-trait/in-trait/cycle-effective-visibilities-during-object-safety.stderr b/tests/ui/impl-trait/in-trait/cycle-effective-visibilities-during-object-safety.stderr new file mode 100644 index 00000000000..01de3e53195 --- /dev/null +++ b/tests/ui/impl-trait/in-trait/cycle-effective-visibilities-during-object-safety.stderr @@ -0,0 +1,78 @@ +error[E0277]: the trait bound `&dyn MyTrait: MyTrait` is not satisfied + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:20:22 + | +LL | MyTrait::foo(&self) + | ------------ ^^^^^ the trait `MyTrait` is not implemented for `&dyn MyTrait` + | | + | required by a bound introduced by this call + | + = help: the trait `MyTrait` is implemented for `Outer` + +error[E0038]: the trait `MyTrait` cannot be made into an object + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:20:9 + | +LL | MyTrait::foo(&self) + | ^^^^^^^^^^^^ `MyTrait` cannot be made into an object + | +note: for a trait to be "object safe" it needs to allow building a vtable to allow the call to be resolvable dynamically; for more information visit <https://doc.rust-lang.org/reference/items/traits.html#object-safety> + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:5:22 + | +LL | trait MyTrait { + | ------- this trait cannot be made into an object... +LL | fn foo(&self) -> impl Marker; + | ^^^^^^^^^^^ ...because method `foo` references an `impl Trait` type in its return type + = help: consider moving `foo` to another trait + = help: only type `Outer` implements the trait, consider using it directly instead + +error[E0277]: the trait bound `&dyn MyTrait: MyTrait` is not satisfied + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:20:9 + | +LL | MyTrait::foo(&self) + | ^^^^^^^^^^^^^^^^^^^ the trait `MyTrait` is not implemented for `&dyn MyTrait` + | + = help: the trait `MyTrait` is implemented for `Outer` + +error[E0277]: the trait bound `&dyn MyTrait: MyTrait` is not satisfied + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:20:9 + | +LL | MyTrait::foo(&self) + | ^^^^^^^^^^^^ the trait `MyTrait` is not implemented for `&dyn MyTrait` + | + = help: the trait `MyTrait` is implemented for `Outer` + +error[E0038]: the trait `MyTrait` cannot be made into an object + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:16:6 + | +LL | impl dyn MyTrait { + | ^^^^^^^^^^^ `MyTrait` cannot be made into an object + | +note: for a trait to be "object safe" it needs to allow building a vtable to allow the call to be resolvable dynamically; for more information visit <https://doc.rust-lang.org/reference/items/traits.html#object-safety> + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:5:22 + | +LL | trait MyTrait { + | ------- this trait cannot be made into an object... +LL | fn foo(&self) -> impl Marker; + | ^^^^^^^^^^^ ...because method `foo` references an `impl Trait` type in its return type + = help: consider moving `foo` to another trait + = help: only type `Outer` implements the trait, consider using it directly instead + +error[E0038]: the trait `MyTrait` cannot be made into an object + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:18:15 + | +LL | fn other(&self) -> impl Marker { + | ^^^^ `MyTrait` cannot be made into an object + | +note: for a trait to be "object safe" it needs to allow building a vtable to allow the call to be resolvable dynamically; for more information visit <https://doc.rust-lang.org/reference/items/traits.html#object-safety> + --> $DIR/cycle-effective-visibilities-during-object-safety.rs:5:22 + | +LL | trait MyTrait { + | ------- this trait cannot be made into an object... +LL | fn foo(&self) -> impl Marker; + | ^^^^^^^^^^^ ...because method `foo` references an `impl Trait` type in its return type + = help: consider moving `foo` to another trait + = help: only type `Outer` implements the trait, consider using it directly instead + +error: aborting due to 6 previous errors + +Some errors have detailed explanations: E0038, E0277. +For more information about an error, try `rustc --explain E0038`. diff --git a/tests/ui/impl-trait/issues/issue-78722-2.stderr b/tests/ui/impl-trait/issues/issue-78722-2.stderr index 8817eb7d243..69c734530f2 100644 --- a/tests/ui/impl-trait/issues/issue-78722-2.stderr +++ b/tests/ui/impl-trait/issues/issue-78722-2.stderr @@ -1,12 +1,3 @@ -error[E0658]: `async` blocks are not allowed in constants - --> $DIR/issue-78722-2.rs:15:20 - | -LL | let f: F = async { 1 }; - | ^^^^^^^^^^^ - | - = note: see issue #85368 <https://github.com/rust-lang/rust/issues/85368> for more information - = help: add `#![feature(const_async_blocks)]` to the crate attributes to enable - error[E0271]: expected `{async block@$DIR/issue-78722-2.rs:13:13: 13:21}` to be a future that resolves to `u8`, but it resolves to `()` --> $DIR/issue-78722-2.rs:11:30 | @@ -26,6 +17,15 @@ note: this item must mention the opaque type in its signature in order to be abl LL | let f: F = async { 1 }; | ^^^^^^^^^^^ +error[E0658]: `async` blocks are not allowed in constants + --> $DIR/issue-78722-2.rs:15:20 + | +LL | let f: F = async { 1 }; + | ^^^^^^^^^^^ + | + = note: see issue #85368 <https://github.com/rust-lang/rust/issues/85368> for more information + = help: add `#![feature(const_async_blocks)]` to the crate attributes to enable + error: aborting due to 3 previous errors Some errors have detailed explanations: E0271, E0658. diff --git a/tests/ui/impl-trait/issues/issue-86800.rs b/tests/ui/impl-trait/issues/issue-86800.rs index df70b324c5e..297b012d90a 100644 --- a/tests/ui/impl-trait/issues/issue-86800.rs +++ b/tests/ui/impl-trait/issues/issue-86800.rs @@ -1,8 +1,8 @@ #![feature(type_alias_impl_trait)] // edition:2021 -// compile-flags:-Z treat-err-as-bug=1 -// error-pattern: aborting due to `-Z treat-err-as-bug=1` +// compile-flags:-Z treat-err-as-bug=2 +// error-pattern: due to `-Z treat-err-as-bug=2 // failure-status:101 // normalize-stderr-test ".*note: .*\n\n" -> "" // normalize-stderr-test "thread 'rustc' panicked.*:\n.*\n" -> "" diff --git a/tests/ui/impl-trait/issues/issue-86800.stderr b/tests/ui/impl-trait/issues/issue-86800.stderr index 8228f8ace9d..07ba8eb021b 100644 --- a/tests/ui/impl-trait/issues/issue-86800.stderr +++ b/tests/ui/impl-trait/issues/issue-86800.stderr @@ -4,9 +4,18 @@ error: unconstrained opaque type LL | type TransactionFuture<'__, O> = impl '__ + Future<Output = TransactionResult<O>>; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | +error[E0792]: expected generic lifetime parameter, found `'_` + --> $DIR/issue-86800.rs:39:5 + | +LL | type TransactionFuture<'__, O> = impl '__ + Future<Output = TransactionResult<O>>; + | --- this generic parameter must be used with a generic lifetime parameter +... +LL | f + | ^ + error: the compiler unexpectedly panicked. this is a bug. query stack during panic: -#0 [type_of_opaque] computing type of opaque `TransactionFuture::{opaque#0}` -#1 [type_of] computing type of `TransactionFuture::{opaque#0}` +#0 [mir_borrowck] borrow-checking `execute_transaction_fut` +#1 [type_of_opaque] computing type of opaque `execute_transaction_fut::{opaque#0}` end of query stack diff --git a/tests/ui/inference/issue-36053.rs b/tests/ui/inference/issue-36053.rs index 5c6d0780416..8eee1c33b0e 100644 --- a/tests/ui/inference/issue-36053.rs +++ b/tests/ui/inference/issue-36053.rs @@ -7,7 +7,7 @@ use std::iter::FusedIterator; -struct Thing<'a>(#[allow(unused_tuple_struct_fields)] &'a str); +struct Thing<'a>(#[allow(dead_code)] &'a str); impl<'a> Iterator for Thing<'a> { type Item = &'a str; fn next(&mut self) -> Option<&'a str> { diff --git a/tests/ui/inline-const/expr-unsafe-err.mir.stderr b/tests/ui/inline-const/expr-unsafe-err.mir.stderr deleted file mode 100644 index ebd18f89d9c..00000000000 --- a/tests/ui/inline-const/expr-unsafe-err.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/expr-unsafe-err.rs:8:9 - | -LL | require_unsafe(); - | ^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/inline-const/expr-unsafe-err.rs b/tests/ui/inline-const/expr-unsafe-err.rs index adf05d352ea..a05a2945168 100644 --- a/tests/ui/inline-const/expr-unsafe-err.rs +++ b/tests/ui/inline-const/expr-unsafe-err.rs @@ -1,7 +1,7 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #![feature(inline_const)] -const unsafe fn require_unsafe() -> usize { 1 } +const unsafe fn require_unsafe() -> usize { + 1 +} fn main() { const { diff --git a/tests/ui/inline-const/expr-unsafe-err.thir.stderr b/tests/ui/inline-const/expr-unsafe-err.stderr index 45f850d1f99..45f850d1f99 100644 --- a/tests/ui/inline-const/expr-unsafe-err.thir.stderr +++ b/tests/ui/inline-const/expr-unsafe-err.stderr diff --git a/tests/ui/inline-const/expr-unsafe.rs b/tests/ui/inline-const/expr-unsafe.rs index d71efd33db1..2370c58a712 100644 --- a/tests/ui/inline-const/expr-unsafe.rs +++ b/tests/ui/inline-const/expr-unsafe.rs @@ -1,6 +1,5 @@ // check-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck + #![warn(unused_unsafe)] #![feature(inline_const)] const unsafe fn require_unsafe() -> usize { 1 } diff --git a/tests/ui/inline-const/expr-unsafe.mir.stderr b/tests/ui/inline-const/expr-unsafe.stderr index 1ab6e42fba0..47334aaab83 100644 --- a/tests/ui/inline-const/expr-unsafe.mir.stderr +++ b/tests/ui/inline-const/expr-unsafe.stderr @@ -1,11 +1,11 @@ warning: unnecessary `unsafe` block - --> $DIR/expr-unsafe.rs:12:13 + --> $DIR/expr-unsafe.rs:11:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/expr-unsafe.rs:4:9 + --> $DIR/expr-unsafe.rs:3:9 | LL | #![warn(unused_unsafe)] | ^^^^^^^^^^^^^ diff --git a/tests/ui/inline-const/expr-unsafe.thir.stderr b/tests/ui/inline-const/expr-unsafe.thir.stderr deleted file mode 100644 index 1ab6e42fba0..00000000000 --- a/tests/ui/inline-const/expr-unsafe.thir.stderr +++ /dev/null @@ -1,14 +0,0 @@ -warning: unnecessary `unsafe` block - --> $DIR/expr-unsafe.rs:12:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/expr-unsafe.rs:4:9 - | -LL | #![warn(unused_unsafe)] - | ^^^^^^^^^^^^^ - -warning: 1 warning emitted - diff --git a/tests/ui/inline-const/pat-unsafe-err.rs b/tests/ui/inline-const/pat-unsafe-err.rs index 6df281c6d94..0db18dd3260 100644 --- a/tests/ui/inline-const/pat-unsafe-err.rs +++ b/tests/ui/inline-const/pat-unsafe-err.rs @@ -1,6 +1,4 @@ -// revisions: mir thir -// [mir]ignore-test This is currently broken -// [thir]compile-flags: -Z thir-unsafeck +// ignore-test This is currently broken #![allow(incomplete_features)] #![feature(inline_const_pat)] diff --git a/tests/ui/inline-const/pat-unsafe-err.thir.stderr b/tests/ui/inline-const/pat-unsafe-err.thir.stderr deleted file mode 100644 index 48a2cb4c704..00000000000 --- a/tests/ui/inline-const/pat-unsafe-err.thir.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: call to unsafe function `require_unsafe` is unsafe and requires unsafe function or block - --> $DIR/pat-unsafe-err.rs:15:13 - | -LL | require_unsafe(); - | ^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function `require_unsafe` is unsafe and requires unsafe function or block - --> $DIR/pat-unsafe-err.rs:22:13 - | -LL | require_unsafe() - | ^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/inline-const/pat-unsafe.rs b/tests/ui/inline-const/pat-unsafe.rs index 36f8632af67..cfef9ad6a56 100644 --- a/tests/ui/inline-const/pat-unsafe.rs +++ b/tests/ui/inline-const/pat-unsafe.rs @@ -1,7 +1,5 @@ // check-pass -// revisions: mir thir -// [mir]ignore-test This is currently broken -// [thir]compile-flags: -Z thir-unsafeck +// ignore-test This is currently broken #![allow(incomplete_features)] #![warn(unused_unsafe)] diff --git a/tests/ui/inline-const/pat-unsafe.thir.stderr b/tests/ui/inline-const/pat-unsafe.thir.stderr deleted file mode 100644 index 0318b3ff2cc..00000000000 --- a/tests/ui/inline-const/pat-unsafe.thir.stderr +++ /dev/null @@ -1,20 +0,0 @@ -warning: unnecessary `unsafe` block - --> $DIR/pat-unsafe.rs:19:17 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/pat-unsafe.rs:7:9 - | -LL | #![warn(unused_unsafe)] - | ^^^^^^^^^^^^^ - -warning: unnecessary `unsafe` block - --> $DIR/pat-unsafe.rs:26:17 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -warning: 2 warnings emitted - diff --git a/tests/ui/intrinsics/issue-28575.rs b/tests/ui/intrinsics/issue-28575.rs index 410f664f89d..141136d25b2 100644 --- a/tests/ui/intrinsics/issue-28575.rs +++ b/tests/ui/intrinsics/issue-28575.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![feature(intrinsics)] extern "C" { diff --git a/tests/ui/intrinsics/issue-28575.mir.stderr b/tests/ui/intrinsics/issue-28575.stderr index 4b29b4c1b6a..8a7816f231f 100644 --- a/tests/ui/intrinsics/issue-28575.mir.stderr +++ b/tests/ui/intrinsics/issue-28575.stderr @@ -1,5 +1,5 @@ error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-28575.rs:11:5 + --> $DIR/issue-28575.rs:8:5 | LL | FOO() | ^^^ use of extern static diff --git a/tests/ui/intrinsics/issue-28575.thir.stderr b/tests/ui/intrinsics/issue-28575.thir.stderr deleted file mode 100644 index 4b29b4c1b6a..00000000000 --- a/tests/ui/intrinsics/issue-28575.thir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-28575.rs:11:5 - | -LL | FOO() - | ^^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/intrinsics/unchecked_math_unsafe.mir.stderr b/tests/ui/intrinsics/unchecked_math_unsafe.mir.stderr deleted file mode 100644 index 26b2f9f2713..00000000000 --- a/tests/ui/intrinsics/unchecked_math_unsafe.mir.stderr +++ /dev/null @@ -1,27 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unchecked_math_unsafe.rs:8:15 - | -LL | let add = std::intrinsics::unchecked_add(x, y); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unchecked_math_unsafe.rs:9:15 - | -LL | let sub = std::intrinsics::unchecked_sub(x, y); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unchecked_math_unsafe.rs:10:15 - | -LL | let mul = std::intrinsics::unchecked_mul(x, y); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 3 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/intrinsics/unchecked_math_unsafe.rs b/tests/ui/intrinsics/unchecked_math_unsafe.rs index 98d3a11ad02..a034b45f530 100644 --- a/tests/ui/intrinsics/unchecked_math_unsafe.rs +++ b/tests/ui/intrinsics/unchecked_math_unsafe.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![feature(core_intrinsics)] fn main() { diff --git a/tests/ui/intrinsics/unchecked_math_unsafe.thir.stderr b/tests/ui/intrinsics/unchecked_math_unsafe.stderr index 5c3728ccdf8..31da1a86ca1 100644 --- a/tests/ui/intrinsics/unchecked_math_unsafe.thir.stderr +++ b/tests/ui/intrinsics/unchecked_math_unsafe.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `unchecked_add` is unsafe and requires unsafe function or block - --> $DIR/unchecked_math_unsafe.rs:8:15 + --> $DIR/unchecked_math_unsafe.rs:5:15 | LL | let add = std::intrinsics::unchecked_add(x, y); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function @@ -7,7 +7,7 @@ LL | let add = std::intrinsics::unchecked_add(x, y); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `unchecked_sub` is unsafe and requires unsafe function or block - --> $DIR/unchecked_math_unsafe.rs:9:15 + --> $DIR/unchecked_math_unsafe.rs:6:15 | LL | let sub = std::intrinsics::unchecked_sub(x, y); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function @@ -15,7 +15,7 @@ LL | let sub = std::intrinsics::unchecked_sub(x, y); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `unchecked_mul` is unsafe and requires unsafe function or block - --> $DIR/unchecked_math_unsafe.rs:10:15 + --> $DIR/unchecked_math_unsafe.rs:7:15 | LL | let mul = std::intrinsics::unchecked_mul(x, y); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/issues/issue-11740.rs b/tests/ui/issues/issue-11740.rs index fa80f509b32..c3badfd9b49 100644 --- a/tests/ui/issues/issue-11740.rs +++ b/tests/ui/issues/issue-11740.rs @@ -1,6 +1,4 @@ // check-pass -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck struct Attr { name: String, diff --git a/tests/ui/issues/issue-13027.rs b/tests/ui/issues/issue-13027.rs index 64bf2a11d0e..ac0d1f11bd7 100644 --- a/tests/ui/issues/issue-13027.rs +++ b/tests/ui/issues/issue-13027.rs @@ -164,7 +164,7 @@ fn range_shadow_multi_pats() { fn misc() { enum Foo { - Bar(#[allow(unused_tuple_struct_fields)] usize, bool) + Bar(#[allow(dead_code)] usize, bool) } // This test basically mimics how trace_macros! macro is implemented, // which is a rare combination of vector patterns, multiple wild-card diff --git a/tests/ui/issues/issue-14382.rs b/tests/ui/issues/issue-14382.rs index dca24d0be8a..b5c2362f05c 100644 --- a/tests/ui/issues/issue-14382.rs +++ b/tests/ui/issues/issue-14382.rs @@ -1,6 +1,6 @@ // run-pass #[derive(Debug)] -struct Matrix4<S>(#[allow(unused_tuple_struct_fields)] S); +struct Matrix4<S>(#[allow(dead_code)] S); trait POrd<S> {} fn translate<S: POrd<S>>(s: S) -> Matrix4<S> { Matrix4(s) } diff --git a/tests/ui/issues/issue-15858.rs b/tests/ui/issues/issue-15858.rs index 8d65afc4883..77941c07671 100644 --- a/tests/ui/issues/issue-15858.rs +++ b/tests/ui/issues/issue-15858.rs @@ -12,7 +12,7 @@ impl Bar for BarImpl { } -struct Foo<B: Bar>(#[allow(unused_tuple_struct_fields)] B); +struct Foo<B: Bar>(#[allow(dead_code)] B); impl<B: Bar> Drop for Foo<B> { fn drop(&mut self) { diff --git a/tests/ui/issues/issue-17905.rs b/tests/ui/issues/issue-17905.rs index dae9648b917..83cea8b4395 100644 --- a/tests/ui/issues/issue-17905.rs +++ b/tests/ui/issues/issue-17905.rs @@ -1,7 +1,7 @@ // run-pass #[derive(Debug)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Pair<T, V> (T, V); impl Pair< diff --git a/tests/ui/issues/issue-23122-2.stderr b/tests/ui/issues/issue-23122-2.stderr index b8aa587a739..10463ab2c33 100644 --- a/tests/ui/issues/issue-23122-2.stderr +++ b/tests/ui/issues/issue-23122-2.stderr @@ -5,7 +5,7 @@ LL | type Next = <GetNext<T::Next> as Next>::Next; | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | = help: consider increasing the recursion limit by adding a `#![recursion_limit = "256"]` attribute to your crate (`issue_23122_2`) -note: required for `GetNext<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<T as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next>` to implement `Next` +note: required for `GetNext<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<<T as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next as Next>::Next>` to implement `Next` --> $DIR/issue-23122-2.rs:10:15 | LL | impl<T: Next> Next for GetNext<T> { diff --git a/tests/ui/issues/issue-23491.rs b/tests/ui/issues/issue-23491.rs index e5f9dd3efbd..efd83112353 100644 --- a/tests/ui/issues/issue-23491.rs +++ b/tests/ui/issues/issue-23491.rs @@ -1,7 +1,7 @@ // run-pass #![allow(unused_variables)] -struct Node<T: ?Sized>(#[allow(unused_tuple_struct_fields)] T); +struct Node<T: ?Sized>(#[allow(dead_code)] T); fn main() { let x: Box<Node<[isize]>> = Box::new(Node([])); diff --git a/tests/ui/issues/issue-24308.rs b/tests/ui/issues/issue-24308.rs index 4a582c68efc..40950938fc7 100644 --- a/tests/ui/issues/issue-24308.rs +++ b/tests/ui/issues/issue-24308.rs @@ -4,7 +4,7 @@ pub trait Foo { fn method2(); } -struct Slice<'a, T: 'a>(#[allow(unused_tuple_struct_fields)] &'a [T]); +struct Slice<'a, T: 'a>(#[allow(dead_code)] &'a [T]); impl<'a, T: 'a> Foo for Slice<'a, T> { fn method2() { diff --git a/tests/ui/issues/issue-25089.rs b/tests/ui/issues/issue-25089.rs index c988f8f55fa..c7063b24608 100644 --- a/tests/ui/issues/issue-25089.rs +++ b/tests/ui/issues/issue-25089.rs @@ -4,7 +4,7 @@ use std::thread; -struct Foo(#[allow(unused_tuple_struct_fields)] i32); +struct Foo(#[allow(dead_code)] i32); impl Drop for Foo { fn drop(&mut self) { diff --git a/tests/ui/issues/issue-25679.rs b/tests/ui/issues/issue-25679.rs index b548da98888..8415eba887b 100644 --- a/tests/ui/issues/issue-25679.rs +++ b/tests/ui/issues/issue-25679.rs @@ -2,7 +2,7 @@ trait Device { type Resources; } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Foo<D, R>(D, R); impl<D: Device> Foo<D, D::Resources> { diff --git a/tests/ui/issues/issue-26127.rs b/tests/ui/issues/issue-26127.rs index f3f9c1d9ae8..b76f1ba51a4 100644 --- a/tests/ui/issues/issue-26127.rs +++ b/tests/ui/issues/issue-26127.rs @@ -1,7 +1,7 @@ // run-pass trait Tr { type T; } impl Tr for u8 { type T=(); } -struct S<I: Tr>(#[allow(unused_tuple_struct_fields)] I::T); +struct S<I: Tr>(#[allow(dead_code)] I::T); fn foo<I: Tr>(i: I::T) { S::<I>(i); diff --git a/tests/ui/issues/issue-26641.rs b/tests/ui/issues/issue-26641.rs index e08edd0b5cb..3256b71660f 100644 --- a/tests/ui/issues/issue-26641.rs +++ b/tests/ui/issues/issue-26641.rs @@ -1,5 +1,5 @@ // run-pass -struct Parser<'a>(#[allow(unused_tuple_struct_fields)] Box<dyn FnMut(Parser) + 'a>); +struct Parser<'a>(#[allow(dead_code)] Box<dyn FnMut(Parser) + 'a>); fn main() { let _x = Parser(Box::new(|_|{})); diff --git a/tests/ui/issues/issue-26709.rs b/tests/ui/issues/issue-26709.rs index 1bd2651dd6c..8a8186de5cc 100644 --- a/tests/ui/issues/issue-26709.rs +++ b/tests/ui/issues/issue-26709.rs @@ -1,5 +1,5 @@ // run-pass -struct Wrapper<'a, T: ?Sized>(&'a mut i32, #[allow(unused_tuple_struct_fields)] T); +struct Wrapper<'a, T: ?Sized>(&'a mut i32, #[allow(dead_code)] T); impl<'a, T: ?Sized> Drop for Wrapper<'a, T> { fn drop(&mut self) { diff --git a/tests/ui/issues/issue-27240.rs b/tests/ui/issues/issue-27240.rs index eaf254f3361..b518e58d194 100644 --- a/tests/ui/issues/issue-27240.rs +++ b/tests/ui/issues/issue-27240.rs @@ -2,12 +2,12 @@ #![allow(unused_assignments)] #![allow(unused_variables)] use std::fmt; -struct NoisyDrop<T: fmt::Debug>(#[allow(unused_tuple_struct_fields)] T); +struct NoisyDrop<T: fmt::Debug>(#[allow(dead_code)] T); impl<T: fmt::Debug> Drop for NoisyDrop<T> { fn drop(&mut self) {} } -struct Bar<T: fmt::Debug>(#[allow(unused_tuple_struct_fields)] [*const NoisyDrop<T>; 2]); +struct Bar<T: fmt::Debug>(#[allow(dead_code)] [*const NoisyDrop<T>; 2]); fn fine() { let (u,b); @@ -15,7 +15,7 @@ fn fine() { b = Bar([&NoisyDrop(&u), &NoisyDrop(&u)]); } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct Bar2<T: fmt::Debug>(*const NoisyDrop<T>, *const NoisyDrop<T>); fn lolwut() { diff --git a/tests/ui/issues/issue-28498-must-work-ex1.rs b/tests/ui/issues/issue-28498-must-work-ex1.rs index ab6d190e0a1..37234699893 100644 --- a/tests/ui/issues/issue-28498-must-work-ex1.rs +++ b/tests/ui/issues/issue-28498-must-work-ex1.rs @@ -6,7 +6,7 @@ use std::cell::Cell; -struct Concrete<'a>(#[allow(unused_tuple_struct_fields)] u32, Cell<Option<&'a Concrete<'a>>>); +struct Concrete<'a>(#[allow(dead_code)] u32, Cell<Option<&'a Concrete<'a>>>); fn main() { let mut data = Vec::new(); diff --git a/tests/ui/issues/issue-28498-must-work-ex2.rs b/tests/ui/issues/issue-28498-must-work-ex2.rs index 378d736ee3d..ab0b7196082 100644 --- a/tests/ui/issues/issue-28498-must-work-ex2.rs +++ b/tests/ui/issues/issue-28498-must-work-ex2.rs @@ -6,7 +6,7 @@ use std::cell::Cell; -struct Concrete<'a>(#[allow(unused_tuple_struct_fields)] u32, Cell<Option<&'a Concrete<'a>>>); +struct Concrete<'a>(#[allow(dead_code)] u32, Cell<Option<&'a Concrete<'a>>>); struct Foo<T> { data: Vec<T> } diff --git a/tests/ui/issues/issue-28498-ugeh-ex1.rs b/tests/ui/issues/issue-28498-ugeh-ex1.rs index 24bf706cef9..ce49cf1ff99 100644 --- a/tests/ui/issues/issue-28498-ugeh-ex1.rs +++ b/tests/ui/issues/issue-28498-ugeh-ex1.rs @@ -8,7 +8,7 @@ #![feature(dropck_eyepatch)] use std::cell::Cell; -struct Concrete<'a>(#[allow(unused_tuple_struct_fields)] u32, Cell<Option<&'a Concrete<'a>>>); +struct Concrete<'a>(#[allow(dead_code)] u32, Cell<Option<&'a Concrete<'a>>>); struct Foo<T> { data: Vec<T> } diff --git a/tests/ui/issues/issue-28776.mir.stderr b/tests/ui/issues/issue-28776.mir.stderr deleted file mode 100644 index e7b7ba08268..00000000000 --- a/tests/ui/issues/issue-28776.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/issue-28776.rs:7:5 - | -LL | (&ptr::write)(1 as *mut _, 42); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/issues/issue-28776.rs b/tests/ui/issues/issue-28776.rs index 19df3c4a425..e564ebcd110 100644 --- a/tests/ui/issues/issue-28776.rs +++ b/tests/ui/issues/issue-28776.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - use std::ptr; fn main() { diff --git a/tests/ui/issues/issue-28776.thir.stderr b/tests/ui/issues/issue-28776.stderr index 63172b85424..3db94ee1810 100644 --- a/tests/ui/issues/issue-28776.thir.stderr +++ b/tests/ui/issues/issue-28776.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `std::ptr::write` is unsafe and requires unsafe function or block - --> $DIR/issue-28776.rs:7:5 + --> $DIR/issue-28776.rs:4:5 | LL | (&ptr::write)(1 as *mut _, 42); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/issues/issue-31267-additional.rs b/tests/ui/issues/issue-31267-additional.rs index 7f0cbd658f1..c6e93533e7c 100644 --- a/tests/ui/issues/issue-31267-additional.rs +++ b/tests/ui/issues/issue-31267-additional.rs @@ -6,7 +6,7 @@ struct Bar; const BAZ: Bar = Bar; #[derive(Debug)] -struct Foo(#[allow(unused_tuple_struct_fields)] [Bar; 1]); +struct Foo(#[allow(dead_code)] [Bar; 1]); struct Biz; diff --git a/tests/ui/issues/issue-31299.rs b/tests/ui/issues/issue-31299.rs index 78c3252d32e..e3c422cb97c 100644 --- a/tests/ui/issues/issue-31299.rs +++ b/tests/ui/issues/issue-31299.rs @@ -25,9 +25,9 @@ impl<T> Front for Vec<T> { type Back = Vec<T>; } -struct PtrBack<T: Front>(#[allow(unused_tuple_struct_fields)] Vec<T::Back>); +struct PtrBack<T: Front>(#[allow(dead_code)] Vec<T::Back>); -struct M(#[allow(unused_tuple_struct_fields)] PtrBack<Vec<M>>); +struct M(#[allow(dead_code)] PtrBack<Vec<M>>); #[allow(unused_must_use)] fn main() { diff --git a/tests/ui/issues/issue-34571.rs b/tests/ui/issues/issue-34571.rs index 5498091da58..c392f59d8da 100644 --- a/tests/ui/issues/issue-34571.rs +++ b/tests/ui/issues/issue-34571.rs @@ -1,7 +1,7 @@ // run-pass #[repr(u8)] enum Foo { - Foo(#[allow(unused_tuple_struct_fields)] u8), + Foo(#[allow(dead_code)] u8), } fn main() { diff --git a/tests/ui/issues/issue-36278-prefix-nesting.rs b/tests/ui/issues/issue-36278-prefix-nesting.rs index a809f7f1329..5f476932018 100644 --- a/tests/ui/issues/issue-36278-prefix-nesting.rs +++ b/tests/ui/issues/issue-36278-prefix-nesting.rs @@ -5,7 +5,7 @@ use std::mem; const SZ: usize = 100; -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct P<T: ?Sized>([u8; SZ], T); type Ack<T> = P<P<T>>; diff --git a/tests/ui/issues/issue-39367.rs b/tests/ui/issues/issue-39367.rs index e7beb8a0392..039b47ae780 100644 --- a/tests/ui/issues/issue-39367.rs +++ b/tests/ui/issues/issue-39367.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck use std::ops::Deref; diff --git a/tests/ui/issues/issue-4252.rs b/tests/ui/issues/issue-4252.rs index 0d47a7f0c16..9b82121baa2 100644 --- a/tests/ui/issues/issue-4252.rs +++ b/tests/ui/issues/issue-4252.rs @@ -7,7 +7,7 @@ trait X { } #[derive(Debug)] -struct Y(#[allow(unused_tuple_struct_fields)] isize); +struct Y(#[allow(dead_code)] isize); #[derive(Debug)] struct Z<T: X+std::fmt::Debug> { diff --git a/tests/ui/issues/issue-46069.rs b/tests/ui/issues/issue-46069.rs index c418128c186..f80ea932001 100644 --- a/tests/ui/issues/issue-46069.rs +++ b/tests/ui/issues/issue-46069.rs @@ -2,7 +2,7 @@ use std::iter::{Fuse, Cloned}; use std::slice::Iter; -struct Foo<'a, T: 'a>(#[allow(unused_tuple_struct_fields)] &'a T); +struct Foo<'a, T: 'a>(#[allow(dead_code)] &'a T); impl<'a, T: 'a> Copy for Foo<'a, T> {} impl<'a, T: 'a> Clone for Foo<'a, T> { fn clone(&self) -> Self { *self } diff --git a/tests/ui/issues/issue-48131.mir.stderr b/tests/ui/issues/issue-48131.mir.stderr deleted file mode 100644 index 6817e8830c5..00000000000 --- a/tests/ui/issues/issue-48131.mir.stderr +++ /dev/null @@ -1,20 +0,0 @@ -error: unnecessary `unsafe` block - --> $DIR/issue-48131.rs:12:9 - | -LL | unsafe { /* unnecessary */ } - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/issue-48131.rs:6:9 - | -LL | #![deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/issue-48131.rs:23:13 - | -LL | unsafe { /* unnecessary */ } - | ^^^^^^ unnecessary `unsafe` block - -error: aborting due to 2 previous errors - diff --git a/tests/ui/issues/issue-48131.rs b/tests/ui/issues/issue-48131.rs index df98547084d..85664e62ead 100644 --- a/tests/ui/issues/issue-48131.rs +++ b/tests/ui/issues/issue-48131.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - // This note is annotated because the purpose of the test // is to ensure that certain other notes are not generated. #![deny(unused_unsafe)] //~ NOTE diff --git a/tests/ui/issues/issue-48131.thir.stderr b/tests/ui/issues/issue-48131.stderr index 6817e8830c5..5acc4f16e9f 100644 --- a/tests/ui/issues/issue-48131.thir.stderr +++ b/tests/ui/issues/issue-48131.stderr @@ -1,17 +1,17 @@ error: unnecessary `unsafe` block - --> $DIR/issue-48131.rs:12:9 + --> $DIR/issue-48131.rs:9:9 | LL | unsafe { /* unnecessary */ } | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/issue-48131.rs:6:9 + --> $DIR/issue-48131.rs:3:9 | LL | #![deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/issue-48131.rs:23:13 + --> $DIR/issue-48131.rs:20:13 | LL | unsafe { /* unnecessary */ } | ^^^^^^ unnecessary `unsafe` block diff --git a/tests/ui/issues/issue-5315.rs b/tests/ui/issues/issue-5315.rs index 0c121a5eee6..81d075a98a9 100644 --- a/tests/ui/issues/issue-5315.rs +++ b/tests/ui/issues/issue-5315.rs @@ -1,7 +1,7 @@ // run-pass // pretty-expanded FIXME #23616 -struct A(#[allow(unused_tuple_struct_fields)] bool); +struct A(#[allow(dead_code)] bool); pub fn main() { let f = A; diff --git a/tests/ui/issues/issue-5844.mir.stderr b/tests/ui/issues/issue-5844.mir.stderr deleted file mode 100644 index 4434f5a0ff2..00000000000 --- a/tests/ui/issues/issue-5844.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/issue-5844.rs:8:5 - | -LL | issue_5844_aux::rand(); - | ^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/issues/issue-5844.rs b/tests/ui/issues/issue-5844.rs index 4f90a9c6645..0db1ccf76d9 100644 --- a/tests/ui/issues/issue-5844.rs +++ b/tests/ui/issues/issue-5844.rs @@ -1,9 +1,7 @@ //aux-build:issue-5844-aux.rs -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck extern crate issue_5844_aux; -fn main () { +fn main() { issue_5844_aux::rand(); //~ ERROR: requires unsafe } diff --git a/tests/ui/issues/issue-5844.thir.stderr b/tests/ui/issues/issue-5844.stderr index 6074f7d0ed4..bae917fa72c 100644 --- a/tests/ui/issues/issue-5844.thir.stderr +++ b/tests/ui/issues/issue-5844.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `rand` is unsafe and requires unsafe function or block - --> $DIR/issue-5844.rs:8:5 + --> $DIR/issue-5844.rs:6:5 | LL | issue_5844_aux::rand(); | ^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/issues/issue-61894.rs b/tests/ui/issues/issue-61894.rs index 776fdbb7466..fe934bdeb60 100644 --- a/tests/ui/issues/issue-61894.rs +++ b/tests/ui/issues/issue-61894.rs @@ -4,7 +4,7 @@ use std::any::type_name; -struct Bar<M>(#[allow(unused_tuple_struct_fields)] M); +struct Bar<M>(#[allow(dead_code)] M); impl<M> Bar<M> { fn foo(&self) -> &'static str { diff --git a/tests/ui/issues/issue-62375.stderr b/tests/ui/issues/issue-62375.stderr index 8750fbcf4cf..faca94a03f0 100644 --- a/tests/ui/issues/issue-62375.stderr +++ b/tests/ui/issues/issue-62375.stderr @@ -11,11 +11,6 @@ note: an implementation of `PartialEq<fn(()) -> A {A::Value}>` might be missing | LL | enum A { | ^^^^^^ must implement `PartialEq<fn(()) -> A {A::Value}>` -help: consider annotating `A` with `#[derive(PartialEq)]` - | -LL + #[derive(PartialEq)] -LL | enum A { - | help: use parentheses to construct this tuple variant | LL | a == A::Value(/* () */); diff --git a/tests/ui/issues/issue-7911.rs b/tests/ui/issues/issue-7911.rs index f64887136ca..d4db3b0776b 100644 --- a/tests/ui/issues/issue-7911.rs +++ b/tests/ui/issues/issue-7911.rs @@ -6,7 +6,7 @@ trait FooBar { fn dummy(&self) { } } -struct Bar(#[allow(unused_tuple_struct_fields)] i32); +struct Bar(#[allow(dead_code)] i32); struct Foo { bar: Bar } impl FooBar for Bar {} diff --git a/tests/ui/issues/issue-99838.rs b/tests/ui/issues/issue-99838.rs index 2e81d5e8221..3bddca43daa 100644 --- a/tests/ui/issues/issue-99838.rs +++ b/tests/ui/issues/issue-99838.rs @@ -2,7 +2,7 @@ use std::hint; -struct U16(u16); +struct U16(#[allow(dead_code)] u16); impl Drop for U16 { fn drop(&mut self) { @@ -23,7 +23,7 @@ struct Wrapper { } #[repr(packed)] -struct Misalign(u8, Wrapper); +struct Misalign(#[allow(dead_code)] u8, Wrapper); fn main() { let m = Misalign( diff --git a/tests/ui/layout/issue-84108.stderr b/tests/ui/layout/issue-84108.stderr index 3a02e73f96b..d6d75851034 100644 --- a/tests/ui/layout/issue-84108.stderr +++ b/tests/ui/layout/issue-84108.stderr @@ -29,15 +29,6 @@ LL | const BAR: (&Path, [u8], usize) = ("hello", [], 42); = help: the trait `Sized` is not implemented for `[u8]` = note: only the last element of a tuple may have a dynamically sized type -error[E0277]: the size for values of type `[u8]` cannot be known at compilation time - --> $DIR/issue-84108.rs:14:13 - | -LL | static BAZ: ([u8], usize) = ([], 0); - | ^^^^^^^^^^^^^ doesn't have a size known at compile-time - | - = help: the trait `Sized` is not implemented for `[u8]` - = note: only the last element of a tuple may have a dynamically sized type - error[E0308]: mismatched types --> $DIR/issue-84108.rs:9:45 | @@ -47,6 +38,15 @@ LL | const BAR: (&Path, [u8], usize) = ("hello", [], 42); = note: expected slice `[u8]` found array `[_; 0]` +error[E0277]: the size for values of type `[u8]` cannot be known at compilation time + --> $DIR/issue-84108.rs:14:13 + | +LL | static BAZ: ([u8], usize) = ([], 0); + | ^^^^^^^^^^^^^ doesn't have a size known at compile-time + | + = help: the trait `Sized` is not implemented for `[u8]` + = note: only the last element of a tuple may have a dynamically sized type + error[E0308]: mismatched types --> $DIR/issue-84108.rs:14:30 | diff --git a/tests/ui/layout/unsafe-cell-hides-niche.rs b/tests/ui/layout/unsafe-cell-hides-niche.rs index 68bcc3c1aff..8d6cea10933 100644 --- a/tests/ui/layout/unsafe-cell-hides-niche.rs +++ b/tests/ui/layout/unsafe-cell-hides-niche.rs @@ -14,10 +14,10 @@ use std::mem::size_of; use std::num::NonZeroU32 as N32; use std::sync::{Mutex, RwLock}; -struct Wrapper<T>(#[allow(unused_tuple_struct_fields)] T); +struct Wrapper<T>(#[allow(dead_code)] T); #[repr(transparent)] -struct Transparent<T>(#[allow(unused_tuple_struct_fields)] T); +struct Transparent<T>(#[allow(dead_code)] T); struct NoNiche<T>(UnsafeCell<T>); diff --git a/tests/ui/lazy-type-alias/implied-outlives-bounds.neg.stderr b/tests/ui/lazy-type-alias/implied-outlives-bounds.neg.stderr new file mode 100644 index 00000000000..a2dbb58ecd0 --- /dev/null +++ b/tests/ui/lazy-type-alias/implied-outlives-bounds.neg.stderr @@ -0,0 +1,34 @@ +error: lifetime may not live long enough + --> $DIR/implied-outlives-bounds.rs:21:12 + | +LL | fn env0<'any>() { + | ---- lifetime `'any` defined here +LL | let _: TypeOutlives<'static, &'any ()>; + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ requires that `'any` must outlive `'static` + +error: lifetime may not live long enough + --> $DIR/implied-outlives-bounds.rs:26:12 + | +LL | fn env1<'any>() { + | ---- lifetime `'any` defined here +LL | let _: RegionOutlives<'static, 'any>; + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ requires that `'any` must outlive `'static` + +error: lifetime may not live long enough + --> $DIR/implied-outlives-bounds.rs:31:12 + | +LL | fn env2<'any>() { + | ---- lifetime `'any` defined here +LL | let _: Outer0<'static, &'any ()>; + | ^^^^^^^^^^^^^^^^^^^^^^^^^ requires that `'any` must outlive `'static` + +error: lifetime may not live long enough + --> $DIR/implied-outlives-bounds.rs:36:12 + | +LL | fn env3<'any>() { + | ---- lifetime `'any` defined here +LL | let _: Outer1<'static, &'any ()>; + | ^^^^^^^^^^^^^^^^^^^^^^^^^ requires that `'any` must outlive `'static` + +error: aborting due to 4 previous errors + diff --git a/tests/ui/lazy-type-alias/implied-outlives-bounds.rs b/tests/ui/lazy-type-alias/implied-outlives-bounds.rs new file mode 100644 index 00000000000..c08e45975de --- /dev/null +++ b/tests/ui/lazy-type-alias/implied-outlives-bounds.rs @@ -0,0 +1,39 @@ +// Check that we imply outlives-bounds on lazy type aliases. + +// revisions: pos neg +//[pos] check-pass + +#![feature(lazy_type_alias)] +#![allow(incomplete_features)] + +type TypeOutlives<'a, T> = &'a T; +type RegionOutlives<'a, 'b> = &'a &'b (); + +// Ensure that we imply bounds from the explicit bounds of weak aliases. +struct Outer0<'a, T>(ExplicitTypeOutlives<'a, T>); +type ExplicitTypeOutlives<'a, T: 'a> = (&'a (), T); + +// Ensure that we imply bounds from the implied bounds of weak aliases. +type Outer1<'b, U> = TypeOutlives<'b, U>; + +#[cfg(neg)] +fn env0<'any>() { + let _: TypeOutlives<'static, &'any ()>; //[neg]~ ERROR lifetime may not live long enough +} + +#[cfg(neg)] +fn env1<'any>() { + let _: RegionOutlives<'static, 'any>; //[neg]~ ERROR lifetime may not live long enough +} + +#[cfg(neg)] +fn env2<'any>() { + let _: Outer0<'static, &'any ()>; //[neg]~ ERROR lifetime may not live long enough +} + +#[cfg(neg)] +fn env3<'any>() { + let _: Outer1<'static, &'any ()>; //[neg]~ ERROR lifetime may not live long enough +} + +fn main() {} diff --git a/tests/ui/lifetimes/issue-76168-hr-outlives-3.rs b/tests/ui/lifetimes/issue-76168-hr-outlives-3.rs index b0b6b318d8f..782c38200a0 100644 --- a/tests/ui/lifetimes/issue-76168-hr-outlives-3.rs +++ b/tests/ui/lifetimes/issue-76168-hr-outlives-3.rs @@ -6,10 +6,9 @@ use std::future::Future; async fn wrapper<F>(f: F) //~^ ERROR: expected a `FnOnce(&'a mut i32)` closure, found `i32` //~| ERROR: expected a `FnOnce(&'a mut i32)` closure, found `i32` -//~| ERROR: expected a `FnOnce(&'a mut i32)` closure, found `i32` where - F:, - for<'a> <i32 as FnOnce<(&'a mut i32,)>>::Output: Future<Output = ()> + 'a, +F:, +for<'a> <i32 as FnOnce<(&'a mut i32,)>>::Output: Future<Output = ()> + 'a, { //~^ ERROR: expected a `FnOnce(&'a mut i32)` closure, found `i32` let mut i = 41; diff --git a/tests/ui/lifetimes/issue-76168-hr-outlives-3.stderr b/tests/ui/lifetimes/issue-76168-hr-outlives-3.stderr index 5b77051dc88..89ebdb57f3c 100644 --- a/tests/ui/lifetimes/issue-76168-hr-outlives-3.stderr +++ b/tests/ui/lifetimes/issue-76168-hr-outlives-3.stderr @@ -4,11 +4,10 @@ error[E0277]: expected a `FnOnce(&'a mut i32)` closure, found `i32` LL | / async fn wrapper<F>(f: F) LL | | LL | | -LL | | LL | | where -LL | | F:, -LL | | for<'a> <i32 as FnOnce<(&'a mut i32,)>>::Output: Future<Output = ()> + 'a, - | |______________________________________________________________________________^ expected an `FnOnce(&'a mut i32)` closure, found `i32` +LL | | F:, +LL | | for<'a> <i32 as FnOnce<(&'a mut i32,)>>::Output: Future<Output = ()> + 'a, + | |__________________________________________________________________________^ expected an `FnOnce(&'a mut i32)` closure, found `i32` | = help: the trait `for<'a> FnOnce<(&'a mut i32,)>` is not implemented for `i32` @@ -21,7 +20,7 @@ LL | async fn wrapper<F>(f: F) = help: the trait `for<'a> FnOnce<(&'a mut i32,)>` is not implemented for `i32` error[E0277]: expected a `FnOnce(&'a mut i32)` closure, found `i32` - --> $DIR/issue-76168-hr-outlives-3.rs:13:1 + --> $DIR/issue-76168-hr-outlives-3.rs:12:1 | LL | / { LL | | @@ -32,20 +31,6 @@ LL | | } | = help: the trait `for<'a> FnOnce<(&'a mut i32,)>` is not implemented for `i32` -error[E0277]: expected a `FnOnce(&'a mut i32)` closure, found `i32` - --> $DIR/issue-76168-hr-outlives-3.rs:6:1 - | -LL | / async fn wrapper<F>(f: F) -LL | | -LL | | -LL | | -LL | | where -LL | | F:, -LL | | for<'a> <i32 as FnOnce<(&'a mut i32,)>>::Output: Future<Output = ()> + 'a, - | |______________________________________________________________________________^ expected an `FnOnce(&'a mut i32)` closure, found `i32` - | - = help: the trait `for<'a> FnOnce<(&'a mut i32,)>` is not implemented for `i32` - -error: aborting due to 4 previous errors +error: aborting due to 3 previous errors For more information about this error, try `rustc --explain E0277`. diff --git a/tests/ui/lint/dead-code/lint-dead-code-1.rs b/tests/ui/lint/dead-code/lint-dead-code-1.rs index 8f5a4c41ef2..ddcafedf7bc 100644 --- a/tests/ui/lint/dead-code/lint-dead-code-1.rs +++ b/tests/ui/lint/dead-code/lint-dead-code-1.rs @@ -37,7 +37,7 @@ struct UsedStruct1 { #[allow(dead_code)] x: isize } -struct UsedStruct2(isize); +struct UsedStruct2(#[allow(dead_code)] isize); struct UsedStruct3; pub struct UsedStruct4; // this struct is never used directly, but its method is, so we don't want diff --git a/tests/ui/lint/dead-code/lint-dead-code-5.rs b/tests/ui/lint/dead-code/lint-dead-code-5.rs index ed90fb46429..76067d114a1 100644 --- a/tests/ui/lint/dead-code/lint-dead-code-5.rs +++ b/tests/ui/lint/dead-code/lint-dead-code-5.rs @@ -2,12 +2,12 @@ #![deny(dead_code)] enum Enum1 { - Variant1(isize), + Variant1(#[allow(dead_code)] isize), Variant2 //~ ERROR: variant `Variant2` is never constructed } enum Enum2 { - Variant3(bool), + Variant3(#[allow(dead_code)] bool), #[allow(dead_code)] Variant4(isize), Variant5 { _x: isize }, //~ ERROR: variants `Variant5` and `Variant6` are never constructed @@ -15,7 +15,7 @@ enum Enum2 { _Variant7, Variant8 { _field: bool }, Variant9, - Variant10(usize) + Variant10(#[allow(dead_code)] usize) } impl Enum2 { diff --git a/tests/ui/lint/dead-code/lint-dead-code-5.stderr b/tests/ui/lint/dead-code/lint-dead-code-5.stderr index eaf43e45361..a583f234a3d 100644 --- a/tests/ui/lint/dead-code/lint-dead-code-5.stderr +++ b/tests/ui/lint/dead-code/lint-dead-code-5.stderr @@ -3,7 +3,7 @@ error: variant `Variant2` is never constructed | LL | enum Enum1 { | ----- variant in this enum -LL | Variant1(isize), +LL | Variant1(#[allow(dead_code)] isize), LL | Variant2 | ^^^^^^^^ | diff --git a/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.rs b/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.rs index a478153b3f4..942c5516500 100644 --- a/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.rs +++ b/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.rs @@ -17,7 +17,7 @@ struct Bar { // Issue 119267: this should not ICE. #[derive(Debug)] -struct Foo(usize, #[allow(unused)] usize); +struct Foo(usize, #[allow(unused)] usize); //~ WARN field `0` is never read fn main() { Bar { diff --git a/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.stderr b/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.stderr index 0e5c78a7167..06f9b229c18 100644 --- a/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.stderr +++ b/tests/ui/lint/dead-code/multiple-dead-codes-in-the-same-struct.stderr @@ -51,5 +51,19 @@ note: the lint level is defined here LL | #[forbid(dead_code)] | ^^^^^^^^^ -error: aborting due to 2 previous errors; 1 warning emitted +warning: field `0` is never read + --> $DIR/multiple-dead-codes-in-the-same-struct.rs:20:12 + | +LL | struct Foo(usize, #[allow(unused)] usize); + | --- ^^^^^ + | | + | field in this struct + | + = note: `Foo` has a derived impl for the trait `Debug`, but this is intentionally ignored during dead code analysis +help: consider changing the field to be of unit type to suppress this warning while preserving the field numbering, or remove the field + | +LL | struct Foo((), #[allow(unused)] usize); + | ~~ + +error: aborting due to 2 previous errors; 2 warnings emitted diff --git a/tests/ui/lint/dead-code/tuple-struct-field.rs b/tests/ui/lint/dead-code/tuple-struct-field.rs index 14fb30be949..d13fe029289 100644 --- a/tests/ui/lint/dead-code/tuple-struct-field.rs +++ b/tests/ui/lint/dead-code/tuple-struct-field.rs @@ -1,4 +1,4 @@ -#![deny(unused_tuple_struct_fields)] +#![deny(dead_code)] //~^ NOTE: the lint level is defined here use std::marker::PhantomData; diff --git a/tests/ui/lint/dead-code/tuple-struct-field.stderr b/tests/ui/lint/dead-code/tuple-struct-field.stderr index b8ad5cbe4e9..0154d5489f9 100644 --- a/tests/ui/lint/dead-code/tuple-struct-field.stderr +++ b/tests/ui/lint/dead-code/tuple-struct-field.stderr @@ -9,8 +9,8 @@ LL | struct SingleUnused(i32, [u8; LEN], String); note: the lint level is defined here --> $DIR/tuple-struct-field.rs:1:9 | -LL | #![deny(unused_tuple_struct_fields)] - | ^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | #![deny(dead_code)] + | ^^^^^^^^^ help: consider changing the field to be of unit type to suppress this warning while preserving the field numbering, or remove the field | LL | struct SingleUnused(i32, (), String); diff --git a/tests/ui/lint/dead-code/with-impl.rs b/tests/ui/lint/dead-code/with-impl.rs index 812fcdd09b6..147ec7b9e2e 100644 --- a/tests/ui/lint/dead-code/with-impl.rs +++ b/tests/ui/lint/dead-code/with-impl.rs @@ -2,7 +2,7 @@ #![deny(dead_code)] -pub struct GenericFoo<T>(#[allow(unused_tuple_struct_fields)] T); +pub struct GenericFoo<T>(#[allow(dead_code)] T); type Foo = GenericFoo<u32>; diff --git a/tests/ui/lint/lint-match-arms-2.stderr b/tests/ui/lint/lint-match-arms-2.stderr index 062d5c12e96..5e803ef1934 100644 --- a/tests/ui/lint/lint-match-arms-2.stderr +++ b/tests/ui/lint/lint-match-arms-2.stderr @@ -11,10 +11,10 @@ LL | #[deny(bindings_with_variant_name)] | ^^^^^^^^^^^^^^^^^^^^^^^^^^ error: irrefutable `if let` guard pattern - --> $DIR/lint-match-arms-2.rs:18:18 + --> $DIR/lint-match-arms-2.rs:18:14 | LL | a if let b = a => {} - | ^ + | ^^^^^^^^^ | = note: this pattern will always match, so the guard is useless = help: consider removing the guard and adding a `let` inside the match arm diff --git a/tests/ui/lint/unused/issue-104397.rs b/tests/ui/lint/unused/issue-104397.rs index 94e15cd96bc..c17e532c17f 100644 --- a/tests/ui/lint/unused/issue-104397.rs +++ b/tests/ui/lint/unused/issue-104397.rs @@ -3,7 +3,7 @@ #![warn(unused)] #![deny(warnings)] -struct Inv<'a>(&'a mut &'a ()); +struct Inv<'a>(#[allow(dead_code)] &'a mut &'a ()); trait Trait {} impl Trait for for<'a> fn(Inv<'a>) {} diff --git a/tests/ui/lint/unused/issue-105061-should-lint.rs b/tests/ui/lint/unused/issue-105061-should-lint.rs index 7e4e0947349..433c2882089 100644 --- a/tests/ui/lint/unused/issue-105061-should-lint.rs +++ b/tests/ui/lint/unused/issue-105061-should-lint.rs @@ -1,7 +1,7 @@ #![warn(unused)] #![deny(warnings)] -struct Inv<'a>(&'a mut &'a ()); +struct Inv<'a>(#[allow(dead_code)] &'a mut &'a ()); trait Trait<'a> {} impl<'b> Trait<'b> for for<'a> fn(Inv<'a>) {} diff --git a/tests/ui/lint/unused/issue-105061.rs b/tests/ui/lint/unused/issue-105061.rs index 92d636d0ac6..6043daf209d 100644 --- a/tests/ui/lint/unused/issue-105061.rs +++ b/tests/ui/lint/unused/issue-105061.rs @@ -1,7 +1,7 @@ #![warn(unused)] #![deny(warnings)] -struct Inv<'a>(&'a mut &'a ()); +struct Inv<'a>(#[allow(dead_code)] &'a mut &'a ()); trait Trait {} impl Trait for (for<'a> fn(Inv<'a>),) {} diff --git a/tests/ui/lint/unused_parens_json_suggestion.fixed b/tests/ui/lint/unused_parens_json_suggestion.fixed index c4004540467..b73197ef1bd 100644 --- a/tests/ui/lint/unused_parens_json_suggestion.fixed +++ b/tests/ui/lint/unused_parens_json_suggestion.fixed @@ -1,4 +1,5 @@ // compile-flags: --error-format json +// error-pattern:unnecessary parentheses // run-rustfix // The output for humans should just highlight the whole span without showing @@ -13,7 +14,7 @@ fn main() { // We want to suggest the properly-balanced expression `1 / (2 + 3)`, not // the malformed `1 / (2 + 3` - let _a = 1 / (2 + 3); //~ERROR unnecessary parentheses + let _a = 1 / (2 + 3); f(); } diff --git a/tests/ui/lint/unused_parens_json_suggestion.rs b/tests/ui/lint/unused_parens_json_suggestion.rs index 962c8bdd7d7..4339655cf9d 100644 --- a/tests/ui/lint/unused_parens_json_suggestion.rs +++ b/tests/ui/lint/unused_parens_json_suggestion.rs @@ -1,4 +1,5 @@ // compile-flags: --error-format json +// error-pattern:unnecessary parentheses // run-rustfix // The output for humans should just highlight the whole span without showing @@ -13,7 +14,7 @@ fn main() { // We want to suggest the properly-balanced expression `1 / (2 + 3)`, not // the malformed `1 / (2 + 3` - let _a = (1 / (2 + 3)); //~ERROR unnecessary parentheses + let _a = (1 / (2 + 3)); f(); } diff --git a/tests/ui/lint/unused_parens_json_suggestion.stderr b/tests/ui/lint/unused_parens_json_suggestion.stderr index 4bdfee9159b..88f6be4236b 100644 --- a/tests/ui/lint/unused_parens_json_suggestion.stderr +++ b/tests/ui/lint/unused_parens_json_suggestion.stderr @@ -1,11 +1,11 @@ -{"$message_type":"diagnostic","message":"unnecessary parentheses around assigned value","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_json_suggestion.rs","byte_start":577,"byte_end":578,"line_start":16,"line_end":16,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" let _a = (1 / (2 + 3)); - --> $DIR/unused_parens_json_suggestion.rs:16:14 +{"$message_type":"diagnostic","message":"unnecessary parentheses around assigned value","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_json_suggestion.rs","byte_start":618,"byte_end":619,"line_start":17,"line_end":17,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" let _a = (1 / (2 + 3));","highlight_start":14,"highlight_end":15}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_json_suggestion.rs","byte_start":630,"byte_end":631,"line_start":17,"line_end":17,"column_start":26,"column_end":27,"is_primary":true,"text":[{"text":" let _a = (1 / (2 + 3));","highlight_start":26,"highlight_end":27}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"the lint level is defined here","code":null,"level":"note","spans":[{"file_name":"$DIR/unused_parens_json_suggestion.rs","byte_start":436,"byte_end":449,"line_start":11,"line_end":11,"column_start":9,"column_end":22,"is_primary":true,"text":[{"text":"#![deny(unused_parens)]","highlight_start":9,"highlight_end":22}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[],"rendered":null},{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_json_suggestion.rs","byte_start":618,"byte_end":619,"line_start":17,"line_end":17,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" let _a = (1 / (2 + 3));","highlight_start":14,"highlight_end":15}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_json_suggestion.rs","byte_start":630,"byte_end":631,"line_start":17,"line_end":17,"column_start":26,"column_end":27,"is_primary":true,"text":[{"text":" let _a = (1 / (2 + 3));","highlight_start":26,"highlight_end":27}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around assigned value + --> $DIR/unused_parens_json_suggestion.rs:17:14 | LL | let _a = (1 / (2 + 3)); | ^ ^ | note: the lint level is defined here - --> $DIR/unused_parens_json_suggestion.rs:10:9 + --> $DIR/unused_parens_json_suggestion.rs:11:9 | LL | #![deny(unused_parens)] | ^^^^^^^^^^^^^ diff --git a/tests/ui/lint/unused_parens_remove_json_suggestion.fixed b/tests/ui/lint/unused_parens_remove_json_suggestion.fixed index 8a57cd57385..39d7a1127b6 100644 --- a/tests/ui/lint/unused_parens_remove_json_suggestion.fixed +++ b/tests/ui/lint/unused_parens_remove_json_suggestion.fixed @@ -1,4 +1,5 @@ // compile-flags: --error-format json +// error-pattern:unnecessary parentheses // run-rustfix // The output for humans should just highlight the whole span without showing @@ -14,7 +15,7 @@ fn main() { let _b = false; - if _b { //~ ERROR unnecessary parentheses + if _b { println!("hello"); } @@ -25,29 +26,29 @@ fn main() { fn f() -> bool { let c = false; - if c { //~ ERROR unnecessary parentheses + if c { println!("next"); } - if c { //~ ERROR unnecessary parentheses + if c { println!("prev"); } while false && true { - if c { //~ ERROR unnecessary parentheses + if c { println!("norm"); } } - while true && false { //~ ERROR unnecessary parentheses - for _ in 0 .. 3 { //~ ERROR unnecessary parentheses + while true && false { + for _ in 0 .. 3 { println!("e~") } } - for _ in 0 .. 3 { //~ ERROR unnecessary parentheses - while true && false { //~ ERROR unnecessary parentheses + for _ in 0 .. 3 { + while true && false { println!("e~") } } diff --git a/tests/ui/lint/unused_parens_remove_json_suggestion.rs b/tests/ui/lint/unused_parens_remove_json_suggestion.rs index 952332d54e9..2748bd3f73d 100644 --- a/tests/ui/lint/unused_parens_remove_json_suggestion.rs +++ b/tests/ui/lint/unused_parens_remove_json_suggestion.rs @@ -1,4 +1,5 @@ // compile-flags: --error-format json +// error-pattern:unnecessary parentheses // run-rustfix // The output for humans should just highlight the whole span without showing @@ -14,7 +15,7 @@ fn main() { let _b = false; - if (_b) { //~ ERROR unnecessary parentheses + if (_b) { println!("hello"); } @@ -25,29 +26,29 @@ fn main() { fn f() -> bool { let c = false; - if(c) { //~ ERROR unnecessary parentheses + if(c) { println!("next"); } - if (c){ //~ ERROR unnecessary parentheses + if (c){ println!("prev"); } while (false && true){ - if (c) { //~ ERROR unnecessary parentheses + if (c) { println!("norm"); } } - while(true && false) { //~ ERROR unnecessary parentheses - for _ in (0 .. 3){ //~ ERROR unnecessary parentheses + while(true && false) { + for _ in (0 .. 3){ println!("e~") } } - for _ in (0 .. 3) { //~ ERROR unnecessary parentheses - while (true && false) { //~ ERROR unnecessary parentheses + for _ in (0 .. 3) { + while (true && false) { println!("e~") } } diff --git a/tests/ui/lint/unused_parens_remove_json_suggestion.stderr b/tests/ui/lint/unused_parens_remove_json_suggestion.stderr index 7521d41cc93..80371c1594f 100644 --- a/tests/ui/lint/unused_parens_remove_json_suggestion.stderr +++ b/tests/ui/lint/unused_parens_remove_json_suggestion.stderr @@ -1,11 +1,11 @@ -{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":481,"byte_end":482,"line_start":17,"line_end":17,"column_start":8,"column_end":9,"is_primary":true,"text":[{"text":" if (_b) { - --> $DIR/unused_parens_remove_json_suggestion.rs:17:8 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":522,"byte_end":523,"line_start":18,"line_end":18,"column_start":8,"column_end":9,"is_primary":true,"text":[{"text":" if (_b) {","highlight_start":8,"highlight_end":9}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":525,"byte_end":526,"line_start":18,"line_end":18,"column_start":11,"column_end":12,"is_primary":true,"text":[{"text":" if (_b) {","highlight_start":11,"highlight_end":12}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"the lint level is defined here","code":null,"level":"note","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":436,"byte_end":449,"line_start":11,"line_end":11,"column_start":9,"column_end":22,"is_primary":true,"text":[{"text":"#![deny(unused_parens)]","highlight_start":9,"highlight_end":22}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[],"rendered":null},{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":522,"byte_end":523,"line_start":18,"line_end":18,"column_start":8,"column_end":9,"is_primary":true,"text":[{"text":" if (_b) {","highlight_start":8,"highlight_end":9}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":525,"byte_end":526,"line_start":18,"line_end":18,"column_start":11,"column_end":12,"is_primary":true,"text":[{"text":" if (_b) {","highlight_start":11,"highlight_end":12}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `if` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:18:8 | LL | if (_b) { | ^ ^ | note: the lint level is defined here - --> $DIR/unused_parens_remove_json_suggestion.rs:10:9 + --> $DIR/unused_parens_remove_json_suggestion.rs:11:9 | LL | #![deny(unused_parens)] | ^^^^^^^^^^^^^ @@ -16,8 +16,8 @@ LL + if _b { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":612,"byte_end":613,"line_start":28,"line_end":28,"column_start":7,"column_end":8,"is_primary":true,"text":[{"text":" if(c) { - --> $DIR/unused_parens_remove_json_suggestion.rs:28:7 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":619,"byte_end":620,"line_start":29,"line_end":29,"column_start":7,"column_end":8,"is_primary":true,"text":[{"text":" if(c) {","highlight_start":7,"highlight_end":8}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":621,"byte_end":622,"line_start":29,"line_end":29,"column_start":9,"column_end":10,"is_primary":true,"text":[{"text":" if(c) {","highlight_start":9,"highlight_end":10}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":619,"byte_end":620,"line_start":29,"line_end":29,"column_start":7,"column_end":8,"is_primary":true,"text":[{"text":" if(c) {","highlight_start":7,"highlight_end":8}],"label":null,"suggested_replacement":" ","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":621,"byte_end":622,"line_start":29,"line_end":29,"column_start":9,"column_end":10,"is_primary":true,"text":[{"text":" if(c) {","highlight_start":9,"highlight_end":10}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `if` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:29:7 | LL | if(c) { | ^ ^ @@ -29,8 +29,8 @@ LL + if c { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":692,"byte_end":693,"line_start":32,"line_end":32,"column_start":8,"column_end":9,"is_primary":true,"text":[{"text":" if (c){ - --> $DIR/unused_parens_remove_json_suggestion.rs:32:8 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":665,"byte_end":666,"line_start":33,"line_end":33,"column_start":8,"column_end":9,"is_primary":true,"text":[{"text":" if (c){","highlight_start":8,"highlight_end":9}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":667,"byte_end":668,"line_start":33,"line_end":33,"column_start":10,"column_end":11,"is_primary":true,"text":[{"text":" if (c){","highlight_start":10,"highlight_end":11}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":665,"byte_end":666,"line_start":33,"line_end":33,"column_start":8,"column_end":9,"is_primary":true,"text":[{"text":" if (c){","highlight_start":8,"highlight_end":9}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":667,"byte_end":668,"line_start":33,"line_end":33,"column_start":10,"column_end":11,"is_primary":true,"text":[{"text":" if (c){","highlight_start":10,"highlight_end":11}],"label":null,"suggested_replacement":" ","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `if` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:33:8 | LL | if (c){ | ^ ^ @@ -42,8 +42,8 @@ LL + if c { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `while` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":774,"byte_end":775,"line_start":36,"line_end":36,"column_start":11,"column_end":12,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":11,"highlight_end":12}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":788,"byte_end":789,"line_start":36,"line_end":36,"column_start":25,"column_end":26,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":25,"highlight_end":26}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":774,"byte_end":775,"line_start":36,"line_end":36,"column_start":11,"column_end":12,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":11,"highlight_end":12}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":788,"byte_end":789,"line_start":36,"line_end":36,"column_start":25,"column_end":26,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":25,"highlight_end":26}],"label":null,"suggested_replacement":" ","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `while` condition - --> $DIR/unused_parens_remove_json_suggestion.rs:36:11 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `while` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":713,"byte_end":714,"line_start":37,"line_end":37,"column_start":11,"column_end":12,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":11,"highlight_end":12}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":727,"byte_end":728,"line_start":37,"line_end":37,"column_start":25,"column_end":26,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":25,"highlight_end":26}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":713,"byte_end":714,"line_start":37,"line_end":37,"column_start":11,"column_end":12,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":11,"highlight_end":12}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":727,"byte_end":728,"line_start":37,"line_end":37,"column_start":25,"column_end":26,"is_primary":true,"text":[{"text":" while (false && true){","highlight_start":25,"highlight_end":26}],"label":null,"suggested_replacement":" ","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `while` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:37:11 | LL | while (false && true){ | ^ ^ @@ -55,8 +55,8 @@ LL + while false && true { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":802,"byte_end":803,"line_start":37,"line_end":37,"column_start":12,"column_end":13,"is_primary":true,"text":[{"text":" if (c) { - --> $DIR/unused_parens_remove_json_suggestion.rs:37:12 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `if` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":741,"byte_end":742,"line_start":38,"line_end":38,"column_start":12,"column_end":13,"is_primary":true,"text":[{"text":" if (c) {","highlight_start":12,"highlight_end":13}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":743,"byte_end":744,"line_start":38,"line_end":38,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" if (c) {","highlight_start":14,"highlight_end":15}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":741,"byte_end":742,"line_start":38,"line_end":38,"column_start":12,"column_end":13,"is_primary":true,"text":[{"text":" if (c) {","highlight_start":12,"highlight_end":13}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":743,"byte_end":744,"line_start":38,"line_end":38,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" if (c) {","highlight_start":14,"highlight_end":15}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `if` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:38:12 | LL | if (c) { | ^ ^ @@ -68,8 +68,8 @@ LL + if c { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `while` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":899,"byte_end":900,"line_start":43,"line_end":43,"column_start":10,"column_end":11,"is_primary":true,"text":[{"text":" while(true && false) { - --> $DIR/unused_parens_remove_json_suggestion.rs:43:10 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `while` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":804,"byte_end":805,"line_start":44,"line_end":44,"column_start":10,"column_end":11,"is_primary":true,"text":[{"text":" while(true && false) {","highlight_start":10,"highlight_end":11}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":818,"byte_end":819,"line_start":44,"line_end":44,"column_start":24,"column_end":25,"is_primary":true,"text":[{"text":" while(true && false) {","highlight_start":24,"highlight_end":25}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":804,"byte_end":805,"line_start":44,"line_end":44,"column_start":10,"column_end":11,"is_primary":true,"text":[{"text":" while(true && false) {","highlight_start":10,"highlight_end":11}],"label":null,"suggested_replacement":" ","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":818,"byte_end":819,"line_start":44,"line_end":44,"column_start":24,"column_end":25,"is_primary":true,"text":[{"text":" while(true && false) {","highlight_start":24,"highlight_end":25}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `while` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:44:10 | LL | while(true && false) { | ^ ^ @@ -81,8 +81,8 @@ LL + while true && false { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `for` iterator expression","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":968,"byte_end":969,"line_start":44,"line_end":44,"column_start":18,"column_end":19,"is_primary":true,"text":[{"text":" for _ in (0 .. 3){ - --> $DIR/unused_parens_remove_json_suggestion.rs:44:18 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `for` iterator expression","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":839,"byte_end":840,"line_start":45,"line_end":45,"column_start":18,"column_end":19,"is_primary":true,"text":[{"text":" for _ in (0 .. 3){","highlight_start":18,"highlight_end":19}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":846,"byte_end":847,"line_start":45,"line_end":45,"column_start":25,"column_end":26,"is_primary":true,"text":[{"text":" for _ in (0 .. 3){","highlight_start":25,"highlight_end":26}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":839,"byte_end":840,"line_start":45,"line_end":45,"column_start":18,"column_end":19,"is_primary":true,"text":[{"text":" for _ in (0 .. 3){","highlight_start":18,"highlight_end":19}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":846,"byte_end":847,"line_start":45,"line_end":45,"column_start":25,"column_end":26,"is_primary":true,"text":[{"text":" for _ in (0 .. 3){","highlight_start":25,"highlight_end":26}],"label":null,"suggested_replacement":" ","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `for` iterator expression + --> $DIR/unused_parens_remove_json_suggestion.rs:45:18 | LL | for _ in (0 .. 3){ | ^ ^ @@ -94,8 +94,8 @@ LL + for _ in 0 .. 3 { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `for` iterator expression","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":1069,"byte_end":1070,"line_start":49,"line_end":49,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" for _ in (0 .. 3) { - --> $DIR/unused_parens_remove_json_suggestion.rs:49:14 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `for` iterator expression","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":906,"byte_end":907,"line_start":50,"line_end":50,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" for _ in (0 .. 3) {","highlight_start":14,"highlight_end":15}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":913,"byte_end":914,"line_start":50,"line_end":50,"column_start":21,"column_end":22,"is_primary":true,"text":[{"text":" for _ in (0 .. 3) {","highlight_start":21,"highlight_end":22}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":906,"byte_end":907,"line_start":50,"line_end":50,"column_start":14,"column_end":15,"is_primary":true,"text":[{"text":" for _ in (0 .. 3) {","highlight_start":14,"highlight_end":15}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":913,"byte_end":914,"line_start":50,"line_end":50,"column_start":21,"column_end":22,"is_primary":true,"text":[{"text":" for _ in (0 .. 3) {","highlight_start":21,"highlight_end":22}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `for` iterator expression + --> $DIR/unused_parens_remove_json_suggestion.rs:50:14 | LL | for _ in (0 .. 3) { | ^ ^ @@ -107,8 +107,8 @@ LL + for _ in 0 .. 3 { | "} -{"$message_type":"diagnostic","message":"unnecessary parentheses around `while` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":1128,"byte_end":1129,"line_start":50,"line_end":50,"column_start":15,"column_end":16,"is_primary":true,"text":[{"text":" while (true && false) { - --> $DIR/unused_parens_remove_json_suggestion.rs:50:15 +{"$message_type":"diagnostic","message":"unnecessary parentheses around `while` condition","code":{"code":"unused_parens","explanation":null},"level":"error","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":931,"byte_end":932,"line_start":51,"line_end":51,"column_start":15,"column_end":16,"is_primary":true,"text":[{"text":" while (true && false) {","highlight_start":15,"highlight_end":16}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":945,"byte_end":946,"line_start":51,"line_end":51,"column_start":29,"column_end":30,"is_primary":true,"text":[{"text":" while (true && false) {","highlight_start":29,"highlight_end":30}],"label":null,"suggested_replacement":null,"suggestion_applicability":null,"expansion":null}],"children":[{"message":"remove these parentheses","code":null,"level":"help","spans":[{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":931,"byte_end":932,"line_start":51,"line_end":51,"column_start":15,"column_end":16,"is_primary":true,"text":[{"text":" while (true && false) {","highlight_start":15,"highlight_end":16}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null},{"file_name":"$DIR/unused_parens_remove_json_suggestion.rs","byte_start":945,"byte_end":946,"line_start":51,"line_end":51,"column_start":29,"column_end":30,"is_primary":true,"text":[{"text":" while (true && false) {","highlight_start":29,"highlight_end":30}],"label":null,"suggested_replacement":"","suggestion_applicability":"MachineApplicable","expansion":null}],"children":[],"rendered":null}],"rendered":"error: unnecessary parentheses around `while` condition + --> $DIR/unused_parens_remove_json_suggestion.rs:51:15 | LL | while (true && false) { | ^ ^ diff --git a/tests/ui/lint/use_suggestion_json.rs b/tests/ui/lint/use_suggestion_json.rs index 7d641e08bf0..6a947f14302 100644 --- a/tests/ui/lint/use_suggestion_json.rs +++ b/tests/ui/lint/use_suggestion_json.rs @@ -1,6 +1,6 @@ // ignore-windows // ignore-sgx std::os::fortanix_sgx::usercalls::alloc::Iter changes compiler suggestions -// compile-flags: --error-format pretty-json --json=diagnostic-rendered-ansi +// compile-flags: --error-format pretty-json --json=diagnostic-rendered-ansi -Z unstable-options // The output for humans should just highlight the whole span without showing // the suggested replacement, but we also want to test that suggested diff --git a/tests/ui/lint/use_suggestion_json.stderr b/tests/ui/lint/use_suggestion_json.stderr index 7dfd269a4e2..b3c973680b7 100644 --- a/tests/ui/lint/use_suggestion_json.stderr +++ b/tests/ui/lint/use_suggestion_json.stderr @@ -1,3 +1,423 @@ -{"$message_type":"diagnostic","message":"`--error-format=pretty-json` is unstable","code":null,"level":"error","spans":[],"children":[],"rendered":"\u001b[0m\u001b[1m\u001b[38;5;9merror\u001b[0m\u001b[0m\u001b[1m: `--error-format=pretty-json` is unstable\u001b[0m +{ + "$message_type": "diagnostic", + "message": "cannot find type `Iter` in this scope", + "code": { + "code": "E0412", + "explanation": "A used type name is not in scope. -"} +Erroneous code examples: + +```compile_fail,E0412 +impl Something {} // error: type name `Something` is not in scope + +// or: + +trait Foo { + fn bar(N); // error: type name `N` is not in scope +} + +// or: + +fn foo(x: T) {} // type name `T` is not in scope +``` + +To fix this error, please verify you didn't misspell the type name, you did +declare it or imported it into the scope. Examples: + +``` +struct Something; + +impl Something {} // ok! + +// or: + +trait Foo { + type N; + + fn bar(_: Self::N); // ok! +} + +// or: + +fn foo<T>(x: T) {} // ok! +``` + +Another case that causes this error is when a type is imported into a parent +module. To fix this, you can follow the suggestion and use File directly or +`use super::File;` which will import the types from the parent namespace. An +example that causes this error is below: + +```compile_fail,E0412 +use std::fs::File; + +mod foo { + fn some_function(f: File) {} +} +``` + +``` +use std::fs::File; + +mod foo { + // either + use super::File; + // or + // use std::fs::File; + fn foo(f: File) {} +} +# fn main() {} // don't insert it for us; that'll break imports +``` +" + }, + "level": "error", + "spans": [ + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 561, + "byte_end": 565, + "line_start": 12, + "line_end": 12, + "column_start": 12, + "column_end": 16, + "is_primary": true, + "text": [ + { + "text": " let x: Iter;", + "highlight_start": 12, + "highlight_end": 16 + } + ], + "label": "not found in this scope", + "suggested_replacement": null, + "suggestion_applicability": null, + "expansion": null + } + ], + "children": [ + { + "message": "consider importing one of these items", + "code": null, + "level": "help", + "spans": [ + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::binary_heap::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::btree_map::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::btree_set::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::hash_map::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::hash_set::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::linked_list::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::collections::vec_deque::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::option::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::path::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::result::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::slice::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + }, + { + "file_name": "$DIR/use_suggestion_json.rs", + "byte_start": 538, + "byte_end": 538, + "line_start": 11, + "line_end": 11, + "column_start": 1, + "column_end": 1, + "is_primary": true, + "text": [ + { + "text": "fn main() {", + "highlight_start": 1, + "highlight_end": 1 + } + ], + "label": null, + "suggested_replacement": "use std::sync::mpsc::Iter; + +", + "suggestion_applicability": "MaybeIncorrect", + "expansion": null + } + ], + "children": [], + "rendered": null + } + ], + "rendered": "\u001b[0m\u001b[1m\u001b[38;5;9merror[E0412]\u001b[0m\u001b[0m\u001b[1m: cannot find type `Iter` in this scope\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m--> \u001b[0m\u001b[0m$DIR/use_suggestion_json.rs:12:12\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m\u001b[1m\u001b[38;5;12mLL\u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m\u001b[0m \u001b[0m\u001b[0m let x: Iter;\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m| \u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;9m^^^^\u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;9mnot found in this scope\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m\u001b[1m\u001b[38;5;14mhelp\u001b[0m\u001b[0m: consider importing one of these items\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m\u001b[1m\u001b[38;5;12mLL\u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[38;5;10m+ use std::collections::binary_heap::Iter;\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m\u001b[1m\u001b[38;5;12mLL\u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[38;5;10m+ use std::collections::btree_map::Iter;\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m\u001b[1m\u001b[38;5;12mLL\u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[38;5;10m+ use std::collections::btree_set::Iter;\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m\u001b[1m\u001b[38;5;12mLL\u001b[0m\u001b[0m \u001b[0m\u001b[0m\u001b[38;5;10m+ use std::collections::hash_map::Iter;\u001b[0m +\u001b[0m \u001b[0m\u001b[0m\u001b[1m\u001b[38;5;12m|\u001b[0m +\u001b[0m and 8 other candidates\u001b[0m + +" +} +{ + "$message_type": "diagnostic", + "message": "aborting due to 1 previous error", + "code": null, + "level": "error", + "spans": [], + "children": [], + "rendered": "\u001b[0m\u001b[1m\u001b[38;5;9merror\u001b[0m\u001b[0m\u001b[1m: aborting due to 1 previous error\u001b[0m + +" +} +{ + "$message_type": "diagnostic", + "message": "For more information about this error, try `rustc --explain E0412`.", + "code": null, + "level": "failure-note", + "spans": [], + "children": [], + "rendered": "\u001b[0m\u001b[1mFor more information about this error, try `rustc --explain E0412`.\u001b[0m +" +} diff --git a/tests/ui/list.rs b/tests/ui/list.rs index ffe9f93860a..e44c94b3219 100644 --- a/tests/ui/list.rs +++ b/tests/ui/list.rs @@ -3,7 +3,7 @@ #![allow(non_camel_case_types)] // pretty-expanded FIXME #23616 -enum list { #[allow(unused_tuple_struct_fields)] cons(isize, Box<list>), nil, } +enum list { #[allow(dead_code)] cons(isize, Box<list>), nil, } pub fn main() { list::cons(10, Box::new(list::cons(11, Box::new(list::cons(12, Box::new(list::nil)))))); diff --git a/tests/ui/lto/lto-still-runs-thread-dtors.rs b/tests/ui/lto/lto-still-runs-thread-dtors.rs index 1c7368b36e1..635ad783b31 100644 --- a/tests/ui/lto/lto-still-runs-thread-dtors.rs +++ b/tests/ui/lto/lto-still-runs-thread-dtors.rs @@ -2,8 +2,6 @@ // compile-flags: -C lto // no-prefer-dynamic // ignore-emscripten no threads support -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck use std::thread; diff --git a/tests/ui/macros/html-literals.rs b/tests/ui/macros/html-literals.rs index 26f00fed9c4..e5ff425041a 100644 --- a/tests/ui/macros/html-literals.rs +++ b/tests/ui/macros/html-literals.rs @@ -88,7 +88,7 @@ pub fn main() { ); } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] enum HTMLFragment { tag(String, Vec<HTMLFragment> ), text(String), diff --git a/tests/ui/macros/issue-118786.stderr b/tests/ui/macros/issue-118786.stderr index ca3a40f31c1..1a8ac9340da 100644 --- a/tests/ui/macros/issue-118786.stderr +++ b/tests/ui/macros/issue-118786.stderr @@ -6,8 +6,8 @@ LL | macro_rules! $macro_name { | help: change the delimiters to curly braces | -LL | macro_rules! {} { - | ~ + +LL | macro_rules! {$macro_name} { + | + + help: add a semicolon | LL | macro_rules! $macro_name; { diff --git a/tests/ui/macros/macro-tt-followed-by-seq.rs b/tests/ui/macros/macro-tt-followed-by-seq.rs index 080dbcfdd41..67238df8524 100644 --- a/tests/ui/macros/macro-tt-followed-by-seq.rs +++ b/tests/ui/macros/macro-tt-followed-by-seq.rs @@ -5,7 +5,7 @@ use self::Join::*; #[derive(Debug)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] enum Join<A,B> { Keep(A,B), Skip(A,B), diff --git a/tests/ui/methods/method-argument-inference-associated-type.rs b/tests/ui/methods/method-argument-inference-associated-type.rs index a3c31fab1c2..852747d06b5 100644 --- a/tests/ui/methods/method-argument-inference-associated-type.rs +++ b/tests/ui/methods/method-argument-inference-associated-type.rs @@ -7,7 +7,7 @@ pub trait Service { fn call(&self, _req: Self::Request); } -pub struct S<T>(#[allow(unused_tuple_struct_fields)] T); +pub struct S<T>(#[allow(dead_code)] T); impl Service for ClientMap { type Request = S<Box<dyn Fn(i32)>>; diff --git a/tests/ui/methods/method-probe-no-guessing-dyn-trait.rs b/tests/ui/methods/method-probe-no-guessing-dyn-trait.rs index ec41b711709..787191a26fb 100644 --- a/tests/ui/methods/method-probe-no-guessing-dyn-trait.rs +++ b/tests/ui/methods/method-probe-no-guessing-dyn-trait.rs @@ -15,7 +15,7 @@ trait MyTrait1 { impl MyTrait1 for Foo<u32> {} -struct Foo<T>(#[allow(unused_tuple_struct_fields)] T); +struct Foo<T>(#[allow(dead_code)] T); impl Deref for Foo<()> { type Target = dyn MyTrait1 + 'static; @@ -33,7 +33,7 @@ trait MyTrait2 { } impl MyTrait2 for u32 {} -struct Bar<T>(#[allow(unused_tuple_struct_fields)] T, u32); +struct Bar<T>(#[allow(dead_code)] T, u32); impl Deref for Bar<u8> { type Target = dyn MyTrait2 + 'static; fn deref(&self) -> &(dyn MyTrait2 + 'static) { diff --git a/tests/ui/mir/lint/assignment-overlap.rs b/tests/ui/mir/lint/assignment-overlap.rs new file mode 100644 index 00000000000..0e4a11467dc --- /dev/null +++ b/tests/ui/mir/lint/assignment-overlap.rs @@ -0,0 +1,19 @@ +// compile-flags: --crate-type=lib -Zlint-mir -Ztreat-err-as-bug +// build-fail +// failure-status: 101 +// dont-check-compiler-stderr +// error-pattern: encountered `Assign` statement with overlapping memory +#![feature(custom_mir, core_intrinsics)] +extern crate core; +use core::intrinsics::mir::*; + +#[custom_mir(dialect = "runtime", phase = "optimized")] +pub fn main() { + mir!( + let a: [u8; 1024]; + { + a = a; + Return() + } + ) +} diff --git a/tests/ui/mir/lint/call-overlap.rs b/tests/ui/mir/lint/call-overlap.rs new file mode 100644 index 00000000000..df38e901e73 --- /dev/null +++ b/tests/ui/mir/lint/call-overlap.rs @@ -0,0 +1,23 @@ +// compile-flags: -Zlint-mir -Ztreat-err-as-bug +// build-fail +// failure-status: 101 +// dont-check-compiler-stderr +// error-pattern: encountered overlapping memory in `Move` arguments to `Call` +#![feature(custom_mir, core_intrinsics)] +extern crate core; +use core::intrinsics::mir::*; + +#[custom_mir(dialect = "runtime", phase = "optimized")] +pub fn main() { + mir!( + let a: [u8; 1024]; + { + Call(a = f(Move(a)), ReturnTo(bb1), UnwindUnreachable()) + } + bb1 = { + Return() + } + ) +} + +pub fn f<T: Copy>(a: T) -> T { a } diff --git a/tests/ui/mir/mir_codegen_switch.rs b/tests/ui/mir/mir_codegen_switch.rs index 9c93499d948..afdcd36f4bc 100644 --- a/tests/ui/mir/mir_codegen_switch.rs +++ b/tests/ui/mir/mir_codegen_switch.rs @@ -1,7 +1,7 @@ // run-pass enum Abc { - A(#[allow(unused_tuple_struct_fields)] u8), - B(#[allow(unused_tuple_struct_fields)] i8), + A(#[allow(dead_code)] u8), + B(#[allow(dead_code)] i8), C, D, } diff --git a/tests/ui/mir/mir_fat_ptr.rs b/tests/ui/mir/mir_fat_ptr.rs index 7c3e07c9e34..0c07fba6e94 100644 --- a/tests/ui/mir/mir_fat_ptr.rs +++ b/tests/ui/mir/mir_fat_ptr.rs @@ -1,7 +1,7 @@ // run-pass // test that ordinary fat pointer operations work. -struct Wrapper<T: ?Sized>(#[allow(unused_tuple_struct_fields)] u32, T); +struct Wrapper<T: ?Sized>(#[allow(dead_code)] u32, T); struct FatPtrContainer<'a> { ptr: &'a [u8] diff --git a/tests/ui/mir/mir_raw_fat_ptr.rs b/tests/ui/mir/mir_raw_fat_ptr.rs index f4a9afd2308..8e5a2043dc6 100644 --- a/tests/ui/mir/mir_raw_fat_ptr.rs +++ b/tests/ui/mir/mir_raw_fat_ptr.rs @@ -105,7 +105,7 @@ impl<T> Foo for T { } } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S<T:?Sized>(u32, T); fn main_ref() { diff --git a/tests/ui/mir/mir_refs_correct.rs b/tests/ui/mir/mir_refs_correct.rs index 6cd9526b749..c5b57f52743 100644 --- a/tests/ui/mir/mir_refs_correct.rs +++ b/tests/ui/mir/mir_refs_correct.rs @@ -3,7 +3,7 @@ extern crate mir_external_refs as ext; -struct S(#[allow(unused_tuple_struct_fields)] u8); +struct S(#[allow(dead_code)] u8); #[derive(Debug, PartialEq, Eq)] struct Unit; @@ -46,7 +46,7 @@ impl<I, O> T<I, O> for O {} impl X for S {} enum E { - U(#[allow(unused_tuple_struct_fields)] u8) + U(#[allow(dead_code)] u8) } #[derive(PartialEq, Debug, Eq)] diff --git a/tests/ui/mir/ssa_call_ret.rs b/tests/ui/mir/ssa_call_ret.rs index 6132a6691de..f8a83249225 100644 --- a/tests/ui/mir/ssa_call_ret.rs +++ b/tests/ui/mir/ssa_call_ret.rs @@ -13,7 +13,7 @@ pub fn f() -> u32 { mir!( let a: u32; { - Call(a = g(), bb1, UnwindCleanup(bb2)) + Call(a = g(), ReturnTo(bb1), UnwindCleanup(bb2)) } bb1 = { RET = a; diff --git a/tests/ui/mir/validate/critical-edge.rs b/tests/ui/mir/validate/critical-edge.rs index 9ef655cd1bb..3bb732ad3f7 100644 --- a/tests/ui/mir/validate/critical-edge.rs +++ b/tests/ui/mir/validate/critical-edge.rs @@ -20,7 +20,7 @@ pub fn f(a: u32) -> u32 { } } bb1 = { - Call(RET = f(1), bb2, UnwindTerminate(ReasonAbi)) + Call(RET = f(1), ReturnTo(bb2), UnwindTerminate(ReasonAbi)) } bb2 = { diff --git a/tests/ui/mir/validate/noncleanup-cleanup.rs b/tests/ui/mir/validate/noncleanup-cleanup.rs index 0a1c4528aa6..a14ab44257f 100644 --- a/tests/ui/mir/validate/noncleanup-cleanup.rs +++ b/tests/ui/mir/validate/noncleanup-cleanup.rs @@ -11,7 +11,7 @@ use core::intrinsics::mir::*; pub fn main() { mir!( { - Call(RET = main(), block, UnwindCleanup(block)) + Call(RET = main(), ReturnTo(block), UnwindCleanup(block)) } block = { Return() diff --git a/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.fixed b/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.fixed index 63b65ab20fe..b8eeb3d5cae 100644 --- a/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.fixed +++ b/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.fixed @@ -4,7 +4,7 @@ macro_rules! my_wrapper { ($expr:expr) => { MyWrapper($expr) } } -pub struct MyWrapper(u32); +pub struct MyWrapper(#[allow(dead_code)] u32); fn main() { let value = MyWrapper(123); diff --git a/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.rs b/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.rs index 2ab4e3955f3..54a13c67350 100644 --- a/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.rs +++ b/tests/ui/mismatched_types/suggest-removing-tuple-struct-field.rs @@ -4,7 +4,7 @@ macro_rules! my_wrapper { ($expr:expr) => { MyWrapper($expr) } } -pub struct MyWrapper(u32); +pub struct MyWrapper(#[allow(dead_code)] u32); fn main() { let value = MyWrapper(123); diff --git a/tests/ui/nullable-pointer-iotareduction.rs b/tests/ui/nullable-pointer-iotareduction.rs index d345fec8118..3f3a962664e 100644 --- a/tests/ui/nullable-pointer-iotareduction.rs +++ b/tests/ui/nullable-pointer-iotareduction.rs @@ -8,7 +8,7 @@ // trying to get assert failure messages that at least identify which case // failed. -enum E<T> { Thing(isize, T), #[allow(unused_tuple_struct_fields)] Nothing((), ((), ()), [i8; 0]) } +enum E<T> { Thing(isize, T), #[allow(dead_code)] Nothing((), ((), ()), [i8; 0]) } impl<T> E<T> { fn is_none(&self) -> bool { match *self { diff --git a/tests/ui/object-safety/bare-trait-dont-suggest-dyn.fixed b/tests/ui/object-safety/bare-trait-dont-suggest-dyn.fixed new file mode 100644 index 00000000000..e95b982966d --- /dev/null +++ b/tests/ui/object-safety/bare-trait-dont-suggest-dyn.fixed @@ -0,0 +1,9 @@ +// run-rustfix +#![deny(bare_trait_objects)] +fn ord_prefer_dot(s: String) -> impl Ord { + //~^ ERROR the trait `Ord` cannot be made into an object + (s.starts_with("."), s) +} +fn main() { + let _ = ord_prefer_dot(String::new()); +} diff --git a/tests/ui/object-safety/bare-trait-dont-suggest-dyn.rs b/tests/ui/object-safety/bare-trait-dont-suggest-dyn.rs new file mode 100644 index 00000000000..fdf7e0a77aa --- /dev/null +++ b/tests/ui/object-safety/bare-trait-dont-suggest-dyn.rs @@ -0,0 +1,9 @@ +// run-rustfix +#![deny(bare_trait_objects)] +fn ord_prefer_dot(s: String) -> Ord { + //~^ ERROR the trait `Ord` cannot be made into an object + (s.starts_with("."), s) +} +fn main() { + let _ = ord_prefer_dot(String::new()); +} diff --git a/tests/ui/object-safety/bare-trait-dont-suggest-dyn.stderr b/tests/ui/object-safety/bare-trait-dont-suggest-dyn.stderr new file mode 100644 index 00000000000..2c499d240ab --- /dev/null +++ b/tests/ui/object-safety/bare-trait-dont-suggest-dyn.stderr @@ -0,0 +1,21 @@ +error[E0038]: the trait `Ord` cannot be made into an object + --> $DIR/bare-trait-dont-suggest-dyn.rs:3:33 + | +LL | fn ord_prefer_dot(s: String) -> Ord { + | ^^^ `Ord` cannot be made into an object + | +note: for a trait to be "object safe" it needs to allow building a vtable to allow the call to be resolvable dynamically; for more information visit <https://doc.rust-lang.org/reference/items/traits.html#object-safety> + --> $SRC_DIR/core/src/cmp.rs:LL:COL + | + = note: the trait cannot be made into an object because it uses `Self` as a type parameter + ::: $SRC_DIR/core/src/cmp.rs:LL:COL + | + = note: the trait cannot be made into an object because it uses `Self` as a type parameter +help: consider using an opaque type instead + | +LL | fn ord_prefer_dot(s: String) -> impl Ord { + | ++++ + +error: aborting due to 1 previous error + +For more information about this error, try `rustc --explain E0038`. diff --git a/tests/ui/object-safety/object-safety-supertrait-mentions-Self.stderr b/tests/ui/object-safety/object-safety-supertrait-mentions-Self.stderr index 08df069275a..fc476691d01 100644 --- a/tests/ui/object-safety/object-safety-supertrait-mentions-Self.stderr +++ b/tests/ui/object-safety/object-safety-supertrait-mentions-Self.stderr @@ -11,6 +11,10 @@ LL | trait Baz : Bar<Self> { | --- ^^^^^^^^^ ...because it uses `Self` as a type parameter | | | this trait cannot be made into an object... +help: consider using an opaque type instead + | +LL | fn make_baz<T:Baz>(t: &T) -> &impl Baz { + | ~~~~ error: aborting due to 1 previous error diff --git a/tests/ui/offset-of/offset-of-arg-count.rs b/tests/ui/offset-of/offset-of-arg-count.rs index 31de45bc756..7b92698c25e 100644 --- a/tests/ui/offset-of/offset-of-arg-count.rs +++ b/tests/ui/offset-of/offset-of-arg-count.rs @@ -8,10 +8,10 @@ fn main() { offset_of!(Container, field, too many arguments); //~ ERROR no rules expected the token `too` offset_of!(S, f); // compiles fine offset_of!(S, f,); // also compiles fine - offset_of!(S, f.); //~ ERROR unexpected end of macro invocation - offset_of!(S, f.,); //~ ERROR expected identifier - offset_of!(S, f..); //~ ERROR no rules expected the token - offset_of!(S, f..,); //~ ERROR no rules expected the token + offset_of!(S, f.); //~ ERROR unexpected token: `)` + offset_of!(S, f.,); //~ ERROR unexpected token: `,` + offset_of!(S, f..); //~ ERROR offset_of expects dot-separated field and variant names + offset_of!(S, f..,); //~ ERROR offset_of expects dot-separated field and variant names offset_of!(Lt<'static>, bar); // issue #111657 offset_of!(Lt<'_>, bar); // issue #111678 } diff --git a/tests/ui/offset-of/offset-of-arg-count.stderr b/tests/ui/offset-of/offset-of-arg-count.stderr index 4275a89545f..af0d42de30d 100644 --- a/tests/ui/offset-of/offset-of-arg-count.stderr +++ b/tests/ui/offset-of/offset-of-arg-count.stderr @@ -13,7 +13,7 @@ error: unexpected end of macro invocation LL | offset_of!(NotEnoughArgumentsWithAComma, ); | ^ missing tokens in macro arguments | -note: while trying to match meta-variable `$fields:tt` +note: while trying to match meta-variable `$fields:expr` --> $SRC_DIR/core/src/mem/mod.rs:LL:COL error: no rules expected the token `too` @@ -24,36 +24,29 @@ LL | offset_of!(Container, field, too many arguments); | = note: while trying to match sequence end -error: unexpected end of macro invocation +error: unexpected token: `)` --> $DIR/offset-of-arg-count.rs:11:21 | LL | offset_of!(S, f.); - | ^ missing tokens in macro arguments - | -note: while trying to match meta-variable `$fields:tt` - --> $SRC_DIR/core/src/mem/mod.rs:LL:COL + | ^ -error: expected identifier, found `,` +error: unexpected token: `,` --> $DIR/offset-of-arg-count.rs:12:21 | LL | offset_of!(S, f.,); - | ^ expected identifier + | ^ -error: no rules expected the token `..` - --> $DIR/offset-of-arg-count.rs:13:20 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-arg-count.rs:13:19 | LL | offset_of!(S, f..); - | ^^ no rules expected this token in macro call - | - = note: while trying to match sequence start + | ^^^ -error: no rules expected the token `..` - --> $DIR/offset-of-arg-count.rs:14:20 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-arg-count.rs:14:19 | LL | offset_of!(S, f..,); - | ^^ no rules expected this token in macro call - | - = note: while trying to match sequence start + | ^^^ error: aborting due to 7 previous errors diff --git a/tests/ui/offset-of/offset-of-builtin.rs b/tests/ui/offset-of/offset-of-builtin.rs index 1be9899887b..6664c10f905 100644 --- a/tests/ui/offset-of/offset-of-builtin.rs +++ b/tests/ui/offset-of/offset-of-builtin.rs @@ -8,37 +8,25 @@ fn main() { builtin # offset_of(NotEnoughArguments); //~ ERROR expected one of } fn t1() { - // Already errored upon at the macro level. Yielding an error would require - // extra effort. - builtin # offset_of(NotEnoughArgumentsWithAComma, ); + builtin # offset_of(NotEnoughArgumentsWithAComma, ); //~ ERROR expected expression } fn t2() { - builtin # offset_of(Container, field, too many arguments); //~ ERROR expected identifier, found - //~| ERROR found `,` - //~| ERROR found `many` - //~| ERROR found `arguments` + builtin # offset_of(S, f, too many arguments); //~ ERROR expected `)`, found `too` } fn t3() { builtin # offset_of(S, f); // compiles fine } fn t4() { - // Already errored upon at the macro level. Yielding an error would require - // extra effort. - builtin # offset_of(S, f); + builtin # offset_of(S, f.); //~ ERROR unexpected token } fn t5() { - builtin # offset_of(S, f.); //~ ERROR expected identifier + builtin # offset_of(S, f.,); //~ ERROR unexpected token } fn t6() { - builtin # offset_of(S, f.,); //~ ERROR expected identifier + builtin # offset_of(S, f..); //~ ERROR offset_of expects dot-separated field and variant names } fn t7() { - builtin # offset_of(S, f..); //~ ERROR expected one of -} -fn t8() { - // Already errored upon at the macro level. Yielding an error would require - // extra effort. - builtin # offset_of(S, f..,); + builtin # offset_of(S, f..,); //~ ERROR offset_of expects dot-separated field and variant names } struct S { f: u8, } diff --git a/tests/ui/offset-of/offset-of-builtin.stderr b/tests/ui/offset-of/offset-of-builtin.stderr index 1a1f33cc613..5917ee29363 100644 --- a/tests/ui/offset-of/offset-of-builtin.stderr +++ b/tests/ui/offset-of/offset-of-builtin.stderr @@ -4,62 +4,43 @@ error: expected one of `!`, `(`, `+`, `,`, `::`, or `<`, found `)` LL | builtin # offset_of(NotEnoughArguments); | ^ expected one of `!`, `(`, `+`, `,`, `::`, or `<` -error: expected identifier, found `,` - --> $DIR/offset-of-builtin.rs:16:41 +error: expected expression, found `)` + --> $DIR/offset-of-builtin.rs:11:55 | -LL | builtin # offset_of(Container, field, too many arguments); - | ^ - | | - | expected identifier - | help: remove this comma +LL | builtin # offset_of(NotEnoughArgumentsWithAComma, ); + | ^ expected expression -error: expected one of `)` or `.`, found `,` - --> $DIR/offset-of-builtin.rs:16:41 +error: expected `)`, found `too` + --> $DIR/offset-of-builtin.rs:14:31 | -LL | builtin # offset_of(Container, field, too many arguments); - | ^ - | | - | expected one of `)` or `.` - | help: missing `.` - -error: expected one of `)` or `.`, found `many` - --> $DIR/offset-of-builtin.rs:16:47 - | -LL | builtin # offset_of(Container, field, too many arguments); - | -^^^^ expected one of `)` or `.` - | | - | help: missing `.` - -error: expected one of `)` or `.`, found `arguments` - --> $DIR/offset-of-builtin.rs:16:52 +LL | builtin # offset_of(S, f, too many arguments); + | ^^^ expected `)` | -LL | builtin # offset_of(Container, field, too many arguments); - | -^^^^^^^^^ expected one of `)` or `.` - | | - | help: missing `.` + = note: unexpected third argument to offset_of -error: expected identifier, found `)` - --> $DIR/offset-of-builtin.rs:30:30 +error: unexpected token: `)` + --> $DIR/offset-of-builtin.rs:20:30 | LL | builtin # offset_of(S, f.); - | ^ expected identifier + | ^ -error: expected identifier, found `,` - --> $DIR/offset-of-builtin.rs:33:30 +error: unexpected token: `,` + --> $DIR/offset-of-builtin.rs:23:30 | LL | builtin # offset_of(S, f.,); - | ^ expected identifier + | ^ -error: expected one of `)` or `.`, found `..` - --> $DIR/offset-of-builtin.rs:36:29 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-builtin.rs:26:28 | LL | builtin # offset_of(S, f..); - | ^^ expected one of `)` or `.` - | -help: if you meant to bind the contents of the rest of the array pattern into `f`, use `@` + | ^^^ + +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-builtin.rs:29:28 | -LL | builtin # offset_of(S, f @ ..); - | + +LL | builtin # offset_of(S, f..,); + | ^^^ -error: aborting due to 8 previous errors +error: aborting due to 7 previous errors diff --git a/tests/ui/offset-of/offset-of-self.rs b/tests/ui/offset-of/offset-of-self.rs index dbeef0e74dc..04dcaf7c0a6 100644 --- a/tests/ui/offset-of/offset-of-self.rs +++ b/tests/ui/offset-of/offset-of-self.rs @@ -17,9 +17,8 @@ impl S { offset_of!(Self, v) } fn v_offs_wrong_syntax() { - offset_of!(Self, Self::v); //~ ERROR no rules expected the token `::` - offset_of!(S, Self); //~ ERROR expected identifier, found keyword `Self` - //~| no field `Self` on type `S` + offset_of!(Self, Self::v); //~ offset_of expects dot-separated field and variant names + offset_of!(S, Self); //~ no field `Self` on type `S` } fn offs_in_c() -> usize { offset_of!(C<Self>, w) @@ -51,8 +50,6 @@ fn main() { offset_of!(self::S, v); offset_of!(Self, v); //~ ERROR cannot find type `Self` in this scope - offset_of!(S, self); //~ ERROR expected identifier, found keyword `self` - //~| no field `self` on type `S` - offset_of!(S, v.self); //~ ERROR expected identifier, found keyword `self` - //~| no field `self` on type `u8` + offset_of!(S, self); //~ no field `self` on type `S` + offset_of!(S, v.self); //~ no field `self` on type `u8` } diff --git a/tests/ui/offset-of/offset-of-self.stderr b/tests/ui/offset-of/offset-of-self.stderr index 2dc17189a70..7c7576e066b 100644 --- a/tests/ui/offset-of/offset-of-self.stderr +++ b/tests/ui/offset-of/offset-of-self.stderr @@ -1,31 +1,11 @@ -error: no rules expected the token `::` - --> $DIR/offset-of-self.rs:20:30 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-self.rs:20:26 | LL | offset_of!(Self, Self::v); - | ^^ no rules expected this token in macro call - | - = note: while trying to match sequence start - -error: expected identifier, found keyword `Self` - --> $DIR/offset-of-self.rs:21:23 - | -LL | offset_of!(S, Self); - | ^^^^ expected identifier, found keyword - -error: expected identifier, found keyword `self` - --> $DIR/offset-of-self.rs:54:19 - | -LL | offset_of!(S, self); - | ^^^^ expected identifier, found keyword - -error: expected identifier, found keyword `self` - --> $DIR/offset-of-self.rs:56:21 - | -LL | offset_of!(S, v.self); - | ^^^^ expected identifier, found keyword + | ^^^^^^^ error[E0412]: cannot find type `S` in module `self` - --> $DIR/offset-of-self.rs:35:26 + --> $DIR/offset-of-self.rs:34:26 | LL | offset_of!(self::S, v); | ^ not found in `self` @@ -41,7 +21,7 @@ LL + offset_of!(S, v); | error[E0411]: cannot find type `Self` in this scope - --> $DIR/offset-of-self.rs:52:16 + --> $DIR/offset-of-self.rs:51:16 | LL | fn main() { | ---- `Self` not allowed in a function @@ -58,13 +38,13 @@ LL | offset_of!(S, Self); = note: available fields are: `v`, `w` error[E0616]: field `v` of struct `T` is private - --> $DIR/offset-of-self.rs:41:30 + --> $DIR/offset-of-self.rs:40:30 | LL | offset_of!(Self, v) | ^ private field error[E0609]: no field `self` on type `S` - --> $DIR/offset-of-self.rs:54:19 + --> $DIR/offset-of-self.rs:53:19 | LL | offset_of!(S, self); | ^^^^ @@ -72,12 +52,12 @@ LL | offset_of!(S, self); = note: available fields are: `v`, `w` error[E0609]: no field `self` on type `u8` - --> $DIR/offset-of-self.rs:56:21 + --> $DIR/offset-of-self.rs:54:21 | LL | offset_of!(S, v.self); | ^^^^ -error: aborting due to 10 previous errors +error: aborting due to 7 previous errors Some errors have detailed explanations: E0411, E0412, E0609, E0616. For more information about an error, try `rustc --explain E0411`. diff --git a/tests/ui/offset-of/offset-of-tuple-nested.rs b/tests/ui/offset-of/offset-of-tuple-nested.rs index 00fbb6bf8f4..59b02e3c5c4 100644 --- a/tests/ui/offset-of/offset-of-tuple-nested.rs +++ b/tests/ui/offset-of/offset-of-tuple-nested.rs @@ -3,7 +3,6 @@ // similar to why `offset-of-unsized.rs` is also build-pass #![feature(offset_of)] -#![feature(builtin_syntax)] use std::mem::offset_of; @@ -17,13 +16,13 @@ fn main() { // Complex case: do all combinations of spacings because the spacing determines what gets // sent to the lexer. println!("{}", offset_of!(ComplexTup, 0.1.1.1)); - println!("{}", builtin # offset_of(ComplexTup, 0. 1.1.1)); + println!("{}", offset_of!(ComplexTup, 0. 1.1.1)); println!("{}", offset_of!(ComplexTup, 0 . 1.1.1)); println!("{}", offset_of!(ComplexTup, 0 .1.1.1)); println!("{}", offset_of!(ComplexTup, 0.1 .1.1)); println!("{}", offset_of!(ComplexTup, 0.1 . 1.1)); println!("{}", offset_of!(ComplexTup, 0.1. 1.1)); - println!("{}", builtin # offset_of(ComplexTup, 0.1.1. 1)); + println!("{}", offset_of!(ComplexTup, 0.1.1. 1)); println!("{}", offset_of!(ComplexTup, 0.1.1 . 1)); println!("{}", offset_of!(ComplexTup, 0.1.1 .1)); diff --git a/tests/ui/offset-of/offset-of-tuple.rs b/tests/ui/offset-of/offset-of-tuple.rs index e31b037ee3e..b6fc1e32229 100644 --- a/tests/ui/offset-of/offset-of-tuple.rs +++ b/tests/ui/offset-of/offset-of-tuple.rs @@ -10,9 +10,9 @@ fn main() { offset_of!((u8, u8), 1_u8); //~ ERROR no field `1_` //~| ERROR suffixes on a tuple index offset_of!((u8, u8), +1); //~ ERROR no rules expected - offset_of!((u8, u8), -1); //~ ERROR no rules expected - offset_of!((u8, u8), 1.); //~ ERROR expected identifier, found `)` - offset_of!((u8, u8), 1 .); //~ ERROR unexpected end of macro + offset_of!((u8, u8), -1); //~ ERROR offset_of expects dot-separated field and variant names + offset_of!((u8, u8), 1.); //~ ERROR offset_of expects dot-separated field and variant names + offset_of!((u8, u8), 1 .); //~ unexpected token: `)` builtin # offset_of((u8, u8), 1e2); //~ ERROR no field `1e2` builtin # offset_of((u8, u8), _0); //~ ERROR no field `_0` builtin # offset_of((u8, u8), 01); //~ ERROR no field `01` @@ -20,12 +20,12 @@ fn main() { //~| ERROR suffixes on a tuple index // We need to put these into curly braces, otherwise only one of the // errors will be emitted and the others suppressed. - { builtin # offset_of((u8, u8), +1) }; //~ ERROR expected identifier, found `+` - { builtin # offset_of((u8, u8), 1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of((u8, u8), 1 .) }; //~ ERROR expected identifier, found `)` + { builtin # offset_of((u8, u8), +1) }; //~ ERROR leading `+` is not supported + { builtin # offset_of((u8, u8), 1.) }; //~ ERROR offset_of expects dot-separated field and variant names + { builtin # offset_of((u8, u8), 1 .) }; //~ ERROR unexpected token: `)` } -type ComplexTup = ((u8, (u8, u8)), u8); +type ComplexTup = (((u8, u8), u8), u8); fn nested() { offset_of!(((u8, u16), (u32, u16, u8)), 0.2); //~ ERROR no field `2` @@ -33,22 +33,22 @@ fn nested() { offset_of!(((u8, u16), (u32, u16, u8)), 1.2.0); //~ ERROR no field `0` // All combinations of spaces (this sends different tokens to the parser) - offset_of!(ComplexTup, 0.0.1.); //~ ERROR expected identifier - offset_of!(ComplexTup, 0 .0.1.); //~ ERROR unexpected end of macro - offset_of!(ComplexTup, 0 . 0.1.); //~ ERROR unexpected end of macro - offset_of!(ComplexTup, 0. 0.1.); //~ ERROR no rules expected - offset_of!(ComplexTup, 0.0 .1.); //~ ERROR expected identifier, found `)` - offset_of!(ComplexTup, 0.0 . 1.); //~ ERROR expected identifier, found `)` - offset_of!(ComplexTup, 0.0. 1.); //~ ERROR expected identifier, found `)` + offset_of!(ComplexTup, 0.0.1.); //~ ERROR unexpected token: `)` + offset_of!(ComplexTup, 0 .0.1.); //~ ERROR unexpected token: `)` + offset_of!(ComplexTup, 0 . 0.1.); //~ ERROR unexpected token: `)` + offset_of!(ComplexTup, 0. 0.1.); //~ ERROR unexpected token: `)` + offset_of!(ComplexTup, 0.0 .1.); //~ ERROR unexpected token: `)` + offset_of!(ComplexTup, 0.0 . 1.); //~ ERROR unexpected token: `)` + offset_of!(ComplexTup, 0.0. 1.); //~ ERROR unexpected token: `)` // Test for builtin too to ensure that the builtin syntax can also handle these cases // We need to put these into curly braces, otherwise only one of the // errors will be emitted and the others suppressed. - { builtin # offset_of(ComplexTup, 0.0.1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of(ComplexTup, 0 .0.1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of(ComplexTup, 0 . 0.1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of(ComplexTup, 0. 0.1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of(ComplexTup, 0.0 .1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of(ComplexTup, 0.0 . 1.) }; //~ ERROR expected identifier, found `)` - { builtin # offset_of(ComplexTup, 0.0. 1.) }; //~ ERROR expected identifier, found `)` + { builtin # offset_of(ComplexTup, 0.0.1.) }; //~ ERROR unexpected token: `)` + { builtin # offset_of(ComplexTup, 0 .0.1.) }; //~ ERROR unexpected token: `)` + { builtin # offset_of(ComplexTup, 0 . 0.1.) }; //~ ERROR unexpected token: `)` + { builtin # offset_of(ComplexTup, 0. 0.1.) }; //~ ERROR unexpected token: `)` + { builtin # offset_of(ComplexTup, 0.0 .1.) }; //~ ERROR unexpected token: `)` + { builtin # offset_of(ComplexTup, 0.0 . 1.) }; //~ ERROR unexpected token: `)` + { builtin # offset_of(ComplexTup, 0.0. 1.) }; //~ ERROR unexpected token: `)` } diff --git a/tests/ui/offset-of/offset-of-tuple.stderr b/tests/ui/offset-of/offset-of-tuple.stderr index ed952345806..e9aa495becd 100644 --- a/tests/ui/offset-of/offset-of-tuple.stderr +++ b/tests/ui/offset-of/offset-of-tuple.stderr @@ -4,65 +4,71 @@ error: suffixes on a tuple index are invalid LL | builtin # offset_of((u8, u8), 1_u8); | ^^^^ invalid suffix `u8` -error: expected identifier, found `+` +error: leading `+` is not supported --> $DIR/offset-of-tuple.rs:23:37 | LL | { builtin # offset_of((u8, u8), +1) }; - | ^ expected identifier + | ^ unexpected `+` + | +help: try removing the `+` + | +LL - { builtin # offset_of((u8, u8), +1) }; +LL + { builtin # offset_of((u8, u8), 1) }; + | -error: expected identifier, found `)` - --> $DIR/offset-of-tuple.rs:24:39 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-tuple.rs:24:38 | LL | { builtin # offset_of((u8, u8), 1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:25:40 | LL | { builtin # offset_of((u8, u8), 1 .) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:47:45 | LL | { builtin # offset_of(ComplexTup, 0.0.1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:48:46 | LL | { builtin # offset_of(ComplexTup, 0 .0.1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:49:47 | LL | { builtin # offset_of(ComplexTup, 0 . 0.1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:50:46 | LL | { builtin # offset_of(ComplexTup, 0. 0.1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:51:46 | LL | { builtin # offset_of(ComplexTup, 0.0 .1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:52:47 | LL | { builtin # offset_of(ComplexTup, 0.0 . 1.) }; - | ^ expected identifier + | ^ -error: expected identifier, found `)` +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:53:46 | LL | { builtin # offset_of(ComplexTup, 0.0. 1.) }; - | ^ expected identifier + | ^ error: suffixes on a tuple index are invalid --> $DIR/offset-of-tuple.rs:10:26 @@ -70,96 +76,74 @@ error: suffixes on a tuple index are invalid LL | offset_of!((u8, u8), 1_u8); | ^^^^ invalid suffix `u8` -error: no rules expected the token `1` - --> $DIR/offset-of-tuple.rs:12:27 +error: no rules expected the token `+` + --> $DIR/offset-of-tuple.rs:12:26 | LL | offset_of!((u8, u8), +1); - | ^ no rules expected this token in macro call + | ^ no rules expected this token in macro call | - = note: while trying to match sequence start +note: while trying to match meta-variable `$fields:expr` + --> $SRC_DIR/core/src/mem/mod.rs:LL:COL -error: no rules expected the token `1` - --> $DIR/offset-of-tuple.rs:13:27 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-tuple.rs:13:26 | LL | offset_of!((u8, u8), -1); - | ^ no rules expected this token in macro call - | - = note: while trying to match sequence start + | ^^ -error: expected identifier, found `)` - --> $DIR/offset-of-tuple.rs:14:5 +error: offset_of expects dot-separated field and variant names + --> $DIR/offset-of-tuple.rs:14:27 | LL | offset_of!((u8, u8), 1.); - | ^^^^^^^^^^^^^^^^^^^^^^^^ expected identifier - | - = note: this error originates in the macro `offset_of` (in Nightly builds, run with -Z macro-backtrace for more info) + | ^ -error: unexpected end of macro invocation +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:15:29 | LL | offset_of!((u8, u8), 1 .); - | ^ missing tokens in macro arguments - | -note: while trying to match meta-variable `$fields:tt` - --> $SRC_DIR/core/src/mem/mod.rs:LL:COL + | ^ -error: expected identifier, found `)` - --> $DIR/offset-of-tuple.rs:36:5 +error: unexpected token: `)` + --> $DIR/offset-of-tuple.rs:36:34 | LL | offset_of!(ComplexTup, 0.0.1.); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ expected identifier - | - = note: this error originates in the macro `offset_of` (in Nightly builds, run with -Z macro-backtrace for more info) + | ^ -error: unexpected end of macro invocation +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:37:35 | LL | offset_of!(ComplexTup, 0 .0.1.); - | ^ missing tokens in macro arguments - | -note: while trying to match meta-variable `$fields:tt` - --> $SRC_DIR/core/src/mem/mod.rs:LL:COL + | ^ -error: unexpected end of macro invocation +error: unexpected token: `)` --> $DIR/offset-of-tuple.rs:38:36 | LL | offset_of!(ComplexTup, 0 . 0.1.); - | ^ missing tokens in macro arguments - | -note: while trying to match meta-variable `$fields:tt` - --> $SRC_DIR/core/src/mem/mod.rs:LL:COL + | ^ -error: no rules expected the token `0.1` - --> $DIR/offset-of-tuple.rs:39:31 +error: unexpected token: `)` + --> $DIR/offset-of-tuple.rs:39:35 | LL | offset_of!(ComplexTup, 0. 0.1.); - | ^^^ no rules expected this token in macro call - | - = note: while trying to match sequence start + | ^ -error: expected identifier, found `)` - --> $DIR/offset-of-tuple.rs:40:5 +error: unexpected token: `)` + --> $DIR/offset-of-tuple.rs:40:35 | LL | offset_of!(ComplexTup, 0.0 .1.); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ expected identifier - | - = note: this error originates in the macro `offset_of` (in Nightly builds, run with -Z macro-backtrace for more info) + | ^ -error: expected identifier, found `)` - --> $DIR/offset-of-tuple.rs:41:5 +error: unexpected token: `)` + --> $DIR/offset-of-tuple.rs:41:36 | LL | offset_of!(ComplexTup, 0.0 . 1.); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ expected identifier - | - = note: this error originates in the macro `offset_of` (in Nightly builds, run with -Z macro-backtrace for more info) + | ^ -error: expected identifier, found `)` - --> $DIR/offset-of-tuple.rs:42:5 +error: unexpected token: `)` + --> $DIR/offset-of-tuple.rs:42:35 | LL | offset_of!(ComplexTup, 0.0. 1.); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ expected identifier - | - = note: this error originates in the macro `offset_of` (in Nightly builds, run with -Z macro-backtrace for more info) + | ^ error[E0609]: no field `_0` on type `(u8, u8)` --> $DIR/offset-of-tuple.rs:7:26 @@ -212,8 +196,16 @@ LL | builtin # offset_of((u8, u8), 1_u8); error[E0609]: no field `2` on type `(u8, u16)` --> $DIR/offset-of-tuple.rs:31:47 | -LL | offset_of!(((u8, u16), (u32, u16, u8)), 0.2); - | ^ +LL | offset_of!(((u8, u16), (u32, u16, u8)), 0.2); + | _____------------------------------------------^- + | | | + | | in this macro invocation +LL | | offset_of!(((u8, u16), (u32, u16, u8)), 1.2); +LL | | offset_of!(((u8, u16), (u32, u16, u8)), 1.2.0); +LL | | +... | + | + = note: this error originates in the macro `offset_of` (in Nightly builds, run with -Z macro-backtrace for more info) error[E0609]: no field `0` on type `u8` --> $DIR/offset-of-tuple.rs:33:49 diff --git a/tests/ui/optimization-fuel-0.rs b/tests/ui/optimization-fuel-0.rs index 2643dbea1c4..77c727ad0f7 100644 --- a/tests/ui/optimization-fuel-0.rs +++ b/tests/ui/optimization-fuel-0.rs @@ -6,9 +6,9 @@ use std::mem::size_of; // compile-flags: -Z fuel=foo=0 -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S1(u8, u16, u8); -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S2(u8, u16, u8); fn main() { diff --git a/tests/ui/optimization-fuel-1.rs b/tests/ui/optimization-fuel-1.rs index d5e2255d9f0..8b3d139201e 100644 --- a/tests/ui/optimization-fuel-1.rs +++ b/tests/ui/optimization-fuel-1.rs @@ -6,9 +6,9 @@ use std::mem::size_of; // compile-flags: -Z fuel=foo=1 -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S1(u8, u16, u8); -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S2(u8, u16, u8); fn main() { diff --git a/tests/ui/packed/issue-118537-field-offset-ice.rs b/tests/ui/packed/issue-118537-field-offset-ice.rs index 657aec64003..679d9d754e3 100644 --- a/tests/ui/packed/issue-118537-field-offset-ice.rs +++ b/tests/ui/packed/issue-118537-field-offset-ice.rs @@ -3,7 +3,7 @@ use std::mem; #[repr(packed(4))] -struct Slice([u32]); +struct Slice(#[allow(dead_code)] [u32]); #[repr(packed(2), C)] struct PackedSized { diff --git a/tests/ui/packed/packed-struct-drop-aligned.rs b/tests/ui/packed/packed-struct-drop-aligned.rs index 4fec72763a4..6c2907c86e9 100644 --- a/tests/ui/packed/packed-struct-drop-aligned.rs +++ b/tests/ui/packed/packed-struct-drop-aligned.rs @@ -24,7 +24,7 @@ impl<'a> Drop for Aligned<'a> { } #[repr(transparent)] -struct NotCopy(#[allow(unused_tuple_struct_fields)] u8); +struct NotCopy(#[allow(dead_code)] u8); #[repr(packed)] struct Packed<'a>(NotCopy, Aligned<'a>); diff --git a/tests/ui/packed/packed-struct-optimized-enum.rs b/tests/ui/packed/packed-struct-optimized-enum.rs index 5e1a1f518c5..c3540f7619b 100644 --- a/tests/ui/packed/packed-struct-optimized-enum.rs +++ b/tests/ui/packed/packed-struct-optimized-enum.rs @@ -1,6 +1,6 @@ // run-pass #[repr(packed)] -struct Packed<T: Copy>(#[allow(unused_tuple_struct_fields)] T); +struct Packed<T: Copy>(#[allow(dead_code)] T); impl<T: Copy> Copy for Packed<T> {} impl<T: Copy> Clone for Packed<T> { diff --git a/tests/ui/packed/packed-tuple-struct-layout.rs b/tests/ui/packed/packed-tuple-struct-layout.rs index 931be5b9414..879553142da 100644 --- a/tests/ui/packed/packed-tuple-struct-layout.rs +++ b/tests/ui/packed/packed-tuple-struct-layout.rs @@ -2,11 +2,11 @@ use std::mem; #[repr(packed)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S4(u8,[u8; 3]); #[repr(packed)] -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S5(u8,u32); pub fn main() { diff --git a/tests/ui/parser/issues/issue-68091-unicode-ident-after-if.stderr b/tests/ui/parser/issues/issue-68091-unicode-ident-after-if.stderr index 2423a7526be..8e125864b8b 100644 --- a/tests/ui/parser/issues/issue-68091-unicode-ident-after-if.stderr +++ b/tests/ui/parser/issues/issue-68091-unicode-ident-after-if.stderr @@ -1,10 +1,10 @@ error: missing condition for `if` expression - --> $DIR/issue-68091-unicode-ident-after-if.rs:3:14 + --> $DIR/issue-68091-unicode-ident-after-if.rs:3:13 | LL | $($c)ö* {} - | ^ - if this block is the condition of the `if` expression, then it must be followed by another block - | | - | expected condition here + | ^ - if this block is the condition of the `if` expression, then it must be followed by another block + | | + | expected condition here error: aborting due to 1 previous error diff --git a/tests/ui/parser/issues/issue-68092-unicode-ident-after-incomplete-expr.stderr b/tests/ui/parser/issues/issue-68092-unicode-ident-after-incomplete-expr.stderr index 43047ff8802..15aa62e0810 100644 --- a/tests/ui/parser/issues/issue-68092-unicode-ident-after-incomplete-expr.stderr +++ b/tests/ui/parser/issues/issue-68092-unicode-ident-after-incomplete-expr.stderr @@ -1,8 +1,8 @@ error: macro expansion ends with an incomplete expression: expected expression - --> $DIR/issue-68092-unicode-ident-after-incomplete-expr.rs:3:14 + --> $DIR/issue-68092-unicode-ident-after-incomplete-expr.rs:3:13 | LL | $($c)ö* - | ^ expected expression + | ^ expected expression error: aborting due to 1 previous error diff --git a/tests/ui/parser/issues/issue-70388-without-witness.fixed b/tests/ui/parser/issues/issue-70388-without-witness.fixed index 8d981405ea1..58721495dcd 100644 --- a/tests/ui/parser/issues/issue-70388-without-witness.fixed +++ b/tests/ui/parser/issues/issue-70388-without-witness.fixed @@ -1,7 +1,7 @@ // run-rustfix // This is for checking if we can apply suggestions as-is. -pub struct Foo(#[allow(unused_tuple_struct_fields)] i32); +pub struct Foo(#[allow(dead_code)] i32); fn main() { let Foo(..) = Foo(0); //~ ERROR unexpected `...` diff --git a/tests/ui/parser/issues/issue-70388-without-witness.rs b/tests/ui/parser/issues/issue-70388-without-witness.rs index bf36073083a..2e679db5464 100644 --- a/tests/ui/parser/issues/issue-70388-without-witness.rs +++ b/tests/ui/parser/issues/issue-70388-without-witness.rs @@ -1,7 +1,7 @@ // run-rustfix // This is for checking if we can apply suggestions as-is. -pub struct Foo(#[allow(unused_tuple_struct_fields)] i32); +pub struct Foo(#[allow(dead_code)] i32); fn main() { let Foo(...) = Foo(0); //~ ERROR unexpected `...` diff --git a/tests/ui/parser/pat-recover-ranges.rs b/tests/ui/parser/pat-recover-ranges.rs new file mode 100644 index 00000000000..65a6fc6fe21 --- /dev/null +++ b/tests/ui/parser/pat-recover-ranges.rs @@ -0,0 +1,19 @@ +fn main() { + match -1 { + 0..=1 => (), + 0..=(1) => (), + //~^ error: range pattern bounds cannot have parentheses + (-12)..=4 => (), + //~^ error: range pattern bounds cannot have parentheses + (0)..=(-4) => (), + //~^ error: range pattern bounds cannot have parentheses + //~| error: range pattern bounds cannot have parentheses + }; +} + +macro_rules! m { + ($pat:pat) => {}; + (($s:literal)..($e:literal)) => {}; +} + +m!((7)..(7)); diff --git a/tests/ui/parser/pat-recover-ranges.stderr b/tests/ui/parser/pat-recover-ranges.stderr new file mode 100644 index 00000000000..0d722b5aa95 --- /dev/null +++ b/tests/ui/parser/pat-recover-ranges.stderr @@ -0,0 +1,50 @@ +error: range pattern bounds cannot have parentheses + --> $DIR/pat-recover-ranges.rs:4:13 + | +LL | 0..=(1) => (), + | ^ ^ + | +help: remove these parentheses + | +LL - 0..=(1) => (), +LL + 0..=1 => (), + | + +error: range pattern bounds cannot have parentheses + --> $DIR/pat-recover-ranges.rs:6:9 + | +LL | (-12)..=4 => (), + | ^ ^ + | +help: remove these parentheses + | +LL - (-12)..=4 => (), +LL + -12..=4 => (), + | + +error: range pattern bounds cannot have parentheses + --> $DIR/pat-recover-ranges.rs:8:9 + | +LL | (0)..=(-4) => (), + | ^ ^ + | +help: remove these parentheses + | +LL - (0)..=(-4) => (), +LL + 0..=(-4) => (), + | + +error: range pattern bounds cannot have parentheses + --> $DIR/pat-recover-ranges.rs:8:15 + | +LL | (0)..=(-4) => (), + | ^ ^ + | +help: remove these parentheses + | +LL - (0)..=(-4) => (), +LL + (0)..=-4 => (), + | + +error: aborting due to 4 previous errors + diff --git a/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.fixed b/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.fixed index 227c40e97c0..a09ff3e5417 100644 --- a/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.fixed +++ b/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.fixed @@ -1,7 +1,7 @@ // Regression test for issues #100790 and #106439. // run-rustfix -pub struct Example(usize) +pub struct Example(#[allow(dead_code)] usize) where (): Sized; //~^^^ ERROR where clauses are not allowed before tuple struct bodies diff --git a/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.rs b/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.rs index 3699e6fe572..e86f2a8acb8 100644 --- a/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.rs +++ b/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.rs @@ -4,7 +4,7 @@ pub struct Example where (): Sized, -(usize); +(#[allow(dead_code)] usize); //~^^^ ERROR where clauses are not allowed before tuple struct bodies struct _Demo diff --git a/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.stderr b/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.stderr index 18aa5fadb6b..ddbf237e866 100644 --- a/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.stderr +++ b/tests/ui/parser/recover/recover-where-clause-before-tuple-struct-body-0.stderr @@ -6,12 +6,12 @@ LL | pub struct Example LL | / where LL | | (): Sized, | |______________^ unexpected where clause -LL | (usize); - | ------- the struct body +LL | (#[allow(dead_code)] usize); + | --------------------------- the struct body | help: move the body before the where clause | -LL ~ pub struct Example(usize) +LL ~ pub struct Example(#[allow(dead_code)] usize) LL | where LL ~ (): Sized; | diff --git a/tests/ui/pattern/issue-117626.rs b/tests/ui/pattern/issue-117626.rs new file mode 100644 index 00000000000..f87147a5d88 --- /dev/null +++ b/tests/ui/pattern/issue-117626.rs @@ -0,0 +1,21 @@ +// check-pass + +#[derive(PartialEq)] +struct NonMatchable; + +impl Eq for NonMatchable {} + +#[derive(PartialEq, Eq)] +enum Foo { + A(NonMatchable), + B(*const u8), +} + +const CONST: Foo = Foo::B(std::ptr::null()); + +fn main() { + match CONST { + CONST => 0, + _ => 1, + }; +} diff --git a/tests/ui/pattern/non-structural-match-types.mir.stderr b/tests/ui/pattern/non-structural-match-types.mir.stderr deleted file mode 100644 index 7a9e5b7e02e..00000000000 --- a/tests/ui/pattern/non-structural-match-types.mir.stderr +++ /dev/null @@ -1,14 +0,0 @@ -error: `{closure@$DIR/non-structural-match-types.rs:12:17: 12:19}` cannot be used in patterns - --> $DIR/non-structural-match-types.rs:12:9 - | -LL | const { || {} } => {} - | ^^^^^^^^^^^^^^^ - -error: `{async block@$DIR/non-structural-match-types.rs:15:17: 15:25}` cannot be used in patterns - --> $DIR/non-structural-match-types.rs:15:9 - | -LL | const { async {} } => {} - | ^^^^^^^^^^^^^^^^^^ - -error: aborting due to 2 previous errors - diff --git a/tests/ui/pattern/non-structural-match-types.rs b/tests/ui/pattern/non-structural-match-types.rs index fb7779fa808..b4f19bb8294 100644 --- a/tests/ui/pattern/non-structural-match-types.rs +++ b/tests/ui/pattern/non-structural-match-types.rs @@ -1,6 +1,4 @@ // edition:2021 -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #![allow(incomplete_features)] #![allow(unreachable_code)] diff --git a/tests/ui/pattern/non-structural-match-types.stderr b/tests/ui/pattern/non-structural-match-types.stderr new file mode 100644 index 00000000000..4a6990da56f --- /dev/null +++ b/tests/ui/pattern/non-structural-match-types.stderr @@ -0,0 +1,14 @@ +error: `{closure@$DIR/non-structural-match-types.rs:10:17: 10:19}` cannot be used in patterns + --> $DIR/non-structural-match-types.rs:10:9 + | +LL | const { || {} } => {} + | ^^^^^^^^^^^^^^^ + +error: `{async block@$DIR/non-structural-match-types.rs:13:17: 13:25}` cannot be used in patterns + --> $DIR/non-structural-match-types.rs:13:9 + | +LL | const { async {} } => {} + | ^^^^^^^^^^^^^^^^^^ + +error: aborting due to 2 previous errors + diff --git a/tests/ui/pattern/non-structural-match-types.thir.stderr b/tests/ui/pattern/non-structural-match-types.thir.stderr deleted file mode 100644 index 7a9e5b7e02e..00000000000 --- a/tests/ui/pattern/non-structural-match-types.thir.stderr +++ /dev/null @@ -1,14 +0,0 @@ -error: `{closure@$DIR/non-structural-match-types.rs:12:17: 12:19}` cannot be used in patterns - --> $DIR/non-structural-match-types.rs:12:9 - | -LL | const { || {} } => {} - | ^^^^^^^^^^^^^^^ - -error: `{async block@$DIR/non-structural-match-types.rs:15:17: 15:25}` cannot be used in patterns - --> $DIR/non-structural-match-types.rs:15:9 - | -LL | const { async {} } => {} - | ^^^^^^^^^^^^^^^^^^ - -error: aborting due to 2 previous errors - diff --git a/tests/ui/pattern/usefulness/deny-irrefutable-let-patterns.stderr b/tests/ui/pattern/usefulness/deny-irrefutable-let-patterns.stderr index cdb6b5c7a49..e8b7f40c70e 100644 --- a/tests/ui/pattern/usefulness/deny-irrefutable-let-patterns.stderr +++ b/tests/ui/pattern/usefulness/deny-irrefutable-let-patterns.stderr @@ -22,10 +22,10 @@ LL | while let _ = 5 { = help: consider instead using a `loop { ... }` with a `let` inside it error: irrefutable `if let` guard pattern - --> $DIR/deny-irrefutable-let-patterns.rs:13:18 + --> $DIR/deny-irrefutable-let-patterns.rs:13:14 | LL | _ if let _ = 2 => {} - | ^ + | ^^^^^^^^^ | = note: this pattern will always match, so the guard is useless = help: consider removing the guard and adding a `let` inside the match arm diff --git a/tests/ui/pattern/usefulness/issue-57472.rs b/tests/ui/pattern/usefulness/issue-57472.rs index 1131006374c..17c252de2be 100644 --- a/tests/ui/pattern/usefulness/issue-57472.rs +++ b/tests/ui/pattern/usefulness/issue-57472.rs @@ -1,4 +1,4 @@ -#![crate_type="lib"] +#![crate_type = "lib"] #![deny(unreachable_patterns)] mod test_struct { @@ -26,10 +26,12 @@ mod test_union { } pub fn test(punned: Punned) { - match punned { - Punned { foo: [_] } => println!("foo"), - Punned { bar: [_] } => println!("bar"), - //~^ ERROR unreachable pattern [unreachable_patterns] + unsafe { + match punned { + Punned { foo: [_] } => println!("foo"), + Punned { bar: [_] } => println!("bar"), + //~^ ERROR unreachable pattern [unreachable_patterns] + } } } } diff --git a/tests/ui/pattern/usefulness/issue-57472.stderr b/tests/ui/pattern/usefulness/issue-57472.stderr index 26efdf6dbaf..c814eaec0d1 100644 --- a/tests/ui/pattern/usefulness/issue-57472.stderr +++ b/tests/ui/pattern/usefulness/issue-57472.stderr @@ -11,10 +11,10 @@ LL | #![deny(unreachable_patterns)] | ^^^^^^^^^^^^^^^^^^^^ error: unreachable pattern - --> $DIR/issue-57472.rs:31:13 + --> $DIR/issue-57472.rs:32:17 | -LL | Punned { bar: [_] } => println!("bar"), - | ^^^^^^^^^^^^^^^^^^^ +LL | Punned { bar: [_] } => println!("bar"), + | ^^^^^^^^^^^^^^^^^^^ error: aborting due to 2 previous errors diff --git a/tests/ui/privacy/auxiliary/issue-119463-extern.rs b/tests/ui/privacy/auxiliary/issue-119463-extern.rs new file mode 100644 index 00000000000..e703a1fb2c2 --- /dev/null +++ b/tests/ui/privacy/auxiliary/issue-119463-extern.rs @@ -0,0 +1,3 @@ +trait PrivateTrait { + const FOO: usize; +} diff --git a/tests/ui/privacy/issue-119463.rs b/tests/ui/privacy/issue-119463.rs new file mode 100644 index 00000000000..e010bc9f536 --- /dev/null +++ b/tests/ui/privacy/issue-119463.rs @@ -0,0 +1,15 @@ +// aux-build:issue-119463-extern.rs + +extern crate issue_119463_extern; + +struct S; + +impl issue_119463_extern::PrivateTrait for S { + //~^ ERROR: trait `PrivateTrait` is private + const FOO: usize = 1; + + fn nonexistent() {} + //~^ ERROR: method `nonexistent` is not a member of trait +} + +fn main() {} diff --git a/tests/ui/privacy/issue-119463.stderr b/tests/ui/privacy/issue-119463.stderr new file mode 100644 index 00000000000..4a0684de613 --- /dev/null +++ b/tests/ui/privacy/issue-119463.stderr @@ -0,0 +1,22 @@ +error[E0407]: method `nonexistent` is not a member of trait `issue_119463_extern::PrivateTrait` + --> $DIR/issue-119463.rs:11:5 + | +LL | fn nonexistent() {} + | ^^^^^^^^^^^^^^^^^^^ not a member of trait `issue_119463_extern::PrivateTrait` + +error[E0603]: trait `PrivateTrait` is private + --> $DIR/issue-119463.rs:7:27 + | +LL | impl issue_119463_extern::PrivateTrait for S { + | ^^^^^^^^^^^^ private trait + | +note: the trait `PrivateTrait` is defined here + --> $DIR/auxiliary/issue-119463-extern.rs:1:1 + | +LL | trait PrivateTrait { + | ^^^^^^^^^^^^^^^^^^ + +error: aborting due to 2 previous errors + +Some errors have detailed explanations: E0407, E0603. +For more information about an error, try `rustc --explain E0407`. diff --git a/tests/ui/proc-macro/capture-macro-rules-invoke.stdout b/tests/ui/proc-macro/capture-macro-rules-invoke.stdout index 71e34119ba7..bbab08bca49 100644 --- a/tests/ui/proc-macro/capture-macro-rules-invoke.stdout +++ b/tests/ui/proc-macro/capture-macro-rules-invoke.stdout @@ -271,7 +271,7 @@ PRINT-BANG INPUT (DEBUG): TokenStream [ span: $DIR/capture-macro-rules-invoke.rs:47:19: 47:20 (#0), }, ], - span: $DIR/capture-macro-rules-invoke.rs:47:13: 47:22 (#0), + span: $DIR/capture-macro-rules-invoke.rs:15:60: 15:63 (#0), }, Punct { ch: ',', diff --git a/tests/ui/proc-macro/expand-expr.rs b/tests/ui/proc-macro/expand-expr.rs index 700aac41c44..89cd1d767a5 100644 --- a/tests/ui/proc-macro/expand-expr.rs +++ b/tests/ui/proc-macro/expand-expr.rs @@ -37,7 +37,7 @@ expand_expr_is!("hello", stringify!(hello)); expand_expr_is!("10 + 20", stringify!(10 + 20)); macro_rules! echo_tts { - ($($t:tt)*) => { $($t)* }; //~ ERROR: expected expression, found `$` + ($($t:tt)*) => { $($t)* }; } macro_rules! echo_lit { @@ -109,7 +109,7 @@ expand_expr_fail!("string"; hello); //~ ERROR: expected one of `.`, `?`, or an o // Invalid expressions produce errors in addition to returning `Err(())`. expand_expr_fail!($); //~ ERROR: expected expression, found `$` -expand_expr_fail!(echo_tts!($)); +expand_expr_fail!(echo_tts!($)); //~ ERROR: expected expression, found `$` expand_expr_fail!(echo_pm!($)); //~ ERROR: expected expression, found `$` // We get errors reported and recover during macro expansion if the macro diff --git a/tests/ui/proc-macro/expand-expr.stderr b/tests/ui/proc-macro/expand-expr.stderr index df61e997289..2b92472e5ab 100644 --- a/tests/ui/proc-macro/expand-expr.stderr +++ b/tests/ui/proc-macro/expand-expr.stderr @@ -11,10 +11,10 @@ LL | expand_expr_fail!($); | ^ expected expression error: expected expression, found `$` - --> $DIR/expand-expr.rs:40:23 + --> $DIR/expand-expr.rs:112:29 | -LL | ($($t:tt)*) => { $($t)* }; - | ^^^^ expected expression +LL | expand_expr_fail!(echo_tts!($)); + | ^ expected expression error: expected expression, found `$` --> $DIR/expand-expr.rs:113:28 diff --git a/tests/ui/proc-macro/inner-attrs.rs b/tests/ui/proc-macro/inner-attrs.rs index 1000c9c755f..c448294e0f6 100644 --- a/tests/ui/proc-macro/inner-attrs.rs +++ b/tests/ui/proc-macro/inner-attrs.rs @@ -1,5 +1,6 @@ // gate-test-custom_inner_attributes // compile-flags: -Z span-debug --error-format human +// error-pattern:expected non-macro inner attribute // aux-build:test-macros.rs // edition:2018 @@ -61,19 +62,19 @@ fn bar() { ); for _ in &[true] { - #![print_attr] //~ ERROR expected non-macro inner attribute + #![print_attr] } let _ = { - #![print_attr] //~ ERROR expected non-macro inner attribute + #![print_attr] }; let _ = async { - #![print_attr] //~ ERROR expected non-macro inner attribute + #![print_attr] }; { - #![print_attr] //~ ERROR expected non-macro inner attribute + #![print_attr] }; } diff --git a/tests/ui/proc-macro/inner-attrs.stderr b/tests/ui/proc-macro/inner-attrs.stderr index a332e143a79..ee8732c650d 100644 --- a/tests/ui/proc-macro/inner-attrs.stderr +++ b/tests/ui/proc-macro/inner-attrs.stderr @@ -1,23 +1,23 @@ error: expected non-macro inner attribute, found attribute macro `print_attr` - --> $DIR/inner-attrs.rs:64:12 + --> $DIR/inner-attrs.rs:65:12 | LL | #![print_attr] | ^^^^^^^^^^ not a non-macro inner attribute error: expected non-macro inner attribute, found attribute macro `print_attr` - --> $DIR/inner-attrs.rs:68:12 + --> $DIR/inner-attrs.rs:69:12 | LL | #![print_attr] | ^^^^^^^^^^ not a non-macro inner attribute error: expected non-macro inner attribute, found attribute macro `print_attr` - --> $DIR/inner-attrs.rs:72:12 + --> $DIR/inner-attrs.rs:73:12 | LL | #![print_attr] | ^^^^^^^^^^ not a non-macro inner attribute error: expected non-macro inner attribute, found attribute macro `print_attr` - --> $DIR/inner-attrs.rs:76:12 + --> $DIR/inner-attrs.rs:77:12 | LL | #![print_attr] | ^^^^^^^^^^ not a non-macro inner attribute diff --git a/tests/ui/proc-macro/inner-attrs.stdout b/tests/ui/proc-macro/inner-attrs.stdout index 037ec044e42..39ec6834f06 100644 --- a/tests/ui/proc-macro/inner-attrs.stdout +++ b/tests/ui/proc-macro/inner-attrs.stdout @@ -2,7 +2,7 @@ PRINT-ATTR_ARGS INPUT (DISPLAY): first PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "first", - span: $DIR/inner-attrs.rs:17:25: 17:30 (#0), + span: $DIR/inner-attrs.rs:18:25: 18:30 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): #[print_target_and_args(second)] fn foo() @@ -13,40 +13,40 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/inner-attrs.rs:18:1: 18:2 (#0), + span: $DIR/inner-attrs.rs:19:1: 19:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:18:3: 18:24 (#0), + span: $DIR/inner-attrs.rs:19:3: 19:24 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "second", - span: $DIR/inner-attrs.rs:18:25: 18:31 (#0), + span: $DIR/inner-attrs.rs:19:25: 19:31 (#0), }, ], - span: $DIR/inner-attrs.rs:18:24: 18:32 (#0), + span: $DIR/inner-attrs.rs:19:24: 19:32 (#0), }, ], - span: $DIR/inner-attrs.rs:18:2: 18:33 (#0), + span: $DIR/inner-attrs.rs:19:2: 19:33 (#0), }, Ident { ident: "fn", - span: $DIR/inner-attrs.rs:19:1: 19:3 (#0), + span: $DIR/inner-attrs.rs:20:1: 20:3 (#0), }, Ident { ident: "foo", - span: $DIR/inner-attrs.rs:19:4: 19:7 (#0), + span: $DIR/inner-attrs.rs:20:4: 20:7 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/inner-attrs.rs:19:7: 19:9 (#0), + span: $DIR/inner-attrs.rs:20:7: 20:9 (#0), }, Group { delimiter: Brace, @@ -54,72 +54,72 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:20:5: 20:6 (#0), + span: $DIR/inner-attrs.rs:21:5: 21:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:20:6: 20:7 (#0), + span: $DIR/inner-attrs.rs:21:6: 21:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:20:8: 20:29 (#0), + span: $DIR/inner-attrs.rs:21:8: 21:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "third", - span: $DIR/inner-attrs.rs:20:30: 20:35 (#0), + span: $DIR/inner-attrs.rs:21:30: 21:35 (#0), }, ], - span: $DIR/inner-attrs.rs:20:29: 20:36 (#0), + span: $DIR/inner-attrs.rs:21:29: 21:36 (#0), }, ], - span: $DIR/inner-attrs.rs:20:7: 20:37 (#0), + span: $DIR/inner-attrs.rs:21:7: 21:37 (#0), }, Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:21:5: 21:6 (#0), + span: $DIR/inner-attrs.rs:22:5: 22:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:21:6: 21:7 (#0), + span: $DIR/inner-attrs.rs:22:6: 22:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:21:8: 21:29 (#0), + span: $DIR/inner-attrs.rs:22:8: 22:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "fourth", - span: $DIR/inner-attrs.rs:21:30: 21:36 (#0), + span: $DIR/inner-attrs.rs:22:30: 22:36 (#0), }, ], - span: $DIR/inner-attrs.rs:21:29: 21:37 (#0), + span: $DIR/inner-attrs.rs:22:29: 22:37 (#0), }, ], - span: $DIR/inner-attrs.rs:21:7: 21:38 (#0), + span: $DIR/inner-attrs.rs:22:7: 22:38 (#0), }, ], - span: $DIR/inner-attrs.rs:19:10: 22:2 (#0), + span: $DIR/inner-attrs.rs:20:10: 23:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): second PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "second", - span: $DIR/inner-attrs.rs:18:25: 18:31 (#0), + span: $DIR/inner-attrs.rs:19:25: 19:31 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): fn foo() @@ -129,16 +129,16 @@ PRINT-ATTR DEEP-RE-COLLECTED (DISPLAY): fn foo() PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "fn", - span: $DIR/inner-attrs.rs:19:1: 19:3 (#0), + span: $DIR/inner-attrs.rs:20:1: 20:3 (#0), }, Ident { ident: "foo", - span: $DIR/inner-attrs.rs:19:4: 19:7 (#0), + span: $DIR/inner-attrs.rs:20:4: 20:7 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/inner-attrs.rs:19:7: 19:9 (#0), + span: $DIR/inner-attrs.rs:20:7: 20:9 (#0), }, Group { delimiter: Brace, @@ -146,72 +146,72 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:20:5: 20:6 (#0), + span: $DIR/inner-attrs.rs:21:5: 21:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:20:6: 20:7 (#0), + span: $DIR/inner-attrs.rs:21:6: 21:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:20:8: 20:29 (#0), + span: $DIR/inner-attrs.rs:21:8: 21:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "third", - span: $DIR/inner-attrs.rs:20:30: 20:35 (#0), + span: $DIR/inner-attrs.rs:21:30: 21:35 (#0), }, ], - span: $DIR/inner-attrs.rs:20:29: 20:36 (#0), + span: $DIR/inner-attrs.rs:21:29: 21:36 (#0), }, ], - span: $DIR/inner-attrs.rs:20:7: 20:37 (#0), + span: $DIR/inner-attrs.rs:21:7: 21:37 (#0), }, Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:21:5: 21:6 (#0), + span: $DIR/inner-attrs.rs:22:5: 22:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:21:6: 21:7 (#0), + span: $DIR/inner-attrs.rs:22:6: 22:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:21:8: 21:29 (#0), + span: $DIR/inner-attrs.rs:22:8: 22:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "fourth", - span: $DIR/inner-attrs.rs:21:30: 21:36 (#0), + span: $DIR/inner-attrs.rs:22:30: 22:36 (#0), }, ], - span: $DIR/inner-attrs.rs:21:29: 21:37 (#0), + span: $DIR/inner-attrs.rs:22:29: 22:37 (#0), }, ], - span: $DIR/inner-attrs.rs:21:7: 21:38 (#0), + span: $DIR/inner-attrs.rs:22:7: 22:38 (#0), }, ], - span: $DIR/inner-attrs.rs:19:10: 22:2 (#0), + span: $DIR/inner-attrs.rs:20:10: 23:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): third PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "third", - span: $DIR/inner-attrs.rs:20:30: 20:35 (#0), + span: $DIR/inner-attrs.rs:21:30: 21:35 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): fn foo() { #![print_target_and_args(fourth)] } @@ -219,16 +219,16 @@ PRINT-ATTR DEEP-RE-COLLECTED (DISPLAY): fn foo() { #! [print_target_and_args(fou PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "fn", - span: $DIR/inner-attrs.rs:19:1: 19:3 (#0), + span: $DIR/inner-attrs.rs:20:1: 20:3 (#0), }, Ident { ident: "foo", - span: $DIR/inner-attrs.rs:19:4: 19:7 (#0), + span: $DIR/inner-attrs.rs:20:4: 20:7 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/inner-attrs.rs:19:7: 19:9 (#0), + span: $DIR/inner-attrs.rs:20:7: 20:9 (#0), }, Group { delimiter: Brace, @@ -236,70 +236,70 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:21:5: 21:6 (#0), + span: $DIR/inner-attrs.rs:22:5: 22:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:21:6: 21:7 (#0), + span: $DIR/inner-attrs.rs:22:6: 22:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:21:8: 21:29 (#0), + span: $DIR/inner-attrs.rs:22:8: 22:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "fourth", - span: $DIR/inner-attrs.rs:21:30: 21:36 (#0), + span: $DIR/inner-attrs.rs:22:30: 22:36 (#0), }, ], - span: $DIR/inner-attrs.rs:21:29: 21:37 (#0), + span: $DIR/inner-attrs.rs:22:29: 22:37 (#0), }, ], - span: $DIR/inner-attrs.rs:21:7: 21:38 (#0), + span: $DIR/inner-attrs.rs:22:7: 22:38 (#0), }, ], - span: $DIR/inner-attrs.rs:19:10: 22:2 (#0), + span: $DIR/inner-attrs.rs:20:10: 23:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): fourth PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "fourth", - span: $DIR/inner-attrs.rs:21:30: 21:36 (#0), + span: $DIR/inner-attrs.rs:22:30: 22:36 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): fn foo() {} PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "fn", - span: $DIR/inner-attrs.rs:19:1: 19:3 (#0), + span: $DIR/inner-attrs.rs:20:1: 20:3 (#0), }, Ident { ident: "foo", - span: $DIR/inner-attrs.rs:19:4: 19:7 (#0), + span: $DIR/inner-attrs.rs:20:4: 20:7 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/inner-attrs.rs:19:7: 19:9 (#0), + span: $DIR/inner-attrs.rs:20:7: 20:9 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/inner-attrs.rs:19:10: 22:2 (#0), + span: $DIR/inner-attrs.rs:20:10: 23:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): mod_first PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "mod_first", - span: $DIR/inner-attrs.rs:24:25: 24:34 (#0), + span: $DIR/inner-attrs.rs:25:25: 25:34 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): #[print_target_and_args(mod_second)] mod inline_mod @@ -313,35 +313,35 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/inner-attrs.rs:25:1: 25:2 (#0), + span: $DIR/inner-attrs.rs:26:1: 26:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:25:3: 25:24 (#0), + span: $DIR/inner-attrs.rs:26:3: 26:24 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "mod_second", - span: $DIR/inner-attrs.rs:25:25: 25:35 (#0), + span: $DIR/inner-attrs.rs:26:25: 26:35 (#0), }, ], - span: $DIR/inner-attrs.rs:25:24: 25:36 (#0), + span: $DIR/inner-attrs.rs:26:24: 26:36 (#0), }, ], - span: $DIR/inner-attrs.rs:25:2: 25:37 (#0), + span: $DIR/inner-attrs.rs:26:2: 26:37 (#0), }, Ident { ident: "mod", - span: $DIR/inner-attrs.rs:26:1: 26:4 (#0), + span: $DIR/inner-attrs.rs:27:1: 27:4 (#0), }, Ident { ident: "inline_mod", - span: $DIR/inner-attrs.rs:26:5: 26:15 (#0), + span: $DIR/inner-attrs.rs:27:5: 27:15 (#0), }, Group { delimiter: Brace, @@ -349,72 +349,72 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:27:5: 27:6 (#0), + span: $DIR/inner-attrs.rs:28:5: 28:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:27:6: 27:7 (#0), + span: $DIR/inner-attrs.rs:28:6: 28:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:27:8: 27:29 (#0), + span: $DIR/inner-attrs.rs:28:8: 28:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "mod_third", - span: $DIR/inner-attrs.rs:27:30: 27:39 (#0), + span: $DIR/inner-attrs.rs:28:30: 28:39 (#0), }, ], - span: $DIR/inner-attrs.rs:27:29: 27:40 (#0), + span: $DIR/inner-attrs.rs:28:29: 28:40 (#0), }, ], - span: $DIR/inner-attrs.rs:27:7: 27:41 (#0), + span: $DIR/inner-attrs.rs:28:7: 28:41 (#0), }, Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:28:5: 28:6 (#0), + span: $DIR/inner-attrs.rs:29:5: 29:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:28:6: 28:7 (#0), + span: $DIR/inner-attrs.rs:29:6: 29:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:28:8: 28:29 (#0), + span: $DIR/inner-attrs.rs:29:8: 29:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "mod_fourth", - span: $DIR/inner-attrs.rs:28:30: 28:40 (#0), + span: $DIR/inner-attrs.rs:29:30: 29:40 (#0), }, ], - span: $DIR/inner-attrs.rs:28:29: 28:41 (#0), + span: $DIR/inner-attrs.rs:29:29: 29:41 (#0), }, ], - span: $DIR/inner-attrs.rs:28:7: 28:42 (#0), + span: $DIR/inner-attrs.rs:29:7: 29:42 (#0), }, ], - span: $DIR/inner-attrs.rs:26:16: 29:2 (#0), + span: $DIR/inner-attrs.rs:27:16: 30:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): mod_second PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "mod_second", - span: $DIR/inner-attrs.rs:25:25: 25:35 (#0), + span: $DIR/inner-attrs.rs:26:25: 26:35 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): mod inline_mod @@ -427,11 +427,11 @@ PRINT-ATTR DEEP-RE-COLLECTED (DISPLAY): mod inline_mod PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "mod", - span: $DIR/inner-attrs.rs:26:1: 26:4 (#0), + span: $DIR/inner-attrs.rs:27:1: 27:4 (#0), }, Ident { ident: "inline_mod", - span: $DIR/inner-attrs.rs:26:5: 26:15 (#0), + span: $DIR/inner-attrs.rs:27:5: 27:15 (#0), }, Group { delimiter: Brace, @@ -439,72 +439,72 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:27:5: 27:6 (#0), + span: $DIR/inner-attrs.rs:28:5: 28:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:27:6: 27:7 (#0), + span: $DIR/inner-attrs.rs:28:6: 28:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:27:8: 27:29 (#0), + span: $DIR/inner-attrs.rs:28:8: 28:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "mod_third", - span: $DIR/inner-attrs.rs:27:30: 27:39 (#0), + span: $DIR/inner-attrs.rs:28:30: 28:39 (#0), }, ], - span: $DIR/inner-attrs.rs:27:29: 27:40 (#0), + span: $DIR/inner-attrs.rs:28:29: 28:40 (#0), }, ], - span: $DIR/inner-attrs.rs:27:7: 27:41 (#0), + span: $DIR/inner-attrs.rs:28:7: 28:41 (#0), }, Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:28:5: 28:6 (#0), + span: $DIR/inner-attrs.rs:29:5: 29:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:28:6: 28:7 (#0), + span: $DIR/inner-attrs.rs:29:6: 29:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:28:8: 28:29 (#0), + span: $DIR/inner-attrs.rs:29:8: 29:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "mod_fourth", - span: $DIR/inner-attrs.rs:28:30: 28:40 (#0), + span: $DIR/inner-attrs.rs:29:30: 29:40 (#0), }, ], - span: $DIR/inner-attrs.rs:28:29: 28:41 (#0), + span: $DIR/inner-attrs.rs:29:29: 29:41 (#0), }, ], - span: $DIR/inner-attrs.rs:28:7: 28:42 (#0), + span: $DIR/inner-attrs.rs:29:7: 29:42 (#0), }, ], - span: $DIR/inner-attrs.rs:26:16: 29:2 (#0), + span: $DIR/inner-attrs.rs:27:16: 30:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): mod_third PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "mod_third", - span: $DIR/inner-attrs.rs:27:30: 27:39 (#0), + span: $DIR/inner-attrs.rs:28:30: 28:39 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): mod inline_mod { #![print_target_and_args(mod_fourth)] } @@ -512,11 +512,11 @@ PRINT-ATTR DEEP-RE-COLLECTED (DISPLAY): mod inline_mod { #! [print_target_and_ar PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "mod", - span: $DIR/inner-attrs.rs:26:1: 26:4 (#0), + span: $DIR/inner-attrs.rs:27:1: 27:4 (#0), }, Ident { ident: "inline_mod", - span: $DIR/inner-attrs.rs:26:5: 26:15 (#0), + span: $DIR/inner-attrs.rs:27:5: 27:15 (#0), }, Group { delimiter: Brace, @@ -524,58 +524,58 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:28:5: 28:6 (#0), + span: $DIR/inner-attrs.rs:29:5: 29:6 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:28:6: 28:7 (#0), + span: $DIR/inner-attrs.rs:29:6: 29:7 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_target_and_args", - span: $DIR/inner-attrs.rs:28:8: 28:29 (#0), + span: $DIR/inner-attrs.rs:29:8: 29:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "mod_fourth", - span: $DIR/inner-attrs.rs:28:30: 28:40 (#0), + span: $DIR/inner-attrs.rs:29:30: 29:40 (#0), }, ], - span: $DIR/inner-attrs.rs:28:29: 28:41 (#0), + span: $DIR/inner-attrs.rs:29:29: 29:41 (#0), }, ], - span: $DIR/inner-attrs.rs:28:7: 28:42 (#0), + span: $DIR/inner-attrs.rs:29:7: 29:42 (#0), }, ], - span: $DIR/inner-attrs.rs:26:16: 29:2 (#0), + span: $DIR/inner-attrs.rs:27:16: 30:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): mod_fourth PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "mod_fourth", - span: $DIR/inner-attrs.rs:28:30: 28:40 (#0), + span: $DIR/inner-attrs.rs:29:30: 29:40 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): mod inline_mod {} PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "mod", - span: $DIR/inner-attrs.rs:26:1: 26:4 (#0), + span: $DIR/inner-attrs.rs:27:1: 27:4 (#0), }, Ident { ident: "inline_mod", - span: $DIR/inner-attrs.rs:26:5: 26:15 (#0), + span: $DIR/inner-attrs.rs:27:5: 27:15 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/inner-attrs.rs:26:16: 29:2 (#0), + span: $DIR/inner-attrs.rs:27:16: 30:2 (#0), }, ] PRINT-DERIVE INPUT (DISPLAY): struct MyDerivePrint @@ -588,63 +588,63 @@ PRINT-DERIVE DEEP-RE-COLLECTED (DISPLAY): struct MyDerivePrint PRINT-DERIVE INPUT (DEBUG): TokenStream [ Ident { ident: "struct", - span: $DIR/inner-attrs.rs:36:1: 36:7 (#0), + span: $DIR/inner-attrs.rs:37:1: 37:7 (#0), }, Ident { ident: "MyDerivePrint", - span: $DIR/inner-attrs.rs:36:8: 36:21 (#0), + span: $DIR/inner-attrs.rs:37:8: 37:21 (#0), }, Group { delimiter: Brace, stream: TokenStream [ Ident { ident: "field", - span: $DIR/inner-attrs.rs:37:5: 37:10 (#0), + span: $DIR/inner-attrs.rs:38:5: 38:10 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/inner-attrs.rs:37:10: 37:11 (#0), + span: $DIR/inner-attrs.rs:38:10: 38:11 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "u8", - span: $DIR/inner-attrs.rs:37:13: 37:15 (#0), + span: $DIR/inner-attrs.rs:38:13: 38:15 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/inner-attrs.rs:37:15: 37:16 (#0), + span: $DIR/inner-attrs.rs:38:15: 38:16 (#0), }, Group { delimiter: Brace, stream: TokenStream [ Ident { ident: "match", - span: $DIR/inner-attrs.rs:38:9: 38:14 (#0), + span: $DIR/inner-attrs.rs:39:9: 39:14 (#0), }, Ident { ident: "true", - span: $DIR/inner-attrs.rs:38:15: 38:19 (#0), + span: $DIR/inner-attrs.rs:39:15: 39:19 (#0), }, Group { delimiter: Brace, stream: TokenStream [ Ident { ident: "_", - span: $DIR/inner-attrs.rs:39:13: 39:14 (#0), + span: $DIR/inner-attrs.rs:40:13: 40:14 (#0), }, Punct { ch: '=', spacing: Joint, - span: $DIR/inner-attrs.rs:39:15: 39:16 (#0), + span: $DIR/inner-attrs.rs:40:15: 40:16 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/inner-attrs.rs:39:16: 39:17 (#0), + span: $DIR/inner-attrs.rs:40:16: 40:17 (#0), }, Group { delimiter: Brace, @@ -652,69 +652,69 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:40:17: 40:18 (#0), + span: $DIR/inner-attrs.rs:41:17: 41:18 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:40:18: 40:19 (#0), + span: $DIR/inner-attrs.rs:41:18: 41:19 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "rustc_dummy", - span: $DIR/inner-attrs.rs:40:41: 40:52 (#0), + span: $DIR/inner-attrs.rs:41:41: 41:52 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "third", - span: $DIR/inner-attrs.rs:40:53: 40:58 (#0), + span: $DIR/inner-attrs.rs:41:53: 41:58 (#0), }, ], - span: $DIR/inner-attrs.rs:40:52: 40:59 (#0), + span: $DIR/inner-attrs.rs:41:52: 41:59 (#0), }, ], - span: $DIR/inner-attrs.rs:40:17: 40:18 (#0), + span: $DIR/inner-attrs.rs:41:17: 41:18 (#0), }, Ident { ident: "true", - span: $DIR/inner-attrs.rs:41:17: 41:21 (#0), + span: $DIR/inner-attrs.rs:42:17: 42:21 (#0), }, ], - span: $DIR/inner-attrs.rs:39:18: 42:14 (#0), + span: $DIR/inner-attrs.rs:40:18: 43:14 (#0), }, ], - span: $DIR/inner-attrs.rs:38:20: 43:10 (#0), + span: $DIR/inner-attrs.rs:39:20: 44:10 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/inner-attrs.rs:43:10: 43:11 (#0), + span: $DIR/inner-attrs.rs:44:10: 44:11 (#0), }, Literal { kind: Integer, symbol: "0", suffix: None, - span: $DIR/inner-attrs.rs:44:9: 44:10 (#0), + span: $DIR/inner-attrs.rs:45:9: 45:10 (#0), }, ], - span: $DIR/inner-attrs.rs:37:17: 45:6 (#0), + span: $DIR/inner-attrs.rs:38:17: 46:6 (#0), }, ], - span: $DIR/inner-attrs.rs:37:12: 45:7 (#0), + span: $DIR/inner-attrs.rs:38:12: 46:7 (#0), }, ], - span: $DIR/inner-attrs.rs:36:22: 46:2 (#0), + span: $DIR/inner-attrs.rs:37:22: 47:2 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): tuple_attrs PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "tuple_attrs", - span: $DIR/inner-attrs.rs:49:29: 49:40 (#0), + span: $DIR/inner-attrs.rs:50:29: 50:40 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): (3, 4, { #![cfg_attr(not(FALSE), rustc_dummy(innermost))] 5 }); @@ -728,23 +728,23 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ kind: Integer, symbol: "3", suffix: None, - span: $DIR/inner-attrs.rs:50:9: 50:10 (#0), + span: $DIR/inner-attrs.rs:51:9: 51:10 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/inner-attrs.rs:50:10: 50:11 (#0), + span: $DIR/inner-attrs.rs:51:10: 51:11 (#0), }, Literal { kind: Integer, symbol: "4", suffix: None, - span: $DIR/inner-attrs.rs:50:12: 50:13 (#0), + span: $DIR/inner-attrs.rs:51:12: 51:13 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/inner-attrs.rs:50:13: 50:14 (#0), + span: $DIR/inner-attrs.rs:51:13: 51:14 (#0), }, Group { delimiter: Brace, @@ -752,85 +752,85 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:51:13: 51:14 (#0), + span: $DIR/inner-attrs.rs:52:13: 52:14 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:51:14: 51:15 (#0), + span: $DIR/inner-attrs.rs:52:14: 52:15 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg_attr", - span: $DIR/inner-attrs.rs:51:16: 51:24 (#0), + span: $DIR/inner-attrs.rs:52:16: 52:24 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/inner-attrs.rs:51:25: 51:28 (#0), + span: $DIR/inner-attrs.rs:52:25: 52:28 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/inner-attrs.rs:51:29: 51:34 (#0), + span: $DIR/inner-attrs.rs:52:29: 52:34 (#0), }, ], - span: $DIR/inner-attrs.rs:51:28: 51:35 (#0), + span: $DIR/inner-attrs.rs:52:28: 52:35 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/inner-attrs.rs:51:35: 51:36 (#0), + span: $DIR/inner-attrs.rs:52:35: 52:36 (#0), }, Ident { ident: "rustc_dummy", - span: $DIR/inner-attrs.rs:51:37: 51:48 (#0), + span: $DIR/inner-attrs.rs:52:37: 52:48 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "innermost", - span: $DIR/inner-attrs.rs:51:49: 51:58 (#0), + span: $DIR/inner-attrs.rs:52:49: 52:58 (#0), }, ], - span: $DIR/inner-attrs.rs:51:48: 51:59 (#0), + span: $DIR/inner-attrs.rs:52:48: 52:59 (#0), }, ], - span: $DIR/inner-attrs.rs:51:24: 51:60 (#0), + span: $DIR/inner-attrs.rs:52:24: 52:60 (#0), }, ], - span: $DIR/inner-attrs.rs:51:15: 51:61 (#0), + span: $DIR/inner-attrs.rs:52:15: 52:61 (#0), }, Literal { kind: Integer, symbol: "5", suffix: None, - span: $DIR/inner-attrs.rs:52:13: 52:14 (#0), + span: $DIR/inner-attrs.rs:53:13: 53:14 (#0), }, ], - span: $DIR/inner-attrs.rs:50:15: 53:10 (#0), + span: $DIR/inner-attrs.rs:51:15: 54:10 (#0), }, ], - span: $DIR/inner-attrs.rs:49:43: 54:6 (#0), + span: $DIR/inner-attrs.rs:50:43: 55:6 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/inner-attrs.rs:54:6: 54:7 (#0), + span: $DIR/inner-attrs.rs:55:6: 55:7 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): tuple_attrs PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "tuple_attrs", - span: $DIR/inner-attrs.rs:56:29: 56:40 (#0), + span: $DIR/inner-attrs.rs:57:29: 57:40 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): (3, 4, { #![cfg_attr(not(FALSE), rustc_dummy(innermost))] 5 }); @@ -844,23 +844,23 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ kind: Integer, symbol: "3", suffix: None, - span: $DIR/inner-attrs.rs:57:9: 57:10 (#0), + span: $DIR/inner-attrs.rs:58:9: 58:10 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/inner-attrs.rs:57:10: 57:11 (#0), + span: $DIR/inner-attrs.rs:58:10: 58:11 (#0), }, Literal { kind: Integer, symbol: "4", suffix: None, - span: $DIR/inner-attrs.rs:57:12: 57:13 (#0), + span: $DIR/inner-attrs.rs:58:12: 58:13 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/inner-attrs.rs:57:13: 57:14 (#0), + span: $DIR/inner-attrs.rs:58:13: 58:14 (#0), }, Group { delimiter: Brace, @@ -868,105 +868,105 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/inner-attrs.rs:58:13: 58:14 (#0), + span: $DIR/inner-attrs.rs:59:13: 59:14 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/inner-attrs.rs:58:14: 58:15 (#0), + span: $DIR/inner-attrs.rs:59:14: 59:15 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg_attr", - span: $DIR/inner-attrs.rs:58:16: 58:24 (#0), + span: $DIR/inner-attrs.rs:59:16: 59:24 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/inner-attrs.rs:58:25: 58:28 (#0), + span: $DIR/inner-attrs.rs:59:25: 59:28 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/inner-attrs.rs:58:29: 58:34 (#0), + span: $DIR/inner-attrs.rs:59:29: 59:34 (#0), }, ], - span: $DIR/inner-attrs.rs:58:28: 58:35 (#0), + span: $DIR/inner-attrs.rs:59:28: 59:35 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/inner-attrs.rs:58:35: 58:36 (#0), + span: $DIR/inner-attrs.rs:59:35: 59:36 (#0), }, Ident { ident: "rustc_dummy", - span: $DIR/inner-attrs.rs:58:37: 58:48 (#0), + span: $DIR/inner-attrs.rs:59:37: 59:48 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "innermost", - span: $DIR/inner-attrs.rs:58:49: 58:58 (#0), + span: $DIR/inner-attrs.rs:59:49: 59:58 (#0), }, ], - span: $DIR/inner-attrs.rs:58:48: 58:59 (#0), + span: $DIR/inner-attrs.rs:59:48: 59:59 (#0), }, ], - span: $DIR/inner-attrs.rs:58:24: 58:60 (#0), + span: $DIR/inner-attrs.rs:59:24: 59:60 (#0), }, ], - span: $DIR/inner-attrs.rs:58:15: 58:61 (#0), + span: $DIR/inner-attrs.rs:59:15: 59:61 (#0), }, Literal { kind: Integer, symbol: "5", suffix: None, - span: $DIR/inner-attrs.rs:59:13: 59:14 (#0), + span: $DIR/inner-attrs.rs:60:13: 60:14 (#0), }, ], - span: $DIR/inner-attrs.rs:57:15: 60:10 (#0), + span: $DIR/inner-attrs.rs:58:15: 61:10 (#0), }, ], - span: $DIR/inner-attrs.rs:56:43: 61:6 (#0), + span: $DIR/inner-attrs.rs:57:43: 62:6 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/inner-attrs.rs:61:6: 61:7 (#0), + span: $DIR/inner-attrs.rs:62:6: 62:7 (#0), }, ] PRINT-ATTR_ARGS INPUT (DISPLAY): tenth PRINT-ATTR_ARGS INPUT (DEBUG): TokenStream [ Ident { ident: "tenth", - span: $DIR/inner-attrs.rs:83:42: 83:47 (#0), + span: $DIR/inner-attrs.rs:84:42: 84:47 (#0), }, ] PRINT-ATTR INPUT (DISPLAY): fn weird_extern() {} PRINT-ATTR INPUT (DEBUG): TokenStream [ Ident { ident: "fn", - span: $DIR/inner-attrs.rs:82:5: 82:7 (#0), + span: $DIR/inner-attrs.rs:83:5: 83:7 (#0), }, Ident { ident: "weird_extern", - span: $DIR/inner-attrs.rs:82:8: 82:20 (#0), + span: $DIR/inner-attrs.rs:83:8: 83:20 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/inner-attrs.rs:82:20: 82:22 (#0), + span: $DIR/inner-attrs.rs:83:20: 83:22 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/inner-attrs.rs:82:23: 84:6 (#0), + span: $DIR/inner-attrs.rs:83:23: 85:6 (#0), }, ] diff --git a/tests/ui/proc-macro/issue-75930-derive-cfg.rs b/tests/ui/proc-macro/issue-75930-derive-cfg.rs index e0213527c50..1e37b40c954 100644 --- a/tests/ui/proc-macro/issue-75930-derive-cfg.rs +++ b/tests/ui/proc-macro/issue-75930-derive-cfg.rs @@ -1,13 +1,10 @@ // check-pass -// compile-flags: -Z span-debug --error-format human +// compile-flags: -Z span-debug // aux-build:test-macros.rs // Regression test for issue #75930 // Tests that we cfg-strip all targets before invoking // a derive macro -// We need '--error-format human' to stop compiletest from -// trying to interpret proc-macro output as JSON messages -// (a pretty-printed struct may cause a line to start with '{' ) // FIXME: We currently lose spans here (see issue #43081) #![no_std] // Don't load unnecessary hygiene information from std @@ -47,6 +44,8 @@ extern crate test_macros; // that kind of correction caused the problem seen in #76399, so maybe not. #[print_helper(a)] //~ WARN derive helper attribute is used before it is introduced + //~| WARN derive helper attribute is used before it is introduced + //~| WARN this was previously accepted //~| WARN this was previously accepted #[cfg_attr(not(FALSE), allow(dead_code))] #[print_attr] diff --git a/tests/ui/proc-macro/issue-75930-derive-cfg.stderr b/tests/ui/proc-macro/issue-75930-derive-cfg.stderr index 1017745de6f..df1e36d7390 100644 --- a/tests/ui/proc-macro/issue-75930-derive-cfg.stderr +++ b/tests/ui/proc-macro/issue-75930-derive-cfg.stderr @@ -1,5 +1,5 @@ warning: derive helper attribute is used before it is introduced - --> $DIR/issue-75930-derive-cfg.rs:49:3 + --> $DIR/issue-75930-derive-cfg.rs:46:3 | LL | #[print_helper(a)] | ^^^^^^^^^^^^ @@ -12,7 +12,7 @@ LL | #[derive(Print)] = note: `#[warn(legacy_derive_helpers)]` on by default warning: derive helper attribute is used before it is introduced - --> $DIR/issue-75930-derive-cfg.rs:49:3 + --> $DIR/issue-75930-derive-cfg.rs:46:3 | LL | #[print_helper(a)] | ^^^^^^^^^^^^ diff --git a/tests/ui/proc-macro/issue-75930-derive-cfg.stdout b/tests/ui/proc-macro/issue-75930-derive-cfg.stdout index 47f26451d1c..093e37f8a8d 100644 --- a/tests/ui/proc-macro/issue-75930-derive-cfg.stdout +++ b/tests/ui/proc-macro/issue-75930-derive-cfg.stdout @@ -74,158 +74,158 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:49:1: 49:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:1: 46:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:49:3: 49:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:3: 46:15 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "a", - span: $DIR/issue-75930-derive-cfg.rs:49:16: 49:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:16: 46:17 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:49:15: 49:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:15: 46:18 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:49:2: 49:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:2: 46:19 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:51:1: 51:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:1: 50:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "allow", - span: $DIR/issue-75930-derive-cfg.rs:51:24: 51:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:24: 50:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "dead_code", - span: $DIR/issue-75930-derive-cfg.rs:51:30: 51:39 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:30: 50:39 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:51:29: 51:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:29: 50:40 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:51:1: 51:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:1: 50:2 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:53:1: 53:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:52:1: 52:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "derive", - span: $DIR/issue-75930-derive-cfg.rs:53:3: 53:9 (#0), + span: $DIR/issue-75930-derive-cfg.rs:52:3: 52:9 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "Print", - span: $DIR/issue-75930-derive-cfg.rs:53:10: 53:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:52:10: 52:15 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:53:9: 53:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:52:9: 52:16 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:53:2: 53:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:52:2: 52:17 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:54:1: 54:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:1: 53:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:54:3: 54:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:3: 53:15 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "b", - span: $DIR/issue-75930-derive-cfg.rs:54:16: 54:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:16: 53:17 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:54:15: 54:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:15: 53:18 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:54:2: 54:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:2: 53:19 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:55:1: 55:7 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:1: 54:7 (#0), }, Ident { ident: "Foo", - span: $DIR/issue-75930-derive-cfg.rs:55:8: 55:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:8: 54:11 (#0), }, Punct { ch: '<', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:55:11: 55:12 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:11: 54:12 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:55:12: 55:13 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:12: 54:13 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:55:14: 55:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:14: 54:17 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:55:18: 55:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:18: 54:23 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:55:17: 55:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:17: 54:24 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:55:13: 55:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:13: 54:25 (#0), }, Ident { ident: "A", - span: $DIR/issue-75930-derive-cfg.rs:55:26: 55:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:26: 54:27 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:55:27: 55:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:27: 54:28 (#0), }, Ident { ident: "B", - span: $DIR/issue-75930-derive-cfg.rs:55:29: 55:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:29: 54:30 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:55:30: 55:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:30: 54:31 (#0), }, Group { delimiter: Brace, @@ -233,128 +233,128 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:56:5: 56:6 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:5: 55:6 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:56:7: 56:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:7: 55:10 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:56:11: 56:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:11: 55:16 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:56:10: 56:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:10: 55:17 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:56:6: 56:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:6: 55:18 (#0), }, Ident { ident: "first", - span: $DIR/issue-75930-derive-cfg.rs:56:19: 56:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:19: 55:24 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:56:24: 56:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:24: 55:25 (#0), }, Ident { ident: "String", - span: $DIR/issue-75930-derive-cfg.rs:56:26: 56:32 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:26: 55:32 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:56:32: 56:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:55:32: 55:33 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:57:5: 57:6 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:5: 56:6 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg_attr", - span: $DIR/issue-75930-derive-cfg.rs:57:7: 57:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:7: 56:15 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:57:16: 57:21 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:16: 56:21 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:57:21: 57:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:21: 56:22 (#0), }, Ident { ident: "deny", - span: $DIR/issue-75930-derive-cfg.rs:57:23: 57:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:23: 56:27 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "warnings", - span: $DIR/issue-75930-derive-cfg.rs:57:28: 57:36 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:28: 56:36 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:57:27: 57:37 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:27: 56:37 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:57:15: 57:38 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:15: 56:38 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:57:6: 57:39 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:6: 56:39 (#0), }, Ident { ident: "second", - span: $DIR/issue-75930-derive-cfg.rs:57:40: 57:46 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:40: 56:46 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:57:46: 57:47 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:46: 56:47 (#0), }, Ident { ident: "bool", - span: $DIR/issue-75930-derive-cfg.rs:57:48: 57:52 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:48: 56:52 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:57:52: 57:53 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:52: 56:53 (#0), }, Ident { ident: "third", - span: $DIR/issue-75930-derive-cfg.rs:58:5: 58:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:5: 57:10 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:58:10: 58:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:10: 57:11 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:58:13: 58:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:13: 57:15 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:58:15: 58:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:15: 57:16 (#0), }, Group { delimiter: Brace, @@ -362,145 +362,145 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:59:9: 59:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:9: 58:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:59:11: 59:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:11: 58:14 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:59:15: 59:20 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:15: 58:20 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:59:14: 59:21 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:14: 58:21 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:59:10: 59:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:10: 58:22 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:59:23: 59:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:23: 58:29 (#0), }, Ident { ident: "Bar", - span: $DIR/issue-75930-derive-cfg.rs:59:30: 59:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:30: 58:33 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:59:33: 59:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:58:33: 58:34 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:60:9: 60:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:9: 59:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:60:11: 60:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:11: 59:14 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:60:15: 60:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:15: 59:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:60:19: 60:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:19: 59:24 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:60:18: 60:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:18: 59:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:60:14: 60:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:14: 59:26 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:60:10: 60:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:10: 59:27 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:60:28: 60:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:28: 59:34 (#0), }, Ident { ident: "Inner", - span: $DIR/issue-75930-derive-cfg.rs:60:35: 60:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:35: 59:40 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:60:40: 60:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:40: 59:41 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:61:9: 61:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:9: 60:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:61:11: 61:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:11: 60:14 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:61:15: 61:20 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:15: 60:20 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:61:14: 61:21 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:14: 60:21 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:61:10: 61:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:10: 60:22 (#0), }, Ident { ident: "let", - span: $DIR/issue-75930-derive-cfg.rs:61:23: 61:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:23: 60:26 (#0), }, Ident { ident: "a", - span: $DIR/issue-75930-derive-cfg.rs:61:27: 61:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:27: 60:28 (#0), }, Punct { ch: '=', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:61:29: 61:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:29: 60:30 (#0), }, Literal { kind: Integer, symbol: "25", suffix: None, - span: $DIR/issue-75930-derive-cfg.rs:61:31: 61:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:31: 60:33 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:61:33: 61:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:60:33: 60:34 (#0), }, Ident { ident: "match", - span: $DIR/issue-75930-derive-cfg.rs:62:9: 62:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:61:9: 61:14 (#0), }, Ident { ident: "true", - span: $DIR/issue-75930-derive-cfg.rs:62:15: 62:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:61:15: 61:19 (#0), }, Group { delimiter: Brace, @@ -508,194 +508,194 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:63:13: 63:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:13: 62:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:63:15: 63:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:15: 62:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:63:19: 63:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:19: 62:24 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:63:18: 63:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:18: 62:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:63:14: 63:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:14: 62:26 (#0), }, Ident { ident: "true", - span: $DIR/issue-75930-derive-cfg.rs:63:27: 63:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:27: 62:31 (#0), }, Punct { ch: '=', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:63:32: 63:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:32: 62:33 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:63:33: 63:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:33: 62:34 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:63:35: 63:37 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:35: 62:37 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:63:37: 63:38 (#0), + span: $DIR/issue-75930-derive-cfg.rs:62:37: 62:38 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:13: 64:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:13: 63:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg_attr", - span: $DIR/issue-75930-derive-cfg.rs:64:15: 64:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:15: 63:23 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:64:24: 64:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:24: 63:27 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:64:28: 64:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:28: 63:33 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:64:27: 64:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:27: 63:34 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:34: 64:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:34: 63:35 (#0), }, Ident { ident: "allow", - span: $DIR/issue-75930-derive-cfg.rs:64:36: 64:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:36: 63:41 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "warnings", - span: $DIR/issue-75930-derive-cfg.rs:64:42: 64:50 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:42: 63:50 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:64:41: 64:51 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:41: 63:51 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:64:23: 64:52 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:23: 63:52 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:64:14: 64:53 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:14: 63:53 (#0), }, Ident { ident: "false", - span: $DIR/issue-75930-derive-cfg.rs:64:54: 64:59 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:54: 63:59 (#0), }, Punct { ch: '=', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:64:60: 64:61 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:60: 63:61 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:61: 64:62 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:61: 63:62 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:64:63: 64:65 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:63: 63:65 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:65: 64:66 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:65: 63:66 (#0), }, Ident { ident: "_", - span: $DIR/issue-75930-derive-cfg.rs:65:13: 65:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:13: 64:14 (#0), }, Punct { ch: '=', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:65:15: 65:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:15: 64:16 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:65:16: 65:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:16: 64:17 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:65:18: 65:20 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:18: 64:20 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:62:20: 66:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:61:20: 65:10 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:66:10: 66:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:65:10: 65:11 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:68:9: 68:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:67:9: 67:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:68:11: 68:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:67:11: 67:23 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "should_be_removed", - span: $DIR/issue-75930-derive-cfg.rs:68:24: 68:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:67:24: 67:41 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:68:23: 68:42 (#0), + span: $DIR/issue-75930-derive-cfg.rs:67:23: 67:42 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:68:10: 68:43 (#0), + span: $DIR/issue-75930-derive-cfg.rs:67:10: 67:43 (#0), }, Ident { ident: "fn", - span: $DIR/issue-75930-derive-cfg.rs:69:9: 69:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:68:9: 68:11 (#0), }, Ident { ident: "removed_fn", - span: $DIR/issue-75930-derive-cfg.rs:69:12: 69:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:68:12: 68:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:69:22: 69:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:68:22: 68:24 (#0), }, Group { delimiter: Brace, @@ -703,108 +703,108 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:70:13: 70:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:69:13: 69:14 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:70:14: 70:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:69:14: 69:15 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:70:16: 70:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:69:16: 69:19 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:70:20: 70:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:69:20: 69:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:70:19: 70:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:69:19: 69:26 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:70:15: 70:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:69:15: 69:27 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:69:25: 71:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:68:25: 70:10 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:73:9: 73:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:9: 72:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:73:11: 73:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:11: 72:23 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "c", - span: $DIR/issue-75930-derive-cfg.rs:73:24: 73:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:24: 72:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:23: 73:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:23: 72:26 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:10: 73:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:10: 72:27 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:73:28: 73:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:28: 72:29 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:73:30: 73:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:30: 72:33 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:73:34: 73:37 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:34: 72:37 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:73:38: 73:43 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:38: 72:43 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:37: 73:44 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:37: 72:44 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:33: 73:45 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:33: 72:45 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:29: 73:46 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:29: 72:46 (#0), }, Ident { ident: "fn", - span: $DIR/issue-75930-derive-cfg.rs:73:47: 73:49 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:47: 72:49 (#0), }, Ident { ident: "kept_fn", - span: $DIR/issue-75930-derive-cfg.rs:73:50: 73:57 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:50: 72:57 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:73:57: 73:59 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:57: 72:59 (#0), }, Group { delimiter: Brace, @@ -812,82 +812,82 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:74:13: 74:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:13: 73:14 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:74:14: 74:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:14: 73:15 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:74:16: 74:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:16: 73:19 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:74:20: 74:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:20: 73:23 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:74:24: 74:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:24: 73:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:74:23: 74:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:23: 73:30 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:74:19: 74:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:19: 73:31 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:74:15: 74:32 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:15: 73:32 (#0), }, Ident { ident: "let", - span: $DIR/issue-75930-derive-cfg.rs:75:13: 75:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:13: 74:16 (#0), }, Ident { ident: "my_val", - span: $DIR/issue-75930-derive-cfg.rs:75:17: 75:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:17: 74:23 (#0), }, Punct { ch: '=', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:75:24: 75:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:24: 74:25 (#0), }, Ident { ident: "true", - span: $DIR/issue-75930-derive-cfg.rs:75:26: 75:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:26: 74:30 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:75:30: 75:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:30: 74:31 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:60: 76:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:60: 75:10 (#0), }, Ident { ident: "enum", - span: $DIR/issue-75930-derive-cfg.rs:78:9: 78:13 (#0), + span: $DIR/issue-75930-derive-cfg.rs:77:9: 77:13 (#0), }, Ident { ident: "TupleEnum", - span: $DIR/issue-75930-derive-cfg.rs:78:14: 78:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:77:14: 77:23 (#0), }, Group { delimiter: Brace, stream: TokenStream [ Ident { ident: "Foo", - span: $DIR/issue-75930-derive-cfg.rs:79:13: 79:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:78:13: 78:16 (#0), }, Group { delimiter: Parenthesis, @@ -895,166 +895,166 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:80:17: 80:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:17: 79:18 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:80:19: 80:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:19: 79:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:80:23: 80:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:23: 79:28 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:80:22: 80:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:22: 79:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:80:18: 80:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:18: 79:30 (#0), }, Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:80:31: 80:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:31: 79:33 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:80:33: 80:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:79:33: 79:34 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:81:17: 81:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:17: 80:18 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:81:19: 81:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:19: 80:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:81:23: 81:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:23: 80:28 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:81:22: 81:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:22: 80:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:81:18: 81:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:18: 80:30 (#0), }, Ident { ident: "bool", - span: $DIR/issue-75930-derive-cfg.rs:81:31: 81:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:31: 80:35 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:81:35: 81:36 (#0), + span: $DIR/issue-75930-derive-cfg.rs:80:35: 80:36 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:82:17: 82:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:17: 81:18 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:82:19: 82:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:19: 81:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:82:23: 82:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:23: 81:26 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:82:27: 82:32 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:27: 81:32 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:82:26: 82:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:26: 81:33 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:82:22: 82:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:22: 81:34 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:82:18: 82:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:18: 81:35 (#0), }, Ident { ident: "i32", - span: $DIR/issue-75930-derive-cfg.rs:82:36: 82:39 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:36: 81:39 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:82:39: 82:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:39: 81:40 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:83:17: 83:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:17: 82:18 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:83:19: 83:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:19: 82:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:83:23: 83:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:23: 82:28 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:83:22: 83:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:22: 82:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:83:18: 83:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:18: 82:30 (#0), }, Ident { ident: "String", - span: $DIR/issue-75930-derive-cfg.rs:83:31: 83:37 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:31: 82:37 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:83:37: 83:38 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:37: 82:38 (#0), }, Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:83:39: 83:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:39: 82:41 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:79:16: 84:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:78:16: 83:14 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:78:24: 85:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:77:24: 84:10 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:87:9: 87:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:86:9: 86:15 (#0), }, Ident { ident: "TupleStruct", - span: $DIR/issue-75930-derive-cfg.rs:87:16: 87:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:86:16: 86:27 (#0), }, Group { delimiter: Parenthesis, @@ -1062,139 +1062,139 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:88:13: 88:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:13: 87:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:88:15: 88:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:15: 87:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:88:19: 88:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:19: 87:24 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:88:18: 88:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:18: 87:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:88:14: 88:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:14: 87:26 (#0), }, Ident { ident: "String", - span: $DIR/issue-75930-derive-cfg.rs:88:27: 88:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:27: 87:33 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:88:33: 88:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:87:33: 87:34 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:89:13: 89:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:13: 88:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:89:15: 89:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:15: 88:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:89:19: 89:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:19: 88:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:89:23: 89:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:23: 88:28 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:89:22: 89:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:22: 88:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:89:18: 89:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:18: 88:30 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:89:14: 89:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:14: 88:31 (#0), }, Ident { ident: "i32", - span: $DIR/issue-75930-derive-cfg.rs:89:32: 89:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:32: 88:35 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:89:35: 89:36 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:35: 88:36 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:90:13: 90:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:13: 89:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:90:15: 90:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:15: 89:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:90:19: 90:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:19: 89:24 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:90:18: 90:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:18: 89:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:90:14: 90:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:14: 89:26 (#0), }, Ident { ident: "bool", - span: $DIR/issue-75930-derive-cfg.rs:90:27: 90:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:27: 89:31 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:90:31: 90:32 (#0), + span: $DIR/issue-75930-derive-cfg.rs:89:31: 89:32 (#0), }, Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:91:13: 91:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:90:13: 90:15 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:87:27: 92:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:86:27: 91:10 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:92:10: 92:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:91:10: 91:11 (#0), }, Ident { ident: "fn", - span: $DIR/issue-75930-derive-cfg.rs:94:9: 94:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:93:9: 93:11 (#0), }, Ident { ident: "plain_removed_fn", - span: $DIR/issue-75930-derive-cfg.rs:94:12: 94:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:93:12: 93:28 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:94:28: 94:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:93:28: 93:30 (#0), }, Group { delimiter: Brace, @@ -1202,122 +1202,122 @@ PRINT-ATTR INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:95:13: 95:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:13: 94:14 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:95:14: 95:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:14: 94:15 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg_attr", - span: $DIR/issue-75930-derive-cfg.rs:95:16: 95:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:16: 94:24 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:95:25: 95:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:25: 94:28 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:95:29: 95:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:29: 94:34 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:95:28: 95:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:28: 94:35 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:95:35: 95:36 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:35: 94:36 (#0), }, Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:95:37: 95:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:37: 94:40 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:95:41: 95:46 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:41: 94:46 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:95:40: 95:47 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:40: 94:47 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:95:24: 95:48 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:24: 94:48 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:95:15: 95:49 (#0), + span: $DIR/issue-75930-derive-cfg.rs:94:15: 94:49 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:94:31: 96:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:93:31: 95:10 (#0), }, Literal { kind: Integer, symbol: "0", suffix: None, - span: $DIR/issue-75930-derive-cfg.rs:98:9: 98:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:97:9: 97:10 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:58:17: 99:6 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:17: 98:6 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:58:12: 99:7 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:12: 98:7 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:99:7: 99:8 (#0), + span: $DIR/issue-75930-derive-cfg.rs:98:7: 98:8 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:100:5: 100:6 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:5: 99:6 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:100:7: 100:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:7: 99:19 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "d", - span: $DIR/issue-75930-derive-cfg.rs:100:20: 100:21 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:20: 99:21 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:100:19: 100:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:19: 99:22 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:100:6: 100:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:6: 99:23 (#0), }, Ident { ident: "fourth", - span: $DIR/issue-75930-derive-cfg.rs:101:5: 101:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:100:5: 100:11 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:101:11: 101:12 (#0), + span: $DIR/issue-75930-derive-cfg.rs:100:11: 100:12 (#0), }, Ident { ident: "B", - span: $DIR/issue-75930-derive-cfg.rs:101:13: 101:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:100:13: 100:14 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:55:32: 102:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:32: 101:2 (#0), }, ] PRINT-DERIVE INPUT (DISPLAY): #[print_helper(a)] #[allow(dead_code)] #[print_helper(b)] struct Foo <B > @@ -1350,141 +1350,141 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:49:1: 49:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:1: 46:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:49:3: 49:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:3: 46:15 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "a", - span: $DIR/issue-75930-derive-cfg.rs:49:16: 49:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:16: 46:17 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:49:15: 49:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:15: 46:18 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:49:2: 49:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:46:2: 46:19 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:51:1: 51:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:1: 50:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "allow", - span: $DIR/issue-75930-derive-cfg.rs:51:24: 51:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:24: 50:29 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "dead_code", - span: $DIR/issue-75930-derive-cfg.rs:51:30: 51:39 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:30: 50:39 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:51:29: 51:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:29: 50:40 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:51:1: 51:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:50:1: 50:2 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:54:1: 54:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:1: 53:2 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:54:3: 54:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:3: 53:15 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "b", - span: $DIR/issue-75930-derive-cfg.rs:54:16: 54:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:16: 53:17 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:54:15: 54:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:15: 53:18 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:54:2: 54:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:53:2: 53:19 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:55:1: 55:7 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:1: 54:7 (#0), }, Ident { ident: "Foo", - span: $DIR/issue-75930-derive-cfg.rs:55:8: 55:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:8: 54:11 (#0), }, Punct { ch: '<', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:55:11: 55:12 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:11: 54:12 (#0), }, Ident { ident: "B", - span: $DIR/issue-75930-derive-cfg.rs:55:29: 55:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:29: 54:30 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:55:30: 55:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:30: 54:31 (#0), }, Group { delimiter: Brace, stream: TokenStream [ Ident { ident: "second", - span: $DIR/issue-75930-derive-cfg.rs:57:40: 57:46 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:40: 56:46 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:57:46: 57:47 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:46: 56:47 (#0), }, Ident { ident: "bool", - span: $DIR/issue-75930-derive-cfg.rs:57:48: 57:52 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:48: 56:52 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:57:52: 57:53 (#0), + span: $DIR/issue-75930-derive-cfg.rs:56:52: 56:53 (#0), }, Ident { ident: "third", - span: $DIR/issue-75930-derive-cfg.rs:58:5: 58:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:5: 57:10 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:58:10: 58:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:10: 57:11 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:58:13: 58:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:13: 57:15 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:58:15: 58:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:15: 57:16 (#0), }, Group { delimiter: Brace, @@ -1492,58 +1492,58 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:60:9: 60:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:9: 59:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:60:11: 60:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:11: 59:14 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:60:15: 60:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:15: 59:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:60:19: 60:24 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:19: 59:24 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:60:18: 60:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:18: 59:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:60:14: 60:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:14: 59:26 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:60:10: 60:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:10: 59:27 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:60:28: 60:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:28: 59:34 (#0), }, Ident { ident: "Inner", - span: $DIR/issue-75930-derive-cfg.rs:60:35: 60:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:35: 59:40 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:60:40: 60:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:59:40: 59:41 (#0), }, Ident { ident: "match", - span: $DIR/issue-75930-derive-cfg.rs:62:9: 62:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:61:9: 61:14 (#0), }, Ident { ident: "true", - span: $DIR/issue-75930-derive-cfg.rs:62:15: 62:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:61:15: 61:19 (#0), }, Group { delimiter: Brace, @@ -1551,151 +1551,151 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:13: 64:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:13: 63:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "allow", - span: $DIR/issue-75930-derive-cfg.rs:64:36: 64:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:36: 63:41 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "warnings", - span: $DIR/issue-75930-derive-cfg.rs:64:42: 64:50 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:42: 63:50 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:64:41: 64:51 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:41: 63:51 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:64:13: 64:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:13: 63:14 (#0), }, Ident { ident: "false", - span: $DIR/issue-75930-derive-cfg.rs:64:54: 64:59 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:54: 63:59 (#0), }, Punct { ch: '=', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:64:60: 64:61 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:60: 63:61 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:61: 64:62 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:61: 63:62 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:64:63: 64:65 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:63: 63:65 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:64:65: 64:66 (#0), + span: $DIR/issue-75930-derive-cfg.rs:63:65: 63:66 (#0), }, Ident { ident: "_", - span: $DIR/issue-75930-derive-cfg.rs:65:13: 65:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:13: 64:14 (#0), }, Punct { ch: '=', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:65:15: 65:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:15: 64:16 (#0), }, Punct { ch: '>', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:65:16: 65:17 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:16: 64:17 (#0), }, Group { delimiter: Brace, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:65:18: 65:20 (#0), + span: $DIR/issue-75930-derive-cfg.rs:64:18: 64:20 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:62:20: 66:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:61:20: 65:10 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:66:10: 66:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:65:10: 65:11 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:73:9: 73:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:9: 72:10 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:73:11: 73:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:11: 72:23 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "c", - span: $DIR/issue-75930-derive-cfg.rs:73:24: 73:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:24: 72:25 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:23: 73:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:23: 72:26 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:10: 73:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:10: 72:27 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:73:28: 73:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:28: 72:29 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:73:30: 73:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:30: 72:33 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:73:34: 73:37 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:34: 72:37 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:73:38: 73:43 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:38: 72:43 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:37: 73:44 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:37: 72:44 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:33: 73:45 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:33: 72:45 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:29: 73:46 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:29: 72:46 (#0), }, Ident { ident: "fn", - span: $DIR/issue-75930-derive-cfg.rs:73:47: 73:49 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:47: 72:49 (#0), }, Ident { ident: "kept_fn", - span: $DIR/issue-75930-derive-cfg.rs:73:50: 73:57 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:50: 72:57 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [], - span: $DIR/issue-75930-derive-cfg.rs:73:57: 73:59 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:57: 72:59 (#0), }, Group { delimiter: Brace, @@ -1703,82 +1703,82 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Joint, - span: $DIR/issue-75930-derive-cfg.rs:74:13: 74:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:13: 73:14 (#0), }, Punct { ch: '!', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:74:14: 74:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:14: 73:15 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:74:16: 74:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:16: 73:19 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:74:20: 74:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:20: 73:23 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:74:24: 74:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:24: 73:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:74:23: 74:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:23: 73:30 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:74:19: 74:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:19: 73:31 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:74:15: 74:32 (#0), + span: $DIR/issue-75930-derive-cfg.rs:73:15: 73:32 (#0), }, Ident { ident: "let", - span: $DIR/issue-75930-derive-cfg.rs:75:13: 75:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:13: 74:16 (#0), }, Ident { ident: "my_val", - span: $DIR/issue-75930-derive-cfg.rs:75:17: 75:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:17: 74:23 (#0), }, Punct { ch: '=', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:75:24: 75:25 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:24: 74:25 (#0), }, Ident { ident: "true", - span: $DIR/issue-75930-derive-cfg.rs:75:26: 75:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:26: 74:30 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:75:30: 75:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:74:30: 74:31 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:73:60: 76:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:72:60: 75:10 (#0), }, Ident { ident: "enum", - span: $DIR/issue-75930-derive-cfg.rs:78:9: 78:13 (#0), + span: $DIR/issue-75930-derive-cfg.rs:77:9: 77:13 (#0), }, Ident { ident: "TupleEnum", - span: $DIR/issue-75930-derive-cfg.rs:78:14: 78:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:77:14: 77:23 (#0), }, Group { delimiter: Brace, stream: TokenStream [ Ident { ident: "Foo", - span: $DIR/issue-75930-derive-cfg.rs:79:13: 79:16 (#0), + span: $DIR/issue-75930-derive-cfg.rs:78:13: 78:16 (#0), }, Group { delimiter: Parenthesis, @@ -1786,64 +1786,64 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:82:17: 82:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:17: 81:18 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:82:19: 82:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:19: 81:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:82:23: 82:26 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:23: 81:26 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:82:27: 82:32 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:27: 81:32 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:82:26: 82:33 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:26: 81:33 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:82:22: 82:34 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:22: 81:34 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:82:18: 82:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:18: 81:35 (#0), }, Ident { ident: "i32", - span: $DIR/issue-75930-derive-cfg.rs:82:36: 82:39 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:36: 81:39 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:82:39: 82:40 (#0), + span: $DIR/issue-75930-derive-cfg.rs:81:39: 81:40 (#0), }, Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:83:39: 83:41 (#0), + span: $DIR/issue-75930-derive-cfg.rs:82:39: 82:41 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:79:16: 84:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:78:16: 83:14 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:78:24: 85:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:77:24: 84:10 (#0), }, Ident { ident: "struct", - span: $DIR/issue-75930-derive-cfg.rs:87:9: 87:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:86:9: 86:15 (#0), }, Ident { ident: "TupleStruct", - span: $DIR/issue-75930-derive-cfg.rs:87:16: 87:27 (#0), + span: $DIR/issue-75930-derive-cfg.rs:86:16: 86:27 (#0), }, Group { delimiter: Parenthesis, @@ -1851,115 +1851,115 @@ PRINT-DERIVE INPUT (DEBUG): TokenStream [ Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:89:13: 89:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:13: 88:14 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "cfg", - span: $DIR/issue-75930-derive-cfg.rs:89:15: 89:18 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:15: 88:18 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "not", - span: $DIR/issue-75930-derive-cfg.rs:89:19: 89:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:19: 88:22 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "FALSE", - span: $DIR/issue-75930-derive-cfg.rs:89:23: 89:28 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:23: 88:28 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:89:22: 89:29 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:22: 88:29 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:89:18: 89:30 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:18: 88:30 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:89:14: 89:31 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:14: 88:31 (#0), }, Ident { ident: "i32", - span: $DIR/issue-75930-derive-cfg.rs:89:32: 89:35 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:32: 88:35 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:89:35: 89:36 (#0), + span: $DIR/issue-75930-derive-cfg.rs:88:35: 88:36 (#0), }, Ident { ident: "u8", - span: $DIR/issue-75930-derive-cfg.rs:91:13: 91:15 (#0), + span: $DIR/issue-75930-derive-cfg.rs:90:13: 90:15 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:87:27: 92:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:86:27: 91:10 (#0), }, Punct { ch: ';', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:92:10: 92:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:91:10: 91:11 (#0), }, Literal { kind: Integer, symbol: "0", suffix: None, - span: $DIR/issue-75930-derive-cfg.rs:98:9: 98:10 (#0), + span: $DIR/issue-75930-derive-cfg.rs:97:9: 97:10 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:58:17: 99:6 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:17: 98:6 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:58:12: 99:7 (#0), + span: $DIR/issue-75930-derive-cfg.rs:57:12: 98:7 (#0), }, Punct { ch: ',', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:99:7: 99:8 (#0), + span: $DIR/issue-75930-derive-cfg.rs:98:7: 98:8 (#0), }, Punct { ch: '#', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:100:5: 100:6 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:5: 99:6 (#0), }, Group { delimiter: Bracket, stream: TokenStream [ Ident { ident: "print_helper", - span: $DIR/issue-75930-derive-cfg.rs:100:7: 100:19 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:7: 99:19 (#0), }, Group { delimiter: Parenthesis, stream: TokenStream [ Ident { ident: "d", - span: $DIR/issue-75930-derive-cfg.rs:100:20: 100:21 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:20: 99:21 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:100:19: 100:22 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:19: 99:22 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:100:6: 100:23 (#0), + span: $DIR/issue-75930-derive-cfg.rs:99:6: 99:23 (#0), }, Ident { ident: "fourth", - span: $DIR/issue-75930-derive-cfg.rs:101:5: 101:11 (#0), + span: $DIR/issue-75930-derive-cfg.rs:100:5: 100:11 (#0), }, Punct { ch: ':', spacing: Alone, - span: $DIR/issue-75930-derive-cfg.rs:101:11: 101:12 (#0), + span: $DIR/issue-75930-derive-cfg.rs:100:11: 100:12 (#0), }, Ident { ident: "B", - span: $DIR/issue-75930-derive-cfg.rs:101:13: 101:14 (#0), + span: $DIR/issue-75930-derive-cfg.rs:100:13: 100:14 (#0), }, ], - span: $DIR/issue-75930-derive-cfg.rs:55:32: 102:2 (#0), + span: $DIR/issue-75930-derive-cfg.rs:54:32: 101:2 (#0), }, ] diff --git a/tests/ui/process/no-stdio.rs b/tests/ui/process/no-stdio.rs index 24985386a97..68e6fa838b4 100644 --- a/tests/ui/process/no-stdio.rs +++ b/tests/ui/process/no-stdio.rs @@ -2,8 +2,6 @@ // ignore-android // ignore-emscripten no processes // ignore-sgx no processes -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![feature(rustc_private)] diff --git a/tests/ui/pub/pub-ident-struct-4.fixed b/tests/ui/pub/pub-ident-struct-4.fixed index b49fa678e1b..71c6f0a6994 100644 --- a/tests/ui/pub/pub-ident-struct-4.fixed +++ b/tests/ui/pub/pub-ident-struct-4.fixed @@ -1,6 +1,6 @@ // run-rustfix -pub struct T(String); +pub struct T(#[allow(dead_code)] String); //~^ ERROR missing `struct` for struct definition fn main() {} diff --git a/tests/ui/pub/pub-ident-struct-4.rs b/tests/ui/pub/pub-ident-struct-4.rs index 20bc94b0acb..971f39a8ce1 100644 --- a/tests/ui/pub/pub-ident-struct-4.rs +++ b/tests/ui/pub/pub-ident-struct-4.rs @@ -1,6 +1,6 @@ // run-rustfix -pub T(String); +pub T(#[allow(dead_code)] String); //~^ ERROR missing `struct` for struct definition fn main() {} diff --git a/tests/ui/pub/pub-ident-struct-4.stderr b/tests/ui/pub/pub-ident-struct-4.stderr index 470874e0637..5fbb02c8673 100644 --- a/tests/ui/pub/pub-ident-struct-4.stderr +++ b/tests/ui/pub/pub-ident-struct-4.stderr @@ -1,12 +1,12 @@ error: missing `struct` for struct definition --> $DIR/pub-ident-struct-4.rs:3:4 | -LL | pub T(String); +LL | pub T(#[allow(dead_code)] String); | ^ | help: add `struct` here to parse `T` as a public struct | -LL | pub struct T(String); +LL | pub struct T(#[allow(dead_code)] String); | ++++++ error: aborting due to 1 previous error diff --git a/tests/ui/range_inclusive.rs b/tests/ui/range_inclusive.rs index c9107d24ed0..2425113b904 100644 --- a/tests/ui/range_inclusive.rs +++ b/tests/ui/range_inclusive.rs @@ -11,7 +11,7 @@ fn foo() -> isize { 42 } pub fn return_range_to() -> RangeToInclusive<i32> { return ..=1; } #[derive(Debug)] -struct P(#[allow(unused_tuple_struct_fields)] u8); +struct P(#[allow(dead_code)] u8); pub fn main() { let mut count = 0; diff --git a/tests/ui/recursion_limit/issue-40003.rs b/tests/ui/recursion_limit/issue-40003.rs index 5e61361f987..01a2aaffb9e 100644 --- a/tests/ui/recursion_limit/issue-40003.rs +++ b/tests/ui/recursion_limit/issue-40003.rs @@ -153,7 +153,7 @@ mod stream { } enum Slot<T> { - Next(#[allow(unused_tuple_struct_fields)] usize), + Next(#[allow(dead_code)] usize), _Data { _a: T }, } diff --git a/tests/ui/repr/align-with-extern-c-fn.rs b/tests/ui/repr/align-with-extern-c-fn.rs index 9e490e27ad1..659ef88fce6 100644 --- a/tests/ui/repr/align-with-extern-c-fn.rs +++ b/tests/ui/repr/align-with-extern-c-fn.rs @@ -8,7 +8,7 @@ #![feature(repr_align)] #[repr(align(16))] -pub struct A(#[allow(unused_tuple_struct_fields)] i64); +pub struct A(#[allow(dead_code)] i64); #[allow(improper_ctypes_definitions)] pub extern "C" fn foo(x: A) {} diff --git a/tests/ui/resolve/issue-5035-2.stderr b/tests/ui/resolve/issue-5035-2.stderr index 8eeb398f077..30721c0a206 100644 --- a/tests/ui/resolve/issue-5035-2.stderr +++ b/tests/ui/resolve/issue-5035-2.stderr @@ -6,10 +6,6 @@ LL | fn foo(_x: K) {} | = help: the trait `Sized` is not implemented for `(dyn I + 'static)` = help: unsized fn params are gated as an unstable feature -help: you can use `impl Trait` as the argument type - | -LL | fn foo(_x: impl K) {} - | ++++ help: function arguments must have a statically known size, borrowed types always have a known size | LL | fn foo(_x: &K) {} diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-embedded.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-embedded.rs index 1914e155493..c95777b0ef1 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-embedded.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-embedded.rs @@ -5,7 +5,7 @@ #![warn(pointer_structural_match)] -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive // (which doesn't matter here because `<*const T>::eq` won't recur on `T`). diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-param.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-param.rs index e713b003b00..3f663fd09f8 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-param.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-direct-unsafe-ptr-param.rs @@ -5,7 +5,7 @@ #![warn(pointer_structural_match)] -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive // (which doesn't matter here because `<*const T>::eq` won't recur on `T`). diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-embedded.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-embedded.rs index 04da14c5419..56b7988e0e4 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-embedded.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-embedded.rs @@ -5,7 +5,7 @@ #![warn(pointer_structural_match)] -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive // (which doesn't matter here because `<*const T>::eq` won't recur on `T`). diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-param.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-param.rs index 8313c25e753..3ebe3225437 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-param.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/allow-hide-behind-indirect-unsafe-ptr-param.rs @@ -5,7 +5,7 @@ #![warn(pointer_structural_match)] -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive // (which doesn't matter here because `<*const T>::eq` won't recur on `T`). diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-direct-struct-embedded.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-direct-struct-embedded.rs index 7623839fdd1..bb5e243d934 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-direct-struct-embedded.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-direct-struct-embedded.rs @@ -5,7 +5,7 @@ // // See discussion on rust-lang/rust#62307 and rust-lang/rust#62339 -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive. impl PartialEq for NoDerive { fn eq(&self, _: &Self) -> bool { false } } diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-embedded.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-embedded.rs index 894739ff705..e3abb47cf73 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-embedded.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-embedded.rs @@ -7,7 +7,7 @@ #![warn(indirect_structural_match)] // run-pass -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive. impl PartialEq for NoDerive { fn eq(&self, _: &Self) -> bool { false } } diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-param.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-param.rs index 1699dae4624..2d3788eea8a 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-param.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-doubly-indirect-param.rs @@ -7,7 +7,7 @@ #![warn(indirect_structural_match)] // run-pass -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive. impl PartialEq for NoDerive { fn eq(&self, _: &Self) -> bool { false } } diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-embedded.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-embedded.rs index 2672bdd9e56..65df7788d90 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-embedded.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-embedded.rs @@ -7,7 +7,7 @@ #![warn(indirect_structural_match)] // run-pass -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive. impl PartialEq for NoDerive { fn eq(&self, _: &Self) -> bool { false } } diff --git a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-param.rs b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-param.rs index 3489995ae71..88260fd1081 100644 --- a/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-param.rs +++ b/tests/ui/rfcs/rfc-1445-restrict-constants-in-patterns/cant-hide-behind-indirect-struct-param.rs @@ -7,7 +7,7 @@ #![warn(indirect_structural_match)] // run-pass -struct NoDerive(#[allow(unused_tuple_struct_fields)] i32); +struct NoDerive(#[allow(dead_code)] i32); // This impl makes NoDerive irreflexive. impl PartialEq for NoDerive { fn eq(&self, _: &Self) -> bool { false } } diff --git a/tests/ui/rfcs/rfc-2151-raw-identifiers/attr.rs b/tests/ui/rfcs/rfc-2151-raw-identifiers/attr.rs index d359067f627..0deb8c7f119 100644 --- a/tests/ui/rfcs/rfc-2151-raw-identifiers/attr.rs +++ b/tests/ui/rfcs/rfc-2151-raw-identifiers/attr.rs @@ -7,7 +7,7 @@ struct Test { } #[r#derive(r#Debug)] -struct Test2(#[allow(unused_tuple_struct_fields)] u32); +struct Test2(#[allow(dead_code)] u32); pub fn main() { assert_eq!(mem::size_of::<Test>(), 9); diff --git a/tests/ui/rfcs/rfc-2294-if-let-guard/drop-scope.rs b/tests/ui/rfcs/rfc-2294-if-let-guard/drop-scope.rs new file mode 100644 index 00000000000..9e6e23e8882 --- /dev/null +++ b/tests/ui/rfcs/rfc-2294-if-let-guard/drop-scope.rs @@ -0,0 +1,72 @@ +// Ensure that temporaries in if-let guards live for the arm +// regression test for #118593 + +// check-pass + +#![feature(if_let_guard)] +#![feature(let_chains)] + +fn get_temp() -> Option<String> { + None +} + +fn let_guard(num: u8) { + match num { + 1 | 2 if let Some(ref a) = get_temp() => { + let _b = a; + } + _ => {} + } + match num { + 3 | 4 if let Some(ref mut c) = get_temp() => { + let _d = c; + } + _ => {} + } +} + +fn let_let_chain_guard(num: u8) { + match num { + 5 | 6 + if let Some(ref a) = get_temp() + && let Some(ref b) = get_temp() => + { + let _x = a; + let _y = b; + } + _ => {} + } + match num { + 7 | 8 + if let Some(ref mut c) = get_temp() + && let Some(ref mut d) = get_temp() => + { + let _w = c; + let _z = d; + } + _ => {} + } +} + +fn let_cond_chain_guard(num: u8) { + match num { + 9 | 10 + if let Some(ref a) = get_temp() + && true => + { + let _x = a; + } + _ => {} + } + match num { + 11 | 12 + if let Some(ref mut b) = get_temp() + && true => + { + let _w = b; + } + _ => {} + } +} + +fn main() {} diff --git a/tests/ui/rfcs/rfc-2294-if-let-guard/scope.rs b/tests/ui/rfcs/rfc-2294-if-let-guard/scope.rs new file mode 100644 index 00000000000..9a3520661a6 --- /dev/null +++ b/tests/ui/rfcs/rfc-2294-if-let-guard/scope.rs @@ -0,0 +1,30 @@ +// Tests for #88015 when using if let chains in match guards + +//run-pass + +#![feature(if_let_guard)] +#![feature(let_chains)] +#![allow(irrefutable_let_patterns)] + +fn lhs_let(opt: Option<bool>) { + match opt { + None | Some(false) | Some(true) if let x = 42 && true => assert_eq!(x, 42), + _ => panic!() + } +} + +fn rhs_let(opt: Option<bool>) { + match opt { + None | Some(false) | Some(true) if true && let x = 41 => assert_eq!(x, 41), + _ => panic!() + } +} + +fn main() { + lhs_let(None); + lhs_let(Some(false)); + lhs_let(Some(true)); + rhs_let(None); + rhs_let(Some(false)); + rhs_let(Some(true)); +} diff --git a/tests/ui/rfcs/rfc-2294-if-let-guard/warns.stderr b/tests/ui/rfcs/rfc-2294-if-let-guard/warns.stderr index 75f22ac8dc0..eed5dbb88de 100644 --- a/tests/ui/rfcs/rfc-2294-if-let-guard/warns.stderr +++ b/tests/ui/rfcs/rfc-2294-if-let-guard/warns.stderr @@ -1,8 +1,8 @@ error: irrefutable `if let` guard pattern - --> $DIR/warns.rs:6:24 + --> $DIR/warns.rs:6:20 | LL | Some(x) if let () = x => {} - | ^^ + | ^^^^^^^^^^ | = note: this pattern will always match, so the guard is useless = help: consider removing the guard and adding a `let` inside the match arm diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/check-pass.rs b/tests/ui/rfcs/rfc-2396-target_feature-11/check-pass.rs index e0842bfa4cd..58a2c271ecf 100644 --- a/tests/ui/rfcs/rfc-2396-target_feature-11/check-pass.rs +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/check-pass.rs @@ -8,8 +8,6 @@ // check-pass // only-x86_64 -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #![feature(target_feature_11)] diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/closures-inherit-target_feature.rs b/tests/ui/rfcs/rfc-2396-target_feature-11/closures-inherit-target_feature.rs index a59d7c2d784..fefe100ba0e 100644 --- a/tests/ui/rfcs/rfc-2396-target_feature-11/closures-inherit-target_feature.rs +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/closures-inherit-target_feature.rs @@ -1,18 +1,16 @@ // Tests #73631: closures inherit `#[target_feature]` annotations // check-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck // only-x86_64 #![feature(target_feature_11)] -#[target_feature(enable="avx")] +#[target_feature(enable = "avx")] fn also_use_avx() { println!("Hello from AVX") } -#[target_feature(enable="avx")] +#[target_feature(enable = "avx")] fn use_avx() -> Box<dyn Fn()> { Box::new(|| also_use_avx()) } diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.rs b/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.rs index c95d4a08e48..3ecea5c5313 100644 --- a/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.rs +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.rs @@ -1,5 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck // only-x86_64 #![feature(target_feature_11)] diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.stderr b/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.stderr new file mode 100644 index 00000000000..cc941be5479 --- /dev/null +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/fn-ptr.stderr @@ -0,0 +1,23 @@ +error[E0308]: mismatched types + --> $DIR/fn-ptr.rs:9:21 + | +LL | #[target_feature(enable = "sse2")] + | ---------------------------------- `#[target_feature]` added here +... +LL | let foo: fn() = foo; + | ---- ^^^ cannot coerce functions with `#[target_feature]` to safe function pointers + | | + | expected due to this + | + = note: expected fn pointer `fn()` + found fn item `fn() {foo}` + = note: fn items are distinct from fn pointers + = note: functions with `#[target_feature]` can only be coerced to `unsafe` function pointers +help: consider casting to a fn pointer + | +LL | let foo: fn() = foo as fn(); + | ~~~~~~~~~~~ + +error: aborting due to 1 previous error + +For more information about this error, try `rustc --explain E0308`. diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/issue-108655-inline-always-closure.rs b/tests/ui/rfcs/rfc-2396-target_feature-11/issue-108655-inline-always-closure.rs index bc886400099..115f00b3f4e 100644 --- a/tests/ui/rfcs/rfc-2396-target_feature-11/issue-108655-inline-always-closure.rs +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/issue-108655-inline-always-closure.rs @@ -1,8 +1,6 @@ // Tests #108655: closures in `#[target_feature]` functions can still be marked #[inline(always)] // check-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck // only-x86_64 #![feature(target_feature_11)] diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.rs b/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.rs index f17dab269bc..788c79adc1f 100644 --- a/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.rs +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.rs @@ -1,5 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck // only-x86_64 #![feature(target_feature_11)] @@ -11,7 +9,6 @@ const fn sse2() {} #[target_feature(enable = "fxsr")] const fn sse2_and_fxsr() {} - #[target_feature(enable = "avx")] #[target_feature(enable = "bmi2")] fn avx_bmi2() {} @@ -26,62 +23,50 @@ impl Quux { fn foo() { sse2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `sse2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `sse2` with `#[target_feature]` is unsafe avx_bmi2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `avx_bmi2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `avx_bmi2` with `#[target_feature]` is unsafe Quux.avx_bmi2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe } #[target_feature(enable = "sse2")] fn bar() { avx_bmi2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `avx_bmi2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `avx_bmi2` with `#[target_feature]` is unsafe Quux.avx_bmi2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe } #[target_feature(enable = "avx")] fn baz() { sse2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `sse2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `sse2` with `#[target_feature]` is unsafe avx_bmi2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `avx_bmi2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `avx_bmi2` with `#[target_feature]` is unsafe Quux.avx_bmi2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe } #[target_feature(enable = "avx")] #[target_feature(enable = "bmi2")] fn qux() { sse2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `sse2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `sse2` with `#[target_feature]` is unsafe } const _: () = sse2(); -//[mir]~^ ERROR call to function with `#[target_feature]` is unsafe -//[thir]~^^ ERROR call to function `sse2` with `#[target_feature]` is unsafe +//~^ ERROR call to function `sse2` with `#[target_feature]` is unsafe const _: () = sse2_and_fxsr(); -//[mir]~^ ERROR call to function with `#[target_feature]` is unsafe -//[thir]~^^ ERROR call to function `sse2_and_fxsr` with `#[target_feature]` is unsafe +//~^ ERROR call to function `sse2_and_fxsr` with `#[target_feature]` is unsafe #[deny(unsafe_op_in_unsafe_fn)] #[target_feature(enable = "avx")] #[target_feature(enable = "bmi2")] unsafe fn needs_unsafe_block() { sse2(); - //[mir]~^ ERROR call to function with `#[target_feature]` is unsafe - //[thir]~^^ ERROR call to function `sse2` with `#[target_feature]` is unsafe + //~^ ERROR call to function `sse2` with `#[target_feature]` is unsafe } fn main() {} diff --git a/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.stderr b/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.stderr new file mode 100644 index 00000000000..e17859eb40f --- /dev/null +++ b/tests/ui/rfcs/rfc-2396-target_feature-11/safe-calls.stderr @@ -0,0 +1,115 @@ +error[E0133]: call to function `sse2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:25:5 + | +LL | sse2(); + | ^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: sse2 + = note: the sse2 target feature being enabled in the build configuration does not remove the requirement to list it in `#[target_feature]` + +error[E0133]: call to function `avx_bmi2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:27:5 + | +LL | avx_bmi2(); + | ^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target features: avx and bmi2 + +error[E0133]: call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:29:5 + | +LL | Quux.avx_bmi2(); + | ^^^^^^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target features: avx and bmi2 + +error[E0133]: call to function `avx_bmi2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:35:5 + | +LL | avx_bmi2(); + | ^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target features: avx and bmi2 + +error[E0133]: call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:37:5 + | +LL | Quux.avx_bmi2(); + | ^^^^^^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target features: avx and bmi2 + +error[E0133]: call to function `sse2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:43:5 + | +LL | sse2(); + | ^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: sse2 + = note: the sse2 target feature being enabled in the build configuration does not remove the requirement to list it in `#[target_feature]` + +error[E0133]: call to function `avx_bmi2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:45:5 + | +LL | avx_bmi2(); + | ^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: bmi2 + +error[E0133]: call to function `Quux::avx_bmi2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:47:5 + | +LL | Quux.avx_bmi2(); + | ^^^^^^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: bmi2 + +error[E0133]: call to function `sse2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:54:5 + | +LL | sse2(); + | ^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: sse2 + = note: the sse2 target feature being enabled in the build configuration does not remove the requirement to list it in `#[target_feature]` + +error[E0133]: call to function `sse2` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:58:15 + | +LL | const _: () = sse2(); + | ^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: sse2 + = note: the sse2 target feature being enabled in the build configuration does not remove the requirement to list it in `#[target_feature]` + +error[E0133]: call to function `sse2_and_fxsr` with `#[target_feature]` is unsafe and requires unsafe function or block + --> $DIR/safe-calls.rs:61:15 + | +LL | const _: () = sse2_and_fxsr(); + | ^^^^^^^^^^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target features: sse2 and fxsr + = note: the fxsr and sse2 target features being enabled in the build configuration does not remove the requirement to list them in `#[target_feature]` + +error: call to function `sse2` with `#[target_feature]` is unsafe and requires unsafe block (error E0133) + --> $DIR/safe-calls.rs:68:5 + | +LL | sse2(); + | ^^^^^^ call to function with `#[target_feature]` + | + = help: in order for the call to be safe, the context requires the following additional target feature: sse2 + = note: the sse2 target feature being enabled in the build configuration does not remove the requirement to list it in `#[target_feature]` +note: an unsafe function restricts its caller, but its body is safe by default + --> $DIR/safe-calls.rs:67:1 + | +LL | unsafe fn needs_unsafe_block() { + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +note: the lint level is defined here + --> $DIR/safe-calls.rs:64:8 + | +LL | #[deny(unsafe_op_in_unsafe_fn)] + | ^^^^^^^^^^^^^^^^^^^^^^ + +error: aborting due to 12 previous errors + +For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/rfcs/rfc-2632-const-trait-impl/const-drop.rs b/tests/ui/rfcs/rfc-2632-const-trait-impl/const-drop.rs index 4836d2b02ce..75797b1cbfe 100644 --- a/tests/ui/rfcs/rfc-2632-const-trait-impl/const-drop.rs +++ b/tests/ui/rfcs/rfc-2632-const-trait-impl/const-drop.rs @@ -100,7 +100,7 @@ implements_const_drop! { } fn main() { - struct HasDropGlue(#[allow(unused_tuple_struct_fields)] Box<u8>); + struct HasDropGlue(#[allow(dead_code)] Box<u8>); struct HasDropImpl; impl Drop for HasDropImpl { fn drop(&mut self) { diff --git a/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.rs b/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.rs index 86706671316..a00a6d48105 100644 --- a/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.rs +++ b/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.rs @@ -1,4 +1,4 @@ -#![feature(const_trait_impl)] +#![feature(const_trait_impl, effects)] // edition: 2021 #[const_trait] @@ -6,4 +6,12 @@ trait Trait {} fn main() { let _: &dyn const Trait; //~ ERROR const trait bounds are not allowed in trait object types + let _: &dyn ~const Trait; //~ ERROR `~const` is not allowed here } + +// Regression test for issue #119525. +trait NonConst {} +const fn handle(_: &dyn const NonConst) {} +//~^ ERROR const trait bounds are not allowed in trait object types +const fn take(_: &dyn ~const NonConst) {} +//~^ ERROR `~const` is not allowed here diff --git a/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.stderr b/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.stderr index 8b9ba94d099..04c2dc2e2e0 100644 --- a/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.stderr +++ b/tests/ui/rfcs/rfc-2632-const-trait-impl/const-trait-bounds-trait-objects.stderr @@ -4,5 +4,27 @@ error: const trait bounds are not allowed in trait object types LL | let _: &dyn const Trait; | ^^^^^^^^^^^ -error: aborting due to 1 previous error +error: `~const` is not allowed here + --> $DIR/const-trait-bounds-trait-objects.rs:9:17 + | +LL | let _: &dyn ~const Trait; + | ^^^^^^ + | + = note: trait objects cannot have `~const` trait bounds + +error: const trait bounds are not allowed in trait object types + --> $DIR/const-trait-bounds-trait-objects.rs:14:25 + | +LL | const fn handle(_: &dyn const NonConst) {} + | ^^^^^^^^^^^^^^ + +error: `~const` is not allowed here + --> $DIR/const-trait-bounds-trait-objects.rs:16:23 + | +LL | const fn take(_: &dyn ~const NonConst) {} + | ^^^^^^ + | + = note: trait objects cannot have `~const` trait bounds + +error: aborting due to 4 previous errors diff --git a/tests/ui/runtime/running-with-no-runtime.rs b/tests/ui/runtime/running-with-no-runtime.rs index c575a6bec8e..c321e86dc18 100644 --- a/tests/ui/runtime/running-with-no-runtime.rs +++ b/tests/ui/runtime/running-with-no-runtime.rs @@ -1,8 +1,6 @@ // run-pass // ignore-emscripten spawning processes is not supported // ignore-sgx no processes -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![feature(start)] diff --git a/tests/ui/sanitize/badfree.rs b/tests/ui/sanitize/badfree.rs index c8d1ce7dff2..4a230e11d95 100644 --- a/tests/ui/sanitize/badfree.rs +++ b/tests/ui/sanitize/badfree.rs @@ -5,7 +5,7 @@ // compile-flags: -Z sanitizer=address -O // // run-fail -// error-pattern: AddressSanitizer: SEGV +// regex-error-pattern: AddressSanitizer: (SEGV|attempting free on address which was not malloc) use std::ffi::c_void; diff --git a/tests/ui/simd/intrinsic/generic-comparison-pass.rs b/tests/ui/simd/intrinsic/generic-comparison-pass.rs index da5c42a1a98..103132c18ae 100644 --- a/tests/ui/simd/intrinsic/generic-comparison-pass.rs +++ b/tests/ui/simd/intrinsic/generic-comparison-pass.rs @@ -1,7 +1,5 @@ // run-pass // ignore-emscripten FIXME(#45351) hits an LLVM assert -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![feature(repr_simd, platform_intrinsics, concat_idents)] #![allow(non_camel_case_types)] diff --git a/tests/ui/span/lint-unused-unsafe.rs b/tests/ui/span/lint-unused-unsafe.rs index ca615f64f22..94bdd114007 100644 --- a/tests/ui/span/lint-unused-unsafe.rs +++ b/tests/ui/span/lint-unused-unsafe.rs @@ -3,9 +3,6 @@ // edition:2018 -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck - #![allow(dead_code)] #![deny(unused_unsafe)] diff --git a/tests/ui/span/lint-unused-unsafe.mir.stderr b/tests/ui/span/lint-unused-unsafe.stderr index 9e8d3359242..d8bd7cc7475 100644 --- a/tests/ui/span/lint-unused-unsafe.mir.stderr +++ b/tests/ui/span/lint-unused-unsafe.stderr @@ -1,77 +1,77 @@ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:22:13 + --> $DIR/lint-unused-unsafe.rs:19:13 | LL | fn bad1() { unsafe {} } | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:10:9 + --> $DIR/lint-unused-unsafe.rs:7:9 | LL | #![deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:23:13 + --> $DIR/lint-unused-unsafe.rs:20:13 | LL | fn bad2() { unsafe { bad1() } } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:24:20 + --> $DIR/lint-unused-unsafe.rs:21:20 | LL | unsafe fn bad3() { unsafe {} } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:25:13 + --> $DIR/lint-unused-unsafe.rs:22:13 | LL | fn bad4() { unsafe { callback(||{}) } } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:28:5 + --> $DIR/lint-unused-unsafe.rs:25:5 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:35:5 + --> $DIR/lint-unused-unsafe.rs:32:5 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:70:9 + --> $DIR/lint-unused-unsafe.rs:67:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:79:9 + --> $DIR/lint-unused-unsafe.rs:76:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:80:13 + --> $DIR/lint-unused-unsafe.rs:77:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:81:13 + --> $DIR/lint-unused-unsafe.rs:78:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:86:9 + --> $DIR/lint-unused-unsafe.rs:83:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:96:13 + --> $DIR/lint-unused-unsafe.rs:93:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -80,7 +80,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:97:13 + --> $DIR/lint-unused-unsafe.rs:94:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -89,7 +89,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:98:13 + --> $DIR/lint-unused-unsafe.rs:95:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -98,7 +98,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:108:17 + --> $DIR/lint-unused-unsafe.rs:105:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -107,13 +107,13 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:106:20 + --> $DIR/lint-unused-unsafe.rs:103:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:109:17 + --> $DIR/lint-unused-unsafe.rs:106:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -122,7 +122,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:110:17 + --> $DIR/lint-unused-unsafe.rs:107:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -131,37 +131,37 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:120:9 + --> $DIR/lint-unused-unsafe.rs:117:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:130:9 + --> $DIR/lint-unused-unsafe.rs:127:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:131:13 + --> $DIR/lint-unused-unsafe.rs:128:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:132:13 + --> $DIR/lint-unused-unsafe.rs:129:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:138:9 + --> $DIR/lint-unused-unsafe.rs:135:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:149:13 + --> $DIR/lint-unused-unsafe.rs:146:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -170,7 +170,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:150:13 + --> $DIR/lint-unused-unsafe.rs:147:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -179,7 +179,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:151:13 + --> $DIR/lint-unused-unsafe.rs:148:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -188,7 +188,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:162:17 + --> $DIR/lint-unused-unsafe.rs:159:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -197,13 +197,13 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:160:20 + --> $DIR/lint-unused-unsafe.rs:157:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:163:17 + --> $DIR/lint-unused-unsafe.rs:160:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -212,7 +212,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:164:17 + --> $DIR/lint-unused-unsafe.rs:161:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -221,37 +221,37 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:174:9 + --> $DIR/lint-unused-unsafe.rs:171:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:184:9 + --> $DIR/lint-unused-unsafe.rs:181:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:185:13 + --> $DIR/lint-unused-unsafe.rs:182:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:186:13 + --> $DIR/lint-unused-unsafe.rs:183:13 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:192:9 + --> $DIR/lint-unused-unsafe.rs:189:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:203:13 + --> $DIR/lint-unused-unsafe.rs:200:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -260,7 +260,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:204:13 + --> $DIR/lint-unused-unsafe.rs:201:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -269,7 +269,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:205:13 + --> $DIR/lint-unused-unsafe.rs:202:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -278,7 +278,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:216:17 + --> $DIR/lint-unused-unsafe.rs:213:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -287,13 +287,13 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:214:20 + --> $DIR/lint-unused-unsafe.rs:211:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:217:17 + --> $DIR/lint-unused-unsafe.rs:214:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -302,7 +302,7 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:218:17 + --> $DIR/lint-unused-unsafe.rs:215:17 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -311,13 +311,13 @@ LL | unsafe { unsf() } | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:238:9 + --> $DIR/lint-unused-unsafe.rs:235:9 | LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:251:13 + --> $DIR/lint-unused-unsafe.rs:248:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -325,7 +325,7 @@ LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:264:13 + --> $DIR/lint-unused-unsafe.rs:261:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -333,37 +333,37 @@ LL | unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:282:20 + --> $DIR/lint-unused-unsafe.rs:279:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:291:20 + --> $DIR/lint-unused-unsafe.rs:288:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:292:24 + --> $DIR/lint-unused-unsafe.rs:289:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:293:24 + --> $DIR/lint-unused-unsafe.rs:290:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:298:20 + --> $DIR/lint-unused-unsafe.rs:295:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:308:24 + --> $DIR/lint-unused-unsafe.rs:305:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -372,7 +372,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:309:24 + --> $DIR/lint-unused-unsafe.rs:306:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -381,7 +381,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:310:24 + --> $DIR/lint-unused-unsafe.rs:307:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -390,7 +390,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:320:28 + --> $DIR/lint-unused-unsafe.rs:317:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -399,13 +399,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:318:20 + --> $DIR/lint-unused-unsafe.rs:315:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:321:28 + --> $DIR/lint-unused-unsafe.rs:318:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -414,7 +414,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:322:28 + --> $DIR/lint-unused-unsafe.rs:319:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -423,37 +423,37 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:332:20 + --> $DIR/lint-unused-unsafe.rs:329:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:342:20 + --> $DIR/lint-unused-unsafe.rs:339:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:343:24 + --> $DIR/lint-unused-unsafe.rs:340:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:344:24 + --> $DIR/lint-unused-unsafe.rs:341:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:350:20 + --> $DIR/lint-unused-unsafe.rs:347:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:361:24 + --> $DIR/lint-unused-unsafe.rs:358:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -462,7 +462,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:362:24 + --> $DIR/lint-unused-unsafe.rs:359:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -471,7 +471,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:363:24 + --> $DIR/lint-unused-unsafe.rs:360:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -480,7 +480,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:374:28 + --> $DIR/lint-unused-unsafe.rs:371:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -489,13 +489,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:372:20 + --> $DIR/lint-unused-unsafe.rs:369:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:375:28 + --> $DIR/lint-unused-unsafe.rs:372:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -504,7 +504,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:376:28 + --> $DIR/lint-unused-unsafe.rs:373:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -513,37 +513,37 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:386:20 + --> $DIR/lint-unused-unsafe.rs:383:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:396:20 + --> $DIR/lint-unused-unsafe.rs:393:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:397:24 + --> $DIR/lint-unused-unsafe.rs:394:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:398:24 + --> $DIR/lint-unused-unsafe.rs:395:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:404:20 + --> $DIR/lint-unused-unsafe.rs:401:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:415:24 + --> $DIR/lint-unused-unsafe.rs:412:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -552,7 +552,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:416:24 + --> $DIR/lint-unused-unsafe.rs:413:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -561,7 +561,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:417:24 + --> $DIR/lint-unused-unsafe.rs:414:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -570,7 +570,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:428:28 + --> $DIR/lint-unused-unsafe.rs:425:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -579,13 +579,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:426:20 + --> $DIR/lint-unused-unsafe.rs:423:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:429:28 + --> $DIR/lint-unused-unsafe.rs:426:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -594,7 +594,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:430:28 + --> $DIR/lint-unused-unsafe.rs:427:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -603,13 +603,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:450:20 + --> $DIR/lint-unused-unsafe.rs:447:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:463:24 + --> $DIR/lint-unused-unsafe.rs:460:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -617,7 +617,7 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:476:24 + --> $DIR/lint-unused-unsafe.rs:473:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -625,37 +625,37 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:495:20 + --> $DIR/lint-unused-unsafe.rs:492:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:504:20 + --> $DIR/lint-unused-unsafe.rs:501:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:505:24 + --> $DIR/lint-unused-unsafe.rs:502:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:506:24 + --> $DIR/lint-unused-unsafe.rs:503:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:511:20 + --> $DIR/lint-unused-unsafe.rs:508:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:521:24 + --> $DIR/lint-unused-unsafe.rs:518:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -664,7 +664,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:522:24 + --> $DIR/lint-unused-unsafe.rs:519:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -673,7 +673,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:523:24 + --> $DIR/lint-unused-unsafe.rs:520:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -682,7 +682,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:533:28 + --> $DIR/lint-unused-unsafe.rs:530:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -691,13 +691,13 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:531:20 + --> $DIR/lint-unused-unsafe.rs:528:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:534:28 + --> $DIR/lint-unused-unsafe.rs:531:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -706,7 +706,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:535:28 + --> $DIR/lint-unused-unsafe.rs:532:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -715,37 +715,37 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:545:20 + --> $DIR/lint-unused-unsafe.rs:542:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:555:20 + --> $DIR/lint-unused-unsafe.rs:552:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:556:24 + --> $DIR/lint-unused-unsafe.rs:553:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:557:24 + --> $DIR/lint-unused-unsafe.rs:554:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:563:20 + --> $DIR/lint-unused-unsafe.rs:560:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:574:24 + --> $DIR/lint-unused-unsafe.rs:571:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -754,7 +754,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:575:24 + --> $DIR/lint-unused-unsafe.rs:572:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -763,7 +763,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:576:24 + --> $DIR/lint-unused-unsafe.rs:573:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -772,7 +772,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:587:28 + --> $DIR/lint-unused-unsafe.rs:584:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -781,13 +781,13 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:585:20 + --> $DIR/lint-unused-unsafe.rs:582:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:588:28 + --> $DIR/lint-unused-unsafe.rs:585:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -796,7 +796,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:589:28 + --> $DIR/lint-unused-unsafe.rs:586:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -805,37 +805,37 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:599:20 + --> $DIR/lint-unused-unsafe.rs:596:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:609:20 + --> $DIR/lint-unused-unsafe.rs:606:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:610:24 + --> $DIR/lint-unused-unsafe.rs:607:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:611:24 + --> $DIR/lint-unused-unsafe.rs:608:24 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:617:20 + --> $DIR/lint-unused-unsafe.rs:614:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:628:24 + --> $DIR/lint-unused-unsafe.rs:625:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -844,7 +844,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:629:24 + --> $DIR/lint-unused-unsafe.rs:626:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -853,7 +853,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:630:24 + --> $DIR/lint-unused-unsafe.rs:627:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -862,7 +862,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:641:28 + --> $DIR/lint-unused-unsafe.rs:638:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -871,13 +871,13 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:639:20 + --> $DIR/lint-unused-unsafe.rs:636:20 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:642:28 + --> $DIR/lint-unused-unsafe.rs:639:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -886,7 +886,7 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:643:28 + --> $DIR/lint-unused-unsafe.rs:640:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -895,13 +895,13 @@ LL | let _ = || unsafe { let _ = || unsf(); }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:663:20 + --> $DIR/lint-unused-unsafe.rs:660:20 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:676:24 + --> $DIR/lint-unused-unsafe.rs:673:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -909,7 +909,7 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:689:24 + --> $DIR/lint-unused-unsafe.rs:686:24 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -917,37 +917,37 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:707:24 + --> $DIR/lint-unused-unsafe.rs:704:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:717:24 + --> $DIR/lint-unused-unsafe.rs:714:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:718:28 + --> $DIR/lint-unused-unsafe.rs:715:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:719:28 + --> $DIR/lint-unused-unsafe.rs:716:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:725:24 + --> $DIR/lint-unused-unsafe.rs:722:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:736:28 + --> $DIR/lint-unused-unsafe.rs:733:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -956,7 +956,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:737:28 + --> $DIR/lint-unused-unsafe.rs:734:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -965,7 +965,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:738:28 + --> $DIR/lint-unused-unsafe.rs:735:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -974,7 +974,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:749:32 + --> $DIR/lint-unused-unsafe.rs:746:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -983,13 +983,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:747:24 + --> $DIR/lint-unused-unsafe.rs:744:24 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:750:32 + --> $DIR/lint-unused-unsafe.rs:747:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -998,7 +998,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:751:32 + --> $DIR/lint-unused-unsafe.rs:748:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1007,37 +1007,37 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:761:24 + --> $DIR/lint-unused-unsafe.rs:758:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:771:24 + --> $DIR/lint-unused-unsafe.rs:768:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:772:28 + --> $DIR/lint-unused-unsafe.rs:769:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:773:28 + --> $DIR/lint-unused-unsafe.rs:770:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:779:24 + --> $DIR/lint-unused-unsafe.rs:776:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:790:28 + --> $DIR/lint-unused-unsafe.rs:787:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1046,7 +1046,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:791:28 + --> $DIR/lint-unused-unsafe.rs:788:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1055,7 +1055,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:792:28 + --> $DIR/lint-unused-unsafe.rs:789:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1064,7 +1064,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:803:32 + --> $DIR/lint-unused-unsafe.rs:800:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1073,13 +1073,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:801:24 + --> $DIR/lint-unused-unsafe.rs:798:24 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:804:32 + --> $DIR/lint-unused-unsafe.rs:801:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1088,7 +1088,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:805:32 + --> $DIR/lint-unused-unsafe.rs:802:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1097,13 +1097,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:825:24 + --> $DIR/lint-unused-unsafe.rs:822:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:838:28 + --> $DIR/lint-unused-unsafe.rs:835:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1111,7 +1111,7 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:851:28 + --> $DIR/lint-unused-unsafe.rs:848:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1119,37 +1119,37 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:865:24 + --> $DIR/lint-unused-unsafe.rs:862:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:875:24 + --> $DIR/lint-unused-unsafe.rs:872:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:876:28 + --> $DIR/lint-unused-unsafe.rs:873:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:877:28 + --> $DIR/lint-unused-unsafe.rs:874:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:883:24 + --> $DIR/lint-unused-unsafe.rs:880:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:894:28 + --> $DIR/lint-unused-unsafe.rs:891:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1158,7 +1158,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:895:28 + --> $DIR/lint-unused-unsafe.rs:892:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1167,7 +1167,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:896:28 + --> $DIR/lint-unused-unsafe.rs:893:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1176,7 +1176,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:907:32 + --> $DIR/lint-unused-unsafe.rs:904:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1185,13 +1185,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:905:24 + --> $DIR/lint-unused-unsafe.rs:902:24 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:908:32 + --> $DIR/lint-unused-unsafe.rs:905:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1200,7 +1200,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:909:32 + --> $DIR/lint-unused-unsafe.rs:906:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1209,37 +1209,37 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:919:24 + --> $DIR/lint-unused-unsafe.rs:916:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:929:24 + --> $DIR/lint-unused-unsafe.rs:926:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:930:28 + --> $DIR/lint-unused-unsafe.rs:927:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:931:28 + --> $DIR/lint-unused-unsafe.rs:928:28 | LL | let _ = || unsafe {}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:937:24 + --> $DIR/lint-unused-unsafe.rs:934:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:948:28 + --> $DIR/lint-unused-unsafe.rs:945:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1248,7 +1248,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:949:28 + --> $DIR/lint-unused-unsafe.rs:946:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1257,7 +1257,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:950:28 + --> $DIR/lint-unused-unsafe.rs:947:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1266,7 +1266,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:961:32 + --> $DIR/lint-unused-unsafe.rs:958:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1275,13 +1275,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:959:24 + --> $DIR/lint-unused-unsafe.rs:956:24 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:962:32 + --> $DIR/lint-unused-unsafe.rs:959:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1290,7 +1290,7 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:963:32 + --> $DIR/lint-unused-unsafe.rs:960:32 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1299,13 +1299,13 @@ LL | let _ = || unsafe { unsf() }; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:983:24 + --> $DIR/lint-unused-unsafe.rs:980:24 | LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:996:28 + --> $DIR/lint-unused-unsafe.rs:993:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1313,7 +1313,7 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1009:28 + --> $DIR/lint-unused-unsafe.rs:1006:28 | LL | let _ = || unsafe { | ------ because it's nested under this `unsafe` block @@ -1321,13 +1321,13 @@ LL | let _ = || unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1055:29 + --> $DIR/lint-unused-unsafe.rs:1052:29 | LL | let _ = async { unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1062:33 + --> $DIR/lint-unused-unsafe.rs:1059:33 | LL | let _ = async { unsafe { | ------ because it's nested under this `unsafe` block @@ -1336,7 +1336,7 @@ LL | let _ = async { unsafe { let _ = async { unsf() }; }}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1063:33 + --> $DIR/lint-unused-unsafe.rs:1060:33 | LL | let _ = async { unsafe { | ------ because it's nested under this `unsafe` block @@ -1345,7 +1345,7 @@ LL | let _ = async { unsafe { let _ = async { unsf() }; }}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1064:33 + --> $DIR/lint-unused-unsafe.rs:1061:33 | LL | let _ = async { unsafe { | ------ because it's nested under this `unsafe` block @@ -1354,13 +1354,13 @@ LL | let _ = async { unsafe { let _ = async { unsf() }; }}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1069:29 + --> $DIR/lint-unused-unsafe.rs:1066:29 | LL | let _ = async { unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1076:33 + --> $DIR/lint-unused-unsafe.rs:1073:33 | LL | let _ = async { unsafe { | ------ because it's nested under this `unsafe` block @@ -1369,7 +1369,7 @@ LL | let _ = async { unsafe { let _ = async { unsf() }; }}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1077:33 + --> $DIR/lint-unused-unsafe.rs:1074:33 | LL | let _ = async { unsafe { | ------ because it's nested under this `unsafe` block @@ -1378,7 +1378,7 @@ LL | let _ = async { unsafe { let _ = async { unsf() }; }}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1078:33 + --> $DIR/lint-unused-unsafe.rs:1075:33 | LL | let _ = async { unsafe { | ------ because it's nested under this `unsafe` block @@ -1387,13 +1387,13 @@ LL | let _ = async { unsafe { let _ = async { unsf() }; }}; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1088:22 + --> $DIR/lint-unused-unsafe.rs:1085:22 | LL | let _x: [(); unsafe { 0 }] = []; | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1092:22 + --> $DIR/lint-unused-unsafe.rs:1089:22 | LL | let _x: [(); unsafe { unsafe { size() } }] = []; | ^^^^^^ unnecessary `unsafe` block diff --git a/tests/ui/span/lint-unused-unsafe.thir.stderr b/tests/ui/span/lint-unused-unsafe.thir.stderr deleted file mode 100644 index 9e8d3359242..00000000000 --- a/tests/ui/span/lint-unused-unsafe.thir.stderr +++ /dev/null @@ -1,1402 +0,0 @@ -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:22:13 - | -LL | fn bad1() { unsafe {} } - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:10:9 - | -LL | #![deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:23:13 - | -LL | fn bad2() { unsafe { bad1() } } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:24:20 - | -LL | unsafe fn bad3() { unsafe {} } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:25:13 - | -LL | fn bad4() { unsafe { callback(||{}) } } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:28:5 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:35:5 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:70:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:79:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:80:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:81:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:86:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:96:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:97:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:98:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:108:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:106:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:109:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:110:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:120:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:130:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:131:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:132:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:138:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:149:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:150:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:151:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:162:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:160:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:163:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:164:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:174:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:184:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:185:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:186:13 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:192:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:203:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:204:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:205:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:216:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:214:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:217:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:218:17 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | unsafe { unsf() } - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:238:9 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:251:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:264:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:282:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:291:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:292:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:293:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:298:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:308:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:309:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:310:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:320:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:318:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:321:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:322:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:332:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:342:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:343:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:344:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:350:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:361:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:362:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:363:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:374:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:372:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:375:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:376:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:386:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:396:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:397:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:398:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:404:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:415:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:416:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:417:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:428:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:426:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:429:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:430:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:450:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:463:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:476:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:495:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:504:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:505:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:506:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:511:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:521:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsf(); -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:522:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:523:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:533:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:531:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:534:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:535:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:545:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:555:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:556:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:557:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:563:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:574:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsf(); -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:575:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:576:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:587:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:585:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:588:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:589:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:599:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:609:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:610:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:611:24 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:617:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:628:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsf(); -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:629:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:630:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:641:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:639:20 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:642:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:643:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { let _ = || unsf(); }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:663:20 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:676:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:689:24 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:707:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:717:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:718:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:719:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:725:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:736:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:737:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:738:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:749:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:747:24 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:750:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:751:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:761:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:771:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:772:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:773:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:779:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:790:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:791:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:792:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:803:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:801:24 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:804:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:805:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:825:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:838:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:851:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:865:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:875:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:876:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:877:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:883:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:894:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:895:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:896:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:907:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:905:24 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:908:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:909:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:919:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:929:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:930:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:931:28 - | -LL | let _ = || unsafe {}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:937:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:948:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | unsf(); -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:949:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:950:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:961:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/lint-unused-unsafe.rs:959:24 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:962:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:963:32 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = || unsafe { unsf() }; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:983:24 - | -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:996:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1009:28 - | -LL | let _ = || unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = || unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1055:29 - | -LL | let _ = async { unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1062:33 - | -LL | let _ = async { unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = async { unsf() }; -LL | let _ = async { unsafe { let _ = async { unsf() }; }}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1063:33 - | -LL | let _ = async { unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = async { unsafe { let _ = async { unsf() }; }}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1064:33 - | -LL | let _ = async { unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = async { unsafe { let _ = async { unsf() }; }}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1069:29 - | -LL | let _ = async { unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1076:33 - | -LL | let _ = async { unsafe { - | ------ because it's nested under this `unsafe` block -LL | let _ = async { unsf() }; -LL | let _ = async { unsafe { let _ = async { unsf() }; }}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1077:33 - | -LL | let _ = async { unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = async { unsafe { let _ = async { unsf() }; }}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1078:33 - | -LL | let _ = async { unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | let _ = async { unsafe { let _ = async { unsf() }; }}; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1088:22 - | -LL | let _x: [(); unsafe { 0 }] = []; - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/lint-unused-unsafe.rs:1092:22 - | -LL | let _x: [(); unsafe { unsafe { size() } }] = []; - | ^^^^^^ unnecessary `unsafe` block - -error: aborting due to 174 previous errors - diff --git a/tests/ui/specialization/min_specialization/issue-79224.stderr b/tests/ui/specialization/min_specialization/issue-79224.stderr index 7541579498e..37ced4cf267 100644 --- a/tests/ui/specialization/min_specialization/issue-79224.stderr +++ b/tests/ui/specialization/min_specialization/issue-79224.stderr @@ -11,10 +11,10 @@ LL | impl<B: ?Sized + std::clone::Clone> Display for Cow<'_, B> { | +++++++++++++++++++ error[E0277]: the trait bound `B: Clone` is not satisfied - --> $DIR/issue-79224.rs:20:13 + --> $DIR/issue-79224.rs:20:5 | LL | fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { - | ^^^^ the trait `Clone` is not implemented for `B` + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ the trait `Clone` is not implemented for `B` | = note: required for `B` to implement `ToOwned` help: consider further restricting this bound @@ -23,10 +23,10 @@ LL | impl<B: ?Sized + std::clone::Clone> Display for Cow<'_, B> { | +++++++++++++++++++ error[E0277]: the trait bound `B: Clone` is not satisfied - --> $DIR/issue-79224.rs:20:5 + --> $DIR/issue-79224.rs:20:13 | LL | fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result { - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ the trait `Clone` is not implemented for `B` + | ^^^^ the trait `Clone` is not implemented for `B` | = note: required for `B` to implement `ToOwned` help: consider further restricting this bound diff --git a/tests/ui/specialization/specialization-cross-crate.rs b/tests/ui/specialization/specialization-cross-crate.rs index d9381d66152..4b2ac07378d 100644 --- a/tests/ui/specialization/specialization-cross-crate.rs +++ b/tests/ui/specialization/specialization-cross-crate.rs @@ -14,7 +14,7 @@ struct NotClone; struct MarkedAndClone; impl MyMarker for MarkedAndClone {} -struct MyType<T>(#[allow(unused_tuple_struct_fields)] T); +struct MyType<T>(#[allow(dead_code)] T); impl<T> Foo for MyType<T> { default fn foo(&self) -> &'static str { "generic MyType" diff --git a/tests/ui/specialization/specialization-translate-projections-with-lifetimes.rs b/tests/ui/specialization/specialization-translate-projections-with-lifetimes.rs index 904aeaa088b..f06afc8ba41 100644 --- a/tests/ui/specialization/specialization-translate-projections-with-lifetimes.rs +++ b/tests/ui/specialization/specialization-translate-projections-with-lifetimes.rs @@ -14,7 +14,7 @@ impl<'a> WithAssoc for &'a () { type Item = &'a u32; } -struct Cloned<I>(#[allow(unused_tuple_struct_fields)] I); +struct Cloned<I>(#[allow(dead_code)] I); impl<'a, I, T: 'a> Iterator for Cloned<I> where I: WithAssoc<Item=&'a T>, T: Clone diff --git a/tests/ui/static/safe-extern-statics-mut.mir.stderr b/tests/ui/static/safe-extern-statics-mut.mir.stderr deleted file mode 100644 index cec5f9d9c9f..00000000000 --- a/tests/ui/static/safe-extern-statics-mut.mir.stderr +++ /dev/null @@ -1,35 +0,0 @@ -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:13:13 - | -LL | let b = B; - | ^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:14:14 - | -LL | let rb = &B; - | ^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:15:14 - | -LL | let xb = XB; - | ^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:16:15 - | -LL | let xrb = &XB; - | ^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: aborting due to 4 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/static/safe-extern-statics-mut.rs b/tests/ui/static/safe-extern-statics-mut.rs index 389a4589a71..324fa443aa5 100644 --- a/tests/ui/static/safe-extern-statics-mut.rs +++ b/tests/ui/static/safe-extern-statics-mut.rs @@ -1,6 +1,4 @@ // aux-build:extern-statics.rs -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck extern crate extern_statics; use extern_statics::*; diff --git a/tests/ui/static/safe-extern-statics-mut.thir.stderr b/tests/ui/static/safe-extern-statics-mut.stderr index 8e6d2805a0b..e390625f20a 100644 --- a/tests/ui/static/safe-extern-statics-mut.thir.stderr +++ b/tests/ui/static/safe-extern-statics-mut.stderr @@ -1,5 +1,5 @@ error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:13:13 + --> $DIR/safe-extern-statics-mut.rs:11:13 | LL | let b = B; | ^ use of mutable static @@ -7,7 +7,7 @@ LL | let b = B; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:14:15 + --> $DIR/safe-extern-statics-mut.rs:12:15 | LL | let rb = &B; | ^ use of mutable static @@ -15,7 +15,7 @@ LL | let rb = &B; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:15:14 + --> $DIR/safe-extern-statics-mut.rs:13:14 | LL | let xb = XB; | ^^ use of mutable static @@ -23,7 +23,7 @@ LL | let xb = XB; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics-mut.rs:16:16 + --> $DIR/safe-extern-statics-mut.rs:14:16 | LL | let xrb = &XB; | ^^ use of mutable static diff --git a/tests/ui/static/safe-extern-statics.mir.stderr b/tests/ui/static/safe-extern-statics.mir.stderr deleted file mode 100644 index 102abd0816f..00000000000 --- a/tests/ui/static/safe-extern-statics.mir.stderr +++ /dev/null @@ -1,35 +0,0 @@ -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:13:13 - | -LL | let a = A; - | ^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:14:14 - | -LL | let ra = &A; - | ^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:15:14 - | -LL | let xa = XA; - | ^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:16:15 - | -LL | let xra = &XA; - | ^^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error: aborting due to 4 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/static/safe-extern-statics.rs b/tests/ui/static/safe-extern-statics.rs index 0aa90c442ea..6fa4c4aaca5 100644 --- a/tests/ui/static/safe-extern-statics.rs +++ b/tests/ui/static/safe-extern-statics.rs @@ -1,6 +1,4 @@ // aux-build:extern-statics.rs -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck extern crate extern_statics; use extern_statics::*; diff --git a/tests/ui/static/safe-extern-statics.thir.stderr b/tests/ui/static/safe-extern-statics.stderr index 7fd2182c4c6..6be6c074c26 100644 --- a/tests/ui/static/safe-extern-statics.thir.stderr +++ b/tests/ui/static/safe-extern-statics.stderr @@ -1,5 +1,5 @@ error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:13:13 + --> $DIR/safe-extern-statics.rs:11:13 | LL | let a = A; | ^ use of extern static @@ -7,7 +7,7 @@ LL | let a = A; = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:14:15 + --> $DIR/safe-extern-statics.rs:12:15 | LL | let ra = &A; | ^ use of extern static @@ -15,7 +15,7 @@ LL | let ra = &A; = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:15:14 + --> $DIR/safe-extern-statics.rs:13:14 | LL | let xa = XA; | ^^ use of extern static @@ -23,7 +23,7 @@ LL | let xa = XA; = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/safe-extern-statics.rs:16:16 + --> $DIR/safe-extern-statics.rs:14:16 | LL | let xra = &XA; | ^^ use of extern static diff --git a/tests/ui/static/static-mut-foreign-requires-unsafe.mir.stderr b/tests/ui/static/static-mut-foreign-requires-unsafe.mir.stderr deleted file mode 100644 index a4659bc8712..00000000000 --- a/tests/ui/static/static-mut-foreign-requires-unsafe.mir.stderr +++ /dev/null @@ -1,27 +0,0 @@ -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-foreign-requires-unsafe.rs:9:5 - | -LL | a += 3; - | ^^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-foreign-requires-unsafe.rs:10:5 - | -LL | a = 4; - | ^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-foreign-requires-unsafe.rs:11:14 - | -LL | let _b = a; - | ^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: aborting due to 3 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/static/static-mut-foreign-requires-unsafe.rs b/tests/ui/static/static-mut-foreign-requires-unsafe.rs index 4f96acb3375..90aa2537a82 100644 --- a/tests/ui/static/static-mut-foreign-requires-unsafe.rs +++ b/tests/ui/static/static-mut-foreign-requires-unsafe.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - extern "C" { static mut a: i32; } diff --git a/tests/ui/static/static-mut-foreign-requires-unsafe.thir.stderr b/tests/ui/static/static-mut-foreign-requires-unsafe.stderr index 2c62d4d8f3b..022f7e9fb16 100644 --- a/tests/ui/static/static-mut-foreign-requires-unsafe.thir.stderr +++ b/tests/ui/static/static-mut-foreign-requires-unsafe.stderr @@ -1,5 +1,5 @@ error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-foreign-requires-unsafe.rs:9:5 + --> $DIR/static-mut-foreign-requires-unsafe.rs:6:5 | LL | a += 3; | ^ use of mutable static @@ -7,7 +7,7 @@ LL | a += 3; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-foreign-requires-unsafe.rs:10:5 + --> $DIR/static-mut-foreign-requires-unsafe.rs:7:5 | LL | a = 4; | ^ use of mutable static @@ -15,7 +15,7 @@ LL | a = 4; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-foreign-requires-unsafe.rs:11:14 + --> $DIR/static-mut-foreign-requires-unsafe.rs:8:14 | LL | let _b = a; | ^ use of mutable static diff --git a/tests/ui/static/static-mut-requires-unsafe.mir.stderr b/tests/ui/static/static-mut-requires-unsafe.mir.stderr deleted file mode 100644 index 0d4ce056fc2..00000000000 --- a/tests/ui/static/static-mut-requires-unsafe.mir.stderr +++ /dev/null @@ -1,27 +0,0 @@ -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-requires-unsafe.rs:7:5 - | -LL | a += 3; - | ^^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-requires-unsafe.rs:8:5 - | -LL | a = 4; - | ^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-requires-unsafe.rs:9:14 - | -LL | let _b = a; - | ^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: aborting due to 3 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/static/static-mut-requires-unsafe.rs b/tests/ui/static/static-mut-requires-unsafe.rs index ea3ba095007..413b97e431d 100644 --- a/tests/ui/static/static-mut-requires-unsafe.rs +++ b/tests/ui/static/static-mut-requires-unsafe.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - static mut a: isize = 3; fn main() { diff --git a/tests/ui/static/static-mut-requires-unsafe.thir.stderr b/tests/ui/static/static-mut-requires-unsafe.stderr index 1a1cf14271a..30be0220cf6 100644 --- a/tests/ui/static/static-mut-requires-unsafe.thir.stderr +++ b/tests/ui/static/static-mut-requires-unsafe.stderr @@ -1,5 +1,5 @@ error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-requires-unsafe.rs:7:5 + --> $DIR/static-mut-requires-unsafe.rs:4:5 | LL | a += 3; | ^ use of mutable static @@ -7,7 +7,7 @@ LL | a += 3; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-requires-unsafe.rs:8:5 + --> $DIR/static-mut-requires-unsafe.rs:5:5 | LL | a = 4; | ^ use of mutable static @@ -15,7 +15,7 @@ LL | a = 4; = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/static-mut-requires-unsafe.rs:9:14 + --> $DIR/static-mut-requires-unsafe.rs:6:14 | LL | let _b = a; | ^ use of mutable static diff --git a/tests/ui/statics/issue-14227.rs b/tests/ui/statics/issue-14227.rs index 5f866ec9061..a1fde14600a 100644 --- a/tests/ui/statics/issue-14227.rs +++ b/tests/ui/statics/issue-14227.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - extern "C" { pub static symbol: u32; } diff --git a/tests/ui/statics/issue-14227.mir.stderr b/tests/ui/statics/issue-14227.stderr index ab50b97d63f..085d6df9c41 100644 --- a/tests/ui/statics/issue-14227.mir.stderr +++ b/tests/ui/statics/issue-14227.stderr @@ -1,5 +1,5 @@ error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-14227.rs:7:21 + --> $DIR/issue-14227.rs:4:21 | LL | static CRASH: u32 = symbol; | ^^^^^^ use of extern static diff --git a/tests/ui/statics/issue-14227.thir.stderr b/tests/ui/statics/issue-14227.thir.stderr deleted file mode 100644 index ab50b97d63f..00000000000 --- a/tests/ui/statics/issue-14227.thir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: use of extern static is unsafe and requires unsafe function or block - --> $DIR/issue-14227.rs:7:21 - | -LL | static CRASH: u32 = symbol; - | ^^^^^^ use of extern static - | - = note: extern statics are not controlled by the Rust type system: invalid data, aliasing violations or data races will cause undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/stats/hir-stats.stderr b/tests/ui/stats/hir-stats.stderr index 5296475c94a..8b9ec30db63 100644 --- a/tests/ui/stats/hir-stats.stderr +++ b/tests/ui/stats/hir-stats.stderr @@ -128,8 +128,8 @@ hir-stats Param 64 ( 0.7%) 2 32 hir-stats Body 72 ( 0.8%) 3 24 hir-stats InlineAsm 72 ( 0.8%) 1 72 hir-stats ImplItemRef 72 ( 0.8%) 2 36 +hir-stats Arm 80 ( 0.9%) 2 40 hir-stats FieldDef 96 ( 1.1%) 2 48 -hir-stats Arm 96 ( 1.1%) 2 48 hir-stats Stmt 96 ( 1.1%) 3 32 hir-stats - Local 32 ( 0.4%) 1 hir-stats - Semi 32 ( 0.4%) 1 @@ -151,11 +151,11 @@ hir-stats - Wild 72 ( 0.8%) 1 hir-stats - Struct 72 ( 0.8%) 1 hir-stats - Binding 216 ( 2.4%) 3 hir-stats GenericParam 400 ( 4.4%) 5 80 -hir-stats Generics 560 ( 6.1%) 10 56 +hir-stats Generics 560 ( 6.2%) 10 56 hir-stats Ty 720 ( 7.9%) 15 48 hir-stats - Ptr 48 ( 0.5%) 1 hir-stats - Ref 48 ( 0.5%) 1 -hir-stats - Path 624 ( 6.8%) 13 +hir-stats - Path 624 ( 6.9%) 13 hir-stats Expr 768 ( 8.4%) 12 64 hir-stats - Path 64 ( 0.7%) 1 hir-stats - Struct 64 ( 0.7%) 1 @@ -174,5 +174,5 @@ hir-stats - Use 352 ( 3.9%) 4 hir-stats Path 1_240 (13.6%) 31 40 hir-stats PathSegment 1_920 (21.1%) 40 48 hir-stats ---------------------------------------------------------------- -hir-stats Total 9_112 +hir-stats Total 9_096 hir-stats diff --git a/tests/ui/stdlib-unit-tests/raw-fat-ptr.rs b/tests/ui/stdlib-unit-tests/raw-fat-ptr.rs index 6b0b09c9894..0f535523dcc 100644 --- a/tests/ui/stdlib-unit-tests/raw-fat-ptr.rs +++ b/tests/ui/stdlib-unit-tests/raw-fat-ptr.rs @@ -39,7 +39,7 @@ impl<T> Foo for T { } } -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] struct S<T:?Sized>(u32, T); fn main() { diff --git a/tests/ui/struct-ctor-mangling.rs b/tests/ui/struct-ctor-mangling.rs index ba6abbf03a5..159e21d2863 100644 --- a/tests/ui/struct-ctor-mangling.rs +++ b/tests/ui/struct-ctor-mangling.rs @@ -4,7 +4,7 @@ fn size_of_val<T>(_: &T) -> usize { std::mem::size_of::<T>() } -struct Foo(#[allow(unused_tuple_struct_fields)] i64); +struct Foo(#[allow(dead_code)] i64); // Test that the (symbol) mangling of `Foo` (the `struct` type) and that of // `typeof Foo` (the function type of the `struct` constructor) don't collide. diff --git a/tests/ui/structs-enums/enum-null-pointer-opt.rs b/tests/ui/structs-enums/enum-null-pointer-opt.rs index 85fa1eac2e2..356f8a6dd36 100644 --- a/tests/ui/structs-enums/enum-null-pointer-opt.rs +++ b/tests/ui/structs-enums/enum-null-pointer-opt.rs @@ -10,8 +10,8 @@ use std::sync::Arc; trait Trait { fn dummy(&self) { } } trait Mirror { type Image; } impl<T> Mirror for T { type Image = T; } -struct ParamTypeStruct<T>(#[allow(unused_tuple_struct_fields)] T); -struct AssocTypeStruct<T>(#[allow(unused_tuple_struct_fields)] <T as Mirror>::Image); +struct ParamTypeStruct<T>(#[allow(dead_code)] T); +struct AssocTypeStruct<T>(#[allow(dead_code)] <T as Mirror>::Image); #[repr(transparent)] union MaybeUninitUnion<T: Copy> { _value: T, @@ -46,7 +46,7 @@ fn main() { struct Foo { _a: Box<isize> } - struct Bar(#[allow(unused_tuple_struct_fields)] Box<isize>); + struct Bar(#[allow(dead_code)] Box<isize>); // Should apply through structs assert_eq!(size_of::<Foo>(), size_of::<Option<Foo>>()); diff --git a/tests/ui/structs-enums/enum-nullable-simplifycfg-misopt.rs b/tests/ui/structs-enums/enum-nullable-simplifycfg-misopt.rs index a05cf8b93d5..4bd7ee45dfe 100644 --- a/tests/ui/structs-enums/enum-nullable-simplifycfg-misopt.rs +++ b/tests/ui/structs-enums/enum-nullable-simplifycfg-misopt.rs @@ -6,7 +6,7 @@ * represented with nullable pointers could be misoptimized in some cases. */ -enum List<X> { Nil, Cons(X, #[allow(unused_tuple_struct_fields)] Box<List<X>>) } +enum List<X> { Nil, Cons(X, #[allow(dead_code)] Box<List<X>>) } pub fn main() { match List::Cons(10, Box::new(List::Nil)) { List::Cons(10, _) => {} diff --git a/tests/ui/structs-enums/resource-in-struct.rs b/tests/ui/structs-enums/resource-in-struct.rs index 9613ca62a49..267ad6b4a86 100644 --- a/tests/ui/structs-enums/resource-in-struct.rs +++ b/tests/ui/structs-enums/resource-in-struct.rs @@ -25,7 +25,7 @@ fn close_res(i: closable) -> close_res { } } -enum option<T> { none, some(#[allow(unused_tuple_struct_fields)] T), } +enum option<T> { none, some(#[allow(dead_code)] T), } fn sink(_res: option<close_res>) { } diff --git a/tests/ui/structs-enums/tuple-struct-construct.rs b/tests/ui/structs-enums/tuple-struct-construct.rs index fbf97e6b225..dc7cbaffddb 100644 --- a/tests/ui/structs-enums/tuple-struct-construct.rs +++ b/tests/ui/structs-enums/tuple-struct-construct.rs @@ -1,5 +1,5 @@ // run-pass -#[allow(unused_tuple_struct_fields)] +#[allow(dead_code)] #[derive(Debug)] struct Foo(isize, isize); diff --git a/tests/ui/structs-enums/uninstantiable-struct.rs b/tests/ui/structs-enums/uninstantiable-struct.rs index b24effe5a9c..15f2fc424bb 100644 --- a/tests/ui/structs-enums/uninstantiable-struct.rs +++ b/tests/ui/structs-enums/uninstantiable-struct.rs @@ -1,4 +1,4 @@ // run-pass -pub struct Z(#[allow(unused_tuple_struct_fields)] &'static Z); +pub struct Z(#[allow(dead_code)] &'static Z); pub fn main() {} diff --git a/tests/ui/suggestions/auxiliary/hidden-struct.rs b/tests/ui/suggestions/auxiliary/hidden-struct.rs new file mode 100644 index 00000000000..30d69acac20 --- /dev/null +++ b/tests/ui/suggestions/auxiliary/hidden-struct.rs @@ -0,0 +1,17 @@ +#[doc(hidden)] +pub mod hidden { + pub struct Foo; +} + +pub mod hidden1 { + #[doc(hidden)] + pub struct Foo; +} + + +#[doc(hidden)] +pub(crate) mod hidden2 { + pub struct Bar; +} + +pub use hidden2::Bar; diff --git a/tests/ui/suggestions/dont-suggest-foreign-doc-hidden.rs b/tests/ui/suggestions/dont-suggest-foreign-doc-hidden.rs new file mode 100644 index 00000000000..779a0c43c02 --- /dev/null +++ b/tests/ui/suggestions/dont-suggest-foreign-doc-hidden.rs @@ -0,0 +1,15 @@ +// aux-build:hidden-struct.rs +// compile-flags: --crate-type lib + +extern crate hidden_struct; + +#[doc(hidden)] +mod local { + pub struct Foo; +} + +pub fn test(_: Foo) {} +//~^ ERROR cannot find type `Foo` in this scope + +pub fn test2(_: Bar) {} +//~^ ERROR cannot find type `Bar` in this scope diff --git a/tests/ui/suggestions/dont-suggest-foreign-doc-hidden.stderr b/tests/ui/suggestions/dont-suggest-foreign-doc-hidden.stderr new file mode 100644 index 00000000000..7fb4d95ff9b --- /dev/null +++ b/tests/ui/suggestions/dont-suggest-foreign-doc-hidden.stderr @@ -0,0 +1,25 @@ +error[E0412]: cannot find type `Foo` in this scope + --> $DIR/dont-suggest-foreign-doc-hidden.rs:11:16 + | +LL | pub fn test(_: Foo) {} + | ^^^ not found in this scope + | +help: consider importing this struct + | +LL + use local::Foo; + | + +error[E0412]: cannot find type `Bar` in this scope + --> $DIR/dont-suggest-foreign-doc-hidden.rs:14:17 + | +LL | pub fn test2(_: Bar) {} + | ^^^ not found in this scope + | +help: consider importing this struct + | +LL + use hidden_struct::Bar; + | + +error: aborting due to 2 previous errors + +For more information about this error, try `rustc --explain E0412`. diff --git a/tests/ui/suggestions/lifetimes/type-param-bound-scope.fixed b/tests/ui/suggestions/lifetimes/type-param-bound-scope.fixed index 470cc67b973..3257ea04c69 100644 --- a/tests/ui/suggestions/lifetimes/type-param-bound-scope.fixed +++ b/tests/ui/suggestions/lifetimes/type-param-bound-scope.fixed @@ -2,7 +2,7 @@ // trait, impl or associated fn. // run-rustfix -struct Inv<'a>(Option<*mut &'a u8>); +struct Inv<'a>(#[allow(dead_code)] Option<*mut &'a u8>); fn check_bound<'a, A: 'a>(_: A, _: Inv<'a>) {} diff --git a/tests/ui/suggestions/lifetimes/type-param-bound-scope.rs b/tests/ui/suggestions/lifetimes/type-param-bound-scope.rs index 874788e13ef..fcc13aad996 100644 --- a/tests/ui/suggestions/lifetimes/type-param-bound-scope.rs +++ b/tests/ui/suggestions/lifetimes/type-param-bound-scope.rs @@ -2,7 +2,7 @@ // trait, impl or associated fn. // run-rustfix -struct Inv<'a>(Option<*mut &'a u8>); +struct Inv<'a>(#[allow(dead_code)] Option<*mut &'a u8>); fn check_bound<'a, A: 'a>(_: A, _: Inv<'a>) {} diff --git a/tests/ui/thread-local/thread-local-static.rs b/tests/ui/thread-local/thread-local-static.rs index afaffbb7e9b..e6cd4839dda 100644 --- a/tests/ui/thread-local/thread-local-static.rs +++ b/tests/ui/thread-local/thread-local-static.rs @@ -1,6 +1,4 @@ // edition:2018 -// revisions: mir thir -//thir: -Zthir-unsafeck #![feature(thread_local)] #![feature(const_swap)] diff --git a/tests/ui/thread-local/thread-local-static.mir.stderr b/tests/ui/thread-local/thread-local-static.stderr index 607d7ee902c..c1777dd60db 100644 --- a/tests/ui/thread-local/thread-local-static.mir.stderr +++ b/tests/ui/thread-local/thread-local-static.stderr @@ -1,5 +1,13 @@ +error[E0133]: use of mutable static is unsafe and requires unsafe function or block + --> $DIR/thread-local-static.rs:10:28 + | +LL | std::mem::swap(x, &mut STATIC_VAR_2) + | ^^^^^^^^^^^^ use of mutable static + | + = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior + error[E0658]: mutable references are not allowed in constant functions - --> $DIR/thread-local-static.rs:10:12 + --> $DIR/thread-local-static.rs:8:12 | LL | const fn g(x: &mut [u32; 8]) { | ^ @@ -8,13 +16,13 @@ LL | const fn g(x: &mut [u32; 8]) { = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable error[E0625]: thread-local statics cannot be accessed at compile-time - --> $DIR/thread-local-static.rs:12:28 + --> $DIR/thread-local-static.rs:10:28 | LL | std::mem::swap(x, &mut STATIC_VAR_2) | ^^^^^^^^^^^^ error[E0013]: constant functions cannot refer to statics - --> $DIR/thread-local-static.rs:12:28 + --> $DIR/thread-local-static.rs:10:28 | LL | std::mem::swap(x, &mut STATIC_VAR_2) | ^^^^^^^^^^^^ @@ -22,7 +30,7 @@ LL | std::mem::swap(x, &mut STATIC_VAR_2) = help: consider extracting the value of the `static` to a `const`, and referring to that error[E0658]: mutable references are not allowed in constant functions - --> $DIR/thread-local-static.rs:12:23 + --> $DIR/thread-local-static.rs:10:23 | LL | std::mem::swap(x, &mut STATIC_VAR_2) | ^^^^^^^^^^^^^^^^^ @@ -30,14 +38,6 @@ LL | std::mem::swap(x, &mut STATIC_VAR_2) = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/thread-local-static.rs:12:23 - | -LL | std::mem::swap(x, &mut STATIC_VAR_2) - | ^^^^^^^^^^^^^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - error: aborting due to 5 previous errors Some errors have detailed explanations: E0013, E0133, E0625, E0658. diff --git a/tests/ui/thread-local/thread-local-static.thir.stderr b/tests/ui/thread-local/thread-local-static.thir.stderr deleted file mode 100644 index 607d7ee902c..00000000000 --- a/tests/ui/thread-local/thread-local-static.thir.stderr +++ /dev/null @@ -1,44 +0,0 @@ -error[E0658]: mutable references are not allowed in constant functions - --> $DIR/thread-local-static.rs:10:12 - | -LL | const fn g(x: &mut [u32; 8]) { - | ^ - | - = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information - = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable - -error[E0625]: thread-local statics cannot be accessed at compile-time - --> $DIR/thread-local-static.rs:12:28 - | -LL | std::mem::swap(x, &mut STATIC_VAR_2) - | ^^^^^^^^^^^^ - -error[E0013]: constant functions cannot refer to statics - --> $DIR/thread-local-static.rs:12:28 - | -LL | std::mem::swap(x, &mut STATIC_VAR_2) - | ^^^^^^^^^^^^ - | - = help: consider extracting the value of the `static` to a `const`, and referring to that - -error[E0658]: mutable references are not allowed in constant functions - --> $DIR/thread-local-static.rs:12:23 - | -LL | std::mem::swap(x, &mut STATIC_VAR_2) - | ^^^^^^^^^^^^^^^^^ - | - = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information - = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable - -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/thread-local-static.rs:12:23 - | -LL | std::mem::swap(x, &mut STATIC_VAR_2) - | ^^^^^^^^^^^^^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: aborting due to 5 previous errors - -Some errors have detailed explanations: E0013, E0133, E0625, E0658. -For more information about an error, try `rustc --explain E0013`. diff --git a/tests/ui/threads-sendsync/issue-43733.mir.stderr b/tests/ui/threads-sendsync/issue-43733.mir.stderr deleted file mode 100644 index ff83e16add9..00000000000 --- a/tests/ui/threads-sendsync/issue-43733.mir.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/issue-43733.rs:19:5 - | -LL | __KEY.get(Default::default) - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/issue-43733.rs:24:42 - | -LL | static FOO: std::thread::LocalKey<Foo> = std::thread::LocalKey::new(__getit); - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/threads-sendsync/issue-43733.rs b/tests/ui/threads-sendsync/issue-43733.rs index cac745f1e12..671b45e777f 100644 --- a/tests/ui/threads-sendsync/issue-43733.rs +++ b/tests/ui/threads-sendsync/issue-43733.rs @@ -1,6 +1,4 @@ // ignore-wasm32 -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #![feature(thread_local)] #![feature(cfg_target_thread_local, thread_local_internals)] @@ -17,13 +15,11 @@ static __KEY: std::thread::local_impl::Key<Foo> = std::thread::local_impl::Key:: fn __getit(_: Option<&mut Option<RefCell<String>>>) -> std::option::Option<&'static Foo> { __KEY.get(Default::default) - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `Key::<T>::get` + //~^ ERROR call to unsafe function `Key::<T>::get` is unsafe } static FOO: std::thread::LocalKey<Foo> = std::thread::LocalKey::new(__getit); -//[mir]~^ ERROR call to unsafe function is unsafe -//[thir]~^^ ERROR call to unsafe function `LocalKey::<T>::new` +//~^ ERROR call to unsafe function `LocalKey::<T>::new` is unsafe fn main() { FOO.with(|foo| println!("{}", foo.borrow())); diff --git a/tests/ui/threads-sendsync/issue-43733.thir.stderr b/tests/ui/threads-sendsync/issue-43733.stderr index 94ec724044c..9b13646a228 100644 --- a/tests/ui/threads-sendsync/issue-43733.thir.stderr +++ b/tests/ui/threads-sendsync/issue-43733.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `Key::<T>::get` is unsafe and requires unsafe function or block - --> $DIR/issue-43733.rs:19:5 + --> $DIR/issue-43733.rs:17:5 | LL | __KEY.get(Default::default) | ^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function @@ -7,7 +7,7 @@ LL | __KEY.get(Default::default) = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `LocalKey::<T>::new` is unsafe and requires unsafe function or block - --> $DIR/issue-43733.rs:24:42 + --> $DIR/issue-43733.rs:21:42 | LL | static FOO: std::thread::LocalKey<Foo> = std::thread::LocalKey::new(__getit); | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/trailing-comma.rs b/tests/ui/trailing-comma.rs index 90adba99e54..31091398508 100644 --- a/tests/ui/trailing-comma.rs +++ b/tests/ui/trailing-comma.rs @@ -3,7 +3,7 @@ fn f<T,>(_: T,) {} -struct Foo<T,>(#[allow(unused_tuple_struct_fields)] T); +struct Foo<T,>(#[allow(dead_code)] T); struct Bar; @@ -14,7 +14,7 @@ impl Bar { } enum Baz { - Qux(#[allow(unused_tuple_struct_fields)] isize,), + Qux(#[allow(dead_code)] isize,), } #[allow(unused,)] diff --git a/tests/ui/traits/augmented-assignments-trait.rs b/tests/ui/traits/augmented-assignments-trait.rs index 747a5393f12..75168c4f1e5 100644 --- a/tests/ui/traits/augmented-assignments-trait.rs +++ b/tests/ui/traits/augmented-assignments-trait.rs @@ -1,7 +1,7 @@ // run-pass use std::ops::AddAssign; -struct Int(#[allow(unused_tuple_struct_fields)] i32); +struct Int(#[allow(dead_code)] i32); impl AddAssign for Int { fn add_assign(&mut self, _: Int) { diff --git a/tests/ui/traits/bound/not-on-bare-trait-2021.rs b/tests/ui/traits/bound/not-on-bare-trait-2021.rs new file mode 100644 index 00000000000..3d97bddb4a4 --- /dev/null +++ b/tests/ui/traits/bound/not-on-bare-trait-2021.rs @@ -0,0 +1,17 @@ +// edition:2021 +trait Foo { + fn dummy(&self) {} +} + +// This should emit the less confusing error, not the more confusing one. + +fn foo(_x: Foo + Send) { + //~^ ERROR trait objects must include the `dyn` keyword +} +fn bar(x: Foo) -> Foo { + //~^ ERROR trait objects must include the `dyn` keyword + //~| ERROR trait objects must include the `dyn` keyword + x +} + +fn main() {} diff --git a/tests/ui/traits/bound/not-on-bare-trait-2021.stderr b/tests/ui/traits/bound/not-on-bare-trait-2021.stderr new file mode 100644 index 00000000000..6f41f872e4c --- /dev/null +++ b/tests/ui/traits/bound/not-on-bare-trait-2021.stderr @@ -0,0 +1,56 @@ +error[E0782]: trait objects must include the `dyn` keyword + --> $DIR/not-on-bare-trait-2021.rs:8:12 + | +LL | fn foo(_x: Foo + Send) { + | ^^^^^^^^^^ + | +help: use a new generic type parameter, constrained by `Foo + Send` + | +LL | fn foo<T: Foo + Send>(_x: T) { + | +++++++++++++++ ~ +help: you can also use an opaque type, but users won't be able to specify the type parameter when calling the `fn`, having to rely exclusively on type inference + | +LL | fn foo(_x: impl Foo + Send) { + | ++++ +help: alternatively, use a trait object to accept any type that implements `Foo + Send`, accessing its methods at runtime using dynamic dispatch + | +LL | fn foo(_x: &(dyn Foo + Send)) { + | +++++ + + +error[E0782]: trait objects must include the `dyn` keyword + --> $DIR/not-on-bare-trait-2021.rs:11:11 + | +LL | fn bar(x: Foo) -> Foo { + | ^^^ + | +help: use a new generic type parameter, constrained by `Foo` + | +LL | fn bar<T: Foo>(x: T) -> Foo { + | ++++++++ ~ +help: you can also use an opaque type, but users won't be able to specify the type parameter when calling the `fn`, having to rely exclusively on type inference + | +LL | fn bar(x: impl Foo) -> Foo { + | ++++ +help: alternatively, use a trait object to accept any type that implements `Foo`, accessing its methods at runtime using dynamic dispatch + | +LL | fn bar(x: &dyn Foo) -> Foo { + | ++++ + +error[E0782]: trait objects must include the `dyn` keyword + --> $DIR/not-on-bare-trait-2021.rs:11:19 + | +LL | fn bar(x: Foo) -> Foo { + | ^^^ + | +help: use `impl Foo` to return an opaque type, as long as you return a single underlying type + | +LL | fn bar(x: Foo) -> impl Foo { + | ++++ +help: alternatively, you can return an owned trait object + | +LL | fn bar(x: Foo) -> Box<dyn Foo> { + | +++++++ + + +error: aborting due to 3 previous errors + +For more information about this error, try `rustc --explain E0782`. diff --git a/tests/ui/traits/bound/not-on-bare-trait.rs b/tests/ui/traits/bound/not-on-bare-trait.rs index daf18c6702e..9e717f3c045 100644 --- a/tests/ui/traits/bound/not-on-bare-trait.rs +++ b/tests/ui/traits/bound/not-on-bare-trait.rs @@ -9,5 +9,8 @@ fn foo(_x: Foo + Send) { //~| WARN trait objects without an explicit `dyn` are deprecated //~| WARN this is accepted in the current edition } +fn bar(_x: (dyn Foo + Send)) { + //~^ ERROR the size for values of type +} fn main() {} diff --git a/tests/ui/traits/bound/not-on-bare-trait.stderr b/tests/ui/traits/bound/not-on-bare-trait.stderr index 1d97bf3d8f9..8d0e40be788 100644 --- a/tests/ui/traits/bound/not-on-bare-trait.stderr +++ b/tests/ui/traits/bound/not-on-bare-trait.stderr @@ -7,10 +7,18 @@ LL | fn foo(_x: Foo + Send) { = warning: this is accepted in the current edition (Rust 2015) but is a hard error in Rust 2021! = note: for more information, see <https://doc.rust-lang.org/nightly/edition-guide/rust-2021/warnings-promoted-to-error.html> = note: `#[warn(bare_trait_objects)]` on by default -help: use `dyn` +help: use a new generic type parameter, constrained by `Foo + Send` | -LL | fn foo(_x: dyn Foo + Send) { - | +++ +LL | fn foo<T: Foo + Send>(_x: T) { + | +++++++++++++++ ~ +help: you can also use an opaque type, but users won't be able to specify the type parameter when calling the `fn`, having to rely exclusively on type inference + | +LL | fn foo(_x: impl Foo + Send) { + | ++++ +help: alternatively, use a trait object to accept any type that implements `Foo + Send`, accessing its methods at runtime using dynamic dispatch + | +LL | fn foo(_x: &(dyn Foo + Send)) { + | +++++ + error[E0277]: the size for values of type `(dyn Foo + Send + 'static)` cannot be known at compilation time --> $DIR/not-on-bare-trait.rs:7:8 @@ -26,9 +34,26 @@ LL | fn foo(_x: impl Foo + Send) { | ++++ help: function arguments must have a statically known size, borrowed types always have a known size | -LL | fn foo(_x: &Foo + Send) { - | + +LL | fn foo(_x: &(dyn Foo + Send)) { + | +++++ + + +error[E0277]: the size for values of type `(dyn Foo + Send + 'static)` cannot be known at compilation time + --> $DIR/not-on-bare-trait.rs:12:8 + | +LL | fn bar(_x: (dyn Foo + Send)) { + | ^^ doesn't have a size known at compile-time + | + = help: the trait `Sized` is not implemented for `(dyn Foo + Send + 'static)` + = help: unsized fn params are gated as an unstable feature +help: you can use `impl Trait` as the argument type + | +LL | fn bar(_x: (impl Foo + Send)) { + | ~~~~ +help: function arguments must have a statically known size, borrowed types always have a known size + | +LL | fn bar(_x: (&(dyn Foo + Send))) { + | ++ + -error: aborting due to 1 previous error; 1 warning emitted +error: aborting due to 2 previous errors; 1 warning emitted For more information about this error, try `rustc --explain E0277`. diff --git a/tests/ui/traits/cycle-cache-err-60010.rs b/tests/ui/traits/cycle-cache-err-60010.rs index 94e718317e7..94875a5a25a 100644 --- a/tests/ui/traits/cycle-cache-err-60010.rs +++ b/tests/ui/traits/cycle-cache-err-60010.rs @@ -29,9 +29,8 @@ struct SalsaStorage { } impl Database for RootDatabase { - // This would also be an error if we didn't abort compilation on the error - // above. type Storage = SalsaStorage; + //~^ ERROR overflow } impl HasQueryGroup for RootDatabase {} impl<DB> Query<DB> for ParseQuery diff --git a/tests/ui/traits/cycle-cache-err-60010.stderr b/tests/ui/traits/cycle-cache-err-60010.stderr index 4f9615104cb..4f5e3181832 100644 --- a/tests/ui/traits/cycle-cache-err-60010.stderr +++ b/tests/ui/traits/cycle-cache-err-60010.stderr @@ -21,7 +21,7 @@ note: required because it appears within the type `RootDatabase` LL | struct RootDatabase { | ^^^^^^^^^^^^ note: required for `RootDatabase` to implement `SourceDatabase` - --> $DIR/cycle-cache-err-60010.rs:44:9 + --> $DIR/cycle-cache-err-60010.rs:43:9 | LL | impl<T> SourceDatabase for T | ^^^^^^^^^^^^^^ ^ @@ -29,7 +29,7 @@ LL | where LL | T: RefUnwindSafe, | ------------- unsatisfied trait bound introduced here note: required for `ParseQuery` to implement `Query<RootDatabase>` - --> $DIR/cycle-cache-err-60010.rs:37:10 + --> $DIR/cycle-cache-err-60010.rs:36:10 | LL | impl<DB> Query<DB> for ParseQuery | ^^^^^^^^^ ^^^^^^^^^^ @@ -37,6 +37,59 @@ LL | where LL | DB: SourceDatabase, | -------------- unsatisfied trait bound introduced here -error: aborting due to 1 previous error +error[E0275]: overflow evaluating the requirement `SalsaStorage: RefUnwindSafe` + --> $DIR/cycle-cache-err-60010.rs:32:20 + | +LL | type Storage = SalsaStorage; + | ^^^^^^^^^^^^ + | +note: required because it appears within the type `PhantomData<SalsaStorage>` + --> $SRC_DIR/core/src/marker.rs:LL:COL +note: required because it appears within the type `Unique<SalsaStorage>` + --> $SRC_DIR/core/src/ptr/unique.rs:LL:COL +note: required because it appears within the type `Box<SalsaStorage>` + --> $SRC_DIR/alloc/src/boxed.rs:LL:COL +note: required because it appears within the type `Runtime<RootDatabase>` + --> $DIR/cycle-cache-err-60010.rs:23:8 + | +LL | struct Runtime<DB: Database> { + | ^^^^^^^ +note: required because it appears within the type `RootDatabase` + --> $DIR/cycle-cache-err-60010.rs:20:8 + | +LL | struct RootDatabase { + | ^^^^^^^^^^^^ +note: required for `RootDatabase` to implement `SourceDatabase` + --> $DIR/cycle-cache-err-60010.rs:43:9 + | +LL | impl<T> SourceDatabase for T + | ^^^^^^^^^^^^^^ ^ +LL | where +LL | T: RefUnwindSafe, + | ------------- unsatisfied trait bound introduced here +note: required for `ParseQuery` to implement `Query<RootDatabase>` + --> $DIR/cycle-cache-err-60010.rs:36:10 + | +LL | impl<DB> Query<DB> for ParseQuery + | ^^^^^^^^^ ^^^^^^^^^^ +LL | where +LL | DB: SourceDatabase, + | -------------- unsatisfied trait bound introduced here +note: required because it appears within the type `SalsaStorage` + --> $DIR/cycle-cache-err-60010.rs:26:8 + | +LL | struct SalsaStorage { + | ^^^^^^^^^^^^ +note: required by a bound in `Database::Storage` + --> $DIR/cycle-cache-err-60010.rs:7:5 + | +LL | type Storage; + | ^^^^^^^^^^^^^ required by this bound in `Database::Storage` +help: consider relaxing the implicit `Sized` restriction + | +LL | type Storage: ?Sized; + | ++++++++ + +error: aborting due to 2 previous errors For more information about this error, try `rustc --explain E0275`. diff --git a/tests/ui/traits/issue-28576.stderr b/tests/ui/traits/issue-28576.stderr index 9fe50864642..3b45a510341 100644 --- a/tests/ui/traits/issue-28576.stderr +++ b/tests/ui/traits/issue-28576.stderr @@ -14,6 +14,10 @@ LL | pub trait Bar: Foo<Assoc=()> { | | | ...because it uses `Self` as a type parameter | | ...because it uses `Self` as a type parameter | this trait cannot be made into an object... +help: consider using an opaque type instead + | +LL | impl Bar + | ~~~~ error: aborting due to 1 previous error diff --git a/tests/ui/traits/negative-bounds/associated-constraints.rs b/tests/ui/traits/negative-bounds/associated-constraints.rs index bc1a0ef1708..4a7132ccde9 100644 --- a/tests/ui/traits/negative-bounds/associated-constraints.rs +++ b/tests/ui/traits/negative-bounds/associated-constraints.rs @@ -1,5 +1,4 @@ #![feature(negative_bounds, associated_type_bounds)] -//~^ WARN the feature `negative_bounds` is incomplete and may not be safe to use and/or cause compiler crashes trait Trait { type Assoc; @@ -17,4 +16,7 @@ fn test3<T: !Trait<Assoc: Send>>() {} fn test4<T>() where T: !Trait<Assoc: Send> {} //~^ ERROR associated type constraints not allowed on negative bounds +fn test5<T>() where T: !Fn() -> i32 {} +//~^ ERROR parenthetical notation may not be used for negative bounds + fn main() {} diff --git a/tests/ui/traits/negative-bounds/associated-constraints.stderr b/tests/ui/traits/negative-bounds/associated-constraints.stderr index 335ac7e5ad9..c1a6d2ca6a2 100644 --- a/tests/ui/traits/negative-bounds/associated-constraints.stderr +++ b/tests/ui/traits/negative-bounds/associated-constraints.stderr @@ -1,34 +1,32 @@ error: associated type constraints not allowed on negative bounds - --> $DIR/associated-constraints.rs:8:19 + --> $DIR/associated-constraints.rs:7:19 | LL | fn test<T: !Trait<Assoc = i32>>() {} | ^^^^^^^^^^^ error: associated type constraints not allowed on negative bounds - --> $DIR/associated-constraints.rs:11:31 + --> $DIR/associated-constraints.rs:10:31 | LL | fn test2<T>() where T: !Trait<Assoc = i32> {} | ^^^^^^^^^^^ error: associated type constraints not allowed on negative bounds - --> $DIR/associated-constraints.rs:14:20 + --> $DIR/associated-constraints.rs:13:20 | LL | fn test3<T: !Trait<Assoc: Send>>() {} | ^^^^^^^^^^^ error: associated type constraints not allowed on negative bounds - --> $DIR/associated-constraints.rs:17:31 + --> $DIR/associated-constraints.rs:16:31 | LL | fn test4<T>() where T: !Trait<Assoc: Send> {} | ^^^^^^^^^^^ -warning: the feature `negative_bounds` is incomplete and may not be safe to use and/or cause compiler crashes - --> $DIR/associated-constraints.rs:1:12 +error: parenthetical notation may not be used for negative bounds + --> $DIR/associated-constraints.rs:19:25 | -LL | #![feature(negative_bounds, associated_type_bounds)] - | ^^^^^^^^^^^^^^^ - | - = note: `#[warn(incomplete_features)]` on by default +LL | fn test5<T>() where T: !Fn() -> i32 {} + | ^^^^^^^^^^^ -error: aborting due to 4 previous errors; 1 warning emitted +error: aborting due to 5 previous errors diff --git a/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-bound.rs b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-bound.rs new file mode 100644 index 00000000000..e1e93f79920 --- /dev/null +++ b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-bound.rs @@ -0,0 +1,23 @@ +// compile-flags: -Znext-solver + +#![feature(negative_bounds, negative_impls)] + +trait Trait {} +impl !Trait for () {} + +fn produce() -> impl !Trait {} +fn consume(_: impl Trait) {} + +fn main() { + consume(produce()); //~ ERROR the trait bound `impl !Trait: Trait` is not satisfied +} + +fn weird0() -> impl Sized + !Sized {} +//~^ ERROR mismatched types +//~| ERROR type mismatch resolving `() == impl !Sized + Sized` +fn weird1() -> impl !Sized + Sized {} +//~^ ERROR mismatched types +//~| ERROR type mismatch resolving `() == impl !Sized + Sized` +fn weird2() -> impl !Sized {} +//~^ ERROR mismatched types +//~| ERROR type mismatch resolving `() == impl !Sized` diff --git a/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-bound.stderr b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-bound.stderr new file mode 100644 index 00000000000..62792761870 --- /dev/null +++ b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-bound.stderr @@ -0,0 +1,69 @@ +error[E0308]: mismatched types + --> $DIR/opaque-type-unsatisfied-bound.rs:15:36 + | +LL | fn weird0() -> impl Sized + !Sized {} + | ------------------- ^^ types differ + | | + | the expected opaque type + | + = note: expected opaque type `impl !Sized + Sized` + found unit type `()` + +error[E0271]: type mismatch resolving `() == impl !Sized + Sized` + --> $DIR/opaque-type-unsatisfied-bound.rs:15:16 + | +LL | fn weird0() -> impl Sized + !Sized {} + | ^^^^^^^^^^^^^^^^^^^ types differ + +error[E0308]: mismatched types + --> $DIR/opaque-type-unsatisfied-bound.rs:18:36 + | +LL | fn weird1() -> impl !Sized + Sized {} + | ------------------- ^^ types differ + | | + | the expected opaque type + | + = note: expected opaque type `impl !Sized + Sized` + found unit type `()` + +error[E0271]: type mismatch resolving `() == impl !Sized + Sized` + --> $DIR/opaque-type-unsatisfied-bound.rs:18:16 + | +LL | fn weird1() -> impl !Sized + Sized {} + | ^^^^^^^^^^^^^^^^^^^ types differ + +error[E0308]: mismatched types + --> $DIR/opaque-type-unsatisfied-bound.rs:21:28 + | +LL | fn weird2() -> impl !Sized {} + | ----------- ^^ types differ + | | + | the expected opaque type + | + = note: expected opaque type `impl !Sized` + found unit type `()` + +error[E0271]: type mismatch resolving `() == impl !Sized` + --> $DIR/opaque-type-unsatisfied-bound.rs:21:16 + | +LL | fn weird2() -> impl !Sized {} + | ^^^^^^^^^^^ types differ + +error[E0277]: the trait bound `impl !Trait: Trait` is not satisfied + --> $DIR/opaque-type-unsatisfied-bound.rs:12:13 + | +LL | consume(produce()); + | ------- ^^^^^^^^^ the trait `Trait` is not implemented for `impl !Trait` + | | + | required by a bound introduced by this call + | +note: required by a bound in `consume` + --> $DIR/opaque-type-unsatisfied-bound.rs:9:20 + | +LL | fn consume(_: impl Trait) {} + | ^^^^^ required by this bound in `consume` + +error: aborting due to 7 previous errors + +Some errors have detailed explanations: E0271, E0277, E0308. +For more information about an error, try `rustc --explain E0271`. diff --git a/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-fn-bound.rs b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-fn-bound.rs new file mode 100644 index 00000000000..72bca1a8910 --- /dev/null +++ b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-fn-bound.rs @@ -0,0 +1,9 @@ +// compile-flags: -Znext-solver + +#![feature(negative_bounds, unboxed_closures)] + +fn produce() -> impl !Fn<(u32,)> {} +//~^ ERROR mismatched types +//~| ERROR type mismatch resolving `() == impl !Fn<(u32,)>` + +fn main() {} diff --git a/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-fn-bound.stderr b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-fn-bound.stderr new file mode 100644 index 00000000000..a4fb4b2b5c4 --- /dev/null +++ b/tests/ui/traits/negative-bounds/opaque-type-unsatisfied-fn-bound.stderr @@ -0,0 +1,21 @@ +error[E0308]: mismatched types + --> $DIR/opaque-type-unsatisfied-fn-bound.rs:5:34 + | +LL | fn produce() -> impl !Fn<(u32,)> {} + | ---------------- ^^ types differ + | | + | the expected opaque type + | + = note: expected opaque type `impl !Fn<(u32,)>` + found unit type `()` + +error[E0271]: type mismatch resolving `() == impl !Fn<(u32,)>` + --> $DIR/opaque-type-unsatisfied-fn-bound.rs:5:17 + | +LL | fn produce() -> impl !Fn<(u32,)> {} + | ^^^^^^^^^^^^^^^^ types differ + +error: aborting due to 2 previous errors + +Some errors have detailed explanations: E0271, E0308. +For more information about an error, try `rustc --explain E0271`. diff --git a/tests/ui/traits/negative-bounds/simple.rs b/tests/ui/traits/negative-bounds/simple.rs index f6d1d5169c4..a2febf353f6 100644 --- a/tests/ui/traits/negative-bounds/simple.rs +++ b/tests/ui/traits/negative-bounds/simple.rs @@ -1,5 +1,4 @@ #![feature(negative_bounds, negative_impls)] -//~^ WARN the feature `negative_bounds` is incomplete and may not be safe to use and/or cause compiler crashes fn not_copy<T: !Copy>() {} diff --git a/tests/ui/traits/negative-bounds/simple.stderr b/tests/ui/traits/negative-bounds/simple.stderr index a3cab41a2ce..6d750739e19 100644 --- a/tests/ui/traits/negative-bounds/simple.stderr +++ b/tests/ui/traits/negative-bounds/simple.stderr @@ -1,44 +1,36 @@ -warning: the feature `negative_bounds` is incomplete and may not be safe to use and/or cause compiler crashes - --> $DIR/simple.rs:1:12 - | -LL | #![feature(negative_bounds, negative_impls)] - | ^^^^^^^^^^^^^^^ - | - = note: `#[warn(incomplete_features)]` on by default - error[E0277]: the trait bound `T: !Copy` is not satisfied - --> $DIR/simple.rs:11:16 + --> $DIR/simple.rs:10:16 | LL | not_copy::<T>(); | ^ the trait `!Copy` is not implemented for `T` | note: required by a bound in `not_copy` - --> $DIR/simple.rs:4:16 + --> $DIR/simple.rs:3:16 | LL | fn not_copy<T: !Copy>() {} | ^^^^^ required by this bound in `not_copy` error[E0277]: the trait bound `T: !Copy` is not satisfied - --> $DIR/simple.rs:16:16 + --> $DIR/simple.rs:15:16 | LL | not_copy::<T>(); | ^ the trait `!Copy` is not implemented for `T` | note: required by a bound in `not_copy` - --> $DIR/simple.rs:4:16 + --> $DIR/simple.rs:3:16 | LL | fn not_copy<T: !Copy>() {} | ^^^^^ required by this bound in `not_copy` error[E0277]: the trait bound `Copyable: !Copy` is not satisfied - --> $DIR/simple.rs:31:16 + --> $DIR/simple.rs:30:16 | LL | not_copy::<Copyable>(); | ^^^^^^^^ the trait `!Copy` is not implemented for `Copyable` | = help: the trait `Copy` is implemented for `Copyable` note: required by a bound in `not_copy` - --> $DIR/simple.rs:4:16 + --> $DIR/simple.rs:3:16 | LL | fn not_copy<T: !Copy>() {} | ^^^^^ required by this bound in `not_copy` @@ -49,13 +41,13 @@ LL | struct Copyable; | error[E0277]: the trait bound `NotNecessarilyCopyable: !Copy` is not satisfied - --> $DIR/simple.rs:38:16 + --> $DIR/simple.rs:37:16 | LL | not_copy::<NotNecessarilyCopyable>(); | ^^^^^^^^^^^^^^^^^^^^^^ the trait `!Copy` is not implemented for `NotNecessarilyCopyable` | note: required by a bound in `not_copy` - --> $DIR/simple.rs:4:16 + --> $DIR/simple.rs:3:16 | LL | fn not_copy<T: !Copy>() {} | ^^^^^ required by this bound in `not_copy` @@ -65,6 +57,6 @@ LL + #[derive(Copy)] LL | struct NotNecessarilyCopyable; | -error: aborting due to 4 previous errors; 1 warning emitted +error: aborting due to 4 previous errors For more information about this error, try `rustc --explain E0277`. diff --git a/tests/ui/traits/negative-bounds/supertrait.rs b/tests/ui/traits/negative-bounds/supertrait.rs index df0884b8b9f..a66bc4a60a0 100644 --- a/tests/ui/traits/negative-bounds/supertrait.rs +++ b/tests/ui/traits/negative-bounds/supertrait.rs @@ -1,7 +1,6 @@ // check-pass #![feature(negative_bounds)] -//~^ WARN the feature `negative_bounds` is incomplete trait A: !B {} trait B: !A {} diff --git a/tests/ui/traits/negative-bounds/supertrait.stderr b/tests/ui/traits/negative-bounds/supertrait.stderr deleted file mode 100644 index f44753b624e..00000000000 --- a/tests/ui/traits/negative-bounds/supertrait.stderr +++ /dev/null @@ -1,10 +0,0 @@ -warning: the feature `negative_bounds` is incomplete and may not be safe to use and/or cause compiler crashes - --> $DIR/supertrait.rs:3:12 - | -LL | #![feature(negative_bounds)] - | ^^^^^^^^^^^^^^^ - | - = note: `#[warn(incomplete_features)]` on by default - -warning: 1 warning emitted - diff --git a/tests/ui/traits/negative-impls/negated-auto-traits-rpass.rs b/tests/ui/traits/negative-impls/negated-auto-traits-rpass.rs index 0bc611c26ca..05345d3432b 100644 --- a/tests/ui/traits/negative-impls/negated-auto-traits-rpass.rs +++ b/tests/ui/traits/negative-impls/negated-auto-traits-rpass.rs @@ -5,7 +5,7 @@ pub struct WaitToken; impl !Send for WaitToken {} -pub struct Test<T>(#[allow(unused_tuple_struct_fields)] T); +pub struct Test<T>(#[allow(dead_code)] T); unsafe impl<T: 'static> Send for Test<T> {} pub fn spawn<F>(_: F) -> () where F: FnOnce(), F: Send + 'static {} diff --git a/tests/ui/traits/next-solver/specialization-transmute.rs b/tests/ui/traits/next-solver/specialization-transmute.rs index 58b62f52dfd..ff25656a7ff 100644 --- a/tests/ui/traits/next-solver/specialization-transmute.rs +++ b/tests/ui/traits/next-solver/specialization-transmute.rs @@ -4,15 +4,15 @@ //~^ WARN the feature `specialization` is incomplete trait Default { - type Id; + type Id; - fn intu(&self) -> &Self::Id; + fn intu(&self) -> &Self::Id; } impl<T> Default for T { default type Id = T; //~ ERROR type annotations needed // This will be fixed by #111994 - fn intu(&self) -> &Self::Id { //~ ERROR type annotations needed + fn intu(&self) -> &Self::Id { self } } diff --git a/tests/ui/traits/next-solver/specialization-transmute.stderr b/tests/ui/traits/next-solver/specialization-transmute.stderr index eaf32a475ac..a5459165587 100644 --- a/tests/ui/traits/next-solver/specialization-transmute.stderr +++ b/tests/ui/traits/next-solver/specialization-transmute.stderr @@ -8,19 +8,12 @@ LL | #![feature(specialization)] = help: consider using `min_specialization` instead, which is more stable and complete = note: `#[warn(incomplete_features)]` on by default -error[E0284]: type annotations needed: cannot satisfy `<T as Default>::Id normalizes-to _` - --> $DIR/specialization-transmute.rs:15:23 - | -LL | fn intu(&self) -> &Self::Id { - | ^^^^^^^^^ cannot satisfy `<T as Default>::Id normalizes-to _` - error[E0282]: type annotations needed --> $DIR/specialization-transmute.rs:13:23 | LL | default type Id = T; | ^ cannot infer type for associated type `<T as Default>::Id` -error: aborting due to 2 previous errors; 1 warning emitted +error: aborting due to 1 previous error; 1 warning emitted -Some errors have detailed explanations: E0282, E0284. -For more information about an error, try `rustc --explain E0282`. +For more information about this error, try `rustc --explain E0282`. diff --git a/tests/ui/traits/object/exclusion.rs b/tests/ui/traits/object/exclusion.rs index 766dceeaffe..3abd3bbfccf 100644 --- a/tests/ui/traits/object/exclusion.rs +++ b/tests/ui/traits/object/exclusion.rs @@ -8,7 +8,7 @@ trait Future: 'static { } } -struct Map<A>(#[allow(unused_tuple_struct_fields)] A); +struct Map<A>(#[allow(dead_code)] A); impl<A: Future> Future for Map<A> {} pub struct Promise; diff --git a/tests/ui/traits/object/generics.rs b/tests/ui/traits/object/generics.rs index 5a4a6aecc6b..e2e70d43ab8 100644 --- a/tests/ui/traits/object/generics.rs +++ b/tests/ui/traits/object/generics.rs @@ -25,7 +25,7 @@ impl<A1, A2, A3> Impl<A1, A2, A3> { // test for #8601 -enum Type<T> { Constant(#[allow(unused_tuple_struct_fields)] T) } +enum Type<T> { Constant(#[allow(dead_code)] T) } trait Trait<K,V> { fn method(&self, _: Type<(K,V)>) -> isize; diff --git a/tests/ui/traits/pointee-deduction.rs b/tests/ui/traits/pointee-deduction.rs index c333b0129c8..82e3aa1ae89 100644 --- a/tests/ui/traits/pointee-deduction.rs +++ b/tests/ui/traits/pointee-deduction.rs @@ -13,8 +13,8 @@ impl Foo for () { type Bar = (); } -struct Wrapper1<T: Foo>(#[allow(unused_tuple_struct_fields)] <T as Foo>::Bar); -struct Wrapper2<T: Foo>(#[allow(unused_tuple_struct_fields)] <Wrapper1<T> as Pointee>::Metadata); +struct Wrapper1<T: Foo>(#[allow(dead_code)] <T as Foo>::Bar); +struct Wrapper2<T: Foo>(#[allow(dead_code)] <Wrapper1<T> as Pointee>::Metadata); fn main() { let _: Wrapper2<()> = Wrapper2(()); diff --git a/tests/ui/traits/principal-less-objects.rs b/tests/ui/traits/principal-less-objects.rs index 62bad0d7d77..5fe01efa4f8 100644 --- a/tests/ui/traits/principal-less-objects.rs +++ b/tests/ui/traits/principal-less-objects.rs @@ -7,7 +7,7 @@ use std::mem; // Array is to make sure the size is not exactly pointer-size, so // we can be sure we are measuring the right size in the // `size_of_val` test. -struct SetOnDrop<'a>(&'a AtomicUsize, #[allow(unused_tuple_struct_fields)] [u8; 64]); +struct SetOnDrop<'a>(&'a AtomicUsize, #[allow(dead_code)] [u8; 64]); impl<'a> Drop for SetOnDrop<'a> { fn drop(&mut self) { self.0.store(self.0.load(Ordering::Relaxed) + 1, Ordering::Relaxed); diff --git a/tests/ui/traits/safety-fn-body.mir.stderr b/tests/ui/traits/safety-fn-body.mir.stderr deleted file mode 100644 index 9a04f3e7d62..00000000000 --- a/tests/ui/traits/safety-fn-body.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/safety-fn-body.rs:14:9 - | -LL | *self += 1; - | ^^^^^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/traits/safety-fn-body.rs b/tests/ui/traits/safety-fn-body.rs index 2cc4fe1b344..df527747305 100644 --- a/tests/ui/traits/safety-fn-body.rs +++ b/tests/ui/traits/safety-fn-body.rs @@ -1,9 +1,6 @@ // Check that an unsafe impl does not imply that unsafe actions are // legal in the methods. -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - unsafe trait UnsafeTrait : Sized { fn foo(self) { } } diff --git a/tests/ui/traits/safety-fn-body.thir.stderr b/tests/ui/traits/safety-fn-body.stderr index 5d4626c161e..7a8e6c81a22 100644 --- a/tests/ui/traits/safety-fn-body.thir.stderr +++ b/tests/ui/traits/safety-fn-body.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/safety-fn-body.rs:14:9 + --> $DIR/safety-fn-body.rs:11:9 | LL | *self += 1; | ^^^^^ dereference of raw pointer diff --git a/tests/ui/type-alias-enum-variants/enum-variant-generic-args-pass.rs b/tests/ui/type-alias-enum-variants/enum-variant-generic-args-pass.rs index 0aa644db052..d869794ec0a 100644 --- a/tests/ui/type-alias-enum-variants/enum-variant-generic-args-pass.rs +++ b/tests/ui/type-alias-enum-variants/enum-variant-generic-args-pass.rs @@ -9,7 +9,7 @@ #![allow(irrefutable_let_patterns)] -enum Enum<T> { TSVariant(#[allow(unused_tuple_struct_fields)] T), SVariant { _v: T }, UVariant } +enum Enum<T> { TSVariant(#[allow(dead_code)] T), SVariant { _v: T }, UVariant } type Alias<T> = Enum<T>; type AliasFixed = Enum<()>; diff --git a/tests/ui/type-alias-enum-variants/self-in-enum-definition.stderr b/tests/ui/type-alias-enum-variants/self-in-enum-definition.stderr index 404e376e364..94113b336c3 100644 --- a/tests/ui/type-alias-enum-variants/self-in-enum-definition.stderr +++ b/tests/ui/type-alias-enum-variants/self-in-enum-definition.stderr @@ -44,11 +44,6 @@ note: ...which requires preparing `Alpha::V3::{constant#0}` for borrow checking. | LL | V3 = Self::V1 {} as u8 + 2, | ^^^^^^^^^^^^^^^^^^^^^ -note: ...which requires unsafety-checking `Alpha::V3::{constant#0}`... - --> $DIR/self-in-enum-definition.rs:5:10 - | -LL | V3 = Self::V1 {} as u8 + 2, - | ^^^^^^^^^^^^^^^^^^^^^ note: ...which requires building MIR for `Alpha::V3::{constant#0}`... --> $DIR/self-in-enum-definition.rs:5:10 | diff --git a/tests/ui/type-alias-impl-trait/generic_underconstrained.stderr b/tests/ui/type-alias-impl-trait/generic_underconstrained.stderr index 88529b370f1..be9b07823ae 100644 --- a/tests/ui/type-alias-impl-trait/generic_underconstrained.stderr +++ b/tests/ui/type-alias-impl-trait/generic_underconstrained.stderr @@ -1,8 +1,13 @@ error[E0277]: the trait bound `T: Trait` is not satisfied - --> $DIR/generic_underconstrained.rs:9:31 + --> $DIR/generic_underconstrained.rs:9:51 | -LL | fn underconstrain<T>(_: T) -> Underconstrained<T> { - | ^^^^^^^^^^^^^^^^^^^ the trait `Trait` is not implemented for `T` +LL | fn underconstrain<T>(_: T) -> Underconstrained<T> { + | ___________________________________________________^ +LL | | +LL | | +LL | | unimplemented!() +LL | | } + | |_^ the trait `Trait` is not implemented for `T` | note: required by a bound on the type alias `Underconstrained` --> $DIR/generic_underconstrained.rs:6:26 @@ -15,15 +20,10 @@ LL | fn underconstrain<T: Trait>(_: T) -> Underconstrained<T> { | +++++++ error[E0277]: the trait bound `T: Trait` is not satisfied - --> $DIR/generic_underconstrained.rs:9:51 + --> $DIR/generic_underconstrained.rs:9:31 | -LL | fn underconstrain<T>(_: T) -> Underconstrained<T> { - | ___________________________________________________^ -LL | | -LL | | -LL | | unimplemented!() -LL | | } - | |_^ the trait `Trait` is not implemented for `T` +LL | fn underconstrain<T>(_: T) -> Underconstrained<T> { + | ^^^^^^^^^^^^^^^^^^^ the trait `Trait` is not implemented for `T` | note: required by a bound on the type alias `Underconstrained` --> $DIR/generic_underconstrained.rs:6:26 diff --git a/tests/ui/type-alias-impl-trait/generic_underconstrained2.stderr b/tests/ui/type-alias-impl-trait/generic_underconstrained2.stderr index b3b9cbca968..15d96191ba9 100644 --- a/tests/ui/type-alias-impl-trait/generic_underconstrained2.stderr +++ b/tests/ui/type-alias-impl-trait/generic_underconstrained2.stderr @@ -1,8 +1,13 @@ error[E0277]: `U` doesn't implement `Debug` - --> $DIR/generic_underconstrained2.rs:8:33 + --> $DIR/generic_underconstrained2.rs:8:53 | -LL | fn underconstrained<U>(_: U) -> Underconstrained<U> { - | ^^^^^^^^^^^^^^^^^^^ `U` cannot be formatted using `{:?}` because it doesn't implement `Debug` +LL | fn underconstrained<U>(_: U) -> Underconstrained<U> { + | _____________________________________________________^ +LL | | +LL | | +LL | | 5u32 +LL | | } + | |_^ `U` cannot be formatted using `{:?}` because it doesn't implement `Debug` | note: required by a bound on the type alias `Underconstrained` --> $DIR/generic_underconstrained2.rs:5:26 @@ -15,10 +20,15 @@ LL | fn underconstrained<U: std::fmt::Debug>(_: U) -> Underconstrained<U> { | +++++++++++++++++ error[E0277]: `V` doesn't implement `Debug` - --> $DIR/generic_underconstrained2.rs:17:43 + --> $DIR/generic_underconstrained2.rs:17:64 | -LL | fn underconstrained2<U, V>(_: U, _: V) -> Underconstrained2<V> { - | ^^^^^^^^^^^^^^^^^^^^ `V` cannot be formatted using `{:?}` because it doesn't implement `Debug` +LL | fn underconstrained2<U, V>(_: U, _: V) -> Underconstrained2<V> { + | ________________________________________________________________^ +LL | | +LL | | +LL | | 5u32 +LL | | } + | |_^ `V` cannot be formatted using `{:?}` because it doesn't implement `Debug` | note: required by a bound on the type alias `Underconstrained2` --> $DIR/generic_underconstrained2.rs:14:27 @@ -31,15 +41,10 @@ LL | fn underconstrained2<U, V: std::fmt::Debug>(_: U, _: V) -> Underconstrained | +++++++++++++++++ error[E0277]: `U` doesn't implement `Debug` - --> $DIR/generic_underconstrained2.rs:8:53 + --> $DIR/generic_underconstrained2.rs:8:33 | -LL | fn underconstrained<U>(_: U) -> Underconstrained<U> { - | _____________________________________________________^ -LL | | -LL | | -LL | | 5u32 -LL | | } - | |_^ `U` cannot be formatted using `{:?}` because it doesn't implement `Debug` +LL | fn underconstrained<U>(_: U) -> Underconstrained<U> { + | ^^^^^^^^^^^^^^^^^^^ `U` cannot be formatted using `{:?}` because it doesn't implement `Debug` | note: required by a bound on the type alias `Underconstrained` --> $DIR/generic_underconstrained2.rs:5:26 @@ -52,15 +57,10 @@ LL | fn underconstrained<U: std::fmt::Debug>(_: U) -> Underconstrained<U> { | +++++++++++++++++ error[E0277]: `V` doesn't implement `Debug` - --> $DIR/generic_underconstrained2.rs:17:64 + --> $DIR/generic_underconstrained2.rs:17:43 | -LL | fn underconstrained2<U, V>(_: U, _: V) -> Underconstrained2<V> { - | ________________________________________________________________^ -LL | | -LL | | -LL | | 5u32 -LL | | } - | |_^ `V` cannot be formatted using `{:?}` because it doesn't implement `Debug` +LL | fn underconstrained2<U, V>(_: U, _: V) -> Underconstrained2<V> { + | ^^^^^^^^^^^^^^^^^^^^ `V` cannot be formatted using `{:?}` because it doesn't implement `Debug` | note: required by a bound on the type alias `Underconstrained2` --> $DIR/generic_underconstrained2.rs:14:27 diff --git a/tests/ui/type-alias-impl-trait/issue-53092-2.stderr b/tests/ui/type-alias-impl-trait/issue-53092-2.stderr index e4054e14abe..e805a71ea6f 100644 --- a/tests/ui/type-alias-impl-trait/issue-53092-2.stderr +++ b/tests/ui/type-alias-impl-trait/issue-53092-2.stderr @@ -17,17 +17,11 @@ LL | const CONST_BUG: Bug<u8, ()> = unsafe { std::mem::transmute(|_: u8| ()) }; = note: ...which requires computing layout of `Bug<u8, ()>`... = note: ...which requires normalizing `Bug<u8, ()>`... = note: ...which again requires computing type of `Bug::{opaque#0}`, completing the cycle -note: cycle used when checking item types in top-level module - --> $DIR/issue-53092-2.rs:1:1 - | -LL | / #![feature(type_alias_impl_trait)] -LL | | #![allow(dead_code)] -LL | | -LL | | type Bug<T, U> = impl Fn(T) -> U + Copy; -... | -LL | | CONST_BUG(0); -LL | | } - | |_^ +note: cycle used when checking that `Bug::{opaque#0}` is well-formed + --> $DIR/issue-53092-2.rs:4:18 + | +LL | type Bug<T, U> = impl Fn(T) -> U + Copy; + | ^^^^^^^^^^^^^^^^^^^^^^ = note: see https://rustc-dev-guide.rust-lang.org/overview.html#queries and https://rustc-dev-guide.rust-lang.org/query.html for more information error[E0277]: the trait bound `U: From<T>` is not satisfied diff --git a/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.rs b/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.rs index fec0fdc46fb..6a74d1dc4ef 100644 --- a/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.rs +++ b/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.rs @@ -1,8 +1,8 @@ #![feature(type_alias_impl_trait)] -pub type Tait = impl Iterator<Item = (&'db Key, impl Iterator)>; +pub type Tait = impl Iterator<Item = (&'db LocalKey, impl Iterator)>; //~^ ERROR use of undeclared lifetime name `'db` -//~| ERROR cannot find type `Key` in this scope +//~| ERROR cannot find type `LocalKey` in this scope //~| ERROR unconstrained opaque type //~| ERROR unconstrained opaque type diff --git a/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.stderr b/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.stderr index d4aeace4ae7..ca15b134a99 100644 --- a/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.stderr +++ b/tests/ui/type-alias-impl-trait/nested-impl-trait-in-tait.stderr @@ -1,43 +1,43 @@ error[E0261]: use of undeclared lifetime name `'db` --> $DIR/nested-impl-trait-in-tait.rs:3:40 | -LL | pub type Tait = impl Iterator<Item = (&'db Key, impl Iterator)>; +LL | pub type Tait = impl Iterator<Item = (&'db LocalKey, impl Iterator)>; | ^^^ undeclared lifetime | = note: for more information on higher-ranked polymorphism, visit https://doc.rust-lang.org/nomicon/hrtb.html help: consider making the bound lifetime-generic with a new `'db` lifetime | -LL | pub type Tait = impl for<'db> Iterator<Item = (&'db Key, impl Iterator)>; +LL | pub type Tait = impl for<'db> Iterator<Item = (&'db LocalKey, impl Iterator)>; | ++++++++ help: consider introducing lifetime `'db` here | -LL | pub type Tait<'db> = impl Iterator<Item = (&'db Key, impl Iterator)>; +LL | pub type Tait<'db> = impl Iterator<Item = (&'db LocalKey, impl Iterator)>; | +++++ -error[E0412]: cannot find type `Key` in this scope +error[E0412]: cannot find type `LocalKey` in this scope --> $DIR/nested-impl-trait-in-tait.rs:3:44 | -LL | pub type Tait = impl Iterator<Item = (&'db Key, impl Iterator)>; - | ^^^ not found in this scope +LL | pub type Tait = impl Iterator<Item = (&'db LocalKey, impl Iterator)>; + | ^^^^^^^^ not found in this scope | help: consider importing this struct | -LL + use std::thread::local_impl::Key; +LL + use std::thread::LocalKey; | error: unconstrained opaque type --> $DIR/nested-impl-trait-in-tait.rs:3:17 | -LL | pub type Tait = impl Iterator<Item = (&'db Key, impl Iterator)>; - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ +LL | pub type Tait = impl Iterator<Item = (&'db LocalKey, impl Iterator)>; + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ | = note: `Tait` must be used in combination with a concrete type within the same module error: unconstrained opaque type - --> $DIR/nested-impl-trait-in-tait.rs:3:49 + --> $DIR/nested-impl-trait-in-tait.rs:3:54 | -LL | pub type Tait = impl Iterator<Item = (&'db Key, impl Iterator)>; - | ^^^^^^^^^^^^^ +LL | pub type Tait = impl Iterator<Item = (&'db LocalKey, impl Iterator)>; + | ^^^^^^^^^^^^^ | = note: `Tait` must be used in combination with a concrete type within the same module diff --git a/tests/ui/typeck/issue-2063.rs b/tests/ui/typeck/issue-2063.rs index f08f9d4cfe4..b00bbc082af 100644 --- a/tests/ui/typeck/issue-2063.rs +++ b/tests/ui/typeck/issue-2063.rs @@ -3,7 +3,7 @@ // cause compiler to loop. Note that no instances // of such a type could ever be constructed. -struct T(#[allow(unused_tuple_struct_fields)] Box<T>); +struct T(#[allow(dead_code)] Box<T>); trait ToStr2 { fn my_to_string(&self) -> String; diff --git a/tests/ui/ufcs/ufcs-explicit-self-bad.stderr b/tests/ui/ufcs/ufcs-explicit-self-bad.stderr index 4c2cb0eb753..b0e71507a2e 100644 --- a/tests/ui/ufcs/ufcs-explicit-self-bad.stderr +++ b/tests/ui/ufcs/ufcs-explicit-self-bad.stderr @@ -1,3 +1,20 @@ +error[E0053]: method `dummy2` has an incompatible type for trait + --> $DIR/ufcs-explicit-self-bad.rs:37:21 + | +LL | fn dummy2(self: &Bar<T>) {} + | ------^^^^^^^ + | | | + | | expected `&'a Bar<T>`, found `Bar<T>` + | help: change the self-receiver type to match the trait: `&self` + | +note: type in trait + --> $DIR/ufcs-explicit-self-bad.rs:31:15 + | +LL | fn dummy2(&self); + | ^^^^^ + = note: expected signature `fn(&&'a Bar<_>)` + found signature `fn(&Bar<_>)` + error[E0307]: invalid `self` parameter type: isize --> $DIR/ufcs-explicit-self-bad.rs:8:18 | @@ -101,23 +118,6 @@ note: ...does not necessarily outlive the anonymous lifetime defined here LL | fn dummy3(self: &&Bar<T>) {} | ^^^^^^^ -error[E0053]: method `dummy2` has an incompatible type for trait - --> $DIR/ufcs-explicit-self-bad.rs:37:21 - | -LL | fn dummy2(self: &Bar<T>) {} - | ------^^^^^^^ - | | | - | | expected `&'a Bar<T>`, found `Bar<T>` - | help: change the self-receiver type to match the trait: `&self` - | -note: type in trait - --> $DIR/ufcs-explicit-self-bad.rs:31:15 - | -LL | fn dummy2(&self); - | ^^^^^ - = note: expected signature `fn(&&'a Bar<_>)` - found signature `fn(&Bar<_>)` - error: aborting due to 8 previous errors Some errors have detailed explanations: E0053, E0307, E0308. diff --git a/tests/ui/unboxed-closures/type-id-higher-rank.rs b/tests/ui/unboxed-closures/type-id-higher-rank.rs index 1f8aec205fb..a9db71a0399 100644 --- a/tests/ui/unboxed-closures/type-id-higher-rank.rs +++ b/tests/ui/unboxed-closures/type-id-higher-rank.rs @@ -4,7 +4,7 @@ use std::any::{Any, TypeId}; -struct Struct<'a>(#[allow(unused_tuple_struct_fields)] &'a ()); +struct Struct<'a>(#[allow(dead_code)] &'a ()); trait Trait<'a> {} fn main() { diff --git a/tests/ui/union/union-align.rs b/tests/ui/union/union-align.rs index 6a44f27dbb2..67ab10fef4b 100644 --- a/tests/ui/union/union-align.rs +++ b/tests/ui/union/union-align.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] diff --git a/tests/ui/union/union-backcomp.rs b/tests/ui/union/union-backcomp.rs index b19eab9f52b..21b9fc50e1d 100644 --- a/tests/ui/union/union-backcomp.rs +++ b/tests/ui/union/union-backcomp.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(path_statements)] #![allow(dead_code)] diff --git a/tests/ui/union/union-basic.rs b/tests/ui/union/union-basic.rs index dcc552ac75c..1009def7d52 100644 --- a/tests/ui/union/union-basic.rs +++ b/tests/ui/union/union-basic.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(unused_imports)] diff --git a/tests/ui/union/union-borrow-move-parent-sibling.rs b/tests/ui/union/union-borrow-move-parent-sibling.rs index 83781c5e550..5b0b44232e4 100644 --- a/tests/ui/union/union-borrow-move-parent-sibling.rs +++ b/tests/ui/union/union-borrow-move-parent-sibling.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![allow(unused)] use std::ops::{Deref, DerefMut}; diff --git a/tests/ui/union/union-borrow-move-parent-sibling.mirunsafeck.stderr b/tests/ui/union/union-borrow-move-parent-sibling.stderr index 7f931b49a58..c9a440a66cc 100644 --- a/tests/ui/union/union-borrow-move-parent-sibling.mirunsafeck.stderr +++ b/tests/ui/union/union-borrow-move-parent-sibling.stderr @@ -1,5 +1,5 @@ error[E0502]: cannot borrow `u` (via `u.y`) as immutable because it is also borrowed as mutable (via `u.x`) - --> $DIR/union-borrow-move-parent-sibling.rs:56:13 + --> $DIR/union-borrow-move-parent-sibling.rs:53:13 | LL | let a = &mut (*u.x).0; | --- mutable borrow occurs here (via `u.x`) @@ -11,7 +11,7 @@ LL | use_borrow(a); = note: `u.y` is a field of the union `U`, so it overlaps the field `u.x` error[E0507]: cannot move out of dereference of `ManuallyDrop<((MockVec<u8>, MockVec<u8>), MockVec<u8>)>` - --> $DIR/union-borrow-move-parent-sibling.rs:62:13 + --> $DIR/union-borrow-move-parent-sibling.rs:59:13 | LL | let a = u.x.0; | ^^^^^ move occurs because value has type `(MockVec<u8>, MockVec<u8>)`, which does not implement the `Copy` trait @@ -22,7 +22,7 @@ LL | let a = &u.x.0; | + error[E0382]: use of moved value: `u` - --> $DIR/union-borrow-move-parent-sibling.rs:64:13 + --> $DIR/union-borrow-move-parent-sibling.rs:61:13 | LL | let u = U { x: ManuallyDrop::new(((MockVec::new(), MockVec::new()), MockVec::new())) }; | - move occurs because `u` has type `U`, which does not implement the `Copy` trait @@ -33,7 +33,7 @@ LL | let b = u.y; | ^^^ value used here after move error[E0502]: cannot borrow `u` (via `u.y`) as immutable because it is also borrowed as mutable (via `u.x`) - --> $DIR/union-borrow-move-parent-sibling.rs:70:13 + --> $DIR/union-borrow-move-parent-sibling.rs:67:13 | LL | let a = &mut ((*u.x).0).0; | --- mutable borrow occurs here (via `u.x`) @@ -45,7 +45,7 @@ LL | use_borrow(a); = note: `u.y` is a field of the union `U`, so it overlaps the field `u.x` error[E0507]: cannot move out of dereference of `ManuallyDrop<((MockVec<u8>, MockVec<u8>), MockVec<u8>)>` - --> $DIR/union-borrow-move-parent-sibling.rs:76:13 + --> $DIR/union-borrow-move-parent-sibling.rs:73:13 | LL | let a = (u.x.0).0; | ^^^^^^^^^ move occurs because value has type `MockVec<u8>`, which does not implement the `Copy` trait @@ -56,7 +56,7 @@ LL | let a = &(u.x.0).0; | + error[E0382]: use of moved value: `u` - --> $DIR/union-borrow-move-parent-sibling.rs:78:13 + --> $DIR/union-borrow-move-parent-sibling.rs:75:13 | LL | let u = U { x: ManuallyDrop::new(((MockVec::new(), MockVec::new()), MockVec::new())) }; | - move occurs because `u` has type `U`, which does not implement the `Copy` trait @@ -67,7 +67,7 @@ LL | let b = u.y; | ^^^ value used here after move error[E0502]: cannot borrow `u` (via `u.x`) as immutable because it is also borrowed as mutable (via `u.y`) - --> $DIR/union-borrow-move-parent-sibling.rs:84:13 + --> $DIR/union-borrow-move-parent-sibling.rs:81:13 | LL | let a = &mut *u.y; | --- mutable borrow occurs here (via `u.y`) diff --git a/tests/ui/union/union-borrow-move-parent-sibling.thirunsafeck.stderr b/tests/ui/union/union-borrow-move-parent-sibling.thirunsafeck.stderr deleted file mode 100644 index 7f931b49a58..00000000000 --- a/tests/ui/union/union-borrow-move-parent-sibling.thirunsafeck.stderr +++ /dev/null @@ -1,84 +0,0 @@ -error[E0502]: cannot borrow `u` (via `u.y`) as immutable because it is also borrowed as mutable (via `u.x`) - --> $DIR/union-borrow-move-parent-sibling.rs:56:13 - | -LL | let a = &mut (*u.x).0; - | --- mutable borrow occurs here (via `u.x`) -LL | let b = &u.y; - | ^^^^ immutable borrow of `u.y` -- which overlaps with `u.x` -- occurs here -LL | use_borrow(a); - | - mutable borrow later used here - | - = note: `u.y` is a field of the union `U`, so it overlaps the field `u.x` - -error[E0507]: cannot move out of dereference of `ManuallyDrop<((MockVec<u8>, MockVec<u8>), MockVec<u8>)>` - --> $DIR/union-borrow-move-parent-sibling.rs:62:13 - | -LL | let a = u.x.0; - | ^^^^^ move occurs because value has type `(MockVec<u8>, MockVec<u8>)`, which does not implement the `Copy` trait - | -help: consider borrowing here - | -LL | let a = &u.x.0; - | + - -error[E0382]: use of moved value: `u` - --> $DIR/union-borrow-move-parent-sibling.rs:64:13 - | -LL | let u = U { x: ManuallyDrop::new(((MockVec::new(), MockVec::new()), MockVec::new())) }; - | - move occurs because `u` has type `U`, which does not implement the `Copy` trait -LL | let a = u.x.0; -LL | let a = u.x; - | --- value moved here -LL | let b = u.y; - | ^^^ value used here after move - -error[E0502]: cannot borrow `u` (via `u.y`) as immutable because it is also borrowed as mutable (via `u.x`) - --> $DIR/union-borrow-move-parent-sibling.rs:70:13 - | -LL | let a = &mut ((*u.x).0).0; - | --- mutable borrow occurs here (via `u.x`) -LL | let b = &u.y; - | ^^^^ immutable borrow of `u.y` -- which overlaps with `u.x` -- occurs here -LL | use_borrow(a); - | - mutable borrow later used here - | - = note: `u.y` is a field of the union `U`, so it overlaps the field `u.x` - -error[E0507]: cannot move out of dereference of `ManuallyDrop<((MockVec<u8>, MockVec<u8>), MockVec<u8>)>` - --> $DIR/union-borrow-move-parent-sibling.rs:76:13 - | -LL | let a = (u.x.0).0; - | ^^^^^^^^^ move occurs because value has type `MockVec<u8>`, which does not implement the `Copy` trait - | -help: consider borrowing here - | -LL | let a = &(u.x.0).0; - | + - -error[E0382]: use of moved value: `u` - --> $DIR/union-borrow-move-parent-sibling.rs:78:13 - | -LL | let u = U { x: ManuallyDrop::new(((MockVec::new(), MockVec::new()), MockVec::new())) }; - | - move occurs because `u` has type `U`, which does not implement the `Copy` trait -LL | let a = (u.x.0).0; -LL | let a = u.x; - | --- value moved here -LL | let b = u.y; - | ^^^ value used here after move - -error[E0502]: cannot borrow `u` (via `u.x`) as immutable because it is also borrowed as mutable (via `u.y`) - --> $DIR/union-borrow-move-parent-sibling.rs:84:13 - | -LL | let a = &mut *u.y; - | --- mutable borrow occurs here (via `u.y`) -LL | let b = &u.x; - | ^^^^ immutable borrow of `u.x` -- which overlaps with `u.y` -- occurs here -LL | use_borrow(a); - | - mutable borrow later used here - | - = note: `u.x` is a field of the union `U`, so it overlaps the field `u.y` - -error: aborting due to 7 previous errors - -Some errors have detailed explanations: E0382, E0502, E0507. -For more information about an error, try `rustc --explain E0382`. diff --git a/tests/ui/union/union-const-codegen.rs b/tests/ui/union/union-const-codegen.rs index 32a546cf35f..d5b30559595 100644 --- a/tests/ui/union/union-const-codegen.rs +++ b/tests/ui/union/union-const-codegen.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck union U { a: u64, diff --git a/tests/ui/union/union-const-eval-field.rs b/tests/ui/union/union-const-eval-field.rs index ca48785cd9f..15a20899a78 100644 --- a/tests/ui/union/union-const-eval-field.rs +++ b/tests/ui/union/union-const-eval-field.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck type Field1 = (i32, u32); type Field2 = f32; diff --git a/tests/ui/union/union-const-eval.rs b/tests/ui/union/union-const-eval.rs index 32ee4a739ea..70a97795b75 100644 --- a/tests/ui/union/union-const-eval.rs +++ b/tests/ui/union/union-const-eval.rs @@ -1,6 +1,4 @@ // check-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck union U { a: usize, diff --git a/tests/ui/union/union-deref.rs b/tests/ui/union/union-deref.rs index 5aa28d93f96..02f9bf2c413 100644 --- a/tests/ui/union/union-deref.rs +++ b/tests/ui/union/union-deref.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - //! Test the part of RFC 2514 that is about not applying `DerefMut` coercions //! of union fields. diff --git a/tests/ui/union/union-deref.mirunsafeck.stderr b/tests/ui/union/union-deref.stderr index be5e60ab88a..38fce568ae7 100644 --- a/tests/ui/union/union-deref.mirunsafeck.stderr +++ b/tests/ui/union/union-deref.stderr @@ -1,5 +1,5 @@ error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:16:14 + --> $DIR/union-deref.rs:13:14 | LL | unsafe { u.f.0 = Vec::new() }; | ^^^ @@ -8,7 +8,7 @@ LL | unsafe { u.f.0 = Vec::new() }; = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:18:19 + --> $DIR/union-deref.rs:15:19 | LL | unsafe { &mut u.f.0 }; | ^^^ @@ -17,7 +17,7 @@ LL | unsafe { &mut u.f.0 }; = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:20:14 + --> $DIR/union-deref.rs:17:14 | LL | unsafe { u.f.0.push(0) }; | ^^^ @@ -26,7 +26,7 @@ LL | unsafe { u.f.0.push(0) }; = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:24:14 + --> $DIR/union-deref.rs:21:14 | LL | unsafe { u.f.0.0 = Vec::new() }; | ^^^^^ @@ -35,7 +35,7 @@ LL | unsafe { u.f.0.0 = Vec::new() }; = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:26:19 + --> $DIR/union-deref.rs:23:19 | LL | unsafe { &mut u.f.0.0 }; | ^^^^^ @@ -44,7 +44,7 @@ LL | unsafe { &mut u.f.0.0 }; = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:28:14 + --> $DIR/union-deref.rs:25:14 | LL | unsafe { u.f.0.0.push(0) }; | ^^^^^ diff --git a/tests/ui/union/union-deref.thirunsafeck.stderr b/tests/ui/union/union-deref.thirunsafeck.stderr deleted file mode 100644 index be5e60ab88a..00000000000 --- a/tests/ui/union/union-deref.thirunsafeck.stderr +++ /dev/null @@ -1,56 +0,0 @@ -error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:16:14 - | -LL | unsafe { u.f.0 = Vec::new() }; - | ^^^ - | - = help: writing to this reference calls the destructor for the old value - = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor - -error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:18:19 - | -LL | unsafe { &mut u.f.0 }; - | ^^^ - | - = help: writing to this reference calls the destructor for the old value - = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor - -error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:20:14 - | -LL | unsafe { u.f.0.push(0) }; - | ^^^ - | - = help: writing to this reference calls the destructor for the old value - = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor - -error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:24:14 - | -LL | unsafe { u.f.0.0 = Vec::new() }; - | ^^^^^ - | - = help: writing to this reference calls the destructor for the old value - = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor - -error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:26:19 - | -LL | unsafe { &mut u.f.0.0 }; - | ^^^^^ - | - = help: writing to this reference calls the destructor for the old value - = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor - -error: not automatically applying `DerefMut` on `ManuallyDrop` union field - --> $DIR/union-deref.rs:28:14 - | -LL | unsafe { u.f.0.0.push(0) }; - | ^^^^^ - | - = help: writing to this reference calls the destructor for the old value - = help: add an explicit `*` if that is desired, or call `ptr::write` to not run the destructor - -error: aborting due to 6 previous errors - diff --git a/tests/ui/union/union-derive-clone.rs b/tests/ui/union/union-derive-clone.rs index 7aa62146e54..7ab19edb471 100644 --- a/tests/ui/union/union-derive-clone.rs +++ b/tests/ui/union/union-derive-clone.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - use std::mem::ManuallyDrop; #[derive(Clone)] //~ ERROR the trait bound `U1: Copy` is not satisfied diff --git a/tests/ui/union/union-derive-clone.mirunsafeck.stderr b/tests/ui/union/union-derive-clone.stderr index 4d23d230fa3..39f1e32e6eb 100644 --- a/tests/ui/union/union-derive-clone.mirunsafeck.stderr +++ b/tests/ui/union/union-derive-clone.stderr @@ -1,5 +1,5 @@ error[E0277]: the trait bound `U1: Copy` is not satisfied - --> $DIR/union-derive-clone.rs:6:10 + --> $DIR/union-derive-clone.rs:3:10 | LL | #[derive(Clone)] | ^^^^^ the trait `Copy` is not implemented for `U1` @@ -14,7 +14,7 @@ LL | union U1 { | error[E0599]: the method `clone` exists for union `U5<CloneNoCopy>`, but its trait bounds were not satisfied - --> $DIR/union-derive-clone.rs:38:15 + --> $DIR/union-derive-clone.rs:35:15 | LL | union U5<T> { | ----------- @@ -29,7 +29,7 @@ LL | let w = u.clone(); | ^^^^^ method cannot be called on `U5<CloneNoCopy>` due to unsatisfied trait bounds | note: trait bound `CloneNoCopy: Copy` was not satisfied - --> $DIR/union-derive-clone.rs:28:10 + --> $DIR/union-derive-clone.rs:25:10 | LL | #[derive(Clone, Copy)] | ^^^^^ unsatisfied trait bound introduced in this `derive` macro diff --git a/tests/ui/union/union-derive-clone.thirunsafeck.stderr b/tests/ui/union/union-derive-clone.thirunsafeck.stderr deleted file mode 100644 index 4d23d230fa3..00000000000 --- a/tests/ui/union/union-derive-clone.thirunsafeck.stderr +++ /dev/null @@ -1,45 +0,0 @@ -error[E0277]: the trait bound `U1: Copy` is not satisfied - --> $DIR/union-derive-clone.rs:6:10 - | -LL | #[derive(Clone)] - | ^^^^^ the trait `Copy` is not implemented for `U1` - | -note: required by a bound in `AssertParamIsCopy` - --> $SRC_DIR/core/src/clone.rs:LL:COL - = note: this error originates in the derive macro `Clone` (in Nightly builds, run with -Z macro-backtrace for more info) -help: consider annotating `U1` with `#[derive(Copy)]` - | -LL + #[derive(Copy)] -LL | union U1 { - | - -error[E0599]: the method `clone` exists for union `U5<CloneNoCopy>`, but its trait bounds were not satisfied - --> $DIR/union-derive-clone.rs:38:15 - | -LL | union U5<T> { - | ----------- - | | - | method `clone` not found for this union - | doesn't satisfy `U5<CloneNoCopy>: Clone` -... -LL | struct CloneNoCopy; - | ------------------ doesn't satisfy `CloneNoCopy: Copy` -... -LL | let w = u.clone(); - | ^^^^^ method cannot be called on `U5<CloneNoCopy>` due to unsatisfied trait bounds - | -note: trait bound `CloneNoCopy: Copy` was not satisfied - --> $DIR/union-derive-clone.rs:28:10 - | -LL | #[derive(Clone, Copy)] - | ^^^^^ unsatisfied trait bound introduced in this `derive` macro -help: consider annotating `CloneNoCopy` with `#[derive(Clone, Copy)]` - | -LL + #[derive(Clone, Copy)] -LL | struct CloneNoCopy; - | - -error: aborting due to 2 previous errors - -Some errors have detailed explanations: E0277, E0599. -For more information about an error, try `rustc --explain E0277`. diff --git a/tests/ui/union/union-derive-eq.rs b/tests/ui/union/union-derive-eq.rs index b7e7f343f8a..e689f8c27d7 100644 --- a/tests/ui/union/union-derive-eq.rs +++ b/tests/ui/union/union-derive-eq.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #[derive(Eq)] // OK union U1 { a: u8, diff --git a/tests/ui/union/union-derive-eq.mirunsafeck.stderr b/tests/ui/union/union-derive-eq.stderr index 86e7c955d2e..b068edd6d69 100644 --- a/tests/ui/union/union-derive-eq.mirunsafeck.stderr +++ b/tests/ui/union/union-derive-eq.stderr @@ -1,5 +1,5 @@ error[E0277]: the trait bound `PartialEqNotEq: Eq` is not satisfied - --> $DIR/union-derive-eq.rs:16:5 + --> $DIR/union-derive-eq.rs:13:5 | LL | #[derive(Eq)] | -- in this derive macro expansion diff --git a/tests/ui/union/union-derive-eq.thirunsafeck.stderr b/tests/ui/union/union-derive-eq.thirunsafeck.stderr deleted file mode 100644 index 86e7c955d2e..00000000000 --- a/tests/ui/union/union-derive-eq.thirunsafeck.stderr +++ /dev/null @@ -1,21 +0,0 @@ -error[E0277]: the trait bound `PartialEqNotEq: Eq` is not satisfied - --> $DIR/union-derive-eq.rs:16:5 - | -LL | #[derive(Eq)] - | -- in this derive macro expansion -LL | union U2 { -LL | a: PartialEqNotEq, - | ^^^^^^^^^^^^^^^^^ the trait `Eq` is not implemented for `PartialEqNotEq` - | -note: required by a bound in `AssertParamIsEq` - --> $SRC_DIR/core/src/cmp.rs:LL:COL - = note: this error originates in the derive macro `Eq` (in Nightly builds, run with -Z macro-backtrace for more info) -help: consider annotating `PartialEqNotEq` with `#[derive(Eq)]` - | -LL + #[derive(Eq)] -LL | struct PartialEqNotEq; - | - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0277`. diff --git a/tests/ui/union/union-derive-rpass.rs b/tests/ui/union/union-derive-rpass.rs index 8276bc635fc..826b9e5a7c6 100644 --- a/tests/ui/union/union-derive-rpass.rs +++ b/tests/ui/union/union-derive-rpass.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] #![allow(unused_variables)] diff --git a/tests/ui/union/union-drop.rs b/tests/ui/union/union-drop.rs index c3d7d41ca35..41c1e9243f7 100644 --- a/tests/ui/union/union-drop.rs +++ b/tests/ui/union/union-drop.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] #![allow(unused_variables)] diff --git a/tests/ui/union/union-fields-1.mirunsafeck.stderr b/tests/ui/union/union-fields-1.mirunsafeck.stderr deleted file mode 100644 index 0c9981c69fc..00000000000 --- a/tests/ui/union/union-fields-1.mirunsafeck.stderr +++ /dev/null @@ -1,42 +0,0 @@ -error: field `c` is never read - --> $DIR/union-fields-1.rs:9:5 - | -LL | union U1 { - | -- field in this union -... -LL | c: u8, - | ^ - | -note: the lint level is defined here - --> $DIR/union-fields-1.rs:4:9 - | -LL | #![deny(dead_code)] - | ^^^^^^^^^ - -error: field `a` is never read - --> $DIR/union-fields-1.rs:12:5 - | -LL | union U2 { - | -- field in this union -LL | a: u8, - | ^ - -error: field `a` is never read - --> $DIR/union-fields-1.rs:16:20 - | -LL | union NoDropLike { a: u8 } - | ---------- ^ - | | - | field in this union - -error: field `c` is never read - --> $DIR/union-fields-1.rs:21:5 - | -LL | union U { - | - field in this union -... -LL | c: u8, - | ^ - -error: aborting due to 4 previous errors - diff --git a/tests/ui/union/union-fields-1.rs b/tests/ui/union/union-fields-1.rs index cf2ef4c03d6..8ab34b55da2 100644 --- a/tests/ui/union/union-fields-1.rs +++ b/tests/ui/union/union-fields-1.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![deny(dead_code)] union U1 { diff --git a/tests/ui/union/union-fields-1.thirunsafeck.stderr b/tests/ui/union/union-fields-1.stderr index 0c9981c69fc..bba8aae6024 100644 --- a/tests/ui/union/union-fields-1.thirunsafeck.stderr +++ b/tests/ui/union/union-fields-1.stderr @@ -1,5 +1,5 @@ error: field `c` is never read - --> $DIR/union-fields-1.rs:9:5 + --> $DIR/union-fields-1.rs:6:5 | LL | union U1 { | -- field in this union @@ -8,13 +8,13 @@ LL | c: u8, | ^ | note: the lint level is defined here - --> $DIR/union-fields-1.rs:4:9 + --> $DIR/union-fields-1.rs:1:9 | LL | #![deny(dead_code)] | ^^^^^^^^^ error: field `a` is never read - --> $DIR/union-fields-1.rs:12:5 + --> $DIR/union-fields-1.rs:9:5 | LL | union U2 { | -- field in this union @@ -22,7 +22,7 @@ LL | a: u8, | ^ error: field `a` is never read - --> $DIR/union-fields-1.rs:16:20 + --> $DIR/union-fields-1.rs:13:20 | LL | union NoDropLike { a: u8 } | ---------- ^ @@ -30,7 +30,7 @@ LL | union NoDropLike { a: u8 } | field in this union error: field `c` is never read - --> $DIR/union-fields-1.rs:21:5 + --> $DIR/union-fields-1.rs:18:5 | LL | union U { | - field in this union diff --git a/tests/ui/union/union-fields-2.rs b/tests/ui/union/union-fields-2.rs index e738b184703..71b204fcdc5 100644 --- a/tests/ui/union/union-fields-2.rs +++ b/tests/ui/union/union-fields-2.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - union U { a: u8, b: u16, diff --git a/tests/ui/union/union-fields-2.mirunsafeck.stderr b/tests/ui/union/union-fields-2.stderr index 1157f0c2ae7..142186885ca 100644 --- a/tests/ui/union/union-fields-2.mirunsafeck.stderr +++ b/tests/ui/union/union-fields-2.stderr @@ -1,17 +1,17 @@ error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:10:13 + --> $DIR/union-fields-2.rs:7:13 | LL | let u = U {}; | ^ error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:12:13 + --> $DIR/union-fields-2.rs:9:13 | LL | let u = U { a: 0, b: 1 }; | ^ error[E0560]: union `U` has no field named `c` - --> $DIR/union-fields-2.rs:13:29 + --> $DIR/union-fields-2.rs:10:29 | LL | let u = U { a: 0, b: 1, c: 2 }; | ^ `U` does not have this field @@ -19,61 +19,61 @@ LL | let u = U { a: 0, b: 1, c: 2 }; = note: all struct fields are already assigned error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:13:13 + --> $DIR/union-fields-2.rs:10:13 | LL | let u = U { a: 0, b: 1, c: 2 }; | ^ error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:15:13 + --> $DIR/union-fields-2.rs:12:13 | LL | let u = U { ..u }; | ^ error[E0436]: functional record update syntax requires a struct - --> $DIR/union-fields-2.rs:15:19 + --> $DIR/union-fields-2.rs:12:19 | LL | let u = U { ..u }; | ^ error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:18:9 + --> $DIR/union-fields-2.rs:15:9 | LL | let U {} = u; | ^^^^ error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:20:9 + --> $DIR/union-fields-2.rs:17:9 | LL | let U { a, b } = u; | ^^^^^^^^^^ error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:21:9 + --> $DIR/union-fields-2.rs:18:9 | LL | let U { a, b, c } = u; | ^^^^^^^^^^^^^ error[E0026]: union `U` does not have a field named `c` - --> $DIR/union-fields-2.rs:21:19 + --> $DIR/union-fields-2.rs:18:19 | LL | let U { a, b, c } = u; | ^ union `U` does not have this field error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:23:9 + --> $DIR/union-fields-2.rs:20:9 | LL | let U { .. } = u; | ^^^^^^^^ error: `..` cannot be used in union patterns - --> $DIR/union-fields-2.rs:23:9 + --> $DIR/union-fields-2.rs:20:9 | LL | let U { .. } = u; | ^^^^^^^^ error: `..` cannot be used in union patterns - --> $DIR/union-fields-2.rs:25:9 + --> $DIR/union-fields-2.rs:22:9 | LL | let U { a, .. } = u; | ^^^^^^^^^^^ diff --git a/tests/ui/union/union-fields-2.thirunsafeck.stderr b/tests/ui/union/union-fields-2.thirunsafeck.stderr deleted file mode 100644 index 1157f0c2ae7..00000000000 --- a/tests/ui/union/union-fields-2.thirunsafeck.stderr +++ /dev/null @@ -1,84 +0,0 @@ -error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:10:13 - | -LL | let u = U {}; - | ^ - -error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:12:13 - | -LL | let u = U { a: 0, b: 1 }; - | ^ - -error[E0560]: union `U` has no field named `c` - --> $DIR/union-fields-2.rs:13:29 - | -LL | let u = U { a: 0, b: 1, c: 2 }; - | ^ `U` does not have this field - | - = note: all struct fields are already assigned - -error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:13:13 - | -LL | let u = U { a: 0, b: 1, c: 2 }; - | ^ - -error[E0784]: union expressions should have exactly one field - --> $DIR/union-fields-2.rs:15:13 - | -LL | let u = U { ..u }; - | ^ - -error[E0436]: functional record update syntax requires a struct - --> $DIR/union-fields-2.rs:15:19 - | -LL | let u = U { ..u }; - | ^ - -error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:18:9 - | -LL | let U {} = u; - | ^^^^ - -error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:20:9 - | -LL | let U { a, b } = u; - | ^^^^^^^^^^ - -error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:21:9 - | -LL | let U { a, b, c } = u; - | ^^^^^^^^^^^^^ - -error[E0026]: union `U` does not have a field named `c` - --> $DIR/union-fields-2.rs:21:19 - | -LL | let U { a, b, c } = u; - | ^ union `U` does not have this field - -error: union patterns should have exactly one field - --> $DIR/union-fields-2.rs:23:9 - | -LL | let U { .. } = u; - | ^^^^^^^^ - -error: `..` cannot be used in union patterns - --> $DIR/union-fields-2.rs:23:9 - | -LL | let U { .. } = u; - | ^^^^^^^^ - -error: `..` cannot be used in union patterns - --> $DIR/union-fields-2.rs:25:9 - | -LL | let U { a, .. } = u; - | ^^^^^^^^^^^ - -error: aborting due to 13 previous errors - -Some errors have detailed explanations: E0026, E0436, E0560, E0784. -For more information about an error, try `rustc --explain E0026`. diff --git a/tests/ui/union/union-generic-rpass.rs b/tests/ui/union/union-generic-rpass.rs index 25f1f5050f9..69837f31cab 100644 --- a/tests/ui/union/union-generic-rpass.rs +++ b/tests/ui/union/union-generic-rpass.rs @@ -1,7 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![allow(dead_code)] use std::mem::ManuallyDrop; diff --git a/tests/ui/union/union-generic.rs b/tests/ui/union/union-generic.rs index 3d68ecb87d8..ff877892579 100644 --- a/tests/ui/union/union-generic.rs +++ b/tests/ui/union/union-generic.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - use std::rc::Rc; union U<T: Copy> { diff --git a/tests/ui/union/union-generic.mirunsafeck.stderr b/tests/ui/union/union-generic.stderr index 037022a91fc..b9d4aee787e 100644 --- a/tests/ui/union/union-generic.mirunsafeck.stderr +++ b/tests/ui/union/union-generic.stderr @@ -1,23 +1,23 @@ error[E0277]: the trait bound `Rc<u32>: Copy` is not satisfied - --> $DIR/union-generic.rs:11:13 + --> $DIR/union-generic.rs:8:13 | LL | let u = U { a: Rc::new(0u32) }; | ^ the trait `Copy` is not implemented for `Rc<u32>` | note: required by a bound in `U` - --> $DIR/union-generic.rs:6:12 + --> $DIR/union-generic.rs:3:12 | LL | union U<T: Copy> { | ^^^^ required by this bound in `U` error[E0277]: the trait bound `Rc<u32>: Copy` is not satisfied - --> $DIR/union-generic.rs:13:17 + --> $DIR/union-generic.rs:10:17 | LL | let u = U::<Rc<u32>> { a: Default::default() }; | ^^^^^^^ the trait `Copy` is not implemented for `Rc<u32>` | note: required by a bound in `U` - --> $DIR/union-generic.rs:6:12 + --> $DIR/union-generic.rs:3:12 | LL | union U<T: Copy> { | ^^^^ required by this bound in `U` diff --git a/tests/ui/union/union-generic.thirunsafeck.stderr b/tests/ui/union/union-generic.thirunsafeck.stderr deleted file mode 100644 index 037022a91fc..00000000000 --- a/tests/ui/union/union-generic.thirunsafeck.stderr +++ /dev/null @@ -1,27 +0,0 @@ -error[E0277]: the trait bound `Rc<u32>: Copy` is not satisfied - --> $DIR/union-generic.rs:11:13 - | -LL | let u = U { a: Rc::new(0u32) }; - | ^ the trait `Copy` is not implemented for `Rc<u32>` - | -note: required by a bound in `U` - --> $DIR/union-generic.rs:6:12 - | -LL | union U<T: Copy> { - | ^^^^ required by this bound in `U` - -error[E0277]: the trait bound `Rc<u32>: Copy` is not satisfied - --> $DIR/union-generic.rs:13:17 - | -LL | let u = U::<Rc<u32>> { a: Default::default() }; - | ^^^^^^^ the trait `Copy` is not implemented for `Rc<u32>` - | -note: required by a bound in `U` - --> $DIR/union-generic.rs:6:12 - | -LL | union U<T: Copy> { - | ^^^^ required by this bound in `U` - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0277`. diff --git a/tests/ui/union/union-inherent-method.rs b/tests/ui/union/union-inherent-method.rs index b0fd22da73a..2e75cce7b10 100644 --- a/tests/ui/union/union-inherent-method.rs +++ b/tests/ui/union/union-inherent-method.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck union U { a: u8, diff --git a/tests/ui/union/union-lint-dead-code.rs b/tests/ui/union/union-lint-dead-code.rs index 65aaf0a1d35..cb2cdd4dba0 100644 --- a/tests/ui/union/union-lint-dead-code.rs +++ b/tests/ui/union/union-lint-dead-code.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![deny(dead_code)] union Foo { diff --git a/tests/ui/union/union-lint-dead-code.mirunsafeck.stderr b/tests/ui/union/union-lint-dead-code.stderr index 8a3677d525d..691a5e19ae6 100644 --- a/tests/ui/union/union-lint-dead-code.mirunsafeck.stderr +++ b/tests/ui/union/union-lint-dead-code.stderr @@ -1,5 +1,5 @@ error: field `b` is never read - --> $DIR/union-lint-dead-code.rs:8:5 + --> $DIR/union-lint-dead-code.rs:5:5 | LL | union Foo { | --- field in this union @@ -8,7 +8,7 @@ LL | b: bool, | ^ | note: the lint level is defined here - --> $DIR/union-lint-dead-code.rs:4:9 + --> $DIR/union-lint-dead-code.rs:1:9 | LL | #![deny(dead_code)] | ^^^^^^^^^ diff --git a/tests/ui/union/union-lint-dead-code.thirunsafeck.stderr b/tests/ui/union/union-lint-dead-code.thirunsafeck.stderr deleted file mode 100644 index 8a3677d525d..00000000000 --- a/tests/ui/union/union-lint-dead-code.thirunsafeck.stderr +++ /dev/null @@ -1,17 +0,0 @@ -error: field `b` is never read - --> $DIR/union-lint-dead-code.rs:8:5 - | -LL | union Foo { - | --- field in this union -LL | x: usize, -LL | b: bool, - | ^ - | -note: the lint level is defined here - --> $DIR/union-lint-dead-code.rs:4:9 - | -LL | #![deny(dead_code)] - | ^^^^^^^^^ - -error: aborting due to 1 previous error - diff --git a/tests/ui/union/union-macro.rs b/tests/ui/union/union-macro.rs index 7fd9d8221c6..5ca013a44cd 100644 --- a/tests/ui/union/union-macro.rs +++ b/tests/ui/union/union-macro.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(unused_variables)] diff --git a/tests/ui/union/union-manuallydrop-rpass.rs b/tests/ui/union/union-manuallydrop-rpass.rs index 826bdf07cef..ba99e7441e6 100644 --- a/tests/ui/union/union-manuallydrop-rpass.rs +++ b/tests/ui/union/union-manuallydrop-rpass.rs @@ -1,7 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![allow(dead_code)] use std::mem::needs_drop; @@ -28,9 +25,9 @@ union UnionOk3<T: Copy> { value: T, } -trait Foo { } +trait Foo {} -trait ImpliesCopy : Copy { } +trait ImpliesCopy: Copy {} #[allow(dead_code)] union UnionOk4<T: ImpliesCopy> { diff --git a/tests/ui/union/union-move.rs b/tests/ui/union/union-move.rs index b8b1ac8046a..76220a7d40a 100644 --- a/tests/ui/union/union-move.rs +++ b/tests/ui/union/union-move.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - //! Test the behavior of moving out of non-`Copy` union fields. //! Avoid types that `Drop`, we want to focus on moving. diff --git a/tests/ui/union/union-move.mirunsafeck.stderr b/tests/ui/union/union-move.stderr index 6381ae874ba..47fb801a50e 100644 --- a/tests/ui/union/union-move.mirunsafeck.stderr +++ b/tests/ui/union/union-move.stderr @@ -1,5 +1,5 @@ error[E0382]: use of moved value: `x` - --> $DIR/union-move.rs:29:18 + --> $DIR/union-move.rs:26:18 | LL | fn test1(x: U1) { | - move occurs because `x` has type `U1`, which does not implement the `Copy` trait @@ -10,7 +10,7 @@ LL | move_out(x.f2_nocopy); | ^^^^^^^^^^^ value used here after move | note: consider changing this parameter type in function `move_out` to borrow instead if owning the value isn't necessary - --> $DIR/union-move.rs:10:19 + --> $DIR/union-move.rs:7:19 | LL | fn move_out<T>(x: T) {} | -------- ^ this parameter takes ownership of the value @@ -18,7 +18,7 @@ LL | fn move_out<T>(x: T) {} | in this function error[E0382]: use of moved value: `x` - --> $DIR/union-move.rs:45:18 + --> $DIR/union-move.rs:42:18 | LL | fn test3(x: U1) { | - move occurs because `x` has type `U1`, which does not implement the `Copy` trait @@ -29,7 +29,7 @@ LL | move_out(x.f3_copy); | ^^^^^^^^^ value used here after move | note: consider changing this parameter type in function `move_out` to borrow instead if owning the value isn't necessary - --> $DIR/union-move.rs:10:19 + --> $DIR/union-move.rs:7:19 | LL | fn move_out<T>(x: T) {} | -------- ^ this parameter takes ownership of the value @@ -37,7 +37,7 @@ LL | fn move_out<T>(x: T) {} | in this function error[E0509]: cannot move out of type `U2`, which implements the `Drop` trait - --> $DIR/union-move.rs:52:18 + --> $DIR/union-move.rs:49:18 | LL | move_out(x.f1_nocopy); | ^^^^^^^^^^^ diff --git a/tests/ui/union/union-move.thirunsafeck.stderr b/tests/ui/union/union-move.thirunsafeck.stderr deleted file mode 100644 index 6381ae874ba..00000000000 --- a/tests/ui/union/union-move.thirunsafeck.stderr +++ /dev/null @@ -1,51 +0,0 @@ -error[E0382]: use of moved value: `x` - --> $DIR/union-move.rs:29:18 - | -LL | fn test1(x: U1) { - | - move occurs because `x` has type `U1`, which does not implement the `Copy` trait -... -LL | move_out(x.f1_nocopy); - | ----------- value moved here -LL | move_out(x.f2_nocopy); - | ^^^^^^^^^^^ value used here after move - | -note: consider changing this parameter type in function `move_out` to borrow instead if owning the value isn't necessary - --> $DIR/union-move.rs:10:19 - | -LL | fn move_out<T>(x: T) {} - | -------- ^ this parameter takes ownership of the value - | | - | in this function - -error[E0382]: use of moved value: `x` - --> $DIR/union-move.rs:45:18 - | -LL | fn test3(x: U1) { - | - move occurs because `x` has type `U1`, which does not implement the `Copy` trait -... -LL | move_out(x.f2_nocopy); - | ----------- value moved here -LL | move_out(x.f3_copy); - | ^^^^^^^^^ value used here after move - | -note: consider changing this parameter type in function `move_out` to borrow instead if owning the value isn't necessary - --> $DIR/union-move.rs:10:19 - | -LL | fn move_out<T>(x: T) {} - | -------- ^ this parameter takes ownership of the value - | | - | in this function - -error[E0509]: cannot move out of type `U2`, which implements the `Drop` trait - --> $DIR/union-move.rs:52:18 - | -LL | move_out(x.f1_nocopy); - | ^^^^^^^^^^^ - | | - | cannot move out of here - | move occurs because `x.f1_nocopy` has type `ManuallyDrop<RefCell<i32>>`, which does not implement the `Copy` trait - -error: aborting due to 3 previous errors - -Some errors have detailed explanations: E0382, E0509. -For more information about an error, try `rustc --explain E0382`. diff --git a/tests/ui/union/union-nodrop.rs b/tests/ui/union/union-nodrop.rs index 6e6b105a73e..7ce17a7c825 100644 --- a/tests/ui/union/union-nodrop.rs +++ b/tests/ui/union/union-nodrop.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] @@ -19,10 +17,14 @@ static X: () = (NoDrop { inner: ManuallyDrop::new(NeedDrop) }, ()).1; const Y: () = (NoDrop { inner: ManuallyDrop::new(NeedDrop) }, ()).1; -const fn _f() { (NoDrop { inner: ManuallyDrop::new(NeedDrop) }, ()).1 } +const fn _f() { + (NoDrop { inner: ManuallyDrop::new(NeedDrop) }, ()).1 +} // A union that scrubs the drop glue from its inner type -union NoDrop<T> { inner: ManuallyDrop<T> } +union NoDrop<T> { + inner: ManuallyDrop<T>, +} // Copy currently can't be implemented on drop-containing unions, // this may change later @@ -35,7 +37,7 @@ union NoDrop<T> { inner: ManuallyDrop<T> } // // We should be able to implement Copy for things using NoDrop // #[derive(Copy, Clone)] struct Foo { - x: NoDrop<Box<u8>> + x: NoDrop<Box<u8>>, } struct Baz { @@ -43,7 +45,9 @@ struct Baz { y: Box<u8>, } -union ActuallyDrop<T> { inner: ManuallyDrop<T> } +union ActuallyDrop<T> { + inner: ManuallyDrop<T>, +} impl<T> Drop for ActuallyDrop<T> { fn drop(&mut self) {} diff --git a/tests/ui/union/union-nonzero.rs b/tests/ui/union/union-nonzero.rs index 3f4f7ea1c10..e7ab4ebe323 100644 --- a/tests/ui/union/union-nonzero.rs +++ b/tests/ui/union/union-nonzero.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] diff --git a/tests/ui/union/union-overwrite.rs b/tests/ui/union/union-overwrite.rs index 0eea14d9de0..399ed9ae458 100644 --- a/tests/ui/union/union-overwrite.rs +++ b/tests/ui/union/union-overwrite.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #[repr(C)] #[derive(Copy, Clone)] diff --git a/tests/ui/union/union-packed.rs b/tests/ui/union/union-packed.rs index 9c6398bf5aa..538c337a773 100644 --- a/tests/ui/union/union-packed.rs +++ b/tests/ui/union/union-packed.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] #![allow(non_snake_case)] diff --git a/tests/ui/union/union-pat-refutability.rs b/tests/ui/union/union-pat-refutability.rs index d628a200a07..17ac6c6dfa9 100644 --- a/tests/ui/union/union-pat-refutability.rs +++ b/tests/ui/union/union-pat-refutability.rs @@ -1,12 +1,13 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(dead_code)] #![allow(illegal_floating_point_literal_pattern)] #[repr(u32)] -enum Tag { I, F } +enum Tag { + I, + F, +} #[repr(C)] union U { diff --git a/tests/ui/union/union-suggest-field.rs b/tests/ui/union/union-suggest-field.rs index 601a22a0600..71b93e873c2 100644 --- a/tests/ui/union/union-suggest-field.rs +++ b/tests/ui/union/union-suggest-field.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - union U { principal: u8, } diff --git a/tests/ui/union/union-suggest-field.mirunsafeck.stderr b/tests/ui/union/union-suggest-field.stderr index efe4987bd02..5c428cf6c89 100644 --- a/tests/ui/union/union-suggest-field.mirunsafeck.stderr +++ b/tests/ui/union/union-suggest-field.stderr @@ -1,5 +1,5 @@ error[E0560]: union `U` has no field named `principle` - --> $DIR/union-suggest-field.rs:13:17 + --> $DIR/union-suggest-field.rs:10:17 | LL | let u = U { principle: 0 }; | ^^^^^^^^^ unknown field @@ -10,7 +10,7 @@ LL | let u = U { principal: 0 }; | ~~~~~~~~~ error[E0609]: no field `principial` on type `U` - --> $DIR/union-suggest-field.rs:17:15 + --> $DIR/union-suggest-field.rs:14:15 | LL | let w = u.principial; | ^^^^^^^^^^ unknown field @@ -21,7 +21,7 @@ LL | let w = u.principal; | ~~~~~~~~~ error[E0615]: attempted to take value of method `calculate` on type `U` - --> $DIR/union-suggest-field.rs:21:15 + --> $DIR/union-suggest-field.rs:18:15 | LL | let y = u.calculate; | ^^^^^^^^^ method, not a field diff --git a/tests/ui/union/union-suggest-field.thirunsafeck.stderr b/tests/ui/union/union-suggest-field.thirunsafeck.stderr deleted file mode 100644 index efe4987bd02..00000000000 --- a/tests/ui/union/union-suggest-field.thirunsafeck.stderr +++ /dev/null @@ -1,37 +0,0 @@ -error[E0560]: union `U` has no field named `principle` - --> $DIR/union-suggest-field.rs:13:17 - | -LL | let u = U { principle: 0 }; - | ^^^^^^^^^ unknown field - | -help: a field with a similar name exists - | -LL | let u = U { principal: 0 }; - | ~~~~~~~~~ - -error[E0609]: no field `principial` on type `U` - --> $DIR/union-suggest-field.rs:17:15 - | -LL | let w = u.principial; - | ^^^^^^^^^^ unknown field - | -help: a field with a similar name exists - | -LL | let w = u.principal; - | ~~~~~~~~~ - -error[E0615]: attempted to take value of method `calculate` on type `U` - --> $DIR/union-suggest-field.rs:21:15 - | -LL | let y = u.calculate; - | ^^^^^^^^^ method, not a field - | -help: use parentheses to call the method - | -LL | let y = u.calculate(); - | ++ - -error: aborting due to 3 previous errors - -Some errors have detailed explanations: E0560, E0609, E0615. -For more information about an error, try `rustc --explain E0560`. diff --git a/tests/ui/union/union-trait-impl.rs b/tests/ui/union/union-trait-impl.rs index 6134e91f31e..8a7ac817240 100644 --- a/tests/ui/union/union-trait-impl.rs +++ b/tests/ui/union/union-trait-impl.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck use std::fmt; diff --git a/tests/ui/union/union-transmute.rs b/tests/ui/union/union-transmute.rs index 1a3b32d55f3..be8062f6276 100644 --- a/tests/ui/union/union-transmute.rs +++ b/tests/ui/union/union-transmute.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck union U { a: (u8, u8), diff --git a/tests/ui/union/union-unsafe.mir.stderr b/tests/ui/union/union-unsafe.mir.stderr deleted file mode 100644 index 15f059ffa48..00000000000 --- a/tests/ui/union/union-unsafe.mir.stderr +++ /dev/null @@ -1,83 +0,0 @@ -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:34:5 - | -LL | *(u.p) = 13; - | ^^^^^^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:47:6 - | -LL | *u3.a = T::default(); - | ^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:53:6 - | -LL | *u3.a = T::default(); - | ^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:61:13 - | -LL | let a = u1.a; - | ^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:64:14 - | -LL | let U1 { a } = u1; - | ^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:65:12 - | -LL | if let U1 { a: 12 } = u1 {} - | ^^^^^^^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:66:12 - | -LL | if let Some(U1 { a: 13 }) = Some(u1) {} - | ^^^^^^^^^^^^^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:71:6 - | -LL | *u2.a = String::from("new"); - | ^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:75:6 - | -LL | *u3.a = 1; - | ^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:79:6 - | -LL | *u3.a = String::from("new"); - | ^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error: aborting due to 10 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/union/union-unsafe.rs b/tests/ui/union/union-unsafe.rs index d1465486f77..bd3946686be 100644 --- a/tests/ui/union/union-unsafe.rs +++ b/tests/ui/union/union-unsafe.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - use std::cell::RefCell; use std::mem::ManuallyDrop; @@ -35,7 +32,6 @@ fn deref_union_field(mut u: URef) { } fn assign_noncopy_union_field(mut u: URefCell) { - // FIXME(thir-unsafeck) u.a = (ManuallyDrop::new(RefCell::new(0)), 1); // OK (assignment does not drop) u.a.0 = ManuallyDrop::new(RefCell::new(0)); // OK (assignment does not drop) u.a.1 = 1; // OK diff --git a/tests/ui/union/union-unsafe.thir.stderr b/tests/ui/union/union-unsafe.stderr index 9ce835497c5..82b3f897167 100644 --- a/tests/ui/union/union-unsafe.thir.stderr +++ b/tests/ui/union/union-unsafe.stderr @@ -1,5 +1,5 @@ error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:34:6 + --> $DIR/union-unsafe.rs:31:6 | LL | *(u.p) = 13; | ^^^^^ access to union field @@ -7,7 +7,7 @@ LL | *(u.p) = 13; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:47:6 + --> $DIR/union-unsafe.rs:43:6 | LL | *u3.a = T::default(); | ^^^^ access to union field @@ -15,7 +15,7 @@ LL | *u3.a = T::default(); = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:53:6 + --> $DIR/union-unsafe.rs:49:6 | LL | *u3.a = T::default(); | ^^^^ access to union field @@ -23,7 +23,7 @@ LL | *u3.a = T::default(); = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:61:13 + --> $DIR/union-unsafe.rs:57:13 | LL | let a = u1.a; | ^^^^ access to union field @@ -31,7 +31,7 @@ LL | let a = u1.a; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:64:14 + --> $DIR/union-unsafe.rs:60:14 | LL | let U1 { a } = u1; | ^ access to union field @@ -39,7 +39,7 @@ LL | let U1 { a } = u1; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:65:20 + --> $DIR/union-unsafe.rs:61:20 | LL | if let U1 { a: 12 } = u1 {} | ^^ access to union field @@ -47,7 +47,7 @@ LL | if let U1 { a: 12 } = u1 {} = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:66:25 + --> $DIR/union-unsafe.rs:62:25 | LL | if let Some(U1 { a: 13 }) = Some(u1) {} | ^^ access to union field @@ -55,7 +55,7 @@ LL | if let Some(U1 { a: 13 }) = Some(u1) {} = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:71:6 + --> $DIR/union-unsafe.rs:67:6 | LL | *u2.a = String::from("new"); | ^^^^ access to union field @@ -63,7 +63,7 @@ LL | *u2.a = String::from("new"); = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:75:6 + --> $DIR/union-unsafe.rs:71:6 | LL | *u3.a = 1; | ^^^^ access to union field @@ -71,7 +71,7 @@ LL | *u3.a = 1; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-unsafe.rs:79:6 + --> $DIR/union-unsafe.rs:75:6 | LL | *u3.a = String::from("new"); | ^^^^ access to union field diff --git a/tests/ui/union/union-unsized.rs b/tests/ui/union/union-unsized.rs index b95b2e414f3..5dd32192ab9 100644 --- a/tests/ui/union/union-unsized.rs +++ b/tests/ui/union/union-unsized.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - union U { a: str, //~^ ERROR the size for values of type diff --git a/tests/ui/union/union-unsized.mirunsafeck.stderr b/tests/ui/union/union-unsized.stderr index f8da20413b2..851ad8939d4 100644 --- a/tests/ui/union/union-unsized.mirunsafeck.stderr +++ b/tests/ui/union/union-unsized.stderr @@ -1,5 +1,5 @@ error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/union-unsized.rs:5:8 + --> $DIR/union-unsized.rs:2:8 | LL | a: str, | ^^^ doesn't have a size known at compile-time @@ -16,8 +16,20 @@ help: the `Box` type always has a statically known size and allocates its conten LL | a: Box<str>, | ++++ + +error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union + --> $DIR/union-unsized.rs:2:5 + | +LL | a: str, + | ^^^^^^ + | + = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` +help: wrap the field type in `ManuallyDrop<...>` + | +LL | a: std::mem::ManuallyDrop<str>, + | +++++++++++++++++++++++ + + error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/union-unsized.rs:14:8 + --> $DIR/union-unsized.rs:11:8 | LL | b: str, | ^^^ doesn't have a size known at compile-time @@ -35,19 +47,7 @@ LL | b: Box<str>, | ++++ + error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-unsized.rs:5:5 - | -LL | a: str, - | ^^^^^^ - | - = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` -help: wrap the field type in `ManuallyDrop<...>` - | -LL | a: std::mem::ManuallyDrop<str>, - | +++++++++++++++++++++++ + - -error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-unsized.rs:14:5 + --> $DIR/union-unsized.rs:11:5 | LL | b: str, | ^^^^^^ diff --git a/tests/ui/union/union-unsized.thirunsafeck.stderr b/tests/ui/union/union-unsized.thirunsafeck.stderr deleted file mode 100644 index f8da20413b2..00000000000 --- a/tests/ui/union/union-unsized.thirunsafeck.stderr +++ /dev/null @@ -1,64 +0,0 @@ -error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/union-unsized.rs:5:8 - | -LL | a: str, - | ^^^ doesn't have a size known at compile-time - | - = help: the trait `Sized` is not implemented for `str` - = note: no field of a union may have a dynamically sized type - = help: change the field's type to have a statically known size -help: borrowed types always have a statically known size - | -LL | a: &str, - | + -help: the `Box` type always has a statically known size and allocates its contents in the heap - | -LL | a: Box<str>, - | ++++ + - -error[E0277]: the size for values of type `str` cannot be known at compilation time - --> $DIR/union-unsized.rs:14:8 - | -LL | b: str, - | ^^^ doesn't have a size known at compile-time - | - = help: the trait `Sized` is not implemented for `str` - = note: no field of a union may have a dynamically sized type - = help: change the field's type to have a statically known size -help: borrowed types always have a statically known size - | -LL | b: &str, - | + -help: the `Box` type always has a statically known size and allocates its contents in the heap - | -LL | b: Box<str>, - | ++++ + - -error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-unsized.rs:5:5 - | -LL | a: str, - | ^^^^^^ - | - = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` -help: wrap the field type in `ManuallyDrop<...>` - | -LL | a: std::mem::ManuallyDrop<str>, - | +++++++++++++++++++++++ + - -error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-unsized.rs:14:5 - | -LL | b: str, - | ^^^^^^ - | - = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` -help: wrap the field type in `ManuallyDrop<...>` - | -LL | b: std::mem::ManuallyDrop<str>, - | +++++++++++++++++++++++ + - -error: aborting due to 4 previous errors - -Some errors have detailed explanations: E0277, E0740. -For more information about an error, try `rustc --explain E0277`. diff --git a/tests/ui/union/union-with-drop-fields.rs b/tests/ui/union/union-with-drop-fields.rs index 9720830fb1f..ae147e9bd2b 100644 --- a/tests/ui/union/union-with-drop-fields.rs +++ b/tests/ui/union/union-with-drop-fields.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![allow(dead_code)] union U { diff --git a/tests/ui/union/union-with-drop-fields.mirunsafeck.stderr b/tests/ui/union/union-with-drop-fields.stderr index 9861a21cb3d..6328be56540 100644 --- a/tests/ui/union/union-with-drop-fields.mirunsafeck.stderr +++ b/tests/ui/union/union-with-drop-fields.stderr @@ -1,5 +1,5 @@ error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-with-drop-fields.rs:11:5 + --> $DIR/union-with-drop-fields.rs:8:5 | LL | a: String, | ^^^^^^^^^ @@ -11,7 +11,7 @@ LL | a: std::mem::ManuallyDrop<String>, | +++++++++++++++++++++++ + error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-with-drop-fields.rs:19:5 + --> $DIR/union-with-drop-fields.rs:16:5 | LL | a: S, | ^^^^ @@ -23,7 +23,7 @@ LL | a: std::mem::ManuallyDrop<S>, | +++++++++++++++++++++++ + error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-with-drop-fields.rs:24:5 + --> $DIR/union-with-drop-fields.rs:21:5 | LL | a: T, | ^^^^ diff --git a/tests/ui/union/union-with-drop-fields.thirunsafeck.stderr b/tests/ui/union/union-with-drop-fields.thirunsafeck.stderr deleted file mode 100644 index 9861a21cb3d..00000000000 --- a/tests/ui/union/union-with-drop-fields.thirunsafeck.stderr +++ /dev/null @@ -1,39 +0,0 @@ -error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-with-drop-fields.rs:11:5 - | -LL | a: String, - | ^^^^^^^^^ - | - = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` -help: wrap the field type in `ManuallyDrop<...>` - | -LL | a: std::mem::ManuallyDrop<String>, - | +++++++++++++++++++++++ + - -error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-with-drop-fields.rs:19:5 - | -LL | a: S, - | ^^^^ - | - = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` -help: wrap the field type in `ManuallyDrop<...>` - | -LL | a: std::mem::ManuallyDrop<S>, - | +++++++++++++++++++++++ + - -error[E0740]: field must implement `Copy` or be wrapped in `ManuallyDrop<...>` to be used in a union - --> $DIR/union-with-drop-fields.rs:24:5 - | -LL | a: T, - | ^^^^ - | - = note: union fields must not have drop side-effects, which is currently enforced via either `Copy` or `ManuallyDrop<...>` -help: wrap the field type in `ManuallyDrop<...>` - | -LL | a: std::mem::ManuallyDrop<T>, - | +++++++++++++++++++++++ + - -error: aborting due to 3 previous errors - -For more information about this error, try `rustc --explain E0740`. diff --git a/tests/ui/unsafe/access_union_field.mir.stderr b/tests/ui/unsafe/access_union_field.mir.stderr deleted file mode 100644 index 98bc4077793..00000000000 --- a/tests/ui/unsafe/access_union_field.mir.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/access_union_field.rs:13:13 - | -LL | let a = foo.bar; - | ^^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/access_union_field.rs:14:13 - | -LL | let b = foo.baz; - | ^^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/access_union_field.rs b/tests/ui/unsafe/access_union_field.rs index 5c4e695df58..4183119725e 100644 --- a/tests/ui/unsafe/access_union_field.rs +++ b/tests/ui/unsafe/access_union_field.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![allow(unused_variables)] union Foo { diff --git a/tests/ui/unsafe/access_union_field.thir.stderr b/tests/ui/unsafe/access_union_field.stderr index 98bc4077793..4c46bb44a1d 100644 --- a/tests/ui/unsafe/access_union_field.thir.stderr +++ b/tests/ui/unsafe/access_union_field.stderr @@ -1,5 +1,5 @@ error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/access_union_field.rs:13:13 + --> $DIR/access_union_field.rs:10:13 | LL | let a = foo.bar; | ^^^^^^^ access to union field @@ -7,7 +7,7 @@ LL | let a = foo.bar; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/access_union_field.rs:14:13 + --> $DIR/access_union_field.rs:11:13 | LL | let b = foo.baz; | ^^^^^^^ access to union field diff --git a/tests/ui/unsafe/const_pat_in_layout_restricted.rs b/tests/ui/unsafe/const_pat_in_layout_restricted.rs new file mode 100644 index 00000000000..5bc7a7113e4 --- /dev/null +++ b/tests/ui/unsafe/const_pat_in_layout_restricted.rs @@ -0,0 +1,24 @@ +// Check that ref mut patterns within a const pattern don't get considered +// unsafe because they're within a pattern for a layout constrained stuct. +// check-pass + +#![allow(incomplete_features)] +#![feature(rustc_attrs)] +#![feature(inline_const_pat)] + +#[rustc_layout_scalar_valid_range_start(3)] +struct Gt2(i32); + +fn main() { + match unsafe { Gt2(5) } { + Gt2( + const { + || match () { + ref mut y => (), + }; + 4 + }, + ) => (), + _ => (), + } +} diff --git a/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.mir.stderr b/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.mir.stderr deleted file mode 100644 index ea53bf59d31..00000000000 --- a/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.mir.stderr +++ /dev/null @@ -1,16 +0,0 @@ -warning: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/edition-2024-unsafe_op_in_unsafe_fn.rs:13:5 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/edition-2024-unsafe_op_in_unsafe_fn.rs:12:1 - | -LL | unsafe fn foo() { - | ^^^^^^^^^^^^^^^ - = note: `#[warn(unsafe_op_in_unsafe_fn)]` on by default - -warning: 1 warning emitted - diff --git a/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.rs b/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.rs index 1b429955cb0..f84f12c8301 100644 --- a/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.rs +++ b/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.rs @@ -1,9 +1,6 @@ // edition: 2024 // compile-flags: -Zunstable-options // check-pass -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck - #![crate_type = "lib"] #![deny(unused_unsafe)] @@ -11,8 +8,7 @@ unsafe fn unsf() {} unsafe fn foo() { unsf(); - //[mir]~^ WARN call to unsafe function is unsafe and requires unsafe block - //[thir]~^^ WARN call to unsafe function `unsf` is unsafe and requires unsafe block + //~^ WARN call to unsafe function `unsf` is unsafe and requires unsafe block // no unused_unsafe unsafe { diff --git a/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.thir.stderr b/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.stderr index d63843ed2b3..1187c2d80f3 100644 --- a/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.thir.stderr +++ b/tests/ui/unsafe/edition-2024-unsafe_op_in_unsafe_fn.stderr @@ -1,12 +1,12 @@ warning: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/edition-2024-unsafe_op_in_unsafe_fn.rs:13:5 + --> $DIR/edition-2024-unsafe_op_in_unsafe_fn.rs:10:5 | LL | unsf(); | ^^^^^^ call to unsafe function | = note: consult the function's documentation for information on how to avoid undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/edition-2024-unsafe_op_in_unsafe_fn.rs:12:1 + --> $DIR/edition-2024-unsafe_op_in_unsafe_fn.rs:9:1 | LL | unsafe fn foo() { | ^^^^^^^^^^^^^^^ diff --git a/tests/ui/unsafe/foreign-unsafe-fn-called.mir.stderr b/tests/ui/unsafe/foreign-unsafe-fn-called.mir.stderr deleted file mode 100644 index 5157dbb514b..00000000000 --- a/tests/ui/unsafe/foreign-unsafe-fn-called.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/foreign-unsafe-fn-called.rs:11:5 - | -LL | test::free(); - | ^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/foreign-unsafe-fn-called.rs b/tests/ui/unsafe/foreign-unsafe-fn-called.rs index 67302ea1bcd..b5065beb5fc 100644 --- a/tests/ui/unsafe/foreign-unsafe-fn-called.rs +++ b/tests/ui/unsafe/foreign-unsafe-fn-called.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - mod test { extern "C" { pub fn free(); @@ -9,6 +6,5 @@ mod test { fn main() { test::free(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `test::free` is unsafe + //~^ ERROR call to unsafe function `test::free` is unsafe } diff --git a/tests/ui/unsafe/foreign-unsafe-fn-called.thir.stderr b/tests/ui/unsafe/foreign-unsafe-fn-called.stderr index 8c221314cd7..cf2d4c493a1 100644 --- a/tests/ui/unsafe/foreign-unsafe-fn-called.thir.stderr +++ b/tests/ui/unsafe/foreign-unsafe-fn-called.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `test::free` is unsafe and requires unsafe function or block - --> $DIR/foreign-unsafe-fn-called.rs:11:5 + --> $DIR/foreign-unsafe-fn-called.rs:8:5 | LL | test::free(); | ^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/unsafe/inline_asm.mir.stderr b/tests/ui/unsafe/inline_asm.mir.stderr deleted file mode 100644 index e38a9388a78..00000000000 --- a/tests/ui/unsafe/inline_asm.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: use of inline assembly is unsafe and requires unsafe function or block - --> $DIR/inline_asm.rs:8:5 - | -LL | asm!("nop"); - | ^^^^^^^^^^^ use of inline assembly - | - = note: inline assembly is entirely unchecked and can cause undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/inline_asm.rs b/tests/ui/unsafe/inline_asm.rs index 12c7efe4f50..df45b8640c1 100644 --- a/tests/ui/unsafe/inline_asm.rs +++ b/tests/ui/unsafe/inline_asm.rs @@ -1,5 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck // needs-asm-support use std::arch::asm; diff --git a/tests/ui/unsafe/inline_asm.thir.stderr b/tests/ui/unsafe/inline_asm.stderr index e38a9388a78..1e829152a72 100644 --- a/tests/ui/unsafe/inline_asm.thir.stderr +++ b/tests/ui/unsafe/inline_asm.stderr @@ -1,5 +1,5 @@ error[E0133]: use of inline assembly is unsafe and requires unsafe function or block - --> $DIR/inline_asm.rs:8:5 + --> $DIR/inline_asm.rs:6:5 | LL | asm!("nop"); | ^^^^^^^^^^^ use of inline assembly diff --git a/tests/ui/unsafe/issue-3080.mir.stderr b/tests/ui/unsafe/issue-3080.mir.stderr deleted file mode 100644 index a1ad98d205e..00000000000 --- a/tests/ui/unsafe/issue-3080.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/issue-3080.rs:10:5 - | -LL | X(()).with(); - | ^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/issue-3080.rs b/tests/ui/unsafe/issue-3080.rs index 2b5269dda8f..883f3bfd24e 100644 --- a/tests/ui/unsafe/issue-3080.rs +++ b/tests/ui/unsafe/issue-3080.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - struct X(()); impl X { pub unsafe fn with(&self) { } diff --git a/tests/ui/unsafe/issue-3080.thir.stderr b/tests/ui/unsafe/issue-3080.stderr index 1018218b1b0..913a601049e 100644 --- a/tests/ui/unsafe/issue-3080.thir.stderr +++ b/tests/ui/unsafe/issue-3080.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `X::with` is unsafe and requires unsafe function or block - --> $DIR/issue-3080.rs:10:5 + --> $DIR/issue-3080.rs:7:5 | LL | X(()).with(); | ^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/unsafe/issue-45087-unreachable-unsafe.mir.stderr b/tests/ui/unsafe/issue-45087-unreachable-unsafe.mir.stderr deleted file mode 100644 index e7960960774..00000000000 --- a/tests/ui/unsafe/issue-45087-unreachable-unsafe.mir.stderr +++ /dev/null @@ -1,27 +0,0 @@ -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45087-unreachable-unsafe.rs:7:5 - | -LL | *(1 as *mut u32) = 42; - | ^^^^^^^^^^^^^^^^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45087-unreachable-unsafe.rs:17:5 - | -LL | *a = 1; - | ^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45087-unreachable-unsafe.rs:29:5 - | -LL | *b = 1; - | ^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 3 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/issue-45087-unreachable-unsafe.rs b/tests/ui/unsafe/issue-45087-unreachable-unsafe.rs index 3e3da667c0b..7c4bde185fb 100644 --- a/tests/ui/unsafe/issue-45087-unreachable-unsafe.rs +++ b/tests/ui/unsafe/issue-45087-unreachable-unsafe.rs @@ -1,6 +1,4 @@ // Verify that unreachable code undergoes unsafety checks. -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck fn main() { return; diff --git a/tests/ui/unsafe/issue-45087-unreachable-unsafe.thir.stderr b/tests/ui/unsafe/issue-45087-unreachable-unsafe.stderr index e81adad4507..d6cc5fd2e08 100644 --- a/tests/ui/unsafe/issue-45087-unreachable-unsafe.thir.stderr +++ b/tests/ui/unsafe/issue-45087-unreachable-unsafe.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45087-unreachable-unsafe.rs:7:5 + --> $DIR/issue-45087-unreachable-unsafe.rs:5:5 | LL | *(1 as *mut u32) = 42; | ^^^^^^^^^^^^^^^^ dereference of raw pointer @@ -7,7 +7,7 @@ LL | *(1 as *mut u32) = 42; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45087-unreachable-unsafe.rs:17:5 + --> $DIR/issue-45087-unreachable-unsafe.rs:15:5 | LL | *a = 1; | ^^ dereference of raw pointer @@ -15,7 +15,7 @@ LL | *a = 1; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-45087-unreachable-unsafe.rs:29:5 + --> $DIR/issue-45087-unreachable-unsafe.rs:27:5 | LL | *b = 1; | ^^ dereference of raw pointer diff --git a/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.mir.stderr b/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.mir.stderr deleted file mode 100644 index 9e9cbcf33ae..00000000000 --- a/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.mir.stderr +++ /dev/null @@ -1,35 +0,0 @@ -error: unnecessary `unsafe` block - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:10:13 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -LL | let f = |v: &mut Vec<_>| { -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:4:8 - | -LL | #[deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:12:38 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | |w: &mut Vec<u32>| { unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:16:34 - | -LL | unsafe { - | ------ because it's nested under this `unsafe` block -... -LL | |x: &mut Vec<u32>| { unsafe { - | ^^^^^^ unnecessary `unsafe` block - -error: aborting due to 3 previous errors - diff --git a/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.rs b/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.rs index ac1cfd62a05..de275ff701a 100644 --- a/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.rs +++ b/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck - #[deny(unused_unsafe)] fn main() { let mut v = Vec::<i32>::with_capacity(24); diff --git a/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.thir.stderr b/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.stderr index 2267da31512..b23c002dc65 100644 --- a/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.thir.stderr +++ b/tests/ui/unsafe/issue-45107-unnecessary-unsafe-in-closure.stderr @@ -1,5 +1,5 @@ error: unnecessary `unsafe` block - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:10:13 + --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:7:13 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -8,13 +8,13 @@ LL | unsafe { | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:4:8 + --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:1:8 | LL | #[deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:12:38 + --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:9:38 | LL | unsafe { | ------ because it's nested under this `unsafe` block @@ -23,7 +23,7 @@ LL | |w: &mut Vec<u32>| { unsafe { | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:16:34 + --> $DIR/issue-45107-unnecessary-unsafe-in-closure.rs:13:34 | LL | unsafe { | ------ because it's nested under this `unsafe` block diff --git a/tests/ui/unsafe/issue-47412.rs b/tests/ui/unsafe/issue-47412.rs index df6d6e4222e..2d1ea72280b 100644 --- a/tests/ui/unsafe/issue-47412.rs +++ b/tests/ui/unsafe/issue-47412.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #[derive(Copy, Clone)] enum Void {} diff --git a/tests/ui/unsafe/issue-47412.mir.stderr b/tests/ui/unsafe/issue-47412.stderr index 305f482e8c2..aebcbf07463 100644 --- a/tests/ui/unsafe/issue-47412.mir.stderr +++ b/tests/ui/unsafe/issue-47412.stderr @@ -1,5 +1,5 @@ error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-47412.rs:14:11 + --> $DIR/issue-47412.rs:11:11 | LL | match u.void {} | ^^^^^^ access to union field @@ -7,7 +7,7 @@ LL | match u.void {} = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-47412.rs:20:11 + --> $DIR/issue-47412.rs:17:11 | LL | match *ptr {} | ^^^^ dereference of raw pointer diff --git a/tests/ui/unsafe/issue-47412.thir.stderr b/tests/ui/unsafe/issue-47412.thir.stderr deleted file mode 100644 index 305f482e8c2..00000000000 --- a/tests/ui/unsafe/issue-47412.thir.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/issue-47412.rs:14:11 - | -LL | match u.void {} - | ^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/issue-47412.rs:20:11 - | -LL | match *ptr {} - | ^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/issue-85435-unsafe-op-in-let-under-unsafe-under-closure.rs b/tests/ui/unsafe/issue-85435-unsafe-op-in-let-under-unsafe-under-closure.rs index 72f7b674777..b0d738855d7 100644 --- a/tests/ui/unsafe/issue-85435-unsafe-op-in-let-under-unsafe-under-closure.rs +++ b/tests/ui/unsafe/issue-85435-unsafe-op-in-let-under-unsafe-under-closure.rs @@ -1,6 +1,4 @@ // check-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck // This is issue #85435. But the real story is reflected in issue #85561, where // a bug in the implementation of feature(capture_disjoint_fields) () was diff --git a/tests/ui/unsafe/issue-87414-query-cycle.rs b/tests/ui/unsafe/issue-87414-query-cycle.rs index 99e40ba4b4c..a004d739422 100644 --- a/tests/ui/unsafe/issue-87414-query-cycle.rs +++ b/tests/ui/unsafe/issue-87414-query-cycle.rs @@ -1,7 +1,6 @@ // Regression test for #87414. // check-pass -// compile-flags: -Zthir-unsafeck fn bad<T>() -> Box<dyn Iterator<Item = [(); { |x: u32| { x }; 4 }]>> { todo!() } diff --git a/tests/ui/unsafe/ranged_ints.rs b/tests/ui/unsafe/ranged_ints.rs index 05efe87ba6e..0fa2da917e9 100644 --- a/tests/ui/unsafe/ranged_ints.rs +++ b/tests/ui/unsafe/ranged_ints.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #[rustc_layout_scalar_valid_range_start(1)] diff --git a/tests/ui/unsafe/ranged_ints.mir.stderr b/tests/ui/unsafe/ranged_ints.stderr index ef00edae05d..b6875e15815 100644 --- a/tests/ui/unsafe/ranged_ints.mir.stderr +++ b/tests/ui/unsafe/ranged_ints.stderr @@ -1,5 +1,5 @@ error[E0133]: initializing type with `rustc_layout_scalar_valid_range` attr is unsafe and requires unsafe function or block - --> $DIR/ranged_ints.rs:10:14 + --> $DIR/ranged_ints.rs:7:14 | LL | let _x = NonZero(0); | ^^^^^^^^^^ initializing type with `rustc_layout_scalar_valid_range` attr diff --git a/tests/ui/unsafe/ranged_ints.thir.stderr b/tests/ui/unsafe/ranged_ints.thir.stderr deleted file mode 100644 index ef00edae05d..00000000000 --- a/tests/ui/unsafe/ranged_ints.thir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: initializing type with `rustc_layout_scalar_valid_range` attr is unsafe and requires unsafe function or block - --> $DIR/ranged_ints.rs:10:14 - | -LL | let _x = NonZero(0); - | ^^^^^^^^^^ initializing type with `rustc_layout_scalar_valid_range` attr - | - = note: initializing a layout restricted type's field with a value outside the valid range is undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints2.rs b/tests/ui/unsafe/ranged_ints2.rs index ad9d598aba2..a3d9f54efe2 100644 --- a/tests/ui/unsafe/ranged_ints2.rs +++ b/tests/ui/unsafe/ranged_ints2.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #[rustc_layout_scalar_valid_range_start(1)] diff --git a/tests/ui/unsafe/ranged_ints2.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints2.stderr index dc6bd72f56c..1885e77af7e 100644 --- a/tests/ui/unsafe/ranged_ints2.mirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints2.stderr @@ -1,5 +1,5 @@ error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints2.rs:11:13 + --> $DIR/ranged_ints2.rs:8:13 | LL | let y = &mut x.0; | ^^^^^^^^ mutation of layout constrained field @@ -7,7 +7,7 @@ LL | let y = &mut x.0; = note: mutating layout constrained fields cannot statically be checked for valid values error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints2.rs:12:25 + --> $DIR/ranged_ints2.rs:9:25 | LL | if let Some(NonZero(ref mut y)) = Some(x) {} | ^^^^^^^^^ mutation of layout constrained field diff --git a/tests/ui/unsafe/ranged_ints2.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints2.thirunsafeck.stderr deleted file mode 100644 index dc6bd72f56c..00000000000 --- a/tests/ui/unsafe/ranged_ints2.thirunsafeck.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints2.rs:11:13 - | -LL | let y = &mut x.0; - | ^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints2.rs:12:25 - | -LL | if let Some(NonZero(ref mut y)) = Some(x) {} - | ^^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints2_const.rs b/tests/ui/unsafe/ranged_ints2_const.rs index 56f5407bb6e..b7178c2b52b 100644 --- a/tests/ui/unsafe/ranged_ints2_const.rs +++ b/tests/ui/unsafe/ranged_ints2_const.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #[rustc_layout_scalar_valid_range_start(1)] diff --git a/tests/ui/unsafe/ranged_ints2_const.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints2_const.stderr index c16550a5800..f267dc6e23e 100644 --- a/tests/ui/unsafe/ranged_ints2_const.mirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints2_const.stderr @@ -1,5 +1,13 @@ +error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block + --> $DIR/ranged_ints2_const.rs:11:13 + | +LL | let y = &mut x.0; + | ^^^^^^^^ mutation of layout constrained field + | + = note: mutating layout constrained fields cannot statically be checked for valid values + error[E0658]: mutable references are not allowed in constant functions - --> $DIR/ranged_ints2_const.rs:14:13 + --> $DIR/ranged_ints2_const.rs:11:13 | LL | let y = &mut x.0; | ^^^^^^^^ @@ -8,7 +16,7 @@ LL | let y = &mut x.0; = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable error[E0658]: mutable references are not allowed in constant functions - --> $DIR/ranged_ints2_const.rs:21:22 + --> $DIR/ranged_ints2_const.rs:18:22 | LL | let y = unsafe { &mut x.0 }; | ^^^^^^^^ @@ -17,7 +25,7 @@ LL | let y = unsafe { &mut x.0 }; = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable error[E0658]: mutable references are not allowed in constant functions - --> $DIR/ranged_ints2_const.rs:27:22 + --> $DIR/ranged_ints2_const.rs:24:22 | LL | unsafe { let y = &mut x.0; } | ^^^^^^^^ @@ -25,14 +33,6 @@ LL | unsafe { let y = &mut x.0; } = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints2_const.rs:14:13 - | -LL | let y = &mut x.0; - | ^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - error: aborting due to 4 previous errors Some errors have detailed explanations: E0133, E0658. diff --git a/tests/ui/unsafe/ranged_ints2_const.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints2_const.thirunsafeck.stderr deleted file mode 100644 index b3f139f7213..00000000000 --- a/tests/ui/unsafe/ranged_ints2_const.thirunsafeck.stderr +++ /dev/null @@ -1,39 +0,0 @@ -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints2_const.rs:14:13 - | -LL | let y = &mut x.0; - | ^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error[E0658]: mutable references are not allowed in constant functions - --> $DIR/ranged_ints2_const.rs:14:13 - | -LL | let y = &mut x.0; - | ^^^^^^^^ - | - = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information - = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable - -error[E0658]: mutable references are not allowed in constant functions - --> $DIR/ranged_ints2_const.rs:21:22 - | -LL | let y = unsafe { &mut x.0 }; - | ^^^^^^^^ - | - = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information - = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable - -error[E0658]: mutable references are not allowed in constant functions - --> $DIR/ranged_ints2_const.rs:27:22 - | -LL | unsafe { let y = &mut x.0; } - | ^^^^^^^^ - | - = note: see issue #57349 <https://github.com/rust-lang/rust/issues/57349> for more information - = help: add `#![feature(const_mut_refs)]` to the crate attributes to enable - -error: aborting due to 4 previous errors - -Some errors have detailed explanations: E0133, E0658. -For more information about an error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints3.rs b/tests/ui/unsafe/ranged_ints3.rs index 76d4bfe9530..47d67fac678 100644 --- a/tests/ui/unsafe/ranged_ints3.rs +++ b/tests/ui/unsafe/ranged_ints3.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] use std::cell::Cell; diff --git a/tests/ui/unsafe/ranged_ints3.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints3.stderr index 72bce5de0ae..8dcb99fc16d 100644 --- a/tests/ui/unsafe/ranged_ints3.mirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints3.stderr @@ -1,5 +1,5 @@ error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3.rs:13:13 + --> $DIR/ranged_ints3.rs:10:13 | LL | let y = &x.0; | ^^^^ borrow of layout constrained field with interior mutability diff --git a/tests/ui/unsafe/ranged_ints3.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints3.thirunsafeck.stderr deleted file mode 100644 index 72bce5de0ae..00000000000 --- a/tests/ui/unsafe/ranged_ints3.thirunsafeck.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3.rs:13:13 - | -LL | let y = &x.0; - | ^^^^ borrow of layout constrained field with interior mutability - | - = note: references to fields of layout constrained fields lose the constraints. Coupled with interior mutability, the field can be changed to invalid values - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints3_const.rs b/tests/ui/unsafe/ranged_ints3_const.rs index 637198d3604..c069ae7da02 100644 --- a/tests/ui/unsafe/ranged_ints3_const.rs +++ b/tests/ui/unsafe/ranged_ints3_const.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] use std::cell::Cell; diff --git a/tests/ui/unsafe/ranged_ints3_const.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints3_const.stderr index 62df9333069..75b36cdf94b 100644 --- a/tests/ui/unsafe/ranged_ints3_const.mirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints3_const.stderr @@ -1,5 +1,13 @@ +error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block + --> $DIR/ranged_ints3_const.rs:12:13 + | +LL | let y = &x.0; + | ^^^^ borrow of layout constrained field with interior mutability + | + = note: references to fields of layout constrained fields lose the constraints. Coupled with interior mutability, the field can be changed to invalid values + error[E0658]: cannot borrow here, since the borrowed element may contain interior mutability - --> $DIR/ranged_ints3_const.rs:15:13 + --> $DIR/ranged_ints3_const.rs:12:13 | LL | let y = &x.0; | ^^^^ @@ -8,7 +16,7 @@ LL | let y = &x.0; = help: add `#![feature(const_refs_to_cell)]` to the crate attributes to enable error[E0658]: cannot borrow here, since the borrowed element may contain interior mutability - --> $DIR/ranged_ints3_const.rs:22:22 + --> $DIR/ranged_ints3_const.rs:19:22 | LL | let y = unsafe { &x.0 }; | ^^^^ @@ -16,14 +24,6 @@ LL | let y = unsafe { &x.0 }; = note: see issue #80384 <https://github.com/rust-lang/rust/issues/80384> for more information = help: add `#![feature(const_refs_to_cell)]` to the crate attributes to enable -error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3_const.rs:15:13 - | -LL | let y = &x.0; - | ^^^^ borrow of layout constrained field with interior mutability - | - = note: references to fields of layout constrained fields lose the constraints. Coupled with interior mutability, the field can be changed to invalid values - error: aborting due to 3 previous errors Some errors have detailed explanations: E0133, E0658. diff --git a/tests/ui/unsafe/ranged_ints3_const.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints3_const.thirunsafeck.stderr deleted file mode 100644 index 5dbc563aad2..00000000000 --- a/tests/ui/unsafe/ranged_ints3_const.thirunsafeck.stderr +++ /dev/null @@ -1,30 +0,0 @@ -error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3_const.rs:15:13 - | -LL | let y = &x.0; - | ^^^^ borrow of layout constrained field with interior mutability - | - = note: references to fields of layout constrained fields lose the constraints. Coupled with interior mutability, the field can be changed to invalid values - -error[E0658]: cannot borrow here, since the borrowed element may contain interior mutability - --> $DIR/ranged_ints3_const.rs:15:13 - | -LL | let y = &x.0; - | ^^^^ - | - = note: see issue #80384 <https://github.com/rust-lang/rust/issues/80384> for more information - = help: add `#![feature(const_refs_to_cell)]` to the crate attributes to enable - -error[E0658]: cannot borrow here, since the borrowed element may contain interior mutability - --> $DIR/ranged_ints3_const.rs:22:22 - | -LL | let y = unsafe { &x.0 }; - | ^^^^ - | - = note: see issue #80384 <https://github.com/rust-lang/rust/issues/80384> for more information - = help: add `#![feature(const_refs_to_cell)]` to the crate attributes to enable - -error: aborting due to 3 previous errors - -Some errors have detailed explanations: E0133, E0658. -For more information about an error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints3_match.rs b/tests/ui/unsafe/ranged_ints3_match.rs index d9fcf0bd665..de6be506d56 100644 --- a/tests/ui/unsafe/ranged_ints3_match.rs +++ b/tests/ui/unsafe/ranged_ints3_match.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] use std::cell::Cell; diff --git a/tests/ui/unsafe/ranged_ints3_match.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints3_match.stderr index 27c06640928..1bdc29d077c 100644 --- a/tests/ui/unsafe/ranged_ints3_match.mirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints3_match.stderr @@ -1,5 +1,5 @@ error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3_match.rs:14:17 + --> $DIR/ranged_ints3_match.rs:11:17 | LL | NonZero(ref x) => { x } | ^^^^^ borrow of layout constrained field with interior mutability @@ -7,7 +7,7 @@ LL | NonZero(ref x) => { x } = note: references to fields of layout constrained fields lose the constraints. Coupled with interior mutability, the field can be changed to invalid values error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3_match.rs:20:23 + --> $DIR/ranged_ints3_match.rs:17:23 | LL | match y { NonZero(ref mut y) => { y } }; | ^^^^^^^^^ mutation of layout constrained field diff --git a/tests/ui/unsafe/ranged_ints3_match.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints3_match.thirunsafeck.stderr deleted file mode 100644 index 27c06640928..00000000000 --- a/tests/ui/unsafe/ranged_ints3_match.thirunsafeck.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: borrow of layout constrained field with interior mutability is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3_match.rs:14:17 - | -LL | NonZero(ref x) => { x } - | ^^^^^ borrow of layout constrained field with interior mutability - | - = note: references to fields of layout constrained fields lose the constraints. Coupled with interior mutability, the field can be changed to invalid values - -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints3_match.rs:20:23 - | -LL | match y { NonZero(ref mut y) => { y } }; - | ^^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints4.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints4.mirunsafeck.stderr deleted file mode 100644 index 4f2f1e42e76..00000000000 --- a/tests/ui/unsafe/ranged_ints4.mirunsafeck.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints4.rs:11:5 - | -LL | x.0 = 0; - | ^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints4.rs b/tests/ui/unsafe/ranged_ints4.rs index fe80af454cb..d8632c48434 100644 --- a/tests/ui/unsafe/ranged_ints4.rs +++ b/tests/ui/unsafe/ranged_ints4.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #[rustc_layout_scalar_valid_range_start(1)] diff --git a/tests/ui/unsafe/ranged_ints4.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints4.stderr index 4f2f1e42e76..4a703696b88 100644 --- a/tests/ui/unsafe/ranged_ints4.thirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints4.stderr @@ -1,5 +1,5 @@ error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints4.rs:11:5 + --> $DIR/ranged_ints4.rs:8:5 | LL | x.0 = 0; | ^^^^^^^ mutation of layout constrained field diff --git a/tests/ui/unsafe/ranged_ints4_const.rs b/tests/ui/unsafe/ranged_ints4_const.rs index a43c8be71c4..f09168c3d3f 100644 --- a/tests/ui/unsafe/ranged_ints4_const.rs +++ b/tests/ui/unsafe/ranged_ints4_const.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #[rustc_layout_scalar_valid_range_start(1)] diff --git a/tests/ui/unsafe/ranged_ints4_const.mirunsafeck.stderr b/tests/ui/unsafe/ranged_ints4_const.stderr index a2a3ae668a2..604ec1167e4 100644 --- a/tests/ui/unsafe/ranged_ints4_const.mirunsafeck.stderr +++ b/tests/ui/unsafe/ranged_ints4_const.stderr @@ -1,5 +1,5 @@ error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints4_const.rs:13:5 + --> $DIR/ranged_ints4_const.rs:10:5 | LL | x.0 = 0; | ^^^^^^^ mutation of layout constrained field diff --git a/tests/ui/unsafe/ranged_ints4_const.thirunsafeck.stderr b/tests/ui/unsafe/ranged_ints4_const.thirunsafeck.stderr deleted file mode 100644 index a2a3ae668a2..00000000000 --- a/tests/ui/unsafe/ranged_ints4_const.thirunsafeck.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/ranged_ints4_const.rs:13:5 - | -LL | x.0 = 0; - | ^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints_const.rs b/tests/ui/unsafe/ranged_ints_const.rs index 472b0968150..8477772867e 100644 --- a/tests/ui/unsafe/ranged_ints_const.rs +++ b/tests/ui/unsafe/ranged_ints_const.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #[rustc_layout_scalar_valid_range_start(1)] diff --git a/tests/ui/unsafe/ranged_ints_const.mir.stderr b/tests/ui/unsafe/ranged_ints_const.stderr index 563b9be2672..2b8be290d3a 100644 --- a/tests/ui/unsafe/ranged_ints_const.mir.stderr +++ b/tests/ui/unsafe/ranged_ints_const.stderr @@ -1,5 +1,5 @@ error[E0133]: initializing type with `rustc_layout_scalar_valid_range` attr is unsafe and requires unsafe function or block - --> $DIR/ranged_ints_const.rs:11:34 + --> $DIR/ranged_ints_const.rs:8:34 | LL | const fn foo() -> NonZero<u32> { NonZero(0) } | ^^^^^^^^^^ initializing type with `rustc_layout_scalar_valid_range` attr diff --git a/tests/ui/unsafe/ranged_ints_const.thir.stderr b/tests/ui/unsafe/ranged_ints_const.thir.stderr deleted file mode 100644 index 563b9be2672..00000000000 --- a/tests/ui/unsafe/ranged_ints_const.thir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: initializing type with `rustc_layout_scalar_valid_range` attr is unsafe and requires unsafe function or block - --> $DIR/ranged_ints_const.rs:11:34 - | -LL | const fn foo() -> NonZero<u32> { NonZero(0) } - | ^^^^^^^^^^ initializing type with `rustc_layout_scalar_valid_range` attr - | - = note: initializing a layout restricted type's field with a value outside the valid range is undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/ranged_ints_macro.rs b/tests/ui/unsafe/ranged_ints_macro.rs index 8293d029951..0acc3e0f6b1 100644 --- a/tests/ui/unsafe/ranged_ints_macro.rs +++ b/tests/ui/unsafe/ranged_ints_macro.rs @@ -1,6 +1,4 @@ // build-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #![feature(rustc_attrs)] diff --git a/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.mir.stderr b/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.mir.stderr deleted file mode 100644 index 0c0826c1cfb..00000000000 --- a/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.mir.stderr +++ /dev/null @@ -1,112 +0,0 @@ -error: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:12:5 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:11:1 - | -LL | unsafe fn deny_level() { - | ^^^^^^^^^^^^^^^^^^^^^^ -note: the lint level is defined here - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:4:9 - | -LL | #![deny(unsafe_op_in_unsafe_fn)] - | ^^^^^^^^^^^^^^^^^^^^^^ - -error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:15:5 - | -LL | *PTR; - | ^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:17:5 - | -LL | VOID = (); - | ^^^^^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: unnecessary `unsafe` block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:20:5 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:5:9 - | -LL | #![deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:28:5 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:27:1 - | -LL | unsafe fn warning_level() { - | ^^^^^^^^^^^^^^^^^^^^^^^^^ -note: the lint level is defined here - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:26:8 - | -LL | #[deny(warnings)] - | ^^^^^^^^ - = note: `#[deny(unsafe_op_in_unsafe_fn)]` implied by `#[deny(warnings)]` - -error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:31:5 - | -LL | *PTR; - | ^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:33:5 - | -LL | VOID = (); - | ^^^^^^^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: unnecessary `unsafe` block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:35:5 - | -LL | unsafe {} - | ^^^^^^ unnecessary `unsafe` block - -error: unnecessary `unsafe` block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:49:5 - | -LL | unsafe { unsafe { unsf() } } - | ^^^^^^ unnecessary `unsafe` block - -error[E0133]: call to unsafe function is unsafe and requires unsafe block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:76:5 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:81:9 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 11 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.rs b/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.rs index db1e916a36c..658d14da829 100644 --- a/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.rs +++ b/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck - #![deny(unsafe_op_in_unsafe_fn)] #![deny(unused_unsafe)] @@ -10,8 +7,7 @@ static mut VOID: () = (); unsafe fn deny_level() { unsf(); - //[mir]~^ ERROR call to unsafe function is unsafe and requires unsafe block - //[thir]~^^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe block + //~^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe block *PTR; //~^ ERROR dereference of raw pointer is unsafe and requires unsafe block VOID = (); @@ -26,8 +22,7 @@ unsafe fn deny_level() { #[deny(warnings)] unsafe fn warning_level() { unsf(); - //[mir]~^ ERROR call to unsafe function is unsafe and requires unsafe block - //[thir]~^^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe block + //~^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe block *PTR; //~^ ERROR dereference of raw pointer is unsafe and requires unsafe block VOID = (); @@ -74,12 +69,10 @@ unsafe fn nested_allow_level() { fn main() { unsf(); - //[mir]~^ ERROR call to unsafe function is unsafe and requires unsafe block - //[thir]~^^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe block + //~^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe block #[allow(unsafe_op_in_unsafe_fn)] { unsf(); - //[mir]~^ ERROR call to unsafe function is unsafe and requires unsafe function or block - //[thir]~^^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe function or block + //~^ ERROR call to unsafe function `unsf` is unsafe and requires unsafe function or block } } diff --git a/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.thir.stderr b/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.stderr index ad0621a1d04..ea0659b2e10 100644 --- a/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.thir.stderr +++ b/tests/ui/unsafe/rfc-2585-unsafe_op_in_unsafe_fn.stderr @@ -1,23 +1,23 @@ error: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:12:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:9:5 | LL | unsf(); | ^^^^^^ call to unsafe function | = note: consult the function's documentation for information on how to avoid undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:11:1 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:8:1 | LL | unsafe fn deny_level() { | ^^^^^^^^^^^^^^^^^^^^^^ note: the lint level is defined here - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:4:9 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:1:9 | LL | #![deny(unsafe_op_in_unsafe_fn)] | ^^^^^^^^^^^^^^^^^^^^^^ error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:15:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:11:5 | LL | *PTR; | ^^^^ dereference of raw pointer @@ -25,7 +25,7 @@ LL | *PTR; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:17:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:13:5 | LL | VOID = (); | ^^^^ use of mutable static @@ -33,38 +33,38 @@ LL | VOID = (); = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error: unnecessary `unsafe` block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:20:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:16:5 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:5:9 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:2:9 | LL | #![deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:28:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:24:5 | LL | unsf(); | ^^^^^^ call to unsafe function | = note: consult the function's documentation for information on how to avoid undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:27:1 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:23:1 | LL | unsafe fn warning_level() { | ^^^^^^^^^^^^^^^^^^^^^^^^^ note: the lint level is defined here - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:26:8 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:22:8 | LL | #[deny(warnings)] | ^^^^^^^^ = note: `#[deny(unsafe_op_in_unsafe_fn)]` implied by `#[deny(warnings)]` error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:31:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:26:5 | LL | *PTR; | ^^^^ dereference of raw pointer @@ -72,7 +72,7 @@ LL | *PTR; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:33:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:28:5 | LL | VOID = (); | ^^^^ use of mutable static @@ -80,19 +80,19 @@ LL | VOID = (); = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error: unnecessary `unsafe` block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:35:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:30:5 | LL | unsafe {} | ^^^^^^ unnecessary `unsafe` block error: unnecessary `unsafe` block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:49:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:44:5 | LL | unsafe { unsafe { unsf() } } | ^^^^^^ unnecessary `unsafe` block error[E0133]: call to unsafe function `unsf` is unsafe and requires unsafe block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:76:5 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:71:5 | LL | unsf(); | ^^^^^^ call to unsafe function @@ -100,7 +100,7 @@ LL | unsf(); = note: consult the function's documentation for information on how to avoid undefined behavior error[E0133]: call to unsafe function `unsf` is unsafe and requires unsafe function or block - --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:81:9 + --> $DIR/rfc-2585-unsafe_op_in_unsafe_fn.rs:75:9 | LL | unsf(); | ^^^^^^ call to unsafe function diff --git a/tests/ui/unsafe/union-assignop.mirunsafeck.stderr b/tests/ui/unsafe/union-assignop.mirunsafeck.stderr deleted file mode 100644 index 0ecd5203dd9..00000000000 --- a/tests/ui/unsafe/union-assignop.mirunsafeck.stderr +++ /dev/null @@ -1,51 +0,0 @@ -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:19:5 - | -LL | foo.a += 5; - | ^^^^^^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:20:6 - | -LL | *foo.b += NonCopy; - | ^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:21:6 - | -LL | *foo.b = NonCopy; - | ^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:23:5 - | -LL | foo.a; - | ^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:25:5 - | -LL | foo.b; - | ^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:27:13 - | -LL | foo.b = foo.b; - | ^^^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error: aborting due to 6 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/union-assignop.rs b/tests/ui/unsafe/union-assignop.rs index 5e667cd10d5..6122aef0565 100644 --- a/tests/ui/unsafe/union-assignop.rs +++ b/tests/ui/unsafe/union-assignop.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - use std::ops::AddAssign; use std::mem::ManuallyDrop; diff --git a/tests/ui/unsafe/union-assignop.thirunsafeck.stderr b/tests/ui/unsafe/union-assignop.stderr index 24b357e762b..6b2ebfb5099 100644 --- a/tests/ui/unsafe/union-assignop.thirunsafeck.stderr +++ b/tests/ui/unsafe/union-assignop.stderr @@ -1,5 +1,5 @@ error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:19:5 + --> $DIR/union-assignop.rs:16:5 | LL | foo.a += 5; | ^^^^^ access to union field @@ -7,7 +7,7 @@ LL | foo.a += 5; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:20:6 + --> $DIR/union-assignop.rs:17:6 | LL | *foo.b += NonCopy; | ^^^^^ access to union field @@ -15,7 +15,7 @@ LL | *foo.b += NonCopy; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:21:6 + --> $DIR/union-assignop.rs:18:6 | LL | *foo.b = NonCopy; | ^^^^^ access to union field @@ -23,7 +23,7 @@ LL | *foo.b = NonCopy; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:23:5 + --> $DIR/union-assignop.rs:20:5 | LL | foo.a; | ^^^^^ access to union field @@ -31,7 +31,7 @@ LL | foo.a; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:25:5 + --> $DIR/union-assignop.rs:22:5 | LL | foo.b; | ^^^^^ access to union field @@ -39,7 +39,7 @@ LL | foo.b; = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union-assignop.rs:27:13 + --> $DIR/union-assignop.rs:24:13 | LL | foo.b = foo.b; | ^^^^^ access to union field diff --git a/tests/ui/unsafe/union-modification.rs b/tests/ui/unsafe/union-modification.rs index 9a53ef90852..fbcb846be9d 100644 --- a/tests/ui/unsafe/union-modification.rs +++ b/tests/ui/unsafe/union-modification.rs @@ -1,7 +1,4 @@ // run-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - union Foo { bar: i8, _blah: isize, diff --git a/tests/ui/unsafe/union.mir.stderr b/tests/ui/unsafe/union.mir.stderr deleted file mode 100644 index 787714cdd2d..00000000000 --- a/tests/ui/unsafe/union.mir.stderr +++ /dev/null @@ -1,19 +0,0 @@ -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union.rs:30:20 - | -LL | Foo { bar: _a } => {}, - | ^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union.rs:32:11 - | -LL | match foo { - | ^^^ access to union field - | - = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/union.rs b/tests/ui/unsafe/union.rs index 4338d78eabb..ae81708aa19 100644 --- a/tests/ui/unsafe/union.rs +++ b/tests/ui/unsafe/union.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - union Foo { bar: i8, zst: (), @@ -29,20 +26,19 @@ pub fn main() { match foo { Foo { bar: _a } => {}, //~ ERROR access to union field is unsafe } - match foo { //[mir]~ ERROR access to union field is unsafe + match foo { Foo { - pizza: Pizza { //[thir]~ ERROR access to union field is unsafe + pizza: Pizza { //~ ERROR access to union field is unsafe topping: Some(PizzaTopping::Cheese) | Some(PizzaTopping::Pineapple) | None } } => {}, } - // MIR unsafeck incorrectly thinks that no unsafe block is needed to do these match foo { - Foo { zst: () } => {}, //[thir]~ ERROR access to union field is unsafe + Foo { zst: () } => {} //~ ERROR access to union field is unsafe } match foo { - Foo { pizza: Pizza { .. } } => {}, //[thir]~ ERROR access to union field is unsafe + Foo { pizza: Pizza { .. } } => {} //~ ERROR access to union field is unsafe } // binding to wildcard is okay diff --git a/tests/ui/unsafe/union.thir.stderr b/tests/ui/unsafe/union.stderr index e1a1bd634de..1506bdb919b 100644 --- a/tests/ui/unsafe/union.thir.stderr +++ b/tests/ui/unsafe/union.stderr @@ -1,5 +1,5 @@ error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union.rs:30:20 + --> $DIR/union.rs:27:20 | LL | Foo { bar: _a } => {}, | ^^ access to union field @@ -7,7 +7,7 @@ LL | Foo { bar: _a } => {}, = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union.rs:34:20 + --> $DIR/union.rs:31:20 | LL | pizza: Pizza { | ____________________^ @@ -18,17 +18,17 @@ LL | | } = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union.rs:42:20 + --> $DIR/union.rs:38:20 | -LL | Foo { zst: () } => {}, +LL | Foo { zst: () } => {} | ^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior error[E0133]: access to union field is unsafe and requires unsafe function or block - --> $DIR/union.rs:45:22 + --> $DIR/union.rs:41:22 | -LL | Foo { pizza: Pizza { .. } } => {}, +LL | Foo { pizza: Pizza { .. } } => {} | ^^^^^^^^^^^^ access to union field | = note: the field may not be properly initialized: using uninitialized data will cause undefined behavior diff --git a/tests/ui/unsafe/union_access_through_block.rs b/tests/ui/unsafe/union_access_through_block.rs index e4c0976b826..8b28c33650e 100644 --- a/tests/ui/unsafe/union_access_through_block.rs +++ b/tests/ui/unsafe/union_access_through_block.rs @@ -1,7 +1,4 @@ // check-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #[derive(Copy, Clone)] pub struct Foo { a: bool } diff --git a/tests/ui/unsafe/union_destructure.mir.stderr b/tests/ui/unsafe/union_destructure.mir.stderr deleted file mode 100644 index 818f5ce03b5..00000000000 --- a/tests/ui/unsafe/union_destructure.mir.stderr +++ /dev/null @@ -1,16 +0,0 @@ -warning: unnecessary `unsafe` block - --> $DIR/union_destructure.rs:35:5 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - | - = note: `#[warn(unused_unsafe)]` on by default - -warning: unnecessary `unsafe` block - --> $DIR/union_destructure.rs:41:5 - | -LL | unsafe { - | ^^^^^^ unnecessary `unsafe` block - -warning: 2 warnings emitted - diff --git a/tests/ui/unsafe/union_destructure.rs b/tests/ui/unsafe/union_destructure.rs index 6c88344b5fd..d0cf8640eaa 100644 --- a/tests/ui/unsafe/union_destructure.rs +++ b/tests/ui/unsafe/union_destructure.rs @@ -1,6 +1,4 @@ // run-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #[derive(Copy, Clone)] #[allow(dead_code)] @@ -12,7 +10,7 @@ struct Pie { union Foo { #[allow(dead_code)] bar: i8, - baz: Pie + baz: Pie, } fn main() { @@ -32,20 +30,20 @@ fn main() { }; let u = Foo { bar: 9 }; - unsafe { //[mir]~ WARNING unnecessary `unsafe` block + unsafe { match u { - Foo { baz: Pie { .. } } => {}, + Foo { baz: Pie { .. } } => {} }; } let u = Foo { bar: 10 }; - unsafe { //[mir]~ WARNING unnecessary `unsafe` block + unsafe { match u { - Foo { baz: Pie { slices: _, size: _ } } => {}, + Foo { baz: Pie { slices: _, size: _ } } => {} }; } let u = Foo { bar: 11 }; match u { - Foo { baz: _ } => {}, + Foo { baz: _ } => {} }; } diff --git a/tests/ui/unsafe/union_wild_or_wild.rs b/tests/ui/unsafe/union_wild_or_wild.rs index 52a0a7abf27..935de97f255 100644 --- a/tests/ui/unsafe/union_wild_or_wild.rs +++ b/tests/ui/unsafe/union_wild_or_wild.rs @@ -1,7 +1,4 @@ // check-pass -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - union X { a: i8 } fn main() { diff --git a/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.mir.stderr b/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.mir.stderr deleted file mode 100644 index 62199e5a2ec..00000000000 --- a/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.mir.stderr +++ /dev/null @@ -1,20 +0,0 @@ -error: unnecessary `unsafe` block - --> $DIR/unsafe-around-compiler-generated-unsafe.rs:9:9 - | -LL | unsafe { async {}.await; } - | ^^^^^^ unnecessary `unsafe` block - | -note: the lint level is defined here - --> $DIR/unsafe-around-compiler-generated-unsafe.rs:5:9 - | -LL | #![deny(unused_unsafe)] - | ^^^^^^^^^^^^^ - -error: unnecessary `unsafe` block - --> $DIR/unsafe-around-compiler-generated-unsafe.rs:13:5 - | -LL | unsafe { println!("foo"); } - | ^^^^^^ unnecessary `unsafe` block - -error: aborting due to 2 previous errors - diff --git a/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.rs b/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.rs index c1a32764039..e060c58e408 100644 --- a/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.rs +++ b/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.rs @@ -1,6 +1,4 @@ // edition:2018 -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck #![deny(unused_unsafe)] diff --git a/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.thir.stderr b/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.stderr index 62199e5a2ec..ffadd90c64b 100644 --- a/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.thir.stderr +++ b/tests/ui/unsafe/unsafe-around-compiler-generated-unsafe.stderr @@ -1,17 +1,17 @@ error: unnecessary `unsafe` block - --> $DIR/unsafe-around-compiler-generated-unsafe.rs:9:9 + --> $DIR/unsafe-around-compiler-generated-unsafe.rs:7:9 | LL | unsafe { async {}.await; } | ^^^^^^ unnecessary `unsafe` block | note: the lint level is defined here - --> $DIR/unsafe-around-compiler-generated-unsafe.rs:5:9 + --> $DIR/unsafe-around-compiler-generated-unsafe.rs:3:9 | LL | #![deny(unused_unsafe)] | ^^^^^^^^^^^^^ error: unnecessary `unsafe` block - --> $DIR/unsafe-around-compiler-generated-unsafe.rs:13:5 + --> $DIR/unsafe-around-compiler-generated-unsafe.rs:11:5 | LL | unsafe { println!("foo"); } | ^^^^^^ unnecessary `unsafe` block diff --git a/tests/ui/unsafe/unsafe-assign.rs b/tests/ui/unsafe/unsafe-assign.rs index 15273165b5e..02ce238854d 100644 --- a/tests/ui/unsafe/unsafe-assign.rs +++ b/tests/ui/unsafe/unsafe-assign.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #![allow(unused,dead_code)] diff --git a/tests/ui/unsafe/unsafe-assign.mirunsafeck.stderr b/tests/ui/unsafe/unsafe-assign.stderr index f8b55e0668d..1fa5d715c2e 100644 --- a/tests/ui/unsafe/unsafe-assign.mirunsafeck.stderr +++ b/tests/ui/unsafe/unsafe-assign.stderr @@ -1,5 +1,5 @@ error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-assign.rs:12:5 + --> $DIR/unsafe-assign.rs:9:5 | LL | foo.0.0 = 0; | ^^^^^^^^^^^ mutation of layout constrained field diff --git a/tests/ui/unsafe/unsafe-assign.thirunsafeck.stderr b/tests/ui/unsafe/unsafe-assign.thirunsafeck.stderr deleted file mode 100644 index f8b55e0668d..00000000000 --- a/tests/ui/unsafe/unsafe-assign.thirunsafeck.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-assign.rs:12:5 - | -LL | foo.0.0 = 0; - | ^^^^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-borrow.rs b/tests/ui/unsafe/unsafe-borrow.rs index 8dddc70be45..ab0e59489a9 100644 --- a/tests/ui/unsafe/unsafe-borrow.rs +++ b/tests/ui/unsafe/unsafe-borrow.rs @@ -1,6 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck - #![feature(rustc_attrs)] #![allow(unused,dead_code)] diff --git a/tests/ui/unsafe/unsafe-borrow.mirunsafeck.stderr b/tests/ui/unsafe/unsafe-borrow.stderr index a206722495a..a53b50583ca 100644 --- a/tests/ui/unsafe/unsafe-borrow.mirunsafeck.stderr +++ b/tests/ui/unsafe/unsafe-borrow.stderr @@ -1,5 +1,5 @@ error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-borrow.rs:12:13 + --> $DIR/unsafe-borrow.rs:9:13 | LL | let a = &mut foo.0.0; | ^^^^^^^^^^^^ mutation of layout constrained field @@ -7,7 +7,7 @@ LL | let a = &mut foo.0.0; = note: mutating layout constrained fields cannot statically be checked for valid values error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-borrow.rs:32:13 + --> $DIR/unsafe-borrow.rs:29:13 | LL | let a = &mut foo.0[2]; | ^^^^^^^^^^^^^ mutation of layout constrained field @@ -15,7 +15,7 @@ LL | let a = &mut foo.0[2]; = note: mutating layout constrained fields cannot statically be checked for valid values error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-borrow.rs:51:18 + --> $DIR/unsafe-borrow.rs:48:18 | LL | NonZero((a,)) => *a = 0, | ^ mutation of layout constrained field diff --git a/tests/ui/unsafe/unsafe-borrow.thirunsafeck.stderr b/tests/ui/unsafe/unsafe-borrow.thirunsafeck.stderr deleted file mode 100644 index a206722495a..00000000000 --- a/tests/ui/unsafe/unsafe-borrow.thirunsafeck.stderr +++ /dev/null @@ -1,27 +0,0 @@ -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-borrow.rs:12:13 - | -LL | let a = &mut foo.0.0; - | ^^^^^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-borrow.rs:32:13 - | -LL | let a = &mut foo.0[2]; - | ^^^^^^^^^^^^^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error[E0133]: mutation of layout constrained field is unsafe and requires unsafe function or block - --> $DIR/unsafe-borrow.rs:51:18 - | -LL | NonZero((a,)) => *a = 0, - | ^ mutation of layout constrained field - | - = note: mutating layout constrained fields cannot statically be checked for valid values - -error: aborting due to 3 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-const-fn.mir.stderr b/tests/ui/unsafe/unsafe-const-fn.mir.stderr deleted file mode 100644 index 2450f08664c..00000000000 --- a/tests/ui/unsafe/unsafe-const-fn.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unsafe-const-fn.rs:10:18 - | -LL | const VAL: u32 = dummy(0xFFFF); - | ^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-const-fn.rs b/tests/ui/unsafe/unsafe-const-fn.rs index 65e3acf3063..3b4becf17a7 100644 --- a/tests/ui/unsafe/unsafe-const-fn.rs +++ b/tests/ui/unsafe/unsafe-const-fn.rs @@ -1,8 +1,5 @@ // A quick test of 'unsafe const fn' functionality -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - const unsafe fn dummy(v: u32) -> u32 { !v } diff --git a/tests/ui/unsafe/unsafe-const-fn.thir.stderr b/tests/ui/unsafe/unsafe-const-fn.stderr index 199dca9237e..5a6e6b7ce59 100644 --- a/tests/ui/unsafe/unsafe-const-fn.thir.stderr +++ b/tests/ui/unsafe/unsafe-const-fn.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `dummy` is unsafe and requires unsafe function or block - --> $DIR/unsafe-const-fn.rs:10:18 + --> $DIR/unsafe-const-fn.rs:7:18 | LL | const VAL: u32 = dummy(0xFFFF); | ^^^^^^^^^^^^^ call to unsafe function diff --git a/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.mir.stderr b/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.mir.stderr deleted file mode 100644 index da3d5f3bd29..00000000000 --- a/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-assign-deref-ptr.rs:5:5 - | -LL | *p = 0; - | ^^^^^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.rs b/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.rs index a94e94375ae..91264e790c8 100644 --- a/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.rs +++ b/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - fn f(p: *mut u8) { *p = 0; //~ ERROR dereference of raw pointer is unsafe return; diff --git a/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.thir.stderr b/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.stderr index aa5644782a4..3a0874f32c0 100644 --- a/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.thir.stderr +++ b/tests/ui/unsafe/unsafe-fn-assign-deref-ptr.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-assign-deref-ptr.rs:5:5 + --> $DIR/unsafe-fn-assign-deref-ptr.rs:2:5 | LL | *p = 0; | ^^ dereference of raw pointer diff --git a/tests/ui/unsafe/unsafe-fn-called-from-safe.mir.stderr b/tests/ui/unsafe/unsafe-fn-called-from-safe.mir.stderr deleted file mode 100644 index d3347437075..00000000000 --- a/tests/ui/unsafe/unsafe-fn-called-from-safe.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-called-from-safe.rs:7:5 - | -LL | f(); - | ^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-fn-called-from-safe.rs b/tests/ui/unsafe/unsafe-fn-called-from-safe.rs index 55072dcc6c3..758b80097f7 100644 --- a/tests/ui/unsafe/unsafe-fn-called-from-safe.rs +++ b/tests/ui/unsafe/unsafe-fn-called-from-safe.rs @@ -1,10 +1,8 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - -unsafe fn f() { return; } +unsafe fn f() { + return; +} fn main() { f(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `f` is unsafe + //~^ ERROR call to unsafe function `f` is unsafe } diff --git a/tests/ui/unsafe/unsafe-fn-called-from-safe.thir.stderr b/tests/ui/unsafe/unsafe-fn-called-from-safe.stderr index 75431666186..1b1c92f0546 100644 --- a/tests/ui/unsafe/unsafe-fn-called-from-safe.thir.stderr +++ b/tests/ui/unsafe/unsafe-fn-called-from-safe.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `f` is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-called-from-safe.rs:7:5 + --> $DIR/unsafe-fn-called-from-safe.rs:6:5 | LL | f(); | ^^^ call to unsafe function diff --git a/tests/ui/unsafe/unsafe-fn-deref-ptr.rs b/tests/ui/unsafe/unsafe-fn-deref-ptr.rs index 4b7c6bf6985..a3144824323 100644 --- a/tests/ui/unsafe/unsafe-fn-deref-ptr.rs +++ b/tests/ui/unsafe/unsafe-fn-deref-ptr.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - fn f(p: *const u8) -> u8 { let _ = *p; //~ ERROR dereference of raw pointer is unsafe let _: u8 = *p; //~ ERROR dereference of raw pointer is unsafe diff --git a/tests/ui/unsafe/unsafe-fn-deref-ptr.mir.stderr b/tests/ui/unsafe/unsafe-fn-deref-ptr.stderr index 7f1e7c8902f..2e68963097e 100644 --- a/tests/ui/unsafe/unsafe-fn-deref-ptr.mir.stderr +++ b/tests/ui/unsafe/unsafe-fn-deref-ptr.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:5:13 + --> $DIR/unsafe-fn-deref-ptr.rs:2:13 | LL | let _ = *p; | ^^ dereference of raw pointer @@ -7,7 +7,7 @@ LL | let _ = *p; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:6:17 + --> $DIR/unsafe-fn-deref-ptr.rs:3:17 | LL | let _: u8 = *p; | ^^ dereference of raw pointer @@ -15,7 +15,7 @@ LL | let _: u8 = *p; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:7:9 + --> $DIR/unsafe-fn-deref-ptr.rs:4:9 | LL | _ = *p; | ^^ dereference of raw pointer @@ -23,7 +23,7 @@ LL | _ = *p; = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:8:12 + --> $DIR/unsafe-fn-deref-ptr.rs:5:12 | LL | return *p; | ^^ dereference of raw pointer diff --git a/tests/ui/unsafe/unsafe-fn-deref-ptr.thir.stderr b/tests/ui/unsafe/unsafe-fn-deref-ptr.thir.stderr deleted file mode 100644 index 7f1e7c8902f..00000000000 --- a/tests/ui/unsafe/unsafe-fn-deref-ptr.thir.stderr +++ /dev/null @@ -1,35 +0,0 @@ -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:5:13 - | -LL | let _ = *p; - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:6:17 - | -LL | let _: u8 = *p; - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:7:9 - | -LL | _ = *p; - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-deref-ptr.rs:8:12 - | -LL | return *p; - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 4 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-fn-used-as-value.mir.stderr b/tests/ui/unsafe/unsafe-fn-used-as-value.mir.stderr deleted file mode 100644 index 01e8e49ecfa..00000000000 --- a/tests/ui/unsafe/unsafe-fn-used-as-value.mir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-used-as-value.rs:8:5 - | -LL | x(); - | ^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-fn-used-as-value.rs b/tests/ui/unsafe/unsafe-fn-used-as-value.rs index 9517598c7ce..99506ea047c 100644 --- a/tests/ui/unsafe/unsafe-fn-used-as-value.rs +++ b/tests/ui/unsafe/unsafe-fn-used-as-value.rs @@ -1,11 +1,9 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - -unsafe fn f() { return; } +unsafe fn f() { + return; +} fn main() { let x = f; x(); - //[mir]~^ ERROR call to unsafe function is unsafe - //[thir]~^^ ERROR call to unsafe function `f` is unsafe + //~^ ERROR call to unsafe function `f` is unsafe } diff --git a/tests/ui/unsafe/unsafe-fn-used-as-value.thir.stderr b/tests/ui/unsafe/unsafe-fn-used-as-value.stderr index c38da7226f6..0542b87b5e6 100644 --- a/tests/ui/unsafe/unsafe-fn-used-as-value.thir.stderr +++ b/tests/ui/unsafe/unsafe-fn-used-as-value.stderr @@ -1,5 +1,5 @@ error[E0133]: call to unsafe function `f` is unsafe and requires unsafe function or block - --> $DIR/unsafe-fn-used-as-value.rs:8:5 + --> $DIR/unsafe-fn-used-as-value.rs:7:5 | LL | x(); | ^^^ call to unsafe function diff --git a/tests/ui/unsafe/unsafe-not-inherited.mirunsafeck.stderr b/tests/ui/unsafe/unsafe-not-inherited.mirunsafeck.stderr deleted file mode 100644 index 5536efbc6f4..00000000000 --- a/tests/ui/unsafe/unsafe-not-inherited.mirunsafeck.stderr +++ /dev/null @@ -1,24 +0,0 @@ -error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/unsafe-not-inherited.rs:8:31 - | -LL | unsafe {static BAR: u64 = FOO;} - | ------ ^^^ use of mutable static - | | - | items do not inherit unsafety from separate enclosing items - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error[E0133]: call to unsafe function is unsafe and requires unsafe function or block - --> $DIR/unsafe-not-inherited.rs:20:13 - | -LL | unsafe { - | ------ items do not inherit unsafety from separate enclosing items -... -LL | unsafe_call(); - | ^^^^^^^^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: aborting due to 2 previous errors - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/unsafe-not-inherited.rs b/tests/ui/unsafe/unsafe-not-inherited.rs index f9d9a595714..6d797caa0f9 100644 --- a/tests/ui/unsafe/unsafe-not-inherited.rs +++ b/tests/ui/unsafe/unsafe-not-inherited.rs @@ -1,5 +1,3 @@ -// revisions: mirunsafeck thirunsafeck -// [thirunsafeck]compile-flags: -Z thir-unsafeck #![allow(unused, dead_code)] static mut FOO: u64 = 0; diff --git a/tests/ui/unsafe/unsafe-not-inherited.thirunsafeck.stderr b/tests/ui/unsafe/unsafe-not-inherited.stderr index 88ea2e6d1fe..8b699127312 100644 --- a/tests/ui/unsafe/unsafe-not-inherited.thirunsafeck.stderr +++ b/tests/ui/unsafe/unsafe-not-inherited.stderr @@ -1,5 +1,5 @@ error[E0133]: use of mutable static is unsafe and requires unsafe function or block - --> $DIR/unsafe-not-inherited.rs:8:31 + --> $DIR/unsafe-not-inherited.rs:6:31 | LL | unsafe {static BAR: u64 = FOO;} | ------ ^^^ use of mutable static @@ -9,7 +9,7 @@ LL | unsafe {static BAR: u64 = FOO;} = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error[E0133]: call to unsafe function `unsafe_call` is unsafe and requires unsafe function or block - --> $DIR/unsafe-not-inherited.rs:20:13 + --> $DIR/unsafe-not-inherited.rs:18:13 | LL | unsafe { | ------ items do not inherit unsafety from separate enclosing items diff --git a/tests/ui/unsafe/unsafe-unstable-const-fn.rs b/tests/ui/unsafe/unsafe-unstable-const-fn.rs index 581b15cdfb0..5398721484a 100644 --- a/tests/ui/unsafe/unsafe-unstable-const-fn.rs +++ b/tests/ui/unsafe/unsafe-unstable-const-fn.rs @@ -1,6 +1,3 @@ -// revisions: mir thir -// [thir]compile-flags: -Z thir-unsafeck - #![stable(feature = "foo", since = "1.33.0")] #![feature(staged_api)] diff --git a/tests/ui/unsafe/unsafe-unstable-const-fn.mir.stderr b/tests/ui/unsafe/unsafe-unstable-const-fn.stderr index 79133ab39a0..22a2dcbf119 100644 --- a/tests/ui/unsafe/unsafe-unstable-const-fn.mir.stderr +++ b/tests/ui/unsafe/unsafe-unstable-const-fn.stderr @@ -1,5 +1,5 @@ error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-unstable-const-fn.rs:10:5 + --> $DIR/unsafe-unstable-const-fn.rs:7:5 | LL | *a == b | ^^ dereference of raw pointer diff --git a/tests/ui/unsafe/unsafe-unstable-const-fn.thir.stderr b/tests/ui/unsafe/unsafe-unstable-const-fn.thir.stderr deleted file mode 100644 index 79133ab39a0..00000000000 --- a/tests/ui/unsafe/unsafe-unstable-const-fn.thir.stderr +++ /dev/null @@ -1,11 +0,0 @@ -error[E0133]: dereference of raw pointer is unsafe and requires unsafe function or block - --> $DIR/unsafe-unstable-const-fn.rs:10:5 - | -LL | *a == b - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: aborting due to 1 previous error - -For more information about this error, try `rustc --explain E0133`. diff --git a/tests/ui/unsafe/wrapping-unsafe-block-sugg.thir.fixed b/tests/ui/unsafe/wrapping-unsafe-block-sugg.fixed index b59029df642..20f4fe847da 100644 --- a/tests/ui/unsafe/wrapping-unsafe-block-sugg.thir.fixed +++ b/tests/ui/unsafe/wrapping-unsafe-block-sugg.fixed @@ -1,7 +1,5 @@ // run-rustfix // aux-build:external_unsafe_macro.rs -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![deny(unsafe_op_in_unsafe_fn)] //~ NOTE #![crate_name = "wrapping_unsafe_block_sugg"] @@ -12,13 +10,11 @@ unsafe fn unsf() {} pub unsafe fn foo() { unsafe { //~^ NOTE an unsafe function restricts its caller, but its body is safe by default - unsf(); //[mir]~ ERROR call to unsafe function is unsafe - //[thir]~^ ERROR call to unsafe function `unsf` is unsafe - //~^^ NOTE + unsf(); //~ ERROR call to unsafe function `unsf` is unsafe + //~^ NOTE //~| NOTE - unsf(); //[mir]~ ERROR call to unsafe function is unsafe - //[thir]~^ ERROR call to unsafe function `unsf` is unsafe - //~^^ NOTE + unsf(); //~ ERROR call to unsafe function `unsf` is unsafe + //~^ NOTE //~| NOTE }} @@ -44,12 +40,10 @@ pub unsafe fn baz() -> i32 { unsafe { }} macro_rules! unsafe_macro { () => (unsf()) } -//[mir]~^ ERROR call to unsafe function is unsafe -//[thir]~^^ ERROR call to unsafe function `unsf` is unsafe +//~^ ERROR call to unsafe function `unsf` is unsafe //~| NOTE //~| NOTE -//[mir]~| ERROR call to unsafe function is unsafe -//[thir]~| ERROR call to unsafe function `unsf` is unsafe +//~| ERROR call to unsafe function `unsf` is unsafe //~| NOTE //~| NOTE diff --git a/tests/ui/unsafe/wrapping-unsafe-block-sugg.mir.fixed b/tests/ui/unsafe/wrapping-unsafe-block-sugg.mir.fixed deleted file mode 100644 index b59029df642..00000000000 --- a/tests/ui/unsafe/wrapping-unsafe-block-sugg.mir.fixed +++ /dev/null @@ -1,73 +0,0 @@ -// run-rustfix -// aux-build:external_unsafe_macro.rs -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck - -#![deny(unsafe_op_in_unsafe_fn)] //~ NOTE -#![crate_name = "wrapping_unsafe_block_sugg"] - -extern crate external_unsafe_macro; - -unsafe fn unsf() {} - -pub unsafe fn foo() { unsafe { - //~^ NOTE an unsafe function restricts its caller, but its body is safe by default - unsf(); //[mir]~ ERROR call to unsafe function is unsafe - //[thir]~^ ERROR call to unsafe function `unsf` is unsafe - //~^^ NOTE - //~| NOTE - unsf(); //[mir]~ ERROR call to unsafe function is unsafe - //[thir]~^ ERROR call to unsafe function `unsf` is unsafe - //~^^ NOTE - //~| NOTE -}} - -pub unsafe fn bar(x: *const i32) -> i32 { unsafe { - //~^ NOTE an unsafe function restricts its caller, but its body is safe by default - let y = *x; //~ ERROR dereference of raw pointer is unsafe and requires unsafe block - //~^ NOTE - //~| NOTE - y + *x //~ ERROR dereference of raw pointer is unsafe and requires unsafe block - //~^ NOTE - //~| NOTE -}} - -static mut BAZ: i32 = 0; -pub unsafe fn baz() -> i32 { unsafe { - //~^ NOTE an unsafe function restricts its caller, but its body is safe by default - let y = BAZ; //~ ERROR use of mutable static is unsafe and requires unsafe block - //~^ NOTE - //~| NOTE - y + BAZ //~ ERROR use of mutable static is unsafe and requires unsafe block - //~^ NOTE - //~| NOTE -}} - -macro_rules! unsafe_macro { () => (unsf()) } -//[mir]~^ ERROR call to unsafe function is unsafe -//[thir]~^^ ERROR call to unsafe function `unsf` is unsafe -//~| NOTE -//~| NOTE -//[mir]~| ERROR call to unsafe function is unsafe -//[thir]~| ERROR call to unsafe function `unsf` is unsafe -//~| NOTE -//~| NOTE - -pub unsafe fn unsafe_in_macro() { unsafe { - //~^ NOTE an unsafe function restricts its caller, but its body is safe by default - unsafe_macro!(); - //~^ NOTE - //~| NOTE - unsafe_macro!(); - //~^ NOTE - //~| NOTE -}} - -pub unsafe fn unsafe_in_external_macro() { - // FIXME: https://github.com/rust-lang/rust/issues/112504 - // FIXME: ~^ NOTE an unsafe function restricts its caller, but its body is safe by default - external_unsafe_macro::unsafe_macro!(); - external_unsafe_macro::unsafe_macro!(); -} - -fn main() {} diff --git a/tests/ui/unsafe/wrapping-unsafe-block-sugg.mir.stderr b/tests/ui/unsafe/wrapping-unsafe-block-sugg.mir.stderr deleted file mode 100644 index 7a1b83c7367..00000000000 --- a/tests/ui/unsafe/wrapping-unsafe-block-sugg.mir.stderr +++ /dev/null @@ -1,99 +0,0 @@ -error: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:15:5 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:13:1 - | -LL | pub unsafe fn foo() { - | ^^^^^^^^^^^^^^^^^^^ -note: the lint level is defined here - --> $DIR/wrapping-unsafe-block-sugg.rs:6:9 - | -LL | #![deny(unsafe_op_in_unsafe_fn)] - | ^^^^^^^^^^^^^^^^^^^^^^ - -error: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:19:5 - | -LL | unsf(); - | ^^^^^^ call to unsafe function - | - = note: consult the function's documentation for information on how to avoid undefined behavior - -error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:27:13 - | -LL | let y = *x; - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:25:1 - | -LL | pub unsafe fn bar(x: *const i32) -> i32 { - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ - -error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:30:9 - | -LL | y + *x - | ^^ dereference of raw pointer - | - = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior - -error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:38:13 - | -LL | let y = BAZ; - | ^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:36:1 - | -LL | pub unsafe fn baz() -> i32 { - | ^^^^^^^^^^^^^^^^^^^^^^^^^^ - -error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:41:9 - | -LL | y + BAZ - | ^^^ use of mutable static - | - = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior - -error: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:46:36 - | -LL | macro_rules! unsafe_macro { () => (unsf()) } - | ^^^^^^ call to unsafe function -... -LL | unsafe_macro!(); - | --------------- in this macro invocation - | - = note: consult the function's documentation for information on how to avoid undefined behavior -note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:56:1 - | -LL | pub unsafe fn unsafe_in_macro() { - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ - = note: this error originates in the macro `unsafe_macro` (in Nightly builds, run with -Z macro-backtrace for more info) - -error: call to unsafe function is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:46:36 - | -LL | macro_rules! unsafe_macro { () => (unsf()) } - | ^^^^^^ call to unsafe function -... -LL | unsafe_macro!(); - | --------------- in this macro invocation - | - = note: consult the function's documentation for information on how to avoid undefined behavior - = note: this error originates in the macro `unsafe_macro` (in Nightly builds, run with -Z macro-backtrace for more info) - -error: aborting due to 8 previous errors - diff --git a/tests/ui/unsafe/wrapping-unsafe-block-sugg.rs b/tests/ui/unsafe/wrapping-unsafe-block-sugg.rs index 3629b8a1beb..13a446d2d24 100644 --- a/tests/ui/unsafe/wrapping-unsafe-block-sugg.rs +++ b/tests/ui/unsafe/wrapping-unsafe-block-sugg.rs @@ -1,7 +1,5 @@ // run-rustfix // aux-build:external_unsafe_macro.rs -// revisions: mir thir -// [thir]compile-flags: -Zthir-unsafeck #![deny(unsafe_op_in_unsafe_fn)] //~ NOTE #![crate_name = "wrapping_unsafe_block_sugg"] @@ -12,13 +10,11 @@ unsafe fn unsf() {} pub unsafe fn foo() { //~^ NOTE an unsafe function restricts its caller, but its body is safe by default - unsf(); //[mir]~ ERROR call to unsafe function is unsafe - //[thir]~^ ERROR call to unsafe function `unsf` is unsafe - //~^^ NOTE + unsf(); //~ ERROR call to unsafe function `unsf` is unsafe + //~^ NOTE //~| NOTE - unsf(); //[mir]~ ERROR call to unsafe function is unsafe - //[thir]~^ ERROR call to unsafe function `unsf` is unsafe - //~^^ NOTE + unsf(); //~ ERROR call to unsafe function `unsf` is unsafe + //~^ NOTE //~| NOTE } @@ -44,12 +40,10 @@ pub unsafe fn baz() -> i32 { } macro_rules! unsafe_macro { () => (unsf()) } -//[mir]~^ ERROR call to unsafe function is unsafe -//[thir]~^^ ERROR call to unsafe function `unsf` is unsafe +//~^ ERROR call to unsafe function `unsf` is unsafe //~| NOTE //~| NOTE -//[mir]~| ERROR call to unsafe function is unsafe -//[thir]~| ERROR call to unsafe function `unsf` is unsafe +//~| ERROR call to unsafe function `unsf` is unsafe //~| NOTE //~| NOTE diff --git a/tests/ui/unsafe/wrapping-unsafe-block-sugg.thir.stderr b/tests/ui/unsafe/wrapping-unsafe-block-sugg.stderr index b1fb35f85a6..84b58bc0288 100644 --- a/tests/ui/unsafe/wrapping-unsafe-block-sugg.thir.stderr +++ b/tests/ui/unsafe/wrapping-unsafe-block-sugg.stderr @@ -1,23 +1,23 @@ error: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:15:5 + --> $DIR/wrapping-unsafe-block-sugg.rs:13:5 | LL | unsf(); | ^^^^^^ call to unsafe function | = note: consult the function's documentation for information on how to avoid undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:13:1 + --> $DIR/wrapping-unsafe-block-sugg.rs:11:1 | LL | pub unsafe fn foo() { | ^^^^^^^^^^^^^^^^^^^ note: the lint level is defined here - --> $DIR/wrapping-unsafe-block-sugg.rs:6:9 + --> $DIR/wrapping-unsafe-block-sugg.rs:4:9 | LL | #![deny(unsafe_op_in_unsafe_fn)] | ^^^^^^^^^^^^^^^^^^^^^^ error: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:19:5 + --> $DIR/wrapping-unsafe-block-sugg.rs:16:5 | LL | unsf(); | ^^^^^^ call to unsafe function @@ -25,20 +25,20 @@ LL | unsf(); = note: consult the function's documentation for information on how to avoid undefined behavior error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:27:13 + --> $DIR/wrapping-unsafe-block-sugg.rs:23:13 | LL | let y = *x; | ^^ dereference of raw pointer | = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:25:1 + --> $DIR/wrapping-unsafe-block-sugg.rs:21:1 | LL | pub unsafe fn bar(x: *const i32) -> i32 { | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ error: dereference of raw pointer is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:30:9 + --> $DIR/wrapping-unsafe-block-sugg.rs:26:9 | LL | y + *x | ^^ dereference of raw pointer @@ -46,20 +46,20 @@ LL | y + *x = note: raw pointers may be null, dangling or unaligned; they can violate aliasing rules and cause data races: all of these are undefined behavior error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:38:13 + --> $DIR/wrapping-unsafe-block-sugg.rs:34:13 | LL | let y = BAZ; | ^^^ use of mutable static | = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:36:1 + --> $DIR/wrapping-unsafe-block-sugg.rs:32:1 | LL | pub unsafe fn baz() -> i32 { | ^^^^^^^^^^^^^^^^^^^^^^^^^^ error: use of mutable static is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:41:9 + --> $DIR/wrapping-unsafe-block-sugg.rs:37:9 | LL | y + BAZ | ^^^ use of mutable static @@ -67,7 +67,7 @@ LL | y + BAZ = note: mutable statics can be mutated by multiple threads: aliasing violations or data races will cause undefined behavior error: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:46:36 + --> $DIR/wrapping-unsafe-block-sugg.rs:42:36 | LL | macro_rules! unsafe_macro { () => (unsf()) } | ^^^^^^ call to unsafe function @@ -77,14 +77,14 @@ LL | unsafe_macro!(); | = note: consult the function's documentation for information on how to avoid undefined behavior note: an unsafe function restricts its caller, but its body is safe by default - --> $DIR/wrapping-unsafe-block-sugg.rs:56:1 + --> $DIR/wrapping-unsafe-block-sugg.rs:50:1 | LL | pub unsafe fn unsafe_in_macro() { | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ = note: this error originates in the macro `unsafe_macro` (in Nightly builds, run with -Z macro-backtrace for more info) error: call to unsafe function `unsf` is unsafe and requires unsafe block (error E0133) - --> $DIR/wrapping-unsafe-block-sugg.rs:46:36 + --> $DIR/wrapping-unsafe-block-sugg.rs:42:36 | LL | macro_rules! unsafe_macro { () => (unsf()) } | ^^^^^^ call to unsafe function diff --git a/tests/ui/unsized-locals/unsized-exprs-rpass.rs b/tests/ui/unsized-locals/unsized-exprs-rpass.rs index 175b02fcb81..83d3680f72f 100644 --- a/tests/ui/unsized-locals/unsized-exprs-rpass.rs +++ b/tests/ui/unsized-locals/unsized-exprs-rpass.rs @@ -2,7 +2,7 @@ #![allow(incomplete_features, unused_braces, unused_parens)] #![feature(unsized_tuple_coercion, unsized_locals, unsized_fn_params)] -struct A<X: ?Sized>(#[allow(unused_tuple_struct_fields)] X); +struct A<X: ?Sized>(#[allow(dead_code)] X); fn udrop<T: ?Sized>(_x: T) {} fn foo() -> Box<[u8]> { diff --git a/tests/ui/unsized/unchanged-param.rs b/tests/ui/unsized/unchanged-param.rs index 6bdc89310eb..8aa2ed15344 100644 --- a/tests/ui/unsized/unchanged-param.rs +++ b/tests/ui/unsized/unchanged-param.rs @@ -1,8 +1,8 @@ // run-pass // Test that we allow unsizing even if there is an unchanged param in the // field getting unsized. -struct A<T, U: ?Sized + 'static>(#[allow(unused_tuple_struct_fields)] T, B<T, U>); -struct B<T, U: ?Sized>(#[allow(unused_tuple_struct_fields)] T, U); +struct A<T, U: ?Sized + 'static>(#[allow(dead_code)] T, B<T, U>); +struct B<T, U: ?Sized>(#[allow(dead_code)] T, U); fn main() { let x: A<[u32; 1], [u32; 1]> = A([0; 1], B([0; 1], [0; 1])); diff --git a/tests/ui/wf/hir-wf-check-erase-regions.stderr b/tests/ui/wf/hir-wf-check-erase-regions.stderr index eb0a8f8f69a..4b696dc1d1d 100644 --- a/tests/ui/wf/hir-wf-check-erase-regions.stderr +++ b/tests/ui/wf/hir-wf-check-erase-regions.stderr @@ -6,15 +6,15 @@ LL | type IntoIter = std::iter::Flatten<std::slice::Iter<'a, T>>; | = help: the trait `Iterator` is not implemented for `&'a T` = help: the trait `Iterator` is implemented for `&mut I` - = note: required for `&'a T` to implement `IntoIterator` -note: required by a bound in `Flatten` - --> $SRC_DIR/core/src/iter/adapters/flatten.rs:LL:COL + = note: required for `Flatten<std::slice::Iter<'a, T>>` to implement `Iterator` +note: required by a bound in `std::iter::IntoIterator::IntoIter` + --> $SRC_DIR/core/src/iter/traits/collect.rs:LL:COL error[E0277]: `&'a T` is not an iterator - --> $DIR/hir-wf-check-erase-regions.rs:11:27 + --> $DIR/hir-wf-check-erase-regions.rs:7:21 | -LL | fn into_iter(self) -> Self::IntoIter { - | ^^^^^^^^^^^^^^ `&'a T` is not an iterator +LL | type IntoIter = std::iter::Flatten<std::slice::Iter<'a, T>>; + | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ `&'a T` is not an iterator | = help: the trait `Iterator` is not implemented for `&'a T` = help: the trait `Iterator` is implemented for `&mut I` @@ -23,16 +23,16 @@ note: required by a bound in `Flatten` --> $SRC_DIR/core/src/iter/adapters/flatten.rs:LL:COL error[E0277]: `&'a T` is not an iterator - --> $DIR/hir-wf-check-erase-regions.rs:7:21 + --> $DIR/hir-wf-check-erase-regions.rs:11:27 | -LL | type IntoIter = std::iter::Flatten<std::slice::Iter<'a, T>>; - | ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ `&'a T` is not an iterator +LL | fn into_iter(self) -> Self::IntoIter { + | ^^^^^^^^^^^^^^ `&'a T` is not an iterator | = help: the trait `Iterator` is not implemented for `&'a T` = help: the trait `Iterator` is implemented for `&mut I` - = note: required for `Flatten<std::slice::Iter<'a, T>>` to implement `Iterator` -note: required by a bound in `std::iter::IntoIterator::IntoIter` - --> $SRC_DIR/core/src/iter/traits/collect.rs:LL:COL + = note: required for `&'a T` to implement `IntoIterator` +note: required by a bound in `Flatten` + --> $SRC_DIR/core/src/iter/adapters/flatten.rs:LL:COL error: aborting due to 3 previous errors |